diff options
Diffstat (limited to '')
472 files changed, 26885 insertions, 18746 deletions
diff --git a/.gitignore b/.gitignore index 51987336c..6afc12116 100644 --- a/.gitignore +++ b/.gitignore @@ -56,6 +56,7 @@ Makefile *.a *.d *.so +BuildInfo.h CMakeCache.txt CMakeFiles Makefile @@ -64,7 +65,7 @@ install_mainfest.txt src/MCServer lib/tolua++/tolua src/Bindings/Bindings.* -src/Bindings/BindingDependecies.txt +src/Bindings/BindingDependencies.txt MCServer.dir/ src/AllFiles.lst diff --git a/.gitmodules b/.gitmodules index 2aaee3624..d2ce2c855 100644 --- a/.gitmodules +++ b/.gitmodules @@ -7,6 +7,21 @@ [submodule "MCServer/Plugins/TransAPI"] path = MCServer/Plugins/TransAPI url = https://github.com/bearbin/transapi.git +[submodule "MCServer/Plugins/ChunkWorx"] + path = MCServer/Plugins/ChunkWorx + url = https://github.com/mc-server/ChunkWorx.git +[submodule "MCServer/Plugins/ChatLog"] + path = MCServer/Plugins/ChatLog + url = https://github.com/mc-server/ChatLog.git +[submodule "MCServer/Plugins/Handy"] + path = MCServer/Plugins/Handy + url = https://github.com/mc-server/Handy.git +[submodule "MCServer/Plugins/MagicCarpet"] + path = MCServer/Plugins/MagicCarpet + url = https://github.com/mc-server/MagicCarpet.git [submodule "lib/polarssl"] path = lib/polarssl - url = https://github.com/mc-server/polarssl + url = https://github.com/mc-server/polarssl.git +[submodule "lib/SQLiteCpp"] + path = lib/SQLiteCpp + url = https://github.com/mc-server/SQLiteCpp.git diff --git a/Android/res/values-pl/strings.xml b/Android/res/values-pl/strings.xml new file mode 100644 index 000000000..74c8044d8 --- /dev/null +++ b/Android/res/values-pl/strings.xml @@ -0,0 +1,13 @@ +<?xml version="1.0" encoding="utf-8"?> +<resources> + + <string name="hello">Hello World, MCServerActivity!</string> + <string name="app_name">MCServer</string> + <string name="start">Start</string> + <string name="stop">Stop</string> + <string name="mcserver_is_running">MCServer jest włączony</string> + <string name="mcserver_is_not_running">MCServer jest wyłączony</string> + <string name="your_ip">Twoje IP …</string> + <string name="configure">Ustawienia</string> + +</resources> diff --git a/CIbuild.sh b/CIbuild.sh index 683c1fc74..5d95f88a6 100755 --- a/CIbuild.sh +++ b/CIbuild.sh @@ -2,6 +2,10 @@ set -e +export MCSERVER_BUILD_SERIES_NAME="Travis $CC $TRAVIS_MCSERVER_BUILD_TYPE" +export MCSERVER_BUILD_ID=$TRAVIS_JOB_NUMBER +export MCSERVER_BUILD_DATETIME=`date` + cmake . -DBUILD_TOOLS=1 -DSELF_TEST=1; make -j 2; make -j 2 test; diff --git a/CMakeLists.txt b/CMakeLists.txt index a6400c1b4..188cf81e3 100644 --- a/CMakeLists.txt +++ b/CMakeLists.txt @@ -1,4 +1,4 @@ -cmake_minimum_required (VERSION 2.8.2) +cmake_minimum_required (VERSION 2.8.7) # Without this, the MSVC variable isn't defined for MSVC builds ( http://www.cmake.org/pipermail/cmake/2011-November/047130.html ) enable_language(CXX C) @@ -18,6 +18,25 @@ if(DEFINED ENV{TRAVIS_BUILD_WITH_COVERAGE}) set(BUILD_WITH_COVERAGE $ENV{TRAVIS_BUILD_WITH_COVERAGE}) endif() +if(DEFINED ENV{MCSERVER_BUILD_ID}) + set(BUILD_ID $ENV{MCSERVER_BUILD_ID}) + set(BUILD_SERIES_NAME $ENV{MCSERVER_BUILD_SERIES_NAME}) + set(BUILD_DATETIME $ENV{MCSERVER_BUILD_DATETIME}) + if(DEFINED ENV{MCSERVER_BUILD_COMMIT_ID}) + set(BUILD_COMMIT_ID $ENV{MCSERVER_BUILD_COMMIT_ID}) + else() + message("Commit id not set, attempting to determine id from git") + execute_process( + COMMAND git rev-parse HEAD + RESULT_VARIABLE GIT_EXECUTED + OUTPUT_VARIABLE BUILD_COMMIT_ID) + string(STRIP ${BUILD_COMMIT_ID} BUILD_COMMIT_ID) + if (NOT (GIT_EXECUTED EQUAL 0)) + message(FATAL_ERROR "Could not identifiy git commit id") + endif() + endif() +endif() + # This has to be done before any flags have been set up. if(${BUILD_TOOLS}) add_subdirectory(Tools/MCADefrag/) @@ -53,6 +72,14 @@ endif() project (MCServer) +# Set options for SQLiteCpp, disable all their tests and lints: +set(SQLITECPP_RUN_CPPLINT OFF CACHE BOOL "Run cpplint.py tool for Google C++ StyleGuide." FORCE) +set(SQLITECPP_RUN_CPPCHECK OFF CACHE BOOL "Run cppcheck C++ static analysis tool." FORCE) +set(SQLITECPP_RUN_DOXYGEN OFF CACHE BOOL "Run Doxygen C++ documentation tool." FORCE) +set(SQLITECPP_BUILD_EXAMPLES OFF CACHE BOOL "Build examples." FORCE) +set(SQLITECPP_BUILD_TESTS OFF CACHE BOOL "Build and run tests." FORCE) +set(SQLITECPP_INTERNAL_SQLITE OFF CACHE BOOL "Add the internal SQLite3 source to the project." FORCE) + # Include all the libraries: add_subdirectory(lib/inifile/) add_subdirectory(lib/jsoncpp/) @@ -60,9 +87,16 @@ add_subdirectory(lib/zlib/) add_subdirectory(lib/lua/) add_subdirectory(lib/tolua++/) add_subdirectory(lib/sqlite/) +add_subdirectory(lib/SQLiteCpp/) add_subdirectory(lib/expat/) add_subdirectory(lib/luaexpat/) +# Add proper include directories so that SQLiteCpp can find SQLite3: +get_property(SQLITECPP_INCLUDES DIRECTORY "lib/SQLiteCpp/" PROPERTY INCLUDE_DIRECTORIES) +set(SQLITECPP_INCLUDES "${SQLITECPP_INCLUDES}" "${CMAKE_CURRENT_SOURCE_DIR}/lib/sqlite/") +set_property(DIRECTORY lib/SQLiteCpp/ PROPERTY INCLUDE_DIRECTORIES "${SQLITECPP_INCLUDES}") +set_property(TARGET SQLiteCpp PROPERTY INCLUDE_DIRECTORIES "${SQLITECPP_INCLUDES}") + if (WIN32) add_subdirectory(lib/luaproxy/) endif() diff --git a/CONTRIBUTORS b/CONTRIBUTORS index 925e8f35b..e65239218 100644 --- a/CONTRIBUTORS +++ b/CONTRIBUTORS @@ -29,5 +29,7 @@ worktycho xoft Yeeeeezus (Donated AlchemistVillage prefabs) Howaner +Masy98 +WebFreak001 Please add yourself to this list if you contribute to MCServer. diff --git a/Install/Lua-LICENSE.txt b/Install/ThirdPartyLicenses/Lua-LICENSE.txt index 3c6d06fcf..3c6d06fcf 100644 --- a/Install/Lua-LICENSE.txt +++ b/Install/ThirdPartyLicenses/Lua-LICENSE.txt diff --git a/Install/LuaExpat-license.html b/Install/ThirdPartyLicenses/LuaExpat-license.html index bd4a54f9a..bd4a54f9a 100644 --- a/Install/LuaExpat-license.html +++ b/Install/ThirdPartyLicenses/LuaExpat-license.html diff --git a/Install/LuaSQLite3-LICENSE.txt b/Install/ThirdPartyLicenses/LuaSQLite3-LICENSE.txt index cf1014378..cf1014378 100644 --- a/Install/LuaSQLite3-LICENSE.txt +++ b/Install/ThirdPartyLicenses/LuaSQLite3-LICENSE.txt diff --git a/Install/MersenneTwister-LICENSE.txt b/Install/ThirdPartyLicenses/MersenneTwister-LICENSE.txt index 5c7a6ef04..5c7a6ef04 100644 --- a/Install/MersenneTwister-LICENSE.txt +++ b/Install/ThirdPartyLicenses/MersenneTwister-LICENSE.txt diff --git a/Install/ThirdPartyLicenses/SQLiteCpp-LICENSE.txt b/Install/ThirdPartyLicenses/SQLiteCpp-LICENSE.txt new file mode 100644 index 000000000..ec952abba --- /dev/null +++ b/Install/ThirdPartyLicenses/SQLiteCpp-LICENSE.txt @@ -0,0 +1,20 @@ +The MIT License (MIT) + +Copyright (c) 2012-2014 Sebastien Rombauts (sebastien.rombauts@gmail.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is furnished +to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR +IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file diff --git a/Install/Zip2008.list b/Install/Zip2008.list index b118ccbf9..e69857d09 100644 --- a/Install/Zip2008.list +++ b/Install/Zip2008.list @@ -6,9 +6,7 @@ ..\MCServer\furnace.txt ..\MCServer\items.ini ..\MCServer\monsters.ini +..\MCServer\buildinfo.txt MCServer*debug.cmd *.example.ini -Lua-LICENSE.txt -LuaExpat-license.html -LuaSQLite3-LICENSE.txt -MersenneTwister-LICENSE.txt +ThirdPartyLicenses diff --git a/Install/Zip2008_PDBs.list b/Install/Zip2008_PDBs.list index 608b0185b..96e4cd7d3 100644 --- a/Install/Zip2008_PDBs.list +++ b/Install/Zip2008_PDBs.list @@ -1,2 +1,3 @@ MCServer\*.pdb -src\Bindings\Bindings.*
\ No newline at end of file +MCServer\buildinfo.txt +src\Bindings\Bindings.* diff --git a/MCServer/Plugins/APIDump/APIDesc.lua b/MCServer/Plugins/APIDump/APIDesc.lua index e65da1d16..6a151b5ef 100644 --- a/MCServer/Plugins/APIDump/APIDesc.lua +++ b/MCServer/Plugins/APIDump/APIDesc.lua @@ -523,22 +523,29 @@ end Functions = { - GenerateOfflineUUID = { Params = "Username", Return = "string", Notes = "(STATIC) Generates an UUID based on the player name provided. This is used for the offline (non-auth) mode, when there's no UUID source. Each username generates a unique and constant UUID, so that when the player reconnects with the same name, their UUID is the same. Returns a 36-char UUID (with dashes)." }, + GenerateOfflineUUID = { Params = "Username", Return = "string", Notes = "(STATIC) Generates an UUID based on the player name provided. This is used for the offline (non-auth) mode, when there's no UUID source. Each username generates a unique and constant UUID, so that when the player reconnects with the same name, their UUID is the same. Returns a 32-char UUID (no dashes)." }, + GetClientBrand = { Params = "", Return = "string", Notes = "Returns the brand that the client has sent in their MC|Brand plugin message." }, + GetIPString = { Params = "", Return = "string", Notes = "Returns the IP address of the connection, as a string. Only the address part is returned, without the port number." }, GetLocale = { Params = "", Return = "Locale", Notes = "Returns the locale string that the client sends as part of the protocol handshake. Can be used to provide localized strings." }, GetPing = { Params = "", Return = "number", Notes = "Returns the ping time, in ms" }, GetPlayer = { Params = "", Return = "{{cPlayer|cPlayer}}", Notes = "Returns the player object connected to this client. Note that this may be nil, for example if the player object is not yet spawned." }, + GetProtocolVersion = { Params = "", Return = "number", Notes = "Returns the protocol version number of the protocol that the client is talking. Returns zero if the protocol version is not (yet) known." }, GetUniqueID = { Params = "", Return = "number", Notes = "Returns the UniqueID of the client used to identify the client in the server" }, - GetUUID = { Params = "", Return = "string", Notes = "Returns the authentication-based UUID of the client. This UUID should be used to identify the player when persisting any player-related data." }, + GetUUID = { Params = "", Return = "string", Notes = "Returns the authentication-based UUID of the client. This UUID should be used to identify the player when persisting any player-related data. Returns a 32-char UUID (no dashes)" }, GetUsername = { Params = "", Return = "string", Notes = "Returns the username that the client has provided" }, GetViewDistance = { Params = "", Return = "number", Notes = "Returns the viewdistance (number of chunks loaded for the player in each direction)" }, HasPluginChannel = { Params = "ChannelName", Return = "bool", Notes = "Returns true if the client has registered to receive messages on the specified plugin channel." }, IsUUIDOnline = { Params = "UUID", Return = "bool", Notes = "(STATIC) Returns true if the UUID is generated by online auth, false if it is an offline-generated UUID. We use Version-3 UUIDs for offline UUIDs, online UUIDs are Version-4, thus we can tell them apart. Accepts both 32-char and 36-char UUIDs (with and without dashes). If the string given is not a valid UUID, returns false."}, Kick = { Params = "Reason", Return = "", Notes = "Kicks the user with the specified reason" }, SendPluginMessage = { Params = "Channel, Message", Return = "", Notes = "Sends the plugin message on the specified channel." }, + SetClientBrand = { Params = "ClientBrand", Return = "", Notes = "Sets the value of the client's brand. Normally this value is received from the client by a MC|Brand plugin message, this function lets plugins overwrite the value." }, SetLocale = { Params = "Locale", Return = "", Notes = "Sets the locale that MCServer keeps on record. Initially the locale is initialized in protocol handshake, this function allows plugins to override the stored value (but only server-side and only until the user disconnects)." }, SetUsername = { Params = "Name", Return = "", Notes = "Sets the username" }, SetViewDistance = { Params = "ViewDistance", Return = "", Notes = "Sets the viewdistance (number of chunks loaded for the player in each direction)" }, SendBlockChange = { Params = "BlockX, BlockY, BlockZ, BlockType, BlockMeta", Return = "", Notes = "Sends a BlockChange packet to the client. This can be used to create fake blocks only for that player." }, + SendEntityAnimation = { Params = "{{cEntity|Entity}}, AnimationNumber", Return = "", Notes = "Sends the specified animation of the specified entity to the client. The AnimationNumber is protocol-specific." }, + SendSoundEffect = { Params = "SoundName, X, Y, Z, Volume, Pitch", Return = "", Notes = "Sends a sound effect request to the client. The sound is played at the specified coords, with the specified volume (a float, 1.0 is full volume, can be more) and pitch (0-255, 63 is 100%)" }, + SendTimeUpdate = { Params = "WorldAge, TimeOfDay, DoDaylightCycle", Return = "", Notes = "Sends the specified time update to the client. WorldAge is the total age of the world, in ticks. TimeOfDay is the current day's time, in ticks (0 - 24000). DoDaylightCycle is a bool that specifies whether the client should automatically move the sun (true) or keep it in the same place (false)." }, }, Constants = { @@ -554,9 +561,9 @@ end and commands suggested on click. The chat message can be sent by the regular chat-sending functions, {{cPlayer}}:SendMessage(), {{cWorld}}:BroadcastChat() and {{cRoot}}:BroadcastChat().</p> <p> - Note that most of the functions in this class are so-called modifiers - they modify the object and - then return the object itself, so that they can be chained one after another. See the Chaining - example below for details.</p> + Note that most of the functions in this class are so-called chaining modifiers - they modify the + object and then return the object itself, so that they can be chained one after another. See the + Chaining example below for details.</p> <p> Each part of the composite chat message takes a "Style" parameter, this is a string that describes the formatting. It uses the following strings, concatenated together: @@ -580,14 +587,17 @@ end { Params = "Text", Return = "", Notes = "Creates a chat message containing the specified text, parsed by the ParseText() function. This allows easy migration from old chat messages." }, }, AddRunCommandPart = { Params = "Text, Command, [Style]", Return = "self", Notes = "Adds a text which, when clicked, runs the specified command. Chaining." }, + AddShowAchievementPart = { Params = "PlayerName, AchievementName, [Style]", Return = "", Notes = "Adds a text that represents the 'Achievement get' message." }, AddSuggestCommandPart = { Params = "Text, Command, [Style]", Return = "self", Notes = "Adds a text which, when clicked, puts the specified command into the player's chat input area. Chaining." }, AddTextPart = { Params = "Text, [Style]", Return = "self", Notes = "Adds a regular text. Chaining." }, AddUrlPart = { Params = "Text, Url, [Style]", Return = "self", Notes = "Adds a text which, when clicked, opens up a browser at the specified URL. Chaining." }, Clear = { Params = "", Return = "", Notes = "Removes all parts from this object" }, + CreateJsonString = { Params = "[AddPrefixes]", Return = "string", Notes = "Returns the entire object serialized into JSON, as it would be sent to a client. AddPrefixes specifies whether the chat prefixes should be prepended to the message, true by default." }, ExtractText = { Params = "", Return = "string", Notes = "Returns the text from the parts that comprises the human-readable data. Used for older protocols that don't support composite chat and for console-logging." }, + GetAdditionalMessageTypeData = { Params = "", Return = "string", Notes = "Returns the AdditionalData associated with the message, such as the sender's name for mtPrivateMessage" }, GetMessageType = { Params = "", Return = "MessageType", Notes = "Returns the MessageType (mtXXX constant) that is associated with this message. When sent to a player, the message will be formatted according to this message type and the player's settings (adding \"[INFO]\" prefix etc.)" }, ParseText = { Params = "Text", Return = "self", Notes = "Adds text, while recognizing http and https URLs and old-style formatting codes (\"@2\"). Chaining." }, - SetMessageType = { Params = "MessageType", Return = "self", Notes = "Sets the MessageType (mtXXX constant) that is associated with this message. When sent to a player, the message will be formatted according to this message type and the player's settings (adding \"[INFO]\" prefix etc.) Chaining." }, + SetMessageType = { Params = "MessageType, AdditionalData", Return = "self", Notes = "Sets the MessageType (mtXXX constant) that is associated with this message. Also sets the additional data (string) associated with the message, which is specific for the message type - such as the sender's name for mtPrivateMessage. When sent to a player, the message will be formatted according to this message type and the player's settings (adding \"[INFO]\" prefix etc.). Chaining." }, UnderlineUrls = { Params = "", Return = "self", Notes = "Makes all URL parts contained in the message underlined. Doesn't affect parts added in the future. Chaining." }, }, @@ -776,7 +786,9 @@ end</pre> AddSpeedX = { Params = "AddX", Return = "", Notes = "Adds the specified amount of speed in the X axis direction." }, AddSpeedY = { Params = "AddY", Return = "", Notes = "Adds the specified amount of speed in the Y axis direction." }, AddSpeedZ = { Params = "AddZ", Return = "", Notes = "Adds the specified amount of speed in the Z axis direction." }, + ArmorCoversAgainst = { Params = "{{cEntity|AttackerEntity}}, DamageType, RawDamage", Return = "number", Notes = "Returns the points out of a_RawDamage that the currently equipped armor would cover." }, Destroy = { Params = "", Return = "", Notes = "Schedules the entity to be destroyed" }, + GetAirLevel = { Params = "", Return = "number", Notes = "Returns the air level (number of ticks of air left). Note, this function is only updated with mobs or players." }, GetArmorCoverAgainst = { Params = "AttackerEntity, DamageType, RawDamage", Return = "number", Notes = "Returns the number of hitpoints out of RawDamage that the currently equipped armor would cover. See {{TakeDamageInfo}} for more information on attack damage." }, GetChunkX = { Params = "", Return = "number", Notes = "Returns the X-coord of the chunk in which the entity is placed" }, GetChunkZ = { Params = "", Return = "number", Notes = "Returns the Z-coord of the chunk in which the entity is placed" }, @@ -792,6 +804,7 @@ end</pre> GetHeadYaw = { Params = "", Return = "number", Notes = "Returns the pitch of the entity's head (FIXME: Rename to GetHeadPitch() )." }, GetHealth = { Params = "", Return = "number", Notes = "Returns the current health of the entity." }, GetHeight = { Params = "", Return = "number", Notes = "Returns the height (Y size) of the entity" }, + GetInvulnerableTicks = { Params = "", Return = "number", Notes = "Returns the number of ticks that this entity will be invulnerable for. This is used for after-hit recovery - the entities are invulnerable for half a second after being hit." }, GetKnockbackAmountAgainst = { Params = "ReceiverEntity", Return = "number", Notes = "Returns the amount of knockback that the currently equipped items would cause when attacking the ReceiverEntity." }, GetLookVector = { Params = "", Return = "{{Vector3f}}", Notes = "Returns the vector that defines the direction in which the entity is looking" }, GetMass = { Params = "", Return = "number", Notes = "Returns the mass of the entity. Currently unused." }, @@ -809,23 +822,29 @@ end</pre> GetSpeedX = { Params = "", Return = "number", Notes = "Returns the X-part of the speed vector" }, GetSpeedY = { Params = "", Return = "number", Notes = "Returns the Y-part of the speed vector" }, GetSpeedZ = { Params = "", Return = "number", Notes = "Returns the Z-part of the speed vector" }, + GetTicksAlive = { Params = "", Return = "number", Notes = "Returns the number of ticks that this entity has been alive for." }, GetUniqueID = { Params = "", Return = "number", Notes = "Returns the ID that uniquely identifies the entity within the running server. Note that this ID is not persisted to the data files." }, GetWidth = { Params = "", Return = "number", Notes = "Returns the width (X and Z size) of the entity." }, GetWorld = { Params = "", Return = "{{cWorld}}", Notes = "Returns the world where the entity resides" }, GetYaw = { Params = "", Return = "number", Notes = "Returns the yaw (direction) of the entity. Measured in degrees, values range from -180 to +180. 0 means ZP, 90 means XM, -180 means ZM, -90 means XP." }, + HandleSpeedFromAttachee = { Params = "ForwardAmount, SidewaysAmount", Return = "", Notes = "Updates the entity's speed based on the attachee exerting the specified force forward and sideways. Used for entities being driven by other entities attached to them - usually players driving minecarts and boats." }, Heal = { Params = "Hitpoints", Return = "", Notes = "Heals the specified number of hitpoints. Hitpoints is expected to be a positive number." }, IsA = { Params = "ClassName", Return = "bool", Notes = "Returns true if the entity class is a descendant of the specified class name, or the specified class itself" }, IsBoat = { Params = "", Return = "bool", Notes = "Returns true if the entity is a {{cBoat|boat}}." }, IsCrouched = { Params = "", Return = "bool", Notes = "Returns true if the entity is crouched. Always false for entities that don't support crouching." }, IsDestroyed = { Params = "", Return = "bool", Notes = "Returns true if the entity has been destroyed and is awaiting removal from the internal structures." }, + IsEnderCrystal = { Params = "", Return = "bool", Notes = "Returns true if the entity is an ender crystal." }, IsExpOrb = { Params = "", Return = "bool", Notes = "Returns true if the entity represents an experience orb" }, IsFallingBlock = { Params = "", Return = "bool", Notes = "Returns true if the entity represents a {{cFallingBlock}} entity." }, + IsFireproof = { Params = "", Return = "bool", Notes = "Returns true if the entity takes no damage from being on fire." }, IsFloater = { Params = "", Return = "bool", Notes = "Returns true if the entity represents a fishing rod floater" }, IsInvisible = { Params = "", Return = "bool", Notes = "Returns true if the entity is invisible" }, + IsItemFrame = { Params = "", Return = "bool", Notes = "Returns true if the entity is an item frame." }, IsMinecart = { Params = "", Return = "bool", Notes = "Returns true if the entity represents a {{cMinecart|minecart}}" }, IsMob = { Params = "", Return = "bool", Notes = "Returns true if the entity represents any {{cMonster|mob}}." }, IsOnFire = { Params = "", Return = "bool", Notes = "Returns true if the entity is on fire" }, IsPainting = { Params = "", Return = "bool", Notes = "Returns if this entity is a painting." }, + IsPawn = { Params = "", Return = "bool", Notes = "Returns true if the entity is a {{cPawn}} descendant." }, IsPickup = { Params = "", Return = "bool", Notes = "Returns true if the entity represents a {{cPickup|pickup}}." }, IsPlayer = { Params = "", Return = "bool", Notes = "Returns true if the entity represents a {{cPlayer|player}}" }, IsProjectile = { Params = "", Return = "bool", Notes = "Returns true if the entity is a {{cProjectileEntity}} descendant." }, @@ -835,12 +854,19 @@ end</pre> IsSubmerged = { Params = "", Return = "bool", Notes = "Returns true if the mob or player is submerged in water (head is in a water block). Note, this function is only updated with mobs or players." }, IsSwimming = { Params = "", Return = "bool", Notes = "Returns true if the mob or player is swimming in water (feet are in a water block). Note, this function is only updated with mobs or players." }, IsTNT = { Params = "", Return = "bool", Notes = "Returns true if the entity represents a {{cTNTEntity|TNT entity}}" }, + Killed = { Params = "{{cEntity|Victim}}", Return = "", Notes = "This entity has killed another entity (the Victim). For players, adds the scoreboard statistics about the kill." }, KilledBy = { Notes = "FIXME: Remove this from API" }, - GetAirLevel = { Params = "", Return = "number", Notes = "Returns the air level (number of ticks of air left). Note, this function is only updated with mobs or players." }, + MoveToWorld = + { + { Params = "{{cWorld|World}}, [ShouldSendRespawn]", Return = "bool", Notes = "Removes the entity from this world and starts moving it to the specified world. Note that to avoid deadlocks, the move is asynchronous - the entity is moved into a queue and will be moved from that queue into the destination world at some (unpredictable) time in the future. ShouldSendRespawn is used only for players, it specifies whether the player should be sent a Repawn packet upon leaving the world (The client handles respawns only between different dimensions)." }, + { Params = "WorldName, [ShouldSendRespawn]", Return = "bool", Notes = "Removes the entity from this world and starts moving it to the specified world. Note that to avoid deadlocks, the move is asynchronous - the entity is moved into a queue and will be moved from that queue into the destination world at some (unpredictable) time in the future. ShouldSendRespawn is used only for players, it specifies whether the player should be sent a Repawn packet upon leaving the world (The client handles respawns only between different dimensions)." }, + }, SetGravity = { Params = "Gravity", Return = "", Notes = "Sets the number that is used as the gravity for physics simulation. 1G (9.78) by default." }, SetHeadYaw = { Params = "HeadPitch", Return = "", Notes = "Sets the head pitch (FIXME: Rename to SetHeadPitch() )." }, SetHealth = { Params = "Hitpoints", Return = "", Notes = "Sets the entity's health to the specified amount of hitpoints. Doesn't broadcast any hurt animation. Doesn't kill the entity if health drops below zero. Use the TakeDamage() function instead for taking damage." }, SetHeight = { Params = "", Return = "", Notes = "FIXME: Remove this from API" }, + SetInvulnerableTicks = { Params = "NumTicks", Return = "", Notes = "Sets the amount of ticks for which the entity will not receive any damage from other entities." }, + SetIsFireproof = { Params = "IsFireproof", Return = "", Notes = "Sets whether the entity receives damage from being on fire." }, SetMass = { Params = "Mass", Return = "", Notes = "Sets the mass of the entity. Currently unused." }, SetMaxHealth = { Params = "MaxHitpoints", Return = "", Notes = "Sets the maximum hitpoints of the entity. If current health is above MaxHitpoints, it is capped to MaxHitpoints." }, SetPitch = { Params = "number", Return = "", Notes = "Sets the pitch (nose-down rotation) of the entity" }, @@ -855,7 +881,7 @@ end</pre> SetPosZ = { Params = "number", Return = "", Notes = "Sets the Z-coord of the entity's pivot" }, SetRoll = { Params = "number", Return = "", Notes = "Sets the roll (sideways rotation) of the entity. Currently unused." }, SetRot = { Params = "{{Vector3f|Rotation}}", Return = "", Notes = "Sets the entire rotation vector (Yaw, Pitch, Roll)" }, - SetYawFromSpeed = { Params = "", Return = "", Notes = "Sets the entity's yaw to match its current speed (entity looking forwards as it moves). (FIXME: Rename to SetYawFromSpeed)" }, + SetYawFromSpeed = { Params = "", Return = "", Notes = "Sets the entity's yaw to match its current speed (entity looking forwards as it moves)." }, SetSpeed = { { Params = "SpeedX, SpeedY, SpeedZ", Return = "", Notes = "Sets the current speed of the entity" }, @@ -881,18 +907,20 @@ end</pre> Constants = { etBoat = { Notes = "The entity is a {{cBoat}}" }, + etEnderCrystal = { Notes = "" }, etEntity = { Notes = "No further specialization available" }, etExpOrb = { Notes = "The entity is a {{cExpOrb}}" }, etFallingBlock = { Notes = "The entity is a {{cFallingBlock}}" }, etFloater = { Notes = "The entity is a fishing rod floater" }, + etItemFrame = { Notes = "" }, + etMinecart = { Notes = "The entity is a {{cMinecart}} descendant" }, etMob = { Notes = "The entity is a {{cMonster}} descendant" }, etMonster = { Notes = "The entity is a {{cMonster}} descendant" }, - etMinecart = { Notes = "The entity is a {{cMinecart}} descendant" }, - etPlayer = { Notes = "The entity is a {{cPlayer}}" }, + etPainting = { Notes = "The entity is a {{cPainting}}" }, etPickup = { Notes = "The entity is a {{cPickup}}" }, + etPlayer = { Notes = "The entity is a {{cPlayer}}" }, etProjectile = { Notes = "The entity is a {{cProjectileEntity}} descendant" }, etTNT = { Notes = "The entity is a {{cTNTEntity}}" }, - etPainting = { Notes = "The entity is a {{cPainting}}" }, }, ConstantGroups = { @@ -942,24 +970,6 @@ cFile:Delete("/usr/bin/virus.exe"); Inherits = "cEntity", }, - cGroup = - { - Desc = [[ - This class represents a group {{cPlayer|players}} can be in. Groups define the permissions players - have, and optionally the color of their name in the chat. - ]], - Functions = - { - SetName = { Return = "" }, - GetName = { Return = "string" }, - SetColor = { Return = "" }, - GetColor = { Return = "string" }, - AddCommand = { Return = "" }, - AddPermission = { Return = "" }, - InheritFrom = { Return = "" }, - }, - }, -- cGroup - cIniFile = { Desc = [[ @@ -1060,6 +1070,7 @@ ValueName0=SomeOtherValue GetValueSetB = { Params = "KeyName, ValueName, Default", Return = "bool", Notes = "Returns the value of the specified name under the specified key, as a bool. If the value doesn't exist, creates it with the specified default." }, GetValueSetF = { Params = "KeyName, ValueName, Default", Return = "number", Notes = "Returns the value of the specified name under the specified key, as a floating-point number. If the value doesn't exist, creates it with the specified default." }, GetValueSetI = { Params = "KeyName, ValueName, Default", Return = "number", Notes = "Returns the value of the specified name under the specified key, as an integer. If the value doesn't exist, creates it with the specified default." }, + HasValue = { Params = "KeyName, ValueName", Return = "bool", Notes = "Returns true if the specified value is present." }, ReadFile = { Params = "FileName, [AllowExampleFallback]", Return = "bool", Notes = "Reads the values from the specified file. Previous in-memory contents are lost. If the file cannot be opened, and AllowExample is true, another file, \"filename.example.ini\", is loaded and then saved as \"filename.ini\". Returns true if successful, false if not." }, SetValue = { @@ -1206,7 +1217,7 @@ These ItemGrids are available in the API and can be manipulated by the plugins, constructor = { { Params = "", Return = "cItem", Notes = "Creates a new empty cItem object" }, - { Params = "ItemType, Count, Damage, EnchantmentString", Return = "cItem", Notes = "Creates a new cItem object of the specified type, count (1 by default), damage (0 by default) and enchantments (non-enchanted by default)" }, + { Params = "ItemType, Count, Damage, EnchantmentString, CustomName, Lore", Return = "cItem", Notes = "Creates a new cItem object of the specified type, count (1 by default), damage (0 by default), enchantments (non-enchanted by default), CustomName (empty by default) and Lore (string, empty by default)" }, { Params = "cItem", Return = "cItem", Notes = "Creates an exact copy of the cItem object in the parameter" }, } , AddCount = { Params = "AmountToAdd", Return = "cItem", Notes = "Adds the specified amount to the item count. Returns self (useful for chaining)." }, @@ -1219,12 +1230,14 @@ These ItemGrids are available in the API and can be manipulated by the plugins, IsDamageable = { Params = "", Return = "bool", Notes = "Returns true if this item does account for its damage" }, IsEmpty = { Params = "", Return = "bool", Notes = "Returns true if this object represents an empty item (zero count or invalid ID)" }, IsEqual = { Params = "cItem", Return = "bool", Notes = "Returns true if the item in the parameter is the same as the one stored in the object (type, damage, lore, name and enchantments)" }, - IsEnchantable = { Params = "", Return = "bool", Notes = "Returns true if the item is enchantable" }, IsFullStack = { Params = "", Return = "bool", Notes = "Returns true if the item is stacked up to its maximum stacking" }, IsSameType = { Params = "cItem", Return = "bool", Notes = "Returns true if the item in the parameter is of the same ItemType as the one stored in the object. This is true even if the two items have different enchantments" }, IsBothNameAndLoreEmpty = { Params = "", Return = "bool", Notes = "Returns if both the custom name and lore are not set." }, IsCustomNameEmpty = { Params = "", Return = "bool", Notes = "Returns if the custom name of the cItem is empty." }, IsLoreEmpty = { Params = "", Return = "", Notes = "Returns if the lore of the cItem is empty." }, + GetEnchantability = { Params = "", Return = "number", Notes = "Returns the enchantability of the item. When the item hasn't a enchantability, it will returns 0" }, + EnchantByXPLevels = { Params = "NumXPLevels", Return = "bool", Notes = "Enchants the item using the specified number of XP levels. Returns true if item enchanted, false if not." }, + IsEnchantable = { Params = "ItemType, WithBook", Return = "bool", Notes = "(STATIC) Returns true if the specified item type is enchantable. If WithBook is true, the function is used in the anvil inventory with book enchantments. So it checks the \"only book enchantments\" too. Example: You can only enchant a hoe with a book." }, }, Variables = { @@ -1232,8 +1245,10 @@ These ItemGrids are available in the API and can be manipulated by the plugins, m_ItemCount = { Type = "number", Notes = "Number of items in this stack" }, m_ItemDamage = { Type = "number", Notes = "The damage of the item. Zero means no damage. Maximum damage can be queried with GetMaxDamage()" }, m_ItemType = { Type = "number", Notes = "The item type. One of E_ITEM_ or E_BLOCK_ constants" }, - m_CustomName = { Type = "string", Notes = "The custom name for an item." }, - m_Lore = { Type = "string", Notes = "The lore for an item. Line breaks are represented by the ` character." }, + m_CustomName = { Type = "string", Notes = "The custom name for an item." }, + m_Lore = { Type = "string", Notes = "The lore for an item. Line breaks are represented by the ` character." }, + m_RepairCost = { Type = "number", Notes = "The repair cost of the item. The anvil need this value" }, + m_Enchantments = { Type = "{{cEnchantments|cEnchantments}}}", Notes = "The enchantments of the item." }, }, AdditionalInfo = { @@ -1606,6 +1621,38 @@ a_Player:OpenWindow(Window); }, -- cMapManager + cMojangAPI = + { + Desc = [[ + Provides interface to various API functions that Mojang provides through their servers. Note that + some of these calls will wait for a response from the network, and so shouldn't be used while the + server is fully running (or at least when there are players connected) to avoid percepted lag.</p> + <p> + All the functions are static, call them using the <code>cMojangAPI:Function()</code> convention.</p> + <p> + Mojang uses two formats for UUIDs, short and dashed. MCServer works with short UUIDs internally, but + will convert to dashed UUIDs where needed - in the protocol login for example. The MakeUUIDShort() + and MakeUUIDDashed() functions are provided for plugins to use for conversion between the two + formats.</p> + <p> + This class will cache values returned by the API service. The cache will hold the values for 7 days + by default, after that, they will no longer be available. This is in order to not let the server get + banned from using the API service, since they are rate-limited to 600 queries per 10 minutes. The + cache contents also gets updated whenever a player successfully joins, since that makes the server + contact the API service, too, and retrieve the relevant data.