150 files changed, 6753 insertions, 1167 deletions

diff --git a/src/Bindings/LuaChunkStay.cpp b/src/Bindings/LuaChunkStay.cpp
index 0e982637f..db865cfa4 100644
--- a/src/Bindings/LuaChunkStay.cpp
+++ b/src/Bindings/LuaChunkStay.cpp
@@ -131,9 +131,6 @@ void cLuaChunkStay::Enable(cChunkMap & a_ChunkMap, int a_OnChunkAvailableStackPo
 
 void cLuaChunkStay::OnChunkAvailable(int a_ChunkX, int a_ChunkZ)
 {
-	// DEBUG:
-	LOGD("LuaChunkStay: Chunk [%d, %d] is now available, calling the callback...", a_ChunkX, a_ChunkZ);
-	
 	cPluginLua::cOperation Op(m_Plugin);
 	Op().Call((int)m_OnChunkAvailable, a_ChunkX, a_ChunkZ);
 }
diff --git a/src/Bindings/LuaState.cpp b/src/Bindings/LuaState.cpp
index f24e15c3b..13eb17f7d 100644
--- a/src/Bindings/LuaState.cpp
+++ b/src/Bindings/LuaState.cpp
@@ -479,6 +479,18 @@ void cLuaState::Push(cEntity * a_Entity)
 
 
 
+void cLuaState::Push(cProjectileEntity * a_ProjectileEntity)
+{
+	ASSERT(IsValid());
+
+	tolua_pushusertype(m_LuaState, a_ProjectileEntity, "cProjectileEntity");
+	m_NumCurrentFunctionArgs += 1;
+}
+
+
+
+
+
 void cLuaState::Push(cMonster * a_Monster)
 {
 	ASSERT(IsValid());
@@ -689,9 +701,10 @@ void cLuaState::Push(void * a_Ptr)
 	ASSERT(IsValid());
 
 	// Investigate the cause of this - what is the callstack?
-	LOGWARNING("Lua engine encountered an error - attempting to push a plain pointer");
+	// One code path leading here is the OnHookExploding / OnHookExploded with exotic parameters. Need to decide what to do with them
+	LOGWARNING("Lua engine: attempting to push a plain pointer, pushing nil instead.");
+	LOGWARNING("This indicates an unimplemented part of MCS bindings");
 	LogStackTrace();
-	ASSERT(!"A plain pointer should never be pushed on Lua stack");
 	
 	lua_pushnil(m_LuaState);
 	m_NumCurrentFunctionArgs += 1;
@@ -1080,20 +1093,20 @@ bool cLuaState::ReportErrors(lua_State * a_LuaState, int a_Status)
 
 
 
-void cLuaState::LogStackTrace(void)
+void cLuaState::LogStackTrace(int a_StartingDepth)
 {
-	LogStackTrace(m_LuaState);
+	LogStackTrace(m_LuaState, a_StartingDepth);
 }
 
 
 
 
 
-void cLuaState::LogStackTrace(lua_State * a_LuaState)
+void cLuaState::LogStackTrace(lua_State * a_LuaState, int a_StartingDepth)
 {
 	LOGWARNING("Stack trace:");
 	lua_Debug entry;
-	int depth = 0;
+	int depth = a_StartingDepth;
 	while (lua_getstack(a_LuaState, depth, &entry))
 	{
 		lua_getinfo(a_LuaState, "Sln", &entry);
@@ -1312,7 +1325,7 @@ void cLuaState::LogStack(lua_State * a_LuaState, const char * a_Header)
 int cLuaState::ReportFnCallErrors(lua_State * a_LuaState)
 {
 	LOGWARNING("LUA: %s", lua_tostring(a_LuaState, -1));
-	LogStackTrace(a_LuaState);
+	LogStackTrace(a_LuaState, 1);
 	return 1;  // We left the error message on the stack as the return value
 }
 
diff --git a/src/Bindings/LuaState.h b/src/Bindings/LuaState.h
index f5cb8379d..b9ca2f29b 100644
--- a/src/Bindings/LuaState.h
+++ b/src/Bindings/LuaState.h
@@ -38,6 +38,7 @@ extern "C"
 class cWorld;
 class cPlayer;
 class cEntity;
+class cProjectileEntity;
 class cMonster;
 class cItem;
 class cItems;
@@ -183,6 +184,7 @@ public:
 	void Push(cPlayer * a_Player);
 	void Push(const cPlayer * a_Player);
 	void Push(cEntity * a_Entity);
+	void Push(cProjectileEntity * a_ProjectileEntity);
 	void Push(cMonster * a_Monster);
 	void Push(cItem * a_Item);
 	void Push(cItems * a_Items);
@@ -200,7 +202,7 @@ public:
 	void Push(const HTTPTemplateRequest * a_Request);
 	void Push(cTNTEntity * a_TNTEntity);
 	void Push(Vector3i * a_Vector);
-	NORETURNDEBUG void Push(void * a_Ptr);
+	void Push(void * a_Ptr);
 	void Push(cHopperEntity * a_Hopper);
 	void Push(cBlockEntity * a_BlockEntity);
 	
@@ -868,10 +870,10 @@ public:
 	static bool ReportErrors(lua_State * a_LuaState, int status);
 	
 	/** Logs all items in the current stack trace to the server console */
-	void LogStackTrace(void);
+	void LogStackTrace(int a_StartingDepth = 0);
 	
 	/** Logs all items in the current stack trace to the server console */
-	static void LogStackTrace(lua_State * a_LuaState);
+	static void LogStackTrace(lua_State * a_LuaState, int a_StartingDepth = 0);
 	
 	/** Returns the type of the item on the specified position in the stack */
 	AString GetTypeText(int a_StackPos);
diff --git a/src/Bindings/ManualBindings.cpp b/src/Bindings/ManualBindings.cpp
index 20bbc48f2..51b9f3e27 100644
--- a/src/Bindings/ManualBindings.cpp
+++ b/src/Bindings/ManualBindings.cpp
@@ -115,10 +115,44 @@ static int tolua_StringSplitAndTrim(lua_State * tolua_S)
 
 
 
-static int tolua_LOG(lua_State* tolua_S)
+/** Retrieves the log message from the first param on the Lua stack.
+Can take either a string or a cCompositeChat.
+*/
+static AString GetLogMessage(lua_State * tolua_S)
 {
-	const char* str = tolua_tocppstring(tolua_S,1,0);
-	cMCLogger::GetInstance()->LogSimple( str, 0 );
+	tolua_Error err;
+	if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err))
+	{
+		return ((cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL))->ExtractText();
+	}
+	else
+	{
+		size_t len = 0;
+		const char * str = lua_tolstring(tolua_S, 1, &len);
+		if (str != NULL)
+		{
+			return AString(str, len);
+		}
+	}
+	return "";
+}
+
+
+
+
+
+static int tolua_LOG(lua_State * tolua_S)
+{
+	// If the param is a cCompositeChat, read the log level from it:
+	cMCLogger::eLogLevel LogLevel = cMCLogger::llRegular;
+	tolua_Error err;
+	if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err))
+	{
+		LogLevel = cCompositeChat::MessageTypeToLogLevel(((cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL))->GetMessageType());
+	}
+	
+	// Log the message:
+	cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), LogLevel);
 	return 0;
 }
 
@@ -126,10 +160,9 @@ static int tolua_LOG(lua_State* tolua_S)
 
 
 
-static int tolua_LOGINFO(lua_State* tolua_S)
+static int tolua_LOGINFO(lua_State * tolua_S)
 {
-	const char* str = tolua_tocppstring(tolua_S,1,0);
-	cMCLogger::GetInstance()->LogSimple( str, 1 );
+	cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llInfo);
 	return 0;
 }
 
@@ -137,10 +170,9 @@ static int tolua_LOGINFO(lua_State* tolua_S)
 
 
 
-static int tolua_LOGWARN(lua_State* tolua_S)
+static int tolua_LOGWARN(lua_State * tolua_S)
 {
-	const char* str = tolua_tocppstring(tolua_S,1,0);
-	cMCLogger::GetInstance()->LogSimple( str, 2 );
+	cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llWarning);
 	return 0;
 }
 
@@ -148,10 +180,9 @@ static int tolua_LOGWARN(lua_State* tolua_S)
 
 
 
-static int tolua_LOGERROR(lua_State* tolua_S)
+static int tolua_LOGERROR(lua_State * tolua_S)
 {
-	const char* str = tolua_tocppstring(tolua_S,1,0);
-	cMCLogger::GetInstance()->LogSimple( str, 3 );
+	cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llError);
 	return 0;
 }
 
@@ -159,6 +190,50 @@ static int tolua_LOGERROR(lua_State* tolua_S)
 
 
 
+static int tolua_Base64Encode(lua_State * tolua_S)
+{
+	cLuaState L(tolua_S);
+	if (
+		!L.CheckParamString(1) ||
+		!L.CheckParamEnd(2)
+	)
+	{
+		return 0;
+	}
+	
+	AString Src;
+	L.GetStackValue(1, Src);
+	AString res = Base64Encode(Src);
+	L.Push(res);
+	return 1;
+}
+
+
+
+
+
+static int tolua_Base64Decode(lua_State * tolua_S)
+{
+	cLuaState L(tolua_S);
+	if (
+		!L.CheckParamString(1) ||
+		!L.CheckParamEnd(2)
+	)
+	{
+		return 0;
+	}
+	
+	AString Src;
+	L.GetStackValue(1, Src);
+	AString res = Base64Decode(Src);
+	L.Push(res);
+	return 1;
+}
+
+
+
+
+
 cPluginLua * GetLuaPlugin(lua_State * L)
 {
 	// Get the plugin identification out of LuaState:
@@ -2838,6 +2913,8 @@ void ManualBindings::Bind(lua_State * tolua_S)
 		tolua_function(tolua_S, "LOGWARN",            tolua_LOGWARN);
 		tolua_function(tolua_S, "LOGWARNING",         tolua_LOGWARN);
 		tolua_function(tolua_S, "LOGERROR",           tolua_LOGERROR);
+		tolua_function(tolua_S, "Base64Encode",       tolua_Base64Encode);
+		tolua_function(tolua_S, "Base64Decode",       tolua_Base64Decode);
 		
 		tolua_beginmodule(tolua_S, "cFile");
 			tolua_function(tolua_S, "GetFolderContents", tolua_cFile_GetFolderContents);
diff --git a/src/Bindings/Plugin.h b/src/Bindings/Plugin.h
index 949e4693a..df0bd4dcc 100644
--- a/src/Bindings/Plugin.h
+++ b/src/Bindings/Plugin.h
@@ -46,6 +46,7 @@ public:
 	 * On all these functions, return true if you want to override default behavior and not call other plugins on that callback.
 	 * You can also return false, so default behavior is used.
 	 **/
+	virtual bool OnBlockSpread              (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source) = 0;
 	virtual bool OnBlockToPickups           (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) = 0;
 	virtual bool OnChat                     (cPlayer * a_Player, AString & a_Message) = 0;
 	virtual bool OnChunkAvailable           (cWorld * a_World, int a_ChunkX, int a_ChunkZ) = 0;
@@ -89,6 +90,8 @@ public:
 	virtual bool OnPluginsLoaded            (void) = 0;
 	virtual bool OnPostCrafting             (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0;
 	virtual bool OnPreCrafting              (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0;
+	virtual bool OnProjectileHitBlock       (cProjectileEntity & a_Projectile) = 0;
+	virtual bool OnProjectileHitEntity      (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) = 0;
 	virtual bool OnSpawnedEntity            (cWorld & a_World, cEntity & a_Entity) = 0;
 	virtual bool OnSpawnedMonster           (cWorld & a_World, cMonster & a_Monster) = 0;
 	virtual bool OnSpawningEntity           (cWorld & a_World, cEntity & a_Entity) = 0;
diff --git a/src/Bindings/PluginLua.cpp b/src/Bindings/PluginLua.cpp
index cccbc3c93..7e69e0f4b 100644
--- a/src/Bindings/PluginLua.cpp
+++ b/src/Bindings/PluginLua.cpp
@@ -195,6 +195,26 @@ void cPluginLua::Tick(float a_Dt)
 
 
 
+bool cPluginLua::OnBlockSpread(cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source)
+{
+	cCSLock Lock(m_CriticalSection);
+	bool res = false;
+	cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_BLOCK_SPREAD];
+	for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
+	{
+		m_LuaState.Call((int)(**itr), a_World, a_BlockX, a_BlockY, a_BlockZ, a_Source, cLuaState::Return, res);
+		if (res)
+		{
+			return true;
+		}
+	}
+	return false;
+}
+
+
+
+
+
 bool cPluginLua::OnBlockToPickups(cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups)
 {
 	cCSLock Lock(m_CriticalSection);
@@ -1088,6 +1108,46 @@ bool cPluginLua::OnPreCrafting(const cPlayer * a_Player, const cCraftingGrid * a
 
 
 
+bool cPluginLua::OnProjectileHitBlock(cProjectileEntity & a_Projectile)
+{
+	cCSLock Lock(m_CriticalSection);
+	bool res = false;
+	cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PROJECTILE_HIT_BLOCK];
+	for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
+	{
+		m_LuaState.Call((int)(**itr), &a_Projectile, cLuaState::Return, res);
+		if (res)
+		{
+			return true;
+		}
+	}
+	return false;
+}
+
+
+
+
+
+bool cPluginLua::OnProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity & a_HitEntity)
+{
+	cCSLock Lock(m_CriticalSection);
+	bool res = false;
+	cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PROJECTILE_HIT_ENTITY];
+	for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
+	{
+		m_LuaState.Call((int)(**itr), &a_Projectile, &a_HitEntity, cLuaState::Return, res);
+		if (res)
+		{
+			return true;
+		}
+	}
+	return false;
+}
+
+
+
+
+
 bool cPluginLua::OnSpawnedEntity(cWorld & a_World, cEntity & a_Entity)
 {
 	cCSLock Lock(m_CriticalSection);
@@ -1430,6 +1490,7 @@ const char * cPluginLua::GetHookFnName(int a_HookType)
 {
 	switch (a_HookType)
 	{
+		case cPluginManager::HOOK_BLOCK_SPREAD:                 return "OnBlockSpread";
 		case cPluginManager::HOOK_BLOCK_TO_PICKUPS:             return "OnBlockToPickups";
 		case cPluginManager::HOOK_CHAT:                         return "OnChat";
 		case cPluginManager::HOOK_CHUNK_AVAILABLE:              return "OnChunkAvailable";
diff --git a/src/Bindings/PluginLua.h b/src/Bindings/PluginLua.h
index a177f5288..59542d23a 100644
--- a/src/Bindings/PluginLua.h
+++ b/src/Bindings/PluginLua.h
@@ -69,6 +69,7 @@ public:
 
 	virtual void Tick(float a_Dt) override;
 
+	virtual bool OnBlockSpread              (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source) override;
 	virtual bool OnBlockToPickups           (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) override;
 	virtual bool OnChat                     (cPlayer * a_Player, AString & a_Message) override;
 	virtual bool OnChunkAvailable           (cWorld * a_World, int a_ChunkX, int a_ChunkZ) override;
@@ -112,6 +113,8 @@ public:
 	virtual bool OnPluginsLoaded            (void) override;
 	virtual bool OnPostCrafting             (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override;
 	virtual bool OnPreCrafting              (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override;
+	virtual bool OnProjectileHitBlock       (cProjectileEntity & a_Projectile) override;
+	virtual bool OnProjectileHitEntity      (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) override;
 	virtual bool OnSpawnedEntity            (cWorld & a_World, cEntity & a_Entity) override;
 	virtual bool OnSpawnedMonster           (cWorld & a_World, cMonster & a_Monster) override;
 	virtual bool OnSpawningEntity           (cWorld & a_World, cEntity & a_Entity) override;
diff --git a/src/Bindings/PluginManager.cpp b/src/Bindings/PluginManager.cpp
index b9cf160c4..6a5356c0b 100644
--- a/src/Bindings/PluginManager.cpp
+++ b/src/Bindings/PluginManager.cpp
@@ -205,6 +205,27 @@ void cPluginManager::Tick(float a_Dt)
 
 
 
+bool cPluginManager::CallHookBlockSpread(cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source)
+{
+	HookMap::iterator Plugins = m_Hooks.find(HOOK_BLOCK_SPREAD);
+	if (Plugins == m_Hooks.end())
+	{
+		return false;
+	}
+	for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
+	{
+		if ((*itr)->OnBlockSpread(a_World, a_BlockX, a_BlockY, a_BlockZ, a_Source))
+		{
+			return true;
+		}
+	}
+	return false;
+}
+
+
+
+
+
 bool cPluginManager::CallHookBlockToPickups(
 	cWorld * a_World, cEntity * a_Digger,
 	int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta,
@@ -1133,6 +1154,48 @@ bool cPluginManager::CallHookPreCrafting(const cPlayer * a_Player, const cCrafti
 
 
 
+bool cPluginManager::CallHookProjectileHitBlock(cProjectileEntity & a_Projectile)
+{
+	HookMap::iterator Plugins = m_Hooks.find(HOOK_PROJECTILE_HIT_BLOCK);
+	if (Plugins == m_Hooks.end())
+	{
+		return false;
+	}
+	for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
+	{
+		if ((*itr)->OnProjectileHitBlock(a_Projectile))
+		{
+			return true;
+		}
+	}
+	return false;
+}
+
+
+
+
+
+bool cPluginManager::CallHookProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity & a_HitEntity)
+{
+	HookMap::iterator Plugins = m_Hooks.find(HOOK_PROJECTILE_HIT_ENTITY);
+	if (Plugins == m_Hooks.end())
+	{
+		return false;
+	}
+	for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
+	{
+		if ((*itr)->OnProjectileHitEntity(a_Projectile, a_HitEntity))
+		{
+			return true;
+		}
+	}
+	return false;
+}
+
+
+
+
+
 bool cPluginManager::CallHookSpawnedEntity(cWorld & a_World, cEntity & a_Entity)
 {
 	HookMap::iterator Plugins = m_Hooks.find(HOOK_SPAWNED_ENTITY);
diff --git a/src/Bindings/PluginManager.h b/src/Bindings/PluginManager.h
index 44bc5a8d7..512bc1351 100644
--- a/src/Bindings/PluginManager.h
+++ b/src/Bindings/PluginManager.h
@@ -18,6 +18,9 @@ class cChunkDesc;
 // fwd: Entities/Entity.h
 class cEntity;
 
+// fwd: Entities/ProjectileEntity.h
+class cProjectileEntity;
+
 // fwd: Mobs/Monster.h
 class cMonster;
 
@@ -58,6 +61,7 @@ public:																	// tolua_export
 	// tolua_begin
 	enum PluginHook
 	{
+		HOOK_BLOCK_SPREAD,
 		HOOK_BLOCK_TO_PICKUPS,
 		HOOK_CHAT,
 		HOOK_CHUNK_AVAILABLE,
@@ -101,6 +105,8 @@ public:																	// tolua_export
 		HOOK_PLUGINS_LOADED,
 		HOOK_POST_CRAFTING,
 		HOOK_PRE_CRAFTING,
+		HOOK_PROJECTILE_HIT_BLOCK,
+		HOOK_PROJECTILE_HIT_ENTITY,
 		HOOK_SPAWNED_ENTITY,
 		HOOK_SPAWNED_MONSTER,
 		HOOK_SPAWNING_ENTITY,
@@ -127,6 +133,8 @@ public:																	// tolua_export
 	class cCommandEnumCallback
 	{
 	public:
+		virtual ~cCommandEnumCallback() {}
+		
 		/** Called for each command; return true to abort enumeration
 		For console commands, a_Permission is not used (set to empty string)
 		*/
@@ -154,6 +162,7 @@ public:																	// tolua_export
 	unsigned int GetNumPlugins() const;  // tolua_export
 	
 	// Calls for individual hooks. Each returns false if the action is to continue or true if the plugin wants to abort
+	bool CallHookBlockSpread              (cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ, eSpreadSource a_Source);
 	bool CallHookBlockToPickups           (cWorld * a_World, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups);
 	bool CallHookChat                     (cPlayer * a_Player, AString & a_Message);
 	bool CallHookChunkAvailable           (cWorld * a_World, int a_ChunkX, int a_ChunkZ);
@@ -197,6 +206,8 @@ public:																	// tolua_export
 	bool CallHookPluginsLoaded            (void);
 	bool CallHookPostCrafting             (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe);
 	bool CallHookPreCrafting              (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe);
+	bool CallHookProjectileHitBlock       (cProjectileEntity & a_Projectile);
+	bool CallHookProjectileHitEntity      (cProjectileEntity & a_Projectile, cEntity & a_HitEntity);
 	bool CallHookSpawnedEntity            (cWorld & a_World, cEntity & a_Entity);
 	bool CallHookSpawnedMonster           (cWorld & a_World, cMonster & a_Monster);
 	bool CallHookSpawningEntity           (cWorld & a_World, cEntity & a_Entity);
diff --git a/src/Bindings/lua5.1.dll b/src/Bindings/lua51.dll
index 515cf8b30..515cf8b30 100644
--- a/src/Bindings/lua5.1.dll
+++ b/src/Bindings/lua51.dll
diff --git a/src/Bindings/tolua++.exe b/src/Bindings/tolua++.exe
index e5cec6d78..1e3cc7789 100644
--- a/src/Bindings/tolua++.exe
+++ b/src/Bindings/tolua++.exe
diff --git a/src/BlockArea.cpp b/src/BlockArea.cpp
index 406e18a3b..60e4f11e5 100644
--- a/src/BlockArea.cpp
+++ b/src/BlockArea.cpp
@@ -54,7 +54,7 @@ template<typename Combinator> void InternalMergeBlocks(
 
 
 /// Combinator used for cBlockArea::msOverwrite merging
-static void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
 {
 	a_DstType = a_SrcType;
 	a_DstMeta = a_SrcMeta;
@@ -65,7 +65,7 @@ static void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType,
 
 
 /// Combinator used for cBlockArea::msFillAir merging
-static void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
 {
 	if (a_DstType == E_BLOCK_AIR)
 	{
@@ -80,7 +80,7 @@ static void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, N
 
 
 /// Combinator used for cBlockArea::msImprint merging
-static void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
 {
 	if (a_SrcType != E_BLOCK_AIR)
 	{
@@ -95,7 +95,7 @@ static void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, N
 
 
 /// Combinator used for cBlockArea::msLake merging
-static void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
 {
 	// Sponge is the NOP block
 	if (a_SrcType == E_BLOCK_SPONGE)
@@ -158,17 +158,59 @@ static void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBB
 
 
 
+/** Combinator used for cBlockArea::msSpongePrint merging */
+static inline void MergeCombinatorSpongePrint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+{
+	// Sponge overwrites nothing, everything else overwrites anything
+	if (a_SrcType != E_BLOCK_SPONGE)
+	{
+		a_DstType = a_SrcType;
+		a_DstMeta = a_SrcMeta;
+	}
+}
+
+
+
+
+
+/** Combinator used for cBlockArea::msDifference merging */
+static inline void MergeCombinatorDifference(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+{
+	if ((a_DstType == a_SrcType) && (a_DstMeta == a_SrcMeta))
+	{
+		a_DstType = E_BLOCK_AIR;
+		a_DstMeta = 0;
+	}
+	else
+	{
+		a_DstType = a_SrcType;
+		a_DstMeta = a_SrcMeta;
+	}
+}
+
+
+
+
+
+/** Combinator used for cBlockArea::msMask merging */
+static inline void MergeCombinatorMask(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+{
+	// If the blocks are the same, keep the dest; otherwise replace with air
+	if ((a_SrcType != a_DstType) || (a_SrcMeta != a_DstMeta))
+	{
+		a_DstType = E_BLOCK_AIR;
+		a_DstMeta = 0;
+	}
+}
+
+
+
+
+
 ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
 // cBlockArea:
 
 cBlockArea::cBlockArea(void) :
-	m_OriginX(0),
-	m_OriginY(0),
-	m_OriginZ(0),
-	m_SizeX(0),
-	m_SizeY(0),
-	m_SizeZ(0),
-	m_WEOffset(0, 0, 0),
 	m_BlockTypes(NULL),
 	m_BlockMetas(NULL),
 	m_BlockLight(NULL),
@@ -195,12 +237,8 @@ void cBlockArea::Clear(void)
 	delete[] m_BlockMetas;    m_BlockMetas = NULL;
 	delete[] m_BlockLight;    m_BlockLight = NULL;
 	delete[] m_BlockSkyLight; m_BlockSkyLight = NULL;
-	m_OriginX = 0;
-	m_OriginY = 0;
-	m_OriginZ = 0;
-	m_SizeX = 0;
-	m_SizeY = 0;
-	m_SizeZ = 0;
+	m_Origin.Set(0, 0, 0);
+	m_Size.Set(0, 0, 0);
 }
 
 
@@ -243,12 +281,17 @@ void cBlockArea::Create(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes)
 			m_BlockSkyLight[i] = 0x0f;
 		}
 	}
-	m_SizeX = a_SizeX;
-	m_SizeY = a_SizeY;
-	m_SizeZ = a_SizeZ;
-	m_OriginX = 0;
-	m_OriginY = 0;
-	m_OriginZ = 0;
+	m_Size.Set(a_SizeX, a_SizeY, a_SizeZ);
+	m_Origin.Set(0, 0, 0);
+}
+
+
+
+
+
+void cBlockArea::Create(const Vector3i & a_Size, int a_DataTypes)
+{
+	Create(a_Size.x, a_Size.y, a_Size.z, a_DataTypes);
 }
 
 
@@ -275,9 +318,7 @@ void cBlockArea::SetWEOffset(const Vector3i & a_Offset)
 
 void cBlockArea::SetOrigin(int a_OriginX, int a_OriginY, int a_OriginZ)
 {
-	m_OriginX = a_OriginX;
-	m_OriginY = a_OriginY;
-	m_OriginZ = a_OriginZ;
+	m_Origin.Set(a_OriginX, a_OriginY, a_OriginZ);
 }
 
 
@@ -286,7 +327,7 @@ void cBlockArea::SetOrigin(int a_OriginX, int a_OriginY, int a_OriginZ)
 
 void cBlockArea::SetOrigin(const Vector3i & a_Origin)
 {
-	SetOrigin(a_Origin.x, a_Origin.y, a_Origin.z);
+	m_Origin.Set(a_Origin.x, a_Origin.y, a_Origin.z);
 }
 
 
@@ -342,9 +383,7 @@ bool cBlockArea::Read(cForEachChunkProvider * a_ForEachChunkProvider, int a_MinB
 	{
 		return false;
 	}
-	m_OriginX = a_MinBlockX;
-	m_OriginY = a_MinBlockY;
-	m_OriginZ = a_MinBlockZ;
+	m_Origin.Set(a_MinBlockX, a_MinBlockY, a_MinBlockZ);
 	cChunkReader Reader(*this);
 	
 	// Convert block coords to chunks coords:
@@ -408,10 +447,10 @@ bool cBlockArea::Write(cForEachChunkProvider * a_ForEachChunkProvider, int a_Min
 		LOGWARNING("%s: MinBlockY less than zero, adjusting to zero", __FUNCTION__);
 		a_MinBlockY = 0;
 	}
-	else if (a_MinBlockY > cChunkDef::Height - m_SizeY)
+	else if (a_MinBlockY > cChunkDef::Height - m_Size.y)
 	{
 		LOGWARNING("%s: MinBlockY + m_SizeY more than chunk height, adjusting to chunk height", __FUNCTION__);
-		a_MinBlockY = cChunkDef::Height - m_SizeY;
+		a_MinBlockY = cChunkDef::Height - m_Size.y;
 	}
 
 	return a_ForEachChunkProvider->WriteBlockArea(*this, a_MinBlockX, a_MinBlockY, a_MinBlockZ, a_DataTypes);
@@ -443,10 +482,8 @@ void cBlockArea::CopyTo(cBlockArea & a_Into) const
 	}
 	
 	a_Into.Clear();
-	a_Into.SetSize(m_SizeX, m_SizeY, m_SizeZ, GetDataTypes());
-	a_Into.m_OriginX = m_OriginX;
-	a_Into.m_OriginY = m_OriginY;
-	a_Into.m_OriginZ = m_OriginZ;
+	a_Into.SetSize(m_Size.x, m_Size.y, m_Size.z, GetDataTypes());
+	a_Into.m_Origin = m_Origin;
 	int BlockCount = GetBlockCount();
 	if (HasBlockTypes())
 	{
@@ -487,9 +524,9 @@ void cBlockArea::DumpToRawFile(const AString & a_FileName)
 		LOGWARNING("cBlockArea: Cannot open file \"%s\" for raw dump", a_FileName.c_str());
 		return;
 	}
-	UInt32 SizeX = ntohl(m_SizeX);
-	UInt32 SizeY = ntohl(m_SizeY);
-	UInt32 SizeZ = ntohl(m_SizeZ);
+	UInt32 SizeX = ntohl(m_Size.x);
+	UInt32 SizeY = ntohl(m_Size.y);
+	UInt32 SizeZ = ntohl(m_Size.z);
 	f.Write(&SizeX, 4);
 	f.Write(&SizeY, 4);
 	f.Write(&SizeZ, 4);
@@ -532,13 +569,13 @@ void cBlockArea::DumpToRawFile(const AString & a_FileName)
 void cBlockArea::Crop(int a_AddMinX, int a_SubMaxX, int a_AddMinY, int a_SubMaxY, int a_AddMinZ, int a_SubMaxZ)
 {
 	if (
-		(a_AddMinX + a_SubMaxX >= m_SizeX) ||
-		(a_AddMinY + a_SubMaxY >= m_SizeY) ||
-		(a_AddMinZ + a_SubMaxZ >= m_SizeZ)
+		(a_AddMinX + a_SubMaxX >= m_Size.x) ||
+		(a_AddMinY + a_SubMaxY >= m_Size.y) ||
+		(a_AddMinZ + a_SubMaxZ >= m_Size.z)
 	)
 	{
 		LOGWARNING("cBlockArea:Crop called with more croping than the dimensions: %d x %d x %d with cropping %d, %d and %d",
-			m_SizeX, m_SizeY, m_SizeZ,
+			m_Size.x, m_Size.y, m_Size.z,
 			a_AddMinX + a_SubMaxX, a_AddMinY + a_SubMaxY, a_AddMinZ + a_SubMaxZ
 		);
 		return;
@@ -560,12 +597,10 @@ void cBlockArea::Crop(int a_AddMinX, int a_SubMaxX, int a_AddMinY, int a_SubMaxY
 	{
 		CropNibbles(m_BlockSkyLight, a_AddMinX, a_SubMaxX, a_AddMinY, a_SubMaxY, a_AddMinZ, a_SubMaxZ);
 	}
-	m_OriginX += a_AddMinX;
-	m_OriginY += a_AddMinY;
-	m_OriginZ += a_AddMinZ;
-	m_SizeX -= a_AddMinX + a_SubMaxX;
-	m_SizeY -= a_AddMinY + a_SubMaxY;
-	m_SizeZ -= a_AddMinZ + a_SubMaxZ;
+	m_Origin.Move(a_AddMinX, a_AddMinY, a_AddMinZ);
+	m_Size.x -= a_AddMinX + a_SubMaxX;
+	m_Size.y -= a_AddMinY + a_SubMaxY;
+	m_Size.z -= a_AddMinZ + a_SubMaxZ;
 }
 
 
@@ -590,12 +625,10 @@ void cBlockArea::Expand(int a_SubMinX, int a_AddMaxX, int a_SubMinY, int a_AddMa
 	{
 		ExpandNibbles(m_BlockSkyLight, a_SubMinX, a_AddMaxX, a_SubMinY, a_AddMaxY, a_SubMinZ, a_AddMaxZ);
 	}
-	m_OriginX -= a_SubMinX;
-	m_OriginY -= a_SubMinY;
-	m_OriginZ -= a_SubMinZ;
-	m_SizeX += a_SubMinX + a_AddMaxX;
-	m_SizeY += a_SubMinY + a_AddMaxY;
-	m_SizeZ += a_SubMinZ + a_AddMaxZ;
+	m_Origin.Move(-a_SubMinX, -a_SubMinY, -a_SubMinZ);
+	m_Size.x += a_SubMinX + a_AddMaxX;
+	m_Size.y += a_SubMinY + a_AddMaxY;
+	m_Size.z += a_SubMinZ + a_AddMaxZ;
 }
 
 
@@ -645,7 +678,7 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R
 				SrcOffX, SrcOffY, SrcOffZ,
 				DstOffX, DstOffY, DstOffZ,
 				a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
-				m_SizeX, m_SizeY, m_SizeZ,
+				m_Size.x, m_Size.y, m_Size.z,
 				MergeCombinatorOverwrite
 			);
 			break;
@@ -660,7 +693,7 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R
 				SrcOffX, SrcOffY, SrcOffZ,
 				DstOffX, DstOffY, DstOffZ,
 				a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
-				m_SizeX, m_SizeY, m_SizeZ,
+				m_Size.x, m_Size.y, m_Size.z,
 				MergeCombinatorFillAir
 			);
 			break;
@@ -675,7 +708,7 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R
 				SrcOffX, SrcOffY, SrcOffZ,
 				DstOffX, DstOffY, DstOffZ,
 				a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
-				m_SizeX, m_SizeY, m_SizeZ,
+				m_Size.x, m_Size.y, m_Size.z,
 				MergeCombinatorImprint
 			);
 			break;
@@ -690,12 +723,57 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R
 				SrcOffX, SrcOffY, SrcOffZ,
 				DstOffX, DstOffY, DstOffZ,
 				a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
-				m_SizeX, m_SizeY, m_SizeZ,
+				m_Size.x, m_Size.y, m_Size.z,
 				MergeCombinatorLake
 			);
 			break;
 		}  // case msLake
 		
+		case msSpongePrint:
+		{
+			InternalMergeBlocks(
+				m_BlockTypes, a_Src.GetBlockTypes(),
+				DstMetas, SrcMetas,
+				SizeX, SizeY, SizeZ,
+				SrcOffX, SrcOffY, SrcOffZ,
+				DstOffX, DstOffY, DstOffZ,
+				a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
+				m_Size.x, m_Size.y, m_Size.z,
+				MergeCombinatorSpongePrint
+			);
+			break;
+		}  // case msSpongePrint
+
+		case msDifference:
+		{
+			InternalMergeBlocks(
+				m_BlockTypes, a_Src.GetBlockTypes(),
+				DstMetas, SrcMetas,
+				SizeX, SizeY, SizeZ,
+				SrcOffX, SrcOffY, SrcOffZ,
+				DstOffX, DstOffY, DstOffZ,
+				a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
+				m_Size.x, m_Size.y, m_Size.z,
+				MergeCombinatorDifference
+			);
+			break;
+		}	// case msDifference
+		
+		case msMask:
+		{
+			InternalMergeBlocks(
+				m_BlockTypes, a_Src.GetBlockTypes(),
+				DstMetas, SrcMetas,
+				SizeX, SizeY, SizeZ,
+				SrcOffX, SrcOffY, SrcOffZ,
+				DstOffX, DstOffY, DstOffZ,
+				a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
+				m_Size.x, m_Size.y, m_Size.z,
+				MergeCombinatorMask
+			);
+			break;
+		}  // case msMask
+		
 		default:
 		{
 			LOGWARNING("Unknown block area merge strategy: %d", a_Strategy);
@@ -982,17 +1060,17 @@ void cBlockArea::RotateCCW(void)
 	}
 	
 	// We are guaranteed that both blocktypes and blockmetas exist; rotate both at the same time:
-	BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ];
-	NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ];
-	for (int x = 0; x < m_SizeX; x++)
+	BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()];
+	NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()];
+	for (int x = 0; x < m_Size.x; x++)
 	{
-		int NewZ = m_SizeX - x - 1;
-		for (int z = 0; z < m_SizeZ; z++)
+		int NewZ = m_Size.x - x - 1;
+		for (int z = 0; z < m_Size.z; z++)
 		{
 			int NewX = z;
-			for (int y = 0; y < m_SizeY; y++)
+			for (int y = 0; y < m_Size.y; y++)
 			{
-				int NewIdx = NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ;
+				int NewIdx = NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z;
 				int OldIdx = MakeIndex(x, y, z);
 				NewTypes[NewIdx] = m_BlockTypes[OldIdx];
 				NewMetas[NewIdx] = BlockHandler(m_BlockTypes[OldIdx])->MetaRotateCCW(m_BlockMetas[OldIdx]);
@@ -1004,7 +1082,7 @@ void cBlockArea::RotateCCW(void)
 	delete[] NewTypes;
 	delete[] NewMetas;
 
-	std::swap(m_SizeX, m_SizeZ);
+	std::swap(m_Size.x, m_Size.z);
 }
 
 
@@ -1027,17 +1105,17 @@ void cBlockArea::RotateCW(void)
 	}
 	
 	// We are guaranteed that both blocktypes and blockmetas exist; rotate both at the same time:
-	BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ];
-	NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ];
-	for (int x = 0; x < m_SizeX; x++)
+	BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()];
+	NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()];
+	for (int x = 0; x < m_Size.x; x++)
 	{
 		int NewZ = x;
-		for (int z = 0; z < m_SizeZ; z++)
+		for (int z = 0; z < m_Size.z; z++)
 		{
-			int NewX = m_SizeZ - z - 1;
-			for (int y = 0; y < m_SizeY; y++)
+			int NewX = m_Size.z - z - 1;
+			for (int y = 0; y < m_Size.y; y++)
 			{
-				int NewIdx = NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ;
+				int NewIdx = NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z;
 				int OldIdx = MakeIndex(x, y, z);
 				NewTypes[NewIdx] = m_BlockTypes[OldIdx];
 				NewMetas[NewIdx] = BlockHandler(m_BlockTypes[OldIdx])->MetaRotateCW(m_BlockMetas[OldIdx]);
@@ -1049,7 +1127,7 @@ void cBlockArea::RotateCW(void)
 	delete[] NewTypes;
 	delete[] NewMetas;
 
-	std::swap(m_SizeX, m_SizeZ);
+	std::swap(m_Size.x, m_Size.z);
 }
 
 
@@ -1072,13 +1150,13 @@ void cBlockArea::MirrorXY(void)
 	}
 
 	// We are guaranteed that both blocktypes and blockmetas exist; mirror both at the same time:
-	int HalfZ = m_SizeZ / 2;
-	int MaxZ = m_SizeZ - 1;
-	for (int y = 0; y < m_SizeY; y++)
+	int HalfZ = m_Size.z / 2;
+	int MaxZ = m_Size.z - 1;
+	for (int y = 0; y < m_Size.y; y++)
 	{
 		for (int z = 0; z < HalfZ; z++)
 		{
-			for (int x = 0; x < m_SizeX; x++)
+			for (int x = 0; x < m_Size.x; x++)
 			{
 				int Idx1 = MakeIndex(x, y, z);
 				int Idx2 = MakeIndex(x, y, MaxZ - z);
@@ -1112,13 +1190,13 @@ void cBlockArea::MirrorXZ(void)
 	}
 
 	// We are guaranteed that both blocktypes and blockmetas exist; mirror both at the same time:
-	int HalfY = m_SizeY / 2;
-	int MaxY = m_SizeY - 1;
+	int HalfY = m_Size.y / 2;
+	int MaxY = m_Size.y - 1;
 	for (int y = 0; y < HalfY; y++)
 	{
-		for (int z = 0; z < m_SizeZ; z++)
+		for (int z = 0; z < m_Size.z; z++)
 		{
-			for (int x = 0; x < m_SizeX; x++)
+			for (int x = 0; x < m_Size.x; x++)
 			{
 				int Idx1 = MakeIndex(x, y, z);
 				int Idx2 = MakeIndex(x, MaxY - y, z);
@@ -1152,11 +1230,11 @@ void cBlockArea::MirrorYZ(void)
 	}
 
 	// We are guaranteed that both blocktypes and blockmetas exist; mirror both at the same time:
-	int HalfX = m_SizeX / 2;
-	int MaxX = m_SizeX - 1;
-	for (int y = 0; y < m_SizeY; y++)
+	int HalfX = m_Size.x / 2;
+	int MaxX = m_Size.x - 1;
+	for (int y = 0; y < m_Size.y; y++)
 	{
-		for (int z = 0; z < m_SizeZ; z++)
+		for (int z = 0; z < m_Size.z; z++)
 		{
 			for (int x = 0; x < HalfX; x++)
 			{
@@ -1180,16 +1258,16 @@ void cBlockArea::RotateCCWNoMeta(void)
 {
 	if (HasBlockTypes())
 	{
-		BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ];
-		for (int x = 0; x < m_SizeX; x++)
+		BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()];
+		for (int x = 0; x < m_Size.x; x++)
 		{
-			int NewZ = m_SizeX - x - 1;
-			for (int z = 0; z < m_SizeZ; z++)
+			int NewZ = m_Size.x - x - 1;
+			for (int z = 0; z < m_Size.z; z++)
 			{
 				int NewX = z;
-				for (int y = 0; y < m_SizeY; y++)
+				for (int y = 0; y < m_Size.y; y++)
 				{
-					NewTypes[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockTypes[MakeIndex(x, y, z)];
+					NewTypes[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockTypes[MakeIndex(x, y, z)];
 				}  // for y
 			}  // for z
 		}  // for x
@@ -1198,23 +1276,23 @@ void cBlockArea::RotateCCWNoMeta(void)
 	}
 	if (HasBlockMetas())
 	{
-		NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ];
-		for (int x = 0; x < m_SizeX; x++)
+		NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()];
+		for (int x = 0; x < m_Size.x; x++)
 		{
-			int NewZ = m_SizeX - x - 1;
-			for (int z = 0; z < m_SizeZ; z++)
+			int NewZ = m_Size.x - x - 1;
+			for (int z = 0; z < m_Size.z; z++)
 			{
 				int NewX = z;
-				for (int y = 0; y < m_SizeY; y++)
+				for (int y = 0; y < m_Size.y; y++)
 				{
-					NewMetas[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockMetas[MakeIndex(x, y, z)];
+					NewMetas[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockMetas[MakeIndex(x, y, z)];
 				}  // for y
 			}  // for z
 		}  // for x
 		std::swap(m_BlockMetas, NewMetas);
 		delete[] NewMetas;
 	}
-	std::swap(m_SizeX, m_SizeZ);
+	std::swap(m_Size.x, m_Size.z);
 }
 
 
@@ -1225,16 +1303,16 @@ void cBlockArea::RotateCWNoMeta(void)
 {
 	if (HasBlockTypes())
 	{
-		BLOCKTYPE * NewTypes = new BLOCKTYPE[m_SizeX * m_SizeY * m_SizeZ];
-		for (int z = 0; z < m_SizeZ; z++)
+		BLOCKTYPE * NewTypes = new BLOCKTYPE[GetBlockCount()];
+		for (int z = 0; z < m_Size.z; z++)
 		{
-			int NewX = m_SizeZ - z - 1;
-			for (int x = 0; x < m_SizeX; x++)
+			int NewX = m_Size.z - z - 1;
+			for (int x = 0; x < m_Size.x; x++)
 			{
 				int NewZ = x;
-				for (int y = 0; y < m_SizeY; y++)
+				for (int y = 0; y < m_Size.y; y++)
 				{
-					NewTypes[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockTypes[MakeIndex(x, y, z)];
+					NewTypes[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockTypes[MakeIndex(x, y, z)];
 				}  // for y
 			}  // for x
 		}  // for z
@@ -1243,23 +1321,23 @@ void cBlockArea::RotateCWNoMeta(void)
 	}
 	if (HasBlockMetas())
 	{
-		NIBBLETYPE * NewMetas = new NIBBLETYPE[m_SizeX * m_SizeY * m_SizeZ];
-		for (int z = 0; z < m_SizeZ; z++)
+		NIBBLETYPE * NewMetas = new NIBBLETYPE[GetBlockCount()];
+		for (int z = 0; z < m_Size.z; z++)
 		{
-			int NewX = m_SizeZ - z - 1;
-			for (int x = 0; x < m_SizeX; x++)
+			int NewX = m_Size.z - z - 1;
+			for (int x = 0; x < m_Size.x; x++)
 			{
 				int NewZ = x;
-				for (int y = 0; y < m_SizeY; y++)
+				for (int y = 0; y < m_Size.y; y++)
 				{
-					NewMetas[NewX + NewZ * m_SizeZ + y * m_SizeX * m_SizeZ] = m_BlockMetas[MakeIndex(x, y, z)];
+					NewMetas[NewX + NewZ * m_Size.z + y * m_Size.x * m_Size.z] = m_BlockMetas[MakeIndex(x, y, z)];
 				}  // for y
 			}  // for x
 		}  // for z
 		std::swap(m_BlockMetas, NewMetas);
 		delete[] NewMetas;
 	}
-	std::swap(m_SizeX, m_SizeZ);
+	std::swap(m_Size.x, m_Size.z);
 }
 
 
@@ -1268,15 +1346,15 @@ void cBlockArea::RotateCWNoMeta(void)
 
 void cBlockArea::MirrorXYNoMeta(void)
 {
-	int HalfZ = m_SizeZ / 2;
-	int MaxZ = m_SizeZ - 1;
+	int HalfZ = m_Size.z / 2;
+	int MaxZ = m_Size.z - 1;
 	if (HasBlockTypes())
 	{
-		for (int y = 0; y < m_SizeY; y++)
+		for (int y = 0; y < m_Size.y; y++)
 		{
 			for (int z = 0; z < HalfZ; z++)
 			{
-				for (int x = 0; x < m_SizeX; x++)
+				for (int x = 0; x < m_Size.x; x++)
 				{
 					std::swap(m_BlockTypes[MakeIndex(x, y, z)], m_BlockTypes[MakeIndex(x, y, MaxZ - z)]);
 				}  // for x
@@ -1286,11 +1364,11 @@ void cBlockArea::MirrorXYNoMeta(void)
 	
 	if (HasBlockMetas())
 	{
-		for (int y = 0; y < m_SizeY; y++)
+		for (int y = 0; y < m_Size.y; y++)
 		{
 			for (int z = 0; z < HalfZ; z++)
 			{
-				for (int x = 0; x < m_SizeX; x++)
+				for (int x = 0; x < m_Size.x; x++)
 				{
 					std::swap(m_BlockMetas[MakeIndex(x, y, z)], m_BlockMetas[MakeIndex(x, y, MaxZ - z)]);
 				}  // for x
@@ -1305,15 +1383,15 @@ void cBlockArea::MirrorXYNoMeta(void)
 
 void cBlockArea::MirrorXZNoMeta(void)
 {
-	int HalfY = m_SizeY / 2;
-	int MaxY = m_SizeY - 1;
+	int HalfY = m_Size.y / 2;
+	int MaxY = m_Size.y - 1;
 	if (HasBlockTypes())
 	{
 		for (int y = 0; y < HalfY; y++)
 		{
-			for (int z = 0; z < m_SizeZ; z++)
+			for (int z = 0; z < m_Size.z; z++)
 			{
-				for (int x = 0; x < m_SizeX; x++)
+				for (int x = 0; x < m_Size.x; x++)
 				{
 					std::swap(m_BlockTypes[MakeIndex(x, y, z)], m_BlockTypes[MakeIndex(x, MaxY - y, z)]);
 				}  // for x
@@ -1325,9 +1403,9 @@ void cBlockArea::MirrorXZNoMeta(void)
 	{
 		for (int y = 0; y < HalfY; y++)
 		{
-			for (int z = 0; z < m_SizeZ; z++)
+			for (int z = 0; z < m_Size.z; z++)
 			{
-				for (int x = 0; x < m_SizeX; x++)
+				for (int x = 0; x < m_Size.x; x++)
 				{
 					std::swap(m_BlockMetas[MakeIndex(x, y, z)], m_BlockMetas[MakeIndex(x, MaxY - y, z)]);
 				}  // for x
@@ -1342,13 +1420,13 @@ void cBlockArea::MirrorXZNoMeta(void)
 
 void cBlockArea::MirrorYZNoMeta(void)
 {
-	int HalfX = m_SizeX / 2;
-	int MaxX = m_SizeX - 1;
+	int HalfX = m_Size.x / 2;
+	int MaxX = m_Size.x - 1;
 	if (HasBlockTypes())
 	{
-		for (int y = 0; y < m_SizeY; y++)
+		for (int y = 0; y < m_Size.y; y++)
 		{
-			for (int z = 0; z < m_SizeZ; z++)
+			for (int z = 0; z < m_Size.z; z++)
 			{
 				for (int x = 0; x < HalfX; x++)
 				{
@@ -1360,9 +1438,9 @@ void cBlockArea::MirrorYZNoMeta(void)
 	
 	if (HasBlockMetas())
 	{
-		for (int y = 0; y < m_SizeY; y++)
+		for (int y = 0; y < m_Size.y; y++)
 		{
-			for (int z = 0; z < m_SizeZ; z++)
+			for (int z = 0; z < m_Size.z; z++)
 			{
 				for (int x = 0; x < HalfX; x++)
 				{
@@ -1393,7 +1471,7 @@ void cBlockArea::SetRelBlockType(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE a
 
 void cBlockArea::SetBlockType(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType)
 {
-	SetRelBlockType(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_BlockType);
+	SetRelBlockType(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_BlockType);
 }
 
 
@@ -1470,7 +1548,7 @@ BLOCKTYPE cBlockArea::GetRelBlockType(int a_RelX, int a_RelY, int a_RelZ) const
 
 BLOCKTYPE cBlockArea::GetBlockType(int a_BlockX, int a_BlockY, int a_BlockZ) const
 {
-	return GetRelBlockType(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ);
+	return GetRelBlockType(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z);
 }
 
 
@@ -1533,7 +1611,7 @@ NIBBLETYPE cBlockArea::GetBlockSkyLight(int a_BlockX, int a_BlockY, int a_BlockZ
 
 void cBlockArea::SetBlockTypeMeta(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta)
 {
-	SetRelBlockTypeMeta(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_BlockType, a_BlockMeta);
+	SetRelBlockTypeMeta(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_BlockType, a_BlockMeta);
 }
 
 
@@ -1567,7 +1645,7 @@ void cBlockArea::SetRelBlockTypeMeta(int a_RelX,   int a_RelY,   int a_RelZ,   B
 
 void cBlockArea::GetBlockTypeMeta(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) const
 {
-	return GetRelBlockTypeMeta(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_BlockType, a_BlockMeta);
+	return GetRelBlockTypeMeta(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_BlockType, a_BlockMeta);
 }
 
 
@@ -1670,9 +1748,7 @@ bool cBlockArea::SetSize(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes)
 			return false;
 		}
 	}
-	m_SizeX = a_SizeX;
-	m_SizeY = a_SizeY;
-	m_SizeZ = a_SizeZ;
+	m_Size.Set(a_SizeX, a_SizeY, a_SizeZ);
 	return true;
 }
 
@@ -1683,13 +1759,13 @@ bool cBlockArea::SetSize(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes)
 int cBlockArea::MakeIndex(int a_RelX, int a_RelY, int a_RelZ) const
 {
 	ASSERT(a_RelX >= 0);
-	ASSERT(a_RelX < m_SizeX);
+	ASSERT(a_RelX < m_Size.x);
 	ASSERT(a_RelY >= 0);
-	ASSERT(a_RelY < m_SizeY);
+	ASSERT(a_RelY < m_Size.y);
 	ASSERT(a_RelZ >= 0);
-	ASSERT(a_RelZ < m_SizeZ);
+	ASSERT(a_RelZ < m_Size.z);
 	
-	return a_RelX + a_RelZ * m_SizeX + a_RelY * m_SizeX * m_SizeZ;
+	return a_RelX + a_RelZ * m_Size.x + a_RelY * m_Size.x * m_Size.z;
 }
 
 
@@ -1712,7 +1788,7 @@ void cBlockArea::SetRelNibble(int a_RelX, int a_RelY, int a_RelZ, NIBBLETYPE a_V
 
 void cBlockArea::SetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE a_Value, NIBBLETYPE * a_Array)
 {
-	SetRelNibble(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_Value, a_Array);
+	SetRelNibble(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_Value, a_Array);
 }
 
 
@@ -1735,7 +1811,7 @@ NIBBLETYPE cBlockArea::GetRelNibble(int a_RelX, int a_RelY, int a_RelZ, NIBBLETY
 
 NIBBLETYPE cBlockArea::GetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE * a_Array) const
 {
-	return GetRelNibble(a_BlockX - m_OriginX, a_BlockY - m_OriginY, a_BlockZ - m_OriginZ, a_Array);
+	return GetRelNibble(a_BlockX - m_Origin.x, a_BlockY - m_Origin.y, a_BlockZ - m_Origin.z, a_Array);
 }
 
 
@@ -1748,9 +1824,7 @@ NIBBLETYPE cBlockArea::GetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBL
 
 cBlockArea::cChunkReader::cChunkReader(cBlockArea & a_Area) :
 	m_Area(a_Area),
-	m_OriginX(a_Area.m_OriginX),
-	m_OriginY(a_Area.m_OriginY),
-	m_OriginZ(a_Area.m_OriginZ)
+	m_Origin(a_Area.m_Origin.x, a_Area.m_Origin.y, a_Area.m_Origin.z)
 {
 }
 
@@ -1760,8 +1834,8 @@ cBlockArea::cChunkReader::cChunkReader(cBlockArea & a_Area) :
 
 void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLETYPE * a_ChunkSrc)
 {
-	int SizeY = m_Area.m_SizeY;
-	int MinY = m_OriginY;
+	int SizeY = m_Area.m_Size.y;
+	int MinY = m_Origin.y;
 	