</p> + ]], + Functions = + { + AddPlayerNameToUUIDMapping = { Params = "PlayerName, UUID", Return = "", Notes = "(STATIC) Adds the specified PlayerName-to-UUID mapping into the cache, with current timestamp. Accepts both short or dashed UUIDs. " }, + GetPlayerNameFromUUID = { Params = "UUID, [UseOnlyCached]", Return = "PlayerName", Notes = "(STATIC) Returns the playername that corresponds to the given UUID, or an empty string on error. If UseOnlyCached is false (the default), queries the Mojang servers if the UUID is not in the cache. The UUID can be either short or dashed. <br /><b>WARNING</b>: Do NOT use this function with UseOnlyCached set to false while the server is running. Only use it when the server is starting up (inside the Initialize() method), otherwise you will lag the server severely." }, + GetUUIDFromPlayerName = { Params = "PlayerName, [UseOnlyCached]", Return = "UUID", Notes = "(STATIC) Returns the (short) UUID that corresponds to the given playername, or an empty string on error. If UseOnlyCached is false (the default), queries the Mojang servers if the playername is not in the cache. <br /><b>WARNING</b>: Do NOT use this function with UseOnlyCached set to false while the server is running. Only use it when the server is starting up (inside the Initialize() method), otherwise you will lag the server severely." }, + GetUUIDsFromPlayerNames = { Params = "PlayerNames, [UseOnlyCached]", Return = "table", Notes = "(STATIC) Returns a table that contains the map, 'PlayerName' -> '(short) UUID', for all valid playernames in the input array-table. PlayerNames not recognized will not be set in the returned map. If UseOnlyCached is false (the default), queries the Mojang servers for the results that are not in the cache. <br /><b>WARNING</b>: Do NOT use this function with UseOnlyCached set to false while the server is running. Only use it when the server is starting up (inside the Initialize() method), otherwise you will lag the server severely." }, + MakeUUIDDashed = { Params = "UUID", Return = "DashedUUID", Notes = "(STATIC) Converts the UUID to a dashed format (\"01234567-8901-2345-6789-012345678901\"). Accepts both dashed or short UUIDs. Logs a warning and returns an empty string if UUID format not recognized." }, + MakeUUIDShort = { Params = "UUID", Return = "ShortUUID", Notes = "(STATIC) Converts the UUID to a short format (without dashes, \"01234567890123456789012345678901\"). Accepts both dashed or short UUIDs. Logs a warning and returns an empty string if UUID format not recognized." }, + }, + + }, + cMonster = { Desc = [[ @@ -1615,6 +1662,11 @@ a_Player:OpenWindow(Window); ]], Functions = { + HasCustomName = { Params = "", Return = "bool", Notes = "Returns true if the monster has a custom name." }, + GetCustomName = { Params = "", Return = "string", Notes = "Gets the custom name of the monster. If no custom name is set, the function returns an empty string." }, + SetCustomName = { Params = "string", Return = "", Notes = "Sets the custom name of the monster. You see the name over the monster. If you want to disable the custom name, simply set an empty string." }, + IsCustomNameAlwaysVisible = { Params = "", Return = "bool", Notes = "Is the custom name of this monster always visible? If not, you only see the name when you sight the mob." }, + SetCustomNameAlwaysVisible = { Params = "bool", Return = "", Notes = "Sets the custom name visiblity of this monster. If it's false, you only see the name when you sight the mob. If it's true, you always see the custom name." }, FamilyFromType = { Params = "{{cMonster#MobType|MobType}}", Return = "{{cMonster#MobFamily|MobFamily}}", Notes = "(STATIC) Returns the mob family ({{cMonster#MobFamily|mfXXX}} constants) based on the mob type ({{cMonster#MobType|mtXXX}} constants)" }, GetMobFamily = { Params = "", Return = "{{cMonster#MobFamily|MobFamily}}", Notes = "Returns this mob's family ({{cMonster#MobFamily|mfXXX}} constant)" }, GetMobType = { Params = "", Return = "{{cMonster#MobType|MobType}}", Notes = "Returns the type of this mob ({{cMonster#MobType|mtXXX}} constant)" }, @@ -1622,6 +1674,8 @@ a_Player:OpenWindow(Window); MobTypeToString = { Params = "{{cMonster#MobType|MobType}}", Return = "string", Notes = "(STATIC) Returns the string representing the given mob type ({{cMonster#MobType|mtXXX}} constant), or empty string if unknown type." }, MoveToPosition = { Params = "Position", Return = "", Notes = "Moves mob to the specified position" }, StringToMobType = { Params = "string", Return = "{{cMonster#MobType|MobType}}", Notes = "(STATIC) Returns the mob type ({{cMonster#MobType|mtXXX}} constant) parsed from the string type (\"creeper\"), or mtInvalidType if unrecognized." }, + GetRelativeWalkSpeed = { Params = "", Return = "number", Notes = "Returns the relative walk speed of this mob. Standard is 1.0" }, + SetRelativeWalkSpeed = { Params = "number", Return = "", Notes = "Sets the relative walk speed of this mob. Standard is 1.0" }, }, Constants = { @@ -1714,6 +1768,7 @@ a_Player:OpenWindow(Window); GetItem = { Params = "", Return = "{{cItem|cItem}}", Notes = "Returns the item represented by this pickup" }, IsCollected = { Params = "", Return = "bool", Notes = "Returns true if this pickup has already been collected (is waiting to be destroyed)" }, IsPlayerCreated = { Params = "", Return = "bool", Notes = "Returns true if the pickup was created by a player" }, + SetAge = { Params = "AgeTicks", Return = "", Notes = "Sets the pickup's age, in ticks." }, }, Inherits = "cEntity", }, -- cPickup @@ -1728,7 +1783,6 @@ a_Player:OpenWindow(Window); Functions = { AddFoodExhaustion = { Params = "Exhaustion", Return = "", Notes = "Adds the specified number to the food exhaustion. Only positive numbers expected." }, - AddToGroup = { Params = "GroupName", Return = "", Notes = "Temporarily adds the player to the specified group. The assignment is lost when the player disconnects." }, CalcLevelFromXp = { Params = "XPAmount", Return = "number", Notes = "(STATIC) Returns the level which is reached with the specified amount of XP. Inverse of XpForLevel()." }, CanFly = { Return = "bool", Notes = "Returns if the player is able to fly." }, CloseWindow = { Params = "[CanRefuse]", Return = "", Notes = "Closes the currently open UI window. If CanRefuse is true (default), the window may refuse the closing." }, @@ -1738,8 +1792,9 @@ a_Player:OpenWindow(Window); FoodPoison = { Params = "NumTicks", Return = "", Notes = "Starts the food poisoning for the specified amount of ticks; if already foodpoisoned, sets FoodPoisonedTicksRemaining to the larger of the two" }, ForceSetSpeed = { Params = "{{Vector3d|Direction}}", Notes = "Forces the player to move to the given direction." }, GetClientHandle = { Params = "", Return = "{{cClientHandle}}", Notes = "Returns the client handle representing the player's connection. May be nil (AI players)." }, - GetColor = { Return = "string", Notes = "Returns the full color code to be used for this player (based on the first group). Prefix player messages with this code." }, + GetColor = { Return = "string", Notes = "Returns the full color code to be used for this player's messages (based on their rank). Prefix player messages with this code." }, GetCurrentXp = { Params = "", Return = "number", Notes = "Returns the current amount of XP" }, + GetCustomName = { Params = "", Return = "string", Notes = "Returns the custom name of this player. If the player hasn't a custom name, it will return an empty string." }, GetEffectiveGameMode = { Params = "", Return = "{{Globals#GameMode|GameMode}}", Notes = "(OBSOLETE) Returns the current resolved game mode of the player. If the player is set to inherit the world's gamemode, returns that instead. See also GetGameMode() and IsGameModeXXX() functions. Note that this function is the same as GetGameMode(), use that function instead." }, GetEquippedItem = { Params = "", Return = "{{cItem}}", Notes = "Returns the item that the player is currently holding; empty item if holding nothing." }, GetEyeHeight = { Return = "number", Notes = "Returns the height of the player's eyes, in absolute coords" }, @@ -1752,21 +1807,26 @@ a_Player:OpenWindow(Window); GetFoodSaturationLevel = { Params = "", Return = "number", Notes = "Returns the food saturation (overcharge of the food level, is depleted before food level)" }, GetFoodTickTimer = { Params = "", Return = "", Notes = "Returns the number of ticks past the last food-based heal or damage action; when this timer reaches 80, a new heal / damage is applied." }, GetGameMode = { Return = "{{Globals#GameMode|GameMode}}", Notes = "Returns the player's gamemode. The player may have their gamemode unassigned, in which case they inherit the gamemode from the current {{cWorld|world}}.<br /> <b>NOTE:</b> Instead of comparing the value returned by this function to the gmXXX constants, use the IsGameModeXXX() functions. These functions handle the gamemode inheritance automatically."}, - GetGroups = { Return = "array-table of {{cGroup}}", Notes = "Returns all the groups that this player is member of, as a table. The groups are stored in the array part of the table, beginning with index 1."}, GetIP = { Return = "string", Notes = "Returns the IP address of the player, if available. Returns an empty string if there's no IP to report."}, GetInventory = { Return = "{{cInventory|Inventory}}", Notes = "Returns the player's inventory"}, + GetLastBedPos = { Params = "", Return = "{{Vector3i}}", Notes = "Returns the position of the last bed the player has slept in, or the world's spawn if no such position was recorded." }, GetMaxSpeed = { Params = "", Return = "number", Notes = "Returns the player's current maximum speed, relative to the game default speed. Takes into account the sprinting / flying status." }, GetName = { Return = "string", Notes = "Returns the player's name" }, GetNormalMaxSpeed = { Params = "", Return = "number", Notes = "Returns the player's maximum walking speed, relative to the game default speed. Defaults to 1, but plugins may modify it for faster or slower walking." }, + GetPermissions = { Params = "", Return = "array-table of strings", Notes = "Returns the list of all permissions that the player has assigned to them through their rank." }, + GetPlayerListName = { Return = "string", Notes = "Returns the name that is used in the playerlist." }, GetResolvedPermissions = { Return = "array-table of string", Notes = "Returns all the player's permissions, as a table. The permissions are stored in the array part of the table, beginning with index 1." }, GetSprintingMaxSpeed = { Params = "", Return = "number", Notes = "Returns the player's maximum sprinting speed, relative to the game default speed. Defaults to 1.3, but plugins may modify it for faster or slower sprinting." }, GetStance = { Return = "number", Notes = "Returns the player's stance (Y-pos of player's eyes)" }, + GetTeam = { Params = "", Return = "{{cTeam}}", Notes = "Returns the team that the player belongs to, or nil if none." }, GetThrowSpeed = { Params = "SpeedCoeff", Return = "{{Vector3d}}", Notes = "Returns the speed vector for an object thrown with the specified speed coeff. Basically returns the normalized look vector multiplied by the coeff, with a slight random variation." }, GetThrowStartPos = { Params = "", Return = "{{Vector3d}}", Notes = "Returns the position where the projectiles should start when thrown by this player." }, + GetUUID = { Params = "", Return = "string", Notes = "Returns the (short) UUID that the player is using. Could be empty string for players that don't have a Mojang account assigned to them (in the future, bots for example)." }, GetWindow = { Params = "", Return = "{{cWindow}}", Notes = "Returns the currently open UI window. If the player doesn't have any UI window open, returns the inventory window." }, GetXpLevel = { Params = "", Return = "number", Notes = "Returns the current XP level (based on current XP amount)." }, GetXpLifetimeTotal = { Params = "", Return = "number", Notes = "Returns the amount of XP that has been accumulated throughout the player's lifetime." }, GetXpPercentage = { Params = "", Return = "number", Notes = "Returns the percentage of the experience bar - the amount of XP towards the next XP level. Between 0 and 1." }, + HasCustomName = { Params = "", Return = "bool", Notes = "Returns true if the player has a custom name." }, HasPermission = { Params = "PermissionString", Return = "bool", Notes = "Returns true if the player has the specified permission" }, Heal = { Params = "HitPoints", Return = "", Notes = "Heals the player by the specified amount of HPs. Only positive amounts are expected. Sends a health update to the client." }, IsEating = { Params = "", Return = "bool", Notes = "Returns true if the player is currently eating the item in their hand." }, @@ -1774,16 +1834,17 @@ a_Player:OpenWindow(Window); IsFlying = { Return = "bool", Notes = "Returns true if the player is flying." }, IsGameModeAdventure = { Params = "", Return = "bool", Notes = "Returns true if the player is in the gmAdventure gamemode, or has their gamemode unset and the world is a gmAdventure world." }, IsGameModeCreative = { Params = "", Return = "bool", Notes = "Returns true if the player is in the gmCreative gamemode, or has their gamemode unset and the world is a gmCreative world." }, + IsGameModeSpectator = { Params = "", Return = "bool", Notes = "Returns true if the player is in the gmSpectator gamemode, or has their gamemode unset and the world is a gmSpectator world." }, IsGameModeSurvival = { Params = "", Return = "bool", Notes = "Returns true if the player is in the gmSurvival gamemode, or has their gamemode unset and the world is a gmSurvival world." }, - IsInGroup = { Params = "GroupNameString", Return = "bool", Notes = "Returns true if the player is a member of the specified group." }, + IsInBed = { Params = "", Return = "bool", Notes = "Returns true if the player is currently lying in a bed." }, IsOnGround = { Params = "", Return = "bool", Notes = "Returns true if the player is on ground (not falling, not jumping, not flying)" }, IsSatiated = { Params = "", Return = "bool", Notes = "Returns true if the player is satiated (cannot eat)." }, IsVisible = { Params = "", Return = "bool", Notes = "Returns true if the player is visible to other players" }, - LoadPermissionsFromDisk = { Params = "", Return = "", Notes = "Reloads the player's permissions from the disk. This loses any temporary changes made to the player's groups." }, + LoadRank = { Params = "", Return = "", Notes = "Reloads the player's rank, message visuals and permissions from the {{cRankManager}}, based on the player's current rank." }, MoveTo = { Params = "{{Vector3d|NewPosition}}", Return = "Tries to move the player into the specified position." }, MoveToWorld = { Params = "WorldName", Return = "bool", Return = "Moves the player to the specified world. Returns true if successful." }, OpenWindow = { Params = "{{cWindow|Window}}", Return = "", Notes = "Opens the specified UI window for the player." }, - RemoveFromGroup = { Params = "GroupName", Return = "", Notes = "Temporarily removes the player from the specified group. This change is lost when the player disconnects." }, + PermissionMatches = { Params = "Permission, Template", Return = "bool", Notes = "(STATIC) Returns true if the specified permission matches the specified template. The template may contain wildcards." }, Respawn = { Params = "", Return = "", Notes = "Restores the health, extinguishes fire, makes visible and sends the Respawn packet." }, SendMessage = { Params = "Message", Return = "", Notes = "Sends the specified message to the player." }, SendMessageFailure = { Params = "Message", Return = "", Notes = "Prepends Rose [INFO] / colours entire text (depending on ShouldUseChatPrefixes()) and sends message to player. For a command that failed to run because of insufficient permissions, etc." }, @@ -1792,9 +1853,12 @@ a_Player:OpenWindow(Window); SendMessagePrivateMsg = { Params = "Message, SenderName", Return = "", Notes = "Prepends Light Blue [MSG: *SenderName*] / prepends SenderName and colours entire text (depending on ShouldUseChatPrefixes()) and sends message to player. For private messaging." }, SendMessageSuccess = { Params = "Message", Return = "", Notes = "Prepends Green [INFO] / colours entire text (depending on ShouldUseChatPrefixes()) and sends message to player. Success notification." }, SendMessageWarning = { Params = "Message, Sender", Return = "", Notes = "Prepends Rose [WARN] / colours entire text (depending on ShouldUseChatPrefixes()) and sends message to player. Denotes that something concerning, such as plugin reload, is about to happen." }, + SendRotation = { Params = "YawDegrees, PitchDegrees", Return = "", Notes = "Sends the specified rotation to the player, forcing them to look that way" }, + SetBedPos = { Params = "{{Vector3i|Position}}", Return = "", Notes = "Sets the internal representation of the last bed position the player has slept in. The player will respawn at this position if they die." }, SetCanFly = { Params = "CanFly", Notes = "Sets if the player can fly or not." }, SetCrouch = { Params = "IsCrouched", Return = "", Notes = "Sets the crouch state, broadcasts the change to other players." }, SetCurrentExperience = { Params = "XPAmount", Return = "", Notes = "Sets the current amount of experience (and indirectly, the XP level)." }, + SetCustomName = { Params = "string", Return = "", Notes = "Sets the custom name of this player. If you want to disable the custom name, simply set an empty string. The custom name will be used in the tab-list, in the player nametag and in the tab-completion." }, SetFlying = { Params = "IsFlying", Notes = "Sets if the player is flying or not." }, SetFlyingMaxSpeed = { Params = "FlyingMaxSpeed", Return = "", Notes = "Sets the flying maximum speed, relative to the game default speed. The default value is 1. Sends the updated speed to the client." }, SetFoodExhaustionLevel = { Params = "ExhaustionLevel", Return = "", Notes = "Sets the food exhaustion to the specified level." }, @@ -1808,7 +1872,11 @@ a_Player:OpenWindow(Window); SetNormalMaxSpeed = { Params = "NormalMaxSpeed", Return = "", Notes = "Sets the normal (walking) maximum speed, relative to the game default speed. The default value is 1. Sends the updated speed to the client, if appropriate." }, SetSprint = { Params = "IsSprinting", Return = "", Notes = "Sets whether the player is sprinting or not." }, SetSprintingMaxSpeed = { Params = "SprintingMaxSpeed", Return = "", Notes = "Sets the sprinting maximum speed, relative to the game default speed. The default value is 1.3. Sends the updated speed to the client, if appropriate." }, + SetTeam = { Params = "{{cTeam|Team}}", Return = "", Notes = "Moves the player to the specified team." }, SetVisible = { Params = "IsVisible", Return = "", Notes = "Sets the player visibility to other players" }, + TossEquippedItem = { Params = "[Amount]", Return = "", Notes = "Tosses the item that the player has selected in their hotbar. Amount defaults to 1." }, + TossHeldItem = { Params = "[Amount]", Return = "", Notes = "Tosses the item held by the cursor, then the player is in a UI window. Amount defaults to 1." }, + TossPickup = { Params = "{{cItem|Item}}", Return = "", Notes = "Tosses a pickup newly created from the specified item." }, XpForLevel = { Params = "XPLevel", Return = "number", Notes = "(STATIC) Returns the total amount of XP needed for the specified XP level. Inverse of CalcLevelFromXp()." }, }, Constants = @@ -1870,13 +1938,13 @@ cPluginManager.AddHook(cPluginManager.HOOK_CHAT, OnChatMessage); }, BindCommand = { - { Params = "Command, Permission, Callback, HelpString", Return = "[bool]", Notes = "(STATIC) Binds an in-game command with the specified callback function, permission and help string. By common convention, providing an empty string for HelpString will hide the command from the /help display. Returns true if successful, logs to console and returns no value on error." }, - { Params = "Command, Permission, Callback, HelpString", Return = "[bool]", Notes = "Binds an in-game command with the specified callback function, permission and help string. By common convention, providing an empty string for HelpString will hide the command from the /help display. Returns true if successful, logs to console and returns no value on error." }, + { Params = "Command, Permission, Callback, HelpString", Return = "[bool]", Notes = "(STATIC) Binds an in-game command with the specified callback function, permission and help string. By common convention, providing an empty string for HelpString will hide the command from the /help display. Returns true if successful, logs to console and returns no value on error. The callback uses the following signature: <pre class=\"prettyprint lang-lua\">function(Split, {{cPlayer|Player}})</pre> The Split parameter contains an array-table of the words that the player has sent, Player is the {{cPlayer}} object representing the player who sent the command. If the callback returns true, the command is assumed to have executed successfully; in all other cases the server sends a warning to the player that the command is unknown (this is so that subcommands can be implemented)." }, + { Params = "Command, Permission, Callback, HelpString", Return = "[bool]", Notes = "Binds an in-game command with the specified callback function, permission and help string. By common convention, providing an empty string for HelpString will hide the command from the /help display. Returns true if successful, logs to console and returns no value on error. The callback uses the following signature: <pre class=\"prettyprint lang-lua\">function(Split, {{cPlayer|Player}})</pre> The Split parameter contains an array-table of the words that the player has sent, Player is the {{cPlayer}} object representing the player who sent the command. If the callback returns true, the command is assumed to have executed successfully; in all other cases the server sends a warning to the player that the command is unknown (this is so that subcommands can be implemented)." }, }, BindConsoleCommand = { - { Params = "Command, Callback, HelpString", Return = "[bool]", Notes = "(STATIC) Binds a console command with the specified callback function and help string. By common convention, providing an empty string for HelpString will hide the command from the \"help\" console command. Returns true if successful, logs to console and returns no value on error." }, - { Params = "Command, Callback, HelpString", Return = "[bool]", Notes = "Binds a console command with the specified callback function and help string. By common convention, providing an empty string for HelpString will hide the command from the \"help\" console command. Returns true if successful, logs to console and returns no value on error." }, + { Params = "Command, Callback, HelpString", Return = "[bool]", Notes = "(STATIC) Binds a console command with the specified callback function and help string. By common convention, providing an empty string for HelpString will hide the command from the \"help\" console command. Returns true if successful, logs to console and returns no value on error. The callback uses the following signature: <pre class=\"prettyprint lang-lua\">function(Split)</pre> The Split parameter contains an array-table of the words that the admin has typed. If the callback returns true, the command is assumed to have executed successfully; in all other cases the server issues a warning to the console that the command is unknown (this is so that subcommands can be implemented)." }, + { Params = "Command, Callback, HelpString", Return = "[bool]", Notes = "Binds a console command with the specified callback function and help string. By common convention, providing an empty string for HelpString will hide the command from the \"help\" console command. Returns true if successful, logs to console and returns no value on error. The callback uses the following signature: <pre class=\"prettyprint lang-lua\">function(Split)</pre> The Split parameter contains an array-table of the words that the admin has typed. If the callback returns true, the command is assumed to have executed successfully; in all other cases the server issues a warning to the console that the command is unknown (this is so that subcommands can be implemented)." }, }, CallPlugin = { Params = "PluginName, FunctionName, [FunctionArgs...]", Return = "[FunctionRets]", Notes = "(STATIC) Calls the specified function in the specified plugin, passing all the given arguments to it. If it succeeds, it returns all the values returned by that function. If it fails, returns no value at all. Note that only strings, numbers, bools, nils and classes can be used for parameters and return values; tables and functions cannot be copied across plugins." }, DisablePlugin = { Params = "PluginName", Return = "bool", Notes = "Disables a plugin specified by its name. Returns true if the plugin was disabled, false if it wasn't found or wasn't active." }, @@ -1958,6 +2026,7 @@ cPluginManager.AddHook(cPluginManager.HOOK_CHAT, OnChatMessage); HOOK_PLAYER_USING_ITEM = { Notes = "Called when the player is about to right-click with a usable item in their hand." }, HOOK_POST_CRAFTING = { Notes = "Called after a valid recipe has been chosen for the current contents of the crafting grid. Plugins may modify the recipe." }, HOOK_PRE_CRAFTING = { Notes = "Called before a recipe is searched for the current contents of the crafting grid. Plugins may provide a recipe and cancel the built-in search." }, + HOOK_SERVER_PING = { Notes = "Called when a client pings the server from the server list. Plugins may change the favicon, server description, players online and maximum players values." }, HOOK_SPAWNED_ENTITY = { Notes = "Called after an entity is spawned in a {{cWorld|world}}. The entity is already part of the world." }, HOOK_SPAWNED_MONSTER = { Notes = "Called after a mob is spawned in a {{cWorld|world}}. The mob is already part of the world." }, HOOK_SPAWNING_ENTITY = { Notes = "Called just before an entity is spawned in a {{cWorld|world}}." }, @@ -1972,6 +2041,74 @@ cPluginManager.AddHook(cPluginManager.HOOK_CHAT, OnChatMessage); }, }, -- cPluginManager + cRankManager = + { + Desc = [[ + Manages the players' permissions. The players are assigned a single rank, which contains groups of + permissions. The functions in this class query or modify these.</p> + <p> + All the functions are static, call them using the <code>cRankManager:Function()</code> convention.</p> + <p> + The players are identified by their UUID, to support player renaming.</p> + <p> + The rank also contains specific "mesage visuals" - bits that are used for formatting messages from the + players. There's a message prefix, which is put in front of every message the player sends, and the + message suffix that is appended to each message. There's also a PlayerNameColorCode, which holds the + color that is used for the player's name in the messages.</p> + <p> + Each rank can contain any number of permission groups. These groups allow for an easier setup of the + permissions - you can share groups among ranks, so the usual approach is to group similar permissions + together and add that group to any rank that should use those permissions.</p> + <p> + Permissions are added to individual groups. Each group can support unlimited permissions. Note that + adding a permission to a group will make the permission available to all the ranks that contain that + permission group.</p> + <p> + One rank is reserved as the Default rank. All players that don't have an explicit rank assigned to them + will behave as if assigned to this rank. The default rank can be changed to any other rank at any time. + Note that the default rank cannot be removed from the RankManager - RemoveRank() will change the default + rank to the replacement rank, if specified, and fail if no replacement rank is specified. Renaming the + default rank using RenameRank() will change the default rank to the new name. + ]], + Functions = + { + AddGroup = { Params = "GroupName", Return = "", Notes = "Adds the group of the specified name. Logs a warning and does nothing if the group already exists." }, + AddGroupToRank = { Params = "GroupName, RankName", Return = "bool", Notes = "Adds the specified group to the specified rank. Returns true on success, false on failure - if the group name or the rank name is not found." }, + AddPermissionToGroup = { Params = "Permission, GroupName", Return = "bool", Notes = "Adds the specified permission to the specified group. Returns true on success, false on failure - if the group name is not found." }, + AddRank = { Params = "RankName, MsgPrefix, MsgSuffix, MsgNameColorCode", Return = "", Notes = "Adds a new rank of the specified name and with the specified message visuals. Logs an info message and does nothing if the rank already exists." }, + ClearPlayerRanks = { Params = "", Return = "", Notes = "Removes all player ranks from the database. Note that this doesn't change the cPlayer instances for the already connected players, you need to update all the instances manually." }, + GetAllGroups = { Params = "", Return = "array-table of groups' names", Notes = "Returns an array-table containing the names of all the groups that are known to the manager." }, + GetAllPermissions = { Params = "", Return = "array-table of permissions", Notes = "Returns an array-table containing all the permissions that are known to the manager." }, + GetAllPlayerUUIDs = { Params = "", Return = "array-table of uuids", Notes = "Returns the short uuids of all players stored in the rank DB, sorted by the players' names (case insensitive)." }, + GetAllRanks = { Params = "", Return = "array-table of ranks' names", Notes = "Returns an array-table containing the names of all the ranks that are known to the manager." }, + GetDefaultRank = { Params = "", Return = "string", Notes = "Returns the name of the default rank. " }, + GetGroupPermissions = { Params = "GroupName", Return = "array-table of permissions", Notes = "Returns an array-table containing the permissions that the specified group contains." }, + GetPlayerGroups = { Params = "PlayerUUID", Return = "array-table of groups' names", Notes = "Returns an array-table of the names of the groups that are assigned to the specified player through their rank. Returns an empty table if the player is not known or has no rank or groups assigned to them." }, + GetPlayerMsgVisuals = { Params = "PlayerUUID", Return = "MsgPrefix, MsgSuffix, MsgNameColorCode", Notes = "Returns the message visuals assigned to the player. If the player is not explicitly assigned a rank, the default rank's visuals are returned. If there is an error, no value is returned at all." }, + GetPlayerPermissions = { Params = "PlayerUUID", Return = "array-table of permissions", Notes = "Returns the permissions that the specified player is assigned through their rank. Returns the default rank's permissions if the player has no explicit rank assigned to them. Returns an empty array on error." }, + GetPlayerRankName = { Params = "PlayerUUID", Return = "RankName", Notes = "Returns the name of the rank that is assigned to the specified player. An empty string (NOT the default rank) is returned if the player has no rank assigned to them." }, + GetPlayerName = { Params = "PlayerUUID", Return = "PlayerName", Notes = "Returns the last name that the specified player has, for a player in the ranks database. An empty string is returned if the player isn't in the database." }, + GetRankGroups = { Params = "RankName", Return = "array-table of groups' names", Notes = "Returns an array-table of the names of all the groups that are assigned to the specified rank. Returns an empty table if there is no such rank." }, + GetRankPermissions = { Params = "RankName", Return = "array-table of permissions", Notes = "Returns an array-table of all the permissions that are assigned to the specified rank through its groups. Returns an empty table if there is no such rank." }, + GetRankVisuals = { Params = "RankName", Return = "MsgPrefix, MsgSuffix, MsgNameColorCode", Notes = "Returns the message visuals for the specified rank. Returns no value if the specified rank does not exist." }, + GroupExists = { Params = "GroupName", Return = "bool", Notes = "Returns true iff the specified group exists." }, + IsGroupInRank = { Params = "GroupName, RankName", Return = "bool", Notes = "Returns true iff the specified group is assigned to the specified rank." }, + IsPermissionInGroup = { Params = "Permission, GroupName", Return = "bool", Notes = "Returns true iff the specified permission is assigned to the specified group." }, + IsPlayerRankSet = { Params = "PlayerUUID", Return = "bool", Notes = "Returns true iff the specified player has a rank assigned to them." }, + RankExists = { Params = "RankName", Return = "bool", Notes = "Returns true iff the specified rank exists." }, + RemoveGroup = { Params = "GroupName", Return = "", Notes = "Removes the specified group completely. The group will be removed from all the ranks using it and then erased from the manager. Logs an info message and does nothing if the group doesn't exist." }, + RemoveGroupFromRank = { Params = "GroupName, RankName", Return = "", Notes = "Removes the specified group from the specified rank. The group will still exist, even if it isn't assigned to any rank. Logs an info message and does nothing if the group or rank doesn't exist." }, + RemovePermissionFromGroup = { Params = "Permission, GroupName", Return = "", Notes = "Removes the specified permission from the specified group. Logs an info message and does nothing if the group doesn't exist." }, + RemovePlayerRank = { Params = "PlayerUUID", Return = "", Notes = "Removes the player's rank; the player's left without a rank. Note that this doesn't change the {{cPlayer}} instances for the already connected players, you need to update all the instances manually. No action if the player has no rank assigned to them already." }, + RemoveRank = { Params = "RankName, [ReplacementRankName]", Return = "", Notes = "Removes the specified rank. If ReplacementRankName is given, the players that have RankName will get their rank set to ReplacementRankName. If it isn't given, or is an invalid rank, the players will be removed from the manager, their ranks will be unset completely. Logs an info message and does nothing if the rank is not found." }, + RenameGroup = { Params = "OldName, NewName", Return = "", Notes = "Renames the specified group. Logs an info message and does nothing if the group is not found or the new name is already used." }, + RenameRank = { Params = "OldName, NewName", Return = "", Notes = "Renames the specified rank. Logs an info message and does nothing if the rank is not found or the new name is already used." }, + SetDefaultRank = { Params = "RankName", Return = "bool", Notes = "Sets the specified rank as the default rank. Returns true on success, false on failure (rank doesn't exist)." }, + SetPlayerRank = { Params = "PlayerUUID, PlayerName, RankName", Return = "", Notes = "Updates the rank for the specified player. The player name is provided for reference, the UUID is used for identification. Logs a warning and does nothing if the rank is not found." }, + SetRankVisuals = { Params = "RankName, MsgPrefix, MsgSuffix, MsgNameColorCode", Return = "", Notes = "Updates the rank's message visuals. Logs an info message and does nothing if rank not found." }, + }, + }, -- cRankManager + cRoot = { Desc = [[ @@ -1985,22 +2122,28 @@ cPluginManager.AddHook(cPluginManager.HOOK_CHAT, OnChatMessage); ]], Functions = { - Get = { Params = "", Return = "Root object", Notes = "(STATIC)This function returns the cRoot object." }, - BroadcastChat = { Params = "Message", Return = "", Notes = "Broadcasts a message to every player in the server. No formatting is done by the server." }, - BroadcastChatFailure = { Params = "Message", Return = "", Notes = "Prepends Rose [INFO] / colours entire text (depending on ShouldUseChatPrefixes()) and broadcasts message. For a command that failed to run because of insufficient permissions, etc." }, - BroadcastChatFatal = { Params = "Message", Return = "", Notes = "Prepends Red [FATAL] / colours entire text (depending on ShouldUseChatPrefixes()) and broadcasts message. For a plugin that crashed, or similar." }, - BroadcastChatInfo = { Params = "Message", Return = "", Notes = "Prepends Yellow [INFO] / colours entire text (depending on ShouldUseChatPrefixes()) and broadcasts message. For informational messages, such as command usage." }, - BroadcastChatSuccess = { Params = "Message", Return = "", Notes = "Prepends Green [INFO] / colours entire text (depending on ShouldUseChatPrefixes()) and broadcasts message. For success messages." }, - BroadcastChatWarning = { Params = "Message", Return = "", Notes = "Prepends Rose [WARN] / colours entire text (depending on ShouldUseChatPrefixes()) and broadcasts message. For concerning events, such as plugin reload etc." }, - CreateAndInitializeWorld = { Params = "WorldName", Return = "{{cWorld|cWorld}}", Notes = "Creates a new world and initializes it. If there is a world whith the same name it returns nil." }, + BroadcastChat = + { + { Params = "MessageText, MessageType", Return = "", Notes = "Broadcasts a message to all players, with its message type set to MessageType (default: mtCustom)." }, + { Params = "{{cCompositeChat|CompositeChat}}", Return = "", Notes = "Broadcasts a {{cCompositeChat|composite chat message} to all players." }, + }, + BroadcastChatDeath = { Params = "MessageText", Return = "", Notes = "Broadcasts the specified message to all players, with its message type set to mtDeath. Use for when a player has died." }, + BroadcastChatFailure = { Params = "MessageText", Return = "", Notes = "Broadcasts the specified message to all players, with its message type set to mtFailure. Use for a command that failed to run because of insufficient permissions, etc." }, + BroadcastChatFatal = { Params = "MessageText", Return = "", Notes = "Broadcasts the specified message to all players, with its message type set to mtFatal. Use for a plugin that crashed, or similar." }, + BroadcastChatInfo = { Params = "MessageText", Return = "", Notes = "Broadcasts the specified message to all players, with its message type set to mtInfo. Use for informational messages, such as command usage." }, + BroadcastChatJoin = { Params = "MessageText", Return = "", Notes = "Broadcasts the specified message to all players, with its message type set to mtJoin. Use for players joining the server." }, + BroadcastChatLeave = { Params = "MessageText", Return = "", Notes = "Broadcasts the specified message to all players, with its message type set to mtLeave. Use for players leaving the server." }, + BroadcastChatSuccess = { Params = "MessageText", Return = "", Notes = "Broadcasts the specified message to all players, with its message type set to mtSuccess. Use for success messages." }, + BroadcastChatWarning = { Params = "MessageText", Return = "", Notes = "Broadcasts the specified message to all players, with its message type set to mtWarning. Use for concerning events, such as plugin reload etc." }, + CreateAndInitializeWorld = { Params = "WorldName", Return = "{{cWorld|cWorld}}", Notes = "Creates a new world and initializes it. If there is a world whith the same name it returns nil.