 	// SizeX, SizeZ are the dmensions of the block data to copy from the current chunk (size of the geometric union)
 	// OffX, OffZ are the offsets of the current chunk data from the area origin
@@ -1770,7 +1844,7 @@ void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLET
 	int SizeZ = cChunkDef::Width;
 	int OffX, OffZ;
 	int BaseX, BaseZ;
-	OffX = m_CurrentChunkX * cChunkDef::Width - m_OriginX;
+	OffX = m_CurrentChunkX * cChunkDef::Width - m_Origin.x;
 	if (OffX < 0)
 	{
 		BaseX = -OffX;
@@ -1781,7 +1855,7 @@ void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLET
 	{
 		BaseX = 0;
 	}
-	OffZ = m_CurrentChunkZ * cChunkDef::Width - m_OriginZ;
+	OffZ = m_CurrentChunkZ * cChunkDef::Width - m_Origin.z;
 	if (OffZ < 0)
 	{
 		BaseZ = -OffZ;
@@ -1793,13 +1867,13 @@ void cBlockArea::cChunkReader::CopyNibbles(NIBBLETYPE * a_AreaDst, const NIBBLET
 		BaseZ = 0;
 	}
 	// If the chunk extends beyond the area in the X or Z axis, cut off the Size:
-	if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_OriginX + m_Area.m_SizeX)
+	if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_Origin.x + m_Area.m_Size.x)
 	{
-		SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_OriginX + m_Area.m_SizeX);
+		SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_Origin.x + m_Area.m_Size.x);
 	}
-	if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_OriginZ + m_Area.m_SizeZ)
+	if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_Origin.z + m_Area.m_Size.z)
 	{
-		SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_OriginZ + m_Area.m_SizeZ);
+		SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_Origin.z + m_Area.m_Size.z);
 	}
 
 	for (int y = 0; y < SizeY; y++)
@@ -1843,8 +1917,8 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes)
 		return;
 	}
 	
-	int SizeY = m_Area.m_SizeY;
-	int MinY = m_OriginY;
+	int SizeY = m_Area.m_Size.y;
+	int MinY = m_Origin.y;
 	
 	// SizeX, SizeZ are the dmensions of the block data to copy from the current chunk (size of the geometric union)
 	// OffX, OffZ are the offsets of the current chunk data from the area origin
@@ -1853,7 +1927,7 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes)
 	int SizeZ = cChunkDef::Width;
 	int OffX, OffZ;
 	int BaseX, BaseZ;
-	OffX = m_CurrentChunkX * cChunkDef::Width - m_OriginX;
+	OffX = m_CurrentChunkX * cChunkDef::Width - m_Origin.x;
 	if (OffX < 0)
 	{
 		BaseX = -OffX;
@@ -1864,7 +1938,7 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes)
 	{
 		BaseX = 0;
 	}
-	OffZ = m_CurrentChunkZ * cChunkDef::Width - m_OriginZ;
+	OffZ = m_CurrentChunkZ * cChunkDef::Width - m_Origin.z;
 	if (OffZ < 0)
 	{
 		BaseZ = -OffZ;
@@ -1876,13 +1950,13 @@ void cBlockArea::cChunkReader::BlockTypes(const BLOCKTYPE * a_BlockTypes)
 		BaseZ = 0;
 	}
 	// If the chunk extends beyond the area in the X or Z axis, cut off the Size:
-	if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_OriginX + m_Area.m_SizeX)
+	if ((m_CurrentChunkX + 1) * cChunkDef::Width > m_Origin.x + m_Area.m_Size.x)
 	{
-		SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_OriginX + m_Area.m_SizeX);
+		SizeX -= (m_CurrentChunkX + 1) * cChunkDef::Width - (m_Origin.x + m_Area.m_Size.x);
 	}
-	if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_OriginZ + m_Area.m_SizeZ)
+	if ((m_CurrentChunkZ + 1) * cChunkDef::Width > m_Origin.z + m_Area.m_Size.z)
 	{
-		SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_OriginZ + m_Area.m_SizeZ);
+		SizeZ -= (m_CurrentChunkZ + 1) * cChunkDef::Width - (m_Origin.z + m_Area.m_Size.z);
 	}
 
 	for (int y = 0; y < SizeY; y++)
@@ -2002,21 +2076,21 @@ void cBlockArea::CropNibbles(NIBBLEARRAY & a_Array, int a_AddMinX, int a_SubMaxX
 
 void cBlockArea::ExpandBlockTypes(int a_SubMinX, int a_AddMaxX, int a_SubMinY, int a_AddMaxY, int a_SubMinZ, int a_AddMaxZ)
 {
-	int NewSizeX = m_SizeX + a_SubMinX + a_AddMaxX;
-	int NewSizeY = m_SizeY + a_SubMinY + a_AddMaxY;
-	int NewSizeZ = m_SizeZ + a_SubMinZ + a_AddMaxZ;
+	int NewSizeX = m_Size.x + a_SubMinX + a_AddMaxX;
+	int NewSizeY = m_Size.y + a_SubMinY + a_AddMaxY;
+	int NewSizeZ = m_Size.z + a_SubMinZ + a_AddMaxZ;
 	int BlockCount = NewSizeX * NewSizeY * NewSizeZ;
 	BLOCKTYPE * NewBlockTypes = new BLOCKTYPE[BlockCount];
 	memset(NewBlockTypes, 0, BlockCount * sizeof(BLOCKTYPE));
 	int OldIndex = 0;
-	for (int y = 0; y < m_SizeY; y++)
+	for (int y = 0; y < m_Size.y; y++)
 	{
-		int IndexBaseY = (y + a_SubMinY) * m_SizeX * m_SizeZ;
-		for (int z = 0; z < m_SizeZ; z++)
+		int IndexBaseY = (y + a_SubMinY) * m_Size.x * m_Size.z;
+		for (int z = 0; z < m_Size.z; z++)
 		{
-			int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_SizeX;
+			int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_Size.x;
 			int idx = IndexBaseZ + a_SubMinX;
-			for (int x = 0; x < m_SizeX; x++)
+			for (int x = 0; x < m_Size.x; x++)
 			{
 				NewBlockTypes[idx++] = m_BlockTypes[OldIndex++];
 			}  // for x
@@ -2032,21 +2106,21 @@ void cBlockArea::ExpandBlockTypes(int a_SubMinX, int a_AddMaxX, int a_SubMinY, i
 
 void cBlockArea::ExpandNibbles(NIBBLEARRAY & a_Array, int a_SubMinX, int a_AddMaxX, int a_SubMinY, int a_AddMaxY, int a_SubMinZ, int a_AddMaxZ)
 {
-	int NewSizeX = m_SizeX + a_SubMinX + a_AddMaxX;
-	int NewSizeY = m_SizeY + a_SubMinY + a_AddMaxY;
-	int NewSizeZ = m_SizeZ + a_SubMinZ + a_AddMaxZ;
+	int NewSizeX = m_Size.x + a_SubMinX + a_AddMaxX;
+	int NewSizeY = m_Size.y + a_SubMinY + a_AddMaxY;
+	int NewSizeZ = m_Size.z + a_SubMinZ + a_AddMaxZ;
 	int BlockCount = NewSizeX * NewSizeY * NewSizeZ;
 	NIBBLETYPE * NewNibbles = new NIBBLETYPE[BlockCount];
 	memset(NewNibbles, 0, BlockCount * sizeof(NIBBLETYPE));
 	int OldIndex = 0;
-	for (int y = 0; y < m_SizeY; y++)
+	for (int y = 0; y < m_Size.y; y++)
 	{
-		int IndexBaseY = (y + a_SubMinY) * m_SizeX * m_SizeZ;
-		for (int z = 0; z < m_SizeZ; z++)
+		int IndexBaseY = (y + a_SubMinY) * m_Size.x * m_Size.z;
+		for (int z = 0; z < m_Size.z; z++)
 		{
-			int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_SizeX;
+			int IndexBaseZ = IndexBaseY + (z + a_SubMinZ) * m_Size.x;
 			int idx = IndexBaseZ + a_SubMinX;
-			for (int x = 0; x < m_SizeX; x++)
+			for (int x = 0; x < m_Size.x; x++)
 			{
 				NewNibbles[idx++] = a_Array[OldIndex++];
 			}  // for x
@@ -2057,6 +2131,9 @@ void cBlockArea::ExpandNibbles(NIBBLEARRAY & a_Array, int a_SubMinX, int a_AddMa
 }
 
 
+
+
+
 void cBlockArea::RelSetData(
 	int a_RelX, int a_RelY, int a_RelZ,
 	int a_DataTypes, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta,
diff --git a/src/BlockArea.h b/src/BlockArea.h
index e0e8fe972..c48175b8c 100644
--- a/src/BlockArea.h
+++ b/src/BlockArea.h
@@ -43,12 +43,17 @@ public:
 		baSkyLight = 8,
 	} ;
 	
+	/** The per-block strategy to use when merging another block area into this object.
+	See the Merge function for the description of these */
 	enum eMergeStrategy
 	{
 		msOverwrite,
 		msFillAir,
 		msImprint,
 		msLake,
+		msSpongePrint,
+		msDifference,
+		msMask,
 	} ;
 	
 	cBlockArea(void);
@@ -57,12 +62,18 @@ public:
 	/** Clears the data stored to reclaim memory */
 	void Clear(void);
 	
-	/** Creates a new area of the specified size and contents. 
-	Origin is set to all zeroes. 
+	/** Creates a new area of the specified size and contents.
+	Origin is set to all zeroes.
 	BlockTypes are set to air, block metas to zero, blocklights to zero and skylights to full light.
 	*/
 	void Create(int a_SizeX, int a_SizeY, int a_SizeZ, int a_DataTypes = baTypes | baMetas);
 	
+	/** Creates a new area of the specified size and contents.
+	Origin is set to all zeroes.
+	BlockTypes are set to air, block metas to zero, blocklights to zero and skylights to full light.
+	*/
+	void Create(const Vector3i & a_Size, int a_DataTypes = baTypes | baMetas);
+	
 	/** Resets the origin. No other changes are made, contents are untouched. */
 	void SetOrigin(int a_OriginX, int a_OriginY, int a_OriginZ);
 	
@@ -119,8 +130,8 @@ public:
 	- msFillAir overwrites only those blocks that were air
 	- msImprint overwrites with only those blocks that are non-air
 
-	Special strategies:
-	msLake (evaluate top-down, first match wins):
+	Special strategies (evaluate top-down, first match wins):
+	msLake:
 	|    area block     |        |
 	|   this   | Src    | result |
 	+----------+--------+--------+
@@ -135,6 +146,22 @@ public:
 	| mycelium | stone  | stone  |    ... and mycelium
 	| A        | stone  | A      |    ... but nothing else
 	| A        | *      | A      |  Everything else is left as it is
+	
+	msSpongePrint:
+	Used for most generators, it allows carving out air pockets, too, and uses the Sponge as the NOP block
+	|    area block     |        |
+	|   this   | Src    | result |
+	+----------+--------+--------+
+	| A        | sponge | A      |  Sponge is the NOP block
+	| *        | B      | B      |  Everything else overwrites anything
+	
+	msMask:
+	Combines two areas, the blocks that are the same are kept, differing ones are reset to air
+	|  area block  |        |
+	| this | Src   | result |
+	+------+-------+--------+
+	| A    | A     | A      |  Same blocks are kept
+	| A    | non-A | air    |  Everything else is replaced with air
 
 	*/
 	void Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_RelZ, eMergeStrategy a_Strategy);
@@ -232,18 +259,24 @@ public:
 	void GetBlockTypeMeta   (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) const;
 	void GetRelBlockTypeMeta(int a_RelX,   int a_RelY,   int a_RelZ,   BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) const;
 	
+	// GetSize() is already exported manually to return 3 numbers, can't auto-export
+	const Vector3i & GetSize(void) const { return m_Size; }
+	
+	// GetOrigin() is already exported manually to return 3 numbers, can't auto-export
+	const Vector3i & GetOrigin(void) const { return m_Origin; }
+	
 	// tolua_begin
 	
-	int GetSizeX(void) const { return m_SizeX; }
-	int GetSizeY(void) const { return m_SizeY; }
-	int GetSizeZ(void) const { return m_SizeZ; }
+	int GetSizeX(void) const { return m_Size.x; }
+	int GetSizeY(void) const { return m_Size.y; }
+	int GetSizeZ(void) const { return m_Size.z; }
 	
 	/** Returns the volume of the area, as number of blocks */
-	int GetVolume(void) const { return m_SizeX * m_SizeY * m_SizeZ; }
+	int GetVolume(void) const { return m_Size.x * m_Size.y * m_Size.z; }
 	
-	int GetOriginX(void) const { return m_OriginX; }
-	int GetOriginY(void) const { return m_OriginY; }
-	int GetOriginZ(void) const { return m_OriginZ; }
+	int GetOriginX(void) const { return m_Origin.x; }
+	int GetOriginY(void) const { return m_Origin.y; }
+	int GetOriginZ(void) const { return m_Origin.z; }
 	
 	/** Returns the datatypes that are stored in the object (bitmask of baXXX values) */
 	int GetDataTypes(void) const;
@@ -261,7 +294,7 @@ public:
 	NIBBLETYPE * GetBlockMetas   (void) const { return m_BlockMetas; }     // NOTE: one byte per block!
 	NIBBLETYPE * GetBlockLight   (void) const { return m_BlockLight; }     // NOTE: one byte per block!
 	NIBBLETYPE * GetBlockSkyLight(void) const { return m_BlockSkyLight; }  // NOTE: one byte per block!
-	int          GetBlockCount(void) const { return m_SizeX * m_SizeY * m_SizeZ; }
+	int          GetBlockCount(void) const { return m_Size.x * m_Size.y * m_Size.z; }
 	int MakeIndex(int a_RelX, int a_RelY, int a_RelZ) const;
 
 protected:
@@ -276,9 +309,7 @@ protected:
 		
 	protected:
 		cBlockArea & m_Area;
-		int m_OriginX;
-		int m_OriginY;
-		int m_OriginZ;
+		Vector3i m_Origin;
 		int m_CurrentChunkX;
 		int m_CurrentChunkZ;
 		
@@ -295,12 +326,8 @@ protected:
 	typedef NIBBLETYPE * NIBBLEARRAY;
 	
 	
-	int m_OriginX;
-	int m_OriginY;
-	int m_OriginZ;
-	int m_SizeX;
-	int m_SizeY;
-	int m_SizeZ;
+	Vector3i m_Origin;
+	Vector3i m_Size;
 	
 	/** An extra data value sometimes stored in the .schematic file. Used mainly by the WorldEdit plugin.
 	cBlockArea doesn't use this value in any way. */
diff --git a/src/BlockEntities/DispenserEntity.cpp b/src/BlockEntities/DispenserEntity.cpp
index cbfbb1b6a..e03bf776d 100644
--- a/src/BlockEntities/DispenserEntity.cpp
+++ b/src/BlockEntities/DispenserEntity.cpp
@@ -138,6 +138,12 @@ void cDispenserEntity::DropSpenseFromSlot(cChunk & a_Chunk, int a_SlotNum)
 			break;
 		}
 		
+		case E_ITEM_FIRE_CHARGE:
+		{
+			// TODO: Spawn fireball entity
+			break;
+		}
+		
 		default:
 		{
 			DropFromSlot(a_Chunk, a_SlotNum);
diff --git a/src/BlockEntities/HopperEntity.cpp b/src/BlockEntities/HopperEntity.cpp
index af7043767..41fb9f811 100644
--- a/src/BlockEntities/HopperEntity.cpp
+++ b/src/BlockEntities/HopperEntity.cpp
@@ -219,7 +219,7 @@ bool cHopperEntity::MovePickupsIn(cChunk & a_Chunk, Int64 a_CurrentTick)
 
 			Vector3f EntityPos = a_Entity->GetPosition();
 			Vector3f BlockPos(m_Pos.x + 0.5f, (float)m_Pos.y + 1, m_Pos.z + 0.5f); // One block above hopper, and search from center outwards
-			float Distance = (EntityPos - BlockPos).Length();
+			double Distance = (EntityPos - BlockPos).Length();
 
 			if (Distance < 0.5)
 			{
diff --git a/src/BlockID.h b/src/BlockID.h
index 1c454cd23..2fec512e2 100644
--- a/src/BlockID.h
+++ b/src/BlockID.h
@@ -853,9 +853,30 @@ enum eExplosionSource
 	esWitherSkullBlue,
 	esWitherBirth,
 	esPlugin,
-	
-	// Obsolete constants, kept for compatibility, will be removed after some time:
-	esCreeper = esMonster,
+} ;
+
+
+
+
+
+enum eShrapnelLevel
+{
+	slNone,
+	slGravityAffectedOnly,
+	slAll
+} ;
+
+
+
+
+
+enum eSpreadSource
+{
+	ssFireSpread,
+	ssGrassSpread,
+	ssMushroomSpread,
+	ssMycelSpread,
+	ssVineSpread,
 } ;
 
 // tolua_end
diff --git a/src/BlockInfo.cpp b/src/BlockInfo.cpp
index d1ecfdf7e..6fb5aa5b3 100644
--- a/src/BlockInfo.cpp
+++ b/src/BlockInfo.cpp
@@ -93,6 +93,7 @@ void cBlockInfo::Initialize(void)
 	ms_Info[E_BLOCK_IRON_BARS           ].m_SpreadLightFalloff = 1;
 	ms_Info[E_BLOCK_IRON_DOOR           ].m_SpreadLightFalloff = 1;
 	ms_Info[E_BLOCK_LEAVES              ].m_SpreadLightFalloff = 1;
+	ms_Info[E_BLOCK_NEW_LEAVES          ].m_SpreadLightFalloff = 1;
 	ms_Info[E_BLOCK_SIGN_POST           ].m_SpreadLightFalloff = 1;
 	ms_Info[E_BLOCK_TORCH               ].m_SpreadLightFalloff = 1;
 	ms_Info[E_BLOCK_VINES               ].m_SpreadLightFalloff = 1;
@@ -364,7 +365,7 @@ void cBlockInfo::Initialize(void)
 	ms_Info[E_BLOCK_WOODEN_SLAB         ].m_IsSolid = false;
 
 
-	// Torch placeable blocks:
+	// Blocks that fully occupy their voxel - used as a guide for torch placeable blocks, amongst other things:
 	ms_Info[E_BLOCK_NEW_LOG             ].m_FullyOccupiesVoxel = true;
 	ms_Info[E_BLOCK_BEDROCK             ].m_FullyOccupiesVoxel = true;
 	ms_Info[E_BLOCK_BLOCK_OF_COAL       ].m_FullyOccupiesVoxel = true;
@@ -396,6 +397,7 @@ void cBlockInfo::Initialize(void)
 	ms_Info[E_BLOCK_HAY_BALE            ].m_FullyOccupiesVoxel = true;
 	ms_Info[E_BLOCK_HUGE_BROWN_MUSHROOM ].m_FullyOccupiesVoxel = true;
 	ms_Info[E_BLOCK_HUGE_RED_MUSHROOM   ].m_FullyOccupiesVoxel = true;
+	ms_Info[E_BLOCK_ICE                 ].m_FullyOccupiesVoxel = true;
 	ms_Info[E_BLOCK_IRON_BLOCK          ].m_FullyOccupiesVoxel = true;
 	ms_Info[E_BLOCK_IRON_ORE            ].m_FullyOccupiesVoxel = true;
 	ms_Info[E_BLOCK_JACK_O_LANTERN      ].m_FullyOccupiesVoxel = true;
diff --git a/src/Blocks/BlockAnvil.h b/src/Blocks/BlockAnvil.h
new file mode 100644
index 000000000..93a796ef7
--- /dev/null
+++ b/src/Blocks/BlockAnvil.h
@@ -0,0 +1,61 @@
+
+#pragma once
+
+#include "BlockHandler.h"
+#include "../World.h"
+#include "../Entities/Player.h"
+
+
+
+
+
+class cBlockAnvilHandler :
+	public cBlockHandler
+{
+public:
+	cBlockAnvilHandler(BLOCKTYPE a_BlockType)
+		: cBlockHandler(a_BlockType)
+	{
+	}
+	
+	
+	virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
+	{
+		a_Pickups.push_back(cItem(E_BLOCK_ANVIL, 1, a_BlockMeta >> 2));
+	}
+	
+	
+	virtual bool GetPlacementBlockTypeMeta(
+		cChunkInterface & a_ChunkInterface, cPlayer * a_Player,
+		int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, 
+		int a_CursorX, int a_CursorY, int a_CursorZ,
+		BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta
+	) override
+	{
+		a_BlockType = m_BlockType;
+		NIBBLETYPE HighBits = a_BlockMeta & 0x0c;  // Only highest two bits are preserved
+		int Direction = (int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 1.5) & 0x3;
+		switch (Direction)
+		{
+			case 0: a_BlockMeta = 0x2 | HighBits; break;
+			case 1: a_BlockMeta = 0x3 | HighBits; break;
+			case 2: a_BlockMeta = 0x0 | HighBits; break;
+			case 3: a_BlockMeta = 0x1 | HighBits; break;
+			default:
+			{
+				return false;
+			}
+		}
+		return true;
+	}
+
+
+	virtual bool IsUseable() override
+	{
+		return true;
+	}
+} ;
+
+
+
+
diff --git a/src/Blocks/BlockBed.cpp b/src/Blocks/BlockBed.cpp
index 3dad4feba..6a3c6a55b 100644
--- a/src/Blocks/BlockBed.cpp
+++ b/src/Blocks/BlockBed.cpp
@@ -51,6 +51,49 @@ void cBlockBedHandler::OnDestroyed(cChunkInterface & a_ChunkInterface, cWorldInt
 
 
 
+class cTimeFastForwardTester :
+	public cPlayerListCallback
+{
+	virtual bool Item(cPlayer * a_Player) override
+	{
+		if (!a_Player->IsInBed())
+		{
+			return true;
+		}
+
+		return false;
+	}
+};
+
+
+
+
+
+class cPlayerBedStateUnsetter :
+	public cPlayerListCallback
+{
+public:
+	cPlayerBedStateUnsetter(Vector3i a_Position, cWorldInterface & a_WorldInterface) :
+		m_Position(a_Position), m_WorldInterface(a_WorldInterface)
+	{
+	}
+
+	virtual bool Item(cPlayer * a_Player) override
+	{
+		a_Player->SetIsInBed(false);
+		m_WorldInterface.GetBroadcastManager().BroadcastEntityAnimation(*a_Player, 2);
+		return false;
+	}
+
+private:
+	Vector3i m_Position;
+	cWorldInterface & m_WorldInterface;
+};
+
+
+
+
+
 void cBlockBedHandler::OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ)
 {
 	if (a_WorldInterface.GetDimension() != dimOverworld)
@@ -69,6 +112,8 @@ void cBlockBedHandler::OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface
 			}
 			else
 			{
+				Vector3i PillowDirection(0, 0, 0);
+
 				if (Meta & 0x8)
 				{
 					// Is pillow	
@@ -77,16 +122,30 @@ void cBlockBedHandler::OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface
 				else
 				{
 					// Is foot end
-					Vector3i Direction = MetaDataToDirection( Meta & 0x7 );
-					if (a_ChunkInterface.GetBlock(a_BlockX + Direction.x, a_BlockY, a_BlockZ + Direction.z) == E_BLOCK_BED) // Must always use pillow location for sleeping
+					VERIFY((Meta & 0x4) != 0x4); // Occupied flag should never be set, else our compilator (intended) is broken
+
+					PillowDirection = MetaDataToDirection(Meta & 0x7);
+					if (a_ChunkInterface.GetBlock(a_BlockX + PillowDirection.x, a_BlockY, a_BlockZ + PillowDirection.z) == E_BLOCK_BED) // Must always use pillow location for sleeping
 					{
-						a_WorldInterface.GetBroadcastManager().BroadcastUseBed(*a_Player, a_BlockX + Direction.x, a_BlockY, a_BlockZ + Direction.z);
+						a_WorldInterface.GetBroadcastManager().BroadcastUseBed(*a_Player, a_BlockX + PillowDirection.x, a_BlockY, a_BlockZ + PillowDirection.z);
 					}
 				}
-				a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, (Meta | (1 << 2)));
-			}
-			
-		} else {
+
+				a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta | 0x4); // Where 0x4 = occupied bit
+				a_Player->SetIsInBed(true);
+
+				cTimeFastForwardTester Tester;
+				if (a_WorldInterface.ForEachPlayer(Tester))
+				{
+					cPlayerBedStateUnsetter Unsetter(Vector3i(a_BlockX + PillowDirection.x, a_BlockY, a_BlockZ + PillowDirection.z), a_WorldInterface);
+					a_WorldInterface.ForEachPlayer(Unsetter);
+					a_WorldInterface.SetTimeOfDay(0);
+					a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta & 0xB); // Where 0xB = 1011, and zero is to make sure 'occupied' bit is always unset
+				}
+			}			
+		}
+		else
+		{
 			a_Player->SendMessageFailure("You can only sleep at night");
 		}
 	}
diff --git a/src/Blocks/BlockBed.h b/src/Blocks/BlockBed.h
index 6daa94730..92804aaac 100644
--- a/src/Blocks/BlockBed.h
+++ b/src/Blocks/BlockBed.h
@@ -4,7 +4,7 @@
 #include "BlockHandler.h"
 #include "ChunkInterface.h"
 #include "WorldInterface.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 #include "../Entities/Player.h"
 
 
@@ -12,11 +12,11 @@
 
 
 class cBlockBedHandler :
-	public cMetaRotater<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01, true>
+	public cMetaRotator<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01, true>
 {
 public:
 	cBlockBedHandler(BLOCKTYPE a_BlockType)
-		: cMetaRotater<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01,true>(a_BlockType)
+		: cMetaRotator<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01,true>(a_BlockType)
 	{
 	}
 
diff --git a/src/Blocks/BlockButton.h b/src/Blocks/BlockButton.h
index 740cbe3c4..4b2f6f618 100644
--- a/src/Blocks/BlockButton.h
+++ b/src/Blocks/BlockButton.h
@@ -2,17 +2,17 @@
 
 #include "BlockHandler.h"
 #include "Chunk.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 
 
 
 
 class cBlockButtonHandler :
-	public cMetaRotater<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>
+	public cMetaRotator<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>
 {
 public:
 	cBlockButtonHandler(BLOCKTYPE a_BlockType)
-		: cMetaRotater<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType)
+		: cMetaRotator<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType)
 	{
 	}
 
diff --git a/src/Blocks/BlockCake.h b/src/Blocks/BlockCake.h
new file mode 100644
index 000000000..36e133388
--- /dev/null
+++ b/src/Blocks/BlockCake.h
@@ -0,0 +1,55 @@
+#pragma once
+
+#include "BlockHandler.h"
+
+
+
+
+
+class cBlockCakeHandler :
+	public cBlockHandler
+{
+public:
+	cBlockCakeHandler(BLOCKTYPE a_BlockType)
+		: cBlockHandler(a_BlockType)
+	{
+	}
+	
+	virtual void OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override
+	{
+		NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
+
+		if (!a_Player->Feed(2, 0.1))
+		{
+			return;
+		}
+		
+		if (Meta >= 5)
+		{
+			a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+		}
+		else
+		{
+			a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta + 1);
+		}
+	}
+
+	virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
+	{
+		// Give nothing
+	}
+
+	virtual bool IsUseable(void) override
+	{
+		return true;
+	}
+
+	virtual const char * GetStepSound(void) override
+	{
+		return "step.cloth";
+	}
+} ;
+
+
+
+
diff --git a/src/Blocks/BlockCauldron.h b/src/Blocks/BlockCauldron.h
index 2e1032d2b..41b79b6c3 100644
--- a/src/Blocks/BlockCauldron.h
+++ b/src/Blocks/BlockCauldron.h
@@ -23,7 +23,7 @@ public:
 
 	virtual void OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override
 	{
-		char Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
+		NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
 		switch (a_Player->GetEquippedItem().m_ItemType)
 		{
 			case E_ITEM_WATER_BUCKET:
diff --git a/src/Blocks/BlockChest.h b/src/Blocks/BlockChest.h
index 30588d8fc..a1ded4c26 100644
--- a/src/Blocks/BlockChest.h
+++ b/src/Blocks/BlockChest.h
@@ -4,18 +4,18 @@
 #include "BlockEntity.h"
 #include "../BlockArea.h"
 #include "../Entities/Player.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 
 
 
 
 
 class cBlockChestHandler :
-	public cMetaRotater<cBlockEntityHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>
+	public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
 {
 public:
 	cBlockChestHandler(BLOCKTYPE a_BlockType)
-		: cMetaRotater<cBlockEntityHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType)
+		: cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
 	{
 	}
 
diff --git a/src/Blocks/BlockComparator.h b/src/Blocks/BlockComparator.h
index e570ff302..4dd05366d 100644
--- a/src/Blocks/BlockComparator.h
+++ b/src/Blocks/BlockComparator.h
@@ -3,18 +3,18 @@
 
 #include "BlockHandler.h"
 #include "BlockRedstoneRepeater.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 
 
 
 
 
 class cBlockComparatorHandler :
-	public cMetaRotater<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>
+	public cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>
 {
 public:
 	cBlockComparatorHandler(BLOCKTYPE a_BlockType)
-		: cMetaRotater<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType)
+		: cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType)
 	{
 	}
 
diff --git a/src/Blocks/BlockCrops.h b/src/Blocks/BlockCrops.h
index ffc2b3f8b..8606cf3f3 100644
--- a/src/Blocks/BlockCrops.h
+++ b/src/Blocks/BlockCrops.h
@@ -2,7 +2,7 @@
 #pragma once
 
 #include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
 
 
 
@@ -21,7 +21,7 @@ public:
 
 	virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_Meta) override
 	{
-		MTRand rand;
+		cFastRandom rand;
 
 		if (a_Meta == 0x7)
 		{
@@ -31,18 +31,18 @@ public:
 				case E_BLOCK_CROPS:
 				{
 					a_Pickups.push_back(cItem(E_ITEM_WHEAT, 1, 0));
-					a_Pickups.push_back(cItem(E_ITEM_SEEDS, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0));  // [1 .. 3] with high preference of 2
+					a_Pickups.push_back(cItem(E_ITEM_SEEDS, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0));  // [1 .. 3] with high preference of 2
 					break;
 				}
 				case E_BLOCK_CARROTS:
 				{
-					a_Pickups.push_back(cItem(E_ITEM_CARROT, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0));  // [1 .. 3] with high preference of 2
+					a_Pickups.push_back(cItem(E_ITEM_CARROT, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0));  // [1 .. 3] with high preference of 2
 					break;
 				}
 				case E_BLOCK_POTATOES:
 				{
-					a_Pickups.push_back(cItem(E_ITEM_POTATO, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0));  // [1 .. 3] with high preference of 2
-					if (rand.randInt(20) == 0)
+					a_Pickups.push_back(cItem(E_ITEM_POTATO, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0));  // [1 .. 3] with high preference of 2
+					if (rand.NextInt(21) == 0)
 					{
 						// With a 5% chance, drop a poisonous potato as well
 						a_Pickups.push_back(cItem(E_ITEM_POISONOUS_POTATO, 1, 0));
diff --git a/src/Blocks/BlockDirt.h b/src/Blocks/BlockDirt.h
index 544424a04..aa24b8668 100644
--- a/src/Blocks/BlockDirt.h
+++ b/src/Blocks/BlockDirt.h
@@ -2,7 +2,7 @@
 #pragma once
 
 #include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
 
 
 
@@ -44,12 +44,12 @@ public:
 		}
 		
 		// Grass spreads to adjacent dirt blocks:
-		MTRand rand;  // TODO: Replace with cFastRandom
+		cFastRandom rand;
 		for (int i = 0; i < 2; i++)  // Pick two blocks to grow to
 		{
-			int OfsX = rand.randInt(2) - 1;  // [-1 .. 1]
-			int OfsY = rand.randInt(4) - 3;  // [-3 .. 1]
-			int OfsZ = rand.randInt(2) - 1;  // [-1 .. 1]
+			int OfsX = rand.NextInt(3, a_RelX) - 1;  // [-1 .. 1]
+			int OfsY = rand.NextInt(5, a_RelY) - 3;  // [-3 .. 1]
+			int OfsZ = rand.NextInt(3, a_RelZ) - 1;  // [-1 .. 1]
 	
 			BLOCKTYPE  DestBlock;
 			NIBBLETYPE DestMeta;
@@ -79,7 +79,10 @@ public:
 			Chunk->GetBlockTypeMeta(BlockX, BlockY + 1, BlockZ, AboveDest, AboveMeta);
 			if ((cBlockInfo::IsOneHitDig(AboveDest) || cBlockInfo::IsTransparent(AboveDest)) && !IsBlockWater(AboveDest))
 			{
-				Chunk->FastSetBlock(BlockX, BlockY, BlockZ, E_BLOCK_GRASS, 0);
+				if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, BlockX * cChunkDef::Width, BlockY, BlockZ * cChunkDef::Width, ssGrassSpread))
+				{
+					Chunk->FastSetBlock(BlockX, BlockY, BlockZ, E_BLOCK_GRASS, 0);
+				}
 			}
 		}  // for i - repeat twice
 	}
diff --git a/src/Blocks/BlockDoor.cpp b/src/Blocks/BlockDoor.cpp
index 4e38ef334..479c68153 100644
--- a/src/Blocks/BlockDoor.cpp
+++ b/src/Blocks/BlockDoor.cpp
@@ -110,3 +110,87 @@ const char * cBlockDoorHandler::GetStepSound(void)
 
 
 
+
+NIBBLETYPE cBlockDoorHandler::MetaRotateCCW(NIBBLETYPE a_Meta)
+{
+	if (a_Meta & 0x08)
+	{
+		return a_Meta;
+	}
+	else
+	{
+		return super::MetaRotateCCW(a_Meta);
+	}
+}
+
+
+
+NIBBLETYPE cBlockDoorHandler::MetaRotateCW(NIBBLETYPE a_Meta)
+{
+	if (a_Meta & 0x08)
+	{
+		return a_Meta;
+	}
+	else
+	{
+		return super::MetaRotateCW(a_Meta);
+	}
+}
+
+
+
+NIBBLETYPE cBlockDoorHandler::MetaMirrorXY(NIBBLETYPE a_Meta)
+{
+	// Top bit (0x08) contains door panel type (Top/Bottom panel)  Only Bottom panels contain position data
+	// Return a_Meta if panel is a top panel (0x08 bit is set to 1)
+
+	// Note: Currently, you can not properly mirror the hinges on a double door.  The orientation of the door is stored
+	// in only the bottom tile while the hinge position is in the top tile.  This function only operates on one tile at a time, 
+	// so the function can only see either the hinge position or orientation, but not both, at any given time.  The class itself
+	// needs extra datamembers.
+	if (a_Meta & 0x08) return a_Meta;
+
+	// Holds open/closed meta data. 0x0C == 1100.
+	NIBBLETYPE OtherMeta = a_Meta & 0x0C;
+
+	// Mirrors according to a table.  0x03 == 0011.
+	switch (a_Meta & 0x03)
+	{
+		case 0x03: return 0x01 + OtherMeta;  // South -> North
+		case 0x01: return 0x03 + OtherMeta;  // North -> South
+	}
+
+	// Not Facing North or South; No change.
+	return a_Meta;
+}
+
+
+
+NIBBLETYPE cBlockDoorHandler::MetaMirrorYZ(NIBBLETYPE a_Meta)
+{
+	// Top bit (0x08) contains door panel type (Top/Bottom panel)  Only Bottom panels contain position data
+	// Return a_Meta if panel is a top panel (0x08 bit is set to 1)
+
+	// Note: Currently, you can not properly mirror the hinges on a double door.  The orientation of the door is stored
+	// in only the bottom tile while the hinge position is in the top tile.  This function only operates on one tile at a time, 
+	// so the function can only see either the hinge position or orientation, but not both, at any given time.The class itself
+	// needs extra datamembers.
+
+	if (a_Meta & 0x08) return a_Meta;
+
+	// Holds open/closed meta data. 0x0C == 1100.
+	NIBBLETYPE OtherMeta = a_Meta & 0x0C;
+
+	// Mirrors according to a table.  0x03 == 0011.
+	switch (a_Meta & 0x03)
+	{
+		case 0x00: return 0x02 + OtherMeta;  // West  -> East
+		case 0x02: return 0x00 + OtherMeta;  // East  -> West
+	}
+
+	// Not Facing North or South; No change.
+	return a_Meta;
+}
+
+
+
diff --git a/src/Blocks/BlockDoor.h b/src/Blocks/BlockDoor.h
index 981774c17..797fe484c 100644
--- a/src/Blocks/BlockDoor.h
+++ b/src/Blocks/BlockDoor.h
@@ -4,15 +4,15 @@
 #include "BlockHandler.h"
 #include "../Entities/Player.h"
 #include "Chunk.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 
 
 
 
 class cBlockDoorHandler :
-	public cMetaRotater<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true>
+	public cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true>
 {
-	typedef cMetaRotater<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> super;
+	typedef cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> super;
 public:
 	cBlockDoorHandler(BLOCKTYPE a_BlockType);
 
@@ -21,6 +21,10 @@ public:
 	virtual void OnCancelRightClick(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override;
 	virtual const char * GetStepSound(void) override;
 	
+	virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override;
+	virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta)  override;
+	virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta)  override;
+	virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta)  override;
 	
 	virtual bool GetPlacementBlockTypeMeta(
 		cChunkInterface & a_ChunkInterface, cPlayer * a_Player,
@@ -142,14 +146,14 @@ public:
 	static void ChangeDoor(cChunkInterface & a_ChunkInterface, int a_X, int a_Y, int a_Z)
 	{
 		NIBBLETYPE OldMetaData = a_ChunkInterface.GetBlockMeta(a_X, a_Y, a_Z);
-		
+
 		a_ChunkInterface.SetBlockMeta(a_X, a_Y, a_Z, ChangeStateMetaData(OldMetaData));
-		
+
 		if (OldMetaData & 8)
 		{
 			// Current block is top of the door
 			BLOCKTYPE  BottomBlock = a_ChunkInterface.GetBlock(a_X, a_Y - 1, a_Z);
-			NIBBLETYPE BottomMeta  = a_ChunkInterface.GetBlockMeta(a_X, a_Y - 1, a_Z);
+			NIBBLETYPE BottomMeta = a_ChunkInterface.GetBlockMeta(a_X, a_Y - 1, a_Z);
 
 			if (IsDoor(BottomBlock) && !(BottomMeta & 8))
 			{
@@ -168,62 +172,6 @@ public:
 			}
 		}
 	}
-	
-	
-	virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
-	{
-		if (a_Meta & 0x08) 
-		{
-			return a_Meta;
-		}
-		else
-		{
-			return super::MetaRotateCCW(a_Meta);
-		}
-	}
-	
-	
-	
-	virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
-	{
-		if (a_Meta & 0x08) 
-		{
-			return a_Meta;
-		}
-		else
-		{
-			return super::MetaRotateCW(a_Meta);
-		}
-	}
-	
-	
-	
-	virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
-	{
-		if (a_Meta & 0x08) 
-		{
-			return a_Meta;
-		}
-		else
-		{
-			return super::MetaMirrorXY(a_Meta);
-		}
-	}
-	
-	
-	
-	virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
-	{
-		if (a_Meta & 0x08) 
-		{
-			return a_Meta;
-		}
-		else
-		{
-			return super::MetaMirrorYZ(a_Meta);
-		}
-	}
-	
 } ;
 
 
diff --git a/src/Blocks/BlockDropSpenser.h b/src/Blocks/BlockDropSpenser.h
index 7e0ad0e55..88b61a418 100644
--- a/src/Blocks/BlockDropSpenser.h
+++ b/src/Blocks/BlockDropSpenser.h
@@ -6,18 +6,18 @@
 #pragma once
 
 #include "../Piston.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 
 
 
 
 
 class cBlockDropSpenserHandler :
-	public cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
+	public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
 {
 public:
 	cBlockDropSpenserHandler(BLOCKTYPE a_BlockType) :
-		cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
+		cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
 	{
 	}
 	
diff --git a/src/Blocks/BlockEnderchest.h b/src/Blocks/BlockEnderchest.h
index 97cf484fb..67955f8ce 100644
--- a/src/Blocks/BlockEnderchest.h
+++ b/src/Blocks/BlockEnderchest.h
@@ -2,17 +2,17 @@
 #pragma once
 
 #include "BlockEntity.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 
 
 
 
 class cBlockEnderchestHandler :
-	public cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
+	public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
 {
 public:
 	cBlockEnderchestHandler(BLOCKTYPE a_BlockType)
-		: cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
+		: cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
 	{
 	}
 
diff --git a/src/Blocks/BlockFenceGate.h b/src/Blocks/BlockFenceGate.h
index e3162bbd6..e202c6610 100644
--- a/src/Blocks/BlockFenceGate.h
+++ b/src/Blocks/BlockFenceGate.h
@@ -2,17 +2,17 @@
 #pragma once
 
 #include "BlockHandler.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 
 
 
 
 class cBlockFenceGateHandler :
-	public cMetaRotater<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>
+	public cMetaRotator<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>
 {
 public:
 	cBlockFenceGateHandler(BLOCKTYPE a_BlockType) :
-		cMetaRotater<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>(a_BlockType)
+		cMetaRotator<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>(a_BlockType)
 	{
 	}
 
diff --git a/src/Blocks/BlockFire.h b/src/Blocks/BlockFire.h
index a25b87858..c8f158e7e 100644
--- a/src/Blocks/BlockFire.h
+++ b/src/Blocks/BlockFire.h
@@ -17,25 +17,27 @@ public:
 	}
 
 	/// Portal boundary and direction variables
-	int XZP, XZM, Dir; // For wont of a better name...
+	// 2014_03_30 _X: What are these used for? Why do we need extra variables?
+	int XZP, XZM;
+	NIBBLETYPE Dir;
 
 	virtual void OnPlaced(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override
 	{
 		/*
 		PORTAL FINDING ALGORITH
 		=======================
-		-Get clicked base block
-		-Trace upwards to find first obsidian block; aborts if anything other than obsidian or air is encountered.
-		 Uses this value as a reference (the 'ceiling')
-		-For both directions (if one fails, try the other), BASE (clicked) block:
-		 -Go in one direction, only stop if a non obsidian block is encountered (abort) OR a portal border is encountered (FindObsidianCeiling returns -1)
-		 -If a border was encountered, go the other direction and repeat above
-		 -Write borders to XZP and XZM, write direction portal faces to Dir
-		-Loop through boundary variables, and fill with portal blocks based on Dir with meta from Dir		
+		- Get clicked base block
+		- Trace upwards to find first obsidian block; aborts if anything other than obsidian or air is encountered.
+			Uses this value as a reference (the 'ceiling')
+		- For both directions (if one fails, try the other), BASE (clicked) block:
+			- Go in one direction, only stop if a non obsidian block is encountered (abort) OR a portal border is encountered (FindObsidianCeiling returns -1)
+			- If a border was encountered, go the other direction and repeat above
+			- Write borders to XZP and XZM, write direction portal faces to Dir
+		- Loop through boundary variables, and fill with portal blocks based on Dir with meta from Dir
 		*/
 
 		a_BlockY--; // Because we want the block below the fire
-		FindAndSetPortalFrame(a_BlockX, a_BlockY, a_BlockZ, a_ChunkInterface, a_WorldInterface); // Brought to you by Aperture Science
+		FindAndSetPortalFrame(a_BlockX, a_BlockY, a_BlockZ, a_ChunkInterface, a_WorldInterface);
 	}
 
 	virtual void OnDigging(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override
diff --git a/src/Blocks/BlockFurnace.h b/src/Blocks/BlockFurnace.h
index 27ef2689f..a7a807957 100644
--- a/src/Blocks/BlockFurnace.h
+++ b/src/Blocks/BlockFurnace.h
@@ -4,17 +4,17 @@
 #include "BlockEntity.h"
 #include "../World.h"
 #include "../Piston.h"
-
+#include "MetaRotator.h"
 
 
 
 
 class cBlockFurnaceHandler :
-	public cBlockEntityHandler
+	public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
 {
 public:
-	cBlockFurnaceHandler(BLOCKTYPE a_BlockType) :
-		cBlockEntityHandler(a_BlockType)
+	cBlockFurnaceHandler(BLOCKTYPE a_BlockType) 
+		: cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
 	{
 	}
 
diff --git a/src/Blocks/BlockHandler.cpp b/src/Blocks/BlockHandler.cpp
index aa97b2ca9..7fd8c183c 100644
--- a/src/Blocks/BlockHandler.cpp
+++ b/src/Blocks/BlockHandler.cpp
@@ -6,10 +6,12 @@
 #include "../Root.h"
 #include "../Bindings/PluginManager.h"
 #include "../Chunk.h"
+#include "BlockAnvil.h"
 #include "BlockBed.h"
 #include "BlockBrewingStand.h"
 #include "BlockButton.h"
 #include "BlockCactus.h"
+#include "BlockCake.h"
 #include "BlockCarpet.h"
 #include "BlockCauldron.h"
 #include "BlockChest.h"
@@ -39,6 +41,7 @@
 #include "BlockIce.h"
 #include "BlockLadder.h"
 #include "BlockLeaves.h"
+#include "BlockLilypad.h"
 #include "BlockNewLeaves.h"
 #include "BlockLever.h"
 #include "BlockMelon.h"
@@ -85,12 +88,14 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType)
 		// Block handlers, alphabetically sorted:
 		case E_BLOCK_ACACIA_WOOD_STAIRS:    return new cBlockStairsHandler          (a_BlockType);
 		case E_BLOCK_ACTIVATOR_RAIL:        return new cBlockRailHandler            (a_BlockType);
+		case E_BLOCK_ANVIL:                 return new cBlockAnvilHandler           (a_BlockType);
 		case E_BLOCK_BED:                   return new cBlockBedHandler             (a_BlockType);
 		case E_BLOCK_BIRCH_WOOD_STAIRS:     return new cBlockStairsHandler          (a_BlockType);
 		case E_BLOCK_BREWING_STAND:         return new cBlockBrewingStandHandler    (a_BlockType);
 		case E_BLOCK_BRICK_STAIRS:          return new cBlockStairsHandler          (a_BlockType);
 		case E_BLOCK_BROWN_MUSHROOM:        return new cBlockMushroomHandler        (a_BlockType);
 		case E_BLOCK_CACTUS:                return new cBlockCactusHandler          (a_BlockType);
+		case E_BLOCK_CAKE:                  return new cBlockCakeHandler            (a_BlockType);
 		case E_BLOCK_CARROTS:               return new cBlockCropsHandler           (a_BlockType);
 		case E_BLOCK_CARPET:                return new cBlockCarpetHandler          (a_BlockType);
 		case E_BLOCK_CAULDRON:              return new cBlockCauldronHandler        (a_BlockType);
@@ -138,6 +143,7 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType)
 		case E_BLOCK_LAPIS_ORE:             return new cBlockOreHandler             (a_BlockType);
 		case E_BLOCK_LAVA:                  return new cBlockLavaHandler            (a_BlockType);
 		case E_BLOCK_LEAVES:                return new cBlockLeavesHandler          (a_BlockType);
+		case E_BLOCK_LILY_PAD:              return new cBlockLilypadHandler         (a_BlockType);
 		case E_BLOCK_LIT_FURNACE:           return new cBlockFurnaceHandler         (a_BlockType);
 		case E_BLOCK_LOG:                   return new cBlockSidewaysHandler        (a_BlockType);
 		case E_BLOCK_MELON:                 return new cBlockMelonHandler           (a_BlockType);
diff --git a/src/Blocks/BlockHopper.h b/src/Blocks/BlockHopper.h
index 59b84aa0e..a882bb077 100644
--- a/src/Blocks/BlockHopper.h
+++ b/src/Blocks/BlockHopper.h
@@ -3,16 +3,16 @@
 
 // Declares the cBlockHopperHandler class representing the handler for the Hopper block
 
-
+#include "MetaRotator.h"
 
 
 
 class cBlockHopperHandler :
-	public cBlockEntityHandler
+	public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
 {
 public:
 	cBlockHopperHandler(BLOCKTYPE a_BlockType)
-		: cBlockEntityHandler(a_BlockType)
+		: cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
 	{
 	}
 
@@ -39,6 +39,21 @@ public:
 		}
 		return true;
 	}
+
+
+	virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override
+	{
+		// Bit 0x08 is a flag.  Lowest three bits are position.  0x08 == 1000
+		NIBBLETYPE OtherMeta = a_Meta & 0x08;
+		// Mirrors defined by by a table. (Source, mincraft.gamepedia.com) 0x07 == 0111
+		switch (a_Meta & 0x07)
+		{
+			case 0x00: return 0x01 + OtherMeta;  // Down -> Up
+			case 0x01: return 0x00 + OtherMeta;  // Up   -> Down
+		}
+		// Not Facing Up or Down; No change.
+		return a_Meta;
+	}
 } ;
 
 
diff --git a/src/Blocks/BlockLadder.h b/src/Blocks/BlockLadder.h
index a3e9edc6b..a605edf3f 100644
--- a/src/Blocks/BlockLadder.h
+++ b/src/Blocks/BlockLadder.h
@@ -9,11 +9,11 @@
 
 
 class cBlockLadderHandler :
-	public cBlockHandler
+	public cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
 {
 public:
 	cBlockLadderHandler(BLOCKTYPE a_BlockType)
-		: cBlockHandler(a_BlockType)
+		: cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
 	{
 	}	
 
diff --git a/src/Blocks/BlockLeaves.h b/src/Blocks/BlockLeaves.h
index 7b8f0b378..8af14686e 100644
--- a/src/Blocks/BlockLeaves.h
+++ b/src/Blocks/BlockLeaves.h
@@ -1,6 +1,6 @@
 #pragma once
 #include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
 #include "../World.h"
 #include "../BlockArea.h"
 
@@ -16,6 +16,7 @@
 	{ \
 		case E_BLOCK_LEAVES: a_Area.SetBlockType(x, y, z, (BLOCKTYPE)(E_BLOCK_SPONGE + i + 1)); break; \
 		case E_BLOCK_LOG: return true; \
+		case E_BLOCK_NEW_LOG: return true; \
 	}
 
 bool HasNearLog(cBlockArea &a_Area, int a_BlockX, int a_BlockY, int a_BlockZ);
@@ -36,16 +37,18 @@ public:
 
 	virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
 	{
-		MTRand rand;
+		cFastRandom rand;
 
 		// Only the first 2 bits contain the display information, the others are for growing
-		if (rand.randInt(5) == 0)
+		if (rand.NextInt(6) == 0)
 		{
 			a_Pickups.push_back(cItem(E_BLOCK_SAPLING, 1, a_BlockMeta & 3));
 		}
-		if ((a_BlockMeta & 3) == E_META_SAPLING_APPLE)
+		
+		// 1 % chance of dropping an apple, if the leaves' type is Apple Leaves
+		if ((a_BlockMeta & 3) == E_META_LEAVES_APPLE)
 		{
-			if (rand.rand(100) == 0)
+			if (rand.NextInt(101) == 0)
 			{
 				a_Pickups.push_back(cItem(E_ITEM_RED_APPLE, 1, 0));
 			}
@@ -57,11 +60,10 @@ public:
 	{
 		cBlockHandler::OnDestroyed(a_ChunkInterface, a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ);
 		
-		//0.5% chance of dropping an apple
+		// 0.5% chance of dropping an apple, if the leaves' type is Apple Leaves:
 		NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
-		//check if Oak (0x1 and 0x2 bit not set)
-		MTRand rand;
-		if(!(Meta & 3) && rand.randInt(200) == 100)
+		cFastRandom rand;
+		if (((Meta & 3) == E_META_LEAVES_APPLE) && (rand.NextInt(201) == 100))
 		{
 			cItems Drops;
 			Drops.push_back(cItem(E_ITEM_RED_APPLE, 1, 0));
diff --git a/src/Blocks/BlockLever.h b/src/Blocks/BlockLever.h
index ef6e102cd..ad2ae29e5 100644
--- a/src/Blocks/BlockLever.h
+++ b/src/Blocks/BlockLever.h
@@ -1,17 +1,18 @@
 #pragma once
 
 #include "BlockHandler.h"
-
+#include "MetaRotator.h"
 
 
 
 
 class cBlockLeverHandler :
-	public cBlockHandler
+	public cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false>
 {
+	typedef cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false> super;
 public:
 	cBlockLeverHandler(BLOCKTYPE a_BlockType)
-		: cBlockHandler(a_BlockType)
+		: cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false>(a_BlockType)
 	{
 	}
 	
@@ -104,6 +105,36 @@ public:
 
 		return (a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn);
 	}
+
+
+	virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
+	{
+		switch (a_Meta)
+		{
+			case 0x00: return 0x07;  // Ceiling rotation
+			case 0x07: return 0x00;
+
+			case 0x05: return 0x06;  // Ground rotation
+			case 0x06: return 0x05;
+
+			default:  return super::MetaRotateCCW(a_Meta);  // Wall Rotation
+		}
+	}
+
+
+	virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
+	{
+		switch (a_Meta)
+		{
+			case 0x00: return 0x07;  // Ceiling rotation
+			case 0x07: return 0x00;
+
+			case 0x05: return 0x06;  // Ground rotation
+			case 0x06: return 0x05;
+
+			default:  return super::MetaRotateCCW(a_Meta);  // Wall Rotation
+		}
+	}
 } ;
 
 
diff --git a/src/Blocks/BlockLilypad.h b/src/Blocks/BlockLilypad.h
new file mode 100644
index 000000000..2dd4ec768
--- /dev/null
+++ b/src/Blocks/BlockLilypad.h
@@ -0,0 +1,28 @@
+
+#pragma once
+
+#include "BlockHandler.h"
+#include "Entities/Pickup.h"
+
+
+
+
+class cBlockLilypadHandler :
+	public cBlockHandler
+{
+public:
+	cBlockLilypadHandler(BLOCKTYPE a_BlockType)
+		: cBlockHandler(a_BlockType)
+	{
+	}
+	
+	virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
+	{
+		// Reset meta to zero
+		a_Pickups.push_back(cItem(E_BLOCK_LILY_PAD, 1, 0));
+	}
+};
+
+
+
+
diff --git a/src/Blocks/BlockMobHead.h b/src/Blocks/BlockMobHead.h
index 2b128f13b..acd1c88fb 100644
--- a/src/Blocks/BlockMobHead.h
+++ b/src/Blocks/BlockMobHead.h
@@ -21,6 +21,103 @@ public:
 	{
 		a_Pickups.push_back(cItem(E_ITEM_HEAD, 1, 0));
 	}
+
+	bool TrySpawnWither(cChunkInterface & a_ChunkInterface, cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ)
+	{
+		if (a_BlockY < 2)
+		{
+			return false;
+		}
+
+		class cCallback : public cMobHeadCallback
+		{
+			bool m_IsWither;
+			
+			virtual bool Item (cMobHeadEntity * a_MobHeadEntity)
+			{
+				m_IsWither = (a_MobHeadEntity->GetType() == SKULL_TYPE_WITHER);
+
+				return false;
+			}
+		
+		public:
+			cCallback () : m_IsWither(false) {}
+
+			bool IsWither(void) const { return m_IsWither; }
+
+			void Reset(void) { m_IsWither = false; }
+		} CallbackA, CallbackB;
+
+		a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ, CallbackA);
+
+		if (!CallbackA.IsWither())
+		{
+			return false;
+		}
+
+		CallbackA.Reset();
+		
+		BLOCKTYPE BlockY1 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ);
+		BLOCKTYPE BlockY2 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 2, a_BlockZ);
+
+		if ((BlockY1 != E_BLOCK_SOULSAND) || (BlockY2 != E_BLOCK_SOULSAND))
+		{
+			return false;
+		}
+		
+		a_World->DoWithMobHeadAt(a_BlockX - 1, a_BlockY, a_BlockZ, CallbackA);
+		a_World->DoWithMobHeadAt(a_BlockX + 1, a_BlockY, a_BlockZ, CallbackB);
+
+		BLOCKTYPE Block1 = a_ChunkInterface.GetBlock(a_BlockX - 1, a_BlockY - 1, a_BlockZ);
+		BLOCKTYPE Block2 = a_ChunkInterface.GetBlock(a_BlockX + 1, a_BlockY - 1, a_BlockZ);
+
+		if ((Block1 == E_BLOCK_SOULSAND) && (Block2 == E_BLOCK_SOULSAND) && CallbackA.IsWither() && CallbackB.IsWither())
+		{
+			a_ChunkInterface.FastSetBlock(a_BlockX,     a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+			a_ChunkInterface.FastSetBlock(a_BlockX + 1, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+			a_ChunkInterface.FastSetBlock(a_BlockX - 1, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+			a_ChunkInterface.FastSetBlock(a_BlockX,     a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0);
+
+			// Block entities
+			a_World->SetBlock(a_BlockX + 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+			a_World->SetBlock(a_BlockX,     a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+			a_World->SetBlock(a_BlockX - 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+
+			// Spawn the wither:
+			a_World->SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither);
+
+			return true;
+		}
+
+		CallbackA.Reset();
+		CallbackB.Reset();
+		
+		a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ - 1, CallbackA);
+		a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ + 1, CallbackB);
+
+		Block1 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ - 1);
+		Block2 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1);
+
+		if ((Block1 == E_BLOCK_SOULSAND) && (Block2 == E_BLOCK_SOULSAND) && CallbackA.IsWither() && CallbackB.IsWither())
+		{
+			a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ,     E_BLOCK_AIR, 0);
+			a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1, E_BLOCK_AIR, 0);
+			a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ - 1, E_BLOCK_AIR, 0);
+			a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ,     E_BLOCK_AIR, 0);
+
+			// Block entities
+			a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ + 1, E_BLOCK_AIR, 0);
+			a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ,     E_BLOCK_AIR, 0);
+			a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ - 1, E_BLOCK_AIR, 0);
+
+			// Spawn the wither:
+			a_World->SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither);
+
+			return true;
+		}
+
+		return false;
+	}
 	
 	virtual void OnPlacedByPlayer(
 		cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, 
@@ -50,18 +147,37 @@ public:
 			}
 		
 		public:
-			cCallback (cPlayer * a_Player, NIBBLETYPE a_OldBlockMeta, NIBBLETYPE a_NewBlockMeta) :
-				m_Player(a_Player),
+			cCallback (cPlayer * a_CBPlayer, NIBBLETYPE a_OldBlockMeta, NIBBLETYPE a_NewBlockMeta) :
+				m_Player(a_CBPlayer),
 				m_OldBlockMeta(a_OldBlockMeta),
 				m_NewBlockMeta(a_NewBlockMeta)
 			{}
 		};
 		cCallback Callback(a_Player, a_BlockMeta, static_cast<NIBBLETYPE>(a_BlockFace));
 		
-		a_BlockMeta = a_BlockFace;
+		a_BlockMeta = (NIBBLETYPE)a_BlockFace;
 		cWorld * World = (cWorld *) &a_WorldInterface;
 		World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ, Callback);
 		a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, a_BlockMeta);
+
+		if (a_BlockMeta == SKULL_TYPE_WITHER)
+		{
+			static const Vector3i Coords[] =
+			{
+				Vector3i( 0, 0,  0),
+				Vector3i( 1, 0,  0),
+				Vector3i(-1, 0,  0),
+				Vector3i( 0, 0,  1),
+				Vector3i( 0, 0, -1),
+			};
+			for (size_t i = 0; i < ARRAYCOUNT(Coords); ++i)
+			{
+				if (TrySpawnWither(a_ChunkInterface, World, a_BlockX + Coords[i].x, a_BlockY, a_BlockZ + Coords[i].z))
+				{
+					break;
+				}
+			}  // for i - Coords[]
+		}
 	}
 } ;
 
diff --git a/src/Blocks/BlockMushroom.h b/src/Blocks/BlockMushroom.h
index 623cfda64..135d418d7 100644
--- a/src/Blocks/BlockMushroom.h
+++ b/src/Blocks/BlockMushroom.h
@@ -17,6 +17,9 @@ public:
 	}
 
 
+	// TODO: Add Mushroom Spread
+
+
 	virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
 	{
 		// Reset meta to 0
@@ -39,6 +42,7 @@ public:
 			case E_BLOCK_CACTUS:
 			case E_BLOCK_ICE:
 			case E_BLOCK_LEAVES:
+			case E_BLOCK_NEW_LEAVES:
 			case E_BLOCK_AIR:
 			{
 				return false;
diff --git a/src/Blocks/BlockMycelium.h b/src/Blocks/BlockMycelium.h
index 7f897c72a..2a8ef5fca 100644
--- a/src/Blocks/BlockMycelium.h
+++ b/src/Blocks/BlockMycelium.h
@@ -16,6 +16,8 @@ public:
 	{
 	}
 
+	// TODO: Add Mycel Spread
+
 	virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
 	{
 		a_Pickups.push_back(cItem(E_BLOCK_DIRT, 1, 0));
diff --git a/src/Blocks/BlockNetherWart.h b/src/Blocks/BlockNetherWart.h
index 923180e19..812cf906f 100644
--- a/src/Blocks/BlockNetherWart.h
+++ b/src/Blocks/BlockNetherWart.h
@@ -2,14 +2,13 @@
 #pragma once
 
 #include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
 #include "../World.h"
 
 
 
 
 
-/// Common class that takes care of carrots, potatoes and wheat
 class cBlockNetherWartHandler :
 	public cBlockHandler
 {
@@ -22,12 +21,12 @@ public:
 	
 	virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_Meta) override
 	{
-		MTRand rand;
+		cFastRandom rand;
 
 		if (a_Meta == 0x7)
 		{
-			// Is fully grown, drop the entire produce:
-			a_Pickups.push_back(cItem(E_ITEM_NETHER_WART, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0));
+			// Fully grown, drop the entire produce:
+			a_Pickups.push_back(cItem(E_ITEM_NETHER_WART, (char)(1 + (rand.NextInt(3) + rand.NextInt(3))) / 2, 0));
 		}
 		else
 		{
@@ -35,18 +34,20 @@ public:
 		}
 	}
 
+
 	virtual void OnUpdate(cChunkInterface & cChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_PluginInterface, cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) override
 	{
-		NIBBLETYPE Meta     = a_Chunk.GetMeta      (a_RelX, a_RelY, a_RelZ);
-
+		NIBBLETYPE Meta = a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ);
 		if (Meta < 7)
 		{
 			a_Chunk.FastSetBlock(a_RelX, a_RelY, a_RelZ, E_BLOCK_NETHER_WART, ++Meta);
 		}
 	}
+	
 
 	virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override
 	{
+		// Needs to be placed on top of a Soulsand block:
 		return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) == E_BLOCK_SOULSAND));
 	}
 } ;
diff --git a/src/Blocks/BlockPluginInterface.h b/src/Blocks/BlockPluginInterface.h
index 7428c9a7a..3a36c40b1 100644
--- a/src/Blocks/BlockPluginInterface.h
+++ b/src/Blocks/BlockPluginInterface.h
@@ -1,8 +1,14 @@
 
 #pragma once
 
+/** This interface is used to decouple block handlers from the cPluginManager dependancy through cWorld.
+The block handlers call this interface, which is then implemented by the specific classes that
+the caller provides.
+*/
 class cBlockPluginInterface
 {
 public:
+	virtual ~cBlockPluginInterface() {}
+	
 	virtual bool CallHookBlockToPickups(cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) = 0;
 };
diff --git a/src/Blocks/BlockPumpkin.h b/src/Blocks/BlockPumpkin.h
index 349f52605..ac2b9817a 100644
--- a/src/Blocks/BlockPumpkin.h
+++ b/src/Blocks/BlockPumpkin.h
@@ -1,16 +1,16 @@
 #pragma once
 
 #include "BlockHandler.h"
-
+#include "MetaRotator.h"
 
 
 
 class cBlockPumpkinHandler :
-	public cBlockHandler
+	public cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false>
 {
 public:
 	cBlockPumpkinHandler(BLOCKTYPE a_BlockType)
-		: cBlockHandler(a_BlockType)
+		: cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false>(a_BlockType)
 	{
 	}
 	
diff --git a/src/Blocks/BlockRail.h b/src/Blocks/BlockRail.h
index 07e9814cd..ad78d290a 100644
--- a/src/Blocks/BlockRail.h
+++ b/src/Blocks/BlockRail.h
@@ -431,9 +431,145 @@ public:
 				}
 				break;
 			}
+			default: break;
 		}
 		return true;
 	}
+
+
+	virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
+	{
+		// Bit 0x08 is a flag when a_Meta is in the range 0x00--0x05 and 0x0A--0x0F.
+		// Bit 0x08 specifies direction when a_Meta is in the range 0x06-0x09.
+		if ((a_Meta < 0x06) || (a_Meta > 0x09))
+		{
+			//  Save powered rail flag.
+			NIBBLETYPE OtherMeta = a_Meta & 0x08;
+			// Rotates according to table; 0x07 == 0111.
+			// Rails can either be flat (North/South) or Ascending (Asc. East)
+			switch (a_Meta & 0x07)
+			{
+				case 0x00: return 0x01 + OtherMeta;  // North/South -> East/West
+				case 0x01: return 0x00 + OtherMeta;  // East/West   -> North/South
+
+				case 0x02: return 0x04 + OtherMeta;  // Asc. East   -> Asc. North
+				case 0x04: return 0x03 + OtherMeta;  // Asc. North  -> Asc. West
+				case 0x03: return 0x05 + OtherMeta;  // Asc. West   -> Asc. South
+				case 0x05: return 0x02 + OtherMeta;  // Asc. South  -> Asc. East
+			}
+		}
+		else
+		{
+			switch (a_Meta)
+			{
+				// Corner Directions
+				case 0x06: return 0x09;  // Northwest Cnr. -> Southwest Cnr.
+				case 0x07: return 0x06;  // Northeast Cnr. -> Northwest Cnr.
+				case 0x08: return 0x07;  // Southeast Cnr. -> Northeast Cnr.
+				case 0x09: return 0x08;  // Southwest Cnr. -> Southeast Cnr.
+			}
+		}
+		// To avoid a compiler warning;
+		return a_Meta;
+	}
+
+
+	virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
+	{
+		// Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09.
+		if ((a_Meta < 0x06) || (a_Meta > 0x09))
+		{
+			//  Save powered rail flag.
+			NIBBLETYPE OtherMeta = a_Meta & 0x08;
+			// Rotates according to table; 0x07 == 0111.
+			// Rails can either be flat (North/South) or Ascending (Asc. East)
+			switch (a_Meta & 0x07)
+			{
+				case 0x00: return 0x01 + OtherMeta;  // North/South -> East/West
+				case 0x01: return 0x00 + OtherMeta;  // East/West   -> North/South
+
+				case 0x02: return 0x05 + OtherMeta;  // Asc. East   -> Asc. South
+				case 0x05: return 0x03 + OtherMeta;  // Asc. South  -> Asc. West
+				case 0x03: return 0x04 + OtherMeta;  // Asc. West   -> Asc. North
+				case 0x04: return 0x02 + OtherMeta;  // Asc. North  -> Asc. East
+			}
+		}
+		else
+		{
+			switch (a_Meta)
+			{
+				// Corner Directions
+				case 0x06: return 0x07;  // Northwest Cnr. -> Northeast Cnr.
+				case 0x07: return 0x08;  // Northeast Cnr. -> Southeast Cnr.
+				case 0x08: return 0x09;  // Southeast Cnr. -> Southwest Cnr.
+				case 0x09: return 0x06;  // Southwest Cnr. -> Northwest Cnr.
+			}
+		}
+		// To avoid a compiler warning;
+		return a_Meta;
+	}
+
+
+	virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
+	{
+		// Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09.
+		if ((a_Meta < 0x06) || (a_Meta > 0x09))
+		{
+			//  Save powered rail flag.
+			NIBBLETYPE OtherMeta = a_Meta & 0x08;
+			// Mirrors according to table; 0x07 == 0111.
+			// Rails can either be flat (North/South) or Ascending (Asc. East)
+			switch (a_Meta & 0x07)
+			{
+				case 0x05: return 0x04 + OtherMeta;  // Asc. South  -> Asc. North
+				case 0x04: return 0x05 + OtherMeta;  // Asc. North  -> Asc. South
+			}
+		}
+		else
+		{
+			switch (a_Meta)
+			{
+				// Corner Directions
+				case 0x06: return 0x09;  // Northwest Cnr. -> Southwest Cnr.
+				case 0x07: return 0x08;  // Northeast Cnr. -> Southeast Cnr.
+				case 0x08: return 0x07;  // Southeast Cnr. -> Northeast Cnr.
+				case 0x09: return 0x06;  // Southwest Cnr. -> Northwest Cnr.
+			}
+		}
+		// To avoid a compiler warning;
+		return a_Meta;
+	}
+
+
+	virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
+	{
+		// Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09.
+		if ((a_Meta < 0x06) || (a_Meta > 0x09))
+		{
+			//  Save powered rail flag.
+			NIBBLETYPE OtherMeta = a_Meta & 0x08;
+			// Mirrors according to table; 0x07 == 0111.
+			// Rails can either be flat (North/South) or Ascending (Asc. East)
+			switch (a_Meta & 0x07)
+			{
+				case 0x02: return 0x03 + OtherMeta;  // Asc. East   -> Asc. West
+				case 0x03: return 0x02 + OtherMeta;  // Asc. West   -> Asc. East
+			}
+		}
+		else
+		{
+			switch (a_Meta)
+			{
+				// Corner Directions
+				case 0x06: return 0x07;  // Northwest Cnr. -> Northeast Cnr.
+				case 0x07: return 0x06;  // Northeast Cnr. -> Northwest Cnr.
+				case 0x08: return 0x09;  // Southeast Cnr. -> Southwest Cnr.
+				case 0x09: return 0x08;  // Southwest Cnr. -> Southeast Cnr.
+			}
+		}
+		// To avoid a compiler warning;
+		return a_Meta;
+	}
 } ;
 
 
diff --git a/src/Blocks/BlockRedstoneRepeater.h b/src/Blocks/BlockRedstoneRepeater.h
index 1e2a86949..fe6cd21b9 100644
--- a/src/Blocks/BlockRedstoneRepeater.h
+++ b/src/Blocks/BlockRedstoneRepeater.h
@@ -3,17 +3,17 @@
 
 #include "BlockHandler.h"
 #include "Chunk.h"
-
+#include "MetaRotator.h"
 
 
 
 
 class cBlockRedstoneRepeaterHandler :
-	public cBlockHandler
+	public cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>
 {
 public:
 	cBlockRedstoneRepeaterHandler(BLOCKTYPE a_BlockType)
-		: cBlockHandler(a_BlockType)
+		: cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType)
 	{
 	}
 
diff --git a/src/Blocks/BlockSideways.h b/src/Blocks/BlockSideways.h
index 69c0a7230..d67c3aa24 100644
--- a/src/Blocks/BlockSideways.h
+++ b/src/Blocks/BlockSideways.h
@@ -29,7 +29,13 @@ public:
 		return true;
 	}
 
-	
+
+	virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
+	{
+		a_Pickups.Add(m_BlockType, 1, a_BlockMeta & 0x3);
+	}
+
+
 	inline static NIBBLETYPE BlockFaceToMetaData(eBlockFace a_BlockFace, NIBBLETYPE a_WoodMeta)
 	{
 		switch (a_BlockFace)
diff --git a/src/Blocks/BlockSign.h b/src/Blocks/BlockSign.h
index cd0c02a40..6c0becfd6 100644
--- a/src/Blocks/BlockSign.h
+++ b/src/Blocks/BlockSign.h
@@ -71,6 +71,37 @@ public:
 	{
 		a_Player->GetClientHandle()->SendEditSign(a_BlockX, a_BlockY, a_BlockZ);
 	}
+
+
+	virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
+	{
+		return (++a_Meta) & 0x0F;
+	}
+
+
+	virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
+	{
+		return (--a_Meta) & 0x0F;
+	}
+
+	virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
+	{
+		//  Mirrors signs over the XY plane (North-South Mirroring)
+
+		//  There are 16 meta values which correspond to different directions.
+		//  These values are equated to angles on a circle; 0x08 = 180 degrees.
+		return (a_Meta < 0x08) ? 0x08 + a_Meta : 0x08 - a_Meta;
+	}
+
+
+	virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
+	{
+		//  Mirrors signs over the YZ plane (East-West Mirroring)
+
+		//  There are 16 meta values which correspond to different directions.
+		//  These values are equated to angles on a circle; 0x10 = 360 degrees.
+		return 0x10 - a_Meta;
+	}
 } ;
 
 
diff --git a/src/Blocks/BlockSlab.h b/src/Blocks/BlockSlab.h
index 7cd2c97b2..4f94d45f6 100644
--- a/src/Blocks/BlockSlab.h
+++ b/src/Blocks/BlockSlab.h
@@ -14,8 +14,6 @@
 
 
 
-
-
 class cBlockSlabHandler :
 	public cBlockHandler
 {
@@ -105,6 +103,7 @@ public:
 					a_BlockMeta = Meta & 0x7; break;
 				}
 			}
+			case BLOCK_FACE_NONE: return false;
 		}  // switch (a_BlockFace)
 		return true;
 	}
@@ -184,6 +183,15 @@ public:
 		ASSERT(!"Unhandled double slab type!");
 		return "";
 	}
+
+
+	virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override
+	{
+		NIBBLETYPE OtherMeta = a_Meta & 0x07;  // Contains unrelated meta data.
+
+		// 8th bit is up/down.  1 right-side-up, 0 is up-side-down.
+		return (a_Meta & 0x08) ? 0x00 + OtherMeta : 0x01 + OtherMeta;
+	}
 } ;
 
 
diff --git a/src/Blocks/BlockStairs.h b/src/Blocks/BlockStairs.h
index ea8405597..09ff254a6 100644
--- a/src/Blocks/BlockStairs.h
+++ b/src/Blocks/BlockStairs.h
@@ -2,17 +2,17 @@
 #pragma once
 
 #include "BlockHandler.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 
 
 
 
 class cBlockStairsHandler :
-	public cMetaRotater<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>
+	public cMetaRotator<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>
 {
 public:
 	cBlockStairsHandler(BLOCKTYPE a_BlockType) :
-		cMetaRotater<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>(a_BlockType)
+		cMetaRotator<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>(a_BlockType)
 	{
 
 	}
@@ -30,9 +30,7 @@ public:
 		UNUSED(a_BlockY);
 		UNUSED(a_BlockZ);
 		UNUSED(a_CursorX);
-		UNUSED(a_CursorY);
 		UNUSED(a_CursorZ);
-		UNUSED(a_BlockMeta);
 		a_BlockType = m_BlockType;
 		a_BlockMeta = RotationToMetaData(a_Player->GetYaw());
 		switch (a_BlockFace)
@@ -51,10 +49,12 @@ public:
 				}
 				break;
 			}
+			case BLOCK_FACE_NONE: return false;
 		}
 		return true;
 	}
 	
+	
 	virtual const char * GetStepSound(void) override
 	{
 		if (
diff --git a/src/Blocks/BlockStems.h b/src/Blocks/BlockStems.h
index 705436345..b726a0901 100644
--- a/src/Blocks/BlockStems.h
+++ b/src/Blocks/BlockStems.h
@@ -17,9 +17,10 @@ public:
 	{
 	}
 
+
 	virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
 	{
-		int ItemType = (m_BlockType == E_BLOCK_MELON_STEM) ? E_ITEM_MELON_SEEDS : E_ITEM_PUMPKIN_SEEDS;
+		short ItemType = (m_BlockType == E_BLOCK_MELON_STEM) ? E_ITEM_MELON_SEEDS : E_ITEM_PUMPKIN_SEEDS;
 		a_Pickups.push_back(cItem(ItemType, 1, 0));
 	}
 
diff --git a/src/Blocks/BlockTorch.h b/src/Blocks/BlockTorch.h
index d32c77629..8ddec8de1 100644
--- a/src/Blocks/BlockTorch.h
+++ b/src/Blocks/BlockTorch.h
@@ -2,17 +2,17 @@
 
 #include "BlockHandler.h"
 #include "../Chunk.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 
 
 
 
 class cBlockTorchHandler :
-	public cMetaRotater<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>
+	public cMetaRotator<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>
 {
 public:
 	cBlockTorchHandler(BLOCKTYPE a_BlockType)
-		: cMetaRotater<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>(a_BlockType)
+		: cMetaRotator<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>(a_BlockType)
 	{
 	}
 	
diff --git a/src/Blocks/BlockTrapdoor.h b/src/Blocks/BlockTrapdoor.h
index 9bae92c4d..6a36ab874 100644
--- a/src/Blocks/BlockTrapdoor.h
+++ b/src/Blocks/BlockTrapdoor.h
@@ -2,17 +2,17 @@
 #pragma once
 
 #include "BlockHandler.h"
-
+#include "MetaRotator.h"
 
 
 
 
 class cBlockTrapdoorHandler :
-	public cBlockHandler
+	public cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x00, 0x03, false>
 {
 public:
 	cBlockTrapdoorHandler(BLOCKTYPE a_BlockType)
-		: cBlockHandler(a_BlockType)
+		: cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x00, 0x03, false>(a_BlockType)
 	{
 	}
 
diff --git a/src/Blocks/BlockVine.h b/src/Blocks/BlockVine.h
index 708583e70..7bb9dc484 100644
--- a/src/Blocks/BlockVine.h
+++ b/src/Blocks/BlockVine.h
@@ -1,7 +1,7 @@
 #pragma once
 
 #include "BlockHandler.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
 
 
 
@@ -73,7 +73,7 @@ public:
 	/// Returns true if the specified block type is good for vines to attach to
 	static bool IsBlockAttachable(BLOCKTYPE a_BlockType)
 	{
-		return (a_BlockType == E_BLOCK_LEAVES) || cBlockInfo::IsSolid(a_BlockType);
+		return (a_BlockType == E_BLOCK_LEAVES) || (a_BlockType == E_BLOCK_NEW_LEAVES) || cBlockInfo::IsSolid(a_BlockType);
 	}
 
 
@@ -83,7 +83,7 @@ public:
 		static const struct
 		{
 			int x, z;
-			int Bit;
+			NIBBLETYPE Bit;
 		} Coords[] =
 		{
 			{ 0,  1, 1},  // south, ZP
@@ -91,7 +91,7 @@ public:
 			{ 0, -1, 4},  // north, ZM
 			{ 1,  0, 8},  // east,  XP
 		} ;
-		int res = 0;
+		NIBBLETYPE res = 0;
 		for (size_t i = 0; i < ARRAYCOUNT(Coords); i++)
 		{
 			BLOCKTYPE  BlockType;
@@ -175,7 +175,10 @@ public:
 		a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY - 1, a_RelZ, Block);
 		if (Block == E_BLOCK_AIR)
 		{
-			a_Chunk.UnboundedRelSetBlock(a_RelX, a_RelY - 1, a_RelZ, E_BLOCK_VINES, a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ));
+			if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, a_RelX * cChunkDef::Width, a_RelY - 1, a_RelZ * cChunkDef::Width, ssVineSpread))
+			{
+				a_Chunk.UnboundedRelSetBlock(a_RelX, a_RelY - 1, a_RelZ, E_BLOCK_VINES, a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ));
+			}
 		}
 	}
 	
@@ -194,14 +197,14 @@ public:
 	virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
 	{
 		// Bits 2 and 4 stay, bits 1 and 3 swap
-		return ((a_Meta & 0x0a) | ((a_Meta & 0x01) << 2) | ((a_Meta & 0x04) >> 2));
+		return (NIBBLETYPE)((a_Meta & 0x0a) | ((a_Meta & 0x01) << 2) | ((a_Meta & 0x04) >> 2));
 	}
 
 
 	virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
 	{
 		// Bits 1 and 3 stay, bits 2 and 4 swap
-		return ((a_Meta & 0x05) | ((a_Meta & 0x02) << 2) | ((a_Meta & 0x08) >> 2));
+		return (NIBBLETYPE)((a_Meta & 0x05) | ((a_Meta & 0x02) << 2) | ((a_Meta & 0x08) >> 2));
 	}
 
 } ;
diff --git a/src/Blocks/BroadcastInterface.h b/src/Blocks/BroadcastInterface.h
index f6ccd580b..b1b450690 100644
--- a/src/Blocks/BroadcastInterface.h
+++ b/src/Blocks/BroadcastInterface.h
@@ -4,7 +4,9 @@
 class cBroadcastInterface 
 {
 public:
-
-	virtual void BroadcastUseBed(const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ ) = 0;
-	virtual void BroadcastSoundEffect        (const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL) = 0; 
+	virtual ~cBroadcastInterface() {}
+	
+	virtual void BroadcastUseBed     (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ ) = 0;
+	virtual void BroadcastSoundEffect(const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL) = 0;
+	virtual void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) = 0;
 };
diff --git a/src/Blocks/MetaRotater.h b/src/Blocks/MetaRotator.h
index dde88e6db..899c583e1 100644
--- a/src/Blocks/MetaRotater.h
+++ b/src/Blocks/MetaRotator.h
@@ -1,4 +1,4 @@
-// MetaRotater.h
+// MetaRotator.h
 
 // Provides a mixin for rotations and reflections
 
@@ -21,15 +21,15 @@ Inherit from this class providing your base class as Base, the BitMask for the d
 */
 
 template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched = false>
-class cMetaRotater : public Base
+class cMetaRotator : public Base
 {
 public:
 
-	cMetaRotater(BLOCKTYPE a_BlockType) :
+	cMetaRotator(BLOCKTYPE a_BlockType) :
 		Base(a_BlockType)
 	{}
 	
-	virtual ~cMetaRotater() {}
+	virtual ~cMetaRotator() {}
 
 	virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta)  override;
 	virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta)  override;
@@ -42,7 +42,7 @@ public:
 
 
 template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
-NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCW(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCW(NIBBLETYPE a_Meta)
 {
 	NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
 	switch (a_Meta & BitMask)
@@ -64,7 +64,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc
 
 
 template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
-NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCCW(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCCW(NIBBLETYPE a_Meta)
 {
 	NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
 	switch (a_Meta & BitMask)
@@ -86,7 +86,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc
 
 
 template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
-NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorXY(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorXY(NIBBLETYPE a_Meta)
 {
 	NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
 	switch (a_Meta & BitMask)
@@ -103,7 +103,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc
 
 
 template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
-NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorYZ(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorYZ(NIBBLETYPE a_Meta)
 {
 	NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
 	switch (a_Meta & BitMask)
diff --git a/src/Blocks/WorldInterface.h b/src/Blocks/WorldInterface.h
index e59b00eff..bfbb053d9 100644
--- a/src/Blocks/WorldInterface.h
+++ b/src/Blocks/WorldInterface.h
@@ -9,7 +9,8 @@ class cItems;
 class cWorldInterface
 {
 public:
-
+	virtual ~cWorldInterface() {}
+	
 	virtual Int64 GetTimeOfDay(void) const = 0;
 	virtual Int64 GetWorldAge(void)  const = 0;
 	
@@ -27,7 +28,13 @@ public:
 	
 	/** Spawns a mob of the specified type. Returns the mob's EntityID if recognized and spawned, <0 otherwise */
 	virtual int SpawnMob(double a_PosX, double a_PosY, double a_PosZ, cMonster::eType a_MonsterType) = 0;
-	
+
 	/** Sends the block on those coords to the player */
 	virtual void SendBlockTo(int a_BlockX, int a_BlockY, int a_BlockZ, cPlayer * a_Player) = 0;
+
+	/** Calls the callback for each player in the list; returns true if all players processed, false if the callback aborted by returning true */
+	virtual bool ForEachPlayer(cItemCallback<cPlayer> & a_Callback) = 0;
+
+	virtual void SetTimeOfDay(Int64 a_TimeOfDay) = 0;
+
 };
diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt
index 0f8700692..30e9dbfd4 100644
--- a/src/CMakeLists.txt
+++ b/src/CMakeLists.txt
@@ -6,16 +6,17 @@ include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/jsoncpp/include")
 include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/polarssl/include")
 
 set(FOLDERS OSSupport HTTPServer Items Blocks Protocol Generating) 
-set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities)
+set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities Generating/Prefabs)
 
 
 if (NOT MSVC)
 
-	#Bindings needs to reference other folders so are done here
+	# Bindings need to reference other folders, so they are done here instead
 	
-	#lib dependecies are not included
+	# lib dependencies are not included
 	
 	set(BINDING_DEPENDECIES
+		tolua
 		${CMAKE_CURRENT_SOURCE_DIR}/Bindings/virtual_method_hooks.lua
 		${CMAKE_CURRENT_SOURCE_DIR}/Bindings/AllToLua.pkg
 		Bindings/LuaFunctions.h
@@ -57,6 +58,9 @@ if (NOT MSVC)
 		Entities/Player.h
 		Entities/ProjectileEntity.h
 		Entities/TNTEntity.h
+		Entities/ExpOrb.h
+		Entities/HangingEntity.h
+		Entities/ItemFrame.h
 		Generating/ChunkDesc.h
 		Group.h
 		Inventory.h
@@ -100,7 +104,6 @@ if (NOT MSVC)
 		Bindings/PluginLua
 		Bindings/PluginManager
 		Bindings/WebPlugin
-		Bindings/WebPlugin
 	)
 
 	target_link_libraries(Bindings lua sqlite tolualib)
@@ -134,6 +137,7 @@ if (NOT MSVC)
 
 
 else ()
+	# MSVC-specific handling: Put all files into one project, separate by the folders:
 
 	# Generate the Bindings if they don't exist:
 	if (NOT EXISTS "${PROJECT_SOURCE_DIR}/Bindings/Bindings.cpp")
@@ -145,6 +149,14 @@ else ()
 		)
 	endif()
 
+	# Get all files in this folder:
+	file(GLOB_RECURSE SOURCE
+		"*.cpp"
+		"*.h"
+		"*.pkg"
+	)
+	source_group("" FILES ${SOURCE})
+
 	# Add all subfolders as solution-folders:
 	list(APPEND FOLDERS "Resources")
 	list(APPEND FOLDERS "Bindings")
@@ -155,23 +167,16 @@ else ()
 			"${PATH}/*.rc"
 			"${PATH}/*.pkg"
 		)
-		source_group("${PATH}" FILES ${FOLDER_FILES})
+		string(REPLACE "/" "\\" PROJECT_PATH ${PATH})
+		source_group("${PROJECT_PATH}" FILES ${FOLDER_FILES})
 	endfunction(includefolder)
 
 	foreach(folder ${FOLDERS})
 		includefolder(${folder})
 	endforeach(folder)
 
-	file(GLOB_RECURSE SOURCE
-		"*.cpp"
-		"*.h"
-		"*.pkg"
-	)
-
 	include_directories("${PROJECT_SOURCE_DIR}")
 
-	source_group("" FILES ${SOURCE})
-
 	# Precompiled headers (1st part)
 	SET_SOURCE_FILES_PROPERTIES(
 		Globals.cpp PROPERTIES COMPILE_FLAGS "/Yc\"Globals.h\""
@@ -227,7 +232,7 @@ endif ()
 
 if (NOT MSVC)
 	target_link_libraries(${EXECUTABLE} OSSupport HTTPServer Bindings Items Blocks)
-	target_link_libraries(${EXECUTABLE} Protocol Generating WorldStorage)
+	target_link_libraries(${EXECUTABLE} Protocol Generating Generating_Prefabs WorldStorage)
 	target_link_libraries(${EXECUTABLE} Mobs Entities Simulator UI BlockEntities)
 endif ()
 if (WIN32)
diff --git a/src/Chunk.cpp b/src/Chunk.cpp
index 957d7d575..22b33c595 100644
--- a/src/Chunk.cpp
+++ b/src/Chunk.cpp
@@ -884,7 +884,7 @@ void cChunk::ApplyWeatherToTop()
 					FastSetBlock(X, Height, Z, E_BLOCK_SNOW, TopMeta - 1);
 				}
 			}
-			else if (cBlockInfo::IsSnowable(TopBlock))
+			else if (cBlockInfo::IsSnowable(TopBlock) && (Height + 1 < cChunkDef::Height))
 			{
 				SetBlock(X, Height + 1, Z, E_BLOCK_SNOW, 0);
 			}
@@ -2510,6 +2510,17 @@ cChunk * cChunk::GetNeighborChunk(int a_BlockX, int a_BlockZ)
 
 cChunk * cChunk::GetRelNeighborChunk(int a_RelX, int a_RelZ)
 {
+	// If the relative coords are too far away, use the parent's chunk lookup instead:
+	if ((a_RelX < 128) || (a_RelX > 128) || (a_RelZ < -128) || (a_RelZ > 128))
+	{
+		int BlockX = m_PosX * cChunkDef::Width + a_RelX;
+		int BlockZ = m_PosZ * cChunkDef::Width + a_RelZ;
+		int BlockY, ChunkX, ChunkZ;
+		AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ);
+		return m_ChunkMap->GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ);
+	}
+
+	// Walk the neighbors:
 	bool ReturnThis = true;
 	if (a_RelX < 0)
 	{
diff --git a/src/ChunkMap.cpp b/src/ChunkMap.cpp
index 40964c654..e695f0ab2 100644
--- a/src/ChunkMap.cpp
+++ b/src/ChunkMap.cpp
@@ -1376,8 +1376,9 @@ void cChunkMap::ReplaceTreeBlocks(const sSetBlockVector & a_Blocks)
 				break;
 			}
 			case E_BLOCK_LEAVES:
+			case E_BLOCK_NEW_LEAVES:
 			{
-				if (itr->BlockType == E_BLOCK_LOG)
+				if ((itr->BlockType == E_BLOCK_LOG) || (itr->BlockType == E_BLOCK_NEW_LOG))
 				{
 					Chunk->SetBlock(itr->x, itr->y, itr->z, itr->BlockType, itr->BlockMeta);
 				}
@@ -1784,57 +1785,73 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
 					BLOCKTYPE Block = area.GetBlockType(bx + x, by + y, bz + z);
 					switch (Block)
 					{
-					case E_BLOCK_TNT:
-					{
-						// Activate the TNT, with a random fuse between 10 to 30 game ticks
-						double FuseTime = (double)(10 + m_World->GetTickRandomNumber(20)) / 20;
-						m_World->SpawnPrimedTNT(a_BlockX + x + 0.5, a_BlockY + y + 0.5, a_BlockZ + z + 0.5, FuseTime);
-						area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_AIR);
-						a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
-						break;
-					}
-					case E_BLOCK_OBSIDIAN:
-					case E_BLOCK_BEDROCK:
-					case E_BLOCK_WATER:
-					case E_BLOCK_LAVA:
-					{
-						// These blocks are not affected by explosions
-						break;
-					}
-
-					case E_BLOCK_STATIONARY_WATER:
-					{
-						// Turn into simulated water:
-						area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_WATER);
-						break;
-					}
+						case E_BLOCK_TNT:
+						{
+							// Activate the TNT, with a random fuse between 10 to 30 game ticks
+							int FuseTime = 10 + m_World->GetTickRandomNumber(20);
+							m_World->SpawnPrimedTNT(a_BlockX + x + 0.5, a_BlockY + y + 0.5, a_BlockZ + z + 0.5, FuseTime);
+							area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_AIR);
+							a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
+							break;
+						}
+						
+						case E_BLOCK_OBSIDIAN:
+						case E_BLOCK_BEDROCK:
+						case E_BLOCK_WATER:
+						case E_BLOCK_LAVA:
+						{
+							// These blocks are not affected by explosions
+							break;
+						}
 
-					case E_BLOCK_STATIONARY_LAVA:
-					{
-						// Turn into simulated lava:
-						area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_LAVA);
-						break;
-					}
+						case E_BLOCK_STATIONARY_WATER:
+						{
+							// Turn into simulated water:
+							area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_WATER);
+							break;
+						}
 
-					case E_BLOCK_AIR:
-					{
-						// No pickups for air
-						break;
-					}
+						case E_BLOCK_STATIONARY_LAVA:
+						{
+							// Turn into simulated lava:
+							area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_LAVA);
+							break;
+						}
 
-					default:
-					{
-						if (m_World->GetTickRandomNumber(100) <= 25) // 25% chance of pickups
+						case E_BLOCK_AIR:
 						{
-							cItems Drops;
-							cBlockHandler * Handler = BlockHandler(Block);
+							// No pickups for air
+							break;
+						}
 
-							Handler->ConvertToPickups(Drops, area.GetBlockMeta(bx + x, by + y, bz + z)); // Stone becomes cobblestone, coal ore becomes coal, etc.
-							m_World->SpawnItemPickups(Drops, bx + x, by + y, bz + z);
+						default:
+						{
+							if (m_World->GetTickRandomNumber(100) <= 25) // 25% chance of pickups
+							{
+								cItems Drops;
+								cBlockHandler * Handler = BlockHandler(Block);
+
+								Handler->ConvertToPickups(Drops, area.GetBlockMeta(bx + x, by + y, bz + z)); // Stone becomes cobblestone, coal ore becomes coal, etc.
+								m_World->SpawnItemPickups(Drops, bx + x, by + y, bz + z);
+							}
+							else if ((m_World->GetTNTShrapnelLevel() > slNone) && (m_World->GetTickRandomNumber(100) < 20)) // 20% chance of flinging stuff around
+							{
+								if (!cBlockInfo::FullyOccupiesVoxel(Block))
+								{
+									break;
+								}
+								else if ((m_World->GetTNTShrapnelLevel() == slGravityAffectedOnly) && ((Block != E_BLOCK_SAND) && (Block != E_BLOCK_GRAVEL)))
+								{
+									break;
+								}
+								m_World->SpawnFallingBlock(bx + x, by + y + 5, bz + z, Block, area.GetBlockMeta(bx + x, by + y, bz + z));
+							}
+
+							area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_AIR);
+							a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
+							break;
+							
 						}
-						area.SetBlockType(bx + x, by + y, bz + z, E_BLOCK_AIR);
-						a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z));
-					}
 					}  // switch (BlockType)
 				}  // for z
 			}  // for y
@@ -1846,11 +1863,10 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
 		public cEntityCallback
 	{
 	public:
-		cTNTDamageCallback(cBoundingBox & a_bbTNT, Vector3d a_ExplosionPos, int a_ExplosionSize, int a_ExplosionSizeSq) :
+		cTNTDamageCallback(cBoundingBox & a_bbTNT, Vector3d a_ExplosionPos, int a_ExplosionSize) :
 			m_bbTNT(a_bbTNT),
 			m_ExplosionPos(a_ExplosionPos),
-			m_ExplosionSize(a_ExplosionSize),
-			m_ExplosionSizeSq(a_ExplosionSizeSq)
+			m_ExplosionSize(a_ExplosionSize)
 		{
 		}
 
@@ -1873,14 +1889,16 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
 			}
 			
 			Vector3d AbsoluteEntityPos(abs(EntityPos.x), abs(EntityPos.y), abs(EntityPos.z));
-			Vector3d MaxExplosionBoundary(m_ExplosionSizeSq, m_ExplosionSizeSq, m_ExplosionSizeSq);
 
 			// Work out how far we are from the edge of the TNT's explosive effect
 			AbsoluteEntityPos -= m_ExplosionPos;
-			AbsoluteEntityPos = MaxExplosionBoundary - AbsoluteEntityPos;
 
-			double FinalDamage = ((AbsoluteEntityPos.x + AbsoluteEntityPos.y + AbsoluteEntityPos.z) / 3) * m_ExplosionSize;
-			FinalDamage = a_Entity->GetMaxHealth() - abs(FinalDamage);
+			// All to positive
+			AbsoluteEntityPos.x = abs(AbsoluteEntityPos.x);
+			AbsoluteEntityPos.y = abs(AbsoluteEntityPos.y);
+			AbsoluteEntityPos.z = abs(AbsoluteEntityPos.z);
+
+			double FinalDamage = (((1 / AbsoluteEntityPos.x) + (1 / AbsoluteEntityPos.y) + (1 / AbsoluteEntityPos.z)) * 2) * m_ExplosionSize;
 
 			// Clip damage values
 			if (FinalDamage > a_Entity->GetMaxHealth())
@@ -1888,7 +1906,7 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
 			else if (FinalDamage < 0)
 				FinalDamage = 0;
 
-			if (!a_Entity->IsTNT()) // Don't apply damage to other TNT entities, they should be invincible
+			if (!a_Entity->IsTNT() && !a_Entity->IsFallingBlock()) // Don't apply damage to other TNT entities and falling blocks, they should be invincible
 			{
 				a_Entity->TakeDamage(dtExplosion, NULL, (int)FinalDamage, 0);
 			}
@@ -1898,7 +1916,7 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
 			if (distance_explosion.SqrLength() < 4096.0)
 			{
 				distance_explosion.Normalize();
-				distance_explosion *= m_ExplosionSizeSq;
+				distance_explosion *= m_ExplosionSize * m_ExplosionSize;
 
 				a_Entity->AddSpeed(distance_explosion);
 			}
@@ -1910,14 +1928,13 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_
 		cBoundingBox & m_bbTNT;
 		Vector3d m_ExplosionPos;
 		int m_ExplosionSize;
-		int m_ExplosionSizeSq;
 	};
 
 	cBoundingBox bbTNT(Vector3d(a_BlockX, a_BlockY, a_BlockZ), 0.5, 1);
 	bbTNT.Expand(ExplosionSizeInt * 2, ExplosionSizeInt * 2, ExplosionSizeInt * 2);
 
 
-	cTNTDamageCallback TNTDamageCallback(bbTNT, Vector3d(a_BlockX, a_BlockY, a_BlockZ), ExplosionSizeInt, ExplosionSizeSq);
+	cTNTDamageCallback TNTDamageCallback(bbTNT, Vector3d(a_BlockX, a_BlockY, a_BlockZ), ExplosionSizeInt);
 	ForEachEntity(TNTDamageCallback);
 
 	// Wake up all simulators for the area, so that water and lava flows and sand falls into the blasted holes (FS #391):
diff --git a/src/ClientHandle.cpp b/src/ClientHandle.cpp
index 46c10ae82..5ed5f1085 100644
--- a/src/ClientHandle.cpp
+++ b/src/ClientHandle.cpp
@@ -941,6 +941,8 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
 		}
 		return;
 	}
+
+	m_NumBlockChangeInteractionsThisTick++;
 	
 	if (!CheckBlockInteractionsRate())
 	{
@@ -960,7 +962,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
 		);
 		
 		// Let's send the current world block to the client, so that it can immediately "let the user know" that they haven't placed the block
-		if (a_BlockFace > -1)
+		if (a_BlockFace != BLOCK_FACE_NONE)
 		{
 			AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace);
 			World->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player);
@@ -988,7 +990,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
 	
 	cItemHandler * ItemHandler = cItemHandler::GetItemHandler(Equipped.m_ItemType);
 	
-	if (ItemHandler->IsPlaceable() && (a_BlockFace > -1))
+	if (ItemHandler->IsPlaceable() && (a_BlockFace != BLOCK_FACE_NONE))
 	{
 		HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler);
 	}
@@ -1026,6 +1028,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
 
 void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, cItemHandler & a_ItemHandler)
 {
+	BLOCKTYPE EquippedBlock = (BLOCKTYPE)(m_Player->GetEquippedItem().m_ItemType);
 	if (a_BlockFace < 0)
 	{
 		// Clicked in air
@@ -1036,7 +1039,6 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
 
 	BLOCKTYPE ClickedBlock;
 	NIBBLETYPE ClickedBlockMeta;
-	BLOCKTYPE EquippedBlock = (BLOCKTYPE)(m_Player->GetEquippedItem().m_ItemType);
 	NIBBLETYPE EquippedBlockDamage = (NIBBLETYPE)(m_Player->GetEquippedItem().m_ItemDamage);
 
 	if ((a_BlockY < 0) || (a_BlockY >= cChunkDef::Height))
@@ -1053,8 +1055,8 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
 		cBlockSlabHandler::IsAnySlabType(EquippedBlock) &&              // Is the player placing another slab?
 		((ClickedBlockMeta & 0x07) == EquippedBlockDamage) &&           // Is it the same slab type?
 		(
-			(a_BlockFace == BLOCK_FACE_TOP) ||                            // Clicking the top of a bottom slab
-			(a_BlockFace == BLOCK_FACE_BOTTOM)                            // Clicking the bottom of a top slab
+			(a_BlockFace == BLOCK_FACE_TOP) ||                          // Clicking the top of a bottom slab
+			(a_BlockFace == BLOCK_FACE_BOTTOM)                          // Clicking the bottom of a top slab
 		)
 	)
 	{
@@ -1138,7 +1140,7 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
 	
 	// The actual block placement:
 	World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, BlockType, BlockMeta);
-	if (m_Player->GetGameMode() != gmCreative)
+	if (!m_Player->IsGameModeCreative())
 	{
 		m_Player->GetInventory().RemoveOneEquippedItem();
 	}
@@ -1606,10 +1608,8 @@ void cClientHandle::MoveToWorld(cWorld & a_World, bool a_SendRespawnPacket)
 		m_Protocol->SendUnloadChunk(itr->m_ChunkX, itr->m_ChunkZ);
 	}  // for itr - Chunks[]
 	
-	// Do NOT stream new chunks, the new world runs its own tick thread and may deadlock
-	// Instead, the chunks will be streamed when the client is moved to the new world's Tick list,
-	// by setting state to csAuthenticated
-	m_State = csAuthenticated;
+	// StreamChunks() called in cPlayer::MoveToWorld() after new world has been set
+	// Meanwhile here, we set last streamed values to bogus ones so everything is resent
 	m_LastStreamedChunkX = 0x7fffffff;
 	m_LastStreamedChunkZ = 0x7fffffff;
 	m_HasSentPlayerChunk = false;
diff --git a/src/CompositeChat.cpp b/src/CompositeChat.cpp
index a917ee70f..c70ef1070 100644
--- a/src/CompositeChat.cpp
+++ b/src/CompositeChat.cpp
@@ -112,8 +112,8 @@ cCompositeChat::cCompositeChat(void) :
 
 
 
-cCompositeChat::cCompositeChat(const AString & a_ParseText) :
-	m_MessageType(mtCustom)
+cCompositeChat::cCompositeChat(const AString & a_ParseText, eMessageType a_MessageType) :
+	m_MessageType(a_MessageType)
 {
 	ParseText(a_ParseText);
 }
@@ -314,6 +314,58 @@ void cCompositeChat::UnderlineUrls(void)
 
 
 
+AString cCompositeChat::ExtractText(void) const
+{
+	AString Msg;
+	for (cParts::const_iterator itr = m_Parts.begin(), end = m_Parts.end(); itr != end; ++itr)
+	{
+		switch ((*itr)->m_PartType)
+		{
+			case ptText:
+			case ptClientTranslated:
+			case ptRunCommand:
+			case ptSuggestCommand:
+			{
+				Msg.append((*itr)->m_Text);
+				break;
+			}
+			case ptUrl:
+			{
+				Msg.append(((cUrlPart *)(*itr))->m_Url);
+				break;
+			}
+		}  // switch (PartType)
+	}  // for itr - m_Parts[]
+	return Msg;
+}
+
+
+
+
+
+cMCLogger::eLogLevel cCompositeChat::MessageTypeToLogLevel(eMessageType a_MessageType)
+{
+	switch (a_MessageType)
+	{
+		case mtCustom:         return cMCLogger::llRegular;
+		case mtFailure:        return cMCLogger::llWarning;
+		case mtInformation:    return cMCLogger::llInfo;
+		case mtSuccess:        return cMCLogger::llRegular;
+		case mtWarning:        return cMCLogger::llWarning;
+		case mtFatal:          return cMCLogger::llError;
+		case mtDeath:          return cMCLogger::llRegular;
+		case mtPrivateMessage: return cMCLogger::llRegular;
+		case mtJoin:           return cMCLogger::llRegular;
+		case mtLeave:          return cMCLogger::llRegular;
+	}
+	ASSERT(!"Unhandled MessageType");
+	return cMCLogger::llError;
+}
+
+
+
+
+
 void cCompositeChat::AddStyle(AString & a_Style, const AString & a_AddStyle)
 {
 	if (a_AddStyle.empty())
diff --git a/src/CompositeChat.h b/src/CompositeChat.h
index 27319490d..5b9c5f612 100644
--- a/src/CompositeChat.h
+++ b/src/CompositeChat.h
@@ -117,7 +117,7 @@ public:
 	/** Creates a new chat message and parses the text into parts.
 	Recognizes "http:" and "https:" links and @color-codes.
 	Uses ParseText() for the actual parsing. */
-	cCompositeChat(const AString & a_ParseText);
+	cCompositeChat(const AString & a_ParseText, eMessageType a_MessageType = mtCustom);
 	
 	~cCompositeChat();
 	
@@ -164,10 +164,19 @@ public:
 	/** Returns the message type set previously by SetMessageType(). */
 	eMessageType GetMessageType(void) const { return m_MessageType; }
 	
+	/** Returns the text from the parts that comprises the human-readable data.
+	Used for older protocols that don't support composite chat
+	and for console-logging. */
+	AString ExtractText(void) const;
+	
 	// tolua_end
 	
 	const cParts & GetParts(void) const { return m_Parts; }
 	
+	/** Converts the MessageType to a LogLevel value.
+	Used by the logging bindings when logging a cCompositeChat object. */
+	static cMCLogger::eLogLevel MessageTypeToLogLevel(eMessageType a_MessageType);
+	
 protected:
 	/** All the parts that */
 	cParts m_Parts;
diff --git a/src/DeadlockDetect.cpp b/src/DeadlockDetect.cpp
index c42d09b89..322084dc4 100644
--- a/src/DeadlockDetect.cpp
+++ b/src/DeadlockDetect.cpp
@@ -7,7 +7,7 @@
 #include "DeadlockDetect.h"
 #include "Root.h"
 #include "World.h"
-# include <cstdlib>
+#include <cstdlib>
 
 
 
@@ -16,9 +16,6 @@
 /// Number of milliseconds per cycle
 const int CYCLE_MILLISECONDS = 100;
 
-/// When the number of cycles for the same world age hits this value, it is considered a deadlock
-const int NUM_CYCLES_LIMIT = 200;  // 200 = twenty seconds
-
 
 
 
@@ -121,7 +118,6 @@ void cDeadlockDetect::CheckWorldAge(const AString & a_WorldName, Int64 a_Age)
 		if (itr->second.m_NumCyclesSame > (1000 * m_IntervalSec) / CYCLE_MILLISECONDS)
 		{
 			DeadlockDetected();
-			return;
 		}
 	}
 	else
diff --git a/src/Defines.h b/src/Defines.h
index 3b7654265..1a8b3fa4a 100644
--- a/src/Defines.h
+++ b/src/Defines.h
@@ -290,7 +290,10 @@ inline AString BlockFaceToString(eBlockFace a_BlockFace)
 		case BLOCK_FACE_ZP: return "BLOCK_FACE_ZP";
 		case BLOCK_FACE_NONE: return "BLOCK_FACE_NONE";
 	}
+	// clang optimisises this line away then warns that it has done so.
+	#if !defined(__clang__)
 	return Printf("Unknown BLOCK_FACE: %d", a_BlockFace);
+	#endif
 }
 
 
@@ -530,16 +533,22 @@ enum eMessageType
 	// http://forum.mc-server.org/showthread.php?tid=1212
 	// MessageType...
 