<br/><br/><b>NOTE</b>This function is currently unsafe, do not use!" }, FindAndDoWithPlayer = { Params = "PlayerName, CallbackFunction", Return = "", Notes = "Calls the given callback function for all players with names partially (or fully) matching the name string provided." }, ForEachPlayer = { Params = "CallbackFunction", Return = "", Notes = "Calls the given callback function for each player. The callback function has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cPlayer|cPlayer}})</pre>" }, ForEachWorld = { Params = "CallbackFunction", Return = "", Notes = "Calls the given callback function for each world. The callback function has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cWorld|cWorld}})</pre>" }, + Get = { Params = "", Return = "Root object", Notes = "(STATIC)This function returns the cRoot object." }, GetCraftingRecipes = { Params = "", Return = "{{cCraftingRecipe|cCraftingRecipe}}", Notes = "Returns the CraftingRecipes object" }, GetDefaultWorld = { Params = "", Return = "{{cWorld|cWorld}}", Notes = "Returns the world object from the default world." }, GetFurnaceFuelBurnTime = { Params = "{{cItem|Fuel}}", Return = "number", Notes = "(STATIC) Returns the number of ticks for how long the item would fuel a furnace. Returns zero if not a fuel." }, GetFurnaceRecipe = { Params = "{{cItem|InItem}}", Return = "{{cItem|OutItem}}, NumTicks, {{cItem|InItem}}", Notes = "(STATIC) Returns the furnace recipe for smelting the specified input. If a recipe is found, returns the smelted result, the number of ticks required for the smelting operation, and the input consumed (note that MCServer supports smelting M items into N items and different smelting rates). If no recipe is found, returns no value." }, - GetGroupManager = { Params = "", Return = "{{cGroupManager|cGroupManager}}", Notes = "Returns the cGroupManager object." }, GetPhysicalRAMUsage = { Params = "", Return = "number", Notes = "Returns the amount of physical RAM that the entire MCServer process is using, in KiB. Negative if the OS doesn't support this query." }, GetPluginManager = { Params = "", Return = "{{cPluginManager|cPluginManager}}", Notes = "Returns the cPluginManager object." }, GetPrimaryServerVersion = { Params = "", Return = "number", Notes = "Returns the servers primary server version." }, @@ -2084,10 +2227,11 @@ end { GetDescription = { Return = "string", Notes = "Returns the server description set in the settings.ini." }, GetMaxPlayers = { Return = "number", Notes = "Returns the max amount of players who can join the server." }, - SetMaxPlayers = { Params = "number", Notes = "Sets the max amount of players who can join." }, GetNumPlayers = { Return = "number", Notes = "Returns the amount of players online." }, GetServerID = { Return = "string", Notes = "Returns the ID of the server?" }, IsHardcore = { Params = "", Return = "bool", Notes = "Returns true if the server is hardcore (players get banned on death)." }, + SetMaxPlayers = { Params = "number", Notes = "Sets the max amount of players who can join." }, + ShouldAuthenticate = { Params = "", Return = "bool", Notes = "Returns true iff the server is set to authenticate players (\"online mode\")." }, }, }, -- cServer @@ -2244,6 +2388,7 @@ end DigBlock = { Params = "X, Y, Z", Return = "", Notes = "Replaces the specified block with air, without dropping the usual pickups for the block. Wakes up the simulators for the block and its neighbors." }, DoExplosionAt = { Params = "Force, X, Y, Z, CanCauseFire, Source, SourceData", Return = "", Notes = "Creates an explosion of the specified relative force in the specified position. If CanCauseFire is set, the explosion will set blocks on fire, too. The Source parameter specifies the source of the explosion, one of the esXXX constants. The SourceData parameter is specific to each source type, usually it provides more info about the source." }, DoWithBlockEntityAt = { Params = "X, Y, Z, CallbackFunction, [CallbackData]", Return = "bool", Notes = "If there is a block entity at the specified coords, calls the CallbackFunction with the {{cBlockEntity}} parameter representing the block entity. The CallbackFunction has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cBlockEntity|BlockEntity}}, [CallbackData])</pre> The function returns false if there is no block entity, or if there is, it returns the bool value that the callback has returned. Use {{tolua}}.cast() to cast the Callback's BlockEntity parameter to the correct {{cBlockEntity}} descendant." }, + DoWithBeaconAt = { Params = "X, Y, Z, CallbackFunction, [CallbackData]", Return = "bool", Notes = "If there is a beacon at the specified coords, calls the CallbackFunction with the {{cBeaconEntity}} parameter representing the beacon. The CallbackFunction has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cBeaconEntity|BeaconEntity}}, [CallbackData])</pre> The function returns false if there is no beacon, or if there is, it returns the bool value that the callback has returned." }, DoWithChestAt = { Params = "X, Y, Z, CallbackFunction, [CallbackData]", Return = "bool", Notes = "If there is a chest at the specified coords, calls the CallbackFunction with the {{cChestEntity}} parameter representing the chest. The CallbackFunction has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cChestEntity|ChestEntity}}, [CallbackData])</pre> The function returns false if there is no chest, or if there is, it returns the bool value that the callback has returned." }, DoWithCommandBlockAt = { Params = "X, Y, Z, CallbackFunction, [CallbackData]", Return = "bool", Notes = "If there is a command block at the specified coords, calls the CallbackFunction with the {{cCommandBlockEntity}} parameter representing the command block. The CallbackFunction has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cCommandBlockEntity|CommandBlockEntity}}, [CallbackData])</pre> The function returns false if there is no command block, or if there is, it returns the bool value that the callback has returned." }, DoWithDispenserAt = { Params = "X, Y, Z, CallbackFunction, [CallbackData]", Return = "bool", Notes = "If there is a dispenser at the specified coords, calls the CallbackFunction with the {{cDispenserEntity}} parameter representing the dispenser. The CallbackFunction has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cDispenserEntity|DispenserEntity}}, [CallbackData])</pre> The function returns false if there is no dispenser, or if there is, it returns the bool value that the callback has returned." }, @@ -2264,6 +2409,7 @@ end ForEachBlockEntityInChunk = { Params = "ChunkX, ChunkZ, CallbackFunction, [CallbackData]", Return = "bool", Notes = "Calls the specified callback for each block entity in the chunk. Returns true if all block entities in the chunk have been processed (including when there are zero block entities), or false if the callback has aborted the enumeration by returning true. The CallbackFunction has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cBlockEntity|BlockEntity}}, [CallbackData])</pre> The callback should return false or no value to continue with the next block entity, or true to abort the enumeration. Use {{tolua}}.cast() to cast the Callback's BlockEntity parameter to the correct {{cBlockEntity}} descendant." }, ForEachChestInChunk = { Params = "ChunkX, ChunkZ, CallbackFunction, [CallbackData]", Return = "bool", Notes = "Calls the specified callback for each chest in the chunk. Returns true if all chests in the chunk have been processed (including when there are zero chests), or false if the callback has aborted the enumeration by returning true. The CallbackFunction has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cChestEntity|ChestEntity}}, [CallbackData])</pre> The callback should return false or no value to continue with the next chest, or true to abort the enumeration." }, ForEachEntity = { Params = "CallbackFunction, [CallbackData]", Return = "bool", Notes = "Calls the specified callback for each entity in the loaded world. Returns true if all the entities have been processed (including when there are zero entities), or false if the callback function has aborted the enumeration by returning true. The callback function has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cEntity|Entity}}, [CallbackData])</pre> The callback should return false or no value to continue with the next entity, or true to abort the enumeration." }, + ForEachEntityInBox = { Params = "{{cBoundingBox|Box}}, CallbackFunction", Return = "bool", Notes = "Calls the specified callback for each entity in the specified bounding box. Returns true if all the entities have been processed (including when there are zero entities), or false if the callback function has aborted the enumeration by returning true. If any chunk within the bounding box is not valid, it is silently skipped without any notification. The callback function has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cEntity|Entity}})</pre> The callback should return false or no value to continue with the next entity, or true to abort the enumeration." }, ForEachEntityInChunk = { Params = "ChunkX, ChunkZ, CallbackFunction, [CallbackData]", Return = "bool", Notes = "Calls the specified callback for each entity in the specified chunk. Returns true if all the entities have been processed (including when there are zero entities), or false if the chunk is not loaded or the callback function has aborted the enumeration by returning true. The callback function has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cEntity|Entity}}, [CallbackData])</pre> The callback should return false or no value to continue with the next entity, or true to abort the enumeration." }, ForEachFurnaceInChunk = { Params = "ChunkX, ChunkZ, CallbackFunction, [CallbackData]", Return = "bool", Notes = "Calls the specified callback for each furnace in the chunk. Returns true if all furnaces in the chunk have been processed (including when there are zero furnaces), or false if the callback has aborted the enumeration by returning true. The CallbackFunction has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cFurnaceEntity|FurnaceEntity}}, [CallbackData])</pre> The callback should return false or no value to continue with the next furnace, or true to abort the enumeration." }, ForEachPlayer = { Params = "CallbackFunction, [CallbackData]", Return = "bool", Notes = "Calls the specified callback for each player in the loaded world. Returns true if all the players have been processed (including when there are zero players), or false if the callback function has aborted the enumeration by returning true. The callback function has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cPlayer|Player}}, [CallbackData])</pre> The callback should return false or no value to continue with the next player, or true to abort the enumeration." }, @@ -2494,8 +2640,8 @@ World:ForEachEntity( The following code snippet checks if the player holds a shovel. <pre class="prettyprint lang-lua"> -- a_Player is a {{cPlayer}} object, possibly received as a hook param -local HeldItem = a_Player:GetEquippedItem(); -if (cItemCategory:IsShovel(HeldItem.m_ItemType)) then +local HeldItem = a_Player:GetEquippedItem() +if (ItemCategory.IsShovel(HeldItem.m_ItemType)) then -- It's a shovel end </pre> @@ -2721,21 +2867,22 @@ end Globals = { Desc = [[ - These functions are available directly, without a class instance. Any plugin cal call them at any + These functions are available directly, without a class instance. Any plugin can call them at any time. ]], Functions = { AddFaceDirection = {Params = "BlockX, BlockY, BlockZ, BlockFace, [IsInverse]", Return = "BlockX, BlockY, BlockZ", Notes = "Returns the coords of a block adjacent to the specified block through the specified {{Globals#BlockFaces|face}}"}, - BlockFaceToString = { Params = "{{Globals#BlockFaces|eBlockFace}}", Return = "string", Notes = "Returns the string representation of the {{Globals#BlockFaces|eBlockFace}} constant. Uses the axis-direction-based names, such as BLOCK_FACE_XP." }, + BlockFaceToString = {Params = "{{Globals#BlockFaces|eBlockFace}}", Return = "string", Notes = "Returns the string representation of the {{Globals#BlockFaces|eBlockFace}} constant. Uses the axis-direction-based names, such as BLOCK_FACE_XP." }, BlockStringToType = {Params = "BlockTypeString", Return = "BLOCKTYPE", Notes = "Returns the block type parsed from the given string"}, + Clamp = {Params = "Number, Min, Max", Return = "number", Notes = "Clamp the number to the specified range."}, ClickActionToString = {Params = "{{Globals#ClickAction|ClickAction}}", Return = "string", Notes = "Returns a string description of the ClickAction enumerated value"}, DamageTypeToString = {Params = "{{Globals#DamageType|DamageType}}", Return = "string", Notes = "Converts the {{Globals#DamageType|DamageType}} enumerated value to a string representation "}, EscapeString = {Params = "string", Return = "string", Notes = "Returns a copy of the string with all quotes and backslashes escaped by a backslash"}, GetChar = {Params = "String, Pos", Return = "string", Notes = "Returns one character from the string, specified by position "}, GetIniItemSet = { Params = "IniFile, SectionName, KeyName, DefaultValue", Return = "{{cItem}}", Notes = "Returns the item that has been read from the specified INI file value. If the value is not present in the INI file, the DefaultValue is stored in the file and parsed as the result. Returns empty item if the value cannot be parsed. " }, GetTime = {Return = "number", Notes = "Returns the current OS time, as a unix time stamp (number of seconds since Jan 1, 1970)"}, - IsBiomeNoDownfall = { Params = "Biome", Return = "bool", Notes = "Returns true if the biome is 'dry', that is, there is no precipitation during rains and storms." }, + IsBiomeNoDownfall = {Params = "Biome", Return = "bool", Notes = "Returns true if the biome is 'dry', that is, there is no precipitation during rains and storms." }, IsValidBlock = {Params = "BlockType", Return = "bool", Notes = "Returns true if BlockType is a known block type"}, IsValidItem = {Params = "ItemType", Return = "bool", Notes = "Returns true if ItemType is a known item type"}, ItemToFullString = {Params = "{{cItem|cItem}}", Return = "string", Notes = "Returns the string representation of the item, in the format 'ItemTypeText:ItemDamage * Count'"}, @@ -2769,7 +2916,7 @@ end MirrorBlockFaceY = { Params = "{{Globals#BlockFaces|eBlockFace}}", Return = "{{Globals#BlockFaces|eBlockFace}}", Notes = "Returns the {{Globals#BlockFaces|eBlockFace}} that corresponds to the given {{Globals#BlockFaces|eBlockFace}} after mirroring it around the Y axis (or rotating 180 degrees around it)." }, NoCaseCompare = {Params = "string, string", Return = "number", Notes = "Case-insensitive string comparison; returns 0 if the strings are the same"}, NormalizeAngleDegrees = { Params = "AngleDegrees", Return = "AngleDegrees", Notes = "Returns the angle, wrapped into the [-180, +180) range." }, - ReplaceString = {Params = "full-string, to-be-replaced-string, to-replace-string", Notes = "Replaces *each* occurence of to-be-replaced-string in full-string with to-replace-string"}, + ReplaceString = {Params = "full-string, to-be-replaced-string, to-replace-string", Return = "string", Notes = "Replaces *each* occurence of to-be-replaced-string in full-string with to-replace-string"}, RotateBlockFaceCCW = { Params = "{{Globals#BlockFaces|eBlockFace}}", Return = "{{Globals#BlockFaces|eBlockFace}}", Notes = "Returns the {{Globals#BlockFaces|eBlockFace}} that corresponds to the given {{Globals#BlockFaces|eBlockFace}} after rotating it around the Y axis 90 degrees counter-clockwise." }, RotateBlockFaceCW = { Params = "{{Globals#BlockFaces|eBlockFace}}", Return = "{{Globals#BlockFaces|eBlockFace}}", Notes = "Returns the {{Globals#BlockFaces|eBlockFace}} that corresponds to the given {{Globals#BlockFaces|eBlockFace}} after rotating it around the Y axis 90 degrees clockwise." }, StringSplit = {Params = "string, SeperatorsString", Return = "array table of strings", Notes = "Seperates string into multiple by splitting every time any of the characters in SeperatorsString is encountered."}, diff --git a/MCServer/Plugins/APIDump/Classes/BlockEntities.lua b/MCServer/Plugins/APIDump/Classes/BlockEntities.lua index de42f66df..90ebf12e6 100644 --- a/MCServer/Plugins/APIDump/Classes/BlockEntities.lua +++ b/MCServer/Plugins/APIDump/Classes/BlockEntities.lua @@ -50,6 +50,32 @@ return }, }, + cBeaconEntity = + { + Desc = [[ + A beacon entity is a {{cBlockEntityWithItems|cBlockEntityWithItems}} descendant that represents a beacon + in the world. + ]], + + Inherits = "cBlockEntityWithItems", + + Functions = + { + IsActive = { Params = "", Return = "bool", Notes = "Is the beacon active?" }, + GetBeaconLevel = { Params = "", Return = "number", Notes = "Returns the beacon level. (0 - 4)" }, + GetPrimaryEffect = { Params = "", Return = "EffectType", Notes = "Returns the primary effect." }, + GetSecondaryEffect = { Params = "", Return = "EffectType", Notes = "Returns the secondary effect." }, + SetPrimaryEffect = { Params = "EffectType", Return = "bool", Notes = "Select the primary effect. Returns false when the effect is invalid." }, + SetSecondaryEffect = { Params = "EffectType", Return = "bool", Notes = "Select the secondary effect. Returns false when the effect is invalid." }, + CalculatePyramidLevel = { Params = "", Return = "number", Notes = "Calculate the amount of layers the pyramid below the beacon has." }, + IsBeaconBlocked = { Params = "", Return = "bool", Notes = "Is the beacon blocked by non-transparent blocks that are higher than the beacon?" }, + UpdateBeacon = { Params = "", Return = "", Notes = "Update the beacon." }, + GiveEffects = { Params = "", Return = "", Notes = "Give the near-players the effects." }, + IsMineralBlock = { Params = "BLOCKTYPE", Return = "bool", Notes = "Returns true if the block is a diamond block, a golden block, an iron block or an emerald block." }, + IsValidEffect = { Params = "EffectType", Return = "bool", Notes = "Returns true if the effect can be used." }, + }, + }, + cChestEntity = { Desc = [[ diff --git a/MCServer/Plugins/APIDump/Hooks/OnPlayerMoving.lua b/MCServer/Plugins/APIDump/Hooks/OnPlayerMoving.lua index 2756529ef..4385bf94d 100644 --- a/MCServer/Plugins/APIDump/Hooks/OnPlayerMoving.lua +++ b/MCServer/Plugins/APIDump/Hooks/OnPlayerMoving.lua @@ -11,9 +11,11 @@ return Params = { { Name = "Player", Type = "{{cPlayer}}", Notes = "The player who has moved. The object already has the new position stored in it." }, + { Name = "OldPosition", Type = "{{Vector3d}}", Notes = "The old position." }, + { Name = "NewPosition", Type = "{{Vector3d}}", Notes = "The new position." }, }, Returns = [[ - If the function returns true, movement is prohibited. FIXME: The player's client is not informed.</p> + If the function returns true, movement is prohibited.</p> <p> If the function returns false or no value, other plugins' callbacks are called and finally the new position is permanently stored in the cPlayer object.</p> diff --git a/MCServer/Plugins/APIDump/Hooks/OnServerPing.lua b/MCServer/Plugins/APIDump/Hooks/OnServerPing.lua new file mode 100644 index 000000000..76b6d1517 --- /dev/null +++ b/MCServer/Plugins/APIDump/Hooks/OnServerPing.lua @@ -0,0 +1,50 @@ +return +{ + HOOK_SERVER_PING = + { + CalledWhen = "Client pings the server from the server list.", + DefaultFnName = "OnServerPing", -- also used as pagename + Desc = [[ + A plugin may implement an OnServerPing() function and register it as a Hook to process pings from + clients in the server server list. It can change the logged in players and player capacity, as well + as the server description and the favicon, that are displayed to the client in the server list. + ]], + Params = { + { Name = "ClientHandle", Type = "{{cClientHandle}}", Notes = "The client handle that pinged the server" }, + { Name = "ServerDescription", Type = "string", Notes = "The server description" }, + { Name = "OnlinePlayersCount", Type = "number", Notes = "The number of players currently on the server" }, + { Name = "MaxPlayersCount", Type = "number", Notes = "The current player cap for the server" }, + { Name = "Favicon", Type = "string", Notes = "The base64 encoded favicon to be displayed in the server list for compatible clients" }, + }, + Returns = [[ + The plugin can return whether to continue processing of the hook with other plugins, the server description to + be displayed to the client, the currently online players, the player cap and the base64/png favicon data, in that order. + ]], + CodeExamples = { + { + Title = "Change information returned to the player", + Desc = "Tells the client that the server description is 'test', there are one more players online than there actually are, and that the player cap is zero. It also changes the favicon data.", + Code = [[ +function OnServerPing(ClientHandle, ServerDescription, OnlinePlayers, MaxPlayers, Favicon) + -- Change Server Description + ServerDescription = "Test" + + -- Change online / max players + OnlinePlayers = OnlinePlayers + 1 + MaxPlayers = 0 + + -- Change favicon + if cFile:IsFile("my-favicon.png") then + local FaviconData = cFile:ReadWholeFile("my-favicon.png") + if (FaviconData ~= "") and (FaviconData ~= nil) then + Favicon = Base64Encode(FaviconData) + end + end + + return false, ServerDescription, OnlinePlayers, MaxPlayers, Favicon +end + ]], + }, + }, + }, -- HOOK_SERVER_PING +} diff --git a/MCServer/Plugins/APIDump/Hooks/OnSpawningEntity.lua b/MCServer/Plugins/APIDump/Hooks/OnSpawningEntity.lua index c4bff3916..e2bd1c940 100644 --- a/MCServer/Plugins/APIDump/Hooks/OnSpawningEntity.lua +++ b/MCServer/Plugins/APIDump/Hooks/OnSpawningEntity.lua @@ -6,8 +6,9 @@ return DefaultFnName = "OnSpawningEntity", -- also used as pagename Desc = [[ This hook is called before the server spawns an {{cEntity|entity}}. The plugin can either modify the - entity before it is spawned, or disable the spawning altogether. If the entity spawning is a - monster, the {{OnSpawningMonster|HOOK_SPAWNING_MONSTER}} hook is called before this hook.</p> + entity before it is spawned, or disable the spawning altogether. You can't disable the spawning if the + entity is a player. If the entity spawning is a monster, the {{OnSpawningMonster|HOOK_SPAWNING_MONSTER}} + hook is called before this hook.</p> <p> See also the {{OnSpawnedEntity|HOOK_SPAWNED_ENTITY}} hook for a similar hook called after the entity is spawned. diff --git a/MCServer/Plugins/APIDump/Writing-a-MCServer-plugin.html b/MCServer/Plugins/APIDump/Writing-a-MCServer-plugin.html index 35c880b00..dd124e119 100644 --- a/MCServer/Plugins/APIDump/Writing-a-MCServer-plugin.html +++ b/MCServer/Plugins/APIDump/Writing-a-MCServer-plugin.html @@ -202,7 +202,7 @@ function Explode(Split, Player) if (#Split ~= 2) then -- There was more or less than one argument (excluding the "/explode" bit) -- Send the proper usage to the player and exit - SendMessage(Player, "Usage: /explode [playername]") + Player:SendMessage("Usage: /explode [playername]") return true end @@ -213,7 +213,7 @@ function Explode(Split, Player) if (Explodee:GetName() == Split[2]) then -- Create an explosion at the same position as they are; see <a href="cWorld.html">API docs</a> for further details of this function Player:GetWorld():DoExplosionAt(Explodee:GetPosX(), Explodee:GetPosY(), Explodee:GetPosZ(), false, esPlugin) - SendMessageSuccess(Player, Split[2] .. " was successfully exploded") + Player:SendMessageSuccess(Split[2] .. " was successfully exploded") HasExploded = true; return true -- Signalize to MCS that we do not need to call this callback for any more players end @@ -224,7 +224,7 @@ function Explode(Split, Player) if not(HasExploded) then -- We have not broken out so far, therefore, the player must not exist, send failure - SendMessageFailure(Player, Split[2] .. " was not found") + Player:SendMessageFailure(Split[2] .. " was not found") end return true diff --git a/MCServer/Plugins/ChatLog b/MCServer/Plugins/ChatLog new file mode 160000 +Subproject 983d23ca37baa89f7e4dc11d71502d9c059f637 diff --git a/MCServer/Plugins/ChatLog/plugin.lua b/MCServer/Plugins/ChatLog/plugin.lua deleted file mode 100644 index adbf986e0..000000000 --- a/MCServer/Plugins/ChatLog/plugin.lua +++ /dev/null @@ -1,31 +0,0 @@ - --- plugin.lua - --- Implements the main entrypoint for the plugin, as well as all the handling needed - --- ChatLog plugin logs all chat messages into the server log - - - - - -function Initialize(Plugin) - Plugin:SetName("ChatLog") - Plugin:SetVersion(3) - - cPluginManager.AddHook(cPluginManager.HOOK_CHAT, OnChat) - - LOG("Initialized " .. Plugin:GetName() .. " v." .. Plugin:GetVersion()) - return true -end - - - - - -function OnChat(Player, Message) - -- Lets get loggin' - LOGINFO("[" .. Player:GetName() .. "]: " .. StripColorCodes(Message)); - - return false -end
\ No newline at end of file diff --git a/MCServer/Plugins/ChunkWorx b/MCServer/Plugins/ChunkWorx new file mode 160000 +Subproject 894c7e32049e9d2a1e736f7d721aaacd1ae29e5 diff --git a/MCServer/Plugins/ChunkWorx/ChunkWorx.deproj b/MCServer/Plugins/ChunkWorx/ChunkWorx.deproj deleted file mode 100644 index 17420d1d7..000000000 --- a/MCServer/Plugins/ChunkWorx/ChunkWorx.deproj +++ /dev/null @@ -1,9 +0,0 @@ -<?xml version="1.0" encoding="utf-8"?> -<project> - <file> - <filename>chunkworx_main.lua</filename> - </file> - <file> - <filename>chunkworx_web.lua</filename> - </file> -</project> diff --git a/MCServer/Plugins/ChunkWorx/chunkworx_main.lua b/MCServer/Plugins/ChunkWorx/chunkworx_main.lua deleted file mode 100644 index 88ecb3979..000000000 --- a/MCServer/Plugins/ChunkWorx/chunkworx_main.lua +++ /dev/null @@ -1,128 +0,0 @@ --- Global variables -PLUGIN = {} -- Reference to own plugin object -GENERATION_STATE = 0 -OPERATION_CODE = 0 -- 0 = generation -CX = 0 -CZ = 0 -CURRENT = 0 -TOTAL = 0 - --- AREA Variables -AreaStartX = -10 -AreaStartZ = -10 -AreaEndX = 10 -AreaEndZ = 10 - --- RADIAL Variables -RadialX = 0 -RadialZ = 0 -Radius = 10 - --- WORLD -WORK_WORLD = cRoot:Get():GetDefaultWorld():GetName() -WW_instance = cRoot:Get():GetDefaultWorld() -WORLDS = {} - - - - - -function Initialize(Plugin) - PLUGIN = Plugin - - PLUGIN:SetName("ChunkWorx") - PLUGIN:SetVersion(6) - - cPluginManager.AddHook(cPluginManager.HOOK_TICK, OnTick) - - Plugin:AddWebTab("(Re)Generation", HandleRequest_Generation) - - GENERATION_STATE = 0 - WW_instance = cRoot:Get():GetWorld(WORK_WORLD) - if (WW_instance == nil) then - LOG("" .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion() .. ": NO WORLD found :(") - end - - -- Read the stored values: - local SettingsIni = cIniFile(); - SettingsIni:ReadFile("ChunkWorx.ini"); -- ignore any read errors - AreaStartX = SettingsIni:GetValueSetI("Area data", "StartX", AreaStartX) - AreaStartZ = SettingsIni:GetValueSetI("Area data", "StartZ", AreaStartZ) - AreaEndX = SettingsIni:GetValueSetI("Area data", "EndX", AreaEndX) - AreaEndZ = SettingsIni:GetValueSetI("Area data", "EndZ", AreaEndZ) - RadialX = SettingsIni:GetValueSetI("Radial data", "RadialX", RadialX) - RadialZ = SettingsIni:GetValueSetI("Radial data", "RadialZ", RadialZ) - Radius = SettingsIni:GetValueSetI("Radial data", "Radius", Radius) - SettingsIni:WriteFile("ChunkWorx.ini"); - - LOG("Initialized " .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion()) - return true -end - - - - - -function OnTick( DeltaTime ) - if (GENERATION_STATE == 1 or GENERATION_STATE == 3) then - LOGINFO("" .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion() .. ": works STARTED!") - LOGINFO("" .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion() .. ": At world: " .. WORK_WORLD) - WW_instance = cRoot:Get():GetWorld(WORK_WORLD) - if (GENERATION_STATE == 1) then GENERATION_STATE = 2 end - if (GENERATION_STATE == 3) then GENERATION_STATE = 4 end - - -- Changing in case coordinates are flipped - local shifter = AreaEndX - if (AreaStartX > AreaEndX) then - AreaEndX = AreaStartX - AreaStartX = shifter - end - shifter = AreaEndZ - if (AreaStartZ > AreaEndZ) then - AreaEndZ = AreaStartZ - AreaStartZ = shifter - end - - CX = AreaStartX - CZ = AreaStartZ - CURRENT = 0 - - if (WW_instance == nil) then - LOGERROR("" .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion() .. ": works ABORTED") - LOGERROR("" .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion() .. ": NO WORLD found :(") - GENERATION_STATE = 0 - end - end - - - - if (GENERATION_STATE == 2 or GENERATION_STATE == 4) then - if (WW_instance:GetGeneratorQueueLength() < 200 - and WW_instance:GetLightingQueueLength() < 200 - and (WW_instance:GetStorageSaveQueueLength() + WW_instance:GetStorageLoadQueueLength()) < 80) then - local chunk_sum = (1+ AreaEndX - AreaStartX) * (1+ AreaEndZ - AreaStartZ) - TOTAL = chunk_sum - LOG("" .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion() .. ": PROCESSING 100 chunks, (" .. CURRENT .. "/" .. chunk_sum .. ")") - for C = 1, 100 do - if (GENERATION_STATE == 2) then WW_instance:GenerateChunk(CX, CZ) end - if (GENERATION_STATE == 4) then WW_instance:RegenerateChunk(CX, CZ) end - - CX = CX + 1 - CURRENT = CURRENT + 1 - if (CX > AreaEndX) then - CX = AreaStartX - CZ = CZ + 1 - if (CZ > AreaEndZ) then - if (GENERATION_STATE == 2) then LOGINFO("" .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion() .. " - generation ENDED!") end - if (GENERATION_STATE == 4) then LOGINFO("" .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion() .. " - REgeneration ENDED!") end - - GENERATION_STATE = 0 - break - end - end - end - WW_instance:QueueSaveAllChunks() - WW_instance:QueueUnloadUnusedChunks() - end - end -end
\ No newline at end of file diff --git a/MCServer/Plugins/ChunkWorx/chunkworx_web.lua b/MCServer/Plugins/ChunkWorx/chunkworx_web.lua deleted file mode 100644 index 9aec38b12..000000000 --- a/MCServer/Plugins/ChunkWorx/chunkworx_web.lua +++ /dev/null @@ -1,274 +0,0 @@ - --- chunkworx_web.lua - --- WebAdmin-related functions - - - - - -local function Buttons_Player( Name ) - return "<form method='POST'><input type='hidden' name='PlayerName' value='"..Name.."'><input type='submit' name='PlayerExact' value='Exact'><input type='submit' name='Player3x3' value='3x3'></form>" -end - - - - - -local function Button_World( Name ) - return "<form method='POST'><input type='hidden' name='WorldName' value='"..Name.."'><input type='submit' name='SelectWorld' value='Select'></form>" -end - - - - - -local function SaveSettings() - local SettingsIni = cIniFile() - SettingsIni:SetValueI("Area data", "StartX", AreaStartX) - SettingsIni:SetValueI("Area data", "StartZ", AreaStartZ) - SettingsIni:SetValueI("Area data", "EndX", AreaEndX) - SettingsIni:SetValueI("Area data", "EndZ", AreaEndZ) - SettingsIni:SetValueI("Radial data", "RadialX", RadialX) - SettingsIni:SetValueI("Radial data", "RadialZ", RadialZ) - SettingsIni:SetValueI("Radial data", "Radius", Radius) - SettingsIni:WriteFile("ChunkWorx.ini") -end - - - - - -function HandleRequest_Generation( Request ) - local Content = "" - if (Request.PostParams["AGHRRRR"] ~= nil) then - GENERATION_STATE = 0 - WW_instance:QueueSaveAllChunks() - WW_instance:QueueUnloadUnusedChunks() - LOGERROR("" .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion() .. ": works ABORTED by admin") - end - --Content = Content .. "<head><meta http-equiv=\"refresh\" content=\"2;\"></head>" - -- PROCESSING - -------------------------------------------------------------------------------------------------- - local function ProcessingContent() - local _small_content = "" - _small_content = _small_content .. "<head><meta http-equiv=\"refresh\" content=\"2;\"></head>" - _small_content = _small_content .. "<h4>World for operations:</h4>"..WORK_WORLD - if (OPERATION_CODE == 0) then - _small_content = _small_content .. "<h4>Operation:</h4>Generation" - elseif (OPERATION_CODE == 1) then - _small_content = _small_content .. "<h4>Operation:</h4>Regeneration" - end - _small_content = _small_content .. "<h4>Area: </h4>["..AreaStartX..":"..AreaStartZ.."] ["..AreaEndX..":"..AreaEndZ.."]" - _small_content = _small_content .. "<h4>Progress:</h4>"..CURRENT.."/"..TOTAL - _small_content = _small_content .. "<br>" - _small_content = _small_content .. "<form method='POST'>" - _small_content = _small_content .. "<input type='submit' name='AGHRRRR' value='Stop'>" - _small_content = _small_content .. "</form>" - return _small_content - end - if (GENERATION_STATE == 2 or GENERATION_STATE == 4) then - Content = ProcessingContent() - return Content - end - -- SELECTING - -------------------------------------------------------------------------------------------------- - if ( Request.PostParams["FormSetWorld"] ) then - WORK_WORLD = Request.PostParams["FormWorldName"] - WW_instance = cRoot:Get():GetWorld(WORK_WORLD) - end - - if( Request.PostParams["SelectWorld"] ~= nil - and Request.PostParams["WorldName"] ~= nil ) then -- World is selected! - WORK_WORLD = Request.PostParams["WorldName"] - WW_instance = cRoot:Get():GetWorld(WORK_WORLD) - end - - if(Request.PostParams["OperationGenerate"] ~= nil) then - OPERATION_CODE = 0 - end - if(Request.PostParams["OperationReGenerate"] ~= nil) then - OPERATION_CODE = 1 - end - - if (GENERATION_STATE == 0) then - if( Request.PostParams["FormAreaStartX"] ~= nil - and Request.PostParams["FormAreaStartZ"] ~= nil - and Request.PostParams["FormAreaEndX"] ~= nil - and Request.PostParams["FormAreaEndZ"] ~= nil ) then --(Re)Generation valid! - -- COMMON (Re)gen - if( Request.PostParams["StartArea"]) then - AreaStartX = tonumber(Request.PostParams["FormAreaStartX"]) - AreaStartZ = tonumber(Request.PostParams["FormAreaStartZ"]) - AreaEndX = tonumber(Request.PostParams["FormAreaEndX"]) - AreaEndZ = tonumber(Request.PostParams["FormAreaEndZ"]) - SaveSettings(); - if (OPERATION_CODE == 0) then - GENERATION_STATE = 1 - elseif (OPERATION_CODE == 1) then - GENERATION_STATE = 3 - end - Content = ProcessingContent() - return Content - end - end - if( Request.PostParams["FormRadialX"] ~= nil - and Request.PostParams["FormRadialZ"] ~= nil - and Request.PostParams["FormRadius"] ~= nil ) then --(Re)Generation valid! - -- COMMON (Re)gen - if( Request.PostParams["StartRadial"]) then - RadialX = tonumber(Request.PostParams["FormRadialX"]) or 0 - RadialZ = tonumber(Request.PostParams["FormRadialZ"]) or 0 - Radius = tonumber(Request.PostParams["FormRadius"]) or 10 - AreaStartX = RadialX - Radius - AreaStartZ = RadialZ - Radius - AreaEndX = RadialX + Radius - AreaEndZ = RadialZ + Radius - SaveSettings() - if (OPERATION_CODE == 0) then - GENERATION_STATE = 1 - elseif (OPERATION_CODE == 1) then - GENERATION_STATE = 3 - end - Content = ProcessingContent() - return Content - end - end - -- POINT REGEN! - if( Request.PostParams["FormPointX"] ~= nil - and Request.PostParams["FormPointZ"] ~= nil ) then --ReGeneration valid! - -- EXACT - if ( Request.PostParams["PointExact"] ~= nil) then - AreaStartX = tonumber(Request.PostParams["FormPointX"]) - AreaStartZ = tonumber(Request.PostParams["FormPointZ"]) - AreaEndX = AreaStartX - AreaEndZ = AreaStartZ - GENERATION_STATE = 3 - Content = ProcessingContent() - return Content - end - -- 3x3 - if ( Request.PostParams["Point3x3"] ~= nil) then - AreaStartX = tonumber(Request.PostParams["FormPointX"]) - 1 - AreaStartZ = tonumber(Request.PostParams["FormPointZ"]) - 1 - AreaEndX = AreaStartX + 2 - AreaEndZ = AreaStartZ + 2 - GENERATION_STATE = 3 - Content = ProcessingContent() - return Content - end - end - - local GetAreaByPlayer = function(Player) - -- Player is valid only within this function, it cannot be stord and used later! - AreaStartX = Player:GetChunkX() - AreaStartZ = Player:GetChunkZ() - end - -- PLAYERS REGEN! - if( Request.PostParams["PlayerExact"] ~= nil - and Request.PostParams["PlayerName"] ~= nil ) then -- Making BOOM! I meant, regenereate... - cRoot:Get():GetWorld(WORK_WORLD):DoWithPlayer(Request.PostParams["PlayerName"],GetAreaByPlayer) - AreaEndX = AreaStartX - AreaEndZ = AreaStartZ - GENERATION_STATE = 3 - Content = ProcessingContent() - return Content - end - if( Request.PostParams["Player3x3"] ~= nil - and Request.PostParams["PlayerName"] ~= nil ) then -- Making BOOM! I meant, regenereate... - cRoot:Get():GetWorld(WORK_WORLD):DoWithPlayer(Request.PostParams["PlayerName"],GetAreaByPlayer) - AreaStartX = AreaStartX - 1 - AreaStartZ = AreaStartZ - 1 - AreaEndX = AreaStartX + 2 - AreaEndZ = AreaStartZ + 2 - GENERATION_STATE = 3 - Content = ProcessingContent() - return Content - end - end - - --Content = Content .. "<h4>World for operations: " .. WORK_WORLD .. "</h4>" - --Content = Content .. "<form method='POST'>" - --Content = Content .. "<input type='text' name='FormWorldName' value='Input world name here'><input type='submit' name='FormSetWorld' value='Set world'>" - --Content = Content .. "</form>" - - -- SELECTING WORK_WORLD - Content = Content .. "<h4>World for operations: " .. WORK_WORLD .. "</h4>" - Content = Content .. "<table>" - local WorldNum = 0 - local AddWorldToTable = function(World) - WorldNum = WorldNum + 1 - Content = Content .. "<tr>" - Content = Content .. "<td style='width: 10px;'>" .. WorldNum .. ".</td>" - Content = Content .. "<td>" .. World:GetName() .. "</td>" - Content = Content .. "<td>" .. Button_World(World:GetName()) .. "</td>" - Content = Content .. "</tr>" - end - cRoot:Get():ForEachWorld(AddWorldToTable) - if( WorldNum == 0 ) then - Content = Content .. "<tr><td>No worlds! O_O</td></tr>" - end - Content = Content .. "</table>" - Content = Content .. "<br>" - - -- SELECTING OPERATION - if (OPERATION_CODE == 0) then - Content = Content .. "<h4>Operation: Generation</h4>" - elseif (OPERATION_CODE == 1) then - Content = Content .. "<h4>Operation: Regeneration</h4>" - end - Content = Content .. "<form method='POST'>" - Content = Content .. "<input type='submit' name='OperationGenerate' value='Generation'>" - Content = Content .. "<input type='submit' name='OperationReGenerate' value='Regeneration'>" - Content = Content .. "</form>" - - -- SELECTING AREA - Content = Content .. "<h4>Area: </h4>Start X, Start Z; End X, End Z" - Content = Content .. "<form method='POST'>" - Content = Content .. "<input type='text' name='FormAreaStartX' value='" .. AreaStartX .. "'><input type='text' name='FormAreaStartZ' value='" .. AreaStartZ .. "'>" - Content = Content .. "<input type='text' name='FormAreaEndX' value='" .. AreaEndX .. "'><input type='text' name='FormAreaEndZ' value='" .. AreaEndZ .. "'>" - Content = Content .. "<input type='submit' name='StartArea' value='Start'>" - Content = Content .. "</form>" - - -- SELECTING RADIAL - Content = Content .. "<h4>Radial: </h4>Center X, Center Z, Radius" - Content = Content .. "<form method='POST'>" - Content = Content .. "<input type='text' name='FormRadialX' value='" .. RadialX .. "'><input type='text' name='FormRadialZ' value='" .. RadialZ .. "'><input type='text' name='FormRadius' value='" .. Radius .. "'>" - Content = Content .. "<input type='submit' name='StartRadial' value='Start'>" - Content = Content .. "</form>" - Content = Content .. "<br>" - Content = Content .. "<br>" - Content = Content .. "<br>" - - -- SELECTING POINT - Content = Content .. "<h4>Point regeneration:</h4> X, Z" - Content = Content .. "<form method='POST'>" - Content = Content .. "<input type='text' name='FormPointX' value='0'><input type='text' name='FormPointZ' value='0'>" - Content = Content .. "<input type='submit' name='PointExact' value='Exact'>" - Content = Content .. "<input type='submit' name='Point3x3' value='3x3'>" - Content = Content .. "</form>" - - -- SELECTING PLAYERS - Content = Content .. "<h4>Player-based regeneration:</h4>" - Content = Content .. "<table>" - local PlayerNum = 0 - local AddPlayerToTable = function( Player ) - PlayerNum = PlayerNum + 1 - Content = Content .. "<tr>" - Content = Content .. "<td style='width: 10px;'>" .. PlayerNum .. ".</td>" - Content = Content .. "<td>" .. Player:GetName() .. "</td>" - Content = Content .. "<td>" .. Buttons_Player(Player:GetName()) .. "</td>" - Content = Content .. "</tr>" - end - if (cRoot:Get():GetWorld(WORK_WORLD) == nil) then - Content = Content .. "<tr><td>Incorrect world selection</td></tr>" - else - cRoot:Get():GetWorld(WORK_WORLD):ForEachPlayer( AddPlayerToTable ) - if( PlayerNum == 0 ) then - Content = Content .. "<tr><td>No connected players</td></tr>" - end - end - Content = Content .. "</table>" - Content = Content .. "<br>" - return Content -end
\ No newline at end of file diff --git a/MCServer/Plugins/Debuggers/Debuggers.lua b/MCServer/Plugins/Debuggers/Debuggers.lua index b402c1867..f66ac76a0 100644 --- a/MCServer/Plugins/Debuggers/Debuggers.lua +++ b/MCServer/Plugins/Debuggers/Debuggers.lua @@ -33,10 +33,12 @@ function Initialize(Plugin) PM:AddHook(cPluginManager.HOOK_PROJECTILE_HIT_BLOCK, OnProjectileHitBlock); PM:AddHook(cPluginManager.HOOK_CHUNK_UNLOADING, OnChunkUnloading); PM:AddHook(cPluginManager.HOOK_WORLD_STARTED, OnWorldStarted); + PM:AddHook(cPluginManager.HOOK_PROJECTILE_HIT_BLOCK, OnProjectileHitBlock); -- _X: Disabled so that the normal operation doesn't interfere with anything -- PM:AddHook(cPluginManager.HOOK_CHUNK_GENERATED, OnChunkGenerated); + PM:BindCommand("/nick", "debuggers", HandleNickCmd, "- Gives you a custom name"); PM:BindCommand("/le", "debuggers", HandleListEntitiesCmd, "- Shows a list of all the loaded entities"); PM:BindCommand("/ke", "debuggers", HandleKillEntitiesCmd, "- Kills all the loaded entities"); PM:BindCommand("/wool", "debuggers", HandleWoolCmd, "- Sets all your armor to blue wool"); @@ -64,6 +66,8 @@ function Initialize(Plugin) PM:BindCommand("/sb", "debuggers", HandleSetBiome, "- Sets the biome around you to the specified one"); PM:BindCommand("/wesel", "debuggers", HandleWESel, "- Expands the current WE selection by 1 block in X/Z"); PM:BindCommand("/rmitem", "debuggers", HandleRMItem, "- Remove the specified item from the inventory."); + PM:BindCommand("/pickups", "debuggers", HandlePickups, "- Spawns random pickups around you"); + PM:BindCommand("/poof", "debuggers", HandlePoof, "- Nudges pickups close to you away from you"); Plugin:AddWebTab("Debuggers", HandleRequest_Debuggers) Plugin:AddWebTab("StressTest", HandleRequest_StressTest) @@ -80,6 +84,8 @@ function Initialize(Plugin) TestBlockAreasString() TestStringBase64() + -- TestUUIDFromName() + -- TestRankMgr() --[[ -- Test cCompositeChat usage in console-logging: @@ -275,6 +281,94 @@ end +function TestUUIDFromName() + LOG("Testing UUID-from-Name resolution...") + + -- Test by querying a few existing names, along with a non-existent one: + local PlayerNames = + { + "xoft", + "aloe_vera", + "nonexistent_player", + } + -- WARNING: Blocking operation! DO NOT USE IN TICK THREAD! + local UUIDs = cMojangAPI:GetUUIDsFromPlayerNames(PlayerNames) + + -- Log the results: + for _, name in ipairs(PlayerNames) do + local UUID = UUIDs[name] + if (UUID == nil) then + LOG(" UUID(" .. name .. ") not found.") + else + LOG(" UUID(" .. name .. ") = \"" .. UUID .. "\"") + end + end + + -- Test once more with the same players, valid-only. This should go directly from cache, so fast. + LOG("Testing again with the same valid players...") + local ValidPlayerNames = + { + "xoft", + "aloe_vera", + } + UUIDs = cMojangAPI:GetUUIDsFromPlayerNames(ValidPlayerNames); + + -- Log the results: + for _, name in ipairs(ValidPlayerNames) do + local UUID = UUIDs[name] + if (UUID == nil) then + LOG(" UUID(" .. name .. ") not found.") + else + LOG(" UUID(" .. name .. ") = \"" .. UUID .. "\"") + end + end + + -- Test yet again, cache-only: + LOG("Testing once more, cache only...") + local PlayerNames3 = + { + "xoft", + "aloe_vera", + "notch", -- Valid player name, but not cached (most likely :) + } + UUIDs = cMojangAPI:GetUUIDsFromPlayerNames(PlayerNames3, true) + + -- Log the results: + for _, name in ipairs(PlayerNames3) do + local UUID = UUIDs[name] + if (UUID == nil) then + LOG(" UUID(" .. name .. ") not found.") + else + LOG(" UUID(" .. name .. ") = \"" .. UUID .. "\"") + end + end + + LOG("UUID-from-Name resolution tests finished.") + + LOG("Performing a Name-from-UUID test...") + -- local NameToTest = "aloe_vera" + local NameToTest = "xoft" + local Name = cMojangAPI:GetPlayerNameFromUUID(UUIDs[NameToTest]) + LOG("Name(" .. UUIDs[NameToTest] .. ") = '" .. Name .. "', expected '" .. NameToTest .. "'.") + LOG("Name-from-UUID test finished.") +end + + + + + +function TestRankMgr() + LOG("Testing the rank manager") + cRankManager:AddRank("LuaRank") + cRankManager:AddGroup("LuaTestGroup") + cRankManager:AddGroupToRank("LuaTestGroup", "LuaRank") + cRankManager:AddPermissionToGroup("luaperm", "LuaTestGroup") +end + + + + + function TestSQLiteBindings() LOG("Testing SQLite bindings..."); @@ -677,6 +771,21 @@ end +function HandleNickCmd(Split, Player) + if (Split[2] == nil) then + Player:SendMessage("Usage: /nick [CustomName]"); + return true; + end + + Player:SetCustomName(Split[2]); + Player:SendMessageSuccess("Custom name setted to " .. Player:GetCustomName() .. "!") + return true +end + + + + + function HandleListEntitiesCmd(Split, Player) local NumEntities = 0; @@ -1409,7 +1518,7 @@ function OnPlayerJoined(a_Player) -- Test composite chat chaining: a_Player:SendMessage(cCompositeChat() :AddTextPart("Hello, ") - :AddUrlPart(a_Player:GetName(), "www.mc-server.org", "u@2") + :AddUrlPart(a_Player:GetName(), "http://www.mc-server.org", "u@2") :AddSuggestCommandPart(", and welcome.", "/help", "u") :AddRunCommandPart(" SetDay", "/time set 0") ) @@ -1455,3 +1564,69 @@ end + +function OnProjectileHitBlock(a_ProjectileEntity, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_BlockHitPos) + -- This simple test is for testing issue #1326 - simply declaring this hook would crash the server upon call + LOG("Projectile hit block") + LOG(" Projectile EntityID: " .. a_ProjectileEntity:GetUniqueID()) + LOG(" Block: {" .. a_BlockX .. ", " .. a_BlockY .. ", " .. a_BlockZ .. "}, face " .. a_BlockFace) + LOG(" HitPos: {" .. a_BlockHitPos.x .. ", " .. a_BlockHitPos.y .. ", " .. a_BlockHitPos.z .. "}") +end + + + + + +local PossibleItems = +{ + cItem(E_ITEM_DIAMOND), + cItem(E_ITEM_GOLD), + cItem(E_ITEM_IRON), + cItem(E_ITEM_DYE, 1, E_META_DYE_BLUE), -- Lapis lazuli + cItem(E_ITEM_COAL), +} + + + + + +function HandlePickups(a_Split, a_Player) + local PlayerX = a_Player:GetPosX() + local PlayerY = a_Player:GetPosY() + local PlayerZ = a_Player:GetPosZ() + local World = a_Player:GetWorld() + local Range = 12 + for x = 0, Range do for z = 0, Range do + local px = PlayerX + x - Range / 2 + local pz = PlayerZ + z - Range / 2 + local Items = cItems() + Items:Add(PossibleItems[math.random(#PossibleItems)]) + World:SpawnItemPickups(Items, px, PlayerY, pz, 0) + end end -- for z, for x + return true +end + + + + +function HandlePoof(a_Split, a_Player) + local PlayerPos = Vector3d(a_Player:GetPosition()) -- Create a copy of the position + PlayerPos.y = PlayerPos.y - 1 + local Box = cBoundingBox(PlayerPos, 4, 2) + local NumEntities = 0 + a_Player:GetWorld():ForEachEntityInBox(Box, + function (a_Entity) + if not(a_Entity:IsPlayer()) then + local AddSpeed = a_Entity:GetPosition() - PlayerPos -- Speed away from the player + a_Entity:AddSpeed(AddSpeed * 32 / (AddSpeed:SqrLength() + 1)) -- The further away, the less speed to add + NumEntities = NumEntities + 1 + end + end + ) + a_Player:SendMessage("Poof! (" .. NumEntities .. " entities)") + return true +end + + + + diff --git a/MCServer/Plugins/Handy b/MCServer/Plugins/Handy new file mode 160000 +Subproject e64a04be39ac7790abcb09de3d4c7d8fc2a2a1e diff --git a/MCServer/Plugins/Handy/handy.lua b/MCServer/Plugins/Handy/handy.lua deleted file mode 100644 index e4e9d3f5f..000000000 --- a/MCServer/Plugins/Handy/handy.lua +++ /dev/null @@ -1,28 +0,0 @@ --- Global variables -PLUGIN = {} -- Reference to own plugin object -CHEST_WIDTH = 9 -HANDY_VERSION = 2 ---[[ - -Handy is a plugin for other plugins. It contain no commands, no hooks, but functions to ease plugins developers' life. - -API: - - -TODO: -1. GetChestSlot wrapper, so it will detect double chest neighbour chest and will be able to access it. -]] - -function Initialize(Plugin) - PLUGIN = Plugin - PLUGIN:SetName("Handy") - PLUGIN:SetVersion(HANDY_VERSION) - - PluginManager = cRoot:Get():GetPluginManager() - LOG("Initialized " .. PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion()) - return true -end - -function OnDisable() - LOG(PLUGIN:GetName() .. " v" .. PLUGIN:GetVersion() .. " is shutting down...") -end
\ No newline at end of file diff --git a/MCServer/Plugins/Handy/handy_functions.lua b/MCServer/Plugins/Handy/handy_functions.lua deleted file mode 100644 index af43f663a..000000000 --- a/MCServer/Plugins/Handy/handy_functions.lua +++ /dev/null @@ -1,216 +0,0 @@ ---[[ -General stuff -]] --- Returns Handy plugin version number -function GetHandyVersion() - return HANDY_VERSION -end --- Checks if handy is in proper version -function CheckForRequiredVersion( inVersion ) - if( inVersion > HANDY_VERSION ) then return false end - return true -end ---[[ -MCS-specific _functions and nasty hacks :D -]] -function GetChestHeightCheat( inChest ) - local chestGrid = inChest:GetContents() - LOGINFO( "This function serves no purpose now! You should consider chest:GetContents():GetHeight() now!" ) - LOGINFO( "Also, you might find Handy's new 'IsChestDouble()' useful for your case" ) - return chestGrid:GetHeight() -end -function IsChestDouble( inChest ) - local chestHeight = inChest:GetContents():GetHeight() - if( chestHeight == 3 ) then - return false - end - return true -end --- Those two checks how many items of given inItemID chest and player have, and how much they could fit inside them -function ReadChestForItem( inChest, inItemID ) - return ReadGridForItems( inChest:GetContents(), inItemID ) -end -function ReadPlayerForItem( inPlayer, inItemID ) - local inventoryFound, inventoryFree = ReadGridForItems( inPlayer:GetInventory():GetInventoryGrid(), inItemID ) - local hotbarFound, hotbarFree = ReadGridForItems( inPlayer:GetInventory():GetHotbarGrid(), inItemID ) - local itemsFound = inventoryFound + hotbarFound - local freeSpace = inventoryFree + hotbarFree - return itemsFound, freeSpace -end --- Following functions are for chest-related operations --- BEWARE! Those assume you did checked if chest has items/space in it! -function ReadGridForItems( inGrid, inItemID ) - local itemsFound = 0 - local freeSpace = 0 - local slotsCount = inGrid:GetNumSlots() - local testerItem = cItem( inItemID ) - local maxStackSize = testerItem:GetMaxStackSize() - for index = 0, (slotsCount - 1) do - slotItem = inGrid:GetSlot( index ) - if( slotItem:IsEmpty() ) then - freeSpace = freeSpace + maxStackSize - else - if( slotItem:IsStackableWith( testerItem ) ) then - itemsFound = itemsFound + slotItem.m_ItemCount - freeSpace = maxStackSize - slotItem.m_ItemCount - end - end - end - return itemsFound, freeSpace -end - -function TakeItemsFromGrid( inGrid, inItem ) - local slotsCount = inGrid:GetNumSlots() - local removedItem = cItem( inItem ) - for index = 0, (slotsCount - 1) do - slotItem = inGrid:GetSlot( index ) - if( slotItem:IsSameType( removedItem ) ) then - if( slotItem.m_ItemCount <= removedItem.m_ItemCount ) then - removedItem.m_ItemCount = removedItem.m_ItemCount - slotItem.m_ItemCount - inGrid:EmptySlot( index ) - else - removedItem.m_ItemCount = slotItem.m_ItemCount - removedItem.m_ItemCount - inGrid:SetSlot( index, removedItem ) - removedItem.m_ItemCount = 0 - end - if( removedItem.m_ItemCount <= 0 ) then break end - end - end - return removedItem.m_ItemCount -end --------------- -function TakeItemsFromChest( inChest, inItemID, inAmount ) -- MIGHT BE UNSAFE! CHECK FOR ITEMS FIRST!! - local chestGrid = inChest:GetContents() - local removedItem = cItem( inItemID, inAmount ) - TakeItemsFromGrid( chestGrid, removedItem ) -end -function PutItemsToChest( inChest, inItemID, inAmount ) - local chestGrid = inChest:GetContents() - local addedItem = cItem( inItemID, inAmount ) - chestGrid:AddItem( addedItem ) -end --- Similar to chest-related. -function TakeItemsFromPlayer( inPlayer, inItemID, inAmount ) -- MIGHT BE UNSAFE! CHECK FIRST! - local removedItem = cItem( inItemID, inAmount ) - local inventoryGrid = inPlayer:GetInventory():GetInventoryGrid() - local hotbarGrid = inPlayer:GetInventory():GetHotbarGrid() - local itemsLeft = TakeItemsFromGrid( inventoryGrid, removedItem ) - if( itemsLeft > 0 ) then - removedItem = cItem( inItemID, itemsLeft ) - TakeItemsFromGrid( hotbarGrid, removedItem ) - end -end -function GiveItemsToPlayer( inPlayer, inItemID, inAmount ) - local addedItem = cItem( inItemID, inAmount ) - local inventoryGrid = inPlayer:GetInventory():GetInventoryGrid() - local hotbarGrid = inPlayer:GetInventory():GetHotbarGrid() - local itemsAdded = inventoryGrid:AddItem( addedItem ) - if( itemsAdded < inAmount ) then - addedItem.m_ItemCount = addedItem.m_ItemCount - itemsAdded - hotbarGrid:AddItem( addedItem ) - end -end --- This function returns item max stack for a given itemID. It uses vanilla max stack size, and uses several non-common items notations; --- Those are: --- oneonerecord( because aparently 11record wasn't the best idea in lua scripting application ) --- carrotonastick( because it wasn't added to items.txt yet ) --- waitrecord( for same reason ) --- Feel free to ignore the difference, or to add those to items.txt -function GetItemMaxStack( inItemID ) - local testerItem = cItem( inItemID ) - LOGINFO( "This function serves no real purpose now, maybe consider using cItem:GetMaxStackSize()?" ) - return testerItem:GetMaxStackSize() -end -function ItemIsArmor( inItemID, inCheckForHorseArmor ) - inCheckForHorseArmor = inCheckForHorseArmor or false - if( inItemID == E_ITEM_LEATHER_CAP ) then return true end - if( inItemID == E_ITEM_LEATHER_TUNIC ) then return true end - if( inItemID == E_ITEM_LEATHER_PANTS ) then return true end - if( inItemID == E_ITEM_LEATHER_BOOTS ) then return true end - - if( inItemID == E_ITEM_CHAIN_HELMET ) then return true end - if( inItemID == E_ITEM_CHAIN_CHESTPLATE ) then return true end - if( inItemID == E_ITEM_CHAIN_LEGGINGS ) then return true end - if( inItemID == E_ITEM_CHAIN_BOOTS ) then return true end - - if( inItemID == E_ITEM_IRON_HELMET ) then return true end - if( inItemID == E_ITEM_IRON_CHESTPLATE ) then return true end - if( inItemID == E_ITEM_IRON_LEGGINGS ) then return true end - if( inItemID == E_ITEM_IRON_BOOTS ) then return true end - - if( inItemID == E_ITEM_DIAMOND_HELMET ) then return true end - if( inItemID == E_ITEM_DIAMOND_CHESTPLATE ) then return true end - if( inItemID == E_ITEM_DIAMOND_LEGGINGS ) then return true end - if( inItemID == E_ITEM_DIAMOND_BOOTS ) then return true end - - if( inItemID == E_ITEM_GOLD_HELMET ) then return true end - if( inItemID == E_ITEM_GOLD_CHESTPLATE ) then return true end - if( inItemID == E_ITEM_GOLD_LEGGINGS ) then return true end - if( inItemID == E_ITEM_GOLD_BOOTS ) then return true end - - if( inCheckForHorseArmor ) then - if( inItemID == E_ITEM_IRON_HORSE_ARMOR ) then return true end - if( inItemID == E_ITEM_GOLD_HORSE_ARMOR ) then return true end - if( inItemID == E_ITEM_DIAMOND_HORSE_ARMOR ) then return true end - end - return false -end --- Returns full-length playername for a short name( usefull for parsing commands ) -function GetExactPlayername( inPlayerName ) - local _result = inPlayerName - local function SetProcessingPlayername( inPlayer ) - _result = inPlayer:GetName() - end - cRoot:Get():FindAndDoWithPlayer( inPlayerName, SetProcessingPlayername ) - return _result -end -function GetPlayerByName( inPlayerName ) - local _player - local PlayerSetter = function( Player ) - _player = Player - end - cRoot:Get():FindAndDoWithPlayer( inPlayerName, PlayerSetter ) - return _player -end ---[[ -Not-so-usual math _functions -]] --- Rounds floating point number. Because lua guys think this function doesn't deserve to be presented in lua's math -function round( inX ) - if( inX%2 ~= 0.5 ) then - return math.floor( inX + 0.5 ) - end - return inX - 0.5 -end ---[[ -Functions I use for filework and stringswork -]] -function PluralString( inValue, inSingularString, inPluralString ) - local _value_string = tostring( inValue ) - if( _value_string[#_value_string] == "1" ) then - return inSingularString - end - return inPluralString -end -function PluralItemName( inItemID, inAmount ) -- BEWARE! TEMPORAL SOLUTION THERE! :D - local _value_string = tostring( inValue ) - local _name = "" - if( _value_string[#_value_string] == "1" ) then - -- singular names - _name = ItemTypeToString( inItemID ) - else - -- plural names - _name = ItemTypeToString( inItemID ).."s" - end - return _name -end --- for filewriting purposes. 0 = false, 1 = true -function StringToBool( inValue ) - if( inValue == "1" ) then return true end - return false -end --- same, but reversal -function BoolToString( inValue ) - if( inValue == true ) then return 1 end - return 0 -end diff --git a/MCServer/Plugins/MagicCarpet b/MCServer/Plugins/MagicCarpet new file mode 160000 +Subproject 493f2dfa6d39f134e37c4c614cf8d6ffd10c825 diff --git a/MCServer/Plugins/MagicCarpet/objects.lua b/MCServer/Plugins/MagicCarpet/objects.lua deleted file mode 100644 index 8d81623a5..000000000 --- a/MCServer/Plugins/MagicCarpet/objects.lua +++ /dev/null @@ -1,97 +0,0 @@ --- Location object -cLocation = {} -function cLocation:new( x, y, z ) - local object = { x = x, y = y, z = z } - setmetatable(object, { __index = cLocation }) - return object -end - --- Offsets -cFibers = { } -function cFibers:new() - local object = { - cLocation:new( 2, -1, 2 ), - cLocation:new( 2, -1, 1 ), - cLocation:new( 2, -1, 0 ), - cLocation:new( 2, -1, -1 ), - cLocation:new( 2, -1, -2 ), - cLocation:new( 1, -1, 2 ), - cLocation:new( 1, -1, 1 ), - cLocation:new( 1, -1, 0 ), - cLocation:new( 1, -1, -1 ), - cLocation:new( 1, -1, -2 ), - cLocation:new( 0, -1, 2 ), - cLocation:new( 0, -1, 1 ), - cLocation:new( 0, -1, 0 ), - cLocation:new( 0, -1, -1 ), - cLocation:new( 0, -1, -2 ), - cLocation:new( -1, -1, 2 ), - cLocation:new( -1, -1, 1 ), - cLocation:new( -1, -1, 0 ), - cLocation:new( -1, -1, -1 ), - cLocation:new( -1, -1, -2 ), - cLocation:new( -2, -1, 2 ), - cLocation:new( -2, -1, 1 ), - cLocation:new( -2, -1, 0 ), - cLocation:new( -2, -1, -1 ), - cLocation:new( -2, -1, -2 ), - imadeit = false, - } - setmetatable(object, { __index = cFibers }) - return object; -end - --- Carpet object -cCarpet = {} -function cCarpet:new() - local object = { Location = cLocation:new(0,0,0), - Fibers = cFibers:new(), - } - setmetatable(object, { __index = cCarpet }) - return object -end - -function cCarpet:remove() - local World = cRoot:Get():GetDefaultWorld() - for i, fib in ipairs( self.Fibers ) do - local x = self.Location.x + fib.x - local y = self.Location.y + fib.y - local z = self.Location.z + fib.z - local BlockID = World:GetBlock( x, y, z ) - if( fib.imadeit == true and BlockID == E_BLOCK_GLASS ) then - World:SetBlock( x, y, z, 0, 0 ) - fib.imadeit = false - end - end -end - -function cCarpet:draw() - local World = cRoot:Get():GetDefaultWorld() - for i, fib in ipairs( self.Fibers ) do - local x = self.Location.x + fib.x - local y = self.Location.y + fib.y - local z = self.Location.z + fib.z - local BlockID = World:GetBlock( x, y, z ) - if( BlockID == 0 ) then - fib.imadeit = true - World:SetBlock( x, y, z, E_BLOCK_GLASS, 0 ) - else - fib.imadeit = false - end - end -end - -function cCarpet:moveTo( NewPos ) - local x = math.floor( NewPos.x ) - local y = math.floor( NewPos.y ) - local z = math.floor( NewPos.z ) - if( self.Location.x ~= x or self.Location.y ~= y or self.Location.z ~= z ) then - self:remove() - self.Location = cLocation:new( x, y, z ) - self:draw() - end -end - -function cCarpet:getY() - return self.Location.y -end
\ No newline at end of file diff --git a/MCServer/Plugins/MagicCarpet/plugin.lua b/MCServer/Plugins/MagicCarpet/plugin.lua deleted file mode 100644 index 417ea0e02..000000000 --- a/MCServer/Plugins/MagicCarpet/plugin.lua +++ /dev/null @@ -1,81 +0,0 @@ -local Carpets = {} -local PLUGIN - -function Initialize( Plugin ) - Plugin:SetName( "MagicCarpet" ) - Plugin:SetVersion( 2 ) - - cPluginManager.AddHook(cPluginManager.HOOK_PLAYER_MOVING, OnPlayerMoving) - cPluginManager.AddHook(cPluginManager.HOOK_PLAYER_DESTROYED, OnDisconnect) - - local PluginManager = cPluginManager:Get() - PluginManager:BindCommand("/mc", "magiccarpet", HandleCarpetCommand, " - Spawns a magical carpet"); - - PLUGIN = Plugin - - LOG( "Initialised " .. Plugin:GetName() .. " v." .. Plugin:GetVersion() ) - return true -end - - - - - -function OnDisable() - LOG( PLUGIN:GetName() .. " v." .. PLUGIN:GetVersion() .. " is shutting down..." ) - for i, Carpet in pairs( Carpets ) do - Carpet:remove() - end -end - - - - - -function HandleCarpetCommand( Split, Player ) - Carpet = Carpets[ Player ] - - if( Carpet == nil ) then - Carpets[ Player ] = cCarpet:new() - Player:SendMessageSuccess("You're on a magic carpet!") - Player:SendMessageInfo("Look straight down to descend. Jump to ascend.") - else - Carpet:remove() - Carpets[ Player ] = nil - Player:SendMessageSuccess("The carpet vanished!") - end - - return true -end - - - - - -function OnDisconnect( Reason, Player ) - local Carpet = Carpets[ Player ] - if( Carpet ~= nil ) then - Carpet:remove() - end - Carpets[ Player ] = nil -end - - - - - -function OnPlayerMoving(Player) - local Carpet = Carpets[ Player ] - if( Carpet == nil ) then - return - end - - if( Player:GetPitch() == 90 ) then - Carpet:moveTo( cLocation:new( Player:GetPosX(), Player:GetPosY() - 1, Player:GetPosZ() ) ) - else - if( Player:GetPosY() < Carpet:getY() ) then - Player:TeleportToCoords(Player:GetPosX(), Carpet:getY() + 0.2, Player:GetPosZ()) - end - Carpet:moveTo( cLocation:new( Player:GetPosX(), Player:GetPosY(), Player:GetPosZ() ) ) - end -end diff --git a/MCServer/Plugins/ProtectionAreas b/MCServer/Plugins/ProtectionAreas -Subproject 9edfee93048f214175cbed7eb2a3f77f7ac4abb +Subproject 7765048fa740b8f119db72a4ccc546504f86b2a diff --git a/MCServer/crafting.txt b/MCServer/crafting.txt index 60cda0673..8e68d5cb5 100644 --- a/MCServer/crafting.txt +++ b/MCServer/crafting.txt @@ -40,10 +40,12 @@ # Need to list each of the four log types, otherwise all logs would get converted into apple planks (^0) -ApplePlanks, 4 = AppleLog, * -ConiferPlanks, 4 = ConiferLog, * +OakPlanks, 4 = OakLog, * +SprucePlanks, 4 = SpruceLog, * BirchPlanks, 4 = BirchLog, * JunglePlanks, 4 = JungleLog, * +AcaciaPlanks, 4 = AcaciaLog, * +DarkOakPlanks, 4 = DarkOakLog, * Stick, 4 = Planks, 2:2, 2:3 Torch, 4 = Stick, 1:2 | Coal, 1:1 Workbench = Planks, 1:1, 1:2, 2:1, 2:2 @@ -59,36 +61,78 @@ Furnace = Cobblestone, 1:1, 1:2, 1:3, 2:1, 2:3, 3:1, 3:2, 3:3 #******************************************************# # Blocks # -IronBlock = IronIngot, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 -GoldBlock = GoldIngot, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 -DiamondBlock = Diamond, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 -LapisBlock = LapisLazuli, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 -EmeraldBlock = Emerald, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 -RedstoneBlock = RedstoneDust, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 -QuartzBlock = NetherQuartz, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 -NetherBrick = netherbrickitem, 1:1, 1:2, 2:1, 2:2 -Glowstone = GlowstoneDust, 1:1, 1:2, 2:1, 2:2 -Wool = String, 1:1, 1:2, 2:1, 2:2 -TNT = Gunpowder, 1:1, 3:1, 2:2, 1:3, 3:3 | Sand, 2:1, 1:2, 3:2, 2:3 -PillarQuartzBlock = QuartzSlab, 1:1, 1:2 -ChiseledQuartzBlock, 2 = QuartzBlock, 1:1, 1:2 -CoalBlock = Coal, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 -HayBale = Wheat, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +IronBlock = IronIngot, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +GoldBlock = GoldIngot, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +DiamondBlock = Diamond, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +LapisBlock = LapisLazuli, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +EmeraldBlock = Emerald, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +RedstoneBlock = RedstoneDust, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +CoalBlock = Coal, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +QuartzBlock = NetherQuartz, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +NetherBrick = netherbrickitem, 1:1, 1:2, 2:1, 2:2 +Glowstone = GlowstoneDust, 1:1, 1:2, 2:1, 2:2 +Wool = String, 1:1, 1:2, 2:1, 2:2 +TNT = Gunpowder, 1:1, 3:1, 2:2, 1:3, 3:3 | Sand, 2:1, 1:2, 3:2, 2:3 +PillarQuartzBlock = QuartzSlab, 1:1, 1:2 +ChiseledQuartzBlock, 2 = QuartzBlock, 1:1, 1:2 +CoalBlock = Coal, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +HayBale = Wheat, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +SnowBlock = SnowBall, 1:1, 1:2, 2:1, 2:2 +ClayBlock = Clay, 1:1, 1:2, 2:1, 2:2 +BrickBlock = Brick, 1:1, 1:2, 2:1, 2:2 +StoneBrick, 4 = Stone, 1:1, 1:2, 2:1, 2:2 +BookShelf = Planks, 1:1, 2:1, 3:1, 1:3, 2:3, 3:3 | Book, 1:2, 2:2, 3:2 +Sandstone, 4 = Sand, 1:1, 1:2, 2:1, 2:2 +SmoothSandstone, 4 = Sandstone, 1:1, 1:2, 2:1, 2:2 +OrnamentSandstone = SandstoneSlab, 1:1, 1:2 +JackOLantern = Pumpkin, 1:1 | Torch, 1:2 +PolishedGranite, 4 = Granite, 1:1, 1:2, 2:1, 2:2 +PolishedDiorite, 4 = Diorite, 1:1, 1:2, 2:1, 2:2 +PolishedAndesite, 4 = Andesite, 1:1, 1:2, 2:1, 2:2 +CoarsedDirt, 4 = Dirt, 1:1, 2:2 | Gravel, 1:2, 2:1 +CoarsedDirt, 4 = Gravel, 1:1, 2:2 | Dirt, 1:2, 2:1 +SlimeBlock = Slimeball, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +Prismarine = PrismarineShard, 1:1, 1:2, 2:1, 2:2 +PrismarineBricks = PrismarineShard, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 +DarkPrismarine = PrismarineShard, 1:1, 1:2, 1:3, 2:1, 2:3, 3:1, 3:2, 3:3 | Inksac, 2:2 +SeaLantern = PrismarineShard, 1:1, 1:3, 3:1, 3:3 | PrismarineCrystals, 1:2, 2:1, 2:2, 2:3, 3:2 +RedSandstone, 4 = RedSand, 1:1, 1:2, 2:1, 2:2 +ChiseledRedSandstone, 4 = RedSandstoneSlab, 1:1, 1:2 +SmoothRedSandstone, 4 = RedSand, 1:1, 1:2, 2:1, 2:2 +MossyStoneBrick = Stonebrick, * | Vines, * +Leather = RabbitHide, 1:1, 1:2, 2:1, 2:2 # Slabs: StoneSlab, 6 = Stone, 1:1, 2:1, 3:1 SandstoneSlab, 6 = Sandstone, 1:1, 2:1, 3:1 -WoodSlab, 6 = Planks, 1:1, 2:1, 3:1 +SpruceWoodSlab, 6 = SprucePlanks, 1:1, 2:1, 3:1 +BirchWoodSlab, 6 = BirchPlanks, 1:1, 2:1, 3:1 +JungleWoodSlab, 6 = JunglePlanks, 1:1, 2:1, 3:1 +AcaciaWoodSlab, 6 = AcaciaPlanks, 1:1, 2:1, 3:1 +DarkOakWoodSlab, 6 = DarkOakPlanks, 1:1, 2:1, 3:1 +OakWoodSlab, 6 = OakPlanks, 1:1, 2:1, 3:1 CobblestoneSlab, 6 = Cobblestone, 1:1, 2:1, 3:1 BrickSlab, 6 = BrickBlock, 1:1, 2:1, 3:1 StonebrickSlab, 6 = StoneBrick, 1:1, 2:1, 3:1 NetherbrickSlab, 6 = NetherBrick, 1:1, 2:1, 3:1 Quartzslab, 6 = QuartzBlock, 1:1, 2:1, 3:1 -snow, 6 = SnowBlock, 1:1, 2:1, 3:1 +snow, 6 = SnowBlock, 1:1, 2:1, 3:1 +RedSandstoneSlab, 6 = RedSandstone, 1:1, 2:1, 3:1 + # Stairs: -WoodStairs, 4 = Planks, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 -WoodStairs, 4 = Planks, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 +SpruceWoodStairs, 4 = SprucePlanks, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 +SpruceWoodStairs, 4 = SprucePlanks, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 +BirchWoodStairs, 4 = BirchPlanks, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 +BirchWoodStairs, 4 = BirchPlanks, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 +JungleWoodStairs, 4 = JunglePlanks, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 +JungleWoodStairs, 4 = JunglePlanks, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 +AcaciaWoodStairs, 4 = AcaciaPlanks, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 +AcaciaWoodStairs, 4 = AcaciaPlanks, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 +DarkOakWoodStairs, 4 = DarkOakPlanks, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 +DarkOakWoodStairs, 4 = DarkOakPlanks, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 +WoodStairs, 4 = OakPlanks, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 +WoodStairs, 4 = OakPlanks, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 cobblestoneStairs, 4 = Cobblestone, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 cobblestoneStairs, 4 = Cobblestone, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 BrickStairs, 4 = BrickBlock, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 @@ -101,18 +145,8 @@ quartzstairs, 4 = QuartzBlock, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 quartzstairs, 4 = QuartzBlock, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 StoneBrickStairs, 4 = StoneBrick, 1:1, 1:2, 2:2, 1:3, 2:3, 3:3 StoneBrickStairs, 4 = StoneBrick, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 -SnowBlock = SnowBall, 1:1, 1:2, 2:1, 2:2 -ClayBlock = Clay, 1:1, 1:2, 2:1, 2:2 -BrickBlock = Brick, 1:1, 1:2, 2:1, 2:2 -StoneBrick, 4 = Stone, 1:1, 1:2, 2:1, 2:2 -BookShelf = Planks, 1:1, 2:1, 3:1, 1:3, 2:3, 3:3 | Book, 1:2, 2:2, 3:2 -Sandstone, 4 = Sand, 1:1, 1:2, 2:1, 2:2 -SmoothSandstone, 4 = Sandstone, 1:1, 1:2, 2:1, 2:2 -OrnamentSandstone = SandstoneSlab, 1:1, 1:2 -JackOLantern = Pumpkin, 1:1 | Torch, 1:2 - -# Other -Carpet = Wool, 1:3, 2:3 +RedSandstoneStairs, 4 = RedSandstone, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 +RedSandstoneStairs, 4 = RedSandstone, 3:1, 2:2, 3:2, 1:3, 2:3, 3:3 @@ -244,11 +278,19 @@ ActivatorRail, 6 = IronIngot, 1:1, 1:2, 1:3, 3:1, 3:2, 3:3 | Stick, 2:1, 2:3 | R #******************************************************# # Mechanisms # -WoodenDoor = Planks, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3 -IronDoor = IronIngot, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3 +WoodenDoor, 3 = OakPlanks, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3 +SpruceDoor, 3 = SprucePlanks, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3 +BirchDoor, 3 = BirchPlanks, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3 +JungleDoor, 3 = JunglePlanks, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3 +AcaciaDoor, 3 = AcaciaPlanks, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3 +DarkOakDoor, 3 = DarkOakPlanks, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3 +IronDoor, 3 = IronIngot, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3 TrapDoor, 2 = Planks, 1:1, 2:1, 3:1, 1:2, 2:2, 3:2 +IronTrapDoor = IronIngot, 1:1, 1:2, 2:1, 2:2 WoodPlate = Planks, 1:1, 2:1 StonePlate = Stone, 1:1, 2:1 +lightweightedpressureplate = IronIngot, 1:1, 2:1 +heavyweightedpressureplate = GoldIngot, 1:1, 2:1 StoneButton = Stone, 1:1 WoodenButton = Planks, 1:1 RedstoneTorchOn = Stick, 1:2 | RedstoneDust, 1:1 @@ -286,6 +328,8 @@ MelonSeeds = MelonSlice, * PumpkinSeeds, 4 = Pumpkin, * PumpkinPie = Pumpkin, * | Sugar, * | egg, * Wheat, 9 = Haybale, * +RabbitStew = Cooked Rabbit, 2:1 | Carrot, 1:2 | BakedPotato, 2:2 | BrownMushroom, 3:2 | Bowl, 2:3 +RabbitStew = Cooked Rabbit, 2:1 | Carrot, 1:2 | BakedPotato, 2:2 | RedMushroom, 3:2 | Bowl, 2:3 @@ -304,27 +348,60 @@ Emerald, 9 = EmeraldBlock, * RedstoneDust, 9 = RedstoneBlock, * Coal, 9 = CoalBlock, * Clay, 4 = ClayBlock, * +SlimeBall, 9 = SlimeBlock, * Painting = Stick, 1:1, 1:2, 1:3, 2:1, 2:3, 3:1, 3:2, 3:3 | Wool, 2:2 ItemFrame = Stick, 1:1, 1:2, 1:3, 2:1, 2:3, 3:1, 3:2, 3:3 | Leather, 2:2 -Sign = Planks, 1:1, 2:1, 3:1, 1:2, 2:2, 3:2 | Stick, 2:3 +Sign, 3 = Planks, 1:1, 2:1, 3:1, 1:2, 2:2, 3:2 | Stick, 2:3 Ladder, 3 = Stick, 1:1, 3:1, 1:2, 2:2, 3:2, 1:3, 3:3 GlassPane, 16 = Glass, 1:1, 2:1, 3:1, 1:2, 2:2, 3:2 IronBars, 16 = IronIngot, 1:1, 2:1, 3:1, 1:2, 2:2, 3:2 Paper, 3 = Sugarcane, 1:1, 2:1, 3:1 Book = Paper, *, *, * | leather, * Bookandquill = Book, * | feather, * | inksac, * -Fence, 2 = Stick, 1:1, 2:1, 3:1, 1:2, 2:2, 3:2 +Fence, 3 = OakPlanks, 1:1, 1:2, 3:1, 3:2 | Stick, 2:1, 2:2 +SpruceFence, 3 = SprucePlanks, 1:1, 1:2, 3:1, 3:2 | Stick, 2:1, 2:2 +BirchFence, 3 = BirchPlanks, 1:1, 1:2, 3:1, 3:2 | Stick, 2:1, 2:2 +JungleFence, 3 = JunglePlanks, 1:1, 1:2, 3:1, 3:2 | Stick, 2:1, 2:2 +DarkOakFence, 3 = DarkOakPlanks, 1:1, 1:2, 3:1, 3:2 | Stick, 2:1, 2:2 +AcaciaFence, 3 = AcaciaPlanks, 1:1, 1:2, 3:1, 3:2 | Stick, 2:1, 2:2 Cobblestonewall, 6 = cobblestone, 1:2, 1:3, 2:2, 2:3, 3:2, 3:3 mossycobblestonewall, 6 = mossycobblestone, 1:2, 1:3, 2:2, 2:3, 3:2, 3:3 NetherBrickFence, 6 = NetherBrick, 1:1, 2:1, 3:1, 1:2, 2:2, 3:2 -FenceGate = Stick, 1:1, 1:2, 3:1, 3:2 | Planks, 2:1, 2:2 +FenceGate = Stick, 1:1, 1:2, 3:1, 3:2 | OakPlanks, 2:1, 2:2 +SpruceFenceGate = Stick, 1:1, 1:2, 3:1, 3:2 | SprucePlanks, 2:1, 2:2 +BirchFenceGate = Stick, 1:1, 1:2, 3:1, 3:2 | BirchPlanks, 2:1, 2:2 +JungleFenceGate = Stick, 1:1, 1:2, 3:1, 3:2 | JunglePlanks, 2:1, 2:2 +DarkOakFenceGate = Stick, 1:1, 1:2, 3:1, 3:2 | DarkOakPlanks, 2:1, 2:2 +AcaciaFenceGate = Stick, 1:1, 1:2, 3:1, 3:2 | AcaciaPlanks, 2:1, 2:2 Bed = Planks, 1:2, 2:2, 3:2 | Wool, 1:1, 2:1, 3:1 GoldIngot = GoldNugget, 1:1, 1:2, 1:3, 2:1, 2:2, 2:3, 3:1, 3:2, 3:3 EyeOfEnder = EnderPearl, * | BlazePowder, * Beacon = Glass, 1:1, 1:2, 2:1, 3:1, 3:2 | Obsidian, 1:3, 2:3, 3:3 | NetherStar, 2:2 Anvil = IronBlock, 1:1, 2:1, 3:1 | IronIngot, 2:2, 1:3, 2:3, 3:3 FlowerPot = Brick, 1:2, 2:3, 3:2 +ArmorStand = Stick, 1:1, 1:3, 2:1, 2:2, 3:1, 3:3 | StoneSlab, 2:3 + +# These are just the basic ones, you can add various shapes and stuff to each of them +# ToDo: Add the various shapes (saved in NBT-Tags, not in meta) +# Banners: + +WhiteBanner = Stick, 2:3 | WhiteWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +OrangeBanner = Stick, 2:3 | OrangeWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +MagentaBanner = Stick, 2:3 | MagentaWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +LightBlueBanner = Stick, 2:3 | LightBlueWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +YellowBanner = Stick, 2:3 | YellowWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +LimeBanner = Stick, 2:3 | LimeWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +PinkBanner = Stick, 2:3 | PinkWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +GrayBanner = Stick, 2:3 | GrayWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +LightGrayBanner = Stick, 2:3 | LightGrayWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +CyanBanner = Stick, 2:3 | CyanWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +PurpleBanner = Stick, 2:3 | PurpleWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +BlueBanner = Stick, 2:3 | BlueWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +BrownBanner = Stick, 2:3 | BrownWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +GreenBanner = Stick, 2:3 | GreenWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +RedBanner = Stick, 2:3 | RedWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 +BlackBanner = Stick, 2:3 | BlackWool, 1:1, 1:2, 2:1, 2:2, 2:1, 2:2 @@ -373,13 +450,30 @@ PinkWool = Wool, * | PinkDye, * GrayWool = Wool, * | GrayDye, * LightGrayWool = Wool, * | LightGrayDye, * CyanWool = Wool, * | CyanDye, * -VioletWool = Wool, * | VioletDye, * +PurpleWool = Wool, * | PurpleDye, * BlueWool = Wool, * | BlueDye, * BrownWool = Wool, * | BrownDye, * GreenWool = Wool, * | GreenDye, * RedWool = Wool, * | RedDye, * BlackWool = Wool, * | BlackDye, * +WhiteCarpet, 3 = WhiteWool, 1:1, 2:1 +OrangeCarpet, 3 = OrangeWool, 1:1, 2:1 +MagentaCarpet, 3 = MagentaWool, 1:1, 2:1 +LightBlueCarpet, 3 = LightBlueWool, 1:1, 2:1 +YellowCarpet, 3 = YellowWool, 1:1, 2:1 +LimeCarpet, 3 = LimeWool, 1:1, 2:1 +PinkCarpet, 3 = PinkWool, 1:1, 2:1 +GrayCarpet, 3 = GrayWool, 1:1, 2:1 +LightGrayCarpet, 3 = LightGrayWool, 1:1, 2:1 +CyanCarpet, 3 = CyanWool, 1:1, 2:1 +PurpleCarpet, 3 = PurpleWool, 1:1, 2:1 +BlueCarpet, 3 = BlueWool, 1:1, 2:1 +BrownCarpet, 3 = BrownWool, 1:1, 2:1 +GreenCarpet, 3 = GreenWool, 1:1, 2:1 +RedCarpet, 3 = RedWool, 1:1, 2:2 +BlackCarpet, 3 = BlackWool, 1:1, 2:1 + #******************************************************# # Stained Glass: # diff --git a/MCServer/furnace.txt b/MCServer/furnace.txt index d6177184b..0c12a798d 100644 --- a/MCServer/furnace.txt +++ b/MCServer/furnace.txt @@ -10,25 +10,28 @@ # An Item is defined by an Item Type, an amount (and damage) # The damage is optional, and if not specified it's assumed to be 0 # -# -Cactus Green: -# 351 : 1 ( : 2 ) -# ItemType : Amount ( : Damage ) +# Cactus Green example: +# 351 : 2 ( , 1 ) +# ItemType : Damage ( , Amount ) +# or simple use the item name (marked in items.ini): +# CactusGreen ( , 1 ) # # # **** Recipe and result **** # -# 4:1@200=1:1 -> Produces 1 smooth stone from 1 cobblestone in 200 ticks (10 seconds) +# Cobble @ 200 = Stone -> Produces 1 smooth stone from 1 cobblestone in 200 ticks (10 seconds) # -# 4 : 1 @ 200 = 1 : 1 -# ItemType : Amount @ ticks = ItemID : Amount +# Write in full: +# Cobble : 0 , 1 @ 200 = 1 : 1 , 1 +# ItemType : Damage , Amount @ ticks = ItemType : Damage , Amount # # # **** Fuel **** # # !17:1 = 300 -> 1 Wood burns for 300 ticks (15 s) # -# ! 17 : 1 = 300 -# Fuel ItemType : Amount = ticks +# ! Wood , 1 = 300 +# Fuel ItemType , Amount = ticks # #******************************************************# @@ -39,20 +42,24 @@ #-------------------------- # Smelting recipes -4:1 @ 200 = 1:1 # 1 Cobblestone -> 1 Rock -15:1 @ 200 = 265:1 # 1 Iron Ore -> 1 Iron Ingot -14:1 @ 200 = 266:1 # 1 Gold Ore -> 1 Gold Ingot -153:1 @ 200 = 406:1 # 1 Quartz Ore -> 1 Quartz -12:1 @ 200 = 20:1 # 1 Sand -> 1 Glass -319:1 @ 200 = 320:1 # 1 Raw Pork -> 1 Cooked Pork -363:1 @ 200 = 364:1 # 1 Raw Beef -> 1 Cooked Beef (steak) -365:1 @ 200 = 366:1 # 1 Raw Chicken -> 1 Cooked Chicken -337:1 @ 200 = 336:1 # 1 Clay -> 1 Clay Brick -82:1 @ 200 = 172:1 # 1 Clay Block -> 1 Hardened Clay -87:1 @ 200 = 405:1 # 1 NetherRack -> 1 NetherBrick -349:1 @ 200 = 350:1 # 1 Raw Fish -> 1 Cooked Fish -17:1 @ 200 = 263:1:1 # 1 Log -> 1 Charcoal -81:1 @ 200 = 351:1:2 # 1 Cactus -> 1 Green Dye +Cobble = Stone +IronOre = IronIngot +GoldOre = GoldIngot +NetherQuartzOre = NetherQuartz +Sand = Glass +Pork = CookedPork +RawBeef = Steak +RawChicken = CookedChicken +Clay = Brick +ClayBlock = HardenedClay +TallGrass = NetherBrickItem +RawFish = CookedFish +Log = CharCoal +Cactus = GreenDye +WetSponge = Sponge +Stonebrick = CrackedStonebrick +RawRabbit = CookedRabbit +RawMutton = CookedMutton @@ -61,31 +68,41 @@ #-------------------------- # Fuels -! 263:1 = 1600 # 1 Coal -> 80 sec -! 263:1:1 = 1600 # 1 Charcoal -> 80 sec -! 126:1 = 15 # 1 Halfslab -> 7.5 sec -! 5:1 = 300 # 1 Planks -> 15 sec -! 280:1 = 100 # 1 Stick -> 5 sec -! 85:1 = 300 # 1 Fence -> 15 sec -! 53:1 = 300 # 1 Wooden Stairs -> 15 sec -! 58:1 = 300 # 1 Crafting Table -> 15 sec -! 47:1 = 300 # 1 Bookshelf -> 15 sec -! 54:1 = 300 # 1 Chest -> 15 sec -! 84:1 = 300 # 1 Jukebox -> 15 sec -! 327:1 = 20000 # 1 Lava Bucket -> 1000 sec -! 17:1 = 300 # 1 Wood -> 15 sec -! 6:1 = 100 # 1 Sapling -> 5 sec -! 173:1 = 16000 # 1 Coal Block -> 800 sec -! 369:1 = 2400 # 1 Blaze Rod -> 120 sec -! 25:1 = 300 # 1 Note Block -> 15 sec -! 151:1 = 300 # 1 Daylight Sensor -> 15 sec -! 107:1 = 300 # 1 Fence Gate -> 15 sec -! 167:1 = 300 # 1 Trapdoor -> 15 sec -! 146:1 = 300 # 1 Trapped Chest -> 15 sec -! 72:1 = 300 # 1 Pressure Plate -> 15 sec -! 270:1 = 200 # 1 Wooden Pickaxe -> 10 sec -! 271:1 = 200 # 1 Wooden Axe -> 10 sec -! 269:1 = 200 # 1 Wooden Shovel -> 10 sec -! 290:1 = 200 # 1 Wooden Hoe -> 10 sec -! 268:1 = 200 # 1 Wooden Sword -> 10 sec +! CharCoal = 1600 # -> 80 sec +! Coal = 1600 # -> 80 sec +! WoodenSlab = 15 # -> 7.5 sec +! Planks = 300 # -> 15 sec +! Stick = 100 # -> 5 sec +! Fence = 300 # -> 15 sec +! SpruceFence = 300 # -> 15 sec +! BirchFence = 300 # -> 15 sec +! JungleFence = 300 # -> 15 sec +! DarkOakFence = 300 # -> 15 sec +! AcaciaFence = 300 # -> 15 sec +! WoodStairs = 300 # -> 15 sec +! Workbench = 300 # -> 15 sec +! Bookshelf = 300 # -> 15 sec +! Chest = 300 # -> 15 sec +! Jukebox = 300 # -> 15 sec +! Lavabucket = 20000 # -> 1000 sec +! Log = 300 # -> 15 sec +! Sapling = 100 # -> 5 sec +! CoalBlock = 16000 # -> 800 sec +! BlazeRod = 2400 # -> 120 sec +! NoteBlock = 300 # -> 15 sec +! DaylightSensor = 300 # -> 15 sec +! FenceGate = 300 # -> 15 sec +! SpruceFenceGate = 300 # -> 15 sec +! BirchFenceGate = 300 # -> 15 sec +! JungleFenceGate = 300 # -> 15 sec +! DarkOakFenceGate = 300 # -> 15 sec +! Trapdoor = 300 # -> 15 sec +! TrappedChest = 300 # -> 15 sec +! WoodPlate = 300 # -> 15 sec +! WoodPickaxe = 200 # -> 10 sec +! WoodAxe = 200 # -> 10 sec +! WoodShovel = 200 # -> 10 sec +! WoodHoe = 200 # -> 10 sec +! WoodSword = 200 # -> 10 sec + diff --git a/MCServer/items.ini b/MCServer/items.ini index 7b8fcf4ee..daf366654 100644 --- a/MCServer/items.ini +++ b/MCServer/items.ini @@ -1,77 +1,99 @@ [Items] air=0 -rock=1 stone=1 +rock=1 +granite=1:1 +polishedgranite=1:2 +diorite=1:3 +polisheddiorite=1:4 +andesite=1:5 +polishedandesite=1:6 grass=2 dirt=3 +coarseddirt=3:1 +podzol=3:2 cobblestone=4 cobble=4 planks=5 -appleplanks=5:0 oakplanks=5:0 +appleplanks=5:0 +spruceplanks=5:1 coniferplanks=5:1 pineplanks=5:1 -spruceplanks=5:1 darkplanks=5:1 birchplanks=5:2 lightplanks=5:2 jungleplanks=5:3 redplanks=5:3 - -; Obsolete: do not use "wood", as its meaning is not clear - wiki uses log as wood, we use planks as wood. -wood=5 - +acaciaplanks=5:4 +darkoakplanks=5:5 +bigoakplanks=5:5 +roofedoakplanks=5:5 sapling=6 -applesapling=6:0 oaksapling=6:0 +applesapling=6:0 +sprucesapling=6:1 conifersapling=6:1 pinesapling=6:1 -sprucesapling=6:1 +darkplanks=6:1 birchsapling=6:2 +whitesapling=6:2 junglesapling=6:3 -adminium=7 +redsapling=6:3 +acaciasapling=6:4 +darkoaksapling=6:5 +bigoaksapling=6:5 +roofedoaksapling=6:5 bedrock=7 +adminium=7 water=8 +flowingwater=8 +stationarywater=9 stillwater=9 swater=9 -stationarywater=9 lava=10 +flowinglava=10 +stationarylava=11 stilllava=11 slava=11 -stationarylava=11 sand=12 +redsand=12:1 gravel=13 goldore=14 ironore=15 coalore=16 -tree=17 log=17 -applelog=17:0 +tree=17 oaklog=17:0 +applelog=17:0 +sprucelog=17:1 coniferlog=17:1 pinelog=17:1 -sprucelog=17:1 darklog=17:1 birchlog=17:2 whitelog=17:2 junglelog=17:3 leaves=18 -appleleaves=18:0 oakleaves=18:0 +appleleaves=18:0 +spruceleaves=18:1 coniferleaves=18:1 pineleaves=18:1 -spruceleaves=18:1 +darkleaves=18:1 birchleaves=18:2 +whiteleaves=18:2 jungleleaves=18:3 sponge=19 +wetsponge=19:1 glass=20 lapisore=21 lapisblock=22 dispenser=23 sandstone=24 normalsandstone=24:0 -ornamentsandstone=24:1 +chiseledsandstone=24:1 decorativesandstone=24:1 +ornamentsandstone=24:1 smoothsandstone=24:2 noteblock=25 bedblock=26 @@ -86,14 +108,16 @@ deadbush=32 piston=33 pistonextension=34 pistonhead=34 -cloth=35 wool=35 +cloth=35 whitewool=35:0 orangewool=35:1 magentawool=35:2 lightbluewool=35:3 +ltbluewool=35:3 yellowwool=35:4 limewool=35:5 +ltbluewool=35:3 lightgreenwool=35:5 ltgreenwool=35:5 pinkwool=35:6 @@ -107,11 +131,13 @@ lightgraywool=35:8 lightgreywool=35:8 ltgraywool=35:8 ltgreywool=35:8 +silverwool=35:8 cyanwool=35:9 purplewool=35:10 violetwool=35:10 bluewool=35:11 darkbluewool=35:11 +dkbluewool=35:11 brownwool=35:12 greenwool=35:13 darkgreenwool=35:13 @@ -119,14 +145,12 @@ dkgreenwool=35:13 redwool=35:14 blackwool=35:15 dandelion=37 - -; Renamed in 1.7, use "poppy" instead; kept for compatibility reasons, will be removed later on. +poppy=38 rose=38 - flower=38 -poppy=38 blueorchid=38:1 allium=38:2 +azurebluet=38:3 redtulip=38:4 orangetulip=38:5 whitetulip=38:6 @@ -134,11 +158,12 @@ pinktulip=38:7 oxeyedaisy=38:8 brownmushroom=39 redmushroom=40 -gold=41 goldblock=41 -iron=42 +gold=41 ironblock=42 +iron=42 doubleslab=43 +doublestep=43 stonedoubleslab=43:0 sandstonedoubleslab=43:1 wooddoubleslab=43:2 @@ -168,18 +193,19 @@ obsidian=49 torch=50 fire=51 mobspawner=52 +oakwoodstairs=53 woodstairs=53 chest=54 -redstonedust=55 redstonewire=55 +redstonedust=55 diamondore=56 diamondblock=57 workbench=58 crop=59 crops=59 -soil=60 farmland=60 tilleddirt=60 +soil=60 furnace=61 litfurnace=62 signblock=63 @@ -191,11 +217,11 @@ track=66 tracks=66 cobblestonestairs=67 stairs=67 -signblocktop=68 wallsign=68 +signblocktop=68 lever=69 -rockplate=70 stoneplate=70 +rockplate=70 irondoorblock=71 woodplate=72 redstoneore=73 @@ -212,13 +238,13 @@ reedblock=83 jukebox=84 fence=85 pumpkin=86 -netherstone=87 netherrack=87 hellrock=87 -slowsand=88 +netherstone=87 soulsand=88 -lightstone=89 +slowsand=88 glowstone=89 +lightstone=89 portal=90 jackolantern=91 jacko=91 @@ -227,22 +253,39 @@ whitestainedglass=95 orangestainedglass=95:1 magentastainedglass=95:2 lightbluestainedglass=95:3 +ltbluestainedglass=95:3 yellowstainedglass=95:4 limestainedglass=95:5 +lightgreenstainedglass=95:5 +ltgreenstainedglass=95:5 pinkstainedglass=95:6 graystainedglass=95:7 +greystainedglass=95:7 +darkgraystainedglass=95:7 +darkgreystainedglass=95:7 +dkgraystainedglass=95:7 +dkgreystainedglass=95:7 lightgraystainedglass=95:8 +lightgreystainedglass=95:8 +ltgraystainedglass=95:8 +ltgreystainedglass=95:8 +silverstainedglass=95:8 cyanstainedglass=95:9 +purplestainedglass=95:10 violetstainedglass=95:10 bluestainedglass=95:11 +darkbluestainedglass=95:11 +dkbluestainedglass=95:11 brownstainedglass=95:12 greenstainedglass=95:13 +darkgreenstainedglass=95:13 +dkgreenstainedglass=95:13 redstainedglass=95:14 blackstainedglass=95:15 trapdoor=96 silverfishblock=97 -stonebricks=98 stonebrick=98 +stonebricks=98 mossystonebrick=98:1 crackedstonebrick=98:2 chiseledstonebrick=98:3 @@ -272,15 +315,50 @@ endstone=121 dragonegg=122 redstonelamp=123 redstonelampoff=123 +litredstonelamp=124 redstonelampon=124 woodendoubleslab=125 +oakwooddoubleslab=125:0 +appledoublewoodslab=125:0 +sprucewooddoubleslab=125:1 +coniferwooddoubleslab=125:1 +pinewooddoubleslab=125:1 +darkwooddoubleslab=125:1 +birchwooddoubleslab=125:2 +whitewooddoubleslab=125:2 +junglewooddoubleslab=125:3 +acaciawooddoubleslab=125:4 +darkoakwooddoubleslab=125:5 +bigoakwooddoubleslab=125:5 +roofedwooddoubleslab=125:5 woodenslab=126 +oakwoodslab=126:0 +applewoodslab=126:0 +sprucewoodslab=126:1 +coniferwoodslab=126:1 +pinewoodslab=126:1 +darkwoodslab=126:1 +birchwoodslab=126:2 +whitewoodslab=126:2 +junglewoodslab=126:3 +acaciawoodslab=126:4 +darkoakwoodslab=126:5 +roofedwoodslab=126:5 +bigoakwoodslab=126:5 +cocoabeans=127 sandstonestairs=128 emeraldore=129 enderchest=130 tripwirehook=131 tripwire=132 emeraldblock=133 +sprucewoodstairs=134 +coniferwoodstairs=134 +pinewoodstairs=134 +darkwoodstairs=134 +birchwoodstairs=135 +whitewoodstairs=135 +junglewoodstairs=136 commandblock=137 beacon=138 cobblestonewall=139 @@ -292,6 +370,7 @@ woodenbutton=143 skeletonhead=144 witherhead=144:1 zombiehead=144:2 +playerhead=144:3 humanhead=144:3 stevehead=144:3 creeperhead=144:4 @@ -315,40 +394,162 @@ whitestainedclay=159 orangestainedclay=159:1 magentastainedclay=159:2 lightbluestainedclay=159:3 +ltbluestainedclay=159:3 yellowstainedclay=159:4 limestainedclay=159:5 +lightgreenstainedclay=159:5 +ltgreenstainedclay=159:5 pinkstainedclay=159:6 graystainedclay=159:7 +greystainedclay=159:7 +darkgraystainedclay=159:7 +darkgreystainedclay=159:7 +dkgraystainedclay=159:7 +dkgreystainedclay=159:7 lightgraystainedclay=159:8 +lightgreystainedclay=159:8 +ltgraystainedclay=159:8 +ltgreystainedclay=159:8 +silverstainedclay=159:8 cyanstainedclay=159:9 +purplestainedclay=159:10 violetstainedclay=159:10 bluestainedclay=159:11 +darkbluestainedclay=159:11 +dkbluestainedclay=159:11 brownstainedclay=159:12 greenstainedclay=159:13 +darkgreenstainedclay=159:13 +dkgreenstainedclay=159:13 redstainedclay=159:14 blackstainedclay=159:15 whitestainedglasspane=160 orangestainedglasspane=160:1 magentastainedglasspane=160:2 lightbluestainedglasspane=160:3 +ltbluestainedglasspane=160:3 yellowstainedglasspane=160:4 limestainedglasspane=160:5 +lightgreenstainedglasspane=160:5 +ltgreenstainedglasspane=160:5 pinkstainedglasspane=160:6 graystainedglasspane=160:7 +greystainedglasspane=160:7 +darkgraystainedglasspane=160:7 +darkgreystainedglasspane=160:7 +dkgraystainedglasspane=160:7 +dkgreystainedglasspane=160:7 lightgraystainedglasspane=160:8 +lightgreystainedglasspane=160:8 +ltgraystainedglasspane=160:8 +ltgreystainedglasspane=160:8 +silverstainedglasspane=160:8 cyanstainedglasspane=160:9 +purplestainedglasspane=160:10 violetstainedglasspane=160:10 bluestainedglasspane=160:11 +darkbluestainedglasspane=160:11 +dkbluestainedglasspane=160:11 brownstainedglasspane=160:12 greenstainedglasspane=160:13 +darkgreenstainedglasspane=160:13 +dkgreenstainedglasspane=160:13 redstainedglasspane=160:14 blackstainedglasspane=160:15 -acaciawood=162 -darkoakwood=162:1 -acaciawoodenstairs=163 -darkoakwoodenstairs=164 +newleaves=161 +acacialeaves=161:0 +darkoakleaves=161:1 +bigoakleaves=161:1 +roofedoakleaves=161:1 +newlog=162 +acacialog=162:0 +darkoaklog=162:1 +bigoaklog=162:1 +roofedoaklog=162:1 +acaciawoodstairs=163 +darkoakwoodstairs=164 +bigoakwoodstiars=164 +roofedoakwoodstairs=164 +slimeblock=165 +barrier=166 +irontrapdoor=167 +prismarine=168 +prismarinebricks=168:1 +darkprismarine=168:2 +sealantern=169 haybale=170 carpet=171 +whitecarpet=171:0 +orangecarpet=171:1 +magentacarpet=171:2 +lightbluecarpet=171:3 +ltbluecarpet=171:3 +yellowcarpet=171:4 +limecarpet=171:5 +lightgreencarpet=171:5 +ltgreencarpet=171:5 +pinkcarpet=171:6 +graycarpet=171:7 +greycarpet=171:7 +darkgraycarpet=171:7 +darkgreycarpet=171:7 +dkgraycarpet=171:7 +dkgreycarpet=171:7 +lightgraycarpet=171:8 +lightgreycarpet=171:8 +ltgraycarpet=171:8 +ltgreycarpet=171:8 +silvercarpet=171:8 +cyancarpet=171:9 +purplecarpet=171:10 +violetcarpet=171:10 +bluecarpet=171:11 +darkbluecarpet=171:11 +dkbluecarpet=171:11 +browncarpet=171:12 +greencarpet=171:13 +darkgreencarpet=171:13 +dkgreencarpet=171:13 +redcarpet=171:14 +blackcarpet=171:15 +hardenedclay=172 +coalblock=173 +packedice=174 +doubleplant=175 +sunflower=175:0 +lilac=175:1 +doubletallgrass=175:2 +doubletallfern=175:3 +rosebush=175:4 +peony=175:5 +redsandstone=179 +chiseledredsandstone=179:1 +smoothredsandstone=179:2 +redsandstonestairs=180 +newstoneslab=182 +redsandstoneslab=182:0 +sprucefencegate=183 +coniferfencegate=183 +pinefencegate=183 +darkfencegate=183 +birchfencegate=184 +whitefencegate=184 +junglefencegate=185 +darkoakfencegate=186 +bigoakfencegate=186 +roofedoakfencegate=186 +acaciafencegate=187 +sprucefence=188 +coniferfence=188 +pinefence=188 +darkfence=188 +birchfence=189 +whitefence=189 +junglefence=190 +darkoakfence=191 +bigoakfence=191 +roofedoakfence=191 +acaciafence=192 ironshovel=256 ironspade=256 ironpickaxe=257 @@ -361,7 +562,6 @@ redapple=260 bow=261 arrow=262 coal=263 -coalblock=173 charcoal=263:1 diamond=264 ironingot=265 @@ -374,9 +574,9 @@ ironsword=267 woodensword=268 woodsword=268 woodenshovel=269 +woodspade=269 woodshovel=269 woodenspade=269 -woodspade=269 woodenpickaxe=270 woodpickaxe=270 woodenpick=270 @@ -404,8 +604,8 @@ soup=282 goldensword=283 goldsword=283 goldenshovel=284 -goldshovel=284 goldenspade=284 +goldshovel=284 goldspade=284 goldenpickaxe=285 goldpickaxe=285 @@ -416,13 +616,13 @@ goldaxe=286 string=287 feather=288 gunpowder=289 -woodhoe=290 woodenhoe=290 +woodhoe=290 stonehoe=291 ironhoe=292 diamondhoe=293 -goldhoe=294 goldenhoe=294 +goldhoe=294 seeds=295 wheat=296 bread=297 @@ -451,19 +651,24 @@ goldpants=316 goldenboots=317 goldboots=317 flint=318 +porkchop=319 meat=319 pork=319 +cookedporkchop=320 cookedmeat=320 cookedpork=320 painting=321 paintings=321 goldenapple=322 goldapple=322 +notchapple=322:1 enchantedgoldenapple=322:1 enchantedgoldapple=322:1 sign=323 -wooddoor=324 +oakdoor=324 +appledoor=324 woodendoor=324 +wooddoor=324 bucket=325 waterbucket=326 lavabucket=327 @@ -477,32 +682,38 @@ leather=334 milkbucket=335 brick=336 clay=337 -reed=338 sugarcane=338 +reed=338 paper=339 book=340 -slimeorb=341 slimeball=341 +slimeorb=341 storageminecart=342 poweredminecart=343 egg=344 compass=345 fishingrod=346 watch=347 +glowstonedust=348 lightstonedust=348 lightdust=348 -glowstonedust=348 glowdust=348 -rawfish=349 fish=349 +rawfish=349 +rawsalmon=349:1 +clownfish=349:2 +pufferfish=349:3 cookedfish=350 +cookedsalmon=350:1 dye=351 inksac=351:0 blackdye=351:0 -reddye=351:1 rosered=351:1 -greendye=351:2 +reddye=351:1 cactusgreen=351:2 +greendye=351:2 +darkgreendye=351:2 +dkgreendye=351:2 cocoabeans=351:3 browndye=351:3 lapislazuli=351:4 @@ -512,12 +723,13 @@ dkbluedye=351:4 purpledye=351:5 violetdye=351:5 cyandye=351:6 -lightgreydye=351:7 lightgraydye=351:7 -ltgreydye=351:7 +lightgreydye=351:7 ltgraydye=351:7 -greydye=351:8 +ltgreydye=351:7 +silverdye=351:7 graydye=351:8 +greydye=351:8 darkgreydye=351:8 darkgraydye=351:8 dkgreydye=351:8 @@ -583,6 +795,7 @@ goldencarrot=396 skeletonhead=397 witherhead=397:1 zombiehead=397:2 +playerhead=397:3 stevehead=397:3 creeperhead=397:4 carrotonastick=398 @@ -596,13 +809,68 @@ netherbrickitem=405 netherquartz=406 tntminecart=407 hopperminecart=408 +prismarineshard=409 +prismarinecrystals=410 +rawrabbit=411 +cookedrabbit=412 +rabbitstew=413 +rabbitsoup=413 +rabbitsfood=414 +rabbithide=415 +armorstand=416 ironhorsearmor=417 goldhorsearmor=418 diamondhorsearmor=419 lead=420 nametag=421 commandblockminecart=422 - +rawmutton=423 +cookedmutton=424 +banner=425 +blackbanner=415:0 +redbanner=415:1 +greenbanner=415:2 +darkgreenbanner=415:2 +dkgreenbanner=415:2 +brownbanner=415:3 +bluebanner=415:4 +darkbluebanner=415:4 +dkbluebanner=415:4 +purplebanner=415:5 +violetbanner=415:5 +cyanbanner=415:6 +lightgraybanner=415:7 +lightgreybanner=415:7 +ltgraybanner=415:7 +ltgreybanner=415:7 +silverbanner=415:7 +graybanner=415:8 +greybanner=415:8 +darkgraybanner=415:8 +darkgreybanner=415:8 +dkgraybanner=415:8 +dkgreybanner=415:8 +pinkbanner=415:9 +limebanner=415:10 +lightgreenbanner=415:10 +ltgreenbanner=415:10 +yellowbanner=415:11 +lightbluebanner=415:12 +ltbluebanner=415:12 +magentabanner=415:13 +orangebanner=415:14 +whitebanner=415:15 +sprucedoor=427 +coniferdoor=427 +pinedoor=427 +darkdoor=427 +birchdoor=428 +whitedoor=428 +jungledoor=429 +acaciadoor=430 +darkoakdoor=431 +bigoakdoor=431 +roofedoakdoor=431 goldrecord=2256 greenrecord=2257 blocksrecord=2258 @@ -617,4 +885,3 @@ wardrecord=2265 - diff --git a/MCServer/lang/items_de.ini b/MCServer/lang/items_de.ini new file mode 100644 index 000000000..3c2ab87d1 --- /dev/null +++ b/MCServer/lang/items_de.ini @@ -0,0 +1,603 @@ +[Items] +luft=0 +stein=1 +granit=1:1 +poliertergranit=1:2 +diorit=1:3 +polierterdiorit=1:4 +andesit=1:5 +polierterandesit=1:6 +grasblock=2 +erde=3 +grobeerde=3:1 +podsol=3:2 +bruchstein=4 +holzbretter=5 +eichenholzbretter=5:0 +fichtenholzbretter=5:1 +birkenholzbretter=5:2 +tropenholzbretter=5:3 +akazienholzbretter=5:4 +schwarzeichenholzbretter=5:5 +setzling=6 +eichensetzling=6:0 +fichtensetzling=6:1 +birkensetzling=6:2 +tropensetzling=6:3 +akaziensetzling=6:4 +schwarzeichensetzling=6:5 +grundgestein=7 +wasser=8 +fliessendeswasser=8 +stehendeswasser=9 +stilleswasser=9 +swasser=9 +lava=10 +fliessendelava=10 +stehendelava=11 +stillelava=11 +slava=11 +sand=12 +rotersand=12:1 +kies=13 +golderz=14 +eisenerz=15 +kohleerz=16 +stamm=17 +eichenholz=17:0 +fichtenholz=17:1 +birkenholz=17:2 +tropenholz=17:3 +laub=18 +eichenlaub=18:0 +fichtenlaub=18:1 +birkenlaub=18:2 +tropenlaub=18:3 +schwamm=19 +nasserschwamm=19:1 +glas=20 +lapislazulierz=21 +lapislazuliblock=22 +werfer=23 +sandstein=24 +normalersandstein=24:0 +gemeisseltersandstein=24:1 +glattersandstein=24:2 +notenblock=25 +bettblock=26 +antriebsschiene=27 +sensorschiene=28 +klebrigerkolben=29 +spinnenweben=30 +gras=31 +gras=31:1 +farn=31:2 +toterbusch=32 +kolben=33 +kolbenkopf=34 +wolle=35 +weissewolle=35:0 +orangenewolle=35:1 +magentawolle=35:2 +hellblauewolle=35:3 +gelbewolle=35:4 +hellgruene=35:5 +rosawolle=35:6 +grauwool=35:7 +greywool=35:7 +grauewolle=35:7 +hellgrauewolle=35:8 +tuerkisewolle=35:9 +violettewolle=35:10 +blauewolle=35:11 +braunewolle=35:12 +gruenewolle=35:13 +rotewolle=35:14 +schwarzewolle=35:15 +loewenzahn=37 +blume=38 +mohn=38:0 +blaueorchidee=38:1 +sternlauch=38:2 +porzellansternchen=38:3 +rotetulpe=38:4 +orangenetulpe=38:5 +weissetulpe=38:6 +rosatulpe=38:7 +margerite=38:8 +braunerpilz=39 +roterpilz=40 +goldblock=41 +eisenblock=42 +doppelstufe=43 +doppelsteinstufe=43:0 +doppelsandsteinstufe=43:1 +doppelholzstufe=43:2 +doppelbruchsteinstufe=43:3 +doppelziegelstufe=43:4 +doppelsteinziegelstufe=43:5 +doppelnetherziegelstufe=43:6 +doppelquarzstufe=43:7 +stufe=44 +steinstufe=44:0 +sandsteinstufe=44:1 +holzstufe=44:2 +bruchsteinstufe=44:3 +ziegelstufe=44:4 +steinziegelstufe=44:5 +netherziegelstufe=44:6 +quarzstufe=44:7 +ziegelsteine=45 +tnt=46 +buecherregal=47 +bemoosterbruchstein=48 +obsidian=49 +fackel=50 +feuer=51 +monsterspawner=52 +eichenholztreppe=53 +kiste=54 +rotstonekabel=55 +diamanterz=56 +diamantblock=57 +werkbank=58 +ernte=59 +farmland=60 +ofen=61 +brennenderofen=62 +schildblock=63 +holztuerblock=64 +leiter=65 +schiene=66 +bruchsteintreppe=67 +wandschild=68 +schalter=69 +steindruckplatte=70 +eisentuerblock=71 +holzdruckplatte=72 +rotstoneerz=73 +leuchtendesrotstoneerz=74 +erloschenerotstonefackel=75 +rotstonefackel=76 +setinknopf=77 +schnee=78 +eis=79 +schneeblock=80 +kaktus=81 +ton=82 +zuckerrohrblock=83 +plattenspieler=84 +eichenholzzaun=85 +kuerbis=86 +netherstein=87 +selensand=88 +leuchtstein=89 +portal=90 +kürbislaterne=91 +kuchenlock=92 +weissesglas=95 +orangenesglas=95:1 +magentaglas=95:2 +hellblauesglas=95:3 +gelbesglas=95:4 +hellgruenesglas=95:5 +rosagerfaerbtglas=95:6 +grauesglas=95:7 +hellgrauesglas=95:8 +tuerkisesglas=95:9 +violettesglas=95:10 +blauesglas=95:11 +braunesglas=95:12 +gruenesglas=95:13 +rotesglas=95:14 +schwarzesglas=95:15 +falltuer=96 +silberfischblock=97 +steinziegel=98 +bemoostesteinziegel=98:1 +rissigesteinziegel=98:2 +gemeisseltesteinziegel=98:3 +braunerpilzblock=99 +roterpilzblock=100 +eisengitter=101 +glasscheibe=102 +melone=103 +kuerbispflanze=104 +melonenpflanze=105 +ranken=106 +eichenholzzauntor=107 +ziegeltreppe=108 +steinziegeltreppe=109 +myzel=110 +seerosenblatt=111 +netherziegel=112 +netherziegelzaun=113 +netherziegeltreppe=114 +netherwarzenblock=115 +zaubertisch=116 +braustandblock=117 +kesselblock=118 +endportal=119 +endportalrahmen=120 +endstein=121 +drachenei=122 +redstonelampe=123 +erlosscheneredstonelampe=124 +doppelholzstufe=125 +doppeleichenholzstufe=125:0 +doppelfichtenholzstufe=125:1 +doppelbirkenholzstufe=125:2 +doppeltropenholzstufe=125:3 +doppelakazienholzstufe=125:4 +doppelschwarzeichenstufe=125:5 +holzstufe=126 +eichenholzstufe=126:0 +fichtenholzstufe=126:1 +birkenholzstufe=126:2 +tropenholzstufe=126:3 +akazienholzstufe=126:4 +schwarzeichenholzstufe=126:5 +kakaobohnen=127 +sandsteintreppe=128 +smaragderz=129 +endertruhe=130 +haken=131 +stolperdraht=132 +smaragdblock=133 +fichtenholztreppe=134 +birkenholztreppe=135 +tropenholztreppe=136 +kommandoblock=137 +leuchtfeuer=138 +bruchsteinmauer=139 +bemoostebruchsteinmauer=139:1 +blumentopfblock=140 +karottenpflanze=141 +kartoffelpflanze=142 +knopf=143 +skelettschaedel=144 +witherskelettschaedel=144:1 +zombieschaedel=144:2 +schaedel=144:3 +creeperschaedel=144:4 +amboss=145 +redstonetruhe=146 +waegeplatteniedrigegewichte=147 # WTF, that names are so stupid... +waegeplattehohegewichte=148 +inaktiverkomparator=149 +aktiverkomparator=150 +tageslichtsensor=151 +redstoneblock=152 +netherquarzerz=153 +trichter=154 +quarzblock=155 +gemeisselterquarzblock=155:1 +quarzsaeule=155:2 +quarztreppe=156 +aktivierungsschiene=157 +spender=158 +weissgerfaerbterton=159 +orangegerfaerbterton=159:1 +magentagerfaerbterton=159:2 +hellblaugerfaerbterton=159:3 +gelbgerfaerbterton=159:4 +hellgruengerfaerbterton=159:5 +rosagerfaerbterton=159:6 +graugerfaerbterton=159:7 +hellgraugefaerbterton=159:8 +tuerkisgerfaerbterton=159:9 +purplegerfaerbterton=159:10 +violettegerfaerbterton=159:10 +blaugerfaerbterton=159:11 +braungerfaerbterton=159:12 +gruengerfaerbterton=159:13 +rotgerfaerbterton=159:14 +schwarzgerfaerbterton=159:15 +weisseglasscheibe=160 +orangeneglasscheibe=160:1 +magentaglasscheibe=160:2 +hellblaueglasscheibe=160:3 +gelbeglasscheibe=160:4 +hellgrueneglasscheibe=160:5 +rosaglasscheibe=160:6 +graueglasscheibe=160:7 +hellgraueglasscheibe=160:8 +tuerkiseglasscheibe=160:9 +violetteglasscheibe=160:10 +blaueglasscheibe=160:11 +brauneglasscheibe=160:12 +grueneglasscheibe=160:13 +roteglasscheibe=160:14 +schwarzeglasscheibe=160:15 +neueslaub=161 +akazienlaub=161:0 +schwarzeichenlaub=161:1 +neuestaemme=162 +akazienholz=162:0 +schwarzeichenholz=162:1 +akazientreppe=163 +schwarzeichentreppe=164 +schleimblock=165 +bartriere=166 +eisenfalltür=167 +prismarin=168 +prismarinziegel=168:1 +dunklerprismarin=168:2 +seelaterne=169 +strohballen=170 +teppich=171 +weisserteppich=171:0 +orangenerteppich=171:1 +magentateppich=171:2 +hellblauerteppich=171:3 +gelberteppich=171:4 +hellgruenerteppich=171:5 +rosateppich=171:6 +grauerteppich=171:7 +hellgrauerteppich=171:8 +tuerkiserteppich=171:9 +violetterteppich=171:10 +blauerteppich=171:11 +braunerteppich=171:12 +gruenerteppich=171:13 +roterteppich=171:14 +schwarzerteppich=171:15 +gebrannterton=172 +kohleblock=173 +packeis=174 +doppelpflanze=175 +sonnenblume=175:0 +Flieder=175:1 +hohesgras=175:2 +grosserfarn=175:3 +rosenstrauch=175:4 +pfingstrose=175:5 +rotersandstein=179 +gemeisselterrotersandstein=179:1 +glatterrotersandstein=179:2 +rotesandsteintreppe=180 +neuesteinstufe=182 +rotesandsteinstufe=182:0 +fichtenzauntor=183 +birkenzauntor=184 +tropenzauntor=185 +schwarzeichenzauntor=186 +akazienzauntor=187 +fichtenzaun=188 +birkenzaun=189 +tropenzaun=190 +schwarzeichenzaun=191 +akazienzaun=192 +eisenschaufel=256 +eisenspitzhacke=257 +eisenaxt=258 +feuerzeug=259 +apfel=260 +bogen=261 +pfeil=262 +kohle=263 +holzkohle=263:1 +diamant=264 +eisenbarren=265 +goldbarren=266 +eisenschwert=267 +holzschwert=268 +holzschaufel=269 +holzspitzhacke=270 +holzaxt=271 +steinschwert=272 +steinschaufel=273 +steinspitzhacke=274 +steinaxt=275 +diamantschwert=276 +diamantschaufel=277 +diamantspitzhacke=278 +diamantaxt=279 +stock=280 +schuessel=281 +pilzsuppe=282 +goldschwert=283 +goldschaufel=284 +goldspitzhacke=285 +goldaxt=286 +faden=287 +feder=288 +schwarzpulver=289 +holzhacke=290 +steinhacke=291 +eisenhacke=292 +diamanthacke=293 +goldhacke=294 +samen=295 +weizen=296 +brot=297 +lederkappe=298 +lederjacke=299 +lederhose=300 +lederstiefel=301 +kettenhaube=302 +kettenhemd=303 +kettenhose=304 +kettenstiefel=305 +eisenhelm=306 +eisenbrustplatte=307 +eisenbeinschutz=308 +eisenstiefel=309 +diamanthelm=310 +diamantbrustplatte=311 +diamantbeinschutz=312 +diamantstiefel=313 +goldhelm=314 +goldharnisch=315 +goldbeinschutz=316 +goldstiefel=317 +goldboots=317 +feuerstein=318 +rohesschweinefleisch=319 +gebratenesschweinefleisch=320 +gemaelde=321 +goldenerapfel=322 +goldenerapfel=322:1 +schild=323 +eichenholztuer=324 +eimer=325 +wassereimer=326 +lavaeimer=327 +lore=328 +sattel=329 +eisentuer=330 +redstone=331 +schneeballl=332 +boot=333 +leder=334 +milcht=335 +ziegel=336 +ton=337 +zuckercane=338 +papier=339 +buch=340 +schleimball=341 +gueterlore=342 +angetriebenelore=343 +ei=344 +kompass=345 +angel=346 +uhr=347 +glowstonestaub=348 +fisch=349 +roherfisch=349 +roherlachs=349:1 +clownfisch=349:2 +kugelfisch=349:3 +gebratenerfisch=350 +gebratenerlachs=350:1 +farbe=351 +tintenbeutel=351:0 +rosenrot=351:1 +kaktusgruen=351:2 +kakaobohnen=351:3 +lapislazuli=351:4 +violetterfarbstoff=351:5 +tuerkiserfarbstoff=351:6 +hellgrauerfarbstoff=351:7 +grauerfarbstoff=351:8 +rosafarbstoff=351:9 +hellgruenerfarbstoff=351:10 +gelberfarbstoff=351:11 +hellblauerfarbstoff=351:12 +magentafarbstoff=351:13 +orangenerfarbstoff=351:14 +knochenmehl=351:15 +knochen=352 +zucker=353 +kuchen=354 +bett=355 +redstoneverstaerker=356 +keks=357 +karte=358 +schere=359 +melone=360 +kürbiskerne=361 +melonenkerne=362 +rohesrindfleisch=363 +steak=364 +roheshühnchen=365 +gebrateneshühnchen=366 +verrottetesfleisch=367 +enderperle=368 +lohenrute=369 +ghasttraene=370 +goldnugget=371 +netherwarze=372 +trank=373 +glasflasche=374 +spinnenauge=375 +fermentiertesspinnenauge=376 +lohenstaub=377 +magmacreme=378 +braustand=379 +kessel=380 +enderauge=381 +glitzerndemelone=382 +spawnei=383 +erfahrungsfläschchen=384 +feuerkugel=385 +buchundfeder=386 +beschriebenesbuch=387 +smaragd=388 +rahmen=389 +blumentopf=390 +karotte=391 +kartoffel=392 +ofenkartoffel=393 +giftigekartoffel=394 +leerekarte=395 +goldenekarotte=396 +skelettschaedel=397 +witherschaedel=397:1 +zombieschaedel=397:2 +kopf=397:3 +creeperschaedel=397:4 +karottenrute=398 +netherstern=399 +kuerbiskuchen=400 +feuerwerksrakete=401 +feuerwerksstern=402 +verzauberungsbuch=403 +redstonekomparator=404 +netherziegelitem=405 +netherquarz=406 +tntlore=407 +trichterlore=408 +prismarinscherbe=409 +prismarinkristalle=410 +roheskaninchen=411 +gebrateneskaninchen=412 +kaninchenragout=413 +hasenpfote=414 +kaninchenfell=415 +ruestungsstaender=416 +eisernepferderuestung=417 +goldenepferderuestung=418 +diamantenepferderuestung=419 +leine=420 +namensschild=421 +kommandoblocklore=422 +roheshammelfleisch=423 +gebrateneshammelfleisch=424 +banner=425 +schwarzesbanner=415:0 +rotesbanner=415:1 +gruenesbanner=415:2 +braunbanner=415:3 +blauesbanner=415:4 +violettesbanner=415:5 +tuerkisesbanner=415:6 +hellgrauesbanner=415:7 +grauesbanner=415:8 +rosabanner=415:9 +hellgruenesbanner=415:10 +gelbesbanner=415:11 +hellblauesbanner=415:12 +magentabanner=415:13 +orangenesbanner=415:14 +weissesbanner=415:15 +fichtenholztuer=427 +birkenholztuer=428 +tropentuer=429 +akazientuer=430 +schwarzeichentuer=431 +goldeneschallplatte=2256 +grueneschallplatte=2257 +blocksschallplatte=2258 +chirpschallplatte=2259 +farschallplatte=2260 +mallschallplatte=2261 +mellohischallplatte=2262 +stalschallplatte=2263 +stradschallplatte=2264 +wardschallplatte=2265 +11schallplatte=2266 + + + diff --git a/MCServer/monsters.ini b/MCServer/monsters.ini index b631fc1a9..c4bc8c810 100644 --- a/MCServer/monsters.ini +++ b/MCServer/monsters.ini @@ -44,7 +44,7 @@ MaxHealth=10 AttackRange=2.0 AttackRate=1 AttackDamage=4.0 -SightDistance=25.0 +SightDistance=64.0 MaxHealth=40 [ZombiePigman] @@ -185,4 +185,10 @@ AttackDamage=6.0 SightDistance=25.0 MaxHealth=100 +[Bat] +AttackRange=2.0 +AttackRate=1 +AttackDamage=0.0 +SightDistance=25.0 +MaxHealth=6 diff --git a/MCServer/profile_run.cmd b/MCServer/profile_run.cmd index 58efea64a..6137e9d4d 100644 --- a/MCServer/profile_run.cmd +++ b/MCServer/profile_run.cmd @@ -12,7 +12,8 @@ :: It expects the MS Performance tools installed in C:\Program Files\Microsoft Visual Studio 9.0\Team Tools\Performance Tools :: You can override this path by setting the pt environment variable prior to launching this script :: -:: By default it will launch the release version of MCServer; set the app environment variable to another executable to run that instead. +:: By default it will launch the 32-bit release version of MCServer; set the app environment variable to another executable to run that instead. +:: Set the IsExecutablex64 env variable to \x64 to profile a 64-bit executable instead (available as the profile_run_x64.cmd script) :: Note that the app needs to be compiled with the "/PROFILE" flag in order for the profiling to work @@ -45,7 +46,7 @@ if %outputdir%n == n ( -::Create the output directory, if it didn't exist +:: Create the output directory, if it didn't exist mkdir %outputdir% @@ -55,15 +56,15 @@ mkdir %outputdir% :: Start the profiler set outputname=profile.vsp set output=%outputdir%\%outputname% -%pt%\vsperfcmd /start:sample /output:%output% +%pt%%IsExecutablex64%\vsperfcmd /start:sample /output:%output% if errorlevel 1 goto haderror :: Launch the application via the profiler -%pt%\vsperfcmd /launch:%app% -if errorlevel 1 goto haderror +%pt%%IsExecutablex64%\vsperfcmd /launch:%app% +if errorlevel 1 goto haderrorshutdown :: Shut down the profiler (this command waits, until the application is terminated) -%pt%\vsperfcmd /shutdown +%pt%%IsExecutablex64%\vsperfcmd /shutdown if errorlevel 1 goto haderror @@ -86,6 +87,10 @@ goto finished +:haderrorshutdown +echo An error was encountered, shutting down the profiler +%pt%%IsExecutablex64%\vsperfcmd /shutdown + :haderror echo An error was encountered pause diff --git a/MCServer/profile_run_debug.cmd b/MCServer/profile_run_debug.cmd index 8bf85f049..a9792541a 100644 --- a/MCServer/profile_run_debug.cmd +++ b/MCServer/profile_run_debug.cmd @@ -2,4 +2,4 @@ :: This script uses the profile_run.cmd script to run profiling on the DebugProfile executable set app=MCServer_debug_profile.exe -call profile_run.cmd
\ No newline at end of file +call profile_run.cmd diff --git a/MCServer/profile_run_x64.cmd b/MCServer/profile_run_x64.cmd new file mode 100644 index 000000000..242136f4b --- /dev/null +++ b/MCServer/profile_run_x64.cmd @@ -0,0 +1,5 @@ +@echo off +:: This script uses the profile_run.cmd script to run profiling on a x64 release executable + +set IsExecutablex64=\x64 +call profile_run.cmd diff --git a/MCServer/webadmin/files/background.gif b/MCServer/webadmin/files/background.gif Binary files differnew file mode 100644 index 000000000..cab9bed56 --- /dev/null +++ b/MCServer/webadmin/files/background.gif diff --git a/MCServer/webadmin/files/favicon.ico b/MCServer/webadmin/files/favicon.ico Binary files differnew file mode 100644 index 000000000..ea4bde926 --- /dev/null +++ b/MCServer/webadmin/files/favicon.ico diff --git a/MCServer/webadmin/files/logo.png b/MCServer/webadmin/files/logo.png Binary files differnew file mode 100644 index 000000000..50733e824 --- /dev/null +++ b/MCServer/webadmin/files/logo.png diff --git a/MCServer/webadmin/files/mc-logo.png b/MCServer/webadmin/files/mc-logo.png Binary files differnew file mode 100644 index 000000000..9a77a490f --- /dev/null +++ b/MCServer/webadmin/files/mc-logo.png diff --git a/MCServer/webadmin/files/style.css b/MCServer/webadmin/files/style.css new file mode 100644 index 000000000..7f01b34b2 --- /dev/null +++ b/MCServer/webadmin/files/style.css @@ -0,0 +1,353 @@ +body, html +{ + font-family: "Open Sans", Tahoma, sans-serif; + padding: 0; + margin: 0; + font-weight: 400; + background-color: #fbe9e7; + color: rgba(0, 0, 0, 0.87); +} + +.light { font-weight: 300; } +.bold { font-weight: 600; } + +#wrapper +{ + background-color: #ff5722; + margin: 40px auto; + width: 99%; + max-width: 1200px; + box-sizing: border-box; + -moz-box-sizing: border-box; + box-shadow: 0px 4px 5px rgba(0, 0, 0, 0.15); + color: rgba(0, 0, 0, 0.87); +} + +.title +{ + font-size: 30pt; + padding: 10px 40px; + text-decoration: none; + color: white; + text-shadow: 0px 1px 2px rgba(0, 0, 0, 0.3); + display: block; +} + +#sidebar +{ + float: left; + width: 20%; +} + +.sideNav +{ + list-style: none; + background-color: #fafafa; + margin: 20px 0; + padding: 5px 0; + width: 100%; + box-shadow: 1px 0px 10px rgba(0, 0, 0, 0.2); +} + +.sideNav li +{ + padding: 10px; + color: rgba(0, 0, 0, 0.54); +} + +.sideNav li.link +{ + padding-left: 30px; +} + +.sideNav li.link a +{ + text-decoration: none; + color: rgba(0, 0, 0, 0.87); +} + +#container +{ + margin: 0; + padding: 0; + overflow: hidden; + background-color: #f5f5f5; +} + +#main +{ + float: right; + width: 80%; + padding: 0 15px 20px 15px; + box-sizing: border-box; + -moz-box-sizing: border-box; +} + +.clear +{ + clear: both; +} + +table +{ + width: 100%; + border-collapse: collapse; +} + +table td +{ + padding: 5px; +} + +table th +{ + border-bottom: 1px solid rgba(0, 0, 0, 0.12); + padding: 5px; + text-align: center; +} + +table tr:nth-child(odd) +{ + background-color: rgba(0, 0, 0, 0.015); +} + +p +{ + margin: 8px 0; + padding: 8px 3px; +} + +a +{ + text-decoration: none; + color: #0277bd; + -webkit-transition: color 0.1s linear; + -moz-transition: color 0.1s linear; + transition: color 0.1s linear; +} + +a:hover +{ + color: #01579b; +} + +.welcome-msg +{ + color: rgba(0, 0, 0, 0.54); +} + +.username +{ + text-transform: capitalize; + color: rgba(0, 0, 0, 0.87); +} + +a:hover +{ + color: black; +} + +input, select +{ + padding: 8px; +} + +form +{ + padding: 4px; +} + +.info input[type="submit"], .info button, .info input[type="button"], +.warn input[type="submit"], .warn button, .warn input[type="button"], +.err input[type="submit"], .err button, .err input[type="button"] +{ + float: right; +} + +.err +{ + color: white; + display: block; + background-color: #e51c23 !important; + padding: 15px; + line-height: 30px; + min-height: 30px; +} + +.err:before +{ + content: "ERROR: "; +} + +.warn +{ + color: white; + display: block; + background-color: #ff5722 !important; + padding: 15px; + line-height: 30px; + min-height: 30px; +} + +.warn:before +{ + content: "WARNING: "; +} + +.info +{ + color: white; + display: block; + background-color: #5677fc !important; + padding: 15px; + line-height: 30px; + min-height: 30px; +} + +.info:before +{ + content: "INFORMATION: "; +} + +#footer .fleft +{ + float: left; +} + +#footer .fright +{ + float: right; + text-align: right; +} + +#footer +{ + margin: 0; + padding: 10px; + font-size: 9pt; + color: rgba(255, 255, 255, 0.8); + box-shadow: 0px 2px 3px rgba(0, 0, 0, 0.2) inset; +} + +#footer a +{ + text-transform: none; + color: white; +} + +input[type="submit"], button, input[type="button"] +{ + background-color: #ffc107; + padding: 8px 15px 8px 15px; + margin: 0 2px; + display: inline-block; + text-align: center; + color: black; + box-shadow: 0px 2px 3px rgba(0,0,0,0.2); + border: none; + outline: none; + cursor: pointer; +} + +input[type="submit"]:hover, button:hover, input[type="button"]:hover +{ + background-color: #ffca28; +} + +input[type="submit"]:active, button:active, input[type="button"]:active +{ + background-color: #ffd54f; + -webkit-transform: translateY(1px); + -moz-transform: translateY(1px); + transform: translateY(1px); +} + +hr +{ + border: none; + height: 1px; + background-color: rgba(0, 0, 0, 0.12); +} + +h4 +{ + padding-bottom: 10px; + margin-bottom: 12px; + border-bottom: 1px solid rgba(0, 0, 0, 0.12); +} + + +/**** PAGE SPECIFIC CSS ****/ + +/* remove the * for disabling: */ + +.page-core-server-settings table td +{ + text-align: center; + width: 25%; +} + +.page-core-server-settings.no-param table td:nth-child(1) a, +.page-core-server-settings.param-tab-general table td:nth-child(1) a +{ + font-weight: 600; + color: rgba(0, 0, 0, 0.87); +} + +.page-core-server-settings.param-tab-monsters table td:nth-child(2) a +{ + font-weight: 600; + color: rgba(0, 0, 0, 0.87); +} + +.page-core-server-settings.param-tab-worlds table td:nth-child(3) a +{ + font-weight: 600; + color: rgba(0, 0, 0, 0.87); +} + +.page-core-server-settings.param-tab-world table td:nth-child(4) a +{ + font-weight: 600; + color: rgba(0, 0, 0, 0.87); +} + +.page-core-permissions form table tr, +.page-core-permissions form table td, +.page-core-permissions form table th +{ + border: none; + background-color: transparent; +} + +.page-core-permissions form table tr:nth-child(1) th +{ + width: 35%; +} + +.page-core-permissions form table tr:nth-child(1) td +{ + width: 65%; +} + +.page-core-permissions form table td input +{ + width: 100%; + box-sizing: border-box; + -moz-box-sizing: border-box; + margin: 0; +} + +#ChatDiv +{ + margin-bottom: 10px; +} + +#ChatMessage +{ + width: 100%; + box-sizing: border-box; + -moz-box-sizing: border-box; +} + +/**/ diff --git a/MCServer/webadmin/login_template.html b/MCServer/webadmin/login_template.html new file mode 100644 index 000000000..913a85db0 --- /dev/null +++ b/MCServer/webadmin/login_template.html @@ -0,0 +1,25 @@ +<html> +<head> + <title>MCServer WebAdmin - Login</title> + <meta charset="UTF-8"> + <link rel="icon" href="favicon.ico"> + <style type="text/css"> + header { + margin: 0 auto; + text-align: center; + vertical-align: middle; + } + </style> +</head> + +<body> + <header> + <img src="mc-logo.png" alt="MCServer Logo" class="logo"> + <h1>MCServer - WebAdmin</h1> + <form method="get" action="webadmin/"> + <input type="submit" value="Log in"> + </form> + </header> +</body> + +</html> diff --git a/MCServer/webadmin/template.html b/MCServer/webadmin/template.html index 822f73857..50eaa486b 100644 --- a/MCServer/webadmin/template.html +++ b/MCServer/webadmin/template.html @@ -51,7 +51,7 @@ table { border-top: 1px solid #ddd; width: 700px; - } + } table tr th { text-align: left; @@ -71,17 +71,23 @@ border: 1px solid #ddd; border-radius: 3px; } - #main table tr.odd td { + + #main table tr.odd td { background: #fbfbfb; } - table tr:hover td { background: #fdfcf6; } + table tr:hover td { + background: #fdfcf6; + } + table .action { text-align: right; padding: 0 20px 0 10px; } - table tr .action a { color: #9b9b9b; } + table tr .action a { + color: #9b9b9b; + } #cssmenu{ height:10px; display:table; padding:0; margin: 0 auto; border:1px #707070 solid; border-radius:5px; } #cssmenu > ul {list-style:inside none; padding:0; margin:0;} diff --git a/MCServer/webadmin/template.lua b/MCServer/webadmin/template.lua index a066d8b33..84a50b055 100644 --- a/MCServer/webadmin/template.lua +++ b/MCServer/webadmin/template.lua @@ -57,7 +57,7 @@ end function ShowPage(WebAdmin, TemplateRequest) SiteContent = {} local BaseURL = WebAdmin:GetBaseURL(TemplateRequest.Request.Path) - local Title = "MCServer" + local Title = "MCServer WebAdmin" local MemoryUsageKiB = cRoot:GetPhysicalRAMUsage() local NumChunks = cRoot:Get():GetTotalChunkCount() local PluginPage = WebAdmin:GetPage(TemplateRequest.Request) @@ -70,367 +70,45 @@ function ShowPage(WebAdmin, TemplateRequest) PageContent, SubTitle = GetDefaultPage() end + local reqParamsClass = "" + + for key,value in pairs(TemplateRequest.Request.Params) do + reqParamsClass = reqParamsClass .. " param-" .. string.lower(string.gsub(key, "[^a-zA-Z0-9]+", "-") .. "-" .. string.gsub(value, "[^a-zA-Z0-9]+", "-")) + end + + if (string.gsub(reqParamsClass, "%s", "") == "") then + reqParamsClass = " no-param" + end + Output([[ <!DOCTYPE html> <head> <meta http-equiv="Content-Type" content="text/html; charset=utf-8" /> -<link rel="icon" href="data:application/octet-stream;base64,AAABAAIAEBAAAAEAIABoBAAAJgAAACAgAAABACAAqBAAAI4EAAAoAAAAEAAAACAAAAABACAAAAAAAAAEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAQEBAQQAAAAAAgIDBRghJ5o5TlumCg0QCQAAAAABAgIEAAEBAQAAAAAAAAAAAAAAAAAAAAAAAAAAAAEBAgAAAAMAAAAACQwPMxsnL88jMz3/S2d6/0xoetcaIig6AAAAAAEBAQMBAQEDAAAAAAAAAAAAAAAAAQEBAwAAAAAEAwMEFhwhgRomMPwfLTj/IC86/DJHWPxKaH3/TGN0/jk+QYgEBgcFAAAAAAEBAgMAAAAAAAAAAgAAAAAKDRAuHSMpzB8rNP8dKTP8FiIp/QkXGv8sSEr/QV1u/UhnefxWdIb/P1dm0BIYHDEAAAAAAAEBAgAAAAARGB1oIC44/R0rNf8PGiL7DxUa/gwdHv8JKSP/HUdC/x9HQf81W17+Qllv+0lkef9ObYH+Ii42bAAAAAAAAAAAFyIqyBopMf8THSX6BRkY/wIbGP8HHhv/FTs1/yJhVP8lZ1b/H05I/xcuNf8jPET6UWp+/0xqfdAAAAAAAQECBxEcI9oOHh//BRgV/QwsJv8NKyb/EDEr/xU3Mv8zeW7/MHpr/ydqXP8oalz/HVtO/i9KUf9AW2zgBwkLDQEEBBgKGhfuCCMd/w4uKf4RNC7/FTcy/w8yLv8PMi7/LXFn/y55av86gW//OoV7/y11av4YTkj/GkFB8gUICh4BCActCSUf+xAxKv8TNjD/EzYx/w8xLP8PMCr/Fjgy/zp+c/8yfXP/OoN5/zN9cf86hHb/NHlt/y1xZP4LGhc0BhEORQ8zLP8SNC7+EDIt/xEzLf8PMCv/DTAs/w4xKv8vdWT/PYh4/y93bf8sdWj/N4R3/zWBdv43hHn/EysoTQgXFWEQMy//DzEs/Q8xK/8SNC3/FjUv/xEuK/8WPjf/OIBw/0OEdP83e27/N31w/zN8bP8vdWj8Mn5z/xg3MmgLHRp8FDkz/xExLPwNKyT/EjIs/xpEPP8kX1T/OY2C/0KVhv8zgG//NH9z/zuBdf8xeGX/PIF1/DSAdf8cRDyEDCMenBEvJ/8VODT4IVZM/C11af06inv/QZaG/z2Rgf84iXz/O5F+/z2Nff85iX3+OYJ2/DuBdPg5g3X/IVBIohIzLaUydGb/RJiJ/TyYiv88k4P/O4t6/j+Rg/w+j3/9PYt5/TyOgfwuhHf+Nox+/zyViP9Aloj9Q5WC/yxiVa0ECgkHEyciLh1BOWwsZV2sN39y4juNfv5Cmon/O5OF/z2Shf86kYT/NoyA/ziGeeUqZlywHEI8chAjHzQDBwUKAAAAAAAAAAAAAAAAAAAAAAQIBwsSKCQ9JU9GgDN2a8owdGjLH0xFghMpJUAFDAsNAAAAAAAAAAAAAAAAAAAAAP5/AAD8PwAA8A8AAOAHAADAAwAAgAEAAIABAACAAQAAgAEAAIABAACAAQAAgAAAAAAAAAAAAAAA4AcAAPw/AAAoAAAAIAAAAEAAAAABACAAAAAAAAAQAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAQEBBAAAAAEAAAAAGB4leTRGUpAICQsDAAAAAAECAgQAAAEBAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAEBAgABAQQAAAAADA4RHRsjK7UaJi7/U3SH/1Z1isgbJCosAAAAAAEBAgMBAQECAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAEBAQMAAAABAAAAABgeJGEkMz3wHSw1/yExOvxLaHn8TWuA/2SJovkzRVB1AAAAAAAAAAACAgIEAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAEBAQIBAQEEAAAAAAoLDhkcJS2xHy03/xkmL/0fLjb8IC85/0FabP9IZHX8O1Jj/GCFnP9KZHTBEhccIwAAAAABAQIEAQEBAgAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAABAQEDAAAAAgAAAAAXHSJZICw27BQeJv8aJzD7JTZC/iQ1P/8nOUX/JzpJ/0hjdf9FX3H+V3iO+01tgv9Wanj0R0dHZwAAAAAAAAABAQICAwAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAQEBAQEBBAAAAAAMDAwUJCouqSAwOv8XIir9Exwj/CM0P/8eLDf/IzM+/xclLv8oPlD/NUla/0Vhc/9EXnH/OU5f/DxPX/xudHn/Ulxjtg8WGxsAAAAAAQICBAEBAQIAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAQEBAwAAAAIAAAAAFhofUTI0NugdJSv/Gicw+yQ0P/0YJC7/GCQt/xEbJP8QGSD/CxUb/yhMTf9AWmz/PVds/z5Xaf8+VWf/Q15x/jtTZPtJX3D/VneK7iUxOlsAAAAAAAAAAgECAgMAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAIAAAAACAkLER4oMKIdKTL/GCEn/RQfJ/weLDb/Gigy/x0lLP8aJS7/DiAj/wgOE/8HFRn/Gks8/0BNS/8xUFv/VXyS/0ZseP9Ye5D/XH+U/0Zhc/xFX3L9SGN2/ztPXqkPFBYUAAAAAAEBAQIAAAAAAAAAAAAAAAAAAAABAAAAABUbIUoqOkbjHy43/xIcJPseLTb9Gicv/xQgKP8NEhn/ISIk/xYkKv8MKyP/Bh0b/wYiHf8RQzz/JTE2/yNYT/8tTVX/KVRM/1N5if9dgJj/RmBy/0pmev1KZXn7Qltt/1NxhOcgKjJOAAAAAAAAAAEAAAAAAQEBBAAAAAATGiBhIjE8/xwrNPwXIyv8His1/yMzPf8OFh7/BgwS/wQSEv8IDxT/CxQa/wUfG/8HJyL/ES0m/ylrYv8YPD//E0I2/xg8Mv8UQTP/LklT/zJHWf80Slv/Ql1x/1yAmP8/VWf8Smd7/E5rgP8fKTFuAAAAAAEBAQQAAQEEAAAAABYhJ5QaJy//FSAo+RglLv8iMz3/Ex8o/wUOEv8GIR3/BB8a/wQYFv8EEBL/Ax4a/wsqJv8VODL/JGhY/xhXTP8kWUv/KWNT/ypuWf8aMDX/HCU0/yEwPv8iMD7/M0dY/0FdcP9egpr6W36T/zlQXacAAAAAAQEBBAAAAAMAAAAAFR8mrR0rNP8YJCz8Fykt/xYiKv8FCRD/BRkY/wglIf8FHhr/AxsY/wYhHf8PKyb/FTo2/xU7N/8ralj/IGRY/ydpV/8wdWr/JW1g/xw9P/8dSkn/FjQ0/xQ/O/8aMDf/TVhi/0ljdvxYe5D/R2NyvgAAAAAAAAACAAAAAQAAAAANFRzGEh0m/x0uN/wKHRn/Bg4T/wMUEv8JJyH/Dy0p/wYjH/8IJB//Gjsz/xQyK/8TNDD/DjMu/z96a/8veG3/J3Fg/zd8b/8oa1//FExD/yhjVv8aWEb/ImRa/xhXTv86SUz/QlNl/Uhmff9bfpPWAAAAAAAAAAAAAAAAAQIDAxEaI9wSIyj/CBYW/QYWE/8HGRr/CSsi/wosI/8RMSz/ES4o/wwtKP8QMy7/Cisn/w8uKv8YNzD/Pod9/zB/df82e3L/Mnho/yduWP8ueW3/N3Zq/ypyZf8nbV3/IFxT/xE4Of8zT1z+Mldc/ztRY+kHCwwNAAAAAAAAAAABBQUSER0d7wwcGP8IIxv+CSId/wsgHP8QMiz/EjYx/w4vKv8XODP/EjIu/w4yLv8KLir/Cywn/w8wKv8qcWj/MH50/ylzYf8ve2j/JnFb/zh+bf8+hHr/LXhu/zJ+bf8wcGf/E09G/x4/Qv4jVEz/IS8++QcKDR0AAAAAAAAAAAEIBiUGFBP+BxgU/wsrJP4HJSD/ES8q/w4xLv8OMi7/FjUu/xM3Mv8XOzf/FDg0/xEzL/8TODT/Cy4q/yRlW/83e3H/KG9g/zSEeP9AhXj/P35u/0GMgf8wf3b/NoR8/yxzaP8hXVT/ED88/xdQSP4gVFL/Bg4QMgAAAAAAAAAAAwsKOgUdGv8NJyH9Dy8p/w8xKf8WOjb/DDEs/xI2MP8UNzD/DTAo/xM2MP8MLib/FTUx/xU1MP8OMy7/PXdo/0KLgP8udW3/JnJo/zyFef9Ai4H/PYd+/y54a/8mcmn/O3xv/zR1aP8obmD/I2JY/CFmWf8LIBpJAAAAAAAAAAAGFBFSCSsk/wssJPwMLib/EjEo/xU3Mv8OMij/HEA4/w4zMP8OMSz/EDAq/wktJ/8NMCv/FDEp/xU3Mf89gnj/PYyA/zyDef8udWv/N4Z8/zB8cv8zd27/LnZj/0GOev9FjYD/OoR7/zuEdv8+gHD7O4Z6/xo2L2IAAAAAAAAAAAcYE20MMCn/EDEr+w4vJv8WODP/EzMv/w8yLP8TODT/DS8q/xAwKv8IKyf/DC8s/w8wK/8MLST/FTQt/zaBdv8pd2P/P4t2/zaEef85e27/Nnpt/y11bP8xeW//QJCD/zyMgf8we2n/N4N6/yduZPtBkYj/Ik5JfAAAAAAAAAAADyMfiBA0Lv8PMiz7GDk1/xAxLf8RMS3/DzIt/xAyLP8PMCf/FzQu/w4vKf8OMC3/EzQv/wgsJ/8JLCf/ImlT/zV3Zf9IkHv/OYh7/yNuaP80e2//KXJp/yNtXf82gnb/MH10/yp3av9AjoX/MH10+zB7cP8eT0mWAAAAAAAAAAARLCiiDjMu/wotJvsTODT/DC8r/wkqJf8PMCj/EDIr/w0yKv8ZOzb/FjUv/xQ2M/8TOjb/DS8r/xk8NP8ocGL/QIV0/0WBcf9Cf3D/Mnhu/zd6bv84e27/KXRk/zh7bP8tdmX/M3lt/zR6bP8veWj8MHxx/y1dUq8AAAAAAAAAAAsnJLsRMi7/DC4q/BU0Lv8OMSz/DS4p/xg4Mv8SNi//ETAq/xs/N/8aPTX/ETEs/xQvKv8YMyv/H05F/yZya/9Km4j/SI+A/zp6a/9Cf23/RYh7/zuGe/86e2v/RYuA/y57af86e2r/J29l/ypyZ/w+jIL/KWVbxwAAAAAAAAAADysn0Rc6Nf8PMS39DS8q/xUzLf8QMiz/DS8l/xEyKv8UNC//EzEs/xAtI/8QMyv/H1FN/zeBeP9CnI//Q5SF/0aRff87h3f/LXVl/yJsWv8xe3T/Q4l+/zh5Zf8reWT/Lnlm/zqHef84fHD/Im9p/Th/dP8pa2HcAAYGBwQIBw4TMy3kFjsy/xI1L/4PMSz/GTo1/xIyKv8KKyL/EzAq/xA0MP8ZQjr/JF1T/zp/cP8xiHb/LIh6/0egkf9Gn5D/NYZ2/ziGcv8whXr/NYuA/zN9dP9Ahnz/Mn91/yNrWP85emb/QYJ3/0SLe/8vd2/+NXpq/zF2ZuwHEREXBxAPIRI3MPQVNSv/GTcw/hY0Lv8UNDH/Cysn/xQ2MP8oX1f/KnFn/0ONf/8yinz/MIh9/z6JeP85in//No+H/yyBdv82iX7/QZOE/yt/aP87jnn/R417/zaFef89kIP/M3dq/0OHev84gXf/R5KA/0KJfv4yf3P/NXhn+hEeGysDDww3EjQr/hcyLP8JJx//Ciwp/yJQSv8ybmD/MYJv/zmUiP8ug3X/QIp8/zyOfP9ElYX/T5yN/0KWhf88i3f/PYh4/ziHfP9El4X/P5aC/zaMf/9Ek4b/M4R2/z2ThP85iX7/Qop9/y+BeP83emz/NHlm/zeCef4mcmn/CyAcQgQTEVQVOTH/GT85/CRYTfstdWr8QJWL/j+Thv8thHT/N4l7/zaIdP85hnL/PI58/zmOfv8+lIb/RZF+/0COe/9AkH7/Qot2/0CTgv8+mI3/MIh2/zOFcv88joL/OY+F/zeFev83in//N4x+/jyFcPw3f237OHpv+0iQf/8fRj1fCh4cTyRkWOxFnIj+TqSR/0idiP9Qo5P/M4N5/Sp9cPs+k4X8RJeL/jqLev8/j37/RpaH/z2SiP84hnn/PZKI/zCHdv86jXz/P46E/zSIfv8xiHv/J31x/y6Eef4rgG/8OYx9+zyPhv05jIH/SZ6Q/1Wyof8/lH//Oohx9yJHPV4AAAAABhAOChw2LzkmTEV3MGxcuDuHdu1Akob/QpuP/0uZiP8yh3r/MIB0/DuKffs4in38PpaD/j6ZjP89kYT/PpCC/0CNgP82g3b+MIV6/S6EevspfHP8Po5//0ihkP8+mon/N4+B/zKCdPM1c2jDH01FhBoyK0YEDQoRAAAAAAAAAAEAAAAAAAAAAAAAAAAAAAAAAQsKDxUuKkIsXliDMnRpwjeEcfRCloH/RJuK/zyRgP9AlIP/PYx+/TKEdvw8kIH8Q5eM/TSLf/8+lYX/SJyM/zuYjf8+lIj3O4F1ySVZU4wWMy1LBhAMFgAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAABAQEBAgIDAQICBAEBAQIAAAAAAAAAAAAAAAAAAAAACxQRFhk2MkomWFGLOXhryEiZhvRElYf/N46G/zCGef9Dk4P/O5CF9SVpYMsrWlCQFzg0UAwZFxoAAAAAAAAAAAAAAAAAAAAAAAAAAgECAgQBAgIDAAEBAQAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAABAQEBAgIDAQMCBAEBAQIAAAAAAAAAAAAAAAAAAAAACBcTHx4+OVw5dWmnK2peqBo5Ml0MHBkiAAICAQAAAAAAAAAAAAAAAAABAQEBAgIEAQICAwABAQIAAAAAAAAAAAAAAAAAAAAAAAAAAP//f////D////gf///gB///wAP//wAA//4AAH/4AAAf8AAAD+AAAAfAAAADwAAAA8AAAAPAAAADwAAAA8AAAAPAAAADwAAAA8AAAAOAAAABgAAAAYAAAAGAAAABgAAAAYAAAAGAAAABgAAAAYAAAAHwAAAH/gAAf//gB////n//"> +<link rel="icon" href="/favicon.ico"> <title>]] .. Title .. [[</title> - -<style type="text/css" media="screen"> - - /* reset CSS */ - - html, body, div, span, applet, object, iframe, - h1, h2, h3, h4, h5, h6, p, blockquote, pre, - a, abbr, acronym, address, big, cite, code, - del, dfn, em, font, img, ins, kbd, q, s, samp, - small, strike, strong, sub, sup, tt, var, - b, u, i, center, - dl, dt, dd, ol, ul, li, - fieldset, form, label, legend, - table, caption, tbody, tfoot, thead, tr, th, td { - margin: 0; - padding: 0; - border: 0; - outline: 0; - font-size: 100%; - vertical-align: baseline; - background: transparent; - } - body { - line-height: 1; - } - ol, ul { - list-style: none; - } - blockquote, q { - quotes: none; - } - - /* remember to define focus styles! */ - :focus { - outline: 0; - } - - /* remove textarea resize at Safari */ - textarea { - resize: none; - } - - /* remember to highlight inserts somehow! */ - ins { - text-decoration: none; - } - del { - text-decoration: line-through; - } - - /* tables still need 'cellspacing="0"' in the markup */ - table { - border-collapse: collapse; - border-spacing: 0; - } - - - /* - Origional from http://www.perspectived.com/ - Modified by Ben Phelps - Made for FakeTruth - MCServer - */ - - /* Basic ---------------------------------------- */ - - .clear { clear: both; } - - body { - background: white; - font-family: Arial, Helvetica, sans-serif; - font-size: 12px; - color: #646464; - text-align: center; - } - - #wrapper { - text-align: left; - width: 930px; - margin: 0 auto; - } - - /* Logo ---------------------------------------- */ - - h1 { - margin: 15px 0 10px 5px; - width: 180px; - height: 36px; - background: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAALQAAAAkCAMAAAAXdeBDAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAuVQTFRFAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAs7OzAAAAAAAAoqKiAAAAvLy8AAAAlZWVtbW1j4+Pra2tiYmJp6enAAAAhISEoaGhAAAAgICAm5ube3t7lZWVd3d3kZGRc3NzjIyMbGxsg4ODgICAeHh43NzcdXV1cnJyy8vLWVlZbGxswcHB09PTvLy8uLi4tLS0sLCwvLy8uLi4tbW1oaGhnp6era2tm5ubqqqq39/f29vblZWV09PT4ODgz8/P3NzckZGRxcXF0tLSwsLCzs7Oy8vLyMjIt7e3vLy85ubm7u7u3d3d5+fn2tra5OTk19fX1dXV3t7e29vb2dnZ1tbW0dHRv7+/8PDw7u7u6+vr8fHx5ubm4+Pj7Ozs4eHh3t7e5+fn5OTk2tra4uLi39/f1dXV3d3d29vb2dnZ19fX1dXV0tLS9fX18/Pzzs7O7u7u8/PzycnJ6urq6Ojo7+/v5ubm7Ozs4+Pj4eHh39/f5ubm5OTk4uLi4ODg2NjY3Nzc29vb19fX8vLy9/f39fX17e3t8/Pz6+vr8fHx7+/v5+fn7e3t5eXl6+vr6enp6Ojo4ODg39/f9PT0+Pj48fHx9vb27+/v9PT07e3t8/Pz7Ozs8fHx7+/v6Ojo7u7u5+fn7Ozs5eXl6urq5OTk6enp5+fn5ubm5OTk+Pj49/f39fX19PT0+fn58vLy8fHx9fX19PT08vLy8fHx6urq+Pj49vb29fX19PT08vLy8PDw+/v7+vr6+Pj49/f39vb29fX18/Pz/f39+/v7+vr6+fn5+Pj49/f3/f39/Pz8+vr6/v7+/f39a5KrdZmxf6G2iai8kq/BnLbHpr7NsMXSuszYxNPdxmZTynBeznpqztvj0YV11Y+B2OLp2ZmM3aOY4a2j4enu5Liv6MK66/D07MzG8NbR9ODd9fj59+vo+/X0ucu1kQAAANl0Uk5TAAECAwQFBgcICQoLDA0ODxAREhMUFBUWFhcXGBgYGRkaGhsbGxwcHB0dHh4fHyEhIiQkJSYnKCgpKSorLC0uLzAxMjIzMzc4Ojo6Ozs8Pj4/P0BBQ0VISUtLTExNTk5PUFFTV1dYWVpbXFxdXl5fYGBhYmJjZGVmZ2doaWprbGxtbW5ub3BxcXJzdHV2d3l6e3x9fX5+f4CAgYGCg4SIi4yNjY6Oj4+QkJGSkpOTlJSVlZaXmJqbnJ2dnp+foKGip6+wsbKztb6/wMHCw8TOz9DR0tPf4OHv8LXp8fEAAAi/SURBVHja3Zh/dBRXFcdhZ+a9eTPzZnaXmJam0FYUEQWLrVVbqdZaf6EWQW2txN/SWiAmxFqtIlWr9bdWqkbwF6WQYIq/+WFpwSZqTahhg6RhNptkl9nsbjeb2eyv+dv73g6wlcyewXMazvGek3Dm5jLv8+689733vTn/q81ldr5zzsWxuVWr55sbCAiiBCYKAeZ1nYIgigJ4Zh2Zj+0OXesTgQ987pOEZUVVVYXISIJQPi3mJETG0kXADggIL5CRWDMy57kCaDgdBMgK1de0gi2jGsESZJt5iXpjS8utGkHiLFMDIHrNgfJBFYs1i0Ei73iifIAggIEHrNDWnuGpFFg50vEKVYbcArNye0+lUCj13aUgYbahRbInbqbu1zAf2XXpR8bN1CZZYItA1jb0pcaiJrdYorxzIRYFYN7qZC2wTOVXMuR+dqGR2hU3Y4NLFSlwJtGIfmbKNFOt4BIkQndOj5rR8dMpsETMjCae+gASJbLKSSftUsWeSJbWz3aqgXBvPGomOnWWajfRoWOjAN2uIWBedOh0NJoYPvJgW1tb+47I1Jg5Vl6AsPrkZLLU+f5bdjjpzNOzDo1pdzw2Fi2vVlBVFgRMf5oyYXl8lmIk00MJc7S8e6mhU02jerC5JzFavgyRlztWbl9j2NC3lvJbpMDFgJ6Ojh/VZb4XA5KycmhkNAXQOpG1ncDfv9HQQNsQZsK3cNvTn5SQ0lKwCveEdYWQd25BrugxUQHjAl/fPKL9Q2t747F/x82pjSpXC0Gme+EJoNt1Vb2jHI1FVlMmawFWYiQgB6mWCIcOaVgCA2ZX3BEGQyI4vAsXWN1of9Bd8diJZ0dG+3QiwuSRsq4cHf8rgzao3jMWnX5Al88oMdNnAQRPlOlwMrcvrBMYk2WrWmyIqlGqqYRJPE+kwK2a0Jr8wo9nNPzRL/QvTpupH4HsAQ4DLX+ZQQeNN02b8W6DSLWVh5mA+EbcHaKkWhF5sdGWdfREIj0dyzSCBDAJY1nGCKo/r/9uguEB/uQZLQZ8Qe+JxwZffGx0ZGixgiSsbXzOTDz2RQYdDm1PmFNrNXTee+ZKMpO8fP+DhiYjAGLF5oYux86m01nb6bqBACr+4Id1/cZHH7pUxne+HkE63fp7522A5xn9IiHgF7ppM6DuokRWjD7Av+7zDHrevEgsFgkq0vndnVtcMvmhjkUKJFvEyqf7ckkrmU7Dr1zfXQTLXyoWv95ZydnblB8UKut5BYL/Rw4Uih9S6Qav6B9CnD/oSGPj0fFouVmn+sOwUH7W9DmmHg0Nw9H4Xp0IM1Z/KOOFjDVhR7ZqMpbVO5yMlS2eGhw8VYTJOC9RtOPp9Ak7adk/picnMv/UZL5jyO0ly+4INntGP+QfOhxeXY6O9c4L31QeGettaLyHQTeuKJsALQdm3PyI0Na+UtZKl3ZSjS7uzVr23z7e0Nj00t8Wk2nnZaoeSadtK1s6uJD+xLYKLSBOTJp6sklnxXLP6AOXin6XRyRoGLsS5nObm34HctccCrdz6GsYNJ0JmquFrOjNvcV0srQrFN5tW/bh5aHQvPm/KQHFVkULDsK3n/x7s0bURZDqPtAg+DxrSlau+5JOz2gVCX434nGod4uhpDzzielo/HFdD7bXzbSbbBHJmvEAbMjK5qZTyUz/8qCuhzsZxf0qUUODaSt94n06rB3aYVulZhVLMgXRcd5SL1oM+IamCtEeTpmn/wFyt1JV9ba6a9qlZtgKUE9kjn0vb+W/FdapsYtTaBgrDCP/3bAiQX4XD01ke6B8qisdkPf5364TDcy+oQkmRu/YyGmmITKhbXXVwy10DFtSgjsgjX/KWc41IeMshQj+wTT4dBxg3cx2iGHbvCuXdN58yb560XP8Q8sSUpunzOho/xICX73trE5P33yeTgOre0KDNYLp1Y5l/xkwrm0In6UICMSArTUYVmHGMLNlTjLbGw69chj+aWjorhftHxoECWrh43HoouEluAodNNZMzVQRWQty2wJJ5NRIexU0fAz6tU2dVQomyVUM+ExCtXGspvjnLOGh0N460RcELQQkcn15/AnAFxCHbvPqPUSE9xedKyBDHPpqBm1blXc/5lKwfkRSOIbBNwQ8vQEW8x+uexaWtqEb2z2jLxSaadjb/vJWLAUCLnRtlye4bQ7CYPK7Slb+ayrMhfUqt1Ss/PeLlv17RvFVqsisEcQqx2C7+FyqfwmJXqcp2ke9oi8YGl4tSkgSAM6Fph799KcU7SSkLEgJxoSGYYVW3v5MZqIAFN8I65qqvu6RLUQLcgx4r9ukO0n7X5lsr04w0fu9on1CI5VDY4F/fN5DAnRriq3u2pMLrTm5XKVBjcvvDoPTCO8uJSePzr+3YFlp5ztNDUEjuO6pXP4rtAaDp/rI5ETBKn5MRbDl2zyifUMrDFrFgdoeTuHQyrkz4hCcEcF29PMz4lXKlVAk8r3fXHtzey8rw+8JzTtsW5POH++9dkV7twM1ehtlH/w4K6duqteWLCgphiyyJeUd7cMAkDwK0AQ9D5psAuhN5NxpfMQ9jY/y07gsK6ucSSubL1UKWYttJ5UuBY5kruA4BWjf7IOXqxRaoLPJgK5Dh36j0Mo6EJjBEo9on9AifiQeG8BSLbSA7wbou7HHvYcsSUhZ9aQ9YYFN5CJbVRnJ6pLDxYzFLVM8dDkhykA6PSDDe91UQ39X7fV4i+gZ7ceA6tW/HviCVNumwAh4f3k/ljxvmAQBkSs7TpYKheLQnusVJIIMErqxr1TI5QqVvg0gZAjfNzBwH3Lfy0DJeod31ezBO9qXsfOPexqqnQlagGa8y1MJFqviB85bW1o+QiHNTHEENrn3tnZ1tb6RsmMBkyJUcznJ5PIyyRX8OtF+jEsGG/S/fPyIOdOtKZuf2+NhonAPBLqTI6qmKQTDLPhrmbjXjnPmuW60/wtqryt07/tp3oA8z8MdCHHXjBcC7mOd6Bfk7r3udC94aDf6/9T+AzWzIkAbVeu4AAAAAElFTkSuQmCC) no-repeat left top; - } - - h1 a { - display: block; - width: 225px; - height: 28px; - } - - h1 span { display: none; } - - a { - color: #646464; - } - - /* Container ---------------------------------------- */ - - #containerHolder { - background: #eee; - padding: 5px; - } - - - #container { - background: #fff url(data:image/gif;base64,R0lGODlhtAABAIAAAN3d3f///yH5BAAAAAAALAAAAAC0AAEAAAIMjI+py+0Po5y0WgYKADs%3D) repeat-y left top; - border: 1px solid #ddd; - width: 918px; - - } - - #connectHolder { - background: #eee; - padding: 5px; - margin-bottom:8px; - } - - - #connect { - border: 1px solid #ddd; - background-color: #fff; - padding:5px; - width: 908px; - } - - .pics { - height: 375px; - width: 600px; - } - - .pics img { - padding: 5px; - border: 1px solid #ddd; - background-color: #eee; - width: 600px; - height: 375px; - margin-left: 15px; - } - - /* Login -------------------------------------- */ - - #loginLogo { - margin: 0 auto; - margin-top:100px; - width: 180px; - height: 36px; - background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAALQAAAAkCAMAAAAXdeBDAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAuVQTFRFAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAs7OzAAAAAAAAoqKiAAAAvLy8AAAAlZWVtbW1j4+Pra2tiYmJp6enAAAAhISEoaGhAAAAgICAm5ube3t7lZWVd3d3kZGRc3NzjIyMbGxsg4ODgICAeHh43NzcdXV1cnJyy8vLWVlZbGxswcHB09PTvLy8uLi4tLS0sLCwvLy8uLi4tbW1oaGhnp6era2tm5ubqqqq39/f29vblZWV09PT4ODgz8/P3NzckZGRxcXF0tLSwsLCzs7Oy8vLyMjIt7e3vLy85ubm7u7u3d3d5+fn2tra5OTk19fX1dXV3t7e29vb2dnZ1tbW0dHRv7+/8PDw7u7u6+vr8fHx5ubm4+Pj7Ozs4eHh3t7e5+fn5OTk2tra4uLi39/f1dXV3d3d29vb2dnZ19fX1dXV0tLS9fX18/Pzzs7O7u7u8/PzycnJ6urq6Ojo7+/v5ubm7Ozs4+Pj4eHh39/f5ubm5OTk4uLi4ODg2NjY3Nzc29vb19fX8vLy9/f39fX17e3t8/Pz6+vr8fHx7+/v5+fn7e3t5eXl6+vr6enp6Ojo4ODg39/f9PT0+Pj48fHx9vb27+/v9PT07e3t8/Pz7Ozs8fHx7+/v6Ojo7u7u5+fn7Ozs5eXl6urq5OTk6enp5+fn5ubm5OTk+Pj49/f39fX19PT0+fn58vLy8fHx9fX19PT08vLy8fHx6urq+Pj49vb29fX19PT08vLy8PDw+/v7+vr6+Pj49/f39vb29fX18/Pz/f39+/v7+vr6+fn5+Pj49/f3/f39/Pz8+vr6/v7+/f39a5KrdZmxf6G2iai8kq/BnLbHpr7NsMXSuszYxNPdxmZTynBeznpqztvj0YV11Y+B2OLp2ZmM3aOY4a2j4enu5Liv6MK66/D07MzG8NbR9ODd9fj59+vo+/X0ucu1kQAAANl0Uk5TAAECAwQFBgcICQoLDA0ODxAREhMUFBUWFhcXGBgYGRkaGhsbGxwcHB0dHh4fHyEhIiQkJSYnKCgpKSorLC0uLzAxMjIzMzc4Ojo6Ozs8Pj4/P0BBQ0VISUtLTExNTk5PUFFTV1dYWVpbXFxdXl5fYGBhYmJjZGVmZ2doaWprbGxtbW5ub3BxcXJzdHV2d3l6e3x9fX5+f4CAgYGCg4SIi4yNjY6Oj4+QkJGSkpOTlJSVlZaXmJqbnJ2dnp+foKGip6+wsbKztb6/wMHCw8TOz9DR0tPf4OHv8LXp8fEAAAi/SURBVHja3Zh/dBRXFcdhZ+a9eTPzZnaXmJam0FYUEQWLrVVbqdZaf6EWQW2txN/SWiAmxFqtIlWr9bdWqkbwF6WQYIq/+WFpwSZqTahhg6RhNptkl9nsbjeb2eyv+dv73g6wlcyewXMazvGek3Dm5jLv8+689733vTn/q81ldr5zzsWxuVWr55sbCAiiBCYKAeZ1nYIgigJ4Zh2Zj+0OXesTgQ987pOEZUVVVYXISIJQPi3mJETG0kXADggIL5CRWDMy57kCaDgdBMgK1de0gi2jGsESZJt5iXpjS8utGkHiLFMDIHrNgfJBFYs1i0Ei73iifIAggIEHrNDWnuGpFFg50vEKVYbcArNye0+lUCj13aUgYbahRbInbqbu1zAf2XXpR8bN1CZZYItA1jb0pcaiJrdYorxzIRYFYN7qZC2wTOVXMuR+dqGR2hU3Y4NLFSlwJtGIfmbKNFOt4BIkQndOj5rR8dMpsETMjCae+gASJbLKSSftUsWeSJbWz3aqgXBvPGomOnWWajfRoWOjAN2uIWBedOh0NJoYPvJgW1tb+47I1Jg5Vl6AsPrkZLLU+f5bdjjpzNOzDo1pdzw2Fi2vVlBVFgRMf5oyYXl8lmIk00MJc7S8e6mhU02jerC5JzFavgyRlztWbl9j2NC3lvJbpMDFgJ6Ojh/VZb4XA5KycmhkNAXQOpG1ncDfv9HQQNsQZsK3cNvTn5SQ0lKwCveEdYWQd25BrugxUQHjAl/fPKL9Q2t747F/x82pjSpXC0Gme+EJoNt1Vb2jHI1FVlMmawFWYiQgB6mWCIcOaVgCA2ZX3BEGQyI4vAsXWN1of9Bd8diJZ0dG+3QiwuSRsq4cHf8rgzao3jMWnX5Al88oMdNnAQRPlOlwMrcvrBMYk2WrWmyIqlGqqYRJPE+kwK2a0Jr8wo9nNPzRL/QvTpupH4HsAQ4DLX+ZQQeNN02b8W6DSLWVh5mA+EbcHaKkWhF5sdGWdfREIj0dyzSCBDAJY1nGCKo/r/9uguEB/uQZLQZ8Qe+JxwZffGx0ZGixgiSsbXzOTDz2RQYdDm1PmFNrNXTee+ZKMpO8fP+DhiYjAGLF5oYux86m01nb6bqBACr+4Id1/cZHH7pUxne+HkE63fp7522A5xn9IiHgF7ppM6DuokRWjD7Av+7zDHrevEgsFgkq0vndnVtcMvmhjkUKJFvEyqf7ckkrmU7Dr1zfXQTLXyoWv95ZydnblB8UKut5BYL/Rw4Uih9S6Qav6B9CnD/oSGPj0fFouVmn+sOwUH7W9DmmHg0Nw9H4Xp0IM1Z/KOOFjDVhR7ZqMpbVO5yMlS2eGhw8VYTJOC9RtOPp9Ak7adk/picnMv/UZL5jyO0ly+4INntGP+QfOhxeXY6O9c4L31QeGettaLyHQTeuKJsALQdm3PyI0Na+UtZKl3ZSjS7uzVr23z7e0Nj00t8Wk2nnZaoeSadtK1s6uJD+xLYKLSBOTJp6sklnxXLP6AOXin6XRyRoGLsS5nObm34HctccCrdz6GsYNJ0JmquFrOjNvcV0srQrFN5tW/bh5aHQvPm/KQHFVkULDsK3n/x7s0bURZDqPtAg+DxrSlau+5JOz2gVCX434nGod4uhpDzzielo/HFdD7bXzbSbbBHJmvEAbMjK5qZTyUz/8qCuhzsZxf0qUUODaSt94n06rB3aYVulZhVLMgXRcd5SL1oM+IamCtEeTpmn/wFyt1JV9ba6a9qlZtgKUE9kjn0vb+W/FdapsYtTaBgrDCP/3bAiQX4XD01ke6B8qisdkPf5364TDcy+oQkmRu/YyGmmITKhbXXVwy10DFtSgjsgjX/KWc41IeMshQj+wTT4dBxg3cx2iGHbvCuXdN58yb560XP8Q8sSUpunzOho/xICX73trE5P33yeTgOre0KDNYLp1Y5l/xkwrm0In6UICMSArTUYVmHGMLNlTjLbGw69chj+aWjorhftHxoECWrh43HoouEluAodNNZMzVQRWQty2wJJ5NRIexU0fAz6tU2dVQomyVUM+ExCtXGspvjnLOGh0N460RcELQQkcn15/AnAFxCHbvPqPUSE9xedKyBDHPpqBm1blXc/5lKwfkRSOIbBNwQ8vQEW8x+uexaWtqEb2z2jLxSaadjb/vJWLAUCLnRtlye4bQ7CYPK7Slb+ayrMhfUqt1Ss/PeLlv17RvFVqsisEcQqx2C7+FyqfwmJXqcp2ke9oi8YGl4tSkgSAM6Fph799KcU7SSkLEgJxoSGYYVW3v5MZqIAFN8I65qqvu6RLUQLcgx4r9ukO0n7X5lsr04w0fu9on1CI5VDY4F/fN5DAnRriq3u2pMLrTm5XKVBjcvvDoPTCO8uJSePzr+3YFlp5ztNDUEjuO6pXP4rtAaDp/rI5ETBKn5MRbDl2zyifUMrDFrFgdoeTuHQyrkz4hCcEcF29PMz4lXKlVAk8r3fXHtzey8rw+8JzTtsW5POH++9dkV7twM1ehtlH/w4K6duqteWLCgphiyyJeUd7cMAkDwK0AQ9D5psAuhN5NxpfMQ9jY/y07gsK6ucSSubL1UKWYttJ5UuBY5kruA4BWjf7IOXqxRaoLPJgK5Dh36j0Mo6EJjBEo9on9AifiQeG8BSLbSA7wbou7HHvYcsSUhZ9aQ9YYFN5CJbVRnJ6pLDxYzFLVM8dDkhykA6PSDDe91UQ39X7fV4i+gZ7ceA6tW/HviCVNumwAh4f3k/ljxvmAQBkSs7TpYKheLQnusVJIIMErqxr1TI5QqVvg0gZAjfNzBwH3Lfy0DJeod31ezBO9qXsfOPexqqnQlagGa8y1MJFqviB85bW1o+QiHNTHEENrn3tnZ1tb6RsmMBkyJUcznJ5PIyyRX8OtF+jEsGG/S/fPyIOdOtKZuf2+NhonAPBLqTI6qmKQTDLPhrmbjXjnPmuW60/wtqryt07/tp3oA8z8MdCHHXjBcC7mOd6Bfk7r3udC94aDf6/9T+AzWzIkAbVeu4AAAAAElFTkSuQmCC); - } - - #loginHolder { - background: #eee; - padding: 5px; - width: 310px; - margin: 0 auto; - height: 90px; - margin-top:20px; - } - - #login { - padding:10px; - width: 288px; - height: 68px; - border: 1px solid #ddd; - background:#fff; - text-align: left; - } - - - /* Sidebar ---------------------------------------- */ - - #sidebar { - width: 179px; - float: left; - } - - #sidebar .sideNav { width: 179px; } - - #sidebar .sideNav li { border-bottom: 1px solid #ddd; width: 179px; } - - #sidebar .sideNav li a { - display: block; - color: #646464; - background: #f6f6f6; - text-decoration: none; - height: 29px; - line-height: 29px; - padding: 0 19px; - width: 141px; - } - - #sidebar .sideNav li a:hover { background: #fdfcf6; } - - #sidebar .sideNav li a.active, #sidebar .sideNav li a.active:hover { - background: #f0f7fa; - color: #c66653; - } - - /* Breadcrumb ---------------------------------------- */ - - h2 { - width: 718px; - float: right; - color: #646464; - font-size: 16px; - line-height: 16px; - font-weight: bold; - margin: 20px 0 0 0; - padding: 0 0 10px 0; - border-bottom: 1px solid #ddd; - } - - h2 a { - color: #646464; - text-decoration: none; - } - - h2 a.active { color: #c66653; } - - h2 a:hover { text-decoration: underline; } - - /* Content ---------------------------------------- */ - - #main { - width: 700px; - float: right; - padding: 0 19px 0 0; - } - - #main p { - - padding: 10px; - - } - - h3 { - font-size: 14px; - line-height: 14px; - font-weight: bold; - color: #5494af; - padding: 0 0 0 10px; - margin: 20px 0 10px; - } - - h4 { - padding: 0 0 0 10px; - margin: 20px 0 10px; - } - - #main ul { - padding: 0 0 0 10px; - list-style-type: circle; - list-style-position: inside; - } - - #main table { - border-top: 1px solid #ddd; - width: 700px; - } - - #main table tr th { - text-align: left; - background: #f6f6f6; - padding: 0px 20px; - height: 20px; - line-height: 20px; - border-bottom: 1px solid #ddd; - } - - #main table tr td { - background: #f6f6f6; - padding: 0px 20px; - height: 29px; - line-height: 29px; - border-bottom: 1px solid #ddd; - } - - #main table tr.odd td { - background: #fbfbfb; - } - - #main table tr:hover td { background: #fdfcf6; } - - #main table .action { - text-align: right; - padding: 0 20px 0 10px; - } - - #main table tr .action a { margin: 0 0 0 10px; text-decoration: none; color: #9b9b9b; } - #main table tr:hover .action .edit { color: #c5a059; } - #main table tr:hover .action .delete { color: #a02b2b; } - #main table tr:hover .action .view { color: #55a34a; } - - #main table tr:hover .action a:hover { text-decoration: underline; } - - fieldset { - border: 1px solid #ddd; - padding: 19px; - margin: 0 0 20px 0; - background: #fbfbfb; - } - - form p { margin: 0 0 14px 0; float: left; width: 100%; } - - label { - display: block; - width: 100%; - margin: 0 0 7px 0; - line-height: 12px; - } - - /* Footer ---------------------------------------- */ - - #footer { - margin: 10px 0 30px 0; - font-size: 11px; - line-height: 11px; - color: #9B9B9B; - padding: 0 0 0 5px; - } - - #footer a { color: #9B9B9B; } - - #footer a:hover { text-decoration: none; } -</style> - +<link href='http://fonts.googleapis.com/css?family=Open+Sans:400,600,300' rel='stylesheet' type='text/css'> +<link rel="stylesheet" type="text/css" href="/style.css"> </head> - <body> - <div id="wrapper"> - <!-- h1 tag stays for the logo, you can use the a tag for linking the index page --> - <h1> - <a href="]] .. BaseURL .. [["><span>MCServer</span></a> - </h1> - <div id="containerHolder"> - <div id="container"> - <div id="sidebar"> - <ul class="sideNav"> +<div id="wrapper"> + <div id="containerHolder"> + <a href="./" class="title light">MCServer</a> + <div id="container"> + <div id="sidebar"> + <ul class="sideNav"> + <li class='link'><a href=']] .. BaseURL .. [['>Home</a></li> ]]) - + local AllPlugins = WebAdmin:GetPlugins() for key,value in pairs(AllPlugins) do local PluginWebTitle = value:GetWebTitle() local TabNames = value:GetTabNames() if (GetTableSize(TabNames) > 0) then - Output("<li>"..PluginWebTitle.."</li>"); + Output("<li>"..PluginWebTitle.."</li>\n"); for webname,prettyname in pairs(TabNames) do - Output("<li><a href='" .. BaseURL .. PluginWebTitle .. "/" .. webname .. "'>" .. prettyname .. "</a></li>") + Output("<li class='link'><a href='" .. BaseURL .. PluginWebTitle .. "/" .. webname .. "'>" .. prettyname .. "</a></li>\n") end end end @@ -438,30 +116,23 @@ function ShowPage(WebAdmin, TemplateRequest) Output([[ </ul> - <!-- // .sideNav --> - </div> - <!-- // #sidebar --> - <!-- h2 stays for breadcrumbs --> - <h2>Welcome ]] .. TemplateRequest.Request.Username .. [[</h2> - <div id="main"> - <h3>]] .. SubTitle .. [[</h3> - ]] .. PageContent .. [[ - </div> - <!-- // #main --> + </div> + + <div id="main" class="page-]] .. string.lower(PluginPage.PluginName .. "-" .. string.gsub(PluginPage.TabName, "[^a-zA-Z0-9]+", "-")) .. reqParamsClass .. [["> + <h2 class="welcome-msg">Welcome <span class="username">]] .. TemplateRequest.Request.Username .. [[</span></h2> - <div class="clear"></div> + <hr/> - </div> - <!-- // #container --> - </div> - <!-- // #containerHolder --> - - <p id="footer">MCServer is using: ]] .. MemoryUsageKiB / 1024 .. [[ MiB of memory; Current chunk count: ]] .. NumChunks .. [[ </p> + <h3>]] .. SubTitle .. [[</h3> + ]] .. PageContent .. [[</div> + <div class="clear"></div> + </div> </div> - <!-- // #wrapper --> + <div id="footer"><div class="fleft">running MCServer using <span class="bold">]] .. MemoryUsageKiB / 1024 .. [[MB</span> of memory; <span class="bold">]] .. NumChunks .. [[</span> chunks</div><div class="fright">design by <a href="//www.github.com/WebFreak001">WebFreak001</a></div><div class="clear"></div></div> +</div> </body> </html> - ]]) +]]) return table.concat(SiteContent) -end
\ No newline at end of file +end diff --git a/MCServer/webadmin/template_orig.lua b/MCServer/webadmin/template_orig.lua new file mode 100644 index 000000000..a7480f83e --- /dev/null +++ b/MCServer/webadmin/template_orig.lua @@ -0,0 +1,137 @@ +-- Use a table for fast concatenation of strings +local SiteContent = {} +function Output(String) + table.insert(SiteContent, String) +end + + + + + +function GetTableSize(Table) + local Size = 0 + for key,value in pairs(Table) do + Size = Size + 1 + end + return Size +end + + + + + +function GetDefaultPage() + local PM = cRoot:Get():GetPluginManager() + + local SubTitle = "Current Game" + local Content = "" + + Content = Content .. "<h4>Server Name:</h4>" + Content = Content .. "<p>" .. cRoot:Get():GetServer():GetServerID() .. "</p>" + + Content = Content .. "<h4>Plugins:</h4><ul>" + local AllPlugins = PM:GetAllPlugins() + for key,value in pairs(AllPlugins) do + if( value ~= nil and value ~= false ) then + Content = Content .. "<li>" .. key .. " V." .. value:GetVersion() .. "</li>" + end + end + + Content = Content .. "</ul>" + Content = Content .. "<h4>Players:</h4><ul>" + + local AddPlayerToTable = function( Player ) + Content = Content .. "<li>" .. Player:GetName() .. "</li>" + end + cRoot:Get():ForEachPlayer( AddPlayerToTable ) + + Content = Content .. "</ul><br>"; + + return Content, SubTitle +end + + + + + +function ShowPage(WebAdmin, TemplateRequest) + SiteContent = {} + local BaseURL = WebAdmin:GetBaseURL(TemplateRequest.Request.Path) + local Title = "MCServer WebAdmin" + local MemoryUsageKiB = cRoot:GetPhysicalRAMUsage() + local NumChunks = cRoot:Get():GetTotalChunkCount() + local PluginPage = WebAdmin:GetPage(TemplateRequest.Request) + local PageContent = PluginPage.Content + local SubTitle = PluginPage.PluginName + if (PluginPage.TabName ~= "") then + SubTitle = PluginPage.PluginName .. " - " .. PluginPage.TabName + end + if (PageContent == "") then + PageContent, SubTitle = GetDefaultPage() + end + + Output([[ +<!DOCTYPE html> +<head> +<meta http-equiv="Content-Type" content="text/html; charset=utf-8" /> +<link rel="icon" href="/favicon.ico"> +<title>]] .. Title .. [[</title> +<link rel="stylesheet" type="text/css" media="screen" href="/style.css"> +</head> + +<body> + <div id="wrapper"> + <!-- h1 tag stays for the logo, you can use the a tag for linking the index page --> + <h1> + <a href="]] .. BaseURL .. [["><span>MCServer</span></a> + </h1> + <div id="containerHolder"> + <div id="container"> + <div id="sidebar"> + <ul class="sideNav"> + ]]) + + + local AllPlugins = WebAdmin:GetPlugins() + for key,value in pairs(AllPlugins) do + local PluginWebTitle = value:GetWebTitle() + local TabNames = value:GetTabNames() + if (GetTableSize(TabNames) > 0) then + Output("<li>"..PluginWebTitle.."</li>\n"); + + for webname,prettyname in pairs(TabNames) do + Output("<li><a href='" .. BaseURL .. PluginWebTitle .. "/" .. webname .. "'>" .. prettyname .. "</a></li>\n") + end + end + end + + + Output([[ + </ul> + <!-- // .sideNav --> + </div> + <!-- // #sidebar --> + <!-- h2 stays for breadcrumbs --> + <h2>Welcome ]] .. TemplateRequest.Request.Username .. [[</h2> + <div id="main"> + <h3>]] .. SubTitle .. [[</h3> + ]] .. PageContent .. [[ + </div> + <!-- // #main --> + + <div class="clear"></div> + + </div> + <!-- // #container --> + </div> + <!-- // #containerHolder --> + + <p id="footer">MCServer is using: ]] .. MemoryUsageKiB / 1024 .. [[ MiB of memory; Current chunk count: ]] .. NumChunks .. [[ </p> + </div> + <!-- // #wrapper --> +</body> +</html> + ]]) + + return table.concat(SiteContent) +end diff --git a/Nightbuild2008.cmd b/Nightbuild2008.cmd deleted file mode 100644 index bbaea0fb7..000000000 --- a/Nightbuild2008.cmd +++ /dev/null @@ -1,209 +0,0 @@ -@echo off -:: Nightbbuild2008.cmd -:: This script is run every night to produce a new version of MCServer, backup its PDB files and upload the packages to web. -:: When run without parameters, this script pauses at the end and waits for a keypress. -:: To run in an automated scheduler, add any parameter to disable waiting for a keystroke -:: -:: The sript creates a symbol store (a database of PDB files) that can be used as a single entry in MSVC's symbol path, -:: then any executable / crashdump built by this script can be debugged and its symbols will be found automatically by MSVC, -:: without the users needing to specify the build version or anything. -:: In order to support pruning the symstore, a per-month store is created, so that old months can be removed when no longer needed. -:: -:: This script expects a few tools on specific paths, you can pass the correct paths for your system as env vars "zip" and "vc" -:: This script assumes that "git", "symstore" and "touch" are available on PATH. -:: git comes from msysgit -:: symstore comes from Microsoft's Debugging Tools for Windows -:: touch comes from unxtools -:: This script is locale-dependent, because it parses the output of "time" and "date" shell commands - - -:: 7-zip executable (by default it should be on PATH): -if %zip%a == a set zip=7z - -:: Visual C++ compiler executable name: -if %vc%a == a set vc="vcbuild.exe" - - - - -:: Check that the required environment vars are available: -if "a%ftppass%" == "a" ( - echo You need to set FTP password in the ftppass environment variable to upload the files - goto haderror -) -if "a%ftpuser%" == "a" ( - echo You need to set FTP username in the ftpuser environment variable to upload the files - goto haderror -) -if "a%ftpsite%" == "a" ( - echo You need to set FTP server in the ftpsite environment variable to upload the files - goto haderror -) - - - - -:: Get the date and time into vars: -:: This is locale-dependent! -For /f "tokens=2-4 delims=/. " %%a in ('date /t') do ( - set MYYEAR=%%c - set MYMONTH=%%b - set MYDAY=%%a -) -For /f "tokens=1-2 delims=/:" %%a in ('time /t') do (set MYTIME=%%a_%%b) - -echo Performing nightbuild of MC-Server - - - - - -set DONOTPAUSE=y - -:: Update the sources to the latest revision: -git pull -if errorlevel 1 goto haderror - - - -:: Update the external plugins to the latest revision: -git submodule update -if errorlevel 1 goto haderror - - - - -:: Get the Git commit ID into an environment var -For /f "tokens=1 delims=/. " %%a in ('git log -1 --oneline --no-abbrev-commit') do (set COMMITID=%%a) -if errorlevel 1 goto haderror - - - -:: Test if the version is already present, using a "tagfile" that we create upon successful build -set TAGFOLDER=Install\%MYYEAR%_%MYMONTH%\ -set TAGFILE=%TAGFOLDER%built_%COMMITID%.tag -echo Tag file: %TAGFILE% -if exist %TAGFILE% ( - echo Latest version already present, bailing out - goto end -) - - - - - -:: Configure the sources to use the MSVC2008 compiler: -cmake -G "Visual Studio 9 2008" . -if errorlevel 1 goto haderror - - - - - -:: Update the Bindings: -echo Updating Lua bindings -del src\Bindings\Bindings.cpp -del src\Bindings\Bindings.h -set ALLTOLUA_WAIT=N -cd src\Bindings -call AllToLua.bat -cd ..\.. - - - - -:: Compile using VC2008 Express. Do a full rebuild. -echo Setting up VS environment... -call "%VS90COMNTOOLS%\vsvars32.bat" -echo Compiling MCServer... -title MCS Nightbuild -start "vc" /b /wait /low /min %vc% /r MCServer.sln "Release|Win32" -if errorlevel 1 goto haderror - - - - -:: Generate the .example.ini files by running the server without any ini files: -cd MCServer -del groups.ini -del settings.ini -del webadmin.ini -echo stop | MCServer -cd .. - - - -:: Copy all the example ini files into the Install folder for zipping: -copy MCServer\groups.ini Install\groups.example.ini -copy MCServer\settings.ini Install\settings.example.ini -copy MCServer\webadmin.ini Install\webadmin.example.ini - - - - -:: Use 7-zip to compress the resulting files into a single file: -set FILESUFFIX=%MYYEAR%_%MYMONTH%_%MYDAY%_%MYTIME%_%COMMITID% -echo FILESUFFIX=%FILESUFFIX% -copy MCServer\MCServer.exe Install\MCServer.exe -cd Install -%zip% a -mx9 -y MCServer_Win_%FILESUFFIX%.7z -scsWIN -i@Zip2008.list -xr!*.git* -if errorlevel 1 goto haderror -cd .. - -:: Also pack PDBs into a separate archive: -%zip% a -mx9 -y Install\PDBs_%FILESUFFIX%.7z -scsWIN @Install\Zip2008_PDBs.list -if errorlevel 1 goto haderror - - - - - -:: upload to the FTP: -:upload -ncftpput -p %ftppass% -u %ftpuser% -T temp_ %ftpsite% / Install\MCServer_Win_%FILESUFFIX%.7z -if errorlevel 1 goto haderror -ncftpput -p %ftppass% -u %ftpuser% -T temp_ %ftpsite% /PDBs Install\PDBs_%FILESUFFIX%.7z -if errorlevel 1 goto haderror -echo Upload finished. - - - - -:: Create the tagfile so that we know that this CommitID has been built already -mkdir %TAGFOLDER% -touch %TAGFILE% - - - - - -:: Add the symbols to a global symbol cache -:: We want per-month symbol caches, so that the old ones can be easily deleted -set SYMBOLS=Symbols\%MYYEAR%_%MYMONTH%\ -echo Storing symbols in %SYMBOLS% - -symstore add /f MCServer\MCServer.* /s %SYMBOLS% /t MCServer -if errorlevel 1 goto haderror - - - -goto end - - - - -:haderror -echo an error was encountered, check command output above -pause -goto finished - - - - - -:end -if "a%1" == "a" pause - - - -:finished
\ No newline at end of file @@ -5,15 +5,15 @@ MCServer is a Minecraft server that is written in C++ and designed to be efficie MCServer can run on PCs, Macs, and *nix. This includes android phones and tablets as well as Raspberry Pis. -We currently support the protocol from Minecraft 1.2 all the way up to Minecraft 1.7.10. +We currently support the protocol from Minecraft 1.2 all the way up to Minecraft 1.8. Installation ------------ Normally, you will want to download a pre-compiled version of MCServer from one of the buildservers: - * [Linux and Raspberry Pi](http://ci.bearbin.net) (Bearbin's CI Server) - * [Windows](http://mc-server.xoft.cz) (xoft's nightly build service) + * [Windows and Linux](http://builds.cuberite.org) + * [Raspberry Pi](http://builds.cuberite.org) You simply need to download and extract these files before you can use the server. @@ -33,7 +33,7 @@ For other stuff, including plugins and discussion, check the [forums](http://for Earn bitcoins for commits or donate to reward the MCServer developers: [![tip for next commit](http://tip4commit.com/projects/74.svg)](http://tip4commit.com/projects/74) -Support Us on Gittip: [![Support via Gittip](http://img.shields.io/gittip/mcs_team.svg)](https://www.gittip.com/mcs_team) +Support Us on Gratipay: [![Support via Gratipay](http://img.shields.io/gittip/cuberite_team.svg)](https://www.gratipay.com/cuberite_team) Travis CI: [![Build Status](http://img.shields.io/travis/mc-server/MCServer.svg)](https://travis-ci.org/mc-server/MCServer) diff --git a/SetFlags.cmake b/SetFlags.cmake index a5a61eaa4..c0a021c25 100644 --- a/SetFlags.cmake +++ b/SetFlags.cmake @@ -1,3 +1,5 @@ + + macro (add_flags_lnk FLAGS) set(CMAKE_EXE_LINKER_FLAGS "${CMAKE_EXE_LINKER_FLAGS} ${FLAGS}") set(CMAKE_EXE_LINKER_FLAGS_DEBUG "${CMAKE_EXE_LINKER_FLAGS_DEBUG} ${FLAGS}") @@ -57,12 +59,25 @@ macro(set_flags) set(CMAKE_SHARED_LINKER_FLAGS_RELEASE "${CMAKE_SHARED_LINKER_FLAGS_RELEASE} /LTCG") set(CMAKE_MODULE_LINKER_FLAGS_RELEASE "${CMAKE_MODULE_LINKER_FLAGS_RELEASE} /LTCG") elseif(APPLE) - #on os x clang adds pthread for us but we need to add it for gcc - if ("${CMAKE_CXX_COMPILER_ID}" STREQUAL "Clang") + + if("${CMAKE_CXX_COMPILER_ID}" STREQUAL "GNU") + execute_process(COMMAND ${CMAKE_C_COMPILER} -dumpversion + OUTPUT_VARIABLE GCC_VERSION) + endif() + + if("${CMAKE_CXX_COMPILER_ID}" STREQUAL "GNU" AND (NOT GCC_VERSION VERSION_GREATER 4.6)) + set(CMAKE_CXX_FLAGS "${CMAKE_CXX_FLAGS} -std=c++0x") + set(CMAKE_CXX_FLAGS_DEBUG "${CMAKE_CXX_FLAGS_DEBUG} -std=c++0x") + set(CMAKE_CXX_FLAGS_COVERAGE "${CMAKE_CXX_FLAGS_COVERAGE} -std=c++0x") + set(CMAKE_CXX_FLAGS_RELEASE "${CMAKE_CXX_FLAGS_RELEASE} -std=c++0x") + else() set(CMAKE_CXX_FLAGS "${CMAKE_CXX_FLAGS} -std=c++11") set(CMAKE_CXX_FLAGS_DEBUG "${CMAKE_CXX_FLAGS_DEBUG} -std=c++11") set(CMAKE_CXX_FLAGS_COVERAGE "${CMAKE_CXX_FLAGS_COVERAGE} -std=c++11") set(CMAKE_CXX_FLAGS_RELEASE "${CMAKE_CXX_FLAGS_RELEASE} -std=c++11") + endif() + #on os x clang adds pthread for us but we need to add it for gcc + if ("${CMAKE_CXX_COMPILER_ID}" STREQUAL "Clang") add_flags_cxx("-stdlib=libc++") add_flags_lnk("-stdlib=libc++") else() @@ -75,8 +90,17 @@ macro(set_flags) add_flags_cxx("-pthread") endif() - # Make CLang use C++11, otherwise MSVC2008-supported extensions don't work ("override" keyword etc.): - if ("${CMAKE_CXX_COMPILER_ID}" STREQUAL "Clang") + if("${CMAKE_CXX_COMPILER_ID}" STREQUAL "GNU") + execute_process(COMMAND ${CMAKE_C_COMPILER} -dumpversion + OUTPUT_VARIABLE GCC_VERSION) + endif() + + if("${CMAKE_CXX_COMPILER_ID}" STREQUAL "GNU" AND (NOT GCC_VERSION VERSION_GREATER 4.6)) + set(CMAKE_CXX_FLAGS "${CMAKE_CXX_FLAGS} -std=c++0x") + set(CMAKE_CXX_FLAGS_DEBUG "${CMAKE_CXX_FLAGS_DEBUG} -std=c++0x") + set(CMAKE_CXX_FLAGS_COVERAGE "${CMAKE_CXX_FLAGS_COVERAGE} -std=c++0x") + set(CMAKE_CXX_FLAGS_RELEASE "${CMAKE_CXX_FLAGS_RELEASE} -std=c++0x") + else() set(CMAKE_CXX_FLAGS "${CMAKE_CXX_FLAGS} -std=c++11") set(CMAKE_CXX_FLAGS_DEBUG "${CMAKE_CXX_FLAGS_DEBUG} -std=c++11") set(CMAKE_CXX_FLAGS_COVERAGE "${CMAKE_CXX_FLAGS_COVERAGE} -std=c++11") @@ -203,6 +227,15 @@ macro(enable_profile) endif() endmacro() +#this is a hack because we can't use cmake 2.8.10 because of travis +macro(get_clang_version) + execute_process( + COMMAND "${CMAKE_CXX_COMPILER}" "--version" + OUTPUT_VARIABLE CLANG_VERSION_OUTPUT) + string(REGEX MATCH "version ([0-9]\\.[0-9])" x ${CLANG_VERSION_OUTPUT}) + set(CLANG_VERSION ${CMAKE_MATCH_1}) +endmacro() + macro(set_exe_flags) # Remove disabling the maximum warning level: # clang does not like a command line that reads -Wall -Wextra -w -Wall -Wextra and does not output any warnings @@ -221,17 +254,28 @@ macro(set_exe_flags) add_flags_cxx("-ffast-math") if ("${CMAKE_CXX_COMPILER_ID}" STREQUAL "Clang") + get_clang_version() + if ("${CLANG_VERSION}" VERSION_LESS 3.0) + message(FATAL_ERROR "MCServer requires clang version 3.0 or higher, version is ${CLANG_VERSION}") + endif() # clang does not provide the __extern_always_inline macro and a part of libm depends on this when using fast-math add_flags_cxx("-D__extern_always_inline=inline") add_flags_cxx("-Werror -Weverything -Wno-c++98-compat-pedantic -Wno-string-conversion") - add_flags_cxx("-Wno-error=switch-enum -Wno-documentation -Wno-exit-time-destructors") - add_flags_cxx("-Wno-error=sign-conversion -Wno-error=conversion -Wno-padded") - add_flags_cxx("-Wno-error=deprecated -Wno-error=weak-vtables -Wno-error=float-equal") - add_flags_cxx("-Wno-error=missing-prototypes -Wno-error=non-virtual-dtor") - add_flags_cxx("-Wno-error=covered-switch-default -Wno-error=shadow -Wno-error=old-style-cast") - add_flags_cxx("-Wno-error=exit-time-destructors -Wno-error=missing-variable-declarations") - add_flags_cxx("-Wno-error=global-constructors -Wno-implicit-fallthrough") - add_flags_cxx("-Wno-error=extra-semi -Wno-weak-vtables -Wno-switch-enum") + add_flags_cxx("-Wno-exit-time-destructors -Wno-padded") + add_flags_cxx("-Wno-error=sign-conversion -Wno-error=conversion -Wno-error=deprecated") + add_flags_cxx("-Wno-error=missing-prototypes") + add_flags_cxx("-Wno-error=shadow -Wno-error=old-style-cast -Wno-error=global-constructors") + add_flags_cxx("-Wno-error=float-equal") + add_flags_cxx("-Wno-weak-vtables -Wno-switch-enum") + if ("${CLANG_VERSION}" VERSION_GREATER 3.0) + # flags that are not present in 3.0 + add_flags_cxx("-Wno-error=covered-switch-default -Wno-error=missing-variable-declarations") + add_flags_cxx("-Wno-implicit-fallthrough -Wno-error=extra-semi") + endif() + if ("${CLANG_VERSION}" VERSION_GREATER 3.1) + # flags introduced in 3.2 + add_flags_cxx("-Wno-documentation") + endif() endif() endif() diff --git a/Tools/.gitignore b/Tools/.gitignore new file mode 100644 index 000000000..f240e723e --- /dev/null +++ b/Tools/.gitignore @@ -0,0 +1 @@ +Debug/ diff --git a/Tools/AnvilStats/.gitignore b/Tools/AnvilStats/.gitignore index 96210cfc9..f093bbe7d 100644 --- a/Tools/AnvilStats/.gitignore +++ b/Tools/AnvilStats/.gitignore @@ -1,3 +1,7 @@ +*.vcproj +*.vcxproj +*.sln +*.user .xls Statistics.txt *.bmp @@ -7,3 +11,4 @@ Profiling *.png world/ *.html +*.xls diff --git a/Tools/AnvilStats/AnvilStats.sln b/Tools/AnvilStats/AnvilStats.sln deleted file mode 100644 index 46bed8969..000000000 --- a/Tools/AnvilStats/AnvilStats.sln +++ /dev/null @@ -1,55 +0,0 @@ -Microsoft Visual Studio Solution File, Format Version 12.00 -# Visual Studio Express 2013 for Windows Desktop -VisualStudioVersion = 12.0.21005.1 -MinimumVisualStudioVersion = 10.0.40219.1 -Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "AnvilStats", "AnvilStats.vcxproj", "{CF996A5E-0A86-4004-9710-682B06B5AEBA}" - ProjectSection(ProjectDependencies) = postProject - {B61007AC-B557-4B67-A765-E468C0C3A821} = {B61007AC-B557-4B67-A765-E468C0C3A821} - EndProjectSection -EndProject -Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "zlib", "..\..\lib\zlib\zlib.vcxproj", "{B61007AC-B557-4B67-A765-E468C0C3A821}" -EndProject -Global - GlobalSection(SolutionConfigurationPlatforms) = preSolution - Debug|Win32 = Debug|Win32 - DebugProfile|Win32 = DebugProfile|Win32 - MinSizeRel|Win32 = MinSizeRel|Win32 - Release profiled|Win32 = Release profiled|Win32 - Release|Win32 = Release|Win32 - ReleaseProfile|Win32 = ReleaseProfile|Win32 - RelWithDebInfo|Win32 = RelWithDebInfo|Win32 - EndGlobalSection - GlobalSection(ProjectConfigurationPlatforms) = postSolution - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.Debug|Win32.ActiveCfg = Debug|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.Debug|Win32.Build.0 = Debug|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.DebugProfile|Win32.ActiveCfg = Debug|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.DebugProfile|Win32.Build.0 = Debug|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.MinSizeRel|Win32.ActiveCfg = Release|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.MinSizeRel|Win32.Build.0 = Release|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.Release profiled|Win32.ActiveCfg = Release profiled|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.Release profiled|Win32.Build.0 = Release profiled|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.Release|Win32.ActiveCfg = Release|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.Release|Win32.Build.0 = Release|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.ReleaseProfile|Win32.ActiveCfg = Release|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.ReleaseProfile|Win32.Build.0 = Release|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.RelWithDebInfo|Win32.ActiveCfg = Release|Win32 - {CF996A5E-0A86-4004-9710-682B06B5AEBA}.RelWithDebInfo|Win32.Build.0 = Release|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.Debug|Win32.ActiveCfg = Debug|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.Debug|Win32.Build.0 = Debug|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.DebugProfile|Win32.ActiveCfg = DebugProfile|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.DebugProfile|Win32.Build.0 = DebugProfile|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.MinSizeRel|Win32.ActiveCfg = MinSizeRel|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.MinSizeRel|Win32.Build.0 = MinSizeRel|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.Release profiled|Win32.ActiveCfg = Release|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.Release profiled|Win32.Build.0 = Release|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.Release|Win32.ActiveCfg = Release|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.Release|Win32.Build.0 = Release|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.ReleaseProfile|Win32.ActiveCfg = ReleaseProfile|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.ReleaseProfile|Win32.Build.0 = ReleaseProfile|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.RelWithDebInfo|Win32.ActiveCfg = RelWithDebInfo|Win32 - {B61007AC-B557-4B67-A765-E468C0C3A821}.RelWithDebInfo|Win32.Build.0 = RelWithDebInfo|Win32 - EndGlobalSection - GlobalSection(SolutionProperties) = preSolution - HideSolutionNode = FALSE - EndGlobalSection -EndGlobal diff --git a/Tools/AnvilStats/AnvilStats.vcproj b/Tools/AnvilStats/AnvilStats.vcproj deleted file mode 100644 index c7a2e9390..000000000 --- a/Tools/AnvilStats/AnvilStats.vcproj +++ /dev/null @@ -1,468 +0,0 @@ -<?xml version="1.0" encoding="windows-1250"?> -<VisualStudioProject - ProjectType="Visual C++" - Version="9,00" - Name="AnvilStats" - ProjectGUID="{CF996A5E-0A86-4004-9710-682B06B5AEBA}" - RootNamespace="AnvilStats" - Keyword="Win32Proj" - TargetFrameworkVersion="196613" - > - <Platforms> - <Platform - Name="Win32" - /> - </Platforms> - <ToolFiles> - </ToolFiles> - <Configurations> - <Configuration - Name="Debug|Win32" - OutputDirectory="$(SolutionDir)$(ConfigurationName)" - IntermediateDirectory="$(ConfigurationName)" - ConfigurationType="1" - CharacterSet="2" - > - <Tool - Name="VCPreBuildEventTool" - /> - <Tool - Name="VCCustomBuildTool" - /> - <Tool - Name="VCXMLDataGeneratorTool" - /> - <Tool - Name="VCWebServiceProxyGeneratorTool" - /> - <Tool - Name="VCMIDLTool" - /> - <Tool - Name="VCCLCompilerTool" - Optimization="0" - AdditionalIncludeDirectories=""..\..\lib"" - PreprocessorDefinitions="WIN32;_DEBUG;_CONSOLE" - MinimalRebuild="true" - BasicRuntimeChecks="3" - RuntimeLibrary="1" - UsePrecompiledHeader="2" - PrecompiledHeaderThrough="Globals.h" - WarningLevel="3" - DebugInformationFormat="4" - /> - <Tool - Name="VCManagedResourceCompilerTool" - /> - <Tool - Name="VCResourceCompilerTool" - /> - <Tool - Name="VCPreLinkEventTool" - /> - <Tool - Name="VCLinkerTool" - AdditionalDependencies="ws2_32.lib" - LinkIncremental="2" - GenerateDebugInformation="true" - SubSystem="1" - StackReserveSize="16777216" - TargetMachine="1" - /> - <Tool - Name="VCALinkTool" - /> - <Tool - Name="VCManifestTool" - /> - <Tool - Name="VCXDCMakeTool" - /> - <Tool - Name="VCBscMakeTool" - /> - <Tool - Name="VCFxCopTool" - /> - <Tool - Name="VCAppVerifierTool" - /> - <Tool - Name="VCPostBuildEventTool" - /> - </Configuration> - <Configuration - Name="Release|Win32" - OutputDirectory="$(SolutionDir)$(ConfigurationName)" - IntermediateDirectory="$(ConfigurationName)" - ConfigurationType="1" - CharacterSet="2" - WholeProgramOptimization="1" - > - <Tool - Name="VCPreBuildEventTool" - /> - <Tool - Name="VCCustomBuildTool" - /> - <Tool - Name="VCXMLDataGeneratorTool" - /> - <Tool - Name="VCWebServiceProxyGeneratorTool" - /> - <Tool - Name="VCMIDLTool" - /> - <Tool - Name="VCCLCompilerTool" - Optimization="2" - EnableIntrinsicFunctions="true" - AdditionalIncludeDirectories=""..\..\lib"" - PreprocessorDefinitions="WIN32;NDEBUG;_CONSOLE" - RuntimeLibrary="0" - EnableFunctionLevelLinking="true" - UsePrecompiledHeader="2" - PrecompiledHeaderThrough="Globals.h" - WarningLevel="3" - DebugInformationFormat="3" - /> - <Tool - Name="VCManagedResourceCompilerTool" - /> - <Tool - Name="VCResourceCompilerTool" - /> - <Tool - Name="VCPreLinkEventTool" - /> - <Tool - Name="VCLinkerTool" - AdditionalDependencies="ws2_32.lib" - LinkIncremental="1" - GenerateDebugInformation="true" - SubSystem="1" - StackReserveSize="16777216" - OptimizeReferences="2" - EnableCOMDATFolding="2" - TargetMachine="1" - /> - <Tool - Name="VCALinkTool" - /> - <Tool - Name="VCManifestTool" - /> - <Tool - Name="VCXDCMakeTool" - /> - <Tool - Name="VCBscMakeTool" - /> - <Tool - Name="VCFxCopTool" - /> - <Tool - Name="VCAppVerifierTool" - /> - <Tool - Name="VCPostBuildEventTool" - /> - </Configuration> - <Configuration - Name="Release profiled|Win32" - OutputDirectory="$(SolutionDir)$(ConfigurationName)" - IntermediateDirectory="$(ConfigurationName)" - ConfigurationType="1" - CharacterSet="2" - WholeProgramOptimization="1" - > - <Tool - Name="VCPreBuildEventTool" - /> - <Tool - Name="VCCustomBuildTool" - /> - <Tool - Name="VCXMLDataGeneratorTool" - /> - <Tool - Name="VCWebServiceProxyGeneratorTool" - /> - <Tool - Name="VCMIDLTool" - /> - <Tool - Name="VCCLCompilerTool" - Optimization="2" - EnableIntrinsicFunctions="true" - AdditionalIncludeDirectories=""..\..\lib"" - PreprocessorDefinitions="WIN32;NDEBUG;_CONSOLE" - RuntimeLibrary="0" - EnableFunctionLevelLinking="true" - UsePrecompiledHeader="2" - PrecompiledHeaderThrough="Globals.h" - WarningLevel="3" - DebugInformationFormat="3" - /> - <Tool - Name="VCManagedResourceCompilerTool" - /> - <Tool - Name="VCResourceCompilerTool" - /> - <Tool - Name="VCPreLinkEventTool" - /> - <Tool - Name="VCLinkerTool" - AdditionalDependencies="ws2_32.lib" - LinkIncremental="1" - GenerateDebugInformation="true" - SubSystem="1" - StackReserveSize="16777216" - OptimizeReferences="2" - EnableCOMDATFolding="2" - TargetMachine="1" - Profile="true" - /> - <Tool - Name="VCALinkTool" - /> - <Tool - Name="VCManifestTool" - /> - <Tool - Name="VCXDCMakeTool" - /> - <Tool - Name="VCBscMakeTool" - /> - <Tool - Name="VCFxCopTool" - /> - <Tool - Name="VCAppVerifierTool" - /> - <Tool - Name="VCPostBuildEventTool" - /> - </Configuration> - </Configurations> - <References> - </References> - <Files> - <Filter - Name="Source Files" - Filter="cpp;c;cc;cxx;def;odl;idl;hpj;bat;asm;asmx" - UniqueIdentifier="{4FC737F1-C7A5-4376-A066-2A32D752A2FF}" - > - <File - RelativePath=".\AnvilStats.cpp" - > - </File> - <File - RelativePath=".\BiomeMap.cpp" - > - </File> - <File - RelativePath=".\BiomeMap.h" - > - </File> - <File - RelativePath=".\Callback.h" - > - </File> - <File - RelativePath=".\ChunkExtract.cpp" - > - </File> - <File - RelativePath=".\ChunkExtract.h" - > - </File> - <File - RelativePath=".\Globals.cpp" - > - <FileConfiguration - Name="Debug|Win32" - > - <Tool - Name="VCCLCompilerTool" - UsePrecompiledHeader="1" - /> - </FileConfiguration> - <FileConfiguration - Name="Release|Win32" - > - <Tool - Name="VCCLCompilerTool" - UsePrecompiledHeader="1" - /> - </FileConfiguration> - <FileConfiguration - Name="Release profiled|Win32" - > - <Tool - Name="VCCLCompilerTool" - UsePrecompiledHeader="1" - /> - </FileConfiguration> - </File> - <File - RelativePath=".\Globals.h" - > - </File> - <File - RelativePath=".\HeightBiomeMap.cpp" - > - </File> - <File - RelativePath=".\HeightBiomeMap.h" - > - </File> - <File - RelativePath=".\HeightMap.cpp" - > - </File> - <File - RelativePath=".\HeightMap.h" - > - </File> - <File - RelativePath=".\ImageComposingCallback.cpp" - > - </File> - <File - RelativePath=".\ImageComposingCallback.h" - > - </File> - <File - RelativePath=".\Processor.cpp" - > - </File> - <File - RelativePath=".\Processor.h" - > - </File> - <File - RelativePath=".\SpringStats.cpp" - > - </File> - <File - RelativePath=".\SpringStats.h" - > - </File> - <File - RelativePath=".\Statistics.cpp" - > - </File> - <File - RelativePath=".\Statistics.h" - > - </File> - <File - RelativePath=".\Utils.cpp" - > - </File> - <File - RelativePath=".\Utils.h" - > - </File> - </Filter> - <Filter - Name="shared" - > - <File - RelativePath="..\..\src\OSSupport\CriticalSection.cpp" - > - </File> - <File - RelativePath="..\..\src\OSSupport\CriticalSection.h" - > - </File> - <File - RelativePath="..\..\src\Endianness.h" - > - </File> - <File - RelativePath="..\..\src\OSSupport\Event.cpp" - > - </File> - <File - RelativePath="..\..\src\OSSupport\Event.h" - > - </File> - <File - RelativePath="..\..\src\WorldStorage\FastNBT.cpp" - > - <FileConfiguration - Name="Debug|Win32" - > - <Tool - Name="VCCLCompilerTool" - PreprocessorDefinitions="NBT_RESERVE_SIZE=10000" - /> - </FileConfiguration> - <FileConfiguration - Name="Release|Win32" - > - <Tool - Name="VCCLCompilerTool" - PreprocessorDefinitions="NBT_RESERVE_SIZE=10000" - /> - </FileConfiguration> - <FileConfiguration - Name="Release profiled|Win32" - > - <Tool - Name="VCCLCompilerTool" - PreprocessorDefinitions="NBT_RESERVE_SIZE=10000" - /> - </FileConfiguration> - </File> - <File - RelativePath="..\..\src\WorldStorage\FastNBT.h" - > - </File> - <File - RelativePath="..\..\src\OSSupport\File.cpp" - > - </File> - <File - RelativePath="..\..\src\OSSupport\File.h" - > - </File> - <File - RelativePath="..\..\src\OSSupport\GZipFile.cpp" - > - </File> - <File - RelativePath="..\..\src\OSSupport\GZipFile.h" - > - </File> - <File - RelativePath="..\..\src\OSSupport\IsThread.cpp" - > - </File> - <File - RelativePath="..\..\src\OSSupport\IsThread.h" - > - </File> - <File - RelativePath="..\..\src\StringUtils.cpp" - > - </File> - <File - RelativePath="..\..\src\StringUtils.h" - > - </File> - </Filter> - <File - RelativePath=".\AnvilStats.txt" - > - </File> - </Files> - <Globals> - </Globals> -</VisualStudioProject> diff --git a/Tools/AnvilStats/CMakeLists.txt b/Tools/AnvilStats/CMakeLists.txt new file mode 100644 index 000000000..557a4c17a --- /dev/null +++ b/Tools/AnvilStats/CMakeLists.txt @@ -0,0 +1,144 @@ + +cmake_minimum_required (VERSION 2.8.3) + +project (AnvilStats) + +include(../../SetFlags.cmake) + +set_flags() +set_lib_flags() + + +# Set include paths to the used libraries: +include_directories("../../lib") +include_directories("../../src") + + + +function(flatten_files arg1) + set(res "") + foreach(f ${${arg1}}) + get_filename_component(f ${f} ABSOLUTE) + list(APPEND res ${f}) + endforeach() + set(${arg1} "${res}" PARENT_SCOPE) +endfunction() + +add_subdirectory(../../lib/zlib ${CMAKE_CURRENT_BINARY_DIR}/${CMAKE_FILES_DIRECTORY}/lib/zlib) + +set_exe_flags() + +# Include the shared files: +set(SHARED_SRC + ../../src/ByteBuffer.cpp + ../../src/StringUtils.cpp + ../../src/LoggerListeners.cpp + ../../src/Logger.cpp + ../../src/WorldStorage/FastNBT.cpp + ../BiomeVisualiser/BiomeColors.cpp +) + +set(SHARED_HDR + ../../src/ByteBuffer.h + ../../src/StringUtils.h + ../../src/LoggerListeners.h + ../../src/Logger.h + ../../src/WorldStorage/FastNBT.h + ../BiomeVisualiser/BiomeColors.h +) + +set(SHARED_OSS_SRC + ../../src/OSSupport/CriticalSection.cpp + ../../src/OSSupport/Event.cpp + ../../src/OSSupport/File.cpp + ../../src/OSSupport/GZipFile.cpp + ../../src/OSSupport/IsThread.cpp + ../../src/OSSupport/Timer.cpp +) + +set(SHARED_OSS_HDR + ../../src/OSSupport/CriticalSection.h + ../../src/OSSupport/Event.h + ../../src/OSSupport/File.h + ../../src/OSSupport/GZipFile.h + ../../src/OSSupport/IsThread.h + ../../src/OSSupport/Timer.h +) + +flatten_files(SHARED_SRC) +flatten_files(SHARED_HDR) +flatten_files(SHARED_OSS_SRC) +flatten_files(SHARED_OSS_HDR) +source_group("Shared" FILES ${SHARED_SRC} ${SHARED_HDR}) +source_group("Shared\\OSSupport" FILES ${SHARED_OSS_SRC} ${SHARED_OSS_HDR}) + + + +# Include the main source files: +set(SOURCES + AnvilStats.cpp + BiomeMap.cpp + ChunkExtract.cpp + Globals.cpp + HeightBiomeMap.cpp + HeightMap.cpp + ImageComposingCallback.cpp + Processor.cpp + SpringStats.cpp + Statistics.cpp + Utils.cpp +) + +set(HEADERS + BiomeMap.h + Callback.h + ChunkExtract.h + Globals.h + HeightBiomeMap.h + HeightMap.h + ImageComposingCallback.h + Processor.h + SpringStats.h + Statistics.h + Utils.h + + AnvilStats.txt +) + +source_group("" FILES ${SOURCES} ${HEADERS}) + +add_definitions(-DNBT_RESERVE_SIZE=10000) + +add_executable(AnvilStats + ${SOURCES} + ${HEADERS} + ${SHARED_SRC} + ${SHARED_HDR} + ${SHARED_OSS_SRC} + ${SHARED_OSS_HDR} +) + + +target_link_libraries(AnvilStats zlib) + + + + + +# Under MSVC we need to enlarge the default stack size for the executable: +if (MSVC) + get_target_property(TEMP AnvilStats LINK_FLAGS) + if (TEMP STREQUAL "TEMP-NOTFOUND") + SET(TEMP "") # set to empty string + message("LINKER_FLAGS not found") + else () + SET(TEMP "${TEMP} ") # a space to cleanly separate from existing content + message("LINKER_FLAGS: ${LINKER_FLAGS}") + endif () + # append our values + SET(TEMP "${TEMP}/STACK:16777216") + set_target_properties(AnvilStats PROPERTIES LINK_FLAGS ${TEMP}) +endif () + + + diff --git a/Tools/AnvilStats/Globals.h b/Tools/AnvilStats/Globals.h index df1430cc4..21d54739a 100644 --- a/Tools/AnvilStats/Globals.h +++ b/Tools/AnvilStats/Globals.h @@ -241,6 +241,17 @@ public: +/** Clamp value to the specified range. */ +template <typename T> +T Clamp(T a_Value, T a_Min, T a_Max) +{ + return (a_Value < a_Min) ? a_Min : ((a_Value > a_Max) ? a_Max : a_Value); +} + + + + + // Common headers (part 2, with macros): #include "../../src/ChunkDef.h" #include "../../src/BlockID.h" diff --git a/Tools/AnvilStats/Processor.cpp b/Tools/AnvilStats/Processor.cpp index a16f78c18..6c4bb0ad5 100644 --- a/Tools/AnvilStats/Processor.cpp +++ b/Tools/AnvilStats/Processor.cpp @@ -28,6 +28,7 @@ cProcessor::cThread::cThread(cCallback & a_Callback, cProcessor & a_ParentProces m_Callback(a_Callback), m_ParentProcessor(a_ParentProcessor) { + LOG("Created a new thread: %p", this); super::Start(); } @@ -35,11 +36,20 @@ cProcessor::cThread::cThread(cCallback & a_Callback, cProcessor & a_ParentProces +void cProcessor::cThread::WaitForStart(void) +{ + m_HasStarted.Wait(); +} + + + + + void cProcessor::cThread::Execute(void) { - LOG("Started a new thread: %d", cIsThread::GetCurrentID()); + LOG("Started a new thread: %p, ID %d", this, cIsThread::GetCurrentID()); - m_ParentProcessor.m_ThreadsHaveStarted.Set(); + m_HasStarted.Set(); for (;;) { @@ -52,7 +62,7 @@ void cProcessor::cThread::Execute(void) ProcessFile(FileName); } // for-ever - LOG("Thread %d terminated", cIsThread::GetCurrentID()); + LOG("Thread %p (ID %d) terminated", this, cIsThread::GetCurrentID()); } @@ -522,20 +532,18 @@ void cProcessor::ProcessWorld(const AString & a_WorldFolder, cCallbackFactory & #endif // _DEBUG //*/ + // Start all the threads: for (int i = 0; i < NumThreads; i++) { cCallback * Callback = a_CallbackFactory.GetNewCallback(); m_Threads.push_back(new cThread(*Callback, *this)); } - // Wait for the first thread to start processing: - m_ThreadsHaveStarted.Wait(); - - // Wait for all threads to finish - // simply by calling each thread's destructor sequentially + // Wait for all threads to finish: LOG("Waiting for threads to finish"); for (cThreads::iterator itr = m_Threads.begin(), end = m_Threads.end(); itr != end; ++itr) { + (*itr)->WaitForStart(); delete *itr; } // for itr - m_Threads[] LOG("Processor finished"); diff --git a/Tools/AnvilStats/Processor.h b/Tools/AnvilStats/Processor.h index 72fea3081..db50ec619 100644 --- a/Tools/AnvilStats/Processor.h +++ b/Tools/AnvilStats/Processor.h @@ -30,6 +30,7 @@ class cProcessor cCallback & m_Callback; cProcessor & m_ParentProcessor; + cEvent m_HasStarted; // cIsThread override: virtual void Execute(void) override; @@ -48,6 +49,9 @@ class cProcessor public: cThread(cCallback & a_Callback, cProcessor & a_ParentProcessor); + + /** Waits until the thread starts processing the callback code. */ + void WaitForStart(void); } ; typedef std::vector<cThread *> cThreads; @@ -65,10 +69,12 @@ protected: AStringList m_FileQueue; cThreads m_Threads; - cEvent m_ThreadsHaveStarted; // This is signalled by each thread to notify the parent thread that it can start waiting for those threads - + + + /** Populates m_FileQueue with Anvil files from the specified folder. */ void PopulateFileQueue(const AString & a_WorldFolder); + /** Returns one filename from m_FileQueue, and removes the name from the queue. */ AString GetOneFileName(void); } ; diff --git a/Tools/AnvilStats/Statistics.cpp b/Tools/AnvilStats/Statistics.cpp index f7519fd37..c8a98b488 100644 --- a/Tools/AnvilStats/Statistics.cpp +++ b/Tools/AnvilStats/Statistics.cpp @@ -26,9 +26,11 @@ cStatistics::cStats::cStats(void) : m_MinChunkZ(0x7fffffff), m_MaxChunkZ(0x80000000) { - memset(m_BiomeCounts, 0, sizeof(m_BiomeCounts)); - memset(m_BlockCounts, 0, sizeof(m_BlockCounts)); - memset(m_SpawnerEntity, 0, sizeof(m_SpawnerEntity)); + memset(m_BiomeCounts, 0, sizeof(m_BiomeCounts)); + memset(m_BlockCounts, 0, sizeof(m_BlockCounts)); + memset(m_PerHeightBlockCounts, 0, sizeof(m_PerHeightBlockCounts)); + memset(m_PerHeightSpawners, 0, sizeof(m_PerHeightSpawners)); + memset(m_SpawnerEntity, 0, sizeof(m_SpawnerEntity)); } @@ -46,6 +48,11 @@ void cStatistics::cStats::Add(const cStatistics::cStats & a_Stats) for (int j = 0; j <= 255; j++) { m_BlockCounts[i][j] += a_Stats.m_BlockCounts[i][j]; + m_PerHeightBlockCounts[i][j] += a_Stats.m_PerHeightBlockCounts[i][j]; + } + for (int j = 0; j < ARRAYCOUNT(m_PerHeightSpawners[0]); j++) + { + m_PerHeightSpawners[i][j] += a_Stats.m_PerHeightSpawners[i][j]; } } for (int i = 0; i < ARRAYCOUNT(m_SpawnerEntity); i++) @@ -149,6 +156,7 @@ bool cStatistics::OnSection for (int y = 0; y < 16; y++) { + int Height = (int)a_Y * 16 + y; for (int z = 0; z < 16; z++) { for (int x = 0; x < 16; x++) @@ -156,6 +164,7 @@ bool cStatistics::OnSection unsigned char Biome = m_BiomeData[x + 16 * z]; // Cannot use cChunkDef, different datatype unsigned char BlockType = cChunkDef::GetBlock(a_BlockTypes, x, y, z); m_Stats.m_BlockCounts[Biome][BlockType] += 1; + m_Stats.m_PerHeightBlockCounts[Height][BlockType] += 1; } } } @@ -259,16 +268,27 @@ bool cStatistics::OnTileTick( void cStatistics::OnSpawner(cParsedNBT & a_NBT, int a_TileEntityTag) { + // Get the spawned entity type: int EntityIDTag = a_NBT.FindChildByName(a_TileEntityTag, "EntityId"); if ((EntityIDTag < 0) || (a_NBT.GetType(EntityIDTag) != TAG_String)) { return; } eEntityType Ent = GetEntityType(a_NBT.GetString(EntityIDTag)); - if (Ent < ARRAYCOUNT(m_Stats.m_SpawnerEntity)) + if (Ent >= ARRAYCOUNT(m_Stats.m_SpawnerEntity)) { - m_Stats.m_SpawnerEntity[Ent] += 1; + return; + } + m_Stats.m_SpawnerEntity[Ent] += 1; + + // Get the spawner pos: + int PosYTag = a_NBT.FindChildByName(a_TileEntityTag, "y"); + if ((PosYTag < 0) || (a_NBT.GetType(PosYTag) != TAG_Int)) + { + return; } + int BlockY = Clamp(a_NBT.GetInt(PosYTag), 0, 255); + m_Stats.m_PerHeightSpawners[BlockY][Ent] += 1; } @@ -316,10 +336,14 @@ cStatisticsFactory::~cStatisticsFactory() SaveBiomes(); LOG(" BlockTypes.xls"); SaveBlockTypes(); + LOG(" PerHeightBlockTypes.xls"); + SavePerHeightBlockTypes(); LOG(" BiomeBlockTypes.xls"); SaveBiomeBlockTypes(); LOG(" Spawners.xls"); SaveSpawners(); + LOG(" PerHeightSpawners.xls"); + SavePerHeightSpawners(); } @@ -395,6 +419,61 @@ void cStatisticsFactory::SaveBlockTypes(void) +void cStatisticsFactory::SavePerHeightBlockTypes(void) +{ + // Export as two tables: biomes 0-127 and 128-255, because OpenOffice doesn't support more than 256 columns + + cFile f; + if (!f.Open("PerHeightBlockTypes.xls", cFile::fmWrite)) + { + LOG("Cannot write to file PerHeightBlockTypes.xls. Statistics not written."); + return; + } + + // Write header: + f.Printf("Blocks 0 - 127:\nHeight"); + for (int i = 0; i < 128; i++) + { + f.Printf("\t%s(%d)", GetBlockTypeString(i), i); + } + f.Printf("\n"); + + // Write first half: + for (int y = 0; y < 256; y++) + { + f.Printf("%d", y); + for (int BlockType = 0; BlockType < 128; BlockType++) + { + f.Printf("\t%llu", m_CombinedStats.m_PerHeightBlockCounts[y][BlockType]); + } // for BlockType + f.Printf("\n"); + } // for y - height (0 - 127) + f.Printf("\n"); + + // Write second header: + f.Printf("Blocks 128 - 255:\nHeight"); + for (int i = 128; i < 256; i++) + { + f.Printf("\t%s(%d)", GetBlockTypeString(i), i); + } + f.Printf("\n"); + + // Write second half: + for (int y = 0; y < 256; y++) + { + f.Printf("%d", y); + for (int BlockType = 128; BlockType < 256; BlockType++) + { + f.Printf("\t%llu", m_CombinedStats.m_PerHeightBlockCounts[y][BlockType]); + } // for BlockType + f.Printf("\n"); + } // for y - height (0 - 127) +} + + + + + void cStatisticsFactory::SaveBiomeBlockTypes(void) { // Export as two tables: biomes 0-127 and 128-255, because OpenOffice doesn't support more than 256 columns @@ -521,3 +600,41 @@ void cStatisticsFactory::SaveSpawners(void) + +void cStatisticsFactory::SavePerHeightSpawners(void) +{ + cFile f; + if (!f.Open("PerHeightSpawners.xls", cFile::fmWrite)) + { + LOG("Cannot write to file PerHeightSpawners.xls. Statistics not written."); + return; + } + + // Write header: + f.Printf("Height\tTotal"); + for (int i = 0; i < entMax; i++) + { + f.Printf("\t%s", GetEntityTypeString((eEntityType)i)); + } + f.Printf("\n"); + + // Write individual lines: + for (int y = 0; y < 256; y++) + { + UInt64 Total = 0; + for (int i = 0; i < entMax; i++) + { + Total += m_CombinedStats.m_PerHeightSpawners[y][i]; + } + f.Printf("%d\t%llu", y, Total); + for (int i = 0; i < entMax; i++) + { + f.Printf("\t%llu", m_CombinedStats.m_PerHeightSpawners[y][i]); + } + f.Printf("\n"); + } +} + + + + diff --git a/Tools/AnvilStats/Statistics.h b/Tools/AnvilStats/Statistics.h index 53e353f22..1b012e283 100644 --- a/Tools/AnvilStats/Statistics.h +++ b/Tools/AnvilStats/Statistics.h @@ -31,6 +31,8 @@ public: UInt64 m_NumEntities; UInt64 m_NumTileEntities; UInt64 m_NumTileTicks; + UInt64 m_PerHeightBlockCounts[256][256]; // First dimension is the height, second dimension is BlockType + UInt64 m_PerHeightSpawners[256][entMax + 1]; // First dimension is the height, second dimension is spawned entity type int m_MinChunkX, m_MaxChunkX; // X coords range int m_MinChunkZ, m_MaxChunkZ; // Z coords range @@ -74,6 +76,8 @@ protected: virtual bool OnEmptySection(unsigned char a_Y) override; + virtual bool OnSectionsFinished(void) override { return false; } // continue processing + virtual bool OnEntity( const AString & a_EntityType, double a_PosX, double a_PosY, double a_PosZ, @@ -128,9 +132,11 @@ protected: void JoinResults(void); void SaveBiomes(void); void SaveBlockTypes(void); + void SavePerHeightBlockTypes(void); void SaveBiomeBlockTypes(void); void SaveStatistics(void); void SaveSpawners(void); + void SavePerHeightSpawners(void); } ; diff --git a/Tools/AnvilStats/Utils.cpp b/Tools/AnvilStats/Utils.cpp index baa87bd69..d7543cb4c 100644 --- a/Tools/AnvilStats/Utils.cpp +++ b/Tools/AnvilStats/Utils.cpp @@ -272,7 +272,7 @@ extern const char * GetEntityTypeString(eEntityType a_EntityType) int GetNumCores(void) { // Get number of cores by querying the system process affinity mask (Windows-specific) - DWORD Affinity, ProcAffinity; + DWORD_PTR Affinity, ProcAffinity; GetProcessAffinityMask(GetCurrentProcess(), &ProcAffinity, &Affinity); int NumCores = 0; while (Affinity > 0) diff --git a/Tools/BiomeVisualiser/.gitignore b/Tools/BiomeVisualiser/.gitignore deleted file mode 100644 index cfbc9164c..000000000 --- a/Tools/BiomeVisualiser/.gitignore +++ /dev/null @@ -1,4 +0,0 @@ -Debug/ -logs/ -Release/ -Release profiled/ diff --git a/Tools/BiomeVisualiser/BiomeCache.cpp b/Tools/BiomeVisualiser/BiomeCache.cpp deleted file mode 100644 index 7d9301d8f..000000000 --- a/Tools/BiomeVisualiser/BiomeCache.cpp +++ /dev/null @@ -1,338 +0,0 @@ - -// BiomeCache.cpp - -// Implements the cBiomeCache class representing a biome source that caches data from the underlying biome source - -#include "Globals.h" -#include "BiomeCache.h" -#include "Timer.h" - - - - - -static int GetNumCores(void) -{ - // Get number of cores by querying the system process affinity mask - DWORD Affinity, ProcAffinity; - GetProcessAffinityMask(GetCurrentProcess(), &ProcAffinity, &Affinity); - int NumCores = 0; - while (Affinity > 0) - { - if ((Affinity & 1) == 1) - { - NumCores++; - } - Affinity >>= 1; - } // while (Affinity > 0) - return NumCores; -} - - - - - -cBiomeCache::cBiomeCache(void) : - m_Source(NULL), - m_BaseX(-100000), - m_BaseZ(-100000), - m_Available(NULL), - m_IsTerminatingThreads(false) -{ - int NumThreads = GetNumCores(); - NumThreads--; // One core should be left for the system to run on ;) - for (int i = NumThreads; i > 0; i--) - { - cThread * Thread = new cThread(*this); - m_Threads.push_back(Thread); - Thread->Start(); - } -} - - - - -cBiomeCache::~cBiomeCache() -{ - m_IsTerminatingThreads = true; - for (cThreads::iterator itr = m_Threads.begin(), end = m_Threads.end(); itr != end; ++itr) - { - m_evtQueued.Set(); - } - for (cThreads::iterator itr = m_Threads.begin(), end = m_Threads.end(); itr != end; ++itr) - { - delete *itr; - } - m_Threads.clear(); - - SetSource(NULL); -} - - - - - -cBiomeSource::eAvailability cBiomeCache::GetBiome(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a_Biomes) -{ - if (m_Source == NULL) - { - return baNever; - } - - // Look up using the cache: - int x = a_ChunkX - m_BaseX; - int z = a_ChunkZ - m_BaseZ; - if ((x < 0) || (x >= m_Width) || (z < 0) || (z >= m_Height)) - { - // Outside the cached region - return baNever; - } - - cCSLock Lock(m_CS); - cItem * Item = m_Available[x + m_Width * z]; - if (Item == NULL) - { - // Item hasn't been processed yet - return baLater; - } - if (Item->m_IsValid) - { - memcpy(a_Biomes, Item->m_Biomes, sizeof(a_Biomes)); - return baNow; - } - - // Item has been processed, but the underlying source refused to give the data to us - return baNever; -} - - - - - -void cBiomeCache::HintViewArea(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ) -{ - cTimer Timer("Cache: HintViewArea"); - - if ( - (a_MinChunkX == m_BaseX) && - (a_MaxChunkX == m_BaseX + m_Width - 1) && - (a_MinChunkZ == m_BaseZ) && - (a_MaxChunkZ == m_BaseZ + m_Height - 1) - ) - { - // The same set of parameters, bail out - return; - } - - if (m_Source != NULL) - { - m_Source->HintViewArea(a_MinChunkX, a_MaxChunkX, a_MinChunkZ, a_MaxChunkZ); - } - - int NewWidth = a_MaxChunkX - a_MinChunkX + 1; - int NewHeight = a_MaxChunkZ - a_MinChunkZ + 1; - - // Make a new empty cache table: - pItem * NewAvailable = new pItem[NewWidth * NewHeight]; - for (int i = NewWidth * NewHeight - 1; i >= 0; --i) - { - NewAvailable[i] = NULL; - } - - // Move the common contents of the old table into the new table: - cCSLock Lock(m_CS); - for (int z = 0; z < NewHeight; z++) - { - int OldZ = z + a_MinChunkZ - m_BaseZ; - if ((OldZ < 0) || (OldZ >= m_Height)) - { - continue; - } - for (int x = 0; x < NewWidth; x++) - { - int OldX = x + a_MinChunkX - m_BaseX; - if ((OldX < 0) || (OldX >= m_Width)) - { - continue; - } - NewAvailable[x + NewWidth * z] = m_Available[OldX + m_Width * OldZ]; - m_Available[OldX + m_Width * OldZ] = NULL; - } // for x - } // for z - - // All items that aren't common go into the pool: - for (int idx = 0, z = 0; z < m_Height; z++) - { - for (int x = 0; x < m_Width; ++x, ++idx) - { - if (m_Available[idx] != NULL) - { - m_Pool.push_back(m_Available[idx]); - m_Available[idx] = NULL; - } - } - } - - // Replace the cache table: - delete m_Available; - m_Available = NewAvailable; - m_Width = NewWidth; - m_Height = NewHeight; - m_BaseX = a_MinChunkX; - m_BaseZ = a_MinChunkZ; - - // Remove all items outside the coords: - FilterOutItems(m_Queue, a_MinChunkX, a_MaxChunkX, a_MinChunkZ, a_MaxChunkZ); - - // Queue all items from inside the coords into m_Queue: - for (int z = 0; z < NewHeight; z++) - { - for (int x = 0; x < NewWidth; x++) - { - if (m_Available[x + m_Width * z] != NULL) - { - // Already calculated, skip - continue; - } - - if (m_Pool.empty()) - { - m_Pool.push_back(new cItem(x + a_MinChunkX, z + a_MinChunkZ)); - } - ASSERT(!m_Pool.empty()); - m_Pool.back()->m_ChunkX = x + a_MinChunkX; - m_Pool.back()->m_ChunkZ = z + a_MinChunkZ; - m_Queue.push_back(m_Pool.back()); - m_Pool.pop_back(); - m_evtQueued.Set(); - } // for x - } // for z -} - - - - - -void cBiomeCache::SetSource(cBiomeSource * a_Source) -{ - // TODO: Stop all threads, so that they don't use the source anymore! - - delete m_Source; - m_Source = a_Source; - - // Invalidate cache contents: - cCSLock Lock(m_CS); - m_BaseX = -10000; - m_BaseZ = -10000; - m_Pool.splice(m_Pool.end(), m_Queue); -} - - - - - -void cBiomeCache::FilterOutItems(cItems & a_Items, int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ) -{ - for (cItems::iterator itr = a_Items.begin(); itr != a_Items.end();) - { - if ( - ((*itr)->m_ChunkX < a_MinChunkX) || - ((*itr)->m_ChunkX > a_MaxChunkX) || - ((*itr)->m_ChunkX < a_MinChunkX) || - ((*itr)->m_ChunkX > a_MaxChunkX) - ) - { - m_Pool.push_back(*itr); - itr = a_Items.erase(itr); - } - else - { - ++itr; - } - } -} - - - - - -void cBiomeCache::thrProcessQueueItem(void) -{ - if (m_Source == NULL) - { - return; - } - - cItem * Item = NULL; - { - cCSLock Lock(m_CS); - if (m_Queue.empty()) - { - cCSUnlock Unlock(Lock); - m_evtQueued.Wait(); - } - if (m_IsTerminatingThreads || m_Queue.empty()) - { - // We've been woken up only to die / spurious wakeup - return; - } - Item = m_Queue.back(); - m_Queue.pop_back(); - } - - // Process the item: - Item->m_IsValid = (m_Source->GetBiome(Item->m_ChunkX, Item->m_ChunkZ, Item->m_Biomes) == baNow); - - // Store result: - cCSLock Lock(m_CS); - int x = Item->m_ChunkX - m_BaseX; - int z = Item->m_ChunkZ - m_BaseZ; - if ((x < 0) || (x >= m_Width) || (z < 0) || (z >= m_Height)) - { - // The cache rectangle has changed under our fingers, drop this chunk - return; - } - m_Available[x + m_Width * z] = Item; -} - - - - - -/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// -// cBiomeCache::cItem: - -cBiomeCache::cItem::cItem(int a_ChunkX, int a_ChunkZ) : - m_ChunkX(a_ChunkX), - m_ChunkZ(a_ChunkZ) -{ -} - - - - - -/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// -// cBiomeCache::cThread: - -cBiomeCache::cThread::cThread(cBiomeCache & a_Parent) : - super("Biome cache thread"), - m_Parent(a_Parent) -{ -} - - - - - -void cBiomeCache::cThread::Execute(void) -{ - while (!m_ShouldTerminate && !m_Parent.m_IsTerminatingThreads) - { - m_Parent.thrProcessQueueItem(); - } -} - - - - diff --git a/Tools/BiomeVisualiser/BiomeCache.h b/Tools/BiomeVisualiser/BiomeCache.h deleted file mode 100644 index da4d6c761..000000000 --- a/Tools/BiomeVisualiser/BiomeCache.h +++ /dev/null @@ -1,96 +0,0 @@ - -// BiomeCache.h - -// Declares the cBiomeCache class representing a biome source that caches data from the underlying biome source - -/* -This cache works a bit differently than regular caches. -It first receives the hint of area that it will need to provide. -The Cache uses several threads to request biomes from the underlying source to fill that area. -While the area is being filled, requests for biomes may already come, such requests are answered with baLater if no data yet. -*/ - -#pragma once - - - - - -#include "BiomeSource.h" -#include "../src/OSSupport/IsThread.h" - - - - - -class cBiomeCache : - public cBiomeSource -{ -public: - cBiomeCache(void); - ~cBiomeCache(); - - // cBiomeSource overrides: - virtual eAvailability GetBiome(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a_Biomes) override; - virtual void HintViewArea(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ) override; - - void SetSource(cBiomeSource * a_Source); // Takes ownership of the source ptr - -protected: - class cItem - { - public: - cItem(int a_ChunkX, int a_ChunkZ); - - int m_ChunkX; - int m_ChunkZ; - bool m_IsValid; - cChunkDef::BiomeMap m_Biomes; - } ; - - typedef cItem * pItem; - typedef std::list<pItem> cItems; - - class cThread : - public cIsThread - { - typedef cIsThread super; - - public: - cThread(cBiomeCache & a_Parent); - - // cIsThread overrides: - virtual void Execute(void) override; - - protected: - cBiomeCache & m_Parent; - } ; - - typedef std::list<cThread *> cThreads; - - cBiomeSource * m_Source; - - cCriticalSection m_CS; - int m_BaseX; ///< MinChunkX for the m_Available rectangle - int m_BaseZ; ///< MinChunkZ for the m_Available rectangle - int m_Width; ///< Width of the m_Available rectangle - int m_Height; ///< Height of the m_Available rectangle - pItem * m_Available; ///< Items that have already been processed (baNow or baNever), [x + m_Width * z] - cItems m_Queue; ///< Items that are queued for processing (baLater) - cItems m_Pool; ///< Items that are not needed anymore, can be reused for other coords - - cEvent m_evtQueued; // Triggerred when an item is added to m_Queue - - cThreads m_Threads; // Threads that update the cache. - bool m_IsTerminatingThreads; // Set to true to indicate to all threads that they should exit - - /// Removes from a_Items all items that are outside of the given coords, moves those into m_Pool - void FilterOutItems(cItems & a_Items, int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ); - - /// Processes one item from m_Queue into m_Available. Blocks if m_Queue is empty; respects m_IsTerminatingThreads - void thrProcessQueueItem(void); -} ; - - - - diff --git a/Tools/BiomeVisualiser/BiomeColors.cpp b/Tools/BiomeVisualiser/BiomeColors.cpp deleted file mode 100644 index 1fd0cb7a0..000000000 --- a/Tools/BiomeVisualiser/BiomeColors.cpp +++ /dev/null @@ -1,114 +0,0 @@ - -// BiomeColors.cpp - -// Implements the g_BiomeColors[] array preparation based on a stored biome-to-color map - -#include "Globals.h" -#include "BiomeColors.h" - - - - - -int g_BiomeColors[256]; - - - - - -static struct -{ - EMCSBiome Biome; - int Color; -} g_BiomeColorMap[] = -{ - { biOcean, 0x000070 }, - { biPlains, 0x8db360 }, - { biDesert, 0xfa9418 }, - { biExtremeHills, 0x606060 }, - { biForest, 0x056621 }, - { biTaiga, 0x0b6659 }, - { biSwampland, 0x2fffda }, - { biRiver, 0x3030af }, - { biHell, 0x7f0000 }, - { biSky, 0x007fff }, - { biFrozenOcean, 0xa0a0df }, - { biFrozenRiver, 0xa0a0ff }, - { biIcePlains, 0xffffff }, - { biIceMountains, 0xa0a0a0 }, - { biMushroomIsland, 0xff00ff }, - { biMushroomShore, 0xa000ff }, - { biBeach, 0xfade55 }, - { biDesertHills, 0xd25f12 }, - { biForestHills, 0x22551c }, - { biTaigaHills, 0x163933 }, - { biExtremeHillsEdge, 0x7f8f7f }, - { biJungle, 0x537b09 }, - { biJungleHills, 0x2c4205 }, - - { biJungleEdge, 0x628b17 }, - { biDeepOcean, 0x000030 }, - { biStoneBeach, 0xa2a284 }, - { biColdBeach, 0xfaf0c0 }, - { biBirchForest, 0x307444 }, - { biBirchForestHills, 0x1f5f32 }, - { biRoofedForest, 0x40511a }, - { biColdTaiga, 0x31554a }, - { biColdTaigaHills, 0x597d72 }, - { biMegaTaiga, 0x596651 }, - { biMegaTaigaHills, 0x596659 }, - { biExtremeHillsPlus, 0x507050 }, - { biSavanna, 0xbdb25f }, - { biSavannaPlateau, 0xa79d64 }, - { biMesa, 0xd94515 }, - { biMesaPlateauF, 0xb09765 }, - { biMesaPlateau, 0xca8c65 }, - - // M variants: - { biSunflowerPlains, 0xb5db88 }, - { biDesertM, 0xffbc40 }, - { biExtremeHillsM, 0x888888 }, - { biFlowerForest, 0x2d8e49 }, - { biTaigaM, 0x338e81 }, - { biSwamplandM, 0x07f9b2 }, - { biIcePlainsSpikes, 0xb4dcdc }, - { biJungleM, 0x7ba331 }, - { biJungleEdgeM, 0x628b17 }, - { biBirchForestM, 0x589c6c }, - { biBirchForestHillsM, 0x47875a }, - { biRoofedForestM, 0x687942 }, - { biColdTaigaM, 0x243f36 }, - { biMegaSpruceTaiga, 0x454f3e }, - { biMegaSpruceTaigaHills, 0x454f4e }, - { biExtremeHillsPlusM, 0x789878 }, - { biSavannaM, 0xe5da87 }, - { biSavannaPlateauM, 0xa79d74 }, - { biMesaBryce, 0xff6d3d }, - { biMesaPlateauFM, 0xd8bf8d }, - { biMesaPlateauM, 0xf2b48d }, -} ; - - - - - -static class cBiomeColorsInitializer -{ -public: - cBiomeColorsInitializer(void) - { - // Reset all colors to gray: - for (size_t i = 0; i < ARRAYCOUNT(g_BiomeColors); i++) - { - g_BiomeColors[i] = 0x7f7f7f; - } - for (size_t i = 0; i < ARRAYCOUNT(g_BiomeColorMap); i++) - { - g_BiomeColors[g_BiomeColorMap[i].Biome] = g_BiomeColorMap[i].Color; - } - } -} g_Initializer; - - - - diff --git a/Tools/BiomeVisualiser/BiomeColors.h b/Tools/BiomeVisualiser/BiomeColors.h deleted file mode 100644 index 0cb0f578c..000000000 --- a/Tools/BiomeVisualiser/BiomeColors.h +++ /dev/null @@ -1,15 +0,0 @@ - -// BiomeColors.h - -// Declares the g_BiomeColors[] array used for biome color lookup - - - - - -extern int g_BiomeColors[256]; - - - - - diff --git a/Tools/BiomeVisualiser/BiomeRenderer.cpp b/Tools/BiomeVisualiser/BiomeRenderer.cpp deleted file mode 100644 index c0123c08a..000000000 --- a/Tools/BiomeVisualiser/BiomeRenderer.cpp +++ /dev/null @@ -1,119 +0,0 @@ - -// BiomeRenderer.cpp - -// Implements the cBiomeRenderer class representing the rendering engine - -#include "Globals.h" -#include "BiomeRenderer.h" -#include "Pixmap.h" -#include "Timer.h" -#include "BiomeColors.h" - - - - - -cBiomeRenderer::cBiomeRenderer(void) : - m_OriginX(160), - m_OriginY(160), - m_Zoom(1) -{ -} - - - - -void cBiomeRenderer::SetSource(cBiomeSource * a_Source) -{ - m_Cache.SetSource(a_Source); -} - - - - - -bool cBiomeRenderer::Render(cPixmap & a_Pixmap) -{ - cTimer Timer("cBiomeRenderer::Render"); - - int Wid = a_Pixmap.GetWidth(); - int Hei = a_Pixmap.GetHeight(); - - // Hint the approximate view area to the biome source so that it can adjust its caches: - int MinBlockX = ( - m_OriginX) * m_Zoom; - int MaxBlockX = (Wid - m_OriginX) * m_Zoom; - int MinBlockZ = ( - m_OriginY) * m_Zoom; - int MaxBlockZ = (Hei - m_OriginY) * m_Zoom; - m_Cache.HintViewArea(MinBlockX / 16 - 1, MaxBlockX / 16 + 1, MinBlockZ / 16 - 1, MaxBlockZ / 16 + 1); - - // Hold one current chunk of biome data: - int CurChunkX = -10000; - int CurChunkZ = -10000; - cChunkDef::BiomeMap CurBiomes; - - bool res = false; - - for (int y = 0; y < Hei; y++) - { - int BlockZ = (y - m_OriginY) * m_Zoom; - int ChunkZ = (BlockZ >= 0) ? (BlockZ / 16) : ((BlockZ + 1) / 16 - 1); - int RelZ = BlockZ - ChunkZ * 16; - for (int x = 0; x < Wid; x++) - { - int BlockX = (x - m_OriginX) * m_Zoom; - int ChunkX = (BlockX >= 0) ? (BlockX / 16) : ((BlockX + 1) / 16 - 1); - int RelX = BlockX - ChunkX * 16; - if ((ChunkZ != CurChunkZ) || (ChunkX != CurChunkX)) - { - CurChunkX = ChunkX; - CurChunkZ = ChunkZ; - switch (m_Cache.GetBiome(CurChunkX, CurChunkZ, CurBiomes)) - { - case cBiomeSource::baLater: - { - res = true; - // fallthrough: - } - case cBiomeSource::baNever: - { - for (int i = 0; i < ARRAYCOUNT(CurBiomes); i++) - { - CurBiomes[i] = biInvalidBiome; - } - break; - } - } // switch (Biome availability) - } - EMCSBiome Biome = cChunkDef::GetBiome(CurBiomes, RelX, RelZ); - a_Pixmap.SetPixel(x, y, GetBiomeColor(Biome)); - } // for x - } // for y - return res; -} - - - - - -int cBiomeRenderer::GetBiomeColor(EMCSBiome a_Biome) -{ - if ((a_Biome < 0) || (a_Biome >= ARRAYCOUNT(g_BiomeColors))) - { - return 0xff0000; - } - return g_BiomeColors[a_Biome]; -} - - - - - -void cBiomeRenderer::MoveViewBy(int a_OffsX, int a_OffsY) -{ - m_OriginX += a_OffsX; - m_OriginY += a_OffsY; -} - - - - diff --git a/Tools/BiomeVisualiser/BiomeRenderer.h b/Tools/BiomeVisualiser/BiomeRenderer.h deleted file mode 100644 index 752b61811..000000000 --- a/Tools/BiomeVisualiser/BiomeRenderer.h +++ /dev/null @@ -1,55 +0,0 @@ - -// BiomeRenderer.h - -// Declares the cBiomeRenderer class representing the rendering engine - - - - - -#pragma once - -#include "BiomeCache.h" - - - - - -// fwd: Pixmap.h -class cPixmap; - - - - - -class cBiomeRenderer -{ -public: - cBiomeRenderer(void); - - void SetSource(cBiomeSource * a_Source); // Takes ownership of the source - - /// Renders the biomes into the given pixmap. Returns true if some biome data was missing and can be retrieved later - bool Render(cPixmap & a_Pixmap); - - /// Returns the RGB color value for the specified biome - int GetBiomeColor(EMCSBiome a_Biome); - - void MoveViewBy(int a_OffsX, int a_OffsY); - - void SetZoom(int a_NewZoom) - { - m_Zoom = a_NewZoom; - } - -protected: - cBiomeCache m_Cache; - - int m_OriginX; - int m_OriginY; - int m_Zoom; -} ; - - - - diff --git a/Tools/BiomeVisualiser/BiomeSource.h b/Tools/BiomeVisualiser/BiomeSource.h deleted file mode 100644 index 4a5153457..000000000 --- a/Tools/BiomeVisualiser/BiomeSource.h +++ /dev/null @@ -1,37 +0,0 @@ - -// BiomeSource.h - -// Declares the cBiomeSource abstract class used as an interface for getting biomes from any source - -#pragma once - - - - - -#include "ChunkDef.h" - - - - - -class cBiomeSource abstract -{ -public: - enum eAvailability - { - baNow, // Data returned now - baLater, // Data not returned, but will be available later, try again after a while - baNever, // Data not returned, will not be available at all - } ; - - /// Fills a_Biomes with the biomes for the chunk specified - virtual eAvailability GetBiome(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a_Biomes) = 0; - - /// Used to inform the source about the view area that will be queried in the near future. - virtual void HintViewArea(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ) = 0; -} ; - - - - diff --git a/Tools/BiomeVisualiser/BiomeViewWnd.cpp b/Tools/BiomeVisualiser/BiomeViewWnd.cpp deleted file mode 100644 index 7fb61c062..000000000 --- a/Tools/BiomeVisualiser/BiomeViewWnd.cpp +++ /dev/null @@ -1,247 +0,0 @@ - -// BiomeViewWnd.cpp - -// Implements the cBiomeViewWnd class representing the window that displays biomes - -#include "Globals.h" -#include "BiomeViewWnd.h" -#include "BiomeCache.h" -#include "GeneratorBiomeSource.h" -#include "iniFile/iniFile.h" - - - - - -const int TIMER_RERENDER = 1200; - - - - - -cBiomeViewWnd::cBiomeViewWnd(void) : - m_Wnd(NULL), - m_Thunk(&cBiomeViewWnd::WndProc, this), - m_IsLButtonDown(false) -{ -} - - - - - -bool cBiomeViewWnd::Create(HWND a_ParentWnd, LPCTSTR a_Title) -{ - ASSERT(m_Wnd == NULL); - - InitBiomeView(); - - // Create a regular STATIC window, then override its window procedure with our own. No need for obnoxious RegisterWindowClass() stuff. - m_Wnd = CreateWindow("STATIC", a_Title, WS_OVERLAPPEDWINDOW | WS_VISIBLE, 0, 0, 400, 300, a_ParentWnd, NULL, GetModuleHandle(NULL), NULL); - if (m_Wnd == NULL) - { - LOGERROR("Cannot create main window: %d", GetLastError()); - return false; - } - SetWindowLongPtr(m_Wnd, GWLP_WNDPROC, m_Thunk); - - return true; -} - - - - - -void cBiomeViewWnd::InitBiomeView(void) -{ - cIniFile IniFile; - IniFile.ReadFile("world.ini"); - int Seed = IniFile.GetValueSetI("Generator", "Seed", 0); - bool CacheOffByDefault = false; - m_BiomeGen = cBiomeGen::CreateBiomeGen(IniFile, Seed, CacheOffByDefault); - m_Renderer.SetSource(new cGeneratorBiomeSource(m_BiomeGen)); - IniFile.WriteFile("world.ini"); -} - - - - - -void cBiomeViewWnd::SetZoom(int a_NewZoom) -{ - m_Renderer.SetZoom(a_NewZoom); - Redraw(); -} - - - - - -void cBiomeViewWnd::Redraw(void) -{ - if (m_Renderer.Render(m_Pixmap)) - { - SetTimer(m_Wnd, TIMER_RERENDER, 200, NULL); - } - InvalidateRect(m_Wnd, NULL, FALSE); -} - - - - - -LRESULT cBiomeViewWnd::WndProc(HWND a_Wnd, UINT a_Msg, WPARAM wParam, LPARAM lParam) -{ - switch (a_Msg) - { - case WM_CHAR: return OnChar (wParam, lParam); - case WM_CLOSE: return OnClose (); - case WM_COMMAND: return OnCommand (wParam, lParam); - case WM_LBUTTONDOWN: return OnLButtonDown(wParam, lParam); - case WM_LBUTTONUP: return OnLButtonUp (wParam, lParam); - case WM_MOUSEMOVE: return OnMouseMove (wParam, lParam); - case WM_PAINT: return OnPaint (); - case WM_TIMER: return OnTimer (wParam); - } - return ::DefWindowProc(a_Wnd, a_Msg, wParam, lParam); -} - - - - - -LRESULT cBiomeViewWnd::OnChar(WPARAM wParam, LPARAM lParam) -{ - switch (wParam) - { - case '1': SetZoom(1); break; - case '2': SetZoom(2); break; - case '3': SetZoom(3); break; - case '4': SetZoom(4); break; - case '5': SetZoom(5); break; - case '6': SetZoom(6); break; - case '7': SetZoom(7); break; - case '8': SetZoom(8); break; - case 27: - { - // Esc pressed, exit - PostQuitMessage(0); - break; - } - } - return 0; -} - - - - - -LRESULT cBiomeViewWnd::OnClose(void) -{ - PostQuitMessage(0); - return 0; -} - - - - - -LRESULT cBiomeViewWnd::OnCommand(WPARAM wParam, LPARAM lParam) -{ - // TODO: Handle menu commands, when we get menu - return 0; -} - - - - - -LRESULT cBiomeViewWnd::OnLButtonDown(WPARAM wParam, LPARAM lParam) -{ - m_IsLButtonDown = true; - GetCursorPos(&m_MouseDown); - return 0; -} - - - - - -LRESULT cBiomeViewWnd::OnMouseMove(WPARAM wParam, LPARAM lParam) -{ - if (!m_IsLButtonDown) - { - return 0; - } - POINT pnt; - GetCursorPos(&pnt); - m_Renderer.MoveViewBy(pnt.x - m_MouseDown.x, pnt.y - m_MouseDown.y); - m_MouseDown = pnt; - Redraw(); - return 0; -} - - - - - -LRESULT cBiomeViewWnd::OnLButtonUp(WPARAM wParam, LPARAM lParam) -{ - OnMouseMove(wParam, lParam); // Last movement - if the mouse move hasn't been reported due to speed - m_IsLButtonDown = false; - InvalidateRect(m_Wnd, NULL, FALSE); - return 0; -} - - - - - -LRESULT cBiomeViewWnd::OnPaint(void) -{ - PAINTSTRUCT ps; - HDC DC = BeginPaint(m_Wnd, &ps); - - RECT rc; - GetClientRect(m_Wnd, &rc); - int Wid = rc.right - rc.left; - int Hei = rc.bottom - rc.top; - if ((m_Pixmap.GetWidth() != Wid) || (m_Pixmap.GetHeight() != Hei)) - { - m_Pixmap.SetSize(Wid, Hei); - if (m_Renderer.Render(m_Pixmap)) - { - SetTimer(m_Wnd, TIMER_RERENDER, 200, NULL); - } - } - - m_Pixmap.DrawToDC(DC, 0, 0); - - EndPaint(m_Wnd, &ps); - return 0; -} - - - - - -LRESULT cBiomeViewWnd::OnTimer(WPARAM wParam) -{ - switch (wParam) - { - case TIMER_RERENDER: - { - if (!m_Renderer.Render(m_Pixmap)) - { - KillTimer(m_Wnd, TIMER_RERENDER); - } - InvalidateRect(m_Wnd, NULL, FALSE); - break; - } - } - return 0; -} - - - - diff --git a/Tools/BiomeVisualiser/BiomeViewWnd.h b/Tools/BiomeVisualiser/BiomeViewWnd.h deleted file mode 100644 index 70c5e38f2..000000000 --- a/Tools/BiomeVisualiser/BiomeViewWnd.h +++ /dev/null @@ -1,69 +0,0 @@ - -// BiomeViewWnd.h - -// Declares the cBiomeViewWnd class representing the window that displays biomes - - - - - -#pragma once - -#include "WndProcThunk.h" -#include "BiomeRenderer.h" -#include "BiomeCache.h" -#include "Pixmap.h" - - - - - -// fwd: -class cBiomeGen; - - - - - -class cBiomeViewWnd -{ -public: - cBiomeViewWnd(void); - - bool Create(HWND a_ParentWnd, LPCTSTR a_Title); - -protected: - HWND m_Wnd; - CWndProcThunk<cBiomeViewWnd> m_Thunk; - - cBiomeRenderer m_Renderer; - cPixmap m_Pixmap; - - /// The generator that is to be visualised - cBiomeGen * m_BiomeGen; - - bool m_IsLButtonDown; - POINT m_MouseDown; - - - void InitBiomeView(void); - - void SetZoom(int a_NewZoom); - void Redraw(void); - - LRESULT WndProc(HWND a_Wnd, UINT a_Msg, WPARAM wParam, LPARAM lParam); - - // Message handlers: - LRESULT OnChar (WPARAM wParam, LPARAM lParam); - LRESULT OnClose (void); - LRESULT OnCommand (WPARAM wParam, LPARAM lParam); - LRESULT OnLButtonDown(WPARAM wParam, LPARAM lParam); - LRESULT OnMouseMove (WPARAM wParam, LPARAM lParam); - LRESULT OnLButtonUp (WPARAM wParam, LPARAM lParam); - LRESULT OnPaint (void); - LRESULT OnTimer (WPARAM wParam); -} ; - - - - diff --git a/Tools/BiomeVisualiser/BiomeVisualiser.cpp b/Tools/BiomeVisualiser/BiomeVisualiser.cpp deleted file mode 100644 index a36111d77..000000000 --- a/Tools/BiomeVisualiser/BiomeVisualiser.cpp +++ /dev/null @@ -1,52 +0,0 @@ - -// BiomeVisualiser.cpp - -// Implements the cBiomeVisualiser class representing the entire app. Also implements the WinMain() entrypoint - -#include "Globals.h" -#include "time.h" -#include "BiomeVisualiser.h" - - - - - -int WINAPI WinMain(HINSTANCE a_Instance, HINSTANCE a_PrevInstance, LPSTR a_CmdLine, int a_ShowCmd) -{ - cBiomeVisualiser App; - return App.Run(); -} - - - - - -cBiomeVisualiser::cBiomeVisualiser(void) : - m_Logger(new cMCLogger(Printf("BiomeVisualiser_%08x.log", time(NULL)))) -{ -} - - - - - -int cBiomeVisualiser::Run(void) -{ - if (!m_MainWnd.Create(GetDesktopWindow(), TEXT("BiomeVisualiser"))) - { - LOGERROR("Cannot create main window: %d", GetLastError()); - return 1; - } - - MSG msg; - while (GetMessage(&msg, NULL, 0, 0)) - { - TranslateMessage(&msg); - DispatchMessage(&msg); - } // while (GetMessage) - return msg.lParam; -} - - - - diff --git a/Tools/BiomeVisualiser/BiomeVisualiser.h b/Tools/BiomeVisualiser/BiomeVisualiser.h deleted file mode 100644 index 4f8ce7513..000000000 --- a/Tools/BiomeVisualiser/BiomeVisualiser.h +++ /dev/null @@ -1,31 +0,0 @@ - -// BiomeVisualiser.h - -// Declares the cBiomeVisualiser class representing the entire application - - - - - -#include "BiomeViewWnd.h" - - - - - -class cBiomeVisualiser -{ -public: - cBiomeVisualiser(void); - - int Run(void); - -protected: - cBiomeViewWnd m_MainWnd; - - cMCLogger * m_Logger; -} ; - - - - diff --git a/Tools/BiomeVisualiser/BiomeVisualiser.sln b/Tools/BiomeVisualiser/BiomeVisualiser.sln deleted file mode 100644 index bdfb586b1..000000000 --- a/Tools/BiomeVisualiser/BiomeVisualiser.sln +++ /dev/null @@ -1,23 +0,0 @@ - -Microsoft Visual Studio Solution File, Format Version 10.00 -# Visual C++ Express 2008 -Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "BiomeVisualiser", "BiomeVisualiser.vcproj", "{6DF3D88B-AD47-45B6-B831-1BDE74F86B5C}" -EndProject -Global - GlobalSection(SolutionConfigurationPlatforms) = preSolution - Debug|Win32 = Debug|Win32 - Release profiled|Win32 = Release profiled|Win32 - Release|Win32 = Release|Win32 - EndGlobalSection - GlobalSection(ProjectConfigurationPlatforms) = postSolution - {6DF3D88B-AD47-45B6-B831-1BDE74F86B5C}.Debug|Win32.ActiveCfg = Debug|Win32 - {6DF3D88B-AD47-45B6-B831-1BDE74F86B5C}.Debug|Win32.Build.0 = Debug|Win32 - {6DF3D88B-AD47-45B6-B831-1BDE74F86B5C}.Release profiled|Win32.ActiveCfg = Release profiled|Win32 - {6DF3D88B-AD47-45B6-B831-1BDE74F86B5C}.Release profiled|Win32.Build.0 = Release profiled|Win32 - {6DF3D88B-AD47-45B6-B831-1BDE74F86B5C}.Release|Win32.ActiveCfg = Release|Win32 - {6DF3D88B-AD47-45B6-B831-1BDE74F86B5C}.Release|Win32.Build.0 = Release|Win32 - EndGlobalSection - GlobalSection(SolutionProperties) = preSolution - HideSolutionNode = FALSE - EndGlobalSection -EndGlobal diff --git a/Tools/BiomeVisualiser/BiomeVisualiser.vcproj b/Tools/BiomeVisualiser/BiomeVisualiser.vcproj deleted file mode 100644 index 3de564ad4..000000000 --- a/Tools/BiomeVisualiser/BiomeVisualiser.vcproj +++ /dev/null @@ -1,527 +0,0 @@ -<?xml version="1.0" encoding="windows-1250"?> -<VisualStudioProject - ProjectType="Visual C++" - Version="9,00" - Name="BiomeVisualiser" - ProjectGUID="{6DF3D88B-AD47-45B6-B831-1BDE74F86B5C}" - RootNamespace="BiomeVisualiser" - Keyword="Win32Proj" - TargetFrameworkVersion="196613" - > - <Platforms> - <Platform - Name="Win32" - /> - </Platforms> - <ToolFiles> - </ToolFiles> - <Configurations> - <Configuration - Name="Debug|Win32" - OutputDirectory="$(SolutionDir)$(ConfigurationName)" - IntermediateDirectory="$(ConfigurationName)" - ConfigurationType="1" - CharacterSet="2" - > - <Tool - Name="VCPreBuildEventTool" - /> - <Tool - Name="VCCustomBuildTool" - /> - <Tool - Name="VCXMLDataGeneratorTool" - /> - <Tool - Name="VCWebServiceProxyGeneratorTool" - /> - <Tool - Name="VCMIDLTool" - /> - <Tool - Name="VCCLCompilerTool" - Optimization="0" - AdditionalIncludeDirectories="../../src;../../lib" - PreprocessorDefinitions="WIN32;_DEBUG;_WINDOWS" - MinimalRebuild="true" - BasicRuntimeChecks="3" - RuntimeLibrary="1" - UsePrecompiledHeader="2" - PrecompiledHeaderThrough="Globals.h" - WarningLevel="3" - DebugInformationFormat="4" - /> - <Tool - Name="VCManagedResourceCompilerTool" - /> - <Tool - Name="VCResourceCompilerTool" - /> - <Tool - Name="VCPreLinkEventTool" - /> - <Tool - Name="VCLinkerTool" - AdditionalDependencies="ws2_32.lib" - LinkIncremental="2" - GenerateDebugInformation="true" - SubSystem="2" - TargetMachine="1" - /> - <Tool - Name="VCALinkTool" - /> - <Tool - Name="VCManifestTool" - /> - <Tool - Name="VCXDCMakeTool" - /> - <Tool - Name="VCBscMakeTool" - /> - <Tool - Name="VCFxCopTool" - /> - <Tool - Name="VCAppVerifierTool" - /> - <Tool - Name="VCPostBuildEventTool" - /> - </Configuration> - <Configuration - Name="Release|Win32" - OutputDirectory="$(SolutionDir)$(ConfigurationName)" - IntermediateDirectory="$(ConfigurationName)" - ConfigurationType="1" - CharacterSet="2" - WholeProgramOptimization="1" - > - <Tool - Name="VCPreBuildEventTool" - /> - <Tool - Name="VCCustomBuildTool" - /> - <Tool - Name="VCXMLDataGeneratorTool" - /> - <Tool - Name="VCWebServiceProxyGeneratorTool" - /> - <Tool - Name="VCMIDLTool" - /> - <Tool - Name="VCCLCompilerTool" - Optimization="2" - InlineFunctionExpansion="2" - EnableIntrinsicFunctions="true" - FavorSizeOrSpeed="1" - AdditionalIncludeDirectories="../../src;../../lib" - PreprocessorDefinitions="WIN32;NDEBUG;_WINDOWS" - RuntimeLibrary="0" - EnableFunctionLevelLinking="true" - EnableEnhancedInstructionSet="2" - UsePrecompiledHeader="2" - PrecompiledHeaderThrough="Globals.h" - WarningLevel="3" - DebugInformationFormat="3" - /> - <Tool - Name="VCManagedResourceCompilerTool" - /> - <Tool - Name="VCResourceCompilerTool" - /> - <Tool - Name="VCPreLinkEventTool" - /> - <Tool - Name="VCLinkerTool" - AdditionalDependencies="ws2_32.lib" - LinkIncremental="1" - GenerateDebugInformation="true" - SubSystem="2" - OptimizeReferences="2" - EnableCOMDATFolding="2" - TargetMachine="1" - /> - <Tool - Name="VCALinkTool" - /> - <Tool - Name="VCManifestTool" - /> - <Tool - Name="VCXDCMakeTool" - /> - <Tool - Name="VCBscMakeTool" - /> - <Tool - Name="VCFxCopTool" - /> - <Tool - Name="VCAppVerifierTool" - /> - <Tool - Name="VCPostBuildEventTool" - /> - </Configuration> - <Configuration - Name="Release profiled|Win32" - OutputDirectory="$(SolutionDir)$(ConfigurationName)" - IntermediateDirectory="$(ConfigurationName)" - ConfigurationType="1" - CharacterSet="2" - WholeProgramOptimization="1" - > - <Tool - Name="VCPreBuildEventTool" - /> - <Tool - Name="VCCustomBuildTool" - /> - <Tool - Name="VCXMLDataGeneratorTool" - /> - <Tool - Name="VCWebServiceProxyGeneratorTool" - /> - <Tool - Name="VCMIDLTool" - /> - <Tool - Name="VCCLCompilerTool" - Optimization="2" - InlineFunctionExpansion="2" - EnableIntrinsicFunctions="true" - FavorSizeOrSpeed="1" - AdditionalIncludeDirectories="../../src;../../lib" - PreprocessorDefinitions="WIN32;NDEBUG;_WINDOWS" - RuntimeLibrary="0" - EnableFunctionLevelLinking="true" - EnableEnhancedInstructionSet="2" - UsePrecompiledHeader="2" - PrecompiledHeaderThrough="Globals.h" - WarningLevel="3" - DebugInformationFormat="3" - /> - <Tool - Name="VCManagedResourceCompilerTool" - /> - <Tool - Name="VCResourceCompilerTool" - /> - <Tool - Name="VCPreLinkEventTool" - /> - <Tool - Name="VCLinkerTool" - AdditionalDependencies="ws2_32.lib" - LinkIncremental="1" - GenerateDebugInformation="true" - SubSystem="2" - OptimizeReferences="2" - EnableCOMDATFolding="2" - TargetMachine="1" - Profile="true" - /> - <Tool - Name="VCALinkTool" - /> - <Tool - Name="VCManifestTool" - /> - <Tool - Name="VCXDCMakeTool" - /> - <Tool - Name="VCBscMakeTool" - /> - <Tool - Name="VCFxCopTool" - /> - <Tool - Name="VCAppVerifierTool" - /> - <Tool - Name="VCPostBuildEventTool" - /> - </Configuration> - </Configurations> - <References> - </References> - <Files> - <Filter - Name="Source Files" - Filter="cpp;c;cc;cxx;def;odl;idl;hpj;bat;asm;asmx" - UniqueIdentifier="{4FC737F1-C7A5-4376-A066-2A32D752A2FF}" - > - <File - RelativePath=".\BiomeCache.cpp" - > - </File> - <File - RelativePath=".\BiomeCache.h" - > - </File> - <File - RelativePath=".\BiomeColors.cpp" - > - </File> - <File - RelativePath=".\BiomeColors.h" - > - </File> - <File - RelativePath=".\BiomeRenderer.cpp" - > - </File> - <File - RelativePath=".\BiomeRenderer.h" - > - </File> - <File - RelativePath=".\BiomeSource.h" - > - </File> - <File - RelativePath=".\BiomeViewWnd.cpp" - > - </File> - <File - RelativePath=".\BiomeViewWnd.h" - > - </File> - <File - RelativePath=".\BiomeVisualiser.cpp" - > - </File> - <File - RelativePath=".\BiomeVisualiser.h" - > - </File> - <File - RelativePath=".\GeneratorBiomeSource.h" - > - </File> - <File - RelativePath=".\Pixmap.cpp" - > - </File> - <File - RelativePath=".\Pixmap.h" - > - </File> - <File - RelativePath=".\Timer.h" - > - </File> - <File - RelativePath=".\WndProcThunk.h" - > - </File> - <Filter - Name="Shared" - > - <File - RelativePath="..\..\src\BiomeDef.cpp" - > - </File> - <File - RelativePath="..\..\src\BiomeDef.h" - > - </File> - <File - RelativePath="..\..\src\BlockID.cpp" - > - </File> - <File - RelativePath="..\..\src\BlockID.h" - > - </File> - <File - RelativePath="..\..\src\ChunkDef.h" - > - </File> - <File - RelativePath="..\..\src\Enchantments.cpp" - > - </File> - <File - RelativePath="..\..\src\Enchantments.h" - > - </File> - <File - RelativePath="..\..\src\WorldStorage\FastNBT.cpp" - > - </File> - <File - RelativePath="..\..\src\WorldStorage\FastNBT.h" - > - </File> - <File - RelativePath="..\..\src\FastRandom.cpp" - > - </File> - <File - RelativePath="..\..\src\FastRandom.h" - > - </File> - <File - RelativePath="..\..\src\Globals.cpp" - > - <FileConfiguration - Name="Debug|Win32" - > - <Tool - Name="VCCLCompilerTool" - UsePrecompiledHeader="1" - /> - </FileConfiguration> - <FileConfiguration - Name="Release|Win32" - > - <Tool - Name="VCCLCompilerTool" - UsePrecompiledHeader="1" - /> - </FileConfiguration> - <FileConfiguration - Name="Release profiled|Win32" - > - <Tool - Name="VCCLCompilerTool" - UsePrecompiledHeader="1" - /> - </FileConfiguration> - </File> - <File - RelativePath="..\..\src\Globals.h" - > - </File> - <File - RelativePath="..\..\src\Item.h" - > - </File> - <File - RelativePath="..\..\src\Log.cpp" - > - </File> - <File - RelativePath="..\..\src\Log.h" - > - </File> - <File - RelativePath="..\..\src\MCLogger.cpp" - > - </File> - <File - RelativePath="..\..\src\MCLogger.h" - > - </File> - <File - RelativePath="..\..\src\Noise.cpp" - > - </File> - <File - RelativePath="..\..\src\Noise.h" - > - </File> - <File - RelativePath="..\..\src\Noise.inc" - > - </File> - <File - RelativePath="..\..\src\StringUtils.cpp" - > - </File> - <File - RelativePath="..\..\src\StringUtils.h" - > - </File> - <File - RelativePath="..\..\src\VoronoiMap.cpp" - > - </File> - <File - RelativePath="..\..\src\VoronoiMap.h" - > - </File> - <Filter - Name="OSSupport" - > - <File - RelativePath="..\..\src\OSSupport\CriticalSection.cpp" - > - </File> - <File - RelativePath="..\..\src\OSSupport\CriticalSection.h" - > - </File> - <File - RelativePath="..\..\src\OSSupport\Event.cpp" - > - </File> - <File - RelativePath="..\..\src\OSSupport\Event.h" - > - </File> - <File - RelativePath="..\..\src\OSSupport\File.cpp" - > - </File> - <File - RelativePath="..\..\src\OSSupport\File.h" - > - </File> - <File - RelativePath="..\..\src\OSSupport\IsThread.cpp" - > - </File> - <File - RelativePath="..\..\src\OSSupport\IsThread.h" - > - </File> - <File - RelativePath="..\..\src\OSSupport\Sleep.h" - > - </File> - </Filter> - <Filter - Name="Generating" - > - <File - RelativePath="..\..\src\Generating\BioGen.cpp" - > - </File> - <File - RelativePath="..\..\src\Generating\BioGen.h" - > - </File> - <File - RelativePath="..\..\src\Generating\ComposableGenerator.h" - > - </File> - </Filter> - <Filter - Name="iniFile" - > - <File - RelativePath="..\..\lib\iniFile\iniFile.cpp" - > - </File> - <File - RelativePath="..\..\lib\iniFile\iniFile.h" - > - </File> - </Filter> - </Filter> - </Filter> - </Files> - <Globals> - </Globals> -</VisualStudioProject> diff --git a/Tools/BiomeVisualiser/GeneratorBiomeSource.h b/Tools/BiomeVisualiser/GeneratorBiomeSource.h deleted file mode 100644 index 751aed245..000000000 --- a/Tools/BiomeVisualiser/GeneratorBiomeSource.h +++ /dev/null @@ -1,42 +0,0 @@ - -// GeneratorBiomeSource.h - -// Declares the cGeneratorBiomeSource that adapts a cBiomeGen into a cBiomeSource - -#include "../src/Generating/BioGen.h" -#include "BiomeSource.h" - - - - - -class cGeneratorBiomeSource : - public cBiomeSource -{ -public: - cGeneratorBiomeSource(cBiomeGen * a_Generator) : m_Generator(a_Generator) {} // Takes ownership of the generator ptr - - ~cGeneratorBiomeSource() - { - delete m_Generator; - } - - // cBiomeSource overrides: - virtual eAvailability GetBiome(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a_Biomes) override - { - m_Generator->GenBiomes(a_ChunkX, a_ChunkZ, a_Biomes); - return baNow; - } - - virtual void HintViewArea(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ) override - { - // Nothing needed - } - -protected: - cBiomeGen * m_Generator; -} ; - - - - diff --git a/Tools/BiomeVisualiser/Pixmap.cpp b/Tools/BiomeVisualiser/Pixmap.cpp deleted file mode 100644 index 1a80cf465..000000000 --- a/Tools/BiomeVisualiser/Pixmap.cpp +++ /dev/null @@ -1,120 +0,0 @@ - -// Pixmap.cpp - -// Implements the cPixmap class that represents a RGB pixmap and allows simple operations on it - -#include "Globals.h" -#include "Pixmap.h" - - - - - -cPixmap::cPixmap(void) : - m_Width(0), - m_Height(0), - m_Stride(0), - m_Pixels(NULL) -{ -} - - - - - -cPixmap::cPixmap(int a_Width, int a_Height) : - m_Width(0), - m_Height(0), - m_Stride(0), - m_Pixels(NULL) -{ - SetSize(a_Width, a_Height); -} - - - - - -cPixmap::~cPixmap() -{ - delete m_Pixels; -} - - - - - -void cPixmap::SetSize(int a_Width, int a_Height) -{ - delete m_Pixels; - m_Pixels = new int[a_Width * a_Height]; - m_Width = a_Width; - m_Height = a_Height; - m_Stride = m_Width; // Currently we don't need a special stride value, but let's support it for the future :) -} - - - - - -void cPixmap::SetPixel(int a_X, int a_Y, int a_Color) -{ - ASSERT(a_X >= 0); - ASSERT(a_X < m_Width); - ASSERT(a_Y >= 0); - ASSERT(a_Y < m_Height); - - m_Pixels[a_X + a_Y * m_Stride] = a_Color; -} - - - - - -int cPixmap::GetPixel(int a_X, int a_Y) const -{ - ASSERT(a_X >= 0); - ASSERT(a_X < m_Width); - ASSERT(a_Y >= 0); - ASSERT(a_Y < m_Height); - - return m_Pixels[a_X + a_Y * m_Stride]; -} - - - - - -void cPixmap::Fill(int a_Color) -{ - int NumElements = m_Height * m_Stride; - for (int i = 0; i < NumElements; i++) - { - m_Pixels[i] = a_Color; - } -} - - - - - -void cPixmap::DrawToDC(HDC a_DC, int a_OriginX, int a_OriginY) -{ - BITMAPINFO bmi; - bmi.bmiHeader.biSize = sizeof(bmi.bmiHeader); - bmi.bmiHeader.biWidth = m_Width; - bmi.bmiHeader.biHeight = -m_Height; // Negative, we are top-down, unlike BMPs - bmi.bmiHeader.biPlanes = 1; - bmi.bmiHeader.biBitCount = 32; - bmi.bmiHeader.biCompression = BI_RGB; - bmi.bmiHeader.biSizeImage = m_Stride * m_Height * 4; - bmi.bmiHeader.biXPelsPerMeter = 1440; - bmi.bmiHeader.biYPelsPerMeter = 1440; - bmi.bmiHeader.biClrUsed = 0; - bmi.bmiHeader.biClrImportant = 0; - SetDIBitsToDevice(a_DC, a_OriginX, a_OriginY, m_Width, m_Height, 0, 0, 0, m_Height, m_Pixels, &bmi, DIB_RGB_COLORS); -} - - - - diff --git a/Tools/BiomeVisualiser/Pixmap.h b/Tools/BiomeVisualiser/Pixmap.h deleted file mode 100644 index e50f6e946..000000000 --- a/Tools/BiomeVisualiser/Pixmap.h +++ /dev/null @@ -1,39 +0,0 @@ - -// Pixmap.h - -// Declares a cPixmap class that represents a RGB pixmap and allows simple operations on it - -#pragma once - - - - - -class cPixmap -{ -public: - cPixmap(void); - cPixmap(int a_Width, int a_Height); - ~cPixmap(); - - void SetSize(int a_Width, int a_Height); - - int GetWidth (void) const { return m_Width; } - int GetHeight(void) const { return m_Height; } - - void SetPixel(int a_X, int a_Y, int a_Color); - int GetPixel(int a_X, int a_Y) const; - void Fill(int a_Color); - - void DrawToDC(HDC a_DC, int a_OriginX, int a_OriginY); - -protected: - int m_Width; - int m_Height; - int m_Stride; - int * m_Pixels; -} ; - - - - diff --git a/Tools/BiomeVisualiser/Timer.h b/Tools/BiomeVisualiser/Timer.h deleted file mode 100644 index 78c4b42c7..000000000 --- a/Tools/BiomeVisualiser/Timer.h +++ /dev/null @@ -1,40 +0,0 @@ - -// Timer.h - -// Declares the cTimer class representing a RAII class that measures time from its creation till its destruction - - - - - -#pragma once - -#include "time.h" - - - - - -class cTimer -{ -public: - cTimer(const AString & a_Title) : - m_Title(a_Title), - m_StartTime(clock()) - { - } - - ~cTimer() - { - clock_t NumTicks = clock() - m_StartTime; - LOG("%s took %d ticks (%.02f sec)", m_Title.c_str(), NumTicks, (double)NumTicks / CLOCKS_PER_SEC); - } - -protected: - AString m_Title; - clock_t m_StartTime; -} ; - - - - diff --git a/Tools/BiomeVisualiser/WndProcThunk.h b/Tools/BiomeVisualiser/WndProcThunk.h deleted file mode 100644 index da995eb5f..000000000 --- a/Tools/BiomeVisualiser/WndProcThunk.h +++ /dev/null @@ -1,143 +0,0 @@ - -// WndProcThunk.h - -// Interfaces to the CWndProcThunk class responsible for WNDPROC class-thunking -// For details, see http://www.hackcraft.net/cpp/windowsThunk/thiscall/ -// Also available is a CDlgProcThunk class doing the same work for DIALOGPROC - -// MD: Made NX-compat by allocating the code structure using VirtualAlloc(..., PAGE_EXECUTE_READWRITE) - - - - - -// fwd: -template <class W> class CWndProcThunk; - - - - - -#ifndef WNDPROCTHUNK_H_INCLUDED -#define WNDPROCTHUNK_H_INCLUDED - - - - -template<typename To, typename From> inline To union_cast(From fr) throw() -{ - union - { - From f; - To t; - } uc; - uc.f = fr; - return uc.t; -} - - - - - -#pragma warning(push) -#pragma warning(disable : 4355) - -#if defined(_M_IX86) - -#pragma pack(push,1) - -template <class W> class CWndProcThunk -{ - typedef ::LRESULT (W::* WndProc)(::HWND, ::UINT, ::WPARAM, ::LPARAM); - typedef CWndProcThunk ThisClass; - - struct SCode - { - BYTE m_mov; // mov ECX, m_this - W * m_this; // - BYTE m_jmp; // jmp m_relproc - ptrdiff_t m_relproc; // relative jmp - }; - - SCode * Code; - -public: - ThisClass(WndProc proc, W * obj) - { - Code = (SCode *)VirtualAlloc(NULL, sizeof(SCode), MEM_COMMIT, PAGE_EXECUTE_READWRITE); - Code->m_mov = 0xB9, - Code->m_this = obj, - Code->m_jmp = 0xE9, - Code->m_relproc = union_cast<char *>(proc) - reinterpret_cast<char *>(Code) - sizeof(*Code); - ::FlushInstructionCache(::GetCurrentProcess(), Code, sizeof(*Code)); - } - - virtual ~CWndProcThunk() - { - VirtualFree(Code, sizeof(*Code), MEM_RELEASE); - Code = NULL; - } - - operator ::WNDPROC() const {return reinterpret_cast<::WNDPROC>(Code); } - operator ::LONG_PTR() const {return reinterpret_cast<::LONG_PTR>(Code); } -} ; - - - - - -template <class W> class CDlgProcThunk -{ - typedef ::BOOL (W::* DlgProc)(::HWND, ::UINT, ::WPARAM, ::LPARAM); - typedef CDlgProcThunk ThisClass; - - struct SCode - { - BYTE m_mov; // mov ECX, m_this - W * m_this; // - BYTE m_jmp; // jmp m_relproc - ptrdiff_t m_relproc; // relative jmp - }; - - SCode * Code; - -public: - CDlgProcThunk(DlgProc proc, W * obj) - { - Code = (SCode *)VirtualAlloc(NULL, sizeof(SCode), MEM_COMMIT, PAGE_EXECUTE_READWRITE); - Code->m_mov = 0xB9, - Code->m_this = obj, - Code->m_jmp = 0xE9, - Code->m_relproc = union_cast<char *>(proc) - reinterpret_cast<char *>(Code) - sizeof(*Code); - ::FlushInstructionCache(::GetCurrentProcess(), Code, sizeof(*Code)); - } - - virtual ~CDlgProcThunk() - { - VirtualFree(Code, sizeof(*Code), MEM_RELEASE); - Code = NULL; - } - - operator ::DLGPROC() const {return reinterpret_cast<::DLGPROC>(Code); } - operator ::LONG_PTR() const {return reinterpret_cast<::LONG_PTR>(Code); } -} ; - - - - - - #pragma pack(pop) - -#else // _M_IX86 - #error Only X86 supported -#endif - - - - - -#endif // WNDPROCTHUNK_H_INCLUDED - - - - diff --git a/Tools/BiomeVisualiser/profile_run.cmd b/Tools/BiomeVisualiser/profile_run.cmd deleted file mode 100644 index d4826d06a..000000000 --- a/Tools/BiomeVisualiser/profile_run.cmd +++ /dev/null @@ -1,70 +0,0 @@ -@echo off -:: -:: Profiling using a MSVC standalone profiler -:: -:: See http://www.codeproject.com/Articles/144643/Profiling-of-C-Applications-in-Visual-Studio-for-F for details -:: - - - - -set pt="C:\Program Files\Microsoft Visual Studio 9.0\Team Tools\Performance Tools" -set appdir="Release profiled" -set app="Release profiled\BiomeVisualiser.exe" -set args="" - -:: outputdir is relative to appdir! -set outputdir=Profiling -set output=profile.vsp - - - - - -::Create the output directory, if it didn't exist -mkdir %outputdir% - - - - - -:: Start the profiler -%pt%\vsperfcmd /start:sample /output:%outputdir%\%output% -if errorlevel 1 goto haderror - -:: Launch the application via the profiler -%pt%\vsperfcmd /launch:%app% /args:%args% -if errorlevel 1 goto haderror - -:: Shut down the profiler (this command waits, until the application is terminated) -%pt%\vsperfcmd /shutdown -if errorlevel 1 goto haderror - - - - - -:: cd to outputdir, so that the reports are generated there -cd %outputdir% - -:: generate the report files (.csv) -%pt%\vsperfreport /summary:all %output% /symbolpath:"srv*C:\Programovani\