-	mtCustom, // Send raw data without any processing
-	mtFailure, // Something could not be done (i.e. command not executed due to insufficient privilege)
-	mtInformation, // Informational message (i.e. command usage)
-	mtSuccess, // Something executed successfully
-	mtWarning, // Something concerning (i.e. reload) is about to happen
-	mtFatal, // Something catastrophic occured (i.e. plugin crash)
-	mtDeath, // Denotes death of player
-	mtPrivateMessage, // Player to player messaging identifier
-	mtJoin, // A player has joined the server
-	mtLeave, // A player has left the server
+	mtCustom,          // Send raw data without any processing
+	mtFailure,         // Something could not be done (i.e. command not executed due to insufficient privilege)
+	mtInformation,     // Informational message (i.e. command usage)
+	mtSuccess,         // Something executed successfully
+	mtWarning,         // Something concerning (i.e. reload) is about to happen
+	mtFatal,           // Something catastrophic occured (i.e. plugin crash)
+	mtDeath,           // Denotes death of player
+	mtPrivateMessage,  // Player to player messaging identifier
+	mtJoin,            // A player has joined the server
+	mtLeave,           // A player has left the server
+	
+	// Common aliases:
+	mtFail  = mtFailure,
+	mtError = mtFailure,
+	mtInfo  = mtInformation,
+	mtPM    = mtPrivateMessage,
 };
 
 
diff --git a/src/Entities/EnderCrystal.cpp b/src/Entities/EnderCrystal.cpp
new file mode 100644
index 000000000..a640b236c
--- /dev/null
+++ b/src/Entities/EnderCrystal.cpp
@@ -0,0 +1,56 @@
+
+#include "Globals.h"  // NOTE: MSVC stupidness requires this to be the same across all modules
+
+#include "EnderCrystal.h"
+#include "ClientHandle.h"
+#include "Player.h"
+#include "../Chunk.h"
+
+
+
+
+
+cEnderCrystal::cEnderCrystal(double a_X, double a_Y, double a_Z)
+	: cEntity(etEnderCrystal, a_X, a_Y, a_Z, 1.0, 1.0)
+{
+	SetMaxHealth(5);
+}
+
+
+
+
+
+void cEnderCrystal::SpawnOn(cClientHandle & a_ClientHandle)
+{
+	a_ClientHandle.SendSpawnObject(*this, 51, 0, (Byte)GetYaw(), (Byte)GetPitch());
+}
+
+
+
+
+
+void cEnderCrystal::Tick(float a_Dt, cChunk & a_Chunk)
+{
+	UNUSED(a_Dt);
+
+	a_Chunk.SetBlock(POSX_TOINT, POSY_TOINT, POSZ_TOINT, E_BLOCK_FIRE, 0);
+
+	// No further processing (physics e.t.c.) is needed
+}
+
+
+
+
+
+void cEnderCrystal::KilledBy(cEntity * a_Killer)
+{
+	super::KilledBy(a_Killer);
+
+	m_World->DoExplosionAt(6.0, GetPosX(), GetPosY(), GetPosZ(), true, esEnderCrystal, this);
+
+	Destroy();
+}
+
+
+
+
diff --git a/src/Entities/EnderCrystal.h b/src/Entities/EnderCrystal.h
new file mode 100644
index 000000000..5b86df987
--- /dev/null
+++ b/src/Entities/EnderCrystal.h
@@ -0,0 +1,33 @@
+
+#pragma once
+
+#include "Entity.h"
+
+
+
+
+
+// tolua_begin
+class cEnderCrystal :
+	public cEntity
+{
+	// tolua_end
+	typedef cEntity super;
+
+public:
+	CLASS_PROTODEF(cEnderCrystal);
+
+	cEnderCrystal(double a_X, double a_Y, double a_Z);
+
+private:
+
+	// cEntity overrides:
+	virtual void SpawnOn(cClientHandle & a_ClientHandle) override;
+	virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
+	virtual void KilledBy(cEntity * a_Killer) override;
+
+};  // tolua_export
+
+
+
+
diff --git a/src/Entities/Entity.cpp b/src/Entities/Entity.cpp
index 0750ae05e..221cbbea7 100644
--- a/src/Entities/Entity.cpp
+++ b/src/Entities/Entity.cpp
@@ -521,27 +521,35 @@ void cEntity::Tick(float a_Dt, cChunk & a_Chunk)
 	{
 		if (a_Chunk.IsValid())
 		{
-			HandlePhysics(a_Dt, a_Chunk);
-		}
-	}
-	if (a_Chunk.IsValid())
-	{
-		TickBurning(a_Chunk);
-	}
-	if ((a_Chunk.IsValid())  && (GetPosY() < -46))
-	{
-		TickInVoid(a_Chunk);
-	}
-	else
-		m_TicksSinceLastVoidDamage = 0;
+			cChunk * NextChunk = a_Chunk.GetNeighborChunk(POSX_TOINT, POSZ_TOINT);
 
-	if (IsMob() || IsPlayer())
-	{
-		// Set swimming state
-		SetSwimState(a_Chunk);
+			if ((NextChunk == NULL) || !NextChunk->IsValid())
+			{
+				return;
+			}
+
+			TickBurning(*NextChunk);
+
+			if (GetPosY() < VOID_BOUNDARY)
+			{
+				TickInVoid(*NextChunk);
+			}
+			else
+			{
+				m_TicksSinceLastVoidDamage = 0;
+			}
+
+			if (IsMob() || IsPlayer())
+			{
+				// Set swimming state
+				SetSwimState(*NextChunk);
 
-		// Handle drowning
-		HandleAir();
+				// Handle drowning
+				HandleAir();
+			}
+
+			HandlePhysics(a_Dt, *NextChunk);
+		}
 	}
 }
 
@@ -562,7 +570,7 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk)
 	if ((BlockY >= cChunkDef::Height) || (BlockY < 0))
 	{
 		// Outside of the world
-
+		
 		cChunk * NextChunk = a_Chunk.GetNeighborChunk(BlockX, BlockZ);
 		// See if we can commit our changes. If not, we will discard them.
 		if (NextChunk != NULL)
@@ -571,210 +579,205 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk)
 			NextPos += (NextSpeed * a_Dt);
 			SetPosition(NextPos);
 		}
+
 		return;
 	}
 	
-	// Make sure we got the correct chunk and a valid one. No one ever knows...
-	cChunk * NextChunk = a_Chunk.GetNeighborChunk(BlockX, BlockZ);
-	if (NextChunk != NULL)
+	int RelBlockX = BlockX - (a_Chunk.GetPosX() * cChunkDef::Width);
+	int RelBlockZ = BlockZ - (a_Chunk.GetPosZ() * cChunkDef::Width);
+	BLOCKTYPE BlockIn = a_Chunk.GetBlock( RelBlockX, BlockY, RelBlockZ );
+	BLOCKTYPE BlockBelow = (BlockY > 0) ? a_Chunk.GetBlock(RelBlockX, BlockY - 1, RelBlockZ) : E_BLOCK_AIR;
+	if (!cBlockInfo::IsSolid(BlockIn))  // Making sure we are not inside a solid block
 	{
-		int RelBlockX = BlockX - (NextChunk->GetPosX() * cChunkDef::Width);
-		int RelBlockZ = BlockZ - (NextChunk->GetPosZ() * cChunkDef::Width);
-		BLOCKTYPE BlockIn = NextChunk->GetBlock( RelBlockX, BlockY, RelBlockZ );
-		BLOCKTYPE BlockBelow = (BlockY > 0) ? NextChunk->GetBlock(RelBlockX, BlockY - 1, RelBlockZ) : E_BLOCK_AIR;
-		if (!cBlockInfo::IsSolid(BlockIn))  // Making sure we are not inside a solid block
+		if (m_bOnGround)  // check if it's still on the ground
 		{
-			if (m_bOnGround)  // check if it's still on the ground
+			if (!cBlockInfo::IsSolid(BlockBelow))  // Check if block below is air or water.
 			{
-				if (!cBlockInfo::IsSolid(BlockBelow))  // Check if block below is air or water.
-				{
-					m_bOnGround = false;
-				}
+				m_bOnGround = false;
 			}
 		}
-		else
-		{
-			// Push out entity.
-			BLOCKTYPE GotBlock;
+	}
+	else
+	{
+		// Push out entity.
+		BLOCKTYPE GotBlock;
 
-			static const struct
-			{
-				int x, y, z;
-			} gCrossCoords[] =
-			{
-				{ 1, 0,  0},
-				{-1, 0,  0},
-				{ 0, 0,  1},
-				{ 0, 0, -1},
-			} ;
-
-			bool IsNoAirSurrounding = true;
-			for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++)
+		static const struct
+		{
+			int x, y, z;
+		} gCrossCoords[] =
+		{
+			{ 1, 0,  0},
+			{-1, 0,  0},
+			{ 0, 0,  1},
+			{ 0, 0, -1},
+		} ;
+
+		bool IsNoAirSurrounding = true;
+		for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++)
+		{
+			if (!a_Chunk.UnboundedRelGetBlockType(RelBlockX + gCrossCoords[i].x, BlockY, RelBlockZ + gCrossCoords[i].z, GotBlock))
 			{
-				if (!NextChunk->UnboundedRelGetBlockType(RelBlockX + gCrossCoords[i].x, BlockY, RelBlockZ + gCrossCoords[i].z, GotBlock))
-				{
-					// The pickup is too close to an unloaded chunk, bail out of any physics handling
-					return;
-				}
-				if (!cBlockInfo::IsSolid(GotBlock))
-				{
-					NextPos.x += gCrossCoords[i].x;
-					NextPos.z += gCrossCoords[i].z;
-					IsNoAirSurrounding = false;
-					break;
-				}
-			}  // for i - gCrossCoords[]
-			
-			if (IsNoAirSurrounding)
+				// The pickup is too close to an unloaded chunk, bail out of any physics handling
+				return;
+			}
+			if (!cBlockInfo::IsSolid(GotBlock))
 			{
-				NextPos.y += 0.5;
+				NextPos.x += gCrossCoords[i].x;
+				NextPos.z += gCrossCoords[i].z;
+				IsNoAirSurrounding = false;
+				break;
 			}
+		}  // for i - gCrossCoords[]
+			
+		if (IsNoAirSurrounding)
+		{
+			NextPos.y += 0.5;
+		}
 
-			m_bOnGround = true;
+		m_bOnGround = true;
 
-			/*
-			// DEBUG:
-			LOGD("Entity #%d (%s) is inside a block at {%d, %d, %d}",
-				m_UniqueID, GetClass(), BlockX, BlockY, BlockZ
-			);
-			*/
-		}
+		/*
+		// DEBUG:
+		LOGD("Entity #%d (%s) is inside a block at {%d, %d, %d}",
+			m_UniqueID, GetClass(), BlockX, BlockY, BlockZ
+		);
+		*/
+	}
 
-		if (!m_bOnGround)
+	if (!m_bOnGround)
+	{
+		float fallspeed;
+		if (IsBlockWater(BlockIn))
 		{
-			float fallspeed;
-			if (IsBlockWater(BlockIn))
-			{
-				fallspeed = m_Gravity * a_Dt / 3;  // Fall 3x slower in water.
-			}
-			else if (BlockIn == E_BLOCK_COBWEB)
-			{
-				NextSpeed.y *= 0.05;  // Reduce overall falling speed
-				fallspeed = 0;  // No falling.
-			}
-			else
-			{
-				// Normal gravity
-				fallspeed = m_Gravity * a_Dt;
-			}
-			NextSpeed.y += fallspeed;
+			fallspeed = m_Gravity * a_Dt / 3;  // Fall 3x slower in water.
+		}
+		else if (BlockIn == E_BLOCK_COBWEB)
+		{
+			NextSpeed.y *= 0.05;  // Reduce overall falling speed
+			fallspeed = 0;  // No falling.
 		}
 		else
 		{
-			// Friction
-			if (NextSpeed.SqrLength() > 0.0004f)
+			// Normal gravity
+			fallspeed = m_Gravity * a_Dt;
+		}
+		NextSpeed.y += fallspeed;
+	}
+	else
+	{
+		// Friction
+		if (NextSpeed.SqrLength() > 0.0004f)
+		{
+			NextSpeed.x *= 0.7f / (1 + a_Dt);
+			if (fabs(NextSpeed.x) < 0.05)
 			{
-				NextSpeed.x *= 0.7f / (1 + a_Dt);
-				if (fabs(NextSpeed.x) < 0.05)
-				{
-					NextSpeed.x = 0;
-				}
-				NextSpeed.z *= 0.7f / (1 + a_Dt);
-				if (fabs(NextSpeed.z) < 0.05)
-				{
-					NextSpeed.z = 0;
-				}
+				NextSpeed.x = 0;
+			}
+			NextSpeed.z *= 0.7f / (1 + a_Dt);
+			if (fabs(NextSpeed.z) < 0.05)
+			{
+				NextSpeed.z = 0;
 			}
 		}
+	}
 
-		// Adjust X and Z speed for COBWEB temporary. This speed modification should be handled inside block handlers since we
-		// might have different speed modifiers according to terrain.
-		if (BlockIn == E_BLOCK_COBWEB)
-		{
-			NextSpeed.x *= 0.25;
-			NextSpeed.z *= 0.25;
-		}
+	// Adjust X and Z speed for COBWEB temporary. This speed modification should be handled inside block handlers since we
+	// might have different speed modifiers according to terrain.
+	if (BlockIn == E_BLOCK_COBWEB)
+	{
+		NextSpeed.x *= 0.25;
+		NextSpeed.z *= 0.25;
+	}
 					
-		//Get water direction
-		Direction WaterDir = m_World->GetWaterSimulator()->GetFlowingDirection(BlockX, BlockY, BlockZ);
+	//Get water direction
+	Direction WaterDir = m_World->GetWaterSimulator()->GetFlowingDirection(BlockX, BlockY, BlockZ);
 
-		m_WaterSpeed *= 0.9f;		//Reduce speed each tick
+	m_WaterSpeed *= 0.9f;		//Reduce speed each tick
 
-		switch(WaterDir)
-		{
-			case X_PLUS:
-				m_WaterSpeed.x = 0.2f;
-				m_bOnGround = false;
-				break;
-			case X_MINUS:
-				m_WaterSpeed.x = -0.2f;
-				m_bOnGround = false;
-				break;
-			case Z_PLUS:
-				m_WaterSpeed.z = 0.2f;
-				m_bOnGround = false;
-				break;
-			case Z_MINUS:
-				m_WaterSpeed.z = -0.2f;
-				m_bOnGround = false;
-				break;
-			
-		default:
+	switch(WaterDir)
+	{
+		case X_PLUS:
+			m_WaterSpeed.x = 0.2f;
+			m_bOnGround = false;
 			break;
-		}
+		case X_MINUS:
+			m_WaterSpeed.x = -0.2f;
+			m_bOnGround = false;
+			break;
+		case Z_PLUS:
+			m_WaterSpeed.z = 0.2f;
+			m_bOnGround = false;
+			break;
+		case Z_MINUS:
+			m_WaterSpeed.z = -0.2f;
+			m_bOnGround = false;
+			break;
+			
+	default:
+		break;
+	}
 
-		if (fabs(m_WaterSpeed.x) < 0.05)
-		{
-			m_WaterSpeed.x = 0;
-		}
+	if (fabs(m_WaterSpeed.x) < 0.05)
+	{
+		m_WaterSpeed.x = 0;
+	}
 
-		if (fabs(m_WaterSpeed.z) < 0.05)
-		{
-			m_WaterSpeed.z = 0;
-		}
+	if (fabs(m_WaterSpeed.z) < 0.05)
+	{
+		m_WaterSpeed.z = 0;
+	}
 
-		NextSpeed += m_WaterSpeed;
+	NextSpeed += m_WaterSpeed;
 
-		if( NextSpeed.SqrLength() > 0.f )
+	if( NextSpeed.SqrLength() > 0.f )
+	{
+		cTracer Tracer( GetWorld() );
+		bool HasHit = Tracer.Trace( NextPos, NextSpeed, 2 );
+		if (HasHit) // Oh noez! we hit something
 		{
-			cTracer Tracer( GetWorld() );
-			int Ret = Tracer.Trace( NextPos, NextSpeed, 2 );
-			if( Ret ) // Oh noez! we hit something
+			// Set to hit position
+			if ((Tracer.RealHit - NextPos).SqrLength() <= (NextSpeed * a_Dt).SqrLength())
 			{
-				// Set to hit position
-				if( (Tracer.RealHit - NextPos).SqrLength() <= ( NextSpeed * a_Dt ).SqrLength() )
-				{
-					if( Ret == 1 )
-					{
-						if( Tracer.HitNormal.x != 0.f ) NextSpeed.x = 0.f;
-						if( Tracer.HitNormal.y != 0.f ) NextSpeed.y = 0.f;
-						if( Tracer.HitNormal.z != 0.f ) NextSpeed.z = 0.f;
-
-						if( Tracer.HitNormal.y > 0 ) // means on ground
-						{
-							m_bOnGround = true;
-						}
-					}
-					NextPos.Set(Tracer.RealHit.x,Tracer.RealHit.y,Tracer.RealHit.z);
-					NextPos.x += Tracer.HitNormal.x * 0.3f;
-					NextPos.y += Tracer.HitNormal.y * 0.05f; // Any larger produces entity vibration-upon-the-spot
-					NextPos.z += Tracer.HitNormal.z * 0.3f;
-				}
-				else
+				if (Tracer.HitNormal.x != 0.f) NextSpeed.x = 0.f;
+				if (Tracer.HitNormal.y != 0.f) NextSpeed.y = 0.f;
+				if (Tracer.HitNormal.z != 0.f) NextSpeed.z = 0.f;
+
+				if (Tracer.HitNormal.y > 0) // means on ground
 				{
-					NextPos += (NextSpeed * a_Dt);
+					m_bOnGround = true;
 				}
+				NextPos.Set(Tracer.RealHit.x,Tracer.RealHit.y,Tracer.RealHit.z);
+				NextPos.x += Tracer.HitNormal.x * 0.3f;
+				NextPos.y += Tracer.HitNormal.y * 0.05f; // Any larger produces entity vibration-upon-the-spot
+				NextPos.z += Tracer.HitNormal.z * 0.3f;
 			}
 			else
 			{
-				// We didn't hit anything, so move =]
 				NextPos += (NextSpeed * a_Dt);
 			}
 		}
-		BlockX = (int) floor(NextPos.x);
-		BlockZ = (int) floor(NextPos.z);
-		NextChunk = NextChunk->GetNeighborChunk(BlockX,BlockZ);
-		// See if we can commit our changes. If not, we will discard them.
-		if (NextChunk != NULL)
+		else
 		{
-			if (NextPos.x != GetPosX()) SetPosX(NextPos.x);
-			if (NextPos.y != GetPosY()) SetPosY(NextPos.y);
-			if (NextPos.z != GetPosZ()) SetPosZ(NextPos.z);
-			if (NextSpeed.x != GetSpeedX()) SetSpeedX(NextSpeed.x);
-			if (NextSpeed.y != GetSpeedY()) SetSpeedY(NextSpeed.y);
-			if (NextSpeed.z != GetSpeedZ()) SetSpeedZ(NextSpeed.z);
+			// We didn't hit anything, so move =]
+			NextPos += (NextSpeed * a_Dt);
 		}
 	}
+
+	BlockX = (int) floor(NextPos.x);
+	BlockZ = (int) floor(NextPos.z);
+
+	cChunk * NextChunk = a_Chunk.GetNeighborChunk(BlockX, BlockZ);
+	// See if we can commit our changes. If not, we will discard them.
+	if (NextChunk != NULL)
+	{
+		if (NextPos.x != GetPosX()) SetPosX(NextPos.x);
+		if (NextPos.y != GetPosY()) SetPosY(NextPos.y);
+		if (NextPos.z != GetPosZ()) SetPosZ(NextPos.z);
+		if (NextSpeed.x != GetSpeedX()) SetSpeedX(NextSpeed.x);
+		if (NextSpeed.y != GetSpeedY()) SetSpeedY(NextSpeed.y);
+		if (NextSpeed.z != GetSpeedZ()) SetSpeedZ(NextSpeed.z);
+	}
 }
 
 
@@ -815,14 +818,13 @@ void cEntity::TickBurning(cChunk & a_Chunk)
 		{
 			int RelX = x;
 			int RelZ = z;
-			cChunk * CurChunk = a_Chunk.GetRelNeighborChunkAdjustCoords(RelX, RelZ);
-			if (CurChunk == NULL)
-			{
-				continue;
-			}
+
 			for (int y = MinY; y <= MaxY; y++)
 			{
-				switch (CurChunk->GetBlock(RelX, y, RelZ))
+				BLOCKTYPE Block;
+				a_Chunk.UnboundedRelGetBlockType(RelX, y, RelZ, Block);
+				
+				switch (Block)
 				{
 					case E_BLOCK_FIRE:
 					{
@@ -922,7 +924,7 @@ void cEntity::TickInVoid(cChunk & a_Chunk)
 
 void cEntity::SetSwimState(cChunk & a_Chunk)
 {
-	int RelY = (int)floor(m_LastPosY + 0.1);
+	int RelY = (int)floor(GetPosY() + 0.1);
 	if ((RelY < 0) || (RelY >= cChunkDef::Height - 1))
 	{
 		m_IsSwimming = false;
@@ -931,11 +933,10 @@ void cEntity::SetSwimState(cChunk & a_Chunk)
 	}
 
 	BLOCKTYPE BlockIn;
-	int RelX = (int)floor(m_LastPosX) - a_Chunk.GetPosX() * cChunkDef::Width;
-	int RelZ = (int)floor(m_LastPosZ) - a_Chunk.GetPosZ() * cChunkDef::Width;
+	int RelX = POSX_TOINT - a_Chunk.GetPosX() * cChunkDef::Width;
+	int RelZ = POSZ_TOINT - a_Chunk.GetPosZ() * cChunkDef::Width;
 
 	// Check if the player is swimming:
-	// Use Unbounded, because we're being called *after* processing super::Tick(), which could have changed our chunk
 	if (!a_Chunk.UnboundedRelGetBlockType(RelX, RelY, RelZ, BlockIn))
 	{
 		// This sometimes happens on Linux machines
diff --git a/src/Entities/Entity.h b/src/Entities/Entity.h
index a73565de7..e41f74b09 100644
--- a/src/Entities/Entity.h
+++ b/src/Entities/Entity.h
@@ -69,6 +69,7 @@ public:
 	enum eEntityType
 	{
 		etEntity,  // For all other types
+		etEnderCrystal,
 		etPlayer,
 		etPickup,
 		etMonster,
@@ -117,6 +118,7 @@ public:
 		BURN_TICKS = 200,            ///< How long to keep an entity burning after it has stood in lava / fire
 		MAX_AIR_LEVEL = 300,         ///< Maximum air an entity can have
 		DROWNING_TICKS = 20,         ///< Number of ticks per heart of damage
+		VOID_BOUNDARY = -46          ///< At what position Y to begin applying void damage
 	} ;
 	
 	cEntity(eEntityType a_EntityType, double a_X, double a_Y, double a_Z, double a_Width, double a_Height);
@@ -129,18 +131,19 @@ public:
 	
 	eEntityType GetEntityType(void) const { return m_EntityType; }
 	
-	bool IsPlayer      (void) const { return (m_EntityType == etPlayer); }
-	bool IsPickup      (void) const { return (m_EntityType == etPickup); }
-	bool IsMob         (void) const { return (m_EntityType == etMonster); }
+	bool IsEnderCrystal(void) const { return (m_EntityType == etEnderCrystal); }
+	bool IsPlayer      (void) const { return (m_EntityType == etPlayer);       }
+	bool IsPickup      (void) const { return (m_EntityType == etPickup);       }
+	bool IsMob         (void) const { return (m_EntityType == etMonster);      }
 	bool IsFallingBlock(void) const { return (m_EntityType == etFallingBlock); }
-	bool IsMinecart    (void) const { return (m_EntityType == etMinecart); }
-	bool IsBoat        (void) const { return (m_EntityType == etBoat); }
-	bool IsTNT         (void) const { return (m_EntityType == etTNT); }
-	bool IsProjectile  (void) const { return (m_EntityType == etProjectile); }
-	bool IsExpOrb      (void) const { return (m_EntityType == etExpOrb); }
-	bool IsFloater     (void) const { return (m_EntityType == etFloater); }
-	bool IsItemFrame   (void) const { return (m_EntityType == etItemFrame); }
-	bool IsPainting    (void) const { return (m_EntityType == etPainting); }
+	bool IsMinecart    (void) const { return (m_EntityType == etMinecart);     }
+	bool IsBoat        (void) const { return (m_EntityType == etBoat);         }
+	bool IsTNT         (void) const { return (m_EntityType == etTNT);          }
+	bool IsProjectile  (void) const { return (m_EntityType == etProjectile);   }
+	bool IsExpOrb      (void) const { return (m_EntityType == etExpOrb);       }
+	bool IsFloater     (void) const { return (m_EntityType == etFloater);      }
+	bool IsItemFrame   (void) const { return (m_EntityType == etItemFrame);    }
+	bool IsPainting    (void) const { return (m_EntityType == etPainting);     }
 	
 	/// Returns true if the entity is of the specified class or a subclass (cPawn's IsA("cEntity") returns true)
 	virtual bool IsA(const char * a_ClassName) const;
diff --git a/src/Entities/ExpOrb.cpp b/src/Entities/ExpOrb.cpp
index 3398f1c7b..3623c869a 100644
--- a/src/Entities/ExpOrb.cpp
+++ b/src/Entities/ExpOrb.cpp
@@ -5,20 +5,26 @@
 #include "../ClientHandle.h"
 
 
-cExpOrb::cExpOrb(double a_X, double a_Y, double a_Z, int a_Reward) :
-	cEntity(etExpOrb, a_X, a_Y, a_Z, 0.98, 0.98),
-	m_Reward(a_Reward)
+cExpOrb::cExpOrb(double a_X, double a_Y, double a_Z, int a_Reward)
+	:	cEntity(etExpOrb, a_X, a_Y, a_Z, 0.98, 0.98)
+	, m_Reward(a_Reward)
+	, m_Timer(0.f)
 {
+	SetMaxHealth(5);
+	SetHealth(5);
 }
 
 
 
 
 
-cExpOrb::cExpOrb(const Vector3d & a_Pos, int a_Reward) :
-	cEntity(etExpOrb, a_Pos.x, a_Pos.y, a_Pos.z, 0.98, 0.98),
-	m_Reward(a_Reward)
+cExpOrb::cExpOrb(const Vector3d & a_Pos, int a_Reward)
+	:	cEntity(etExpOrb, a_Pos.x, a_Pos.y, a_Pos.z, 0.98, 0.98)
+	, m_Reward(a_Reward)
+	, m_Timer(0.f)
 {
+	SetMaxHealth(5);
+	SetHealth(5);
 }
 
 
@@ -52,7 +58,7 @@ void cExpOrb::Tick(float a_Dt, cChunk & a_Chunk)
 			LOGD("Player %s picked up an ExpOrb. His reward is %i", a_ClosestPlayer->GetName().c_str(), m_Reward);
 			a_ClosestPlayer->DeltaExperience(m_Reward);
 			
-			m_World->BroadcastSoundEffect("random.orb", (int)GetPosX() * 8, (int)GetPosY() * 8, (int)GetPosZ() * 8, 0.5f, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64));
+			m_World->BroadcastSoundEffect("random.orb", (int)(GetPosX() * 8), (int)(GetPosY() * 8), (int)(GetPosZ() * 8), 0.5f, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64));
 			
 			Destroy();
 		}
@@ -64,4 +70,10 @@ void cExpOrb::Tick(float a_Dt, cChunk & a_Chunk)
 		BroadcastMovementUpdate();
 	}
 	HandlePhysics(a_Dt, a_Chunk);
+	
+	m_Timer += a_Dt;
+	if (m_Timer >= 1000 * 60 * 5)  // 5 minutes
+	{
+		Destroy(true);
+	}
 }
diff --git a/src/Entities/ExpOrb.h b/src/Entities/ExpOrb.h
index 47d86922c..c1150bd03 100644
--- a/src/Entities/ExpOrb.h
+++ b/src/Entities/ExpOrb.h
@@ -7,14 +7,17 @@
 
 
 
+// tolua_begin
 class cExpOrb :
 	public cEntity
 {
 	typedef cExpOrb super;
 	
 public:
+	// tolua_end
+
 	CLASS_PROTODEF(cExpOrb);
-	
+
 	cExpOrb(double a_X, double a_Y, double a_Z, int a_Reward);
 	cExpOrb(const Vector3d & a_Pos, int a_Reward);
 
@@ -22,9 +25,21 @@ public:
 	virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
 	virtual void SpawnOn(cClientHandle & a_Client) override;
 
-	// cExpOrb functions
-	int GetReward(void) const { return m_Reward; }
+	/** Returns the number of ticks that this entity has existed */
+	int GetAge(void) const { return (int)(m_Timer / 50); }     // tolua_export
+
+	/** Set the number of ticks that this entity has existed */
+	void SetAge(int a_Age) { m_Timer = (float)(a_Age * 50); }  // tolua_export
+
+	/** Get the exp amount */
+	int GetReward(void) const { return m_Reward; }  // tolua_export
+
+	/** Set the exp amount */
+	void SetReward(int a_Reward) { m_Reward = a_Reward; }  // tolua_export
 
 protected:
 	int m_Reward;
-} ;
\ No newline at end of file
+	
+	/** The number of ticks that the entity has existed / timer between collect and destroy; in msec */
+	float m_Timer;
+} ;  // tolua_export
\ No newline at end of file
diff --git a/src/Entities/FallingBlock.cpp b/src/Entities/FallingBlock.cpp
index 9fcd9ac80..a66c7e4ae 100644
--- a/src/Entities/FallingBlock.cpp
+++ b/src/Entities/FallingBlock.cpp
@@ -33,20 +33,16 @@ void cFallingBlock::SpawnOn(cClientHandle & a_ClientHandle)
 
 void cFallingBlock::Tick(float a_Dt, cChunk & a_Chunk)
 {
-	float MilliDt = a_Dt * 0.001f;
-	AddSpeedY(MilliDt * -9.8f);
-	AddPosY(GetSpeedY() * MilliDt);
-
 	// GetWorld()->BroadcastTeleportEntity(*this);  // Test position
 	
-	int BlockX = m_OriginalPosition.x;
+	int BlockX = POSX_TOINT;
 	int BlockY = (int)(GetPosY() - 0.5);
-	int BlockZ = m_OriginalPosition.z;
+	int BlockZ = POSZ_TOINT;
 	
 	if (BlockY < 0)
 	{
 		// Fallen out of this world, just continue falling until out of sight, then destroy:
-		if (BlockY < 100)
+		if (BlockY < VOID_BOUNDARY)
 		{
 			Destroy(true);
 		}
@@ -86,6 +82,15 @@ void cFallingBlock::Tick(float a_Dt, cChunk & a_Chunk)
 		Destroy(true);
 		return;
 	}
+	
+	float MilliDt = a_Dt * 0.001f;
+	AddSpeedY(MilliDt * -9.8f);
+	AddPosition(GetSpeed() * MilliDt);
+
+	if ((GetSpeedX() != 0) || (GetSpeedZ() != 0))
+	{
+		BroadcastMovementUpdate();
+	}
 }
 
 
diff --git a/src/Entities/HangingEntity.cpp b/src/Entities/HangingEntity.cpp
new file mode 100644
index 000000000..41ac86268
--- /dev/null
+++ b/src/Entities/HangingEntity.cpp
@@ -0,0 +1,53 @@
+
+#include "Globals.h"  // NOTE: MSVC stupidness requires this to be the same across all modules
+
+#include "HangingEntity.h"
+#include "ClientHandle.h"
+#include "Player.h"
+
+
+
+
+
+cHangingEntity::cHangingEntity(eEntityType a_EntityType, eBlockFace a_BlockFace, double a_X, double a_Y, double a_Z)
+	:	cEntity(a_EntityType, a_X, a_Y, a_Z, 0.8, 0.8)
+	, m_BlockFace(a_BlockFace)
+{
+	SetMaxHealth(1);
+	SetHealth(1);
+}
+
+
+
+
+
+void cHangingEntity::SpawnOn(cClientHandle & a_ClientHandle)
+{
+	int Dir = 0;
+			
+	// The client uses different values for item frame directions and block faces. Our constants are for the block faces, so we convert them here to item frame faces
+	switch (m_BlockFace)
+	{
+		case BLOCK_FACE_ZP: break; // Initialised to zero
+		case BLOCK_FACE_ZM: Dir = 2; break;
+		case BLOCK_FACE_XM: Dir = 1; break;
+		case BLOCK_FACE_XP: Dir = 3; break;
+		default: ASSERT(!"Unhandled block face when trying to spawn item frame!"); return;
+	}
+
+	if ((Dir == 0) || (Dir == 2)) // Probably a client bug, but two directions are flipped and contrary to the norm, so we do -180
+	{
+		SetYaw((Dir * 90) - 180);
+	}
+	else
+	{
+		SetYaw(Dir * 90);
+	}
+
+	a_ClientHandle.SendSpawnObject(*this, 71, Dir, (Byte)GetYaw(), (Byte)GetPitch());
+	a_ClientHandle.SendEntityMetadata(*this);
+}
+
+
+
+
diff --git a/src/Entities/HangingEntity.h b/src/Entities/HangingEntity.h
new file mode 100644
index 000000000..6498e4b5b
--- /dev/null
+++ b/src/Entities/HangingEntity.h
@@ -0,0 +1,49 @@
+
+#pragma once
+
+#include "Entity.h"
+
+
+
+
+
+// tolua_begin
+class cHangingEntity :
+	public cEntity
+{
+	// tolua_end
+	typedef cEntity super;
+
+public:
+
+	CLASS_PROTODEF(cHangingEntity);
+
+	cHangingEntity(eEntityType a_EntityType, eBlockFace a_BlockFace, double a_X, double a_Y, double a_Z);
+	
+	/** Returns the orientation from the hanging entity */
+	eBlockFace GetDirection() const { return m_BlockFace; }  // tolua_export
+	
+	/** Set the orientation from the hanging entity */
+	void SetDirection(eBlockFace a_BlockFace) { m_BlockFace = a_BlockFace; }  // tolua_export
+	
+	/** Returns the X coord. */
+	int GetTileX() const { return POSX_TOINT; }  // tolua_export
+	
+	/** Returns the Y coord. */
+	int GetTileY() const { return POSY_TOINT; }  // tolua_export
+	
+	/** Returns the Z coord. */
+	int GetTileZ() const { return POSZ_TOINT; }  // tolua_export
+
+private:
+
+	virtual void SpawnOn(cClientHandle & a_ClientHandle) override;
+	virtual void Tick(float a_Dt, cChunk & a_Chunk) override {};
+
+	eBlockFace m_BlockFace;
+
+};  // tolua_export
+
+
+
+
diff --git a/src/Entities/ItemFrame.cpp b/src/Entities/ItemFrame.cpp
index 8cfa5e18d..9dd909880 100644
--- a/src/Entities/ItemFrame.cpp
+++ b/src/Entities/ItemFrame.cpp
@@ -10,43 +10,10 @@
 
 
 cItemFrame::cItemFrame(eBlockFace a_BlockFace, double a_X, double a_Y, double a_Z)
-	: cEntity(etItemFrame, a_X, a_Y, a_Z, 0.8, 0.8),
-	m_BlockFace(a_BlockFace),
-	m_Item(E_BLOCK_AIR),
-	m_Rotation(0)
+	:	cHangingEntity(etItemFrame, a_BlockFace, a_X, a_Y, a_Z)
+	, m_Item(E_BLOCK_AIR)
+	, m_Rotation(0)
 {
-	SetMaxHealth(1);
-	SetHealth(1);
-}
-
-
-
-
-
-void cItemFrame::SpawnOn(cClientHandle & a_ClientHandle)
-{
-	int Dir = 0;
-			
-	// The client uses different values for item frame directions and block faces. Our constants are for the block faces, so we convert them here to item frame faces
-	switch (m_BlockFace)
-	{
-		case BLOCK_FACE_ZP: break; // Initialised to zero
-		case BLOCK_FACE_ZM: Dir = 2; break;
-		case BLOCK_FACE_XM: Dir = 1; break;
-		case BLOCK_FACE_XP: Dir = 3; break;
-		default: ASSERT(!"Unhandled block face when trying to spawn item frame!"); return;
-	}
-
-	if ((Dir == 0) || (Dir == 2)) // Probably a client bug, but two directions are flipped and contrary to the norm, so we do -180
-	{
-		SetYaw((Dir * 90) - 180);
-	}
-	else
-	{
-		SetYaw(Dir * 90);
-	}
-
-	a_ClientHandle.SendSpawnObject(*this, 71, Dir, (Byte)GetYaw(), (Byte)GetPitch());
 }
 
 
diff --git a/src/Entities/ItemFrame.h b/src/Entities/ItemFrame.h
index 43915e3f9..6577e7d94 100644
--- a/src/Entities/ItemFrame.h
+++ b/src/Entities/ItemFrame.h
@@ -1,7 +1,7 @@
 
 #pragma once
 
-#include "Entity.h"
+#include "HangingEntity.h"
 
 
 
@@ -9,10 +9,10 @@
 
 // tolua_begin
 class cItemFrame :
-	public cEntity
+	public cHangingEntity
 {
 	// tolua_end
-	typedef cEntity super;
+	typedef cHangingEntity super;
 
 public:
 
@@ -20,18 +20,24 @@ public:
 
 	cItemFrame(eBlockFace a_BlockFace, double a_X, double a_Y, double a_Z);
 
-	const cItem & GetItem(void) { return m_Item; }
-	Byte GetRotation(void) const { return m_Rotation; }
+	/** Returns the item in the frame */
+	const cItem & GetItem(void) { return m_Item; }                  // tolua_export
+
+	/** Set the item in the frame */
+	void SetItem(cItem & a_Item) { m_Item = a_Item; };              // tolua_export
+
+	/** Returns the rotation from the item in the frame */
+	Byte GetRotation(void) const { return m_Rotation; }             // tolua_export
+
+	/** Set the rotation from the item in the frame */
+	void SetRotation(Byte a_Rotation) { m_Rotation = a_Rotation; }  // tolua_export
 
 private:
 
-	virtual void SpawnOn(cClientHandle & a_ClientHandle) override;
 	virtual void OnRightClicked(cPlayer & a_Player) override;
-	virtual void Tick(float a_Dt, cChunk & a_Chunk) override {};
 	virtual void KilledBy(cEntity * a_Killer) override;
 	virtual void GetDrops(cItems & a_Items, cEntity * a_Killer) override;
 
-	eBlockFace m_BlockFace;
 	cItem m_Item;
 	Byte m_Rotation;
 
diff --git a/src/Entities/Pickup.cpp b/src/Entities/Pickup.cpp
index c5503c16a..7fc89b62b 100644
--- a/src/Entities/Pickup.cpp
+++ b/src/Entities/Pickup.cpp
@@ -82,7 +82,7 @@ cPickup::cPickup(double a_PosX, double a_PosY, double a_PosZ, const cItem & a_It
 
 void cPickup::SpawnOn(cClientHandle & a_Client)
 {
-	a_Client.SendPickupSpawn(*this);	
+	a_Client.SendPickupSpawn(*this);
 }
 
 
diff --git a/src/Entities/Pickup.h b/src/Entities/Pickup.h
index c273567d1..74b917bce 100644
--- a/src/Entities/Pickup.h
+++ b/src/Entities/Pickup.h
@@ -26,31 +26,34 @@ public:
 	CLASS_PROTODEF(cPickup);
 
 	cPickup(double a_PosX, double a_PosY, double a_PosZ, const cItem & a_Item, bool IsPlayerCreated, float a_SpeedX = 0.f, float a_SpeedY = 0.f, float a_SpeedZ = 0.f);
-	
+
 	cItem &       GetItem(void)       {return m_Item; } // tolua_export
 	const cItem & GetItem(void) const {return m_Item; }
 
 	virtual void SpawnOn(cClientHandle & a_ClientHandle) override;
-	
+
 	bool CollectedBy(cPlayer * a_Dest);					// tolua_export
 
 	virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
-	
-	/// Returns the number of ticks that this entity has existed
-	int GetAge(void) const { return (int)(m_Timer / 50); }  // tolua_export
-	
-	/// Returns true if the pickup has already been collected
+
+	/** Returns the number of ticks that this entity has existed */
+	int GetAge(void) const { return (int)(m_Timer / 50); }     // tolua_export
+
+	/** Set the number of ticks that this entity has existed */
+	void SetAge(int a_Age) { m_Timer = (float)(a_Age * 50); }  // tolua_export
+
+	/** Returns true if the pickup has already been collected */
 	bool IsCollected(void) const { return m_bCollected; }  // tolua_export
 
-	/// Returns true if created by player (i.e. vomiting), used for determining picking-up delay time
+	/** Returns true if created by player (i.e. vomiting), used for determining picking-up delay time */
 	bool IsPlayerCreated(void) const { return m_bIsPlayerCreated; } // tolua_export
-	
+
 private:
 	Vector3d   m_ResultingSpeed;	 //Can be used to modify the resulting speed for the current tick ;)
 
 	Vector3d   m_WaterSpeed;
 
-	/// The number of ticks that the entity has existed / timer between collect and destroy; in msec
+	/** The number of ticks that the entity has existed / timer between collect and destroy; in msec */
 	float m_Timer;
 
 	cItem m_Item;
diff --git a/src/Entities/Player.cpp b/src/Entities/Player.cpp
index 440d30595..646aad50f 100644
--- a/src/Entities/Player.cpp
+++ b/src/Entities/Player.cpp
@@ -43,8 +43,9 @@ cPlayer::cPlayer(cClientHandle* a_Client, const AString & a_PlayerName)
 	, m_GameMode(eGameMode_NotSet)
 	, m_IP("")
 	, m_ClientHandle(a_Client)
-	, m_NormalMaxSpeed(0.1)
-	, m_SprintingMaxSpeed(0.13)
+	, m_NormalMaxSpeed(1.0)
+	, m_SprintingMaxSpeed(1.3)
+	, m_FlyingMaxSpeed(1.0)
 	, m_IsCrouched(false)
 	, m_IsSprinting(false)
 	, m_IsFlying(false)
@@ -684,7 +685,21 @@ const cSlotNums & cPlayer::GetInventoryPaintSlots(void) const
 
 double cPlayer::GetMaxSpeed(void) const
 {
-	return m_IsSprinting ? m_SprintingMaxSpeed : m_NormalMaxSpeed;
+	if (m_IsFlying)
+	{
+		return m_FlyingMaxSpeed;
+	}
+	else
+	{
+		if (m_IsSprinting)
+		{
+			return m_SprintingMaxSpeed;
+		}
+		else
+		{
+			return m_NormalMaxSpeed;
+		}
+	}
 }
 
 
@@ -694,7 +709,7 @@ double cPlayer::GetMaxSpeed(void) const
 void cPlayer::SetNormalMaxSpeed(double a_Speed)
 {
 	m_NormalMaxSpeed = a_Speed;
-	if (!m_IsSprinting)
+	if (!m_IsSprinting && !m_IsFlying)
 	{
 		m_ClientHandle->SendPlayerMaxSpeed();
 	}
@@ -707,7 +722,7 @@ void cPlayer::SetNormalMaxSpeed(double a_Speed)
 void cPlayer::SetSprintingMaxSpeed(double a_Speed)
 {
 	m_SprintingMaxSpeed = a_Speed;
-	if (m_IsSprinting)
+	if (m_IsSprinting && !m_IsFlying)
 	{
 		m_ClientHandle->SendPlayerMaxSpeed();
 	}
@@ -717,6 +732,18 @@ void cPlayer::SetSprintingMaxSpeed(double a_Speed)
 
 
 
+void cPlayer::SetFlyingMaxSpeed(double a_Speed)
+{
+	m_FlyingMaxSpeed = a_Speed;
+	
+	// Update the flying speed, always:
+	m_ClientHandle->SendPlayerAbilities();
+}
+
+
+
+
+
 void cPlayer::SetCrouch(bool a_IsCrouched)
 {
 	// Set the crouch status, broadcast to all visible players
@@ -1462,6 +1489,7 @@ bool cPlayer::MoveToWorld(const char * a_WorldName)
 
 	// Add player to all the necessary parts of the new world
 	SetWorld(World);
+	m_ClientHandle->StreamChunks();
 	World->AddEntity(this);
 	World->AddPlayer(this);
 
diff --git a/src/Entities/Player.h b/src/Entities/Player.h
index f9404dfaf..ea32dbfb9 100644
--- a/src/Entities/Player.h
+++ b/src/Entities/Player.h
@@ -47,19 +47,19 @@ public:
 
 	virtual void HandlePhysics(float a_Dt, cChunk &) override { UNUSED(a_Dt); };
 
-	/// Returns the curently equipped weapon; empty item if none
+	/** Returns the curently equipped weapon; empty item if none */
 	virtual cItem GetEquippedWeapon(void) const override { return m_Inventory.GetEquippedItem(); }
 	
-	/// Returns the currently equipped helmet; empty item if none
+	/** Returns the currently equipped helmet; empty item if none */
 	virtual cItem GetEquippedHelmet(void) const override { return m_Inventory.GetEquippedHelmet(); }
 	
-	/// Returns the currently equipped chestplate; empty item if none
+	/** Returns the currently equipped chestplate; empty item if none */
 	virtual cItem GetEquippedChestplate(void) const override { return m_Inventory.GetEquippedChestplate(); }
 
-	/// Returns the currently equipped leggings; empty item if none
+	/** Returns the currently equipped leggings; empty item if none */
 	virtual cItem GetEquippedLeggings(void) const override { return m_Inventory.GetEquippedLeggings(); }
 	
-	/// Returns the currently equipped boots; empty item if none
+	/** Returns the currently equipped boots; empty item if none */
 	virtual cItem GetEquippedBoots(void) const override { return m_Inventory.GetEquippedBoots(); }
 
 
@@ -77,36 +77,41 @@ public:
 	*/
 	short DeltaExperience(short a_Xp_delta);
 
-	/// Gets the experience total - XpTotal for score on death
+	/** Gets the experience total - XpTotal for score on death */
 	inline short GetXpLifetimeTotal(void) { return m_LifetimeTotalXp; }
 
-	/// Gets the currrent experience
+	/** Gets the currrent experience */
 	inline short GetCurrentXp(void) { return m_CurrentXp; }
 
-	/// Gets the current level - XpLevel
+	/** Gets the current level - XpLevel */
 	short GetXpLevel(void);
 
-	/// Gets the experience bar percentage - XpP
+	/** Gets the experience bar percentage - XpP */
 	float GetXpPercentage(void);
 
-	/// Caculates the amount of XP needed for a given level, ref: http://minecraft.gamepedia.com/XP
+	/** Caculates the amount of XP needed for a given level
+	Ref: http://minecraft.gamepedia.com/XP
+	*/
 	static short XpForLevel(short int a_Level);
 
-	/// inverse of XpForLevel, ref: http://minecraft.gamepedia.com/XP values are as per this with pre-calculations
+	/** Inverse of XpForLevel
+	Ref: http://minecraft.gamepedia.com/XP
+	values are as per this with pre-calculations
+	*/
 	static short CalcLevelFromXp(short int a_CurrentXp);
 
 	// tolua_end
 	
-	/// Starts charging the equipped bow
+	/** Starts charging the equipped bow */
 	void StartChargingBow(void);
 	
-	/// Finishes charging the current bow. Returns the number of ticks for which the bow has been charged
+	/** Finishes charging the current bow. Returns the number of ticks for which the bow has been charged */
 	int FinishChargingBow(void);
 	
-	/// Cancels the current bow charging
+	/** Cancels the current bow charging */
 	void CancelChargingBow(void);
 	
-	/// Returns true if the player is currently charging the bow
+	/** Returns true if the player is currently charging the bow */
 	bool IsChargingBow(void) const { return m_IsChargingBow; }
 
 	void SetTouchGround( bool a_bTouchGround );
@@ -124,16 +129,16 @@ public:
 
 	// tolua_begin
 	
-	/// Returns the position where projectiles thrown by this player should start, player eye position + adjustment
+	/** Returns the position where projectiles thrown by this player should start, player eye position + adjustment */
 	Vector3d GetThrowStartPos(void) const;
 	
-	/// Returns the initial speed vector of a throw, with a 3D length of a_SpeedCoeff.
+	/** Returns the initial speed vector of a throw, with a 3D length of a_SpeedCoeff. */
 	Vector3d GetThrowSpeed(double a_SpeedCoeff) const;
 	
-	/// Returns the current gamemode. Partly OBSOLETE, you should use IsGameModeXXX() functions wherever applicable
+	/** Returns the current gamemode. Partly OBSOLETE, you should use IsGameModeXXX() functions wherever applicable */
 	eGameMode GetGameMode(void) const { return m_GameMode; }
 	
-	/// Returns the current effective gamemode (inherited gamemode is resolved before returning)
+	/** Returns the current effective gamemode (inherited gamemode is resolved before returning) */
 	eGameMode GetEffectiveGameMode(void) const { return (m_GameMode == gmNotSet) ? m_World->GetGameMode() : m_GameMode; }
 	
 	/** Sets the gamemode for the player.
@@ -142,24 +147,24 @@ public:
 	*/
 	void SetGameMode(eGameMode a_GameMode);
 
-	/// Returns true if the player is in Creative mode, either explicitly, or by inheriting from current world
+	/** Returns true if the player is in Creative mode, either explicitly, or by inheriting from current world */
 	bool IsGameModeCreative(void) const;
 	
-	/// Returns true if the player is in Survival mode, either explicitly, or by inheriting from current world
+	/** Returns true if the player is in Survival mode, either explicitly, or by inheriting from current world */
 	bool IsGameModeSurvival(void) const;
 	
-	/// Returns true if the player is in Adventure mode, either explicitly, or by inheriting from current world
+	/** Returns true if the player is in Adventure mode, either explicitly, or by inheriting from current world */
 	bool IsGameModeAdventure(void) const;
 	
 	AString GetIP(void) const { return m_IP; }  // tolua_export
 
-	/// Returns the associated team, NULL if none
+	/** Returns the associated team, NULL if none */
 	cTeam * GetTeam(void) { return m_Team; } // tolua_export
 
-	/// Sets the player team, NULL if none
+	/** Sets the player team, NULL if none */
 	void SetTeam(cTeam * a_Team);
 
-	/// Forces the player to query the scoreboard for his team
+	/** Forces the player to query the scoreboard for his team */
 	cTeam * UpdateTeam(void);
 
 	// tolua_end
@@ -169,24 +174,24 @@ public:
 	// Sets the current gamemode, doesn't check validity, doesn't send update packets to client
 	void LoginSetGameMode(eGameMode a_GameMode);
 
-	/// Forces the player to move in the given direction.
+	/** Forces the player to move in the given direction. */
 	void ForceSetSpeed(Vector3d a_Direction); // tolua_export
 
-	/// Tries to move to a new position, with attachment-related checks (y == -999)
+	/** Tries to move to a new position, with attachment-related checks (y == -999) */
 	void MoveTo(const Vector3d & a_NewPos);  // tolua_export
 
 	cWindow * GetWindow(void) { return m_CurrentWindow; }  // tolua_export
 	const cWindow * GetWindow(void) const { return m_CurrentWindow; }
 	
-	/// Opens the specified window; closes the current one first using CloseWindow()
+	/** Opens the specified window; closes the current one first using CloseWindow() */
 	void OpenWindow(cWindow * a_Window);  // Exported in ManualBindings.cpp
 	
 	// tolua_begin
 	
-	/// Closes the current window, resets current window to m_InventoryWindow. A plugin may refuse the closing if a_CanRefuse is true
+	/** Closes the current window, resets current window to m_InventoryWindow. A plugin may refuse the closing if a_CanRefuse is true */
 	void CloseWindow(bool a_CanRefuse = true);
 	
-	/// Closes the current window if it matches the specified ID, resets current window to m_InventoryWindow
+	/** Closes the current window if it matches the specified ID, resets current window to m_InventoryWindow */
 	void CloseWindowIfID(char a_WindowID, bool a_CanRefuse = true);
 
 	cClientHandle * GetClientHandle(void) const { return m_ClientHandle; }
@@ -208,10 +213,10 @@ public:
 	typedef std::list< cGroup* > GroupList;
 	typedef std::list< std::string > StringList;
 
-	/// Adds a player to existing group or creates a new group when it doesn't exist
+	/** Adds a player to existing group or creates a new group when it doesn't exist */
 	void AddToGroup( const AString & a_GroupName );							// tolua_export
 	
-	/// Removes a player from the group, resolves permissions and group inheritance (case sensitive)
+	/** Removes a player from the group, resolves permissions and group inheritance (case sensitive) */
 	void RemoveFromGroup( const AString & a_GroupName );					// tolua_export
 	
 	bool HasPermission( const AString & a_Permission );						// tolua_export
@@ -234,7 +239,7 @@ public:
 	/** tosses a pickup newly created from a_Item */
 	void TossPickup(const cItem & a_Item);
 
-	/// Heals the player by the specified amount of HPs (positive only); sends health update
+	/** Heals the player by the specified amount of HPs (positive only); sends health update */
 	void Heal(int a_Health);
 	
 	int    GetFoodLevel                 (void) const { return m_FoodLevel; }
@@ -243,7 +248,7 @@ public:
 	double GetFoodExhaustionLevel       (void) const { return m_FoodExhaustionLevel; }
 	int    GetFoodPoisonedTicksRemaining(void) const { return m_FoodPoisonedTicksRemaining; }
 	
-	/// Returns true if the player is satiated, i. e. their foodlevel is at the max and they cannot eat anymore
+	/** Returns true if the player is satiated, i. e. their foodlevel is at the max and they cannot eat anymore */
 	bool IsSatiated(void) const { return (m_FoodLevel >= MAX_FOOD_LEVEL); }
 	
 	void SetFoodLevel                 (int a_FoodLevel);
@@ -252,25 +257,28 @@ public:
 	void SetFoodExhaustionLevel       (double a_FoodExhaustionLevel);
 	void SetFoodPoisonedTicksRemaining(int a_FoodPoisonedTicksRemaining);
 
-	/// Adds to FoodLevel and FoodSaturationLevel, returns true if any food has been consumed, false if player "full"
+	/** Adds to FoodLevel and FoodSaturationLevel, returns true if any food has been consumed, false if player "full" */
 	bool Feed(int a_Food, double a_Saturation);
 
-	/// Adds the specified exhaustion to m_FoodExhaustion. Expects only positive values.
+	/** Adds the specified exhaustion to m_FoodExhaustion. Expects only positive values. */
 	void AddFoodExhaustion(double a_Exhaustion)
 	{
 		m_FoodExhaustionLevel += a_Exhaustion;
 	}
 	
-	/// Starts the food poisoning for the specified amount of ticks; if already foodpoisoned, sets FoodPoisonedTicksRemaining to the larger of the two
+	/** Starts the food poisoning for the specified amount of ticks; if already foodpoisoned, sets FoodPoisonedTicksRemaining to the larger of the two */
 	void FoodPoison(int a_NumTicks);
 	
-	/// Returns true if the player is currently in the process of eating the currently equipped item
+	/** Returns true if the player is currently in the process of eating the currently equipped item */
 	bool IsEating(void) const { return (m_EatingFinishTick >= 0); }
 	
-	/// Returns true if the player is currently flying.
+	/** Returns true if the player is currently flying. */
 	bool IsFlying(void) const { return m_IsFlying; }
 
-	/// returns true if the player has thrown out a floater.
+	/** Returns if a player is sleeping in a bed */
+	bool IsInBed(void) const { return m_bIsInBed; }
+
+	/** returns true if the player has thrown out a floater. */
 	bool IsFishing(void) const { return m_IsFishing; }
 
 	void SetIsFishing(bool a_IsFishing, int a_FloaterID = -1) { m_IsFishing = a_IsFishing; m_FloaterID = a_FloaterID; }
@@ -278,14 +286,17 @@ public:
 	int GetFloaterID(void) const { return m_FloaterID; }
 
 	// tolua_end
+
+	/** Sets a player's in-bed state; we can't be sure plugins will keep this value updated, so no exporting */
+	void SetIsInBed(bool a_Flag) { m_bIsInBed = a_Flag; }
 	
-	/// Starts eating the currently equipped item. Resets the eating timer and sends the proper animation packet
+	/** Starts eating the currently equipped item. Resets the eating timer and sends the proper animation packet */
 	void StartEating(void);
 	
-	/// Finishes eating the currently equipped item. Consumes the item, updates health and broadcasts the packets
+	/** Finishes eating the currently equipped item. Consumes the item, updates health and broadcasts the packets */
 	void FinishEating(void);
 	
-	/// Aborts the current eating operation
+	/** Aborts the current eating operation */
 	void AbortEating(void);
 	
 	virtual void KilledBy(cEntity * a_Killer) override;
@@ -314,45 +325,51 @@ public:
 	cItem & GetDraggingItem(void) {return m_DraggingItem; }
 	
 	// In UI windows, when inventory-painting:
-	/// Clears the list of slots that are being inventory-painted. To be used by cWindow only
+	/** Clears the list of slots that are being inventory-painted. To be used by cWindow only */
 	void ClearInventoryPaintSlots(void);
 	
-	/// Adds a slot to the list for inventory painting. To be used by cWindow only
+	/** Adds a slot to the list for inventory painting. To be used by cWindow only */
 	void AddInventoryPaintSlot(int a_SlotNum);
 	
-	/// Returns the list of slots currently stored for inventory painting. To be used by cWindow only
+	/** Returns the list of slots currently stored for inventory painting. To be used by cWindow only */
 	const cSlotNums & GetInventoryPaintSlots(void) const;
 	
 	// tolua_begin
 	
-	/// Returns the current maximum speed, as reported in the 1.6.1+ protocol (takes current sprinting state into account)
+	/** Returns the current relative maximum speed (takes current sprinting / flying state into account) */
 	double GetMaxSpeed(void) const;
 	
-	/// Gets the normal maximum speed, as reported in the 1.6.1+ protocol, in the protocol units
+	/** Gets the normal relative maximum speed */
 	double GetNormalMaxSpeed(void) const { return m_NormalMaxSpeed; }
 	
-	/// Gets the sprinting maximum speed, as reported in the 1.6.1+ protocol, in the protocol units
+	/** Gets the sprinting relative maximum speed */
 	double GetSprintingMaxSpeed(void) const { return m_SprintingMaxSpeed; }
 	
-	/// Sets the normal maximum speed, as reported in the 1.6.1+ protocol. Sends the update to player, if needed.
+	/** Gets the flying relative maximum speed */
+	double GetFlyingMaxSpeed(void) const { return m_FlyingMaxSpeed; }
+	
+	/** Sets the normal relative maximum speed. Sends the update to player, if needed. */
 	void SetNormalMaxSpeed(double a_Speed);
 	
-	/// Sets the sprinting maximum speed, as reported in the 1.6.1+ protocol. Sends the update to player, if needed.
+	/** Sets the sprinting relative maximum speed. Sends the update to player, if needed. */
 	void SetSprintingMaxSpeed(double a_Speed);
 	
-	/// Sets the crouch status, broadcasts to all visible players
+	/** Sets the flying relative maximum speed. Sends the update to player, if needed. */
+	void SetFlyingMaxSpeed(double a_Speed);
+	
+	/** Sets the crouch status, broadcasts to all visible players */
 	void SetCrouch(bool a_IsCrouched);
 	
-	/// Starts or stops sprinting, sends the max speed update to the client, if needed
+	/** Starts or stops sprinting, sends the max speed update to the client, if needed */
 	void SetSprint(bool a_IsSprinting);
 	
-	/// Flags the player as flying
+	/** Flags the player as flying */
 	void SetFlying(bool a_IsFlying);
 
-	/// If true the player can fly even when he's not in creative.
+	/** If true the player can fly even when he's not in creative. */
 	void SetCanFly(bool a_CanFly);
 
-	/// Returns wheter the player can fly or not.
+	/** Returns wheter the player can fly or not. */
 	virtual bool CanFly(void) const { return m_CanFly; }
 	// tolua_end
 
@@ -371,10 +388,10 @@ protected:
 	GroupList m_ResolvedGroups;
 	GroupList m_Groups;
 
-	std::string m_PlayerName;
-	std::string m_LoadedWorldName;
+	AString m_PlayerName;
+	AString m_LoadedWorldName;
 
-	/// Xp Level stuff
+	/** Xp Level stuff */
 	enum 
 	{
 		XP_TO_LEVEL15 = 255,
@@ -385,22 +402,22 @@ protected:
 	bool m_bVisible;
 
 	// Food-related variables:
-	/// Represents the food bar, one point equals half a "drumstick"
+	/** Represents the food bar, one point equals half a "drumstick" */
 	int m_FoodLevel;
 	
-	/// "Overcharge" for the m_FoodLevel; is depleted before m_FoodLevel
+	/** "Overcharge" for the m_FoodLevel; is depleted before m_FoodLevel */
 	double m_FoodSaturationLevel;
 	
-	/// Count-up to the healing or damaging action, based on m_FoodLevel
+	/** Count-up to the healing or damaging action, based on m_FoodLevel */
 	int   m_FoodTickTimer;
 	
-	/// A "buffer" which adds up hunger before it is substracted from m_FoodSaturationLevel or m_FoodLevel. Each action adds a little
+	/** A "buffer" which adds up hunger before it is substracted from m_FoodSaturationLevel or m_FoodLevel. Each action adds a little */
 	double m_FoodExhaustionLevel;
 	
-	/// Number of ticks remaining for the foodpoisoning effect; zero if not foodpoisoned
+	/** Number of ticks remaining for the foodpoisoning effect; zero if not foodpoisoned */
 	int m_FoodPoisonedTicksRemaining;
 	
-	/// Last position that has been recorded for food-related processing:
+	/** Last position that has been recorded for food-related processing: */
 	Vector3d m_LastFoodPos;
 	
 	float m_LastJumpHeight;
@@ -416,7 +433,7 @@ protected:
 	eGameMode m_GameMode;
 	AString m_IP;
 	
-	/// The item being dragged by the cursor while in a UI window
+	/** The item being dragged by the cursor while in a UI window */
 	cItem m_DraggingItem;
 
 	long long m_LastPlayerListTime;
@@ -426,12 +443,21 @@ protected:
 	
 	cSlotNums m_InventoryPaintSlots;
 	
-	/// Max speed, in ENTITY_PROPERTIES packet's units, when the player is walking. 0.1 by default
+	/** Max speed, relative to the game default.
+	1 means regular speed, 2 means twice as fast, 0.5 means half-speed.
+	Default value is 1. */
 	double m_NormalMaxSpeed;
 	
-	/// Max speed, in ENTITY_PROPERTIES packet's units, when the player is sprinting. 0.13 by default
+	/** Max speed, relative to the game default max speed, when sprinting.
+	1 means regular speed, 2 means twice as fast, 0.5 means half-speed.
+	Default value is 1.3. */
 	double m_SprintingMaxSpeed;
 	
+	/** Max speed, relative to the game default flying max speed, when flying.
+	1 means regular speed, 2 means twice as fast, 0.5 means half-speed.
+	Default value is 1. */
+	double m_FlyingMaxSpeed;
+	
 	bool m_IsCrouched;
 	bool m_IsSprinting;
 	bool m_IsFlying;
@@ -441,10 +467,10 @@ protected:
 
 	bool m_CanFly;  // If this is true the player can fly. Even if he is not in creative.
 
-	/// The world tick in which eating will be finished. -1 if not eating
+	/** The world tick in which eating will be finished. -1 if not eating */
 	Int64 m_EatingFinishTick;
 
-	/// Player Xp level
+	/** Player Xp level */
 	short int m_LifetimeTotalXp;
 	short int m_CurrentXp;
 
@@ -456,7 +482,7 @@ protected:
 
 	int m_FloaterID;
 
-	cTeam* m_Team;
+	cTeam * m_Team;
 
 
 
@@ -465,20 +491,25 @@ protected:
 
 	virtual void Destroyed(void);
 
-	/// Filters out damage for creative mode/friendly fire
+	/** Filters out damage for creative mode/friendly fire */
 	virtual void DoTakeDamage(TakeDamageInfo & TDI) override;
 
 	/** Stops players from burning in creative mode */
 	virtual void TickBurning(cChunk & a_Chunk) override;
 	
-	/// Called in each tick to handle food-related processing
+	/** Called in each tick to handle food-related processing */
 	void HandleFood(void);
 
-	/// Called in each tick if the player is fishing to make sure the floater dissapears when the player doesn't have a fishing rod as equipped item.
+	/** Called in each tick if the player is fishing to make sure the floater dissapears when the player doesn't have a fishing rod as equipped item. */
 	void HandleFloater(void);
 
-	/// Adds food exhaustion based on the difference between Pos and LastPos, sprinting status and swimming (in water block)
+	/** Adds food exhaustion based on the difference between Pos and LastPos, sprinting status and swimming (in water block) */
 	void ApplyFoodExhaustionFromMovement();
+
+	/** Flag representing whether the player is currently in a bed
+	Set by a right click on unoccupied bed, unset by a time fast forward or teleport */
+	bool m_bIsInBed;
+
 } ; // tolua_export
 
 
diff --git a/src/Entities/ProjectileEntity.cpp b/src/Entities/ProjectileEntity.cpp
index f4ab825f2..a9735a53c 100644
--- a/src/Entities/ProjectileEntity.cpp
+++ b/src/Entities/ProjectileEntity.cpp
@@ -4,6 +4,7 @@
 // Implements the cProjectileEntity class representing the common base class for projectiles, as well as individual projectile types
 
 #include "Globals.h"
+#include "../Bindings/PluginManager.h"
 #include "ProjectileEntity.h"
 #include "../ClientHandle.h"
 #include "Player.h"
@@ -66,6 +67,11 @@ protected:
 			eBlockFace Face;
 			if (bb.CalcLineIntersection(Line1, Line2, LineCoeff, Face))
 			{
+				if (cPluginManager::Get()->CallHookProjectileHitBlock(*m_Projectile))
+				{
+					return false;
+				}
+
 				Vector3d Intersection = Line1 + m_Projectile->GetSpeed() * LineCoeff;
 				m_Projectile->OnHitSolidBlock(Intersection, Face);
 				return true;
@@ -147,7 +153,11 @@ public:
 		}
 
 		// TODO: Some entities don't interact with the projectiles (pickups, falling blocks)
-		// TODO: Allow plugins to interfere about which entities can be hit
+		if (cPluginManager::Get()->CallHookProjectileHitEntity(*m_Projectile, *a_Entity))
+		{
+			// A plugin disagreed.
+			return false;
+		}
 		
 		if (LineCoeff < m_MinCoeff)
 		{
diff --git a/src/ForEachChunkProvider.h b/src/ForEachChunkProvider.h
index 6017173ee..7a6e8c5c6 100644
--- a/src/ForEachChunkProvider.h
+++ b/src/ForEachChunkProvider.h
@@ -24,6 +24,8 @@ class cBlockArea;
 class cForEachChunkProvider
 {
 public:
+	virtual ~cForEachChunkProvider() {}
+	
 	/** Calls the callback for each chunk in the specified range. */
 	virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) = 0;
 	
diff --git a/src/Generating/BioGen.cpp b/src/Generating/BioGen.cpp
index 967deba6a..32a687201 100644
--- a/src/Generating/BioGen.cpp
+++ b/src/Generating/BioGen.cpp
@@ -371,8 +371,8 @@ void cBioGenDistortedVoronoi::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::B
 		Distort(BaseX + x * 4, BaseZ + z * 4, DistortX[4 * x][4 * z], DistortZ[4 * x][4 * z]);
 	}
 	
-	LinearUpscale2DArrayInPlace(&DistortX[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
-	LinearUpscale2DArrayInPlace(&DistortZ[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
+	LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortX[0][0]);
+	LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortZ[0][0]);
 	
 	for (int z = 0; z < cChunkDef::Width; z++)
 	{
@@ -477,8 +477,8 @@ void cBioGenMultiStepMap::DecideOceanLandMushroom(int a_ChunkX, int a_ChunkZ, cC
 	{
 		Distort(BaseX + x * 4, BaseZ + z * 4, DistortX[4 * x][4 * z], DistortZ[4 * x][4 * z], DistortSize);
 	}
-	LinearUpscale2DArrayInPlace(&DistortX[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
-	LinearUpscale2DArrayInPlace(&DistortZ[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
+	LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortX[0][0]);
+	LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortZ[0][0]);
 	
 	// Prepare a 9x9 area of neighboring cell seeds
 	// (assuming that 7x7 cell area is larger than a chunk being generated)
@@ -651,8 +651,8 @@ void cBioGenMultiStepMap::BuildTemperatureHumidityMaps(int a_ChunkX, int a_Chunk
 			HumidityMap[x + 17 * z] = NoiseH;
 		}  // for x
 	}  // for z
-	LinearUpscale2DArrayInPlace(TemperatureMap, 17, 17, 8, 8);
-	LinearUpscale2DArrayInPlace(HumidityMap,    17, 17, 8, 8);
+	LinearUpscale2DArrayInPlace<17, 17, 8, 8>(TemperatureMap);
+	LinearUpscale2DArrayInPlace<17, 17, 8, 8>(HumidityMap);
 	
 	// Re-map into integral values in [0 .. 255] range:
 	for (size_t idx = 0; idx < ARRAYCOUNT(a_TemperatureMap); idx++)
@@ -778,8 +778,8 @@ void cBioGenTwoLevel::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap
 		DistortZ[4 * x][4 * z] = BlockZ + (int)(64 * NoiseZ);
 	}
 	
-	LinearUpscale2DArrayInPlace(&DistortX[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
-	LinearUpscale2DArrayInPlace(&DistortZ[0][0], cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4);
+	LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortX[0][0]);
+	LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortZ[0][0]);
 	
 	// Apply distortion to each block coord, then query the voronoi maps for biome group and biome index and choose biome based on that:
 	for (int z = 0; z < cChunkDef::Width; z++)
diff --git a/src/Generating/ChunkDesc.cpp b/src/Generating/ChunkDesc.cpp
index 308fbe423..7711723fc 100644
--- a/src/Generating/ChunkDesc.cpp
+++ b/src/Generating/ChunkDesc.cpp
@@ -343,9 +343,9 @@ void cChunkDesc::ReadBlockArea(cBlockArea & a_Dest, int a_MinRelX, int a_MaxRelX
 	int SizeY = a_MaxRelY - a_MinRelY;
 	int SizeZ = a_MaxRelZ - a_MinRelZ;
 	a_Dest.Clear();
-	a_Dest.m_OriginX = m_ChunkX * cChunkDef::Width + a_MinRelX;
-	a_Dest.m_OriginY = a_MinRelY;
-	a_Dest.m_OriginZ = m_ChunkZ * cChunkDef::Width + a_MinRelZ;
+	a_Dest.m_Origin.x = m_ChunkX * cChunkDef::Width + a_MinRelX;
+	a_Dest.m_Origin.y = a_MinRelY;
+	a_Dest.m_Origin.z = m_ChunkZ * cChunkDef::Width + a_MinRelZ;
 	a_Dest.SetSize(SizeX, SizeY, SizeZ, cBlockArea::baTypes | cBlockArea::baMetas);
 
 	for (int y = 0; y < SizeY; y++)
diff --git a/src/Generating/CompoGen.cpp b/src/Generating/CompoGen.cpp
index 60356fe46..578bb2481 100644
--- a/src/Generating/CompoGen.cpp
+++ b/src/Generating/CompoGen.cpp
@@ -566,7 +566,7 @@ void cCompoGenNether::ComposeTerrain(cChunkDesc & a_ChunkDesc)
 			m_Noise2.IntNoise3DInt(BaseX + INTERPOL_X * x, 0, BaseZ + INTERPOL_Z * z) /
 			256;
 	}  // for x, z - FloorLo[]
-	LinearUpscale2DArrayInPlace(FloorLo, 17, 17, INTERPOL_X, INTERPOL_Z);
+	LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorLo);
 	
 	// Interpolate segments:
 	for (int Segment = 0; Segment < MaxHeight; Segment += SEGMENT_HEIGHT)
@@ -579,7 +579,7 @@ void cCompoGenNether::ComposeTerrain(cChunkDesc & a_ChunkDesc)
 				m_Noise2.IntNoise3DInt(BaseX + INTERPOL_Z * x, Segment + SEGMENT_HEIGHT, BaseZ + INTERPOL_Z * z) /
 				256;
 		}  // for x, z - FloorLo[]
-		LinearUpscale2DArrayInPlace(FloorHi, 17, 17, INTERPOL_X, INTERPOL_Z);
+		LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorHi);
 		
 		// Interpolate between FloorLo and FloorHi:
 		for (int z = 0; z < 16; z++) for (int x = 0; x < 16; x++)
diff --git a/src/Generating/ComposableGenerator.cpp b/src/Generating/ComposableGenerator.cpp
index 6c00b5905..2e886336f 100644
--- a/src/Generating/ComposableGenerator.cpp
+++ b/src/Generating/ComposableGenerator.cpp
@@ -21,6 +21,7 @@
 #include "DistortedHeightmap.h"
 #include "EndGen.h"
 #include "MineShafts.h"
+#include "NetherFortGen.h"
 #include "Noise3DGenerator.h"
 #include "POCPieceGenerator.h"
 #include "Ravines.h"
@@ -191,9 +192,11 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a
 		m_HeightGen->GenHeightMap(a_ChunkX, a_ChunkZ, a_ChunkDesc.GetHeightMap());
 	}
 	
+	bool ShouldUpdateHeightmap = false;
 	if (a_ChunkDesc.IsUsingDefaultComposition())
 	{
 		m_CompositionGen->ComposeTerrain(a_ChunkDesc);
+		ShouldUpdateHeightmap = true;
 	}
 
 	if (a_ChunkDesc.IsUsingDefaultFinish())
@@ -202,6 +205,12 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a
 		{
 			(*itr)->GenFinish(a_ChunkDesc);
 		}  // for itr - m_FinishGens[]
+		ShouldUpdateHeightmap = true;
+	}
+	
+	if (ShouldUpdateHeightmap)
+	{
+		a_ChunkDesc.UpdateHeightmap();
 	}
 }
 
@@ -349,7 +358,7 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile)
 			int ChanceCrossing  = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceCrossing",  200);
 			int ChanceStaircase = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceStaircase", 200);
 			m_FinishGens.push_back(new cStructGenMineShafts(
-				Seed, GridSize, MaxSystemSize, 
+				Seed, GridSize, MaxSystemSize,
 				ChanceCorridor, ChanceCrossing, ChanceStaircase
 			));
 		}
@@ -361,6 +370,12 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile)
 		{
 			m_FinishGens.push_back(new cFinishGenNetherClumpFoliage(Seed));
 		}
+		else if (NoCaseCompare(*itr, "NetherForts") == 0)
+		{
+			int GridSize = a_IniFile.GetValueSetI("Generator", "NetherFortsGridSize", 512);
+			int MaxDepth = a_IniFile.GetValueSetI("Generator", "NetherFortsMaxDepth", 12);
+			m_FinishGens.push_back(new cNetherFortGen(Seed, GridSize, MaxDepth));
+		}
 		else if (NoCaseCompare(*itr, "OreNests") == 0)
 		{
 			m_FinishGens.push_back(new cStructGenOreNests(Seed));
diff --git a/src/Generating/HeiGen.cpp b/src/Generating/HeiGen.cpp
index 10710b4a1..3621421c2 100644
--- a/src/Generating/HeiGen.cpp
+++ b/src/Generating/HeiGen.cpp
@@ -428,7 +428,7 @@ void cHeiGenBiomal::GenHeightMap(int a_ChunkX, int a_ChunkZ, cChunkDef::HeightMa
 			Height[x + 17 * z] = GetHeightAt(x, z, a_ChunkX, a_ChunkZ, Biomes);
 		}
 	}
-	LinearUpscale2DArrayInPlace(Height, 17, 17, STEPX, STEPZ);
+	LinearUpscale2DArrayInPlace<17, 17, STEPX, STEPZ>(Height);
 	
 	// Copy into the heightmap
 	for (int z = 0; z < cChunkDef::Width; z++)
diff --git a/src/Generating/MineShafts.cpp b/src/Generating/MineShafts.cpp
index 28dc37567..231295c3f 100644
--- a/src/Generating/MineShafts.cpp
+++ b/src/Generating/MineShafts.cpp
@@ -1340,7 +1340,7 @@ void cStructGenMineShafts::GetMineShaftSystemsForChunk(
 	BaseX -= NEIGHBORHOOD_SIZE / 2;
 	BaseZ -= NEIGHBORHOOD_SIZE / 2;
 
-	// Walk the cache, move each cave system that we want into a_Caves:
+	// Walk the cache, move each cave system that we want into a_Mineshafts:
 	int StartX = BaseX * m_GridSize;
 	int EndX = (BaseX + NEIGHBORHOOD_SIZE + 1) * m_GridSize;
 	int StartZ = BaseZ * m_GridSize;
diff --git a/src/Generating/NetherFortGen.cpp b/src/Generating/NetherFortGen.cpp
new file mode 100644
index 000000000..02779a8a3
--- /dev/null
+++ b/src/Generating/NetherFortGen.cpp
@@ -0,0 +1,275 @@
+
+// NetherFortGen.cpp
+
+// Implements the cNetherFortGen class representing the nether fortress generator
+
+#include "Globals.h"
+#include "NetherFortGen.h"
+#include "Prefabs/NetherFortPrefabs.h"
+
+
+
+
+
+static const int NEIGHBORHOOD_SIZE = 3;
+
+
+
+
+
+///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+// cNetherFortGen::cNetherFort:
+
+class cNetherFortGen::cNetherFort
+{
+public:
+	cNetherFortGen & m_ParentGen;
+	int m_BlockX, m_BlockZ;
+	int m_GridSize;
+	int m_Seed;
+	cPlacedPieces m_Pieces;
+
+
+	cNetherFort(cNetherFortGen & a_ParentGen, int a_BlockX, int a_BlockZ, int a_GridSize, int a_MaxDepth, int a_Seed) :
+		m_ParentGen(a_ParentGen),
+		m_BlockX(a_BlockX),
+		m_BlockZ(a_BlockZ),
+		m_GridSize(a_GridSize),
+		m_Seed(a_Seed)
+	{
+		// TODO: Proper Y-coord placement
+		int BlockY = 64;
+		
+		// Generate pieces:
+		for (int i = 0; m_Pieces.size() < (size_t)(a_MaxDepth * a_MaxDepth / 8 + a_MaxDepth); i++)
+		{
+			cBFSPieceGenerator pg(m_ParentGen, a_Seed + i);
+			pg.PlacePieces(a_BlockX, BlockY, a_BlockZ, a_MaxDepth, m_Pieces);
+		}
+	}
+
+	
+	~cNetherFort()
+	{
+		cPieceGenerator::FreePieces(m_Pieces);
+	}
+	
+		
+	/** Carves the system into the chunk data */
+	void ProcessChunk(cChunkDesc & a_Chunk)
+	{
+		for (cPlacedPieces::const_iterator itr = m_Pieces.begin(), end = m_Pieces.end(); itr != end; ++itr)
+		{
+			const cPrefab & Prefab = (const cPrefab &)((*itr)->GetPiece());
+			Prefab.Draw(a_Chunk, *itr);
+		}  // for itr - m_PlacedPieces[]
+	}
+};
+
+
+
+
+
+///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+// cNetherFortGen:
+
+cNetherFortGen::cNetherFortGen(int a_Seed, int a_GridSize, int a_MaxDepth) :
+	m_Seed(a_Seed),
+	m_Noise(a_Seed),
+	m_GridSize(a_GridSize),
+	m_MaxDepth(a_MaxDepth)
+{
+	// Initialize the prefabs:
+	for (size_t i = 0; i < g_NetherFortPrefabs1Count; i++)
+	{
+		cPrefab * Prefab = new cPrefab(g_NetherFortPrefabs1[i]);
+		m_AllPieces.push_back(Prefab);
+		if (Prefab->HasConnectorType(0))
+		{
+			m_OuterPieces.push_back(Prefab);
+		}
+		if (Prefab->HasConnectorType(1))
+		{
+			m_InnerPieces.push_back(Prefab);
+		}
+	}
+	
+	// Initialize the starting piece prefabs:
+	for (size_t i = 0; i < g_NetherFortStartingPrefabs1Count; i++)
+	{
+		m_StartingPieces.push_back(new cPrefab(g_NetherFortStartingPrefabs1[i]));
+	}
+
+	// DEBUG: Try one round of placement:
+	cPlacedPieces Pieces;
+	cBFSPieceGenerator pg(*this, a_Seed);
+	pg.PlacePieces(0, 64, 0, a_MaxDepth, Pieces);
+}
+
+
+
+
+
+cNetherFortGen::~cNetherFortGen()
+{
+	ClearCache();
+	for (cPieces::iterator itr = m_AllPieces.begin(), end = m_AllPieces.end(); itr != end; ++itr)
+	{
+		delete *itr;
+	}  // for itr - m_AllPieces[]
+	m_AllPieces.clear();
+}
+
+
+
+
+
+void cNetherFortGen::ClearCache(void)
+{
+	// TODO
+}
+
+
+
+
+
+void cNetherFortGen::GetFortsForChunk(int a_ChunkX, int a_ChunkZ, cNetherForts & a_Forts)
+{
+	int BaseX = a_ChunkX * cChunkDef::Width / m_GridSize;
+	int BaseZ = a_ChunkZ * cChunkDef::Width / m_GridSize;
+	if (BaseX < 0)
+	{
+		--BaseX;
+	}
+	if (BaseZ < 0)
+	{
+		--BaseZ;
+	}
+	BaseX -= NEIGHBORHOOD_SIZE / 2;
+	BaseZ -= NEIGHBORHOOD_SIZE / 2;
+
+	// Walk the cache, move each cave system that we want into a_Forts:
+	int StartX = BaseX * m_GridSize;
+	int EndX = (BaseX + NEIGHBORHOOD_SIZE + 1) * m_GridSize;
+	int StartZ = BaseZ * m_GridSize;
+	int EndZ = (BaseZ + NEIGHBORHOOD_SIZE + 1) * m_GridSize;
+	for (cNetherForts::iterator itr = m_Cache.begin(), end = m_Cache.end(); itr != end;)
+	{
+		if (
+			((*itr)->m_BlockX >= StartX) && ((*itr)->m_BlockX < EndX) &&
+			((*itr)->m_BlockZ >= StartZ) && ((*itr)->m_BlockZ < EndZ)
+		)
+		{
+			// want
+			a_Forts.push_back(*itr);
+			itr = m_Cache.erase(itr);
+		}
+		else
+		{
+			// don't want
+			++itr;
+		}
+	}  // for itr - m_Cache[]
+
+	// Create those forts that haven't been in the cache:
+	for (int x = 0; x < NEIGHBORHOOD_SIZE; x++)
+	{
+		int RealX = (BaseX + x) * m_GridSize;
+		for (int z = 0; z < NEIGHBORHOOD_SIZE; z++)
+		{
+			int RealZ = (BaseZ + z) * m_GridSize;
+			bool Found = false;
+			for (cNetherForts::const_iterator itr = a_Forts.begin(), end = a_Forts.end(); itr != end; ++itr)
+			{
+				if (((*itr)->m_BlockX == RealX) && ((*itr)->m_BlockZ == RealZ))
+				{
+					Found = true;
+					break;
+				}
+			}  // for itr - a_Mineshafts
+			if (!Found)
+			{
+				a_Forts.push_back(new cNetherFort(*this, RealX, RealZ, m_GridSize, m_MaxDepth, m_Seed));
+			}
+		}  // for z
+	}  // for x
+
+	// Copy a_Forts into m_Cache to the beginning:
+	cNetherForts FortsCopy (a_Forts);
+	m_Cache.splice(m_Cache.begin(), FortsCopy, FortsCopy.begin(), FortsCopy.end());
+
+	// Trim the cache if it's too long:
+	if (m_Cache.size() > 100)
+	{
+		cNetherForts::iterator itr = m_Cache.begin();
+		std::advance(itr, 100);
+		for (cNetherForts::iterator end = m_Cache.end(); itr != end; ++itr)
+		{
+			delete *itr;
+		}
+		itr = m_Cache.begin();
+		std::advance(itr, 100);
+		m_Cache.erase(itr, m_Cache.end());
+	}
+}
+
+
+
+
+
+void cNetherFortGen::GenFinish(cChunkDesc & a_ChunkDesc)
+{
+	int ChunkX = a_ChunkDesc.GetChunkX();
+	int ChunkZ = a_ChunkDesc.GetChunkZ();
+	cNetherForts Forts;
+	GetFortsForChunk(ChunkX, ChunkZ, Forts);
+	for (cNetherForts::const_iterator itr = Forts.begin(); itr != Forts.end(); ++itr)
+	{
+		(*itr)->ProcessChunk(a_ChunkDesc);
+	}  // for itr - Forts[]
+}
+
+
+
+
+
+cPieces cNetherFortGen::GetPiecesWithConnector(int a_ConnectorType)
+{
+	switch (a_ConnectorType)
+	{
+		case 0: return m_OuterPieces;
+		case 1: return m_InnerPieces;
+		default: return cPieces();
+	}
+}
+
+
+
+
+
+cPieces cNetherFortGen::GetStartingPieces(void)
+{
+	return m_StartingPieces;
+}
+
+
+
+
+
+void cNetherFortGen::PiecePlaced(const cPiece & a_Piece)
+{
+	UNUSED(a_Piece);
+}
+
+
+
+
+
+void cNetherFortGen::Reset(void)
+{
+	// Nothing needed
+}
+
+
+
+
diff --git a/src/Generating/NetherFortGen.h b/src/Generating/NetherFortGen.h
new file mode 100644
index 000000000..10ba01396
--- /dev/null
+++ b/src/Generating/NetherFortGen.h
@@ -0,0 +1,86 @@
+
+// NetherFortGen.h
+
+// Declares the cNetherFortGen class representing the nether fortress generator
+
+
+
+
+
+#pragma once
+
+#include "ComposableGenerator.h"
+#include "PieceGenerator.h"
+
+
+
+
+
+class cNetherFortGen :
+	public cFinishGen,
+	public cPiecePool
+{
+public:
+	cNetherFortGen(int a_Seed, int a_GridSize, int a_MaxDepth);
+	
+	virtual ~cNetherFortGen();
+	
+protected:
+	class cNetherFort;  // fwd: NetherFortGen.cpp
+	typedef std::list<cNetherFort *> cNetherForts;
+	
+	
+	/** The seed used for generating*/
+	int m_Seed;
+	
+	/** The noise used for generating */
+	cNoise m_Noise;
+	
+	/** Average spacing between the fortresses*/
+	int m_GridSize;
+	
+	/** Maximum depth of the piece-generator tree */
+	int m_MaxDepth;
+
+	/** Cache of the most recently used systems. MoveToFront used. */
+	cNetherForts m_Cache;
+	
+	/** All the pieces that are allowed for building.
+	This is the list that's used for memory allocation and deallocation for the pieces. */
+	cPieces m_AllPieces;
+	
+	/** The pieces that are used as starting pieces.
+	This list is not shared and the pieces need deallocation. */
+	cPieces m_StartingPieces;
+	
+	/** The pieces that have an "outer" connector.
+	The pieces are copies out of m_AllPieces and shouldn't be ever delete-d. */
+	cPieces m_OuterPieces;
+
+	/** The pieces that have an "inner" connector.
+	The pieces are copies out of m_AllPieces and shouldn't be ever delete-d. */
+	cPieces m_InnerPieces;
+
+
+	/** Clears everything from the cache.
+	Also invalidates the forst returned by GetFortsForChunk(). */
+	void ClearCache(void);
+	
+	/** Returns all forts that *may* intersect the given chunk.
+	The returned forts live within m_Cache.They are valid until the next call
+	to this function (which may delete some of the pointers).	*/
+	void GetFortsForChunk(int a_ChunkX, int a_ChunkZ, cNetherForts & a_Forts);
+
+	// cFinishGen overrides:
+	virtual void GenFinish(cChunkDesc & a_ChunkDesc) override;
+	
+	// cPiecePool overrides:
+	virtual cPieces GetPiecesWithConnector(int a_ConnectorType) override;
+	virtual cPieces GetStartingPieces(void) override;
+	virtual void PiecePlaced(const cPiece & a_Piece) override;
+	virtual void Reset(void) override;
+} ;
+
+
+
+
diff --git a/src/Generating/Noise3DGenerator.cpp b/src/Generating/Noise3DGenerator.cpp
index afa40c647..15a588d45 100644
--- a/src/Generating/Noise3DGenerator.cpp
+++ b/src/Generating/Noise3DGenerator.cpp
@@ -420,7 +420,7 @@ void cNoise3DComposable::GenerateNoiseArrayIfNeeded(int a_ChunkX, int a_ChunkZ)
 			}
 		}
 		// Linear-interpolate this XZ floor:
-		LinearUpscale2DArrayInPlace(CurFloor, 17, 17, UPSCALE_X, UPSCALE_Z);
+		LinearUpscale2DArrayInPlace<17, 17, UPSCALE_X, UPSCALE_Z>(CurFloor);
 	}
 
 	// Finish the 3D linear interpolation by interpolating between each XZ-floors on the Y axis
diff --git a/src/Generating/Prefab.cpp b/src/Generating/Prefab.cpp
new file mode 100644
index 000000000..131b6acb2
--- /dev/null
+++ b/src/Generating/Prefab.cpp
@@ -0,0 +1,316 @@
+
+// Prefab.cpp
+
+/*
+Implements the cPrefab class, representing a cPiece descendant for the cPieceGenerator that
+uses a prefabricate in a cBlockArea for drawing itself.
+*/
+
+#include "Globals.h"
+#include "Prefab.h"
+#include "../WorldStorage/SchematicFileSerializer.h"
+#include "ChunkDesc.h"
+
+
+
+
+
+#ifdef SELF_TEST
+
+// Create one static prefab to test the parser:
+static const cPrefab::sDef g_TestPrefabDef =
+{
+	// Size:
+	7, 6, 7,  // SizeX = 7, SizeY = 6, SizeZ = 7
+
+	// Block definitions:
+	".:  0: 0\n"  /* 0 */
+	"a:112: 0\n"  /* netherbrick */
+	"b:113: 0\n"  /* netherbrickfence */,
+
+	// Block data:
+	// Level 1
+	"aaaaaaa"
+	"aaaaaaa"
+	"aaaaaaa"
+	"aaaaaaa"
+	"aaaaaaa"
+	"aaaaaaa"
+	"aaaaaaa"
+
+	// Level 2
+	"aa...aa"
+	"a.....a"
+	"......."
+	"......."
+	"......."
+	"a.....a"
+	"aa...aa"
+
+	// Level 3
+	"aa...aa"
+	"a.....a"
+	"......."
+	"......."
+	"......."
+	"a.....a"
+	"aa...aa"
+
+	// Level 4
+	"aa...aa"
+	"a.....a"
+	"......."
+	"......."
+	"......."
+	"a.....a"
+	"aa...aa"
+
+	// Level 5
+	"aabbbaa"
+	"a.....a"
+	"b.....b"
+	"b.....b"
+	"b.....b"
+	"a.....a"
+	"aabbbaa"
+
+	// Level 6
+	"aaaaaaa"
+	"a.....a"
+	"a.....a"
+	"a.....a"
+	"a.....a"
+	"a.....a"
+	"aaaaaaa",
+	
+	// Connections:
+	"0: 0, 3, 2: 4\n"
+	"0: 2, 3, 0: 2\n",
+	
+	// AllowedRotations:
+	7,  /* 1, 2, 3 CCW rotations */
+	
+	// Merge strategy:
+	cBlockArea::msImprint
+};
+
+static cPrefab g_TestPrefab(g_TestPrefabDef);
+#endif
+
+
+
+
+
+cPrefab::cPrefab(const cPrefab::sDef & a_Def) :
+	m_Size(a_Def.m_SizeX, a_Def.m_SizeY, a_Def.m_SizeZ),
+	m_HitBox(0, 0, 0, a_Def.m_SizeX - 1, a_Def.m_SizeY - 1, a_Def.m_SizeZ - 1),
+	m_AllowedRotations(a_Def.m_AllowedRotations),
+	m_MergeStrategy(a_Def.m_MergeStrategy)
+{
+	m_BlockArea[0].Create(m_Size);
+	CharMap cm;
+	ParseCharMap(cm, a_Def.m_CharMap);
+	ParseBlockImage(cm, a_Def.m_Image);
+	ParseConnectors(a_Def.m_Connectors);
+	
+	// 1 CCW rotation:
+	if ((m_AllowedRotations & 0x01) != 0)
+	{
+		m_BlockArea[1].CopyFrom(m_BlockArea[0]);
+		m_BlockArea[1].RotateCCW();
+	}
+	
+	// 2 rotations are the same as mirroring twice; mirroring is faster because it has no reallocations
+	if ((m_AllowedRotations & 0x02) != 0)
+	{
+		m_BlockArea[2].CopyFrom(m_BlockArea[0]);
+		m_BlockArea[2].MirrorXY();
+		m_BlockArea[2].MirrorYZ();
+	}	
+	
+	// 3 CCW rotations = 1 CW rotation:
+	if ((m_AllowedRotations & 0x04) != 0)
+	{
+		m_BlockArea[3].CopyFrom(m_BlockArea[0]);
+		m_BlockArea[3].RotateCW();
+	}
+}
+
+
+
+
+
+void cPrefab::Draw(cChunkDesc & a_Dest, const cPlacedPiece * a_Placement) const
+{
+	Vector3i Placement = a_Placement->GetCoords();
+	int ChunkStartX = a_Dest.GetChunkX() * cChunkDef::Width;
+	int ChunkStartZ = a_Dest.GetChunkZ() * cChunkDef::Width;
+	Placement.Move(-ChunkStartX, 0, -ChunkStartZ);
+	a_Dest.WriteBlockArea(m_BlockArea[a_Placement->GetNumCCWRotations()], Placement.x, Placement.y, Placement.z, m_MergeStrategy);
+	
+}
+
+
+
+
+
+bool cPrefab::HasConnectorType(int a_ConnectorType) const
+{
+	for (cConnectors::const_iterator itr = m_Connectors.begin(), end = m_Connectors.end(); itr != end; ++itr)
+	{
+		if (itr->m_Type == a_ConnectorType)
+		{
+			return true;
+		}
+	}  // for itr - m_Connectors[]
+	return false;
+}
+
+
+
+
+
+void cPrefab::ParseCharMap(CharMap & a_CharMapOut, const char * a_CharMapDef)
+{
+	ASSERT(a_CharMapDef != NULL);
+	
+	// Initialize the charmap to all-invalid values:
+	for (size_t i = 0; i < ARRAYCOUNT(a_CharMapOut); i++)
+	{
+		a_CharMapOut[i].m_BlockType = 0;
+		a_CharMapOut[i].m_BlockMeta = 16;  // Mark unassigned entries with a meta that is impossible otherwise
+	}
+	
+	// Process the lines in the definition:
+	AStringVector Lines = StringSplitAndTrim(a_CharMapDef, "\n");
+	for (AStringVector::const_iterator itr = Lines.begin(), end = Lines.end(); itr != end; ++itr)
+	{
+		AStringVector CharDef = StringSplitAndTrim(*itr, ":");
+		size_t NumElements = CharDef.size();
+		if ((NumElements < 2) || CharDef[0].empty() || CharDef[1].empty())
+		{
+			LOGWARNING("Bad prefab CharMap definition line: \"%s\", skipping.", itr->c_str());
+			continue;
+		}
+		unsigned char Src = (unsigned char)CharDef[0][0];
+		ASSERT(a_CharMapOut[Src].m_BlockMeta == 16);  // This letter has not been assigned yet?
+		a_CharMapOut[Src].m_BlockType = (BLOCKTYPE)atoi(CharDef[1].c_str());
+		NIBBLETYPE BlockMeta = 0;
+		if ((NumElements >= 3) && !CharDef[2].empty())
+		{
+			BlockMeta = (NIBBLETYPE)atoi(CharDef[2].c_str());
+			ASSERT((BlockMeta >= 0) && (BlockMeta <= 15));
+		}
+		a_CharMapOut[Src].m_BlockMeta = BlockMeta;
+	}  // for itr - Lines[]
+}
+
+
+
+
+
+void cPrefab::ParseBlockImage(const CharMap & a_CharMap, const char * a_BlockImage)
+{
+	// Map each letter in the a_BlockImage (from the in-source definition) to real blocktype / blockmeta:
+	for (int y = 0; y < m_Size.y; y++)
+	{
+		for (int z = 0; z < m_Size.z; z++)
+		{
+			const unsigned char * BlockImage = (const unsigned char *)a_BlockImage + y * m_Size.x * m_Size.z + z * m_Size.x;
+			for (int x = 0; x < m_Size.x; x++)
+			{
+				const sBlockTypeDef & MappedValue = a_CharMap[BlockImage[x]];
+				ASSERT(MappedValue.m_BlockMeta != 16);  // Using a letter not defined in the CharMap?
+				m_BlockArea[0].SetRelBlockTypeMeta(x, y, z, MappedValue.m_BlockType, MappedValue.m_BlockMeta);
+			}
+		}
+	}
+}
+
+
+
+
+
+void cPrefab::ParseConnectors(const char * a_ConnectorsDef)
+{
+	ASSERT(a_ConnectorsDef != NULL);
+	
+	AStringVector Lines = StringSplitAndTrim(a_ConnectorsDef, "\n");
+	for (AStringVector::const_iterator itr = Lines.begin(), end = Lines.end(); itr != end; ++itr)
+	{
+		if (itr->empty())
+		{
+			continue;
+		}
+		// Split into components: "Type: X, Y, Z: Face":
+		AStringVector Defs = StringSplitAndTrim(*itr, ":");
+		if (Defs.size() != 3)
+		{
+			LOGWARNING("Bad prefab Connector definition line: \"%s\", skipping.", itr->c_str());
+			continue;
+		}
+		AStringVector Coords = StringSplitAndTrim(Defs[1], ",");
+		if (Coords.size() != 3)
+		{
+			LOGWARNING("Bad prefab Connector coords definition: \"%s\", skipping.", Defs[1].c_str());
+			continue;
+		}
+		
+		// Check that the BlockFace is within range:
+		int BlockFace = atoi(Defs[2].c_str());
+		if ((BlockFace < 0) || (BlockFace >= 6))
+		{
+			LOGWARNING("Bad prefab Connector Blockface: \"%s\", skipping.", Defs[2].c_str());
+			continue;
+		}
+
+		// Add the connector:
+		m_Connectors.push_back(cPiece::cConnector(
+			atoi(Coords[0].c_str()), atoi(Coords[1].c_str()), atoi(Coords[2].c_str()),  // Connector pos
+			atoi(Defs[0].c_str()),  // Connector type
+			(eBlockFace)BlockFace
+		));
+	}  // for itr - Lines[]
+}
+
+
+
+
+
+cPiece::cConnectors cPrefab::GetConnectors(void) const
+{
+	return m_Connectors;
+}
+
+
+
+
+
+Vector3i cPrefab::GetSize(void) const
+{
+	return m_Size;
+}
+
+
+
+
+
+cCuboid cPrefab::GetHitBox(void) const
+{
+	return m_HitBox;
+}
+
+
+
+
+
+bool cPrefab::CanRotateCCW(int a_NumRotations) const
+{
+	// Either zero rotations
+	// Or the proper bit in m_AllowedRotations is set
+	return (a_NumRotations == 0) || ((m_AllowedRotations & (1 << ((a_NumRotations + 3) % 4))) != 0);
+}
+
+
+
+
diff --git a/src/Generating/Prefab.h b/src/Generating/Prefab.h
new file mode 100644
index 000000000..04c4f09da
--- /dev/null
+++ b/src/Generating/Prefab.h
@@ -0,0 +1,105 @@
+
+// Prefab.h
+
+/*
+Declares the cPrefab class, representing a cPiece descendant for the cPieceGenerator that
+uses a prefabricate in a cBlockArea for drawing itself.
+The class can be constructed from data that is stored directly in the executable, in a sPrefabDef structure
+declared in this file as well; the Gallery server exports areas in this format.
+*/
+
+
+
+
+
+#pragma once
+
+#include "PieceGenerator.h"
+#include "../BlockArea.h"
+
+
+
+
+
+// fwd:
+class cChunkDesc;
+
+
+
+
+
+class cPrefab :
+	public cPiece
+{
+public:
+	struct sDef
+	{
+		int m_SizeX;
+		int m_SizeY;
+		int m_SizeZ;
+		const char * m_CharMap;
+		const char * m_Image;
+		const char * m_Connectors;
+		int m_AllowedRotations;
+		cBlockArea::eMergeStrategy m_MergeStrategy;
+	};
+	
+	cPrefab(const sDef & a_Def);
+	
+	/** Draws the prefab into the specified chunk, according to the placement stored in the PlacedPiece. */
+	void Draw(cChunkDesc & a_Dest, const cPlacedPiece * a_Placement) const;
+	
+	/** Returns true if the prefab has any connector of the specified type. */
+	bool HasConnectorType(int a_ConnectorType) const;
+
+protected:
+	/** Packs complete definition of a single block, for per-letter assignment. */
+	struct sBlockTypeDef
+	{
+		BLOCKTYPE  m_BlockType;
+		NIBBLETYPE m_BlockMeta;
+	};
+	
+	/** Maps letters in the sDef::m_Image onto a number, BlockType * 16 | BlockMeta */
+	typedef sBlockTypeDef CharMap[256];
+	
+	
+	/** The cBlockArea that contains the block definitions for the prefab.
+	The index identifies the number of CCW rotations applied (0 = no rotation, 1 = 1 CCW rotation, ...). */
+	cBlockArea m_BlockArea[4];
+	
+	/** The size of the prefab */
+	Vector3i m_Size;
+	
+	/** The hitbox of the prefab. In first version is the same as the m_BlockArea dimensions */
+	cCuboid m_HitBox;
+	
+	/** The connectors through which the piece connects to other pieces */
+	cConnectors m_Connectors;
+	
+	/** Bitmask, bit N set -> N rotations CCW supported */
+	int m_AllowedRotations;
+	
+	/** The merge strategy to use when drawing the prefab into a block area */
+	cBlockArea::eMergeStrategy m_MergeStrategy;
+	
+	
+	// cPiece overrides:	
+	virtual cConnectors GetConnectors(void) const override;
+	virtual Vector3i GetSize(void) const override;
+	virtual cCuboid GetHitBox(void) const override;
+	virtual bool CanRotateCCW(int a_NumRotations) const override;
+	
+	/** Parses the CharMap in the definition into a CharMap binary data used for translating the definition into BlockArea. */
+	void ParseCharMap(CharMap & a_CharMapOut, const char * a_CharMapDef);
+	
+	/** Parses the Image in the definition into m_BlockArea[0]'s block types and metas, using the specified CharMap. */
+	void ParseBlockImage(const CharMap & a_CharMap, const char * a_BlockImage);
+	
+	/** Parses the connectors definition text into m_Connectors member. */
+	void ParseConnectors(const char * a_ConnectorsDef);
+};
+
+
+
+
diff --git a/src/Generating/Prefabs/CMakeLists.txt b/src/Generating/Prefabs/CMakeLists.txt
new file mode 100644
index 000000000..1e60447e7
--- /dev/null
+++ b/src/Generating/Prefabs/CMakeLists.txt
@@ -0,0 +1,13 @@
+
+cmake_minimum_required (VERSION 2.6)
+project (MCServer)
+
+include_directories ("${PROJECT_SOURCE_DIR}/../../")
+
+file(GLOB SOURCE
+    "*.cpp"
+)
+
+add_library(Generating_Prefabs ${SOURCE})
+
+target_link_libraries(Generating_Prefabs OSSupport iniFile Blocks)
diff --git a/src/Generating/Prefabs/NetherFortPrefabs.cpp b/src/Generating/Prefabs/NetherFortPrefabs.cpp
new file mode 100644
index 000000000..5e8685e32
--- /dev/null
+++ b/src/Generating/Prefabs/NetherFortPrefabs.cpp
@@ -0,0 +1,2758 @@
+
+// NetherFortPrefabs.cpp
+
+// Defines all the prefabs for nether forts
+
+#include "Globals.h"
+#include "NetherFortPrefabs.h"
+
+
+
+
+
+/*
+The nether fortress has two types of connectors, Outer and Inner. Outer is Type 0, Inner is Type 1.
+*/
+
+
+
+
+
+const cPrefab::sDef g_NetherFortPrefabs1[] =
+{
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// BalconyCorridor:
+	// The data has been exported from gallery Nether, area index 37, ID 288
+	{
+		// Size:
+		13, 7, 9,  // SizeX = 13, SizeY = 7, SizeZ = 9
+
+		// Block definitions:
+		"a:112: 0\n"  /* netherbrick */
+		"b: 19: 0\n"  /* sponge */
+		"c:114: 4\n"  /* netherbrickstairs */
+		"d:114: 7\n"  /* netherbrickstairs */
+		"e:114: 5\n"  /* netherbrickstairs */
+		"f: 44: 6\n"  /* step */
+		"g:113: 0\n"  /* netherbrickfence */
+		"h:114: 2\n"  /* netherbrickstairs */
+		"i:114: 3\n"  /* netherbrickstairs */
+		"j:114: 0\n"  /* netherbrickstairs */
+		"k:114: 1\n"  /* netherbrickstairs */
+		".:  0: 0\n"  /* air */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"bbbbaaaaabbbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+
+		// Level 2
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaa.aaa.aaaa"
+		"bbcdaaaaadebb"
+		"bbbcdddddebbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+
+		// Level 3
+		"aaaaaaaaaaaaa"
+		"............."
+		"............."
+		"............."
+		"aaaa.fff.aaaa"
+		"bbaaaaaaaaabb"
+		"bbaaaaaaaaabb"
+		"bbaaaaaaaaabb"
+		"bbaaaaaaaaabb"
+
+		// Level 4
+		"agagagagagaga"
+		"............."
+		"............."
+		"............."
+		"agaa.....aaga"
+		"bbaaa...aaabb"
+		"bbg.......gbb"
+		"bbg.......gbb"
+		"bbgggggggggbb"
+
+		// Level 5
+		"agagagagagaga"
+		"............."
+		"............."
+		"............."
+		"agaa.....aaga"
+		"bbaaa...aaabb"
+		"bb.........bb"
+		"bb.........bb"
+		"bb.........bb"
+
+		// Level 6
+		"agagagagagaga"
+		"............."
+		"............."
+		"............."
+		"agaa.....aaga"
+		"bbaaa...aaabb"
+		"bb.........bb"
+		"bb.........bb"
+		"bb.........bb"
+
+		// Level 7
+		"hhhhhhhhhhhhh"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"iijaaaaaaaiii"
+		"bbjiiiiiiikbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb",
+		
+		// Connections:
+		"1:  0, 2, 2: 4\n"  /* Type 1, BLOCK_FACE_XM */
+		"1: 12, 2, 2: 5\n"  /* Type 1, BLOCK_FACE_XP */,
+		
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // BalconyCorridor
+
+
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// BalconyTee2:
+	// The data has been exported from gallery Nether, area index 38, ID 289
+	{
+		// Size:
+		13, 7, 11,  // SizeX = 13, SizeY = 7, SizeZ = 11
+
+		// Block definitions:
+		"a: 19: 0\n"  /* sponge */
+		"b:112: 0\n"  /* netherbrick */
+		"c:114: 4\n"  /* netherbrickstairs */
+		"d:114: 7\n"  /* netherbrickstairs */
+		"e:114: 5\n"  /* netherbrickstairs */
+		"f: 44: 6\n"  /* step */
+		"g:113: 0\n"  /* netherbrickfence */
+		"h:114: 0\n"  /* netherbrickstairs */
+		"i:114: 1\n"  /* netherbrickstairs */
+		"j:114: 2\n"  /* netherbrickstairs */
+		"k:114: 3\n"  /* netherbrickstairs */
+		".:  0: 0\n"  /* air */,
+
+		// Block data:
+		// Level 1
+		"aaaabbbbbaaaa"
+		"aaaabbbbbaaaa"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"aaaabbbbbaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 2
+		"aaaabbbbbaaaa"
+		"aaaabbbbbaaaa"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"bbbb.bbb.bbbb"
+		"aacdbbbbbdeaa"
+		"aaacdddddeaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 3
+		"aaaab...baaaa"
+		"aaaab...baaaa"
+		"bbbbb...bbbbb"
+		"............."
+		"............."
+		"............."
+		"bbbb.fff.bbbb"
+		"aabbbbbbbbbaa"
+		"aabbbbbbbbbaa"
+		"aabbbbbbbbbaa"
+		"aabbbbbbbbbaa"
+
+		// Level 4
+		"aaaab...baaaa"
+		"aaaag...gaaaa"
+		"bgbgb...bgbgb"
+		"............."
+		"............."
+		"............."
+		"bgbb.....bbgb"
+		"aabbb...bbbaa"
+		"aag.......gaa"
+		"aag.......gaa"
+		"aagggggggggaa"
+
+		// Level 5
+		"aaaab...baaaa"
+		"aaaag...gaaaa"
+		"bgbgb...bgbgb"
+		"............."
+		"............."
+		"............."
+		"bgbb.....bbgb"
+		"aabbb...bbbaa"
+		"aa.........aa"
+		"aa.........aa"
+		"aa.........aa"
+
+		// Level 6
+		"aaaab...baaaa"
+		"aaaag...gaaaa"
+		"bgbgb...bgbgb"
+		"............."
+		"............."
+		"............."
+		"bgbb.....bbgb"
+		"aabbb...bbbaa"
+		"aa.........aa"
+		"aa.........aa"
+		"aa.........aa"
+
+		// Level 7
+		"aaaahbbbiaaaa"
+		"aaaahbbbiaaaa"
+		"jjjjjbbbjjjjj"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"bbbbbbbbbbbbb"
+		"kkhbbbbbbbkkk"
+		"aahkkkkkkkiaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa",
+		
+		// Connections:
+		"1:  0, 2, 4: 4\n"  /* Type 1, BLOCK_FACE_XM */
+		"1: 12, 2, 4: 5\n"  /* Type 1, BLOCK_FACE_XP */
+		"1:  6, 2, 0: 2\n"  /* Type 1, BLOCK_FACE_ZM */,
+		
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // BalconyTee2
+
+
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// BlazePlatform
+	// The data has been exported from gallery Nether, area index 26, ID 276
+	{
+		// Size:
+		10, 7, 7,  // SizeX = 10, SizeY = 7, SizeZ = 7
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b: 52: 0\n"  /* mobspawner */
+		"c:113: 0\n"  /* netherbrickfence */,
+
+		// Block data:
+		// Level 1
+		".........."
+		"aaaaaaaaaa"
+		"aaaaaaaaaa"
+		"aaaaaaaaaa"
+		"aaaaaaaaaa"
+		"aaaaaaaaaa"
+		".........."
+
+		// Level 2
+		".........."
+		"aaaaaaaaaa"
+		"..aaaaaaaa"
+		"..aaaaaaaa"
+		"..aaaaaaaa"
+		"aaaaaaaaaa"
+		".........."
+
+		// Level 3
+		"....aaaaaa"
+		"aaaaaaaaaa"
+		"...aaaaaaa"
+		"...aaaaaaa"
+		"...aaaaaaa"
+		"aaaaaaaaaa"
+		"....aaaaaa"
+
+		// Level 4
+		"....aaaaaa"
+		"..aaa....a"
+		".........a"
+		"......b..a"
+		".........a"
+		"..aaa....a"
+		"....aaaaaa"
+
+		// Level 5
+		"....cccccc"
+		"...cc....c"
+		".........c"
+		".........c"
+		".........c"
+		"...cc....c"
+		"....cccccc"
+
+		// Level 6
+		".........."
+		".........c"
+		".........c"
+		".........c"
+		".........c"
+		".........c"
+		".........."
+
+		// Level 7
+		".........."
+		".........."
+		".........c"
+		".........c"
+		".........c"
+		".........."
+		"..........",
+
+		// Connections:
+		"0:  0, 1, 3: 4\n"  /* Type 0, BLOCK_FACE_XM */,
+		
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // BlazePlatform
+
+
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// BlazePlatformOverhang:
+	// The data has been exported from gallery Nether, area index 20, ID 162
+	{
+		// Size:
+		14, 9, 7,  // SizeX = 14, SizeY = 9, SizeZ = 7
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:114: 5\n"  /* netherbrickstairs */
+		"c: 44:14\n"  /* step */
+		"d:114: 6\n"  /* netherbrickstairs */
+		"e:114: 7\n"  /* netherbrickstairs */
+		"f:114: 0\n"  /* netherbrickstairs */
+		"g:114: 4\n"  /* netherbrickstairs */
+		"h:113: 0\n"  /* netherbrickfence */
+		"i: 52: 0\n"  /* mobspawner */
+		"m: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"mmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmm"
+		"aammmmmmmmmmmm"
+		"aammmmmmmmmmmm"
+		"aammmmmmmmmmmm"
+		"mmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmm"
+
+		// Level 2
+		"mmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmm"
+		"aabcmmmmmmmmmm"
+		"aabcmmmmmmmmmm"
+		"aabcmmmmmmmmmm"
+		"mmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmm"
+
+		// Level 3
+		"mmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmm"
+		"aaaaabmmmmmmmm"
+		"aaaaabmmmmmmmm"
+		"aaaaabmmmmmmmm"
+		"mmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmm"
+
+		// Level 4
+		"mmmmmmmmmmmmmm"
+		"dddddddmmmmmmm"
+		"aaaaaabmmmmmmm"
+		"aaaaaabmmmmmmm"
+		"aaaaaabmmmmmmm"
+		"eeeeeeemmmmmmm"
+		"mmmmmmmmmmmmmm"
+
+		// Level 5
+		"mmmmmmmmmmmmmm"
+		"aaaaaaadmmmmmm"
+		"aaaaaaabmmmmmm"
+		"aaaaaaabmmmmmm"
+		"aaaaaaabmmmmmm"
+		"aaaaaaaemmmmmm"
+		"mmmmmmmmmmmmmm"
+
+		// Level 6
+		"mmmmmmmmmmmmmm"
+		"aaaaaaaabddddm"
+		"......faaaaabm"
+		"......faaaaabm"
+		"......faaaaabm"
+		"aaaaaaaaabeebm"
+		"mmmmmmmmmmmmmm"
+
+		// Level 7
+		"mmmmmmmmgdddbm"
+		"......aaaaaaad"
+		".......faaaaab"
+		".......faaaaab"
+		".......faaaaab"
+		"......aaaaaaae"
+		"mmmmmmmmgeeebm"
+
+		// Level 8
+		"mmmmmmmmaaaaam"
+		"......haa...aa"
+		".............a"
+		"..........i..a"
+		".............a"
+		"......haa...aa"
+		"mmmmmmmmaaaaam"
+
+		// Level 9
+		"mmmmmmmmhhhhhm"
+		"......hhh...hh"
+		".............h"
+		".............h"
+		".............h"
+		"......hhh...hh"
+		"mmmmmmmmhhhhhm",
+
+		// Connections:
+		"0:  0, 5, 3: 4\n"  /* Type 0, BLOCK_FACE_XM */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // BlazePlatformOverhang
+
+
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// BridgeCrossing:
+	// The data has been exported from gallery Nether, area index 17, ID 159
+	{
+		// Size:
+		15, 8, 15,  // SizeX = 15, SizeY = 8, SizeZ = 15
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:114: 7\n"  /* netherbrickstairs */
+		"c:114: 5\n"  /* netherbrickstairs */
+		"d:114: 4\n"  /* netherbrickstairs */
+		"e:114: 6\n"  /* netherbrickstairs */
+		"f: 44:14\n"  /* step */
+		"m: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"aammmmmmmmmmmaa"
+		"aammmmmmmmmmmaa"
+		"aammmmmmmmmmmaa"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+
+		// Level 2
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmbbbmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"aacmmmmmmmmmdaa"
+		"aacmmmmmmmmmdaa"
+		"aacmmmmmmmmmdaa"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmeeemmmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+
+		// Level 3
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmbbbmmmmmm"
+		"mmmmmmfffmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"aaacfmmmmmfdaaa"
+		"aaacfmmmmmfdaaa"
+		"aaacfmmmmmfdaaa"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmfffmmmmmm"
+		"mmmmmmeeemmmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+
+		// Level 4
+		"mmmmmdaaacmmmmm"
+		"mmmmmdaaacmmmmm"
+		"mmmmmdaaacmmmmm"
+		"mmmmmdaaacmmmmm"
+		"mmmmmdaaacmmmmm"
+		"eeeeeeaaaeeeeee"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"bbbbbdaaacbbbbb"
+		"mmmmmdaaacmmmmm"
+		"mmmmmdaaacmmmmm"
+		"mmmmmdaaacmmmmm"
+		"mmmmmdaaacmmmmm"
+		"mmmmmdaaacmmmmm"
+
+		// Level 5
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+
+		// Level 6
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+		"aaaaaa...aaaaaa"
+		"..............."
+		"..............."
+		"..............."
+		"aaaaaa...aaaaaa"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+
+		// Level 7
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"..............."
+		"..............."
+		"..............."
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+
+		// Level 8
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"..............."
+		"..............."
+		"..............."
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm",
+		
+		// Connections:
+		"0:  0, 5,  7: 4\n"  /* Type 0, BLOCK_FACE_XM */
+		"0:  7, 5,  0: 2\n"  /* Type 0, BLOCK_FACE_ZM */
+		"0: 14, 5,  7: 5\n"  /* Type 0, BLOCK_FACE_XP */
+		"0:  7, 5, 14: 3\n"  /* Type 0, BLOCK_FACE_ZP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // BridgeCrossing
+
+
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// BridgeCrumble1:
+	// The data has been exported from gallery Nether, area index 19, ID 161
+	{
+		// Size:
+		9, 6, 5,  // SizeX = 9, SizeY = 6, SizeZ = 5
+
+		// Block definitions:
+		".: 19: 0\n"  /* sponge */
+		"a:112: 0\n"  /* netherbrick */
+		"b:114: 5\n"  /* netherbrickstairs */
+		"c: 44:14\n"  /* step */
+		"d:114: 6\n"  /* netherbrickstairs */
+		"e:114: 7\n"  /* netherbrickstairs */,
+
+		// Block data:
+		// Level 1
+		"........."
+		"aa......."
+		"aa......."
+		"aa......."
+		"........."
+
+		// Level 2
+		"........."
+		"aab......"
+		"aab......"
+		"aab......"
+		"........."
+
+		// Level 3
+		"........."
+		"aaabc...."
+		"aaabc...."
+		"aaabc...."
+		"........."
+
+		// Level 4
+		"ddddddd.."
+		"aaaaaaaa."
+		"aaaaaaaaa"
+		"aaaaaaa.."
+		"eeeee...."
+
+		// Level 5
+		"aaaaaaaaa"
+		"aaaaa...."
+		"aaaaaa..."
+		"aaaaaa..."
+		"aaaaaaaa."
+
+		// Level 6
+		"aaaaaa..."
+		"........."
+		"........."
+		"........."
+		"aaaaaaa..",
+
+		// Connections:
+		"0:  0, 5, 2: 4\n"  /* Type 0, BLOCK_FACE_XM */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // BridgeCrumble1
+
+
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// BridgeCrumble2
+	// The data has been exported from gallery Nether, area index 18, ID 160
+	{
+		// Size:
+		13, 6, 5,  // SizeX = 13, SizeY = 6, SizeZ = 5
+
+		// Block definitions:
+		".: 19: 0\n"  /* sponge */
+		"a:112: 0\n"  /* netherbrick */
+		"b:114: 5\n"  /* netherbrickstairs */
+		"c: 44:14\n"  /* step */
+		"d:114: 6\n"  /* netherbrickstairs */
+		"e:114: 7\n"  /* netherbrickstairs */,
+
+		// Block data:
+		// Level 1
+		"............."
+		"aa..........."
+		"aa..........."
+		"aa..........."
+		"............."
+
+		// Level 2
+		"............."
+		"aab.........."
+		"aab.........."
+		"aab.........."
+		"............."
+
+		// Level 3
+		"............."
+		"aaabc........"
+		"aaabc........"
+		"aaabc........"
+		"............."
+
+		// Level 4
+		"ddddddddd...."
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaa...."
+		"aaaaaaaaaaaa."
+		"eeeeeeeee...."
+
+		// Level 5
+		"aaaaaaaaaaaa."
+		"aaaaaaaaaa..."
+		"aaaaaaaaaaa.."
+		"aaaaaaaaa...."
+		"aaaaaaaaaaaaa"
+
+		// Level 6
+		"aaaaaaaaa...."
+		"............."
+		"............."
+		"............."
+		"aaaaaaaaaa...",
+
+		// Connections:
+		"0:  0, 5, 2: 4\n"  /* Type 0, BLOCK_FACE_XM */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // BridgeCrumble2
+
+
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// BridgeSegment:
+	// The data has been exported from gallery Nether, area index 16, ID 158
+	{
+		// Size:
+		15, 8, 5,  // SizeX = 15, SizeY = 8, SizeZ = 5
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:114: 5\n"  /* netherbrickstairs */
+		"c:114: 4\n"  /* netherbrickstairs */
+		"d: 44:14\n"  /* step */
+		"e:114: 6\n"  /* netherbrickstairs */
+		"f:114: 7\n"  /* netherbrickstairs */
+		"m: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"mmmmmmmmmmmmmmm"
+		"aammmmmmmmmmmaa"
+		"aammmmmmmmmmmaa"
+		"aammmmmmmmmmmaa"
+		"mmmmmmmmmmmmmmm"
+
+		// Level 2
+		"mmmmmmmmmmmmmmm"
+		"aabmmmmmmmmmcaa"
+		"aabmmmmmmmmmcaa"
+		"aabmmmmmmmmmcaa"
+		"mmmmmmmmmmmmmmm"
+
+		// Level 3
+		"mmmmmmmmmmmmmmm"
+		"aaabdmmmmmdcaaa"
+		"aaabdmmmmmdcaaa"
+		"aaabdmmmmmdcaaa"
+		"mmmmmmmmmmmmmmm"
+
+		// Level 4
+		"eeeeeeeeeeeeeee"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"fffffffffffffff"
+
+		// Level 5
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+
+		// Level 6
+		"aaaaaaaaaaaaaaa"
+		"..............."
+		"..............."
+		"..............."
+		"aaaaaaaaaaaaaaa"
+
+		// Level 7
+		"mmmmmmmmmmmmmmm"
+		"..............."
+		"..............."
+		"..............."
+		"mmmmmmmmmmmmmmm"
+
+		// Level 8
+		"mmmmmmmmmmmmmmm"
+		"..............."
+		"..............."
+		"..............."
+		"mmmmmmmmmmmmmmm",
+
+		// Connections:
+		"0:  0, 5, 2: 4\n"  /* Type 0, BLOCK_FACE_XM */
+		"0: 14, 5, 2: 5\n"  /* Type 0, BLOCK_FACE_XP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // BridgeSegment
+
+
+	// BridgeTee:
+	// The data has been exported from gallery Nether, area index 39, ID 290
+	{
+		// Size:
+		15, 8, 10,  // SizeX = 15, SizeY = 8, SizeZ = 10
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:114: 5\n"  /* netherbrickstairs */
+		"c:114: 4\n"  /* netherbrickstairs */
+		"d:114: 6\n"  /* netherbrickstairs */
+		"e: 44:14\n"  /* step */
+		"f:114: 7\n"  /* netherbrickstairs */
+		"m: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"mmmmmmmmmmmmmmm"
+		"aammmmmmmmmmmaa"
+		"aammmmmmmmmmmaa"
+		"aammmmmmmmmmmaa"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+
+		// Level 2
+		"mmmmmmmmmmmmmmm"
+		"aabmmmmmmmmmcaa"
+		"aabmmmmmmmmmcaa"
+		"aabmmmmmmmmmcaa"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmdddmmmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+
+		// Level 3
+		"mmmmmmmmmmmmmmm"
+		"aaabemmmmmecaaa"
+		"aaabemmmmmecaaa"
+		"aaabemmmmmecaaa"
+		"mmmmmmmmmmmmmmm"
+		"mmmmmmeeemmmmmm"
+		"mmmmmmdddmmmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+		"mmmmmmaaammmmmm"
+
+		// Level 4
+		"ddddddddddddddd"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"fffffcaaabfffff"
+		"mmmmmcaaabmmmmm"
+		"mmmmmcaaabmmmmm"
+		"mmmmmcaaabmmmmm"
+		"mmmmmcaaabmmmmm"
+		"mmmmmcaaabmmmmm"
+
+		// Level 5
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+		"mmmmmaaaaammmmm"
+
+		// Level 6
+		"aaaaaaaaaaaaaaa"
+		"..............."
+		"..............."
+		"..............."
+		"aaaaaa...aaaaaa"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+		"mmmmma...ammmmm"
+
+		// Level 7
+		"mmmmmmmmmmmmmmm"
+		"..............."
+		"..............."
+		"..............."
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+
+		// Level 8
+		"mmmmmmmmmmmmmmm"
+		"..............."
+		"..............."
+		"..............."
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm"
+		"mmmmmm...mmmmmm",
+
+		// Connections:
+		"0:  0, 5, 2: 4\n"  /* Type 0, BLOCK_FACE_XM */
+		"0: 14, 5, 2: 5\n"  /* Type 0, BLOCK_FACE_XP */
+		"0:  7, 5, 9: 3\n"  /* Type 0, BLOCK_FACE_ZP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // BridgeTee
+
+
+	// Corridor11:
+	// The data has been exported from gallery Nether, area index 36, ID 287
+	{
+		// Size:
+		11, 6, 5,  // SizeX = 11, SizeY = 6, SizeZ = 5
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:113: 0\n"  /* netherbrickfence */
+		"c:114: 2\n"  /* netherbrickstairs */
+		"d:114: 3\n"  /* netherbrickstairs */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+
+		// Level 2
+		"aaaaaaaaaaa"
+		"..........."
+		"..........."
+		"..........."
+		"aaaaaaaaaaa"
+
+		// Level 3
+		"abababababa"
+		"..........."
+		"..........."
+		"..........."
+		"abababababa"
+
+		// Level 4
+		"abababababa"
+		"..........."
+		"..........."
+		"..........."
+		"abababababa"
+
+		// Level 5
+		"abababababa"
+		"..........."
+		"..........."
+		"..........."
+		"abababababa"
+
+		// Level 6
+		"ccccccccccc"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"ddddddddddd",
+
+		// Connections:
+		"1:  0, 1, 2: 4\n"  /* Type 1, BLOCK_FACE_XM */
+		"1: 10, 1, 2: 5\n"  /* Type 1, BLOCK_FACE_XP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // Corridor11
+
+
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// Corridor13:
+	// The data has been exported from gallery Nether, area index 35, ID 286
+	{
+		// Size:
+		13, 6, 5,  // SizeX = 13, SizeY = 6, SizeZ = 5
+
+		// Block definitions:
+		"a:112: 0\n"  /* netherbrick */
+		".:  0: 0\n"  /* air */
+		"c:113: 0\n"  /* netherbrickfence */
+		"d:114: 2\n"  /* netherbrickstairs */
+		"e:114: 3\n"  /* netherbrickstairs */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 2
+		"aaaaaaaaaaaaa"
+		"............."
+		"............."
+		"............."
+		"aaaaaaaaaaaaa"
+
+		// Level 3
+		"acacacacacaca"
+		"............."
+		"............."
+		"............."
+		"acacacacacaca"
+
+		// Level 4
+		"acacacacacaca"
+		"............."
+		"............."
+		"............."
+		"acacacacacaca"
+
+		// Level 5
+		"acacacacacaca"
+		"............."
+		"............."
+		"............."
+		"acacacacacaca"
+
+		// Level 6
+		"ddddddddddddd"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"eeeeeeeeeeeee",
+		
+		// Connections:
+		"1:  0, 1, 2: 4\n"  /* Type 1, BLOCK_FACE_XM */
+		"1: 12, 1, 2: 5\n"  /* Type 1, BLOCK_FACE_XP */,
+		
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // Corridor13
+
+
+	// CorridorCorner5:
+	// The data has been exported from gallery Nether, area index 10, ID 40
+	{
+		// Size:
+		11, 6, 11,  // SizeX = 11, SizeY = 6, SizeZ = 11
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:113: 0\n"  /* netherbrickfence */
+		"c:114: 2\n"  /* netherbrickstairs */
+		"d:114: 0\n"  /* netherbrickstairs */
+		"e:114: 3\n"  /* netherbrickstairs */
+		"f:114: 1\n"  /* netherbrickstairs */
+		"m: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaammmmmm"
+		"aaaaammmmmm"
+		"aaaaammmmmm"
+		"aaaaammmmmm"
+		"aaaaammmmmm"
+		"aaaaammmmmm"
+
+		// Level 2
+		"aaaaaaaaaaa"
+		"a.........."
+		"a.........."
+		"a.........."
+		"a...aaaaaaa"
+		"a...ammmmmm"
+		"a...ammmmmm"
+		"a...ammmmmm"
+		"a...ammmmmm"
+		"a...ammmmmm"
+		"a...ammmmmm"
+
+		// Level 3
+		"abababababa"
+		"b.........."
+		"a.........."
+		"b.........."
+		"a...abababa"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+
+		// Level 4
+		"abababababa"
+		"b.........."
+		"a.........."
+		"b.........."
+		"a...abababa"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+
+		// Level 5
+		"abababababa"
+		"b.........."
+		"a.........."
+		"b.........."
+		"a...abababa"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+
+		// Level 6
+		"ccccccccccc"
+		"daaaaaaaaaa"
+		"daaaaaaaaaa"
+		"daaaaaaaaaa"
+		"daaaeeeeeee"
+		"daaafmmmmmm"
+		"daaafmmmmmm"
+		"daaafmmmmmm"
+		"daaafmmmmmm"
+		"daaafmmmmmm"
+		"daaafmmmmmm",
+		
+		// Connections:
+		"1: 10, 1,  2: 5\n"  /* Type 1, BLOCK_FACE_XP */
+		"1:  2, 1, 10: 3\n"  /* Type 1, BLOCK_FACE_ZP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // CorridorCorner5
+
+
+	// CorridorCorner5:
+	// The data has been exported from gallery Nether, area index 10, ID 40
+	{
+		// Size:
+		11, 6, 11,  // SizeX = 11, SizeY = 6, SizeZ = 11
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:113: 0\n"  /* netherbrickfence */
+		"c:114: 2\n"  /* netherbrickstairs */
+		"d:114: 0\n"  /* netherbrickstairs */
+		"e:114: 3\n"  /* netherbrickstairs */
+		"f:114: 1\n"  /* netherbrickstairs */
+		"g: 54: 5\n"  /* chest */
+		"m: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaaaaaaaa"
+		"aaaaammmmmm"
+		"aaaaammmmmm"
+		"aaaaammmmmm"
+		"aaaaammmmmm"
+		"aaaaammmmmm"
+		"aaaaammmmmm"
+
+		// Level 2
+		"aaaaaaaaaaa"
+		"ag........."
+		"a.........."
+		"a.........."
+		"a...aaaaaaa"
+		"a...ammmmmm"
+		"a...ammmmmm"
+		"a...ammmmmm"
+		"a...ammmmmm"
+		"a...ammmmmm"
+		"a...ammmmmm"
+
+		// Level 3
+		"abababababa"
+		"b.........."
+		"a.........."
+		"b.........."
+		"a...abababa"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+
+		// Level 4
+		"abababababa"
+		"b.........."
+		"a.........."
+		"b.........."
+		"a...abababa"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+
+		// Level 5
+		"abababababa"
+		"b.........."
+		"a.........."
+		"b.........."
+		"a...abababa"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+		"b...bmmmmmm"
+		"a...ammmmmm"
+
+		// Level 6
+		"ccccccccccc"
+		"daaaaaaaaaa"
+		"daaaaaaaaaa"
+		"daaaaaaaaaa"
+		"daaaeeeeeee"
+		"daaafmmmmmm"
+		"daaafmmmmmm"
+		"daaafmmmmmm"
+		"daaafmmmmmm"
+		"daaafmmmmmm"
+		"daaafmmmmmm",
+		
+		// Connections:
+		"1: 10, 1,  2: 5\n"  /* Type 1, BLOCK_FACE_XP */
+		"1:  2, 1, 10: 3\n"  /* Type 1, BLOCK_FACE_ZP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // CorridorCorner5Chest
+
+
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// CorridorStairs:
+	// The data has been exported from gallery Nether, area index 12, ID 42
+	{
+		// Size:
+		9, 13, 5,  // SizeX = 9, SizeY = 13, SizeZ = 5
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:114: 0\n"  /* netherbrickstairs */
+		"c:113: 0\n"  /* netherbrickfence */
+		"d:114: 2\n"  /* netherbrickstairs */
+		"e:114: 3\n"  /* netherbrickstairs */
+		"f: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaaaa"
+		"aaaaaaaaa"
+		"aaaaaaaaa"
+		"aaaaaaaaa"
+		"aaaaaaaaa"
+
+		// Level 2
+		"aaaaaaaaa"
+		".baaaaaaa"
+		".baaaaaaa"
+		".baaaaaaa"
+		"aaaaaaaaa"
+
+		// Level 3
+		"acaaaaaaa"
+		"..baaaaaa"
+		"..baaaaaa"
+		"..baaaaaa"
+		"acaaaaaaa"
+
+		// Level 4
+		"acaaaaaaa"
+		"...baaaaa"
+		"...baaaaa"
+		"...baaaaa"
+		"acaaaaaaa"
+
+		// Level 5
+		"acacaaaaa"
+		"....baaaa"
+		"....baaaa"
+		"....baaaa"
+		"acacaaaaa"
+
+		// Level 6
+		"aaacaaaaa"
+		".....baaa"
+		".....baaa"
+		".....baaa"
+		"aaacaaaaa"
+
+		// Level 7
+		"daacacaaa"
+		"a.....baa"
+		"a.....baa"
+		"a.....baa"
+		"eaacacaaa"
+
+		// Level 8
+		"fdaaacaaa"
+		"fa.....ba"
+		"fa.....ba"
+		"fa.....ba"
+		"feaaacaaa"
+
+		// Level 9
+		"ffdaacaca"
+		"ffa......"
+		"ffa......"
+		"ffa......"
+		"ffeaacaca"
+
+		// Level 10
+		"fffdaaaca"
+		"fffa....."
+		"fffa....."
+		"fffa....."
+		"fffeaaaca"
+
+		// Level 11
+		"ffffdaaca"
+		"ffffa...."
+		"ffffa...."
+		"ffffa...."
+		"ffffeaaca"
+
+		// Level 12
+		"fffffdaaa"
+		"fffffa..."
+		"fffffa..."
+		"fffffa..."
+		"fffffeaaa"
+
+		// Level 13
+		"ffffffddd"
+		"ffffffaaa"
+		"ffffffaaa"
+		"ffffffaaa"
+		"ffffffeee",
+
+		// Connections:
+		"1: 0, 1, 2: 4\n"  /* Type 1, BLOCK_FACE_XM */
+		"1: 8, 8, 2: 5\n"  /* Type 1, BLOCK_FACE_XP */,
+		
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // CorridorStairs
+
+
+	// LavaStaircase:
+	// The data has been exported from gallery Nether, area index 28, ID 278
+	{
+		// Size:
+		15, 11, 15,  // SizeX = 15, SizeY = 11, SizeZ = 15
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:113: 0\n"  /* netherbrickfence */
+		"c: 11: 0\n"  /* lava */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+
+		// Level 2
+		"aaaaaaaa...aaaa"
+		"aaaaa.........a"
+		"aaaaa.........a"
+		"aaaaab........a"
+		"accca...aaaa..a"
+		"accca...acca..a"
+		"acccaaaaacca..a"
+		"acccccccccca..a"
+		"acccaaaaacca..a"
+		"accca...acca..a"
+		"accca...aaaa..a"
+		"aaaaab........a"
+		"aaaaa.........a"
+		"aaaaa.........a"
+		"aaaaaaaa...aaaa"
+
+		// Level 3
+		"aaaaaaaa...aaaa"
+		"aaaa..........a"
+		"aaaa..........a"
+		"aaaabb........a"
+		"aaaa..........a"
+		"a.............a"
+		"a.............a"
+		"a.............a"
+		"a.............a"
+		"a.............a"
+		"aaaa..........a"
+		"aaaabb........a"
+		"aaaa..........a"
+		"aaaa..........a"
+		"aaaaaaaa...aaaa"
+
+		// Level 4
+		"aaaaaaaa...aaaa"
+		"a.............a"
+		"a.............a"
+		"a..bb.........a"
+		"aaaa..........a"
+		"aaaa..........a"
+		"a.............a"
+		"a.............a"
+		"a.............a"
+		"aaaa..........a"
+		"aaaa..........a"
+		"a..bb.........a"
+		"a.............a"
+		"a.............a"
+		"aaaaaaaa...aaaa"
+
+		// Level 5
+		"aaaaaaaabbbaaaa"
+		"a.............a"
+		"a.............a"
+		"a..b..........a"
+		"a..b..........a"
+		"aaaa..........a"
+		"aaaa..........a"
+		"a.............a"
+		"aaaa..........a"
+		"aaaa..........a"
+		"a..b..........a"
+		"a..b..........a"
+		"a.............a"
+		"a.............a"
+		"aaaaaaaabbbaaaa"
+
+		// Level 6
+		"aaaaaaaaaaaaaaa"
+		"a.............a"
+		"a.............a"
+		"a.............a"
+		"a..b..........a"
+		"a..b..........a"
+		"aaaa..........a"
+		"aaaa..........a"
+		"aaaa..........a"
+		"a..b..........a"
+		"a..b..........a"
+		"a.............a"
+		"a.............a"
+		"a.............a"
+		"aaaaaaaaaaaaaaa"
+
+		// Level 7
+		"aaaaaaaaaaaaaaa"
+		"a.............a"
+		"a.............a"
+		"a.............a"
+		"a.............a"
+		"a..b..........a"
+		"...b..........a"
+		"...b..........a"
+		"...b..........a"
+		"a..b..........a"
+		"a.............a"
+		"a.............a"
+		"a.............a"
+		"a.............a"
+		"aaaaaaaaaaaaaaa"
+
+		// Level 8
+		"aababababababaa"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"..............b"
+		"..............a"
+		"..............b"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"aababababababaa"
+
+		// Level 9
+		"aababababababaa"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"..............b"
+		"..............a"
+		"..............b"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"aababababababaa"
+
+		// Level 10
+		"aababababababaa"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"..............b"
+		"..............a"
+		"..............b"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"b.............b"
+		"a.............a"
+		"aababababababaa"
+
+		// Level 11
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa"
+		"aaaaaaaaaaaaaaa",
+		
+		// Connections:
+		"1:  0, 6,  7: 4\n"  /* Type 1, BLOCK_FACE_XM */
+		"0:  9, 1,  0: 2\n"  /* Type 0, BLOCK_FACE_ZM */
+		"0:  9, 1, 14: 3\n"  /* Type 0, BLOCK_FACE_ZP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // LavaStaircase
+
+
+	// LavaStaircaseBig:
+	// The data has been exported from gallery Nether, area index 31, ID 282
+	{
+		// Size:
+		12, 15, 15,  // SizeX = 12, SizeY = 15, SizeZ = 15
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b: 10: 0\n"  /* lava */
+		"c:113: 0\n"  /* netherbrickfence */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+
+		// Level 2
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"abbbbbaaaaaa"
+		"abbbbbbaaaaa"
+		"abbbbbba...."
+		"abbbbbba...."
+		"abbbbbba...."
+		"abbbbbbaaaaa"
+		"abbbbb.aaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+
+		// Level 3
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"abbbbbaaaaaa"
+		"abbbbbba...a"
+		"abbbbbba...."
+		"abbbbbba...."
+		"abbbbbba...."
+		"abbbbbba...a"
+		"abbbbb.aaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+
+		// Level 4
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"abbbbbaa...a"
+		"abbbbbba...a"
+		"abbbbbba...."
+		"abbbbbba...."
+		"abbbbbba...."
+		"abbbbbba...a"
+		"abbbbbaa...a"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+
+		// Level 5
+		"aaaaaaaaaaaa"
+		"aaaaa......a"
+		"aaaaa......a"
+		"aaaaacc....a"
+		"a.....cc...a"
+		"a......c...a"
+		"a......c...."
+		"a......c...."
+		"a......c...."
+		"a......c...a"
+		"a.....cc...a"
+		"aaaaacc....a"
+		"aaaaa......a"
+		"aaaaa......a"
+		"aaaaaaaaaaaa"
+
+		// Level 6
+		"aaaaaaaaaaaa"
+		"aaaa.......a"
+		"aaaa.......a"
+		"aaaacc.....a"
+		"aaaa.......a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"aaaa.......a"
+		"aaaacc.....a"
+		"aaaa.......a"
+		"aaaa.......a"
+		"aaaaaaaaaaaa"
+
+		// Level 7
+		"aaaaaaaaaaaa"
+		"a..........a"
+		"a..........a"
+		"a..cc......a"
+		"aaaa.......a"
+		"aaaa.......a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"aaaa.......a"
+		"aaaa.......a"
+		"a..cc......a"
+		"a..........a"
+		"a..........a"
+		"aaaaaaaaaaaa"
+
+		// Level 8
+		"aaaaaaaaaaaa"
+		"a..........a"
+		"a..........a"
+		"a..c.......a"
+		"a..c.......a"
+		"aaaa.......a"
+		"aaaa.......a"
+		"a..........a"
+		"aaaa.......a"
+		"aaaa.......a"
+		"a..c.......a"
+		"a..c.......a"
+		"a..........a"
+		"a..........a"
+		"aaaaaaaaaaaa"
+
+		// Level 9
+		"aaaaaaaaaaaa"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..c.......a"
+		"a..c.......a"
+		"aaaa.......a"
+		"aaaa.......a"
+		"aaaa.......a"
+		"a..c.......a"
+		"a..c.......a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"aaaaaaaaaaaa"
+
+		// Level 10
+		"aaaaaaaaaaaa"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..c.......a"
+		"...c.......a"
+		"...c.......a"
+		"...c.......a"
+		"a..c.......a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"aaaaaaaaaaaa"
+
+		// Level 11
+		"aaaaaaaaaaaa"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"...........a"
+		"...........a"
+		"...........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"aaaaaaaaaaaa"
+
+		// Level 12
+		"aaaaaaaaaaaa"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"...........a"
+		"...........a"
+		"...........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"aaaaaaaaaaaa"
+
+		// Level 13
+		"aaaaaaaaaaaa"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"...........a"
+		"...........a"
+		"...........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"a..........a"
+		"aaaaaaaaaaaa"
+
+		// Level 14
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+		"aaaaaaaaaaaa"
+
+		// Level 15
+		"aaaaaaaaaaaa"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"abbbbbbbbbba"
+		"aaaaaaaaaaaa",
+		
+		// Connections:
+		"1:  0, 9,  7: 4\n"  /* Type 1, BLOCK_FACE_XM */
+		"1: 11, 1,  7: 5\n"  /* Type 1, BLOCK_FACE_XP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // LavaStaircaseBig
+
+
+	// MidStaircase:
+	// The data has been exported from gallery Nether, area index 23, ID 165
+	{
+		// Size:
+		13, 8, 13,  // SizeX = 13, SizeY = 8, SizeZ = 13
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b: 88: 0\n"  /* soulsand */
+		"c:115: 7\n"  /* netherwartblock */
+		"d:114: 3\n"  /* netherbrickstairs */
+		"e:114: 0\n"  /* netherbrickstairs */
+		"f:114: 1\n"  /* netherbrickstairs */
+		"g:114: 2\n"  /* netherbrickstairs */
+		"h: 10: 0\n"  /* lava */
+		"i:113: 0\n"  /* netherbrickfence */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaabbbbbaaaa"
+		"aaaabbbbbaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaabbbbbaaaa"
+		"aaaabbbbbaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 2
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaacccccaaaa"
+		"addecccccfdda"
+		"...eaaaaad..."
+		"...eaaaaa...."
+		"...eaaaaag..."
+		"agggcccccfgga"
+		"aaaacccccaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 3
+		"aaaaaaaaaaaaa"
+		"aha.......aha"
+		"aaa.......aaa"
+		"a...........a"
+		"a...........a"
+		"....eaaaa...."
+		"....eaaaa...."
+		"....eaaaa...."
+		"a...........a"
+		"a...........a"
+		"aaa.......aaa"
+		"aha.......aha"
+		"aaaaaaaaaaaaa"
+
+		// Level 4
+		"aaaiiaaaiiaaa"
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		".....eaaa...."
+		".....eaaa...."
+		".....eaaa...."
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"aaaiiaaaiiaaa"
+
+		// Level 5
+		"aaaiiaaaiiaaa"
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"......eaa...."
+		"......eaa...."
+		"......eaa...."
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"aaaiiaaaiiaaa"
+
+		// Level 6
+		"aaaaaaaaaaaaa"
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"a......ea...a"
+		"a......ea...a"
+		"a......ea...a"
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"a...........a"
+		"aaaaaaaaaaaaa"
+
+		// Level 7
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaa....eaaaa"
+		"aaaa....eaaaa"
+		"aaaa....eaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 8
+		"iaiaiaiaiaiai"
+		"a...........a"
+		"i...........i"
+		"a...........a"
+		"i...........i"
+		"a............"
+		"i............"
+		"a............"
+		"i...........i"
+		"a...........a"
+		"i...........i"
+		"a...........a"
+		"iaiaiaiaiaiai",
+
+		// Connections:
+		"1:  0, 1, 6: 4\n"  /* Type 1, BLOCK_FACE_XM */
+		"1: 12, 1, 6: 5\n"  /* Type 1, BLOCK_FACE_XP */
+		"1: 12, 7, 6: 5\n"  /* Type 1, BLOCK_FACE_XP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // MidStaircase
+
+
+	// StairsToOpen1:
+	// The data has been exported from gallery Nether, area index 27, ID 277
+	{
+		// Size:
+		7, 10, 7,  // SizeX = 7, SizeY = 10, SizeZ = 7
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:113: 0\n"  /* netherbrickfence */
+		"m: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+
+		// Level 2
+		"aa...aa"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"aaaaaaa"
+		"aaaaaaa"
+
+		// Level 3
+		"aa...aa"
+		"a.....a"
+		"b.....b"
+		"a.....a"
+		"b.....b"
+		"a.aaaaa"
+		"aabaaba"
+
+		// Level 4
+		"aa...aa"
+		"a.....a"
+		"b.....b"
+		"a.....a"
+		"b.....b"
+		"a..aaaa"
+		"aabaaba"
+
+		// Level 5
+		"aabbbaa"
+		"a.....a"
+		"b.....b"
+		"a.....a"
+		"b.....b"
+		"a...aaa"
+		"aabaaba"
+
+		// Level 6
+		"aaaaaaa"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"a....aa"
+		"aaaaaaa"
+
+		// Level 7
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"a.....a"
+		"aaaaaaa"
+
+		// Level 8
+		"aaaaaaa"
+		"a.....a"
+		"a......"
+		"a......"
+		"a......"
+		"a.....a"
+		"aaaaaaa"
+
+		// Level 9
+		"mmmmmmm"
+		"m.....m"
+		"m......"
+		"m......"
+		"m......"
+		"m.....m"
+		"mmmmmmm"
+
+		// Level 10
+		"mmmmmmm"
+		"m.....m"
+		"m......"
+		"m......"
+		"m......"
+		"m.....m"
+		"mmmmmmm",
+		
+		// Connections:
+		"0: 3, 1, 0: 2\n"  /* Type 0, BLOCK_FACE_ZM */
+		"0: 6, 7, 3: 5\n"  /* Type 0, BLOCK_FACE_XP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // StairsToOpen1
+
+
+	// StairsToOpen2:
+	// The data has been exported from gallery Nether, area index 8, ID 35
+	{
+		// Size:
+		7, 10, 7,  // SizeX = 7, SizeY = 10, SizeZ = 7
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:113: 0\n"  /* netherbrickfence */
+		"m: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+
+		// Level 2
+		"aa...aa"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"aaaaaaa"
+		"aaaaaaa"
+
+		// Level 3
+		"aa...aa"
+		"a.....a"
+		"b.....b"
+		"a.....a"
+		"b.....b"
+		"a.aaaaa"
+		"aabaaba"
+
+		// Level 4
+		"aa...aa"
+		"a.....a"
+		"b.....b"
+		"a.....a"
+		"b.....b"
+		"a..aaaa"
+		"aabaaba"
+
+		// Level 5
+		"aabbbaa"
+		"a.....a"
+		"b.....b"
+		"a.....a"
+		"b.....b"
+		"a...aaa"
+		"aabaaba"
+
+		// Level 6
+		"aaaaaaa"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"a....aa"
+		"aaaaaaa"
+
+		// Level 7
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"a.....a"
+		"aaaaaaa"
+
+		// Level 8
+		"aaaaaaa"
+		"a.....a"
+		"......a"
+		"......a"
+		"......a"
+		"a.....a"
+		"aaaaaaa"
+
+		// Level 9
+		"mmmmmmm"
+		"m.....m"
+		"......m"
+		"......m"
+		"......m"
+		"m.....m"
+		"mmmmmmm"
+
+		// Level 10
+		"mmmmmmm"
+		"m.....m"
+		"......m"
+		"......m"
+		"......m"
+		"m.....m"
+		"mmmmmmm",
+		
+		// Connections:
+		"0: 3, 1, 0: 2\n"  /* Type 0, BLOCK_FACE_ZM */
+		"0: 0, 7, 3: 4\n"  /* Type 0, BLOCK_FACE_XM */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // StairsToOpen2
+
+
+	// Tee2x4:
+	// The data has been exported from gallery Nether, area index 40, ID 291
+	{
+		// Size:
+		13, 6, 7,  // SizeX = 13, SizeY = 6, SizeZ = 7
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:113: 0\n"  /* netherbrickfence */
+		"c:114: 0\n"  /* netherbrickstairs */
+		"d:114: 1\n"  /* netherbrickstairs */
+		"e:114: 2\n"  /* netherbrickstairs */
+		"f:114: 3\n"  /* netherbrickstairs */
+		"m: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"mmmmaaaaammmm"
+		"mmmmaaaaammmm"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 2
+		"mmmma...ammmm"
+		"mmmma...ammmm"
+		"aaaaa...aaaaa"
+		"............."
+		"............."
+		"............."
+		"aaaaaaaaaaaaa"
+
+		// Level 3
+		"mmmma...ammmm"
+		"mmmmb...bmmmm"
+		"ababa...ababa"
+		"............."
+		"............."
+		"............."
+		"ababababababa"
+
+		// Level 4
+		"mmmma...ammmm"
+		"mmmmb...bmmmm"
+		"ababa...ababa"
+		"............."
+		"............."
+		"............."
+		"ababababababa"
+
+		// Level 5
+		"mmmma...ammmm"
+		"mmmmb...bmmmm"
+		"ababa...ababa"
+		"............."
+		"............."
+		"............."
+		"ababababababa"
+
+		// Level 6
+		"mmmmcaaadmmmm"
+		"mmmmcaaadmmmm"
+		"eeeecaaadeeee"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"fffffffffffff",
+
+		// Connections:
+		"1:  0, 1, 4: 4\n"  /* Type 1, BLOCK_FACE_XM */
+		"1:  6, 1, 0: 2\n"  /* Type 1, BLOCK_FACE_ZM */
+		"1: 12, 1, 4: 5\n"  /* Type 1, BLOCK_FACE_XP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // Tee2x4
+
+
+	// Tee4x4:
+	// The data has been exported from gallery Nether, area index 41, ID 292
+	{
+		// Size:
+		13, 6, 9,  // SizeX = 13, SizeY = 6, SizeZ = 9
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:113: 0\n"  /* netherbrickfence */
+		"c:114: 0\n"  /* netherbrickstairs */
+		"d:114: 1\n"  /* netherbrickstairs */
+		"e:114: 2\n"  /* netherbrickstairs */
+		"f:114: 3\n"  /* netherbrickstairs */
+		"m: 19: 0\n"  /* sponge */,
+
+		// Block data:
+		// Level 1
+		"mmmmaaaaammmm"
+		"mmmmaaaaammmm"
+		"mmmmaaaaammmm"
+		"mmmmaaaaammmm"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 2
+		"mmmma...ammmm"
+		"mmmma...ammmm"
+		"mmmma...ammmm"
+		"mmmma...ammmm"
+		"aaaaa...aaaaa"
+		"............."
+		"............."
+		"............."
+		"aaaaaaaaaaaaa"
+
+		// Level 3
+		"mmmma...ammmm"
+		"mmmmb...bmmmm"
+		"mmmma...ammmm"
+		"mmmmb...bmmmm"
+		"ababa...ababa"
+		"............."
+		"............."
+		"............."
+		"ababababababa"
+
+		// Level 4
+		"mmmma...ammmm"
+		"mmmmb...bmmmm"
+		"mmmma...ammmm"
+		"mmmmb...bmmmm"
+		"ababa...ababa"
+		"............."
+		"............."
+		"............."
+		"ababababababa"
+
+		// Level 5
+		"mmmma...ammmm"
+		"mmmmb...bmmmm"
+		"mmmma...ammmm"
+		"mmmmb...bmmmm"
+		"ababa...ababa"
+		"............."
+		"............."
+		"............."
+		"ababababababa"
+
+		// Level 6
+		"mmmmcaaadmmmm"
+		"mmmmcaaadmmmm"
+		"mmmmcaaadmmmm"
+		"mmmmcaaadmmmm"
+		"eeeecaaadeeee"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"fffffffffffff",
+
+		// Connections:
+		"1:  0, 1,  6: 4\n"  /* Type 1, BLOCK_FACE_XM */
+		"1: 12, 1,  6: 5\n"  /* Type 1, BLOCK_FACE_XP */
+		"1:  6, 1,  0: 2\n"  /* Type 1, BLOCK_FACE_ZM */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // Tee4x4
+
+	// Turret:
+	// The data has been exported from gallery Nether, area index 7, ID 34
+	{
+		// Size:
+		7, 6, 7,  // SizeX = 7, SizeY = 6, SizeZ = 7
+
+		// Block definitions:
+		".:  0: 0\n"  /* air */
+		"a:112: 0\n"  /* netherbrick */
+		"b:113: 0\n"  /* netherbrickfence */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+		"aaaaaaa"
+
+		// Level 2
+		"aa...aa"
+		"a.....a"
+		"......."
+		"......."
+		"......."
+		"a.....a"
+		"aa...aa"
+
+		// Level 3
+		"aa...aa"
+		"a.....a"
+		"......."
+		"......."
+		"......."
+		"a.....a"
+		"aa...aa"
+
+		// Level 4
+		"aa...aa"
+		"a.....a"
+		"......."
+		"......."
+		"......."
+		"a.....a"
+		"aa...aa"
+
+		// Level 5
+		"aabbbaa"
+		"a.....a"
+		"b.....b"
+		"b.....b"
+		"b.....b"
+		"a.....a"
+		"aabbbaa"
+
+		// Level 6
+		"aaaaaaa"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"a.....a"
+		"aaaaaaa",
+
+		// Connections:
+		"0: 0, 1, 3: 4\n"  /* Type 0, BLOCK_FACE_XM */
+		"0: 3, 1, 0: 2\n"  /* Type 0, BLOCK_FACE_ZM */
+		"0: 6, 1, 3: 5\n"  /* Type 0, BLOCK_FACE_XP */
+		"0: 3, 1, 6: 3\n"  /* Type 0, BLOCK_FACE_ZP */,
+
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},  // Turret
+
+} ;  // g_NetherFortPrefabs1
+
+
+
+
+
+const cPrefab::sDef g_NetherFortStartingPrefabs1[] =
+{
+	///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+	// CentralRoom:
+	// The data has been exported from gallery Nether, area index 22, ID 164
+	{
+		// Size:
+		13, 9, 13,  // SizeX = 13, SizeY = 9, SizeZ = 13
+
+		// Block definitions:
+		"a:112: 0\n"  /* netherbrick */
+		"b:  0: 0\n"  /* air */
+		"c: 10: 0\n"  /* lava */
+		"d:113: 0\n"  /* netherbrickfence */,
+
+		// Block data:
+		// Level 1
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 2
+		"aaaaabbbaaaaa"
+		"aaaaabbbaaaaa"
+		"aabbbbbbbbbaa"
+		"aabbbbbbbbbaa"
+		"aabbbbbbbbbaa"
+		"aabbbaaabbbaa"
+		"aabbbacabbbaa"
+		"aabbbaaabbbaa"
+		"aabbbbbbbbbaa"
+		"aabbbbbbbbbaa"
+		"aabbbbbbbbbaa"
+		"aaaaabbbaaaaa"
+		"aaaaabbbaaaaa"
+
+		// Level 3
+		"aaaaabbbaaaaa"
+		"aaadabbbadaaa"
+		"aabbbbbbbbbaa"
+		"adbbbbbbbbbda"
+		"aabbbbbbbbbaa"
+		"adbbbbbbbbbda"
+		"aabbbbbbbbbaa"
+		"adbbbbbbbbbda"
+		"aabbbbbbbbbaa"
+		"adbbbbbbbbbda"
+		"aabbbbbbbbbaa"
+		"aaadabbbadaaa"
+		"aaaaabbbaaaaa"
+
+		// Level 4
+		"aaaaabbbaaaaa"
+		"aaadabbbadaaa"
+		"aabbbbbbbbbaa"
+		"adbbbbbbbbbda"
+		"aabbbbbbbbbaa"
+		"adbbbbbbbbbda"
+		"aabbbbbbbbbaa"
+		"adbbbbbbbbbda"
+		"aabbbbbbbbbaa"
+		"adbbbbbbbbbda"
+		"aabbbbbbbbbaa"
+		"aaadabbbadaaa"
+		"aaaaabbbaaaaa"
+
+		// Level 5
+		"adadadddadada"
+		"daaaabbbaaaad"
+		"aabbbbbbbbbaa"
+		"dabbbbbbbbbad"
+		"aabbbbbbbbbaa"
+		"dabbbbbbbbbad"
+		"aabbbbbbbbbaa"
+		"dabbbbbbbbbad"
+		"aabbbbbbbbbaa"
+		"dabbbbbbbbbad"
+		"aabbbbbbbbbaa"
+		"daaaabbbaaaad"
+		"adadabbbadada"
+
+		// Level 6
+		"adadaaaaadada"
+		"daaaaaaaaaaad"
+		"aabbbbbbbbbaa"
+		"dabbbbbbbbbad"
+		"aabbbbbbbbbaa"
+		"dabbbbbbbbbad"
+		"aabbbbbbbbbaa"
+		"dabbbbbbbbbad"
+		"aabbbbbbbbbaa"
+		"dabbbbbbbbbad"
+		"aabbbbbbbbbaa"
+		"daaaaaaaaaaad"
+		"adadaaaaadada"
+
+		// Level 7
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 8
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+		"aaaaaaaaaaaaa"
+
+		// Level 9
+		"dadadadadadad"
+		"abbbbbbbbbbba"
+		"dbbbbbbbbbbbd"
+		"abbbbbbbbbbba"
+		"dbbbbbbbbbbbd"
+		"abbbbbbbbbbba"
+		"dbbbbbbbbbbbd"
+		"abbbbbbbbbbba"
+		"dbbbbbbbbbbbd"
+		"abbbbbbbbbbba"
+		"dbbbbbbbbbbbd"
+		"abbbbbbbbbbba"
+		"dadadadadadad",
+
+		// Connections:
+		"0: 6, 1,  0: 2\n"  /* Type 0, BLOCK_FACE_ZM */
+		"1: 6, 1, 12: 3\n"  /* Type 1, BLOCK_FACE_ZP */,
+		
+		// AllowedRotations:
+		7,  /* 1, 2, 3 CCW rotations */
+		
+		// Merge strategy:
+		cBlockArea::msSpongePrint,
+	},
+} ;  // g_NetherFortStartingPrefabs1
+
+const size_t g_NetherFortPrefabs1Count = ARRAYCOUNT(g_NetherFortPrefabs1);
+const size_t g_NetherFortStartingPrefabs1Count = ARRAYCOUNT(g_NetherFortStartingPrefabs1);
+
+
+
+
diff --git a/src/Generating/Prefabs/NetherFortPrefabs.h b/src/Generating/Prefabs/NetherFortPrefabs.h
new file mode 100644
index 000000000..37a91689d
--- /dev/null
+++ b/src/Generating/Prefabs/NetherFortPrefabs.h
@@ -0,0 +1,15 @@
+
+// NetherFortPrefabs.h
+
+// Declares the data used for nether fortress prefabs
+
+#include "../Prefab.h"
+
+
+
+
+
+extern const cPrefab::sDef g_NetherFortPrefabs1[];
+extern const cPrefab::sDef g_NetherFortStartingPrefabs1[];
+extern const size_t g_NetherFortPrefabs1Count;
+extern const size_t g_NetherFortStartingPrefabs1Count;
diff --git a/src/Generating/StructGen.cpp b/src/Generating/StructGen.cpp
index 3cc8a09c3..db9d5578c 100644
--- a/src/Generating/StructGen.cpp
+++ b/src/Generating/StructGen.cpp
@@ -578,7 +578,7 @@ void cStructGenDirectOverhangs::GenFinish(cChunkDesc & a_ChunkDesc)
 			m_Noise2.IntNoise3DInt(BaseX + INTERPOL_X * x, BaseY, BaseZ + INTERPOL_Z * z) /
 			256;
 	}  // for x, z - FloorLo[]
-	LinearUpscale2DArrayInPlace(FloorLo, 17, 17, INTERPOL_X, INTERPOL_Z);
+	LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorLo);
 	
 	// Interpolate segments:
 	for (int Segment = BaseY; Segment < MaxHeight; Segment += SEGMENT_HEIGHT)
@@ -591,7 +591,7 @@ void cStructGenDirectOverhangs::GenFinish(cChunkDesc & a_ChunkDesc)
 				m_Noise2.IntNoise3DInt(BaseX + INTERPOL_Z * x, Segment + SEGMENT_HEIGHT, BaseZ + INTERPOL_Z * z) /
 				256;
 		}  // for x, z - FloorLo[]
-		LinearUpscale2DArrayInPlace(FloorHi, 17, 17, INTERPOL_X, INTERPOL_Z);
+		LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorHi);
 		
 		// Interpolate between FloorLo and FloorHi:
 		for (int z = 0; z < 16; z++) for (int x = 0; x < 16; x++)
diff --git a/src/Globals.h b/src/Globals.h
index 3e62832b7..a1cee5c2f 100644
--- a/src/Globals.h
+++ b/src/Globals.h
@@ -264,11 +264,17 @@ template class SizeChecker<UInt16, 2>;
 #define assert_test(x) ( !!(x) || (assert(!#x), exit(1), 0))
 #endif
 
-/// A generic interface used mainly in ForEach() functions
+
+
+
+
+/** A generic interface used mainly in ForEach() functions */
 template <typename Type> class cItemCallback
 {
 public:
-	/// Called for each item in the internal list; return true to stop the loop, or false to continue enumerating
+	virtual ~cItemCallback() {}
+	
+	/** Called for each item in the internal list; return true to stop the loop, or false to continue enumerating */
 	virtual bool Item(Type * a_Type) = 0;
 } ;
 
diff --git a/src/HTTPServer/HTTPServer.h b/src/HTTPServer/HTTPServer.h
index 24baf8c95..383abb4b6 100644
--- a/src/HTTPServer/HTTPServer.h
+++ b/src/HTTPServer/HTTPServer.h
@@ -37,6 +37,8 @@ public:
 	class cCallbacks
 	{
 	public:
+		virtual ~cCallbacks() {}
+		
 		/** Called when a new request arrives over a connection and its headers have been parsed.
 		The request body needn't have arrived yet.
 		*/
@@ -50,7 +52,7 @@ public:
 	} ;
 	
 	cHTTPServer(void);
-	~cHTTPServer();
+	virtual ~cHTTPServer();
 	
 	/// Initializes the server on the specified ports
 	bool Initialize(const AString & a_PortsIPv4, const AString & a_PortsIPv6);
diff --git a/src/Inventory.h b/src/Inventory.h
index fd2089a13..1ad7c4776 100644
--- a/src/Inventory.h
+++ b/src/Inventory.h
@@ -52,6 +52,8 @@ public:
 	
 	cInventory(cPlayer & a_Owner);
 	
+	virtual ~cInventory() {}
+	
 	// tolua_begin
 
 	/// Removes all items from the entire inventory
diff --git a/src/Item.h b/src/Item.h
index 4bdfb12dd..910ecb382 100644
--- a/src/Item.h
+++ b/src/Item.h
@@ -209,7 +209,7 @@ public:
 	void    Add   (const cItem & a_Item) {push_back(a_Item); }
 	void    Delete(int a_Idx);
 	void    Clear (void) {clear(); }
-	int     Size  (void) {return size(); }
+	size_t  Size  (void) {return size(); }
 	void    Set   (int a_Idx, short a_ItemType, char a_ItemCount, short a_ItemDamage);
 
 	void    Add   (short a_ItemType, char a_ItemCount, short a_ItemDamage)
diff --git a/src/ItemGrid.h b/src/ItemGrid.h
index b344e3daf..c34d5e9e2 100644
--- a/src/ItemGrid.h
+++ b/src/ItemGrid.h
@@ -20,11 +20,13 @@ class cItemGrid
 public:
 	// tolua_end
 	
-	/// This class is used as a callback for when a slot changes
+	/** This class is used as a callback for when a slot changes */
 	class cListener
 	{
 	public:
-		/// Called whenever a slot changes
+		virtual ~cListener() {}
+		
+		/** Called whenever a slot changes */
 		virtual void OnSlotChanged(cItemGrid * a_ItemGrid, int a_SlotNum) = 0;
 	} ;
 	typedef std::vector<cListener *> cListeners;
@@ -38,12 +40,12 @@ public:
 	int GetHeight  (void) const { return m_Height; }
 	int GetNumSlots(void) const { return m_NumSlots; }
 	
-	/// Converts XY coords into slot number; returns -1 on invalid coords
+	/** Converts XY coords into slot number; returns -1 on invalid coords */
 	int GetSlotNum(int a_X, int a_Y) const;
 	
 	// tolua_end
 
-	/// Converts slot number into XY coords; sets coords to -1 on invalid slot number. Exported in ManualBindings.cpp
+	/** Converts slot number into XY coords; sets coords to -1 on invalid slot number. Exported in ManualBindings.cpp */
 	void GetSlotCoords(int a_SlotNum, int & a_X, int & a_Y) const;
 
 	// tolua_begin
@@ -62,16 +64,16 @@ public:
 	void EmptySlot(int a_X, int a_Y);
 	void EmptySlot(int a_SlotNum);
 	
-	/// Returns true if the specified slot is empty or the slot doesn't exist
+	/** Returns true if the specified slot is empty or the slot doesn't exist */
 	bool IsSlotEmpty(int a_SlotNum) const;
 	
-	/// Returns true if the specified slot is empty or the slot doesn't exist
+	/** Returns true if the specified slot is empty or the slot doesn't exist */
 	bool IsSlotEmpty(int a_X, int a_Y) const;
 	
-	/// Sets all items as empty
+	/** Sets all items as empty */
 	void Clear(void);
 	
-	/// Returns number of items out of a_ItemStack that can fit in the storage
+	/** Returns number of items out of a_ItemStack that can fit in the storage */
 	int HowManyCanFit(const cItem & a_ItemStack, bool a_AllowNewStacks = true);
 	
 	/** Adds as many items out of a_ItemStack as can fit.
@@ -117,37 +119,37 @@ public:
 	*/
 	cItem RemoveOneItem(int a_X, int a_Y);
 	
-	/// Returns the number of items of type a_Item that are stored
+	/** Returns the number of items of type a_Item that are stored */
 	int HowManyItems(const cItem & a_Item);
 	
-	/// Returns true if there are at least as many items of type a_ItemStack as in a_ItemStack
+	/** Returns true if there are at least as many items of type a_ItemStack as in a_ItemStack */
 	bool HasItems(const cItem & a_ItemStack);
 	
-	/// Returns the index of the first empty slot; -1 if all full
+	/** Returns the index of the first empty slot; -1 if all full */
 	int GetFirstEmptySlot(void) const;
 
-	/// Returns the index of the first non-empty slot; -1 if all empty
+	/** Returns the index of the first non-empty slot; -1 if all empty */
 	int GetFirstUsedSlot(void) const;
 
-	/// Returns the index of the last empty slot; -1 if all full
+	/** Returns the index of the last empty slot; -1 if all full */
 	int GetLastEmptySlot(void) const;
 	
-	/// Returns the index of the last used slot; -1 if all empty
+	/** Returns the index of the last used slot; -1 if all empty */
 	int GetLastUsedSlot(void) const;
 
-	/// Returns the index of the first empty slot following a_StartFrom (a_StartFrom is not checked)
+	/** Returns the index of the first empty slot following a_StartFrom (a_StartFrom is not checked) */
 	int GetNextEmptySlot(int a_StartFrom) const;
 	
-	/// Returns the index of the first used slot following a_StartFrom (a_StartFrom is not checked)
+	/** Returns the index of the first used slot following a_StartFrom (a_StartFrom is not checked) */
 	int GetNextUsedSlot(int a_StartFrom) const;
 	
-	/// Copies the contents into a cItems object; preserves the original a_Items contents
+	/** Copies the contents into a cItems object; preserves the original a_Items contents */
 	void CopyToItems(cItems & a_Items) const;
 
-	/// Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact)
+	/** Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) */
 	bool DamageItem(int a_SlotNum, short a_Amount);
 	
-	/// Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact)
+	/** Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) */
 	bool DamageItem(int a_X, int a_Y, short a_Amount);
 	
 	// tolua_end
@@ -159,10 +161,10 @@ public:
 	*/
 	void GenerateRandomLootWithBooks(const cLootProbab * a_LootProbabs, size_t a_CountLootProbabs, int a_NumSlots, int a_Seed);
 	
-	/// Adds a callback that gets called whenever a slot changes. Must not be called from within the listener callback!
+	/** Adds a callback that gets called whenever a slot changes. Must not be called from within the listener callback! */
 	void AddListener(cListener & a_Listener);
 	
-	/// Removes a slot-change-callback. Must not be called from within the listener callback!
+	/** Removes a slot-change-callback. Must not be called from within the listener callback! */
 	void RemoveListener(cListener & a_Listener);
 
 	// tolua_begin
@@ -177,7 +179,7 @@ protected:
 	cCriticalSection m_CSListeners;  ///< CS that guards the m_Listeners against multi-thread access
 	bool             m_IsInTriggerListeners;  ///< Set to true while TriggerListeners is running, to detect attempts to manipulate listener list while triggerring
 	
-	/// Calls all m_Listeners for the specified slot number
+	/** Calls all m_Listeners for the specified slot number */
 	void TriggerListeners(int a_SlotNum);
 
 	/** Adds up to a_Num items out of a_ItemStack, as many as can fit, in specified slot
diff --git a/src/Items/ItemBucket.h b/src/Items/ItemBucket.h
index 72cb8fa0a..68c89dd85 100644
--- a/src/Items/ItemBucket.h
+++ b/src/Items/ItemBucket.h
@@ -172,12 +172,12 @@ public:
 			
 			virtual bool OnNextBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, char a_EntryFace) override
 			{
-				if (a_BlockMeta != 0)  // Even if it was a water block it would not be a source.
-				{
-					return false;
-				}
 				if (IsBlockWater(a_BlockType) || IsBlockLava(a_BlockType))
 				{
+					if (a_BlockMeta != 0) // GetBlockFromTrace is called for scooping up fluids; the hit block should be a source
+					{
+						return false;
+					}
 					m_HasHitFluid = true;
 					m_Pos.Set(a_BlockX, a_BlockY, a_BlockZ);
 					return true;
diff --git a/src/Items/ItemCake.h b/src/Items/ItemCake.h
new file mode 100644
index 000000000..48e23ed59
--- /dev/null
+++ b/src/Items/ItemCake.h
@@ -0,0 +1,41 @@
+
+#pragma once
+
+#include "ItemHandler.h"
+
+
+
+
+
+class cItemCakeHandler :
+	public cItemHandler
+{
+public:
+	cItemCakeHandler(int a_ItemType) :
+		cItemHandler(a_ItemType)
+	{
+	}
+
+
+	virtual bool IsPlaceable(void) override
+	{
+		return true;
+	}
+
+
+	virtual bool GetPlacementBlockTypeMeta(
+		cWorld * a_World, cPlayer * a_Player,
+		int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, 
+		int a_CursorX, int a_CursorY, int a_CursorZ,
+		BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta
+	) override
+	{
+		a_BlockType = E_BLOCK_CAKE;
+		a_BlockMeta = 0;
+		return true;
+	}
+} ;
+
+
+
+
diff --git a/src/Items/ItemHandler.cpp b/src/Items/ItemHandler.cpp
index 1d357fcf1..337b3a83c 100644
--- a/src/Items/ItemHandler.cpp
+++ b/src/Items/ItemHandler.cpp
@@ -13,6 +13,7 @@
 #include "ItemBow.h"
 #include "ItemBrewingStand.h"
 #include "ItemBucket.h"
+#include "ItemCake.h"
 #include "ItemCauldron.h"
 #include "ItemCloth.h"
 #include "ItemComparator.h"
@@ -26,6 +27,7 @@
 #include "ItemHoe.h"
 #include "ItemLeaves.h"
 #include "ItemLighter.h"
+#include "ItemLilypad.h"
 #include "ItemMap.h"
 #include "ItemMinecart.h"
 #include "ItemNetherWart.h"
@@ -94,6 +96,7 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType)
 		
 		// Single item per handler, alphabetically sorted:
 		case E_BLOCK_LEAVES:           return new cItemLeavesHandler(a_ItemType);
+		case E_BLOCK_NEW_LEAVES:       return new cItemLeavesHandler(a_ItemType);
 		case E_BLOCK_SAPLING:          return new cItemSaplingHandler(a_ItemType);
 		case E_BLOCK_WOOL:             return new cItemClothHandler(a_ItemType);
 		case E_ITEM_BED:               return new cItemBedHandler(a_ItemType);
@@ -101,16 +104,19 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType)
 		case E_ITEM_BOTTLE_O_ENCHANTING: return new cItemBottleOEnchantingHandler();
 		case E_ITEM_BOW:               return new cItemBowHandler;
 		case E_ITEM_BREWING_STAND:     return new cItemBrewingStandHandler(a_ItemType);
+		case E_ITEM_CAKE:              return new cItemCakeHandler(a_ItemType);
 		case E_ITEM_CAULDRON:          return new cItemCauldronHandler(a_ItemType);
 		case E_ITEM_COMPARATOR:        return new cItemComparatorHandler(a_ItemType);
 		case E_ITEM_DYE:               return new cItemDyeHandler(a_ItemType);
 		case E_ITEM_EGG:               return new cItemEggHandler();
 		case E_ITEM_EMPTY_MAP:         return new cItemEmptyMapHandler();
 		case E_ITEM_ENDER_PEARL:       return new cItemEnderPearlHandler();
+		case E_ITEM_FIRE_CHARGE:       return new cItemLighterHandler(a_ItemType);
 		case E_ITEM_FIREWORK_ROCKET:   return new cItemFireworkHandler();
 		case E_ITEM_FISHING_ROD:       return new cItemFishingRodHandler(a_ItemType);
 		case E_ITEM_FLINT_AND_STEEL:   return new cItemLighterHandler(a_ItemType);
 		case E_ITEM_FLOWER_POT:        return new cItemFlowerPotHandler(a_ItemType);
+		case E_BLOCK_LILY_PAD:         return new cItemLilypadHandler(a_ItemType);
 		case E_ITEM_MAP:               return new cItemMapHandler();
 		case E_ITEM_ITEM_FRAME:        return new cItemItemFrameHandler(a_ItemType);
 		case E_ITEM_NETHER_WART:       return new cItemNetherWartHandler(a_ItemType);
@@ -337,6 +343,7 @@ char cItemHandler::GetMaxStackSize(void)
 		case E_ITEM_BREWING_STAND:        return 64;
 		case E_ITEM_BUCKET:               return 16;
 		case E_ITEM_CARROT:               return 64;
+		case E_ITEM_CAKE:                 return 1;
 		case E_ITEM_CAULDRON:             return 64;
 		case E_ITEM_CLAY:                 return 64;
 		case E_ITEM_CLAY_BRICK:           return 64;
diff --git a/src/Items/ItemItemFrame.h b/src/Items/ItemItemFrame.h
index 74e987445..27e7dba35 100644
--- a/src/Items/ItemItemFrame.h
+++ b/src/Items/ItemItemFrame.h
@@ -34,7 +34,11 @@ public:
 		if (Block == E_BLOCK_AIR)
 		{
 			cItemFrame * ItemFrame = new cItemFrame(a_Dir, a_BlockX, a_BlockY, a_BlockZ);
-			ItemFrame->Initialize(a_World);
+			if (!ItemFrame->Initialize(a_World))
+			{
+				delete ItemFrame;
+				return false;
+			}
 
 			if (!a_Player->IsGameModeCreative())
 			{
diff --git a/src/Items/ItemLighter.h b/src/Items/ItemLighter.h
index 18873e911..32f49cab6 100644
--- a/src/Items/ItemLighter.h
+++ b/src/Items/ItemLighter.h
@@ -26,7 +26,26 @@ public:
 			return false;
 		}
 		
-		a_Player->UseEquippedItem();
+		if (!a_Player->IsGameModeCreative())
+		{
+			switch (m_ItemType)
+			{
+				case E_ITEM_FLINT_AND_STEEL:
+				{
+					a_Player->UseEquippedItem();
+					break;
+				}
+				case E_ITEM_FIRE_CHARGE:
+				{
+					a_Player->GetInventory().RemoveOneEquippedItem();
+					break;
+				}
+				default:
+				{
+					ASSERT(!"Unknown Lighter Item!");
+				}
+			}
+		}
 
 		switch (a_World->GetBlock(a_BlockX, a_BlockY, a_BlockZ))
 		{
@@ -34,8 +53,8 @@ public:
 			{
 				// Activate the TNT:
 				a_World->BroadcastSoundEffect("game.tnt.primed", a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 1.0f, 1.0f);
-				a_World->SpawnPrimedTNT(a_BlockX + 0.5, a_BlockY + 0.5, a_BlockZ + 0.5);  // 80 ticks to boom
 				a_World->SetBlock(a_BlockX,a_BlockY,a_BlockZ, E_BLOCK_AIR, 0);
+				a_World->SpawnPrimedTNT(a_BlockX + 0.5, a_BlockY + 0.5, a_BlockZ + 0.5);  // 80 ticks to boom
 				break;
 			}
 			default:
@@ -49,6 +68,7 @@ public:
 				if (a_World->GetBlock(a_BlockX, a_BlockY, a_BlockZ) == E_BLOCK_AIR)
 				{
 					a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_FIRE, 0);
+					a_World->BroadcastSoundEffect("fire.ignite", a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 1.0F, 1.04F);
 					break;
 				}
 			}
diff --git a/src/Items/ItemLilypad.h b/src/Items/ItemLilypad.h
new file mode 100644
index 000000000..5a29abe94
--- /dev/null
+++ b/src/Items/ItemLilypad.h
@@ -0,0 +1,109 @@
+#pragma once
+
+#include "ItemHandler.h"
+#include "../Entities/Player.h"
+#include "Vector3.h"
+#include "../LineBlockTracer.h"
+#include "BlockInfo.h"
+
+
+
+
+
+class cItemLilypadHandler :
+	public cItemHandler
+{
+	typedef cItemHandler super;
+
+public:
+	cItemLilypadHandler(BLOCKTYPE a_BlockType)
+		: cItemHandler(a_BlockType)
+	{
+
+	}
+
+	virtual bool IsPlaceable(void) override
+	{
+		return false; // Set as not placeable so OnItemUse is called
+	}
+
+	virtual bool OnItemUse(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override
+	{
+		if (a_BlockFace > BLOCK_FACE_NONE)
+		{
+			// Clicked on the side of a submerged block; vanilla allows placement, so should we
+			AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace);
+			a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_LILY_PAD, 0);
+			if (!a_Player->IsGameModeCreative())
+			{
+				a_Player->GetInventory().RemoveOneEquippedItem();
+			}
+			return true;
+		}
+
+		class cCallbacks :
+			public cBlockTracer::cCallbacks
+		{
+		public:
+			cCallbacks(cWorld * a_World) :
+				m_HasHitFluid(false),
+				m_World(a_World)
+			{
+			}
+
+			virtual bool OnNextBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, char a_EntryFace) override
+			{
+				if (IsBlockWater(a_BlockType))
+				{
+					if ((a_BlockMeta != 0) || (a_EntryFace == BLOCK_FACE_NONE)) // The hit block should be a source. The FACE_NONE check is clicking whilst submerged
+					{
+						return false;
+					}
+					a_EntryFace = BLOCK_FACE_YP; // Always place pad at top of water block
+					AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, (eBlockFace)a_EntryFace);
+					BLOCKTYPE Block = m_World->GetBlock(a_BlockX, a_BlockY, a_BlockZ);
+					if (
+						!IsBlockWater(Block) &&
+						cBlockInfo::FullyOccupiesVoxel(Block)
+						)
+					{
+						// Can't place lilypad on air/in another block!
+						return true;
+					}
+					m_HasHitFluid = true;
+					m_Pos.Set(a_BlockX, a_BlockY, a_BlockZ);
+					return true;
+				}
+				return false;
+			}
+
+			Vector3i m_Pos;
+			bool m_HasHitFluid;
+			cWorld * m_World;
+
+		};
+
+		cCallbacks Callbacks(a_World);
+		cLineBlockTracer Tracer(*a_Player->GetWorld(), Callbacks);
+		Vector3d Start(a_Player->GetEyePosition() + a_Player->GetLookVector());
+		Vector3d End(a_Player->GetEyePosition() + a_Player->GetLookVector() * 5);
+
+		Tracer.Trace(Start.x, Start.y, Start.z, End.x, End.y, End.z);
+
+		if (Callbacks.m_HasHitFluid)
+		{
+			a_World->SetBlock(Callbacks.m_Pos.x, Callbacks.m_Pos.y, Callbacks.m_Pos.z, E_BLOCK_LILY_PAD, 0);
+			if (!a_Player->IsGameModeCreative())
+			{
+				a_Player->GetInventory().RemoveOneEquippedItem();
+			}
+			return true;
+		}
+
+		return false;
+	}
+};
+
+
+
+
diff --git a/src/Items/ItemMinecart.h b/src/Items/ItemMinecart.h
index bcaa5635a..25500aeb9 100644
--- a/src/Items/ItemMinecart.h
+++ b/src/Items/ItemMinecart.h
@@ -1,4 +1,3 @@
-
 // ItemMinecart.h
 
 // Declares the various minecart ItemHandlers
@@ -72,6 +71,11 @@ public:
 			}
 		}  // switch (m_ItemType)
 		Minecart->Initialize(a_World);
+
+		if (!a_Player->IsGameModeCreative())
+		{
+			a_Player->GetInventory().RemoveOneEquippedItem();
+		}
 		return true;
 	}
 	
diff --git a/src/Items/ItemShears.h b/src/Items/ItemShears.h
index b8f75f5ba..39d2776fa 100644
--- a/src/Items/ItemShears.h
+++ b/src/Items/ItemShears.h
@@ -28,10 +28,10 @@ public:
 	virtual bool OnDiggingBlock(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Dir) override
 	{
 		BLOCKTYPE Block = a_World->GetBlock(a_BlockX, a_BlockY, a_BlockZ);
-		if (Block == E_BLOCK_LEAVES)
+		if ((Block == E_BLOCK_LEAVES) || (Block == E_BLOCK_NEW_LEAVES))
 		{
 			cItems Drops;
-			Drops.push_back(cItem(E_BLOCK_LEAVES, 1, a_World->GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) & 0x03));
+			Drops.push_back(cItem(Block, 1, a_World->GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) & 0x03));
 			a_World->SpawnItemPickups(Drops, a_BlockX, a_BlockY, a_BlockZ);
 
 			a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
@@ -49,6 +49,7 @@ public:
 			case E_BLOCK_COBWEB:
 			case E_BLOCK_VINES:
 			case E_BLOCK_LEAVES:
+			case E_BLOCK_NEW_LEAVES:
 			{
 				return true;
 			}
diff --git a/src/LightingThread.h b/src/LightingThread.h
index 198f27248..3209ad9b2 100644
--- a/src/LightingThread.h
+++ b/src/LightingThread.h
@@ -160,14 +160,14 @@ protected:
 	
 	inline void PropagateLight(
 		NIBBLETYPE * a_Light, 
-		int a_SrcIdx, int a_DstIdx,
+		unsigned int a_SrcIdx, unsigned int a_DstIdx,
 		int & a_NumSeedsOut, unsigned char * a_IsSeedOut, unsigned int * a_SeedIdxOut
 	)
 	{
 		ASSERT(a_SrcIdx >= 0);
-		ASSERT(a_SrcIdx < (int)ARRAYCOUNT(m_SkyLight));
+		ASSERT(a_SrcIdx < ARRAYCOUNT(m_SkyLight));
 		ASSERT(a_DstIdx >= 0);
-		ASSERT(a_DstIdx < (int)ARRAYCOUNT(m_BlockTypes));
+		ASSERT(a_DstIdx < ARRAYCOUNT(m_BlockTypes));
 		
 		if (a_Light[a_SrcIdx] <= a_Light[a_DstIdx] + cBlockInfo::GetSpreadLightFalloff(m_BlockTypes[a_DstIdx]))
 		{
diff --git a/src/LinearUpscale.h b/src/LinearUpscale.h
index b337b3219..0b04408cf 100644
--- a/src/LinearUpscale.h
+++ b/src/LinearUpscale.h
@@ -18,7 +18,7 @@ Therefore, there is no cpp file.
 
 InPlace upscaling works on a single array and assumes that the values to work on have already
 been interspersed into the array to the cell boundaries.
-Specifically, a_Array[x * a_AnchorStepX + y * a_AnchorStepY] contains the anchor value.
+Specifically, a_Array[x * AnchorStepX + y * AnchorStepY] contains the anchor value.
 
 Regular upscaling takes two arrays and "moves" the input from src to dst; src is expected packed.
 */
@@ -29,46 +29,48 @@ Regular upscaling takes two arrays and "moves" the input from src to dst; src is
 /**
 Linearly interpolates values in the array between the equidistant anchor points (upscales).
 Works in-place (input is already present at the correct output coords)
+Uses templates to make it possible for the compiler to further optimizer the loops
 */
-template<typename TYPE> void LinearUpscale2DArrayInPlace(
-	TYPE * a_Array,
-	int a_SizeX, int a_SizeY,  // Dimensions of the array
-	int a_AnchorStepX, int a_AnchorStepY  // Distances between the anchor points in each direction
-)
+template<
+	int SizeX, int SizeY,  // Dimensions of the array
+	int AnchorStepX, int AnchorStepY,
+	typename TYPE
+>
+void LinearUpscale2DArrayInPlace(TYPE * a_Array)
 {
 	// First interpolate columns where the anchor points are:
-	int LastYCell = a_SizeY - a_AnchorStepY;
-	for (int y = 0; y < LastYCell; y += a_AnchorStepY)
+	int LastYCell = SizeY - AnchorStepY;
+	for (int y = 0; y < LastYCell; y += AnchorStepY)
 	{
-		int Idx = a_SizeX * y;
-		for (int x = 0; x < a_SizeX; x += a_AnchorStepX)
+		int Idx = SizeX * y;
+		for (int x = 0; x < SizeX; x += AnchorStepX)
 		{
 			TYPE StartValue = a_Array[Idx];
-			TYPE EndValue   = a_Array[Idx + a_SizeX * a_AnchorStepY];
+			TYPE EndValue   = a_Array[Idx + SizeX * AnchorStepY];
 			TYPE Diff = EndValue - StartValue;
-			for (int CellY = 1; CellY < a_AnchorStepY; CellY++)
+			for (int CellY = 1; CellY < AnchorStepY; CellY++)
 			{
-				a_Array[Idx + a_SizeX * CellY] = StartValue + Diff * CellY / a_AnchorStepY;
+				a_Array[Idx + SizeX * CellY] = StartValue + Diff * CellY / AnchorStepY;
 			}  // for CellY
-			Idx += a_AnchorStepX;
+			Idx += AnchorStepX;
 		}  // for x
 	}  // for y
 
 	// Now interpolate in rows, each row has values in the anchor columns
-	int LastXCell = a_SizeX - a_AnchorStepX;
-	for (int y = 0; y < a_SizeY; y++)
+	int LastXCell = SizeX - AnchorStepX;
+	for (int y = 0; y < SizeY; y++)
 	{
-		int Idx = a_SizeX * y;
-		for (int x = 0; x < LastXCell; x += a_AnchorStepX)
+		int Idx = SizeX * y;
+		for (int x = 0; x < LastXCell; x += AnchorStepX)
 		{
 			TYPE StartValue = a_Array[Idx];
-			TYPE EndValue   = a_Array[Idx + a_AnchorStepX];
+			TYPE EndValue   = a_Array[Idx + AnchorStepX];
 			TYPE Diff = EndValue - StartValue;
-			for (int CellX = 1; CellX < a_AnchorStepX; CellX++)
+			for (int CellX = 1; CellX < AnchorStepX; CellX++)
 			{
-				a_Array[Idx + CellX] = StartValue + CellX * Diff / a_AnchorStepX;
+				a_Array[Idx + CellX] = StartValue + CellX * Diff / AnchorStepX;
 			}  // for CellY
-			Idx += a_AnchorStepX;
+			Idx += AnchorStepX;
 		}
 	}
 }
diff --git a/src/MCLogger.cpp b/src/MCLogger.cpp
index 4f3e5dc0f..80fa7b173 100644
--- a/src/MCLogger.cpp
+++ b/src/MCLogger.cpp
@@ -93,25 +93,30 @@ void cMCLogger::InitLog(const AString & a_FileName)
 
 
 
-void cMCLogger::LogSimple(const char* a_Text, int a_LogType /* = 0 */ )
+void cMCLogger::LogSimple(const char * a_Text, eLogLevel a_LogLevel)
 {
-	switch( a_LogType )
+	switch (a_LogLevel)
 	{
-		case 0:
+		case llRegular:
+		{
 			LOG("%s", a_Text);
 			break;
-		case 1:
+		}
+		case llInfo:
+		{
 			LOGINFO("%s", a_Text);
 			break;
-		case 2:
+		}
+		case llWarning:
+		{
 			LOGWARN("%s", a_Text);
 			break;
-		case 3:
+		}
+		case llError:
+		{
 			LOGERROR("%s", a_Text);
 			break;
-		default:
-			LOG("(#%d#: %s", a_LogType, a_Text);
-			break;
+		}
 	}
 }
 
diff --git a/src/MCLogger.h b/src/MCLogger.h
index 996e60329..c0150c124 100644
--- a/src/MCLogger.h
+++ b/src/MCLogger.h
@@ -10,25 +10,36 @@ class cLog;
 
 
 
-class cMCLogger														// tolua_export
-{																	// tolua_export
-public:																// tolua_export
-	/// Creates a logger with the default filename, "logs/LOG_<timestamp>.log"
+// tolua_begin
+class cMCLogger
+{
+public:
+	enum eLogLevel
+	{
+		llRegular,
+		llInfo,
+		llWarning,
+		llError,
+	};
+	// tolua_end
+	
+	/** Creates a logger with the default filename, "logs/LOG_<timestamp>.log" */
 	cMCLogger(void);
 	
-	/// Creates a logger with the specified filename inside "logs" folder
+	/** Creates a logger with the specified filename inside "logs" folder */
 	cMCLogger(const AString & a_FileName);  // tolua_export
 	
 	~cMCLogger();													// tolua_export
 
-	void Log(const char* a_Format, va_list a_ArgList)   FORMATSTRING(2, 0);
-	void Info(const char* a_Format, va_list a_ArgList)  FORMATSTRING(2, 0);
-	void Warn(const char* a_Format, va_list a_ArgList)  FORMATSTRING(2, 0);
-	void Error(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+	void Log  (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+	void Info (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+	void Warn (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+	void Error(const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
 
-	void LogSimple(const char* a_Text, int a_LogType = 0 );			// tolua_export
+	/** Logs the simple text message at the specified log level. */
+	void LogSimple(const char * a_Text, eLogLevel a_LogLevel = llRegular);  // tolua_export
 
-	static cMCLogger* GetInstance();
+	static cMCLogger * GetInstance();
 private:
 	enum eColorScheme
 	{
diff --git a/src/Map.cpp b/src/Map.cpp
index 2d8f57168..79370b097 100644
--- a/src/Map.cpp
+++ b/src/Map.cpp
@@ -243,7 +243,7 @@ bool cMap::UpdatePixel(unsigned int a_X, unsigned int a_Z)
 			{
 				for (unsigned int Z = m_RelZ; Z < m_RelZ + PixelWidth; ++Z)
 				{
-					unsigned int WaterDepth = 0;
+					// unsigned int WaterDepth = 0;
 
 					BLOCKTYPE TargetBlock = E_BLOCK_AIR;
 					NIBBLETYPE TargetMeta = 0;
@@ -261,12 +261,14 @@ bool cMap::UpdatePixel(unsigned int a_X, unsigned int a_Z)
 							continue;
 						}
 						// TODO 2014-02-22 xdot: Check if block is liquid
+						/*
 						else if (false)
 						{
 							--Height;
 							++WaterDepth;
 							continue;
 						}
+						*/
 
 						break;
 					}
diff --git a/src/MobSpawner.cpp b/src/MobSpawner.cpp
index 7704f6cf3..a0d0f5c54 100644
--- a/src/MobSpawner.cpp
+++ b/src/MobSpawner.cpp
@@ -169,7 +169,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R
 					(TargetBlock == E_BLOCK_AIR) &&
 					(BlockAbove == E_BLOCK_AIR) &&
 					(
-						(BlockBelow == E_BLOCK_GRASS) || (BlockBelow == E_BLOCK_LEAVES)
+						(BlockBelow == E_BLOCK_GRASS) || (BlockBelow == E_BLOCK_LEAVES) || (BlockBelow == E_BLOCK_NEW_LEAVES)
 					) &&
 					(a_RelY >= 62) &&
 					(m_Random.NextInt(3, a_Biome) != 0)
diff --git a/src/Mobs/Monster.cpp b/src/Mobs/Monster.cpp
index 6e3c91d58..d3e0f1c26 100644
--- a/src/Mobs/Monster.cpp
+++ b/src/Mobs/Monster.cpp
@@ -82,11 +82,11 @@ cMonster::cMonster(const AString & a_ConfigName, eType a_MobType, const AString
 	, m_AttackRange(2)
 	, m_AttackInterval(0)
 	, m_SightDistance(25)
-	, m_DropChanceWeapon(0.085)
-	, m_DropChanceHelmet(0.085)
-	, m_DropChanceChestplate(0.085)
-	, m_DropChanceLeggings(0.085)
-	, m_DropChanceBoots(0.085)
+	, m_DropChanceWeapon(0.085f)
+	, m_DropChanceHelmet(0.085f)
+	, m_DropChanceChestplate(0.085f)
+	, m_DropChanceLeggings(0.085f)
+	, m_DropChanceBoots(0.085f)
 	, m_CanPickUpLoot(true)
 	, m_BurnsInDaylight(false)
 {
@@ -758,6 +758,7 @@ cMonster::eFamily cMonster::FamilyFromType(eType a_Type)
 		case mtSquid:        return mfWater;
 		case mtVillager:     return mfPassive;
 		case mtWitch:        return mfHostile;
+		case mtWither:       return mfHostile;
 		case mtWolf:         return mfHostile;
 		case mtZombie:       return mfHostile;
 		case mtZombiePigman: return mfHostile;
diff --git a/src/Mobs/Villager.h b/src/Mobs/Villager.h
index b99ae876f..5bba4d4ba 100644
--- a/src/Mobs/Villager.h
+++ b/src/Mobs/Villager.h
@@ -29,7 +29,7 @@ public:
 
 	CLASS_PROTODEF(cVillager);
 
-	// Override functions
+	// cEntity overrides
 	virtual void DoTakeDamage(TakeDamageInfo & a_TDI) override;
 	virtual void Tick        (float a_Dt, cChunk & a_Chunk) override;
 
diff --git a/src/Mobs/Wither.cpp b/src/Mobs/Wither.cpp
index c46e0beab..8f5d28b68 100644
--- a/src/Mobs/Wither.cpp
+++ b/src/Mobs/Wither.cpp
@@ -2,14 +2,90 @@
 #include "Globals.h"  // NOTE: MSVC stupidness requires this to be the same across all modules
 
 #include "Wither.h"
+#include "../World.h"
 
 
 
 
 
 cWither::cWither(void) :
-	super("Wither", mtWither, "mob.wither.hurt", "mob.wither.death", 0.9, 4.0)
+	super("Wither", mtWither, "mob.wither.hurt", "mob.wither.death", 0.9, 4.0),
+	m_InvulnerableTicks(220)
 {
+	SetMaxHealth(300);
+}
+
+
+
+
+
+bool cWither::IsArmored(void) const
+{
+	return GetHealth() <= (GetMaxHealth() / 2);
+}
+
+
+
+
+
+bool cWither::Initialize(cWorld * a_World)
+{
+	// Set health before BroadcastSpawnEntity()
+	SetHealth(GetMaxHealth() / 3);
+
+	return super::Initialize(a_World);
+}
+
+
+
+
+
+void cWither::DoTakeDamage(TakeDamageInfo & a_TDI)
+{
+	if (a_TDI.DamageType == dtDrowning)
+	{
+		return;
+	}
+
+	if (m_InvulnerableTicks > 0)
+	{
+		return;
+	}
+
+	if (IsArmored() && (a_TDI.DamageType == dtRangedAttack))
+	{
+		return;
+	}
+
+	super::DoTakeDamage(a_TDI);
+}
+
+
+
+
+
+void cWither::Tick(float a_Dt, cChunk & a_Chunk)
+{
+	super::Tick(a_Dt, a_Chunk);
+
+	if (m_InvulnerableTicks > 0)
+	{
+		unsigned int NewTicks = m_InvulnerableTicks - 1;
+
+		if (NewTicks == 0)
+		{
+			m_World->DoExplosionAt(7.0, GetPosX(), GetPosY(), GetPosZ(), false, esWitherBirth, this);
+		}
+
+		m_InvulnerableTicks = NewTicks;
+
+		if ((NewTicks % 10) == 0)
+		{
+			Heal(10);
+		}
+	}
+
+	m_World->BroadcastEntityMetadata(*this);
 }
 
 
diff --git a/src/Mobs/Wither.h b/src/Mobs/Wither.h
index 56effc6bb..bc78bfaad 100644
--- a/src/Mobs/Wither.h
+++ b/src/Mobs/Wither.h
@@ -16,8 +16,25 @@ public:
 	cWither(void);
 
 	CLASS_PROTODEF(cWither);
+
+	unsigned int GetNumInvulnerableTicks(void) const { return m_InvulnerableTicks; }
+
+	void SetNumInvulnerableTicks(unsigned int a_Ticks) { m_InvulnerableTicks = a_Ticks; }
+
+	/** Returns whether the wither is invulnerable to arrows. */
+	bool IsArmored(void) const;
 	
+	// cEntity overrides
+	virtual bool Initialize(cWorld * a_World) override;
 	virtual void GetDrops(cItems & a_Drops, cEntity * a_Killer = NULL) override;
+	virtual void DoTakeDamage(TakeDamageInfo & a_TDI) override;
+	virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
+
+private:
+
+	/** The number of ticks of invulnerability left after being initially created. Zero once invulnerability has expired. */
+	unsigned int m_InvulnerableTicks;
+
 } ;
 
 
diff --git a/src/OSSupport/File.cpp b/src/OSSupport/File.cpp
index 17070030f..7f0f0ad2f 100644
--- a/src/OSSupport/File.cpp
+++ b/src/OSSupport/File.cpp
@@ -152,7 +152,7 @@ int cFile::Read (void * iBuffer, int iNumBytes)
 		return -1;
 	}
 	
-	return fread(iBuffer, 1, iNumBytes, m_File);  // fread() returns the portion of Count parameter actually read, so we need to send iNumBytes as Count
+	return (int)fread(iBuffer, 1, (size_t)iNumBytes, m_File);  // fread() returns the portion of Count parameter actually read, so we need to send iNumBytes as Count
 }
 
 
@@ -168,7 +168,7 @@ int cFile::Write(const void * iBuffer, int iNumBytes)
 		return -1;
 	}
 
-	int res = fwrite(iBuffer, 1, iNumBytes, m_File);  // fwrite() returns the portion of Count parameter actually written, so we need to send iNumBytes as Count
+	int res = (int)fwrite(iBuffer, 1, (size_t)iNumBytes, m_File);  // fwrite() returns the portion of Count parameter actually written, so we need to send iNumBytes as Count
 	return res;
 }
 
@@ -189,7 +189,7 @@ int cFile::Seek (int iPosition)
 	{
 		return -1;
 	}
-	return ftell(m_File);
+	return (int)ftell(m_File);
 }
 
 
@@ -206,7 +206,7 @@ int cFile::Tell (void) const
 		return -1;
 	}
 	
-	return ftell(m_File);
+	return (int)ftell(m_File);
 }
 
 
@@ -222,7 +222,7 @@ int cFile::GetSize(void) const
 		return -1;
 	}
 	
-	int CurPos = ftell(m_File);
+	int CurPos = Tell();
 	if (CurPos < 0)
 	{
 		return -1;
@@ -231,8 +231,8 @@ int cFile::GetSize(void) const
 	{
 		return -1;
 	}
-	int res = ftell(m_File);
-	if (fseek(m_File, CurPos, SEEK_SET) != 0)
+	int res = Tell();
+	if (fseek(m_File, (long)CurPos, SEEK_SET) != 0)
 	{
 		return -1;
 	}
@@ -255,7 +255,7 @@ int cFile::ReadRestOfFile(AString & a_Contents)
 	int DataSize = GetSize() - Tell();
 	
 	// HACK: This depends on the internal knowledge that AString's data() function returns the internal buffer directly
-	a_Contents.assign(DataSize, '\0');
+	a_Contents.assign((size_t)DataSize, '\0');
 	return Read((void *)a_Contents.data(), DataSize);
 }
 
@@ -350,7 +350,7 @@ int cFile::GetSize(const AString & a_FileName)
 	struct stat st;
 	if (stat(a_FileName.c_str(), &st) == 0)
 	{
-		return st.st_size;
+		return (int)st.st_size;
 	}
 	return -1;
 }
@@ -456,7 +456,7 @@ int cFile::Printf(const char * a_Fmt, ...)
 	va_start(args, a_Fmt);
 	AppendVPrintf(buf, a_Fmt, args);
 	va_end(args);
-	return Write(buf.c_str(), buf.length());
+	return Write(buf.c_str(), (int)buf.length());
 }
 
 
diff --git a/src/OSSupport/GZipFile.cpp b/src/OSSupport/GZipFile.cpp
index cbf6be6c4..7a8433f4f 100644
--- a/src/OSSupport/GZipFile.cpp
+++ b/src/OSSupport/GZipFile.cpp
@@ -73,12 +73,15 @@ int cGZipFile::ReadRestOfFile(AString & a_Contents)
 	
 	// Since the gzip format doesn't really support getting the uncompressed length, we need to read incrementally. Yuck!
 	int NumBytesRead = 0;
+	int TotalBytes = 0;
 	char Buffer[64 KiB];
 	while ((NumBytesRead = gzread(m_File, Buffer, sizeof(Buffer))) > 0)
 	{
-		a_Contents.append(Buffer, NumBytesRead);
+		TotalBytes += NumBytesRead;
+		a_Contents.append(Buffer, (size_t)NumBytesRead);
 	}
-	return NumBytesRead;
+	// NumBytesRead is < 0 on error
+	return (NumBytesRead >= 0) ? TotalBytes : NumBytesRead;
 }
 
 
@@ -99,7 +102,7 @@ bool cGZipFile::Write(const char * a_Contents, int a_Size)
 		return false;
 	}
 
-	return (gzwrite(m_File, a_Contents, a_Size) != 0);
+	return (gzwrite(m_File, a_Contents, (unsigned int)a_Size) != 0);
 }
 
 
diff --git a/src/OSSupport/ListenThread.h b/src/OSSupport/ListenThread.h
index 4e337d814..b2d806c82 100644
--- a/src/OSSupport/ListenThread.h
+++ b/src/OSSupport/ListenThread.h
@@ -29,43 +29,45 @@ class cListenThread :
 	typedef cIsThread super;
 	
 public:
-	/// Used as the callback for connection events
+	/** Used as the callback for connection events */
 	class cCallback
 	{
 	public:
-		/// This callback is called whenever a socket connection is accepted
+		virtual ~cCallback() {}
+		
+		/** This callback is called whenever a socket connection is accepted */
 		virtual void OnConnectionAccepted(cSocket & a_Socket) = 0;
 	} ;
 	
 	cListenThread(cCallback & a_Callback, cSocket::eFamily a_Family, const AString & a_ServiceName = "");
 	~cListenThread();
 	
-	/// Creates all the sockets, returns trus if successful, false if not.
+	/** Creates all the sockets, returns trus if successful, false if not. */
 	bool Initialize(const AString & a_PortsString);
 	
 	bool Start(void);
 	
 	void Stop(void);
 	
-	/// Call before Initialize() to set the "reuse" flag on the sockets
+	/** Call before Initialize() to set the "reuse" flag on the sockets */
 	void SetReuseAddr(bool a_Reuse = true);
 	
 protected:
 	typedef std::vector<cSocket> cSockets;
 
-	/// The callback which to notify of incoming connections	
+	/** The callback which to notify of incoming connections	 */
 	cCallback & m_Callback;
 	
-	/// Socket address family to use
+	/** Socket address family to use */
 	cSocket::eFamily m_Family;
 	
-	/// Sockets that are being monitored
+	/** Sockets that are being monitored */
 	cSockets m_Sockets;
 	
-	/// If set to true, the SO_REUSEADDR socket option is set to true
+	/** If set to true, the SO_REUSEADDR socket option is set to true */
 	bool m_ShouldReuseAddr;
 	
-	/// Name of the service that's listening on the ports; for logging purposes only
+	/** Name of the service that's listening on the ports; for logging purposes only */
 	AString m_ServiceName;
 	
 	
diff --git a/src/Protocol/Protocol125.cpp b/src/Protocol/Protocol125.cpp
index 69f4934d8..fe6280218 100644
--- a/src/Protocol/Protocol125.cpp
+++ b/src/Protocol/Protocol125.cpp
@@ -239,32 +239,11 @@ void cProtocol125::SendChat(const AString & a_Message)
 void cProtocol125::SendChat(const cCompositeChat & a_Message)
 {
 	// This version doesn't support composite messages, just extract each part's text and use it:
-	AString Msg;
-	const cCompositeChat::cParts & Parts = a_Message.GetParts();
-	for (cCompositeChat::cParts::const_iterator itr = Parts.begin(), end = Parts.end(); itr != end; ++itr)
-	{
-		switch ((*itr)->m_PartType)
-		{
-			case cCompositeChat::ptText:
-			case cCompositeChat::ptClientTranslated:
-			case cCompositeChat::ptRunCommand:
-			case cCompositeChat::ptSuggestCommand:
-			{
-				Msg.append((*itr)->m_Text);
-				break;
-			}
-			case cCompositeChat::ptUrl:
-			{
-				Msg.append(((cCompositeChat::cUrlPart *)(*itr))->m_Url);
-				break;
-			}
-		}  // switch (PartType)
-	}  // for itr - Parts[]
 	
 	// Send the message:
 	cCSLock Lock(m_CSPacket);
 	WriteByte  (PACKET_CHAT);
-	WriteString(Msg);
+	WriteString(a_Message.ExtractText());
 	Flush();
 }
 
@@ -1972,6 +1951,14 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob)
 			WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0); // Aggravated? Doesn't seem to do anything
 			break;
 		}
+		case cMonster::mtWither:
+		{
+			WriteByte(0x54); // Int at index 20
+			WriteInt(((const cWither &)a_Mob).GetNumInvulnerableTicks());
+			WriteByte(0x66); // Float at index 6
+			WriteFloat((float)(a_Mob.GetHealth()));
+			break;
+		}
 		case cMonster::mtSlime:
 		case cMonster::mtMagmaCube:
 		{
diff --git a/src/Protocol/Protocol16x.cpp b/src/Protocol/Protocol16x.cpp
index f6ec0a199..ecb24254f 100644
--- a/src/Protocol/Protocol16x.cpp
+++ b/src/Protocol/Protocol16x.cpp
@@ -135,7 +135,7 @@ void cProtocol161::SendPlayerMaxSpeed(void)
 	WriteInt(m_Client->GetPlayer()->GetUniqueID());
 	WriteInt(1);
 	WriteString("generic.movementSpeed");
-	WriteDouble(m_Client->GetPlayer()->GetMaxSpeed());
+	WriteDouble(0.1 * m_Client->GetPlayer()->GetMaxSpeed());
 	Flush();
 }
 
@@ -267,7 +267,7 @@ void cProtocol162::SendPlayerMaxSpeed(void)
 	WriteInt(m_Client->GetPlayer()->GetUniqueID());
 	WriteInt(1);
 	WriteString("generic.movementSpeed");
-	WriteDouble(m_Client->GetPlayer()->GetMaxSpeed());
+	WriteDouble(0.1 * m_Client->GetPlayer()->GetMaxSpeed());
 	WriteShort(0);
 	Flush();
 }
diff --git a/src/Protocol/Protocol17x.cpp b/src/Protocol/Protocol17x.cpp
index 6fc344eaf..c678fc9a0 100644
--- a/src/Protocol/Protocol17x.cpp
+++ b/src/Protocol/Protocol17x.cpp
@@ -687,9 +687,8 @@ void cProtocol172::SendPlayerAbilities(void)
 		Flags |= 0x04;
 	}
 	Pkt.WriteByte(Flags);
-	// TODO: Pkt.WriteFloat(m_Client->GetPlayer()->GetMaxFlyingSpeed());
-	Pkt.WriteFloat(0.05f);
-	Pkt.WriteFloat((float)m_Client->GetPlayer()->GetMaxSpeed());
+	Pkt.WriteFloat((float)(0.05 * m_Client->GetPlayer()->GetFlyingMaxSpeed()));
+	Pkt.WriteFloat((float)(0.1 * m_Client->GetPlayer()->GetMaxSpeed()));
 }
 
 
@@ -743,13 +742,14 @@ void cProtocol172::SendPlayerMaxSpeed(void)
 	Pkt.WriteInt(m_Client->GetPlayer()->GetUniqueID());
 	Pkt.WriteInt(1);  // Count
 	Pkt.WriteString("generic.movementSpeed");
-	Pkt.WriteDouble(0.1);
+	// The default game speed is 0.1, multiply that value by the relative speed:
+	Pkt.WriteDouble(0.1 * m_Client->GetPlayer()->GetNormalMaxSpeed());
 	if (m_Client->GetPlayer()->IsSprinting())
 	{
 		Pkt.WriteShort(1);  // Modifier count
 		Pkt.WriteInt64(0x662a6b8dda3e4c1c);
 		Pkt.WriteInt64(0x881396ea6097278d);  // UUID of the modifier
-		Pkt.WriteDouble(0.3);
+		Pkt.WriteDouble(m_Client->GetPlayer()->GetSprintingMaxSpeed() - m_Client->GetPlayer()->GetNormalMaxSpeed());
 		Pkt.WriteByte(2);
 	}
 	else
@@ -2535,6 +2535,7 @@ void cProtocol172::cPacketizer::WriteEntityMetadata(const cEntity & a_Entity)
 			WriteByte(Frame.GetRotation());
 			break;
 		}
+		default: break;
 	}
 }
 
@@ -2659,6 +2660,15 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob)
 			WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0);
 			break;
 		}
+
+		case cMonster::mtWither:
+		{
+			WriteByte(0x54); // Int at index 20
+			WriteInt(((const cWither &)a_Mob).GetNumInvulnerableTicks());
+			WriteByte(0x66); // Float at index 6
+			WriteFloat((float)(a_Mob.GetHealth()));
+			break;
+		}
 		
 		case cMonster::mtSlime:
 		{
diff --git a/src/RCONServer.h b/src/RCONServer.h
index 0e89800a2..88aac4b5f 100644
--- a/src/RCONServer.h
+++ b/src/RCONServer.h
@@ -29,7 +29,7 @@ class cRCONServer :
 {
 public:
 	cRCONServer(cServer & a_Server);
-	~cRCONServer();
+	virtual ~cRCONServer();
 	
 	void Initialize(cIniFile & a_IniFile);
 	
diff --git a/src/Root.cpp b/src/Root.cpp
index 3555afb45..ba4398b35 100644
--- a/src/Root.cpp
+++ b/src/Root.cpp
@@ -304,6 +304,7 @@ void cRoot::LoadWorlds(cIniFile & IniFile)
 	{
 		if (IniFile.GetKeyComment("Worlds", 0) != " World=secondworld")
 		{
+			IniFile.DeleteKeyComment("Worlds", 0);
 			IniFile.AddKeyComment("Worlds", " World=secondworld");
 		}
 	}
diff --git a/src/Scoreboard.cpp b/src/Scoreboard.cpp
index 8088e624b..4c89ce265 100644
--- a/src/Scoreboard.cpp
+++ b/src/Scoreboard.cpp
@@ -30,9 +30,13 @@ AString cObjective::TypeToString(eType a_Type)
 		case otStatBlockMine:      return "stat.mineBlock";
 		case otStatEntityKill:     return "stat.killEntity";
 		case otStatEntityKilledBy: return "stat.entityKilledBy";
-
+		
+		// clang optimisises this line away then warns that it has done so.
+		#if !defined(__clang__)
 		default: return "";
+		#endif
 	}
+	
 }
 
 
diff --git a/src/Simulator/FireSimulator.cpp b/src/Simulator/FireSimulator.cpp
index 26712e6e6..470dfc791 100644
--- a/src/Simulator/FireSimulator.cpp
+++ b/src/Simulator/FireSimulator.cpp
@@ -6,6 +6,8 @@
 #include "../BlockID.h"
 #include "../Defines.h"
 #include "../Chunk.h"
+#include "Root.h"
+#include "../Bindings/PluginManager.h"
 
 
 
@@ -315,9 +317,15 @@ void cFireSimulator::TrySpreadFire(cChunk * a_Chunk, int a_RelX, int a_RelY, int
 				*/
 				if (CanStartFireInBlock(a_Chunk, x, y, z))
 				{
-					FLOG("FS: Starting new fire at {%d, %d, %d}.", 
-						x + a_Chunk->GetPosX() * cChunkDef::Width, y, z + a_Chunk->GetPosZ() * cChunkDef::Width
-					);
+					int a_PosX = x + a_Chunk->GetPosX() * cChunkDef::Width;
+					int a_PosZ = z + a_Chunk->GetPosZ() * cChunkDef::Width;
+					
+					if (cRoot::Get()->GetPluginManager()->CallHookBlockSpread(&m_World, a_PosX, y, a_PosZ, ssFireSpread))
+					{
+						return;
+					}
+					
+					FLOG("FS: Starting new fire at {%d, %d, %d}.", a_PosX, y, a_PosZ);
 					a_Chunk->UnboundedRelSetBlock(x, y, z, E_BLOCK_FIRE, 0);
 				}
 			}  // for y
diff --git a/src/Simulator/FluidSimulator.cpp b/src/Simulator/FluidSimulator.cpp
index 61c93ed73..7779573d7 100644
--- a/src/Simulator/FluidSimulator.cpp
+++ b/src/Simulator/FluidSimulator.cpp
@@ -36,6 +36,7 @@ bool cFluidSimulator::CanWashAway(BLOCKTYPE a_BlockType)
 		case E_BLOCK_COBWEB:
 		case E_BLOCK_CROPS:
 		case E_BLOCK_DEAD_BUSH:
+		case E_BLOCK_LILY_PAD:
 		case E_BLOCK_RAIL:
 		case E_BLOCK_REDSTONE_TORCH_OFF:
 		case E_BLOCK_REDSTONE_TORCH_ON:
diff --git a/src/Simulator/IncrementalRedstoneSimulator.cpp b/src/Simulator/IncrementalRedstoneSimulator.cpp
index ca2ef4b1a..92659fab7 100644
--- a/src/Simulator/IncrementalRedstoneSimulator.cpp
+++ b/src/Simulator/IncrementalRedstoneSimulator.cpp
@@ -838,8 +838,8 @@ void cIncrementalRedstoneSimulator::HandleTNT(int a_BlockX, int a_BlockY, int a_
 	if (AreCoordsPowered(a_BlockX, a_BlockY, a_BlockZ))
 	{
 		m_World.BroadcastSoundEffect("game.tnt.primed", a_BlockX * 8, a_BlockY * 8, a_BlockZ * 8, 0.5f, 0.6f);
-		m_World.SpawnPrimedTNT(a_BlockX + 0.5, a_BlockY + 0.5, a_BlockZ + 0.5);  // 80 ticks to boom
 		m_World.SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+		m_World.SpawnPrimedTNT(a_BlockX + 0.5, a_BlockY + 0.5, a_BlockZ + 0.5);  // 80 ticks to boom
 	}
 }
 
@@ -1062,7 +1062,7 @@ void cIncrementalRedstoneSimulator::HandlePressurePlate(int a_BlockX, int a_Bloc
 				{
 					Vector3f EntityPos = a_Entity->GetPosition();
 					Vector3f BlockPos(m_X + 0.5f, (float)m_Y, m_Z + 0.5f);
-					float Distance = (EntityPos - BlockPos).Length();
+					double Distance = (EntityPos - BlockPos).Length();
 
 					if (Distance <= 0.7)
 					{
diff --git a/src/StringCompression.cpp b/src/StringCompression.cpp
index 5b9a3bb0a..2a85649a1 100644
--- a/src/StringCompression.cpp
+++ b/src/StringCompression.cpp
@@ -53,7 +53,7 @@ int UncompressString(const char * a_Data, int a_Length, AString & a_Uncompressed
 
 
 
-int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed)
+int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Compressed)
 {
 	// Compress a_Data into a_Compressed using GZIP; return Z_XXX error constants same as zlib's compress2()
 
@@ -83,6 +83,7 @@ int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed
 			{
 				// Some data has been compressed. Consume the buffer and continue compressing
 				a_Compressed.append(Buffer, sizeof(Buffer) - strm.avail_out);
+				strm.next_out = (Bytef *)Buffer;
 				strm.avail_out = sizeof(Buffer);
 				if (strm.avail_in == 0)
 				{
@@ -116,7 +117,7 @@ int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed
 
 
 
-extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_Uncompressed)
+extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed)
 {
 	// Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib
 
@@ -139,13 +140,14 @@ extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_U
 	
 	for (;;)
 	{
-		res = inflate(&strm, Z_FINISH);
+		res = inflate(&strm, Z_NO_FLUSH);
 		switch (res)
 		{
 			case Z_OK:
 			{
 				// Some data has been uncompressed. Consume the buffer and continue uncompressing
 				a_Uncompressed.append(Buffer, sizeof(Buffer) - strm.avail_out);
+				strm.next_out = (Bytef *)Buffer;
 				strm.avail_out = sizeof(Buffer);
 				if (strm.avail_in == 0)
 				{
diff --git a/src/StringCompression.h b/src/StringCompression.h
index 3f4e12d2d..c3a9eca91 100644
--- a/src/StringCompression.h
+++ b/src/StringCompression.h
@@ -16,10 +16,10 @@ extern int CompressString(const char * a_Data, int a_Length, AString & a_Compres
 extern int UncompressString(const char * a_Data, int a_Length, AString & a_Uncompressed, int a_UncompressedSize);
 
 /// Compresses a_Data into a_Compressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib
-extern int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed);
+extern int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Compressed);
 
 /// Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib
-extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_Uncompressed);
+extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed);
 
 
 
diff --git a/src/StringUtils.cpp b/src/StringUtils.cpp
index 3f9275798..ad622d707 100644
--- a/src/StringUtils.cpp
+++ b/src/StringUtils.cpp
@@ -454,7 +454,6 @@ AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a
 		if (!isLegalUTF8(source, extraBytesToRead + 1))
 		{
 			return a_UTF16;
-			break;
 		}
 		
 		// The cases all fall through. See "Note A" below.
diff --git a/src/StringUtils.h b/src/StringUtils.h
index 4feff7553..da395e5b5 100644
--- a/src/StringUtils.h
+++ b/src/StringUtils.h
@@ -79,10 +79,10 @@ extern AString URLDecode(const AString & a_String);  // Cannot export to Lua aut
 extern AString ReplaceAllCharOccurrences(const AString & a_String, char a_From, char a_To);  // Needn't export to Lua, since Lua doesn't have chars anyway
 
 /// Decodes a Base64-encoded string into the raw data
-extern AString Base64Decode(const AString & a_Base64String);
+extern AString Base64Decode(const AString & a_Base64String);  // Exported manually due to embedded NULs and extra parameter
 
 /// Encodes a string into Base64
-extern AString Base64Encode(const AString & a_Input);
+extern AString Base64Encode(const AString & a_Input);  // Exported manually due to embedded NULs and extra parameter
 
 /// Reads two bytes from the specified memory location and interprets them as BigEndian short
 extern short GetBEShort(const char * a_Mem);
diff --git a/src/UI/WindowOwner.h b/src/UI/WindowOwner.h
index d41abf66d..e3c73edc4 100644
--- a/src/UI/WindowOwner.h
+++ b/src/UI/WindowOwner.h
@@ -33,6 +33,10 @@ public:
 	{
 	}
 	
+	virtual ~cWindowOwner()
+	{
+	}
+	
 	void CloseWindow(void)
 	{
 		m_Window = NULL;
diff --git a/src/Vector3.h b/src/Vector3.h
index ba4abe3eb..a00e14508 100644
--- a/src/Vector3.h
+++ b/src/Vector3.h
@@ -121,6 +121,13 @@ public:
 		z += a_Z;
 	}
 
+	inline void Move(const Vector3<T> & a_Diff)
+	{
+		x += a_Diff.x;
+		y += a_Diff.y;
+		z += a_Diff.z;
+	}
+
 	// tolua_end
 
 	inline void operator += (const Vector3<T> & a_Rhs)
diff --git a/src/World.cpp b/src/World.cpp
index 012ba915b..e39a605bb 100644
--- a/src/World.cpp
+++ b/src/World.cpp
@@ -60,9 +60,6 @@
 
 
 
-/// Up to this many m_SpreadQueue elements are handled each world tick
-const int MAX_LIGHTING_SPREAD_PER_TICK = 10;
-
 const int TIME_SUNSET        = 12000;
 const int TIME_NIGHT_START   = 13187;
 const int TIME_NIGHT_END     = 22812;
@@ -250,8 +247,6 @@ cWorld::cWorld(const AString & a_WorldName) :
 	m_SkyDarkness(0),
 	m_Weather(eWeather_Sunny),
 	m_WeatherInterval(24000),  // Guaranteed 1 day of sunshine at server start :)
-	m_bCommandBlocksEnabled(false),
-	m_bUseChatPrefixes(true),
 	m_Scoreboard(this),
 	m_MapManager(this),
 	m_GeneratorCallbacks(*this),
@@ -562,29 +557,33 @@ void cWorld::Start(void)
 		m_SpawnZ = IniFile.GetValueF("SpawnPosition", "Z", m_SpawnZ);
 	}
 
-	m_StorageSchema             = IniFile.GetValueSet ("Storage",       "Schema",                    m_StorageSchema);
-	m_StorageCompressionFactor  = IniFile.GetValueSetI("Storage",       "CompressionFactor",         m_StorageCompressionFactor);
-	m_MaxCactusHeight           = IniFile.GetValueSetI("Plants",        "MaxCactusHeight",           3);
-	m_MaxSugarcaneHeight        = IniFile.GetValueSetI("Plants",        "MaxSugarcaneHeight",        3);
-	m_IsCactusBonemealable      = IniFile.GetValueSetB("Plants",        "IsCactusBonemealable",      false);
-	m_IsCarrotsBonemealable     = IniFile.GetValueSetB("Plants",        "IsCarrotsBonemealable",     true);
-	m_IsCropsBonemealable       = IniFile.GetValueSetB("Plants",        "IsCropsBonemealable",       true);
-	m_IsGrassBonemealable       = IniFile.GetValueSetB("Plants",        "IsGrassBonemealable",       true);
-	m_IsMelonStemBonemealable   = IniFile.GetValueSetB("Plants",        "IsMelonStemBonemealable",   true);
-	m_IsMelonBonemealable       = IniFile.GetValueSetB("Plants",        "IsMelonBonemealable",       false);
-	m_IsPotatoesBonemealable    = IniFile.GetValueSetB("Plants",        "IsPotatoesBonemealable",    true);
-	m_IsPumpkinStemBonemealable = IniFile.GetValueSetB("Plants",        "IsPumpkinStemBonemealable", true);
-	m_IsPumpkinBonemealable     = IniFile.GetValueSetB("Plants",        "IsPumpkinBonemealable",     false);
-	m_IsSaplingBonemealable     = IniFile.GetValueSetB("Plants",        "IsSaplingBonemealable",     true);
-	m_IsSugarcaneBonemealable   = IniFile.GetValueSetB("Plants",        "IsSugarcaneBonemealable",   false);
-	m_IsDeepSnowEnabled         = IniFile.GetValueSetB("Physics",       "DeepSnow",                  true);
-	m_ShouldLavaSpawnFire       = IniFile.GetValueSetB("Physics",       "ShouldLavaSpawnFire",       true);
-	m_bCommandBlocksEnabled     = IniFile.GetValueSetB("Mechanics",     "CommandBlocksEnabled",      false);
-	m_bEnabledPVP               = IniFile.GetValueSetB("Mechanics",     "PVPEnabled",                true);
-	m_bUseChatPrefixes          = IniFile.GetValueSetB("Mechanics",     "UseChatPrefixes",           true);
-	m_VillagersShouldHarvestCrops = IniFile.GetValueSetB("Monsters",    "VillagersShouldHarvestCrops", true);
-
-	m_GameMode = (eGameMode)IniFile.GetValueSetI("General", "Gamemode", m_GameMode);
+	m_StorageSchema               = IniFile.GetValueSet ("Storage",       "Schema",                      m_StorageSchema);
+	m_StorageCompressionFactor    = IniFile.GetValueSetI("Storage",       "CompressionFactor",           m_StorageCompressionFactor);
+	m_MaxCactusHeight             = IniFile.GetValueSetI("Plants",        "MaxCactusHeight",             3);
+	m_MaxSugarcaneHeight          = IniFile.GetValueSetI("Plants",        "MaxSugarcaneHeight",          3);
+	m_IsCactusBonemealable        = IniFile.GetValueSetB("Plants",        "IsCactusBonemealable",        false);
+	m_IsCarrotsBonemealable       = IniFile.GetValueSetB("Plants",        "IsCarrotsBonemealable",       true);
+	m_IsCropsBonemealable         = IniFile.GetValueSetB("Plants",        "IsCropsBonemealable",         true);
+	m_IsGrassBonemealable         = IniFile.GetValueSetB("Plants",        "IsGrassBonemealable",         true);
+	m_IsMelonStemBonemealable     = IniFile.GetValueSetB("Plants",        "IsMelonStemBonemealable",     true);
+	m_IsMelonBonemealable         = IniFile.GetValueSetB("Plants",        "IsMelonBonemealable",         false);
+	m_IsPotatoesBonemealable      = IniFile.GetValueSetB("Plants",        "IsPotatoesBonemealable",      true);
+	m_IsPumpkinStemBonemealable   = IniFile.GetValueSetB("Plants",        "IsPumpkinStemBonemealable",   true);
+	m_IsPumpkinBonemealable       = IniFile.GetValueSetB("Plants",        "IsPumpkinBonemealable",       false);
+	m_IsSaplingBonemealable       = IniFile.GetValueSetB("Plants",        "IsSaplingBonemealable",       true);
+	m_IsSugarcaneBonemealable     = IniFile.GetValueSetB("Plants",        "IsSugarcaneBonemealable",     false);
+	m_IsDeepSnowEnabled           = IniFile.GetValueSetB("Physics",       "DeepSnow",                    true);
+	m_ShouldLavaSpawnFire         = IniFile.GetValueSetB("Physics",       "ShouldLavaSpawnFire",         true);
+	int TNTShrapnelLevel          = IniFile.GetValueSetI("Physics",       "TNTShrapnelLevel",            (int)slNone);
+	m_bCommandBlocksEnabled       = IniFile.GetValueSetB("Mechanics",     "CommandBlocksEnabled",        false);
+	m_bEnabledPVP                 = IniFile.GetValueSetB("Mechanics",     "PVPEnabled",                  true);
+	m_bUseChatPrefixes            = IniFile.GetValueSetB("Mechanics",     "UseChatPrefixes",             true);
+	m_VillagersShouldHarvestCrops = IniFile.GetValueSetB("Monsters",      "VillagersShouldHarvestCrops", true);
+	int GameMode                  = IniFile.GetValueSetI("General",       "Gamemode",                    (int)m_GameMode);
+	
+	// Adjust the enum-backed variables into their respective bounds:
+	m_GameMode         = (eGameMode)     Clamp(GameMode,         (int)gmSurvival, (int)gmAdventure);
+	m_TNTShrapnelLevel = (eShrapnelLevel)Clamp(TNTShrapnelLevel, (int)slNone,     (int)slAll);
 
 	// Load allowed mobs:
 	const char * DefaultMonsters = "";
@@ -1727,10 +1726,13 @@ int cWorld::SpawnMinecart(double a_X, double a_Y, double a_Z, int a_MinecartType
 
 void cWorld::SpawnPrimedTNT(double a_X, double a_Y, double a_Z, int a_FuseTicks, double a_InitialVelocityCoeff)
 {
-	UNUSED(a_InitialVelocityCoeff);
 	cTNTEntity * TNT = new cTNTEntity(a_X, a_Y, a_Z, a_FuseTicks);
 	TNT->Initialize(this);
-	// TODO: Add a bit of speed in horiz and vert axes, based on the a_InitialVelocityCoeff
+	TNT->SetSpeed(
+		a_InitialVelocityCoeff * (GetTickRandomNumber(2) - 1), /** -1, 0, 1 */
+		a_InitialVelocityCoeff * 2,
+		a_InitialVelocityCoeff * (GetTickRandomNumber(2) - 1)
+	);
 }
 
 
diff --git a/src/World.h b/src/World.h
index a772710ab..b3ee94a27 100644
--- a/src/World.h
+++ b/src/World.h
@@ -125,15 +125,16 @@ public:
 	// tolua_begin
 
 	int GetTicksUntilWeatherChange(void) const { return m_WeatherInterval; }
-	virtual Int64 GetWorldAge(void)  const { return m_WorldAge; }
-	virtual Int64 GetTimeOfDay(void) const { return m_TimeOfDay; }
+	
+	virtual Int64 GetWorldAge (void) const { return m_WorldAge; }   // override, cannot specify due to tolua
+	virtual Int64 GetTimeOfDay(void) const { return m_TimeOfDay; }  // override, cannot specify due to tolua
 	
 	void SetTicksUntilWeatherChange(int a_WeatherInterval)
 	{
 		m_WeatherInterval = a_WeatherInterval;
 	}
 
-	void SetTimeOfDay(Int64 a_TimeOfDay)
+	virtual void SetTimeOfDay(Int64 a_TimeOfDay)  // override, cannot specify due to tolua
 	{
 		m_TimeOfDay = a_TimeOfDay;
 		m_TimeOfDaySecs = (double)a_TimeOfDay / 20.0;
@@ -191,35 +192,35 @@ public:
 	void BroadcastChat       (const cCompositeChat & a_Message, const cClientHandle * a_Exclude = NULL);
 	// tolua_end
 
-	void BroadcastChunkData          (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude = NULL);
-	void BroadcastCollectPickup      (const cPickup & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL);
-	void BroadcastDestroyEntity      (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
-	void BroadcastEntityEffect       (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude = NULL);
-	void BroadcastEntityEquipment    (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item, const cClientHandle * a_Exclude = NULL);
-	void BroadcastEntityHeadLook     (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
-	void BroadcastEntityLook         (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
-	void BroadcastEntityMetadata     (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
-	void BroadcastEntityRelMove      (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL);
-	void BroadcastEntityRelMoveLook  (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL);
-	void BroadcastEntityStatus       (const cEntity & a_Entity, char a_Status, const cClientHandle * a_Exclude = NULL);
-	void BroadcastEntityVelocity     (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
-	void BroadcastEntityAnimation    (const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL);
-	void BroadcastParticleEffect     (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL); // tolua_export
-	void BroadcastPlayerListItem     (const cPlayer & a_Player, bool a_IsOnline, const cClientHandle * a_Exclude = NULL);
-	void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL);
-	void BroadcastScoreboardObjective(const AString & a_Name, const AString & a_DisplayName, Byte a_Mode);
-	void BroadcastScoreUpdate        (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode);
-	void BroadcastDisplayObjective   (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display);
-	void BroadcastSoundEffect        (const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL);   // tolua_export a_Src coords are Block * 8
-	void BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL); // tolua_export
-	void BroadcastSpawnEntity        (cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
-	void BroadcastTeleportEntity     (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
-	void BroadcastThunderbolt        (int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL);
-	void BroadcastTimeUpdate         (const cClientHandle * a_Exclude = NULL);
-	virtual void BroadcastUseBed             (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ );
-	void BroadcastWeather            (eWeather a_Weather, const cClientHandle * a_Exclude = NULL);
-	
-	virtual cBroadcastInterface & GetBroadcastManager()
+	void BroadcastChunkData              (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude = NULL);
+	void BroadcastCollectPickup          (const cPickup & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL);
+	void BroadcastDestroyEntity          (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+	void BroadcastEntityEffect           (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude = NULL);
+	void BroadcastEntityEquipment        (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item, const cClientHandle * a_Exclude = NULL);
+	void BroadcastEntityHeadLook         (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+	void BroadcastEntityLook             (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+	void BroadcastEntityMetadata         (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+	void BroadcastEntityRelMove          (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL);
+	void BroadcastEntityRelMoveLook      (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL);
+	void BroadcastEntityStatus           (const cEntity & a_Entity, char a_Status, const cClientHandle * a_Exclude = NULL);
+	void BroadcastEntityVelocity         (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+	virtual void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) override;
+	void BroadcastParticleEffect         (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL); // tolua_export
+	void BroadcastPlayerListItem         (const cPlayer & a_Player, bool a_IsOnline, const cClientHandle * a_Exclude = NULL);
+	void BroadcastRemoveEntityEffect     (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL);
+	void BroadcastScoreboardObjective    (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode);
+	void BroadcastScoreUpdate            (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode);
+	void BroadcastDisplayObjective       (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display);
+	void BroadcastSoundEffect            (const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL);   // tolua_export a_Src coords are Block * 8
+	void BroadcastSoundParticleEffect    (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL); // tolua_export
+	void BroadcastSpawnEntity            (cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+	void BroadcastTeleportEntity         (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL);
+	void BroadcastThunderbolt            (int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL);
+	void BroadcastTimeUpdate             (const cClientHandle * a_Exclude = NULL);
+	virtual void BroadcastUseBed         (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) override;
+	void BroadcastWeather                (eWeather a_Weather, const cClientHandle * a_Exclude = NULL);
+	
+	virtual cBroadcastInterface & GetBroadcastManager(void) override
 	{
 		return *this;
 	}
@@ -273,7 +274,7 @@ public:
 	void RemovePlayer( cPlayer* a_Player );
 
 	/** Calls the callback for each player in the list; returns true if all players processed, false if the callback aborted by returning true */
-	bool ForEachPlayer(cPlayerListCallback & a_Callback);  // >> EXPORTED IN MANUALBINDINGS <<
+	virtual bool ForEachPlayer(cPlayerListCallback & a_Callback) override;  // >> EXPORTED IN MANUALBINDINGS <<
 
 	/** Calls the callback for the player of the given name; returns true if the player was found and the callback called, false if player not found. Callback return ignored */
 	bool DoWithPlayer(const AString & a_PlayerName, cPlayerListCallback & a_Callback);  // >> EXPORTED IN MANUALBINDINGS <<
@@ -365,7 +366,7 @@ public:
 	bool IsChunkLighted(int a_ChunkX, int a_ChunkZ);
 	
 	/** Calls the callback for each chunk in the coords specified (all cords are inclusive). Returns true if all chunks have been processed successfully */
-	virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback);
+	virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) override;
 
 	// tolua_begin
 	
@@ -456,7 +457,7 @@ public:
 	
 	// tolua_begin
 	bool DigBlock   (int a_X, int a_Y, int a_Z);
-	virtual void SendBlockTo(int a_X, int a_Y, int a_Z, cPlayer * a_Player);
+	virtual void SendBlockTo(int a_X, int a_Y, int a_Z, cPlayer * a_Player);  // override, cannot specify due to tolua
 
 	double GetSpawnX(void) const { return m_SpawnX; }
 	double GetSpawnY(void) const { return m_SpawnY; }
@@ -496,18 +497,18 @@ public:
 	
 	/** Does an explosion with the specified strength at the specified coordinate
 	a_SourceData exact type depends on the a_Source:
-	| esOther | void * |
-	| esPrimedTNT | cTNTEntity * |
-	| esMonster | cMonster * |
-	| esBed | cVector3i * |
-	| esEnderCrystal | Vector3i * |
-	| esGhastFireball | cGhastFireball * |
-	| esWitherSkullBlack | TBD |
-	| esWitherSkullBlue | TBD |
-	| esWitherBirth | TBD |
-	| esPlugin | void * |
+	| esOther            | void *           |
+	| esPrimedTNT        | cTNTEntity *     |
+	| esMonster          | cMonster *       |
+	| esBed              | cVector3i *      |
+	| esEnderCrystal     | Vector3i *       |
+	| esGhastFireball    | cGhastFireball * |
+	| esWitherSkullBlack | TBD              |
+	| esWitherSkullBlue  | TBD              |
+	| esWitherBirth      | cMonster *       |
+	| esPlugin           | void *           |
 	*/
-	virtual void DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_BlockY, double a_BlockZ, bool a_CanCauseFire, eExplosionSource a_Source, void * a_SourceData);  // tolua_export
+	virtual void DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_BlockY, double a_BlockZ, bool a_CanCauseFire, eExplosionSource a_Source, void * a_SourceData);  // tolua_export  // override, cannot specify due to tolua
 
 	/** Calls the callback for the block entity at the specified coords; returns false if there's no block entity at those coords, true if found */
 	bool DoWithBlockEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBlockEntityCallback & a_Callback);  // Exported in ManualBindings.cpp
@@ -604,6 +605,9 @@ public:
 	bool AreCommandBlocksEnabled(void) const { return m_bCommandBlocksEnabled; }
 	void SetCommandBlocksEnabled(bool a_Flag) { m_bCommandBlocksEnabled = a_Flag; }
 
+	eShrapnelLevel GetTNTShrapnelLevel(void) const { return m_TNTShrapnelLevel; }
+	void SetTNTShrapnelLevel(eShrapnelLevel a_Flag) { m_TNTShrapnelLevel = a_Flag; }
+
 	bool ShouldUseChatPrefixes(void) const { return m_bUseChatPrefixes; }
 	void SetShouldUseChatPrefixes(bool a_Flag) { m_bUseChatPrefixes = a_Flag; }
 	
@@ -642,9 +646,9 @@ public:
 
 	// Various queues length queries (cannot be const, they lock their CS):
 	inline int GetGeneratorQueueLength  (void) { return m_Generator.GetQueueLength();   }    // tolua_export
-	inline int GetLightingQueueLength   (void) { return m_Lighting.GetQueueLength();    }    // tolua_export
-	inline int GetStorageLoadQueueLength(void) { return m_Storage.GetLoadQueueLength(); }    // tolua_export
-	inline int GetStorageSaveQueueLength(void) { return m_Storage.GetSaveQueueLength(); }    // tolua_export
+	inline size_t GetLightingQueueLength   (void) { return m_Lighting.GetQueueLength();    }    // tolua_export
+	inline size_t GetStorageLoadQueueLength(void) { return m_Storage.GetLoadQueueLength(); }    // tolua_export
+	inline size_t GetStorageSaveQueueLength(void) { return m_Storage.GetSaveQueueLength(); }    // tolua_export
 
 	void InitializeSpawn(void);
 	
@@ -703,7 +707,7 @@ public:
 	bool IsBlockDirectlyWatered(int a_BlockX, int a_BlockY, int a_BlockZ);  // tolua_export
 	
 	/** Spawns a mob of the specified type. Returns the mob's EntityID if recognized and spawned, <0 otherwise */
-	virtual int SpawnMob(double a_PosX, double a_PosY, double a_PosZ, cMonster::eType a_MonsterType);  // tolua_export
+	virtual int SpawnMob(double a_PosX, double a_PosY, double a_PosZ, cMonster::eType a_MonsterType);  // tolua_export  // override, cannot specify due to tolua
 	int SpawnMobFinalize(cMonster* a_Monster);
 	
 	/** Creates a projectile of the specified type. Returns the projectile's EntityID if successful, <0 otherwise */
@@ -861,6 +865,11 @@ private:
 	
 	/** Whether prefixes such as [INFO] are prepended to SendMessageXXX() / BroadcastChatXXX() functions */
 	bool m_bUseChatPrefixes;
+
+	/** The level of DoExplosionAt() projecting random affected blocks as FallingBlock entities
+	See the eShrapnelLevel enumeration for details
+	*/
+	eShrapnelLevel m_TNTShrapnelLevel;
 	
 
 	cChunkGenerator  m_Generator;
diff --git a/src/WorldStorage/FireworksSerializer.cpp b/src/WorldStorage/FireworksSerializer.cpp
index 3c97ae0a2..744fc731f 100644
--- a/src/WorldStorage/FireworksSerializer.cpp
+++ b/src/WorldStorage/FireworksSerializer.cpp
@@ -20,8 +20,14 @@ void cFireworkItem::WriteToNBTCompound(const cFireworkItem & a_FireworkItem, cFa
 			a_Writer.AddByte("Flicker", a_FireworkItem.m_HasFlicker);
 			a_Writer.AddByte("Trail", a_FireworkItem.m_HasTrail);
 			a_Writer.AddByte("Type", a_FireworkItem.m_Type);
-			a_Writer.AddIntArray("Colors", &(a_FireworkItem.m_Colours[0]), a_FireworkItem.m_Colours.size());
-			a_Writer.AddIntArray("FadeColors", &(a_FireworkItem.m_FadeColours[0]), a_FireworkItem.m_FadeColours.size());
+			if (!a_FireworkItem.m_Colours.empty())
+			{
+				a_Writer.AddIntArray("Colors", &(a_FireworkItem.m_Colours[0]), a_FireworkItem.m_Colours.size());
+			}
+			if (!a_FireworkItem.m_FadeColours.empty())
+			{
+				a_Writer.AddIntArray("FadeColors", &(a_FireworkItem.m_FadeColours[0]), a_FireworkItem.m_FadeColours.size());
+			}
 			a_Writer.EndCompound();
 			a_Writer.EndList();
 			a_Writer.EndCompound();
diff --git a/src/WorldStorage/MapSerializer.cpp b/src/WorldStorage/MapSerializer.cpp
index a4a0aab57..df72d1cc9 100644
--- a/src/WorldStorage/MapSerializer.cpp
+++ b/src/WorldStorage/MapSerializer.cpp
@@ -141,7 +141,11 @@ bool cMapSerializer::LoadMapFromNBT(const cParsedNBT & a_NBT)
 	{
 		eDimension Dimension = (eDimension) a_NBT.GetByte(CurrLine);
 		
-		ASSERT(Dimension == m_Map->m_World->GetDimension());
+		if (Dimension != m_Map->m_World->GetDimension())
+		{
+			// TODO 2014-03-20 xdot: We should store nether maps in nether worlds, e.t.c.
+			return false;
+		}
 	}
 
 	CurrLine = a_NBT.FindChildByName(Data, "width");
diff --git a/src/WorldStorage/NBTChunkSerializer.cpp b/src/WorldStorage/NBTChunkSerializer.cpp
index 4cf3c62d7..415693ae2 100644
--- a/src/WorldStorage/NBTChunkSerializer.cpp
+++ b/src/WorldStorage/NBTChunkSerializer.cpp
@@ -23,12 +23,16 @@
 #include "../BlockEntities/FlowerPotEntity.h"
 
 #include "../Entities/Entity.h"
+#include "../Entities/EnderCrystal.h"
 #include "../Entities/FallingBlock.h"
 #include "../Entities/Boat.h"
 #include "../Entities/Minecart.h"
 #include "../Entities/Pickup.h"
 #include "../Entities/ProjectileEntity.h"
 #include "../Entities/TNTEntity.h"
+#include "../Entities/ExpOrb.h"
+#include "../Entities/HangingEntity.h"
+#include "../Entities/ItemFrame.h"
 
 #include "../Mobs/Monster.h"
 #include "../Mobs/Bat.h"
@@ -40,6 +44,7 @@
 #include "../Mobs/Slime.h"
 #include "../Mobs/Skeleton.h"
 #include "../Mobs/Villager.h"
+#include "../Mobs/Wither.h"
 #include "../Mobs/Wolf.h"
 #include "../Mobs/Zombie.h"
 
@@ -332,6 +337,17 @@ void cNBTChunkSerializer::AddBoatEntity(cBoat * a_Boat)
 
 
 
+void cNBTChunkSerializer::AddEnderCrystalEntity(cEnderCrystal * a_EnderCrystal)
+{
+	m_Writer.BeginCompound("");
+		AddBasicEntity(a_EnderCrystal, "EnderCrystal");
+	m_Writer.EndCompound();
+}
+
+
+
+
+
 void cNBTChunkSerializer::AddFallingBlockEntity(cFallingBlock * a_FallingBlock)
 {
 	m_Writer.BeginCompound("");
@@ -419,7 +435,7 @@ void cNBTChunkSerializer::AddMonsterEntity(cMonster * a_Monster)
 		case cMonster::mtSquid:         EntityClass = "Squid";          break;
 		case cMonster::mtVillager:      EntityClass = "Villager";       break;
 		case cMonster::mtWitch:         EntityClass = "Witch";          break;
-		case cMonster::mtWither:        EntityClass = "Wither";         break;
+		case cMonster::mtWither:        EntityClass = "WitherBoss";     break;
 		case cMonster::mtWolf:          EntityClass = "Wolf";           break;
 		case cMonster::mtZombie:        EntityClass = "Zombie";         break;
 		case cMonster::mtZombiePigman:  EntityClass = "PigZombie";      break;
@@ -498,6 +514,11 @@ void cNBTChunkSerializer::AddMonsterEntity(cMonster * a_Monster)
 				m_Writer.AddInt("Profession", ((const cVillager *)a_Monster)->GetVilType());
 				break;
 			}
+			case cMonster::mtWither:
+			{
+				m_Writer.AddInt("Invul", ((const cWither *)a_Monster)->GetNumInvulnerableTicks());
+				break;
+			}
 			case cMonster::mtWolf:
 			{
 				m_Writer.AddString("Owner", ((const cWolf *)a_Monster)->GetOwner());
@@ -526,8 +547,8 @@ void cNBTChunkSerializer::AddPickupEntity(cPickup * a_Pickup)
 	m_Writer.BeginCompound("");
 		AddBasicEntity(a_Pickup, "Item");
 		AddItem(a_Pickup->GetItem(), -1, "Item");
-		m_Writer.AddShort("Health", a_Pickup->GetHealth());
-		m_Writer.AddShort("Age",    a_Pickup->GetAge());
+		m_Writer.AddShort("Health", (Int16)(unsigned char)a_Pickup->GetHealth());
+		m_Writer.AddShort("Age",    (Int16)a_Pickup->GetAge());
 	m_Writer.EndCompound();
 }
 
@@ -592,6 +613,25 @@ void cNBTChunkSerializer::AddProjectileEntity(cProjectileEntity * a_Projectile)
 
 
 
+void cNBTChunkSerializer::AddHangingEntity(cHangingEntity * a_Hanging)
+{
+	m_Writer.AddByte("Direction", (unsigned char)a_Hanging->GetDirection());
+	m_Writer.AddInt("TileX", a_Hanging->GetTileX());
+	m_Writer.AddInt("TileY", a_Hanging->GetTileY());
+	m_Writer.AddInt("TileZ", a_Hanging->GetTileZ());
+	switch (a_Hanging->GetDirection())
+	{
+		case 0:    m_Writer.AddByte("Dir", (unsigned char)2); break;
+		case 1:    m_Writer.AddByte("Dir", (unsigned char)1); break;
+		case 2:    m_Writer.AddByte("Dir", (unsigned char)0); break;
+		case 3:    m_Writer.AddByte("Dir", (unsigned char)3); break;
+	}
+}
+
+
+
+
+
 void cNBTChunkSerializer::AddTNTEntity(cTNTEntity * a_TNT)
 {
 	m_Writer.BeginCompound("");
@@ -604,6 +644,35 @@ void cNBTChunkSerializer::AddTNTEntity(cTNTEntity * a_TNT)
 
 
 
+void cNBTChunkSerializer::AddExpOrbEntity(cExpOrb * a_ExpOrb)
+{
+	m_Writer.BeginCompound("");
+		AddBasicEntity(a_ExpOrb, "XPOrb");
+		m_Writer.AddShort("Health", (Int16)(unsigned char)a_ExpOrb->GetHealth());
+		m_Writer.AddShort("Age", (Int16)a_ExpOrb->GetAge());
+		m_Writer.AddShort("Value", (Int16)a_ExpOrb->GetReward());
+	m_Writer.EndCompound();
+}
+
+
+
+
+
+void cNBTChunkSerializer::AddItemFrameEntity(cItemFrame * a_ItemFrame)
+{
+	m_Writer.BeginCompound("");
+		AddBasicEntity(a_ItemFrame, "ItemFrame");
+		AddHangingEntity(a_ItemFrame);
+		AddItem(a_ItemFrame->GetItem(), -1, "Item");
+		m_Writer.AddByte("ItemRotation", (unsigned char)a_ItemFrame->GetRotation());
+		m_Writer.AddFloat("ItemDropChance", 1.0F);
+	m_Writer.EndCompound();
+}
+
+
+
+
+
 void cNBTChunkSerializer::AddMinecartChestContents(cMinecartWithChest * a_Minecart)
 {
 	m_Writer.BeginList("Items", TAG_Compound);
@@ -678,14 +747,15 @@ void cNBTChunkSerializer::Entity(cEntity * a_Entity)
 	switch (a_Entity->GetEntityType())
 	{
 		case cEntity::etBoat:         AddBoatEntity        ((cBoat *)            a_Entity); break;
+		case cEntity::etEnderCrystal: AddEnderCrystalEntity((cEnderCrystal *)    a_Entity); break;
 		case cEntity::etFallingBlock: AddFallingBlockEntity((cFallingBlock *)    a_Entity); break;
 		case cEntity::etMinecart:     AddMinecartEntity    ((cMinecart *)        a_Entity); break;
 		case cEntity::etMonster:      AddMonsterEntity     ((cMonster *)         a_Entity); break;
 		case cEntity::etPickup:       AddPickupEntity      ((cPickup *)          a_Entity); break;
 		case cEntity::etProjectile:   AddProjectileEntity  ((cProjectileEntity *)a_Entity); break;
 		case cEntity::etTNT:          AddTNTEntity         ((cTNTEntity *)       a_Entity); break;
-		case cEntity::etExpOrb: /* TODO */ break;
-		case cEntity::etItemFrame: /* TODO */ break;
+		case cEntity::etExpOrb:       AddExpOrbEntity      ((cExpOrb *)          a_Entity); break;
+		case cEntity::etItemFrame:    AddItemFrameEntity   ((cItemFrame *)       a_Entity); break;
 		case cEntity::etPainting: /* TODO */ break;
 		case cEntity::etPlayer: return;  // Players aren't saved into the world
 		default:
diff --git a/src/WorldStorage/NBTChunkSerializer.h b/src/WorldStorage/NBTChunkSerializer.h
index 3b486d2bc..51d104970 100644
--- a/src/WorldStorage/NBTChunkSerializer.h
+++ b/src/WorldStorage/NBTChunkSerializer.h
@@ -24,6 +24,7 @@ class cChestEntity;
 class cCommandBlockEntity;
 class cDispenserEntity;
 class cDropperEntity;
+class cEnderCrystal;
 class cFurnaceEntity;
 class cHopperEntity;
 class cJukeboxEntity;
@@ -42,6 +43,9 @@ class cPickup;
 class cItemGrid;
 class cProjectileEntity;
 class cTNTEntity;
+class cExpOrb;
+class cHangingEntity;
+class cItemFrame;
 
 
 
@@ -103,12 +107,16 @@ protected:
 	// Entities:
 	void AddBasicEntity       (cEntity * a_Entity, const AString & a_ClassName);
 	void AddBoatEntity        (cBoat * a_Boat);
+	void AddEnderCrystalEntity(cEnderCrystal * a_EnderCrystal);
 	void AddFallingBlockEntity(cFallingBlock * a_FallingBlock);
 	void AddMinecartEntity    (cMinecart * a_Minecart);
 	void AddMonsterEntity     (cMonster * a_Monster);
 	void AddPickupEntity      (cPickup * a_Pickup);
 	void AddProjectileEntity  (cProjectileEntity * a_Projectile);
+	void AddHangingEntity     (cHangingEntity * a_Hanging);
 	void AddTNTEntity         (cTNTEntity * a_TNT);
+	void AddExpOrbEntity      (cExpOrb * a_ExpOrb);
+	void AddItemFrameEntity   (cItemFrame * a_ItemFrame);
 	
 	void AddMinecartChestContents(cMinecartWithChest * a_Minecart);
 	
diff --git a/src/WorldStorage/SchematicFileSerializer.cpp b/src/WorldStorage/SchematicFileSerializer.cpp
index ef67fdb13..9d594a084 100644
--- a/src/WorldStorage/SchematicFileSerializer.cpp
+++ b/src/WorldStorage/SchematicFileSerializer.cpp
@@ -14,6 +14,39 @@
 
 
 
+#ifdef SELF_TEST
+
+static class cSchematicStringSelfTest
+{
+public:
+	cSchematicStringSelfTest(void)
+	{
+		cBlockArea ba;
+		ba.Create(21, 256, 21);
+		ba.RelLine(0, 0, 0, 9, 8, 7, cBlockArea::baTypes | cBlockArea::baMetas, E_BLOCK_WOODEN_STAIRS, 1);
+		AString Schematic;
+		if (!cSchematicFileSerializer::SaveToSchematicString(ba, Schematic))
+		{
+			assert_test(!"Schematic failed to save!");
+		}
+		cBlockArea ba2;
+		if (!cSchematicFileSerializer::LoadFromSchematicString(ba2, Schematic))
+		{
+			assert_test(!"Schematic failed to load!");
+		}
+	}
+} g_SelfTest;
+
+#endif
+
+
+
+
+
+
+///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+// cSchematicFileSerializer:
+
 bool cSchematicFileSerializer::LoadFromSchematicFile(cBlockArea & a_BlockArea, const AString & a_FileName)
 {
 	// Un-GZip the contents:
@@ -197,7 +230,7 @@ bool cSchematicFileSerializer::LoadFromSchematicNBT(cBlockArea & a_BlockArea, cP
 	}
 
 	// Copy the block types and metas:
-	int NumBytes = a_BlockArea.m_SizeX * a_BlockArea.m_SizeY * a_BlockArea.m_SizeZ;
+	int NumBytes = a_BlockArea.GetBlockCount();
 	if (a_NBT.GetDataLength(TBlockTypes) < NumBytes)
 	{
 		LOG("BlockTypes truncated in the schematic file (exp %d, got %d bytes). Loading partial.",
@@ -209,7 +242,7 @@ bool cSchematicFileSerializer::LoadFromSchematicNBT(cBlockArea & a_BlockArea, cP
 	
 	if (AreMetasPresent)
 	{
-		int NumBytes = a_BlockArea.m_SizeX * a_BlockArea.m_SizeY * a_BlockArea.m_SizeZ;
+		int NumBytes = a_BlockArea.GetBlockCount();
 		if (a_NBT.GetDataLength(TBlockMetas) < NumBytes)
 		{
 			LOG("BlockMetas truncated in the schematic file (exp %d, got %d bytes). Loading partial.",
@@ -230,9 +263,9 @@ bool cSchematicFileSerializer::LoadFromSchematicNBT(cBlockArea & a_BlockArea, cP
 AString cSchematicFileSerializer::SaveToSchematicNBT(const cBlockArea & a_BlockArea)
 {
 	cFastNBTWriter Writer("Schematic");
-	Writer.AddShort("Width",  a_BlockArea.m_SizeX);
-	Writer.AddShort("Height", a_BlockArea.m_SizeY);
-	Writer.AddShort("Length", a_BlockArea.m_SizeZ);
+	Writer.AddShort("Width",  a_BlockArea.m_Size.x);
+	Writer.AddShort("Height", a_BlockArea.m_Size.y);
+	Writer.AddShort("Length", a_BlockArea.m_Size.z);
 	Writer.AddString("Materials", "Alpha");
 	if (a_BlockArea.HasBlockTypes())
 	{
diff --git a/src/WorldStorage/WSSAnvil.cpp b/src/WorldStorage/WSSAnvil.cpp
index 070738164..48934d074 100644
--- a/src/WorldStorage/WSSAnvil.cpp
+++ b/src/WorldStorage/WSSAnvil.cpp
@@ -32,11 +32,15 @@
 #include "../Mobs/IncludeAllMonsters.h"
 
 #include "../Entities/Boat.h"
+#include "../Entities/EnderCrystal.h"
 #include "../Entities/FallingBlock.h"
 #include "../Entities/Minecart.h"
 #include "../Entities/Pickup.h"
 #include "../Entities/ProjectileEntity.h"
 #include "../Entities/TNTEntity.h"
+#include "../Entities/ExpOrb.h"
+#include "../Entities/HangingEntity.h"
+#include "../Entities/ItemFrame.h"
 
 
 
@@ -366,6 +370,7 @@ bool cWSSAnvil::LoadChunkFromNBT(const cChunkCoords & a_Chunk, const cParsedNBT
 				{
 					case E_BLOCK_AIR:
 					case E_BLOCK_LEAVES:
+					case E_BLOCK_NEW_LEAVES:
 					{
 						// nothing needed
 						break;
@@ -1053,6 +1058,10 @@ void cWSSAnvil::LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a
 	{
 		LoadBoatFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
 	}
+	else if (strncmp(a_IDTag, "EnderCrystal", a_IDTagLength) == 0)
+	{
+		LoadEnderCrystalFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
+	}
 	else if (strncmp(a_IDTag, "FallingBlock", a_IDTagLength) == 0)
 	{
 		LoadFallingBlockFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
@@ -1098,6 +1107,18 @@ void cWSSAnvil::LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a
 	{
 		LoadPickupFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
 	}
+	else if (strncmp(a_IDTag, "PrimedTnt", a_IDTagLength) == 0)
+	{
+		LoadTNTFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
+	}
+	else if (strncmp(a_IDTag, "XPOrb", a_IDTagLength) == 0)
+	{
+		LoadExpOrbFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
+	}
+	else if (strncmp(a_IDTag, "ItemFrame", a_IDTagLength) == 0)
+	{
+		LoadItemFrameFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
+	}
 	else if (strncmp(a_IDTag, "Arrow", a_IDTagLength) == 0)
 	{
 		LoadArrowFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
@@ -1222,7 +1243,7 @@ void cWSSAnvil::LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a
 	{
 		LoadWitchFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
 	}
-	else if (strncmp(a_IDTag, "Wither", a_IDTagLength) == 0)
+	else if (strncmp(a_IDTag, "WitherBoss", a_IDTagLength) == 0)
 	{
 		LoadWitherFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
 	}
@@ -1238,10 +1259,6 @@ void cWSSAnvil::LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a
 	{
 		LoadPigZombieFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
 	}
-	else if (strncmp(a_IDTag, "PrimedTnt", a_IDTagLength) == 0)
-	{
-		LoadTNTFromNBT(a_Entities, a_NBT, a_EntityTagIdx);
-	}
 	// TODO: other entities
 }
 
@@ -1263,6 +1280,20 @@ void cWSSAnvil::LoadBoatFromNBT(cEntityList & a_Entities, const cParsedNBT & a_N
 
 
 
+void cWSSAnvil::LoadEnderCrystalFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
+{
+	std::auto_ptr<cEnderCrystal> EnderCrystal(new cEnderCrystal(0, 0, 0));
+	if (!LoadEntityBaseFromNBT(*EnderCrystal.get(), a_NBT, a_TagIdx))
+	{
+		return;
+	}
+	a_Entities.push_back(EnderCrystal.release());
+}
+
+
+
+
+
 void cWSSAnvil::LoadFallingBlockFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
 {
 	int TypeIdx = a_NBT.FindChildByName(a_TagIdx, "TileID");
@@ -1384,6 +1415,7 @@ void cWSSAnvil::LoadMinecartHFromNBT(cEntityList & a_Entities, const cParsedNBT
 
 void cWSSAnvil::LoadPickupFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
 {
+	// Load item:
 	int ItemTag = a_NBT.FindChildByName(a_TagIdx, "Item");
 	if ((ItemTag < 0) || (a_NBT.GetType(ItemTag) != TAG_Compound))
 	{
@@ -1394,11 +1426,27 @@ void cWSSAnvil::LoadPickupFromNBT(cEntityList & a_Entities, const cParsedNBT & a
 	{
 		return;
 	}
+	
 	std::auto_ptr<cPickup> Pickup(new cPickup(0, 0, 0, Item, false)); // Pickup delay doesn't matter, just say false
 	if (!LoadEntityBaseFromNBT(*Pickup.get(), a_NBT, a_TagIdx))
 	{
 		return;
 	}
+
+	// Load health:
+	int Health = a_NBT.FindChildByName(a_TagIdx, "Health");
+	if (Health > 0)
+	{
+		Pickup->SetHealth((int) (a_NBT.GetShort(Health) & 0xFF));
+	}
+	
+	// Load age:
+	int Age = a_NBT.FindChildByName(a_TagIdx, "Age");
+	if (Age > 0)
+	{
+		Pickup->SetAge(a_NBT.GetShort(Age));
+	}
+
 	a_Entities.push_back(Pickup.release());
 }
 
@@ -1406,6 +1454,148 @@ void cWSSAnvil::LoadPickupFromNBT(cEntityList & a_Entities, const cParsedNBT & a
 
 
 
+void cWSSAnvil::LoadTNTFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
+{
+	std::auto_ptr<cTNTEntity> TNT(new cTNTEntity(0.0, 0.0, 0.0, 0));
+	if (!LoadEntityBaseFromNBT(*TNT.get(), a_NBT, a_TagIdx))
+	{
+		return;
+	}
+	
+	// Load Fuse Ticks:
+	int FuseTicks = a_NBT.FindChildByName(a_TagIdx, "Fuse");
+	if (FuseTicks > 0)
+	{
+		TNT->SetFuseTicks((int) a_NBT.GetByte(FuseTicks));
+	}
+	
+	a_Entities.push_back(TNT.release());
+}
+
+
+
+
+
+void cWSSAnvil::LoadExpOrbFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
+{
+	std::auto_ptr<cExpOrb> ExpOrb(new cExpOrb(0.0, 0.0, 0.0, 0));
+	if (!LoadEntityBaseFromNBT(*ExpOrb.get(), a_NBT, a_TagIdx))
+	{
+		return;
+	}
+
+	// Load Health:
+	int Health = a_NBT.FindChildByName(a_TagIdx, "Health");
+	if (Health > 0)
+	{
+		ExpOrb->SetHealth((int) (a_NBT.GetShort(Health) & 0xFF));
+	}
+
+	// Load Age:
+	int Age = a_NBT.FindChildByName(a_TagIdx, "Age");
+	if (Age > 0)
+	{
+		ExpOrb->SetAge(a_NBT.GetShort(Age));
+	}
+
+	// Load Reward (Value):
+	int Reward = a_NBT.FindChildByName(a_TagIdx, "Value");
+	if (Reward > 0)
+	{
+		ExpOrb->SetReward(a_NBT.GetShort(Reward));
+	}
+
+	a_Entities.push_back(ExpOrb.release());
+}
+
+
+
+
+
+void cWSSAnvil::LoadHangingFromNBT(cHangingEntity & a_Hanging, const cParsedNBT & a_NBT, int a_TagIdx)
+{
+	int Direction = a_NBT.FindChildByName(a_TagIdx, "Direction");
+	if (Direction > 0)
+	{
+		Direction = (int)a_NBT.GetByte(Direction);
+		if ((Direction < 0) || (Direction > 5))
+		{
+			a_Hanging.SetDirection(BLOCK_FACE_NORTH);
+		}
+		else
+		{
+			a_Hanging.SetDirection(static_cast<eBlockFace>(Direction));
+		}
+	}
+	else
+	{
+		Direction = a_NBT.FindChildByName(a_TagIdx, "Dir");
+		if (Direction > 0)
+		{
+			switch ((int)a_NBT.GetByte(Direction))
+			{
+				case 0:   a_Hanging.SetDirection(BLOCK_FACE_NORTH);  break;
+				case 1:   a_Hanging.SetDirection(BLOCK_FACE_TOP);    break;
+				case 2:   a_Hanging.SetDirection(BLOCK_FACE_BOTTOM); break;
+				case 3:   a_Hanging.SetDirection(BLOCK_FACE_SOUTH);  break;
+			}
+		}
+	}
+
+	int TileX = a_NBT.FindChildByName(a_TagIdx, "TileX");
+	int TileY = a_NBT.FindChildByName(a_TagIdx, "TileY");
+	int TileZ = a_NBT.FindChildByName(a_TagIdx, "TileZ");
+	if ((TileX > 0) && (TileY > 0) && (TileZ > 0))
+	{
+		a_Hanging.SetPosition(
+			(double)a_NBT.GetInt(TileX),
+			(double)a_NBT.GetInt(TileY),
+			(double)a_NBT.GetInt(TileZ)
+		);
+	}
+}
+
+
+
+
+
+void cWSSAnvil::LoadItemFrameFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
+{
+	// Load item:
+	int ItemTag = a_NBT.FindChildByName(a_TagIdx, "Item");
+	if ((ItemTag < 0) || (a_NBT.GetType(ItemTag) != TAG_Compound))
+	{
+		return;
+	}
+	cItem Item;
+	if (!LoadItemFromNBT(Item, a_NBT, ItemTag))
+	{
+		return;
+	}
+	
+	std::auto_ptr<cItemFrame> ItemFrame(new cItemFrame(BLOCK_FACE_NONE, 0.0, 0.0, 0.0));
+	if (!LoadEntityBaseFromNBT(*ItemFrame.get(), a_NBT, a_TagIdx))
+	{
+		return;
+	}
+	ItemFrame->SetItem(Item);
+
+	LoadHangingFromNBT(*ItemFrame.get(), a_NBT, a_TagIdx);
+	
+	// Load Rotation:
+	int Rotation = a_NBT.FindChildByName(a_TagIdx, "ItemRotation");
+	if (Rotation > 0)
+	{
+		ItemFrame->SetRotation((Byte)a_NBT.GetByte(Rotation));
+	}
+	
+	a_Entities.push_back(ItemFrame.release());
+}
+
+
+
+
+
 void cWSSAnvil::LoadArrowFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
 {
 	std::auto_ptr<cArrowEntity> Arrow(new cArrowEntity(NULL, 0, 0, 0, Vector3d(0, 0, 0)));
@@ -2079,6 +2269,12 @@ void cWSSAnvil::LoadWitherFromNBT(cEntityList & a_Entities, const cParsedNBT & a
 		return;
 	}
 
+	int CurrLine = a_NBT.FindChildByName(a_TagIdx, "Invul");
+	if (CurrLine > 0)
+	{
+		Monster->SetNumInvulnerableTicks(a_NBT.GetInt(CurrLine));
+	}
+
 	a_Entities.push_back(Monster.release());
 }
 
@@ -2178,28 +2374,6 @@ void cWSSAnvil::LoadPigZombieFromNBT(cEntityList & a_Entities, const cParsedNBT
 
 
 
-void cWSSAnvil::LoadTNTFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx)
-{
-	std::auto_ptr<cTNTEntity> TNT(new cTNTEntity(0.0, 0.0, 0.0, 0));
-	if (!LoadEntityBaseFromNBT(*TNT.get(), a_NBT, a_TagIdx))
-	{
-		return;
-	}
-	
-	// Load Fuse Ticks:
-	int FuseTicks = a_NBT.FindChildByName(a_TagIdx, "Fuse");
-	if (FuseTicks > 0)
-	{
-		TNT->SetFuseTicks((int) a_NBT.GetByte(FuseTicks));
-	}
-	
-	a_Entities.push_back(TNT.release());
-}
-
-
-
-
-
 bool cWSSAnvil::LoadEntityBaseFromNBT(cEntity & a_Entity, const cParsedNBT & a_NBT, int a_TagIdx)
 {
 	double Pos[3];
diff --git a/src/WorldStorage/WSSAnvil.h b/src/WorldStorage/WSSAnvil.h
index fe93d16c3..1773ee882 100644
--- a/src/WorldStorage/WSSAnvil.h
+++ b/src/WorldStorage/WSSAnvil.h
@@ -20,6 +20,7 @@
 class cItemGrid;
 
 class cProjectileEntity;
+class cHangingEntity;
 
 
 
@@ -147,8 +148,13 @@ protected:
 	void LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_EntityTagIdx, const char * a_IDTag, int a_IDTagLength);
 	
 	void LoadBoatFromNBT            (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
+	void LoadEnderCrystalFromNBT    (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
 	void LoadFallingBlockFromNBT    (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
 	void LoadPickupFromNBT          (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
+	void LoadTNTFromNBT             (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
+	void LoadExpOrbFromNBT          (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
+	void LoadHangingFromNBT         (cHangingEntity & a_Hanging,const cParsedNBT & a_NBT, int a_TagIdx);
+	void LoadItemFrameFromNBT       (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
 
 	void LoadMinecartRFromNBT       (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
 	void LoadMinecartCFromNBT       (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
@@ -192,7 +198,6 @@ protected:
 	void LoadWolfFromNBT            (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
 	void LoadZombieFromNBT          (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
 	void LoadPigZombieFromNBT       (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
-	void LoadTNTFromNBT             (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx);
 	
 	/// Loads entity common data from the NBT compound; returns true if successful
 	bool LoadEntityBaseFromNBT(cEntity & a_Entity, const cParsedNBT & a_NBT, int a_TagIdx);
diff --git a/src/main.cpp b/src/main.cpp
index 2ae8a413b..68eea7f4d 100644
--- a/src/main.cpp
+++ b/src/main.cpp
@@ -72,7 +72,6 @@ void NonCtrlHandler(int a_Signal)
 			LOGERROR("  D:    | MCServer has encountered an error and needs to close");
 			LOGERROR("Details | SIGABRT: Server self-terminated due to an internal fault");
 			exit(EXIT_FAILURE);
-			break;
 		}
 		case SIGINT:
 		case SIGTERM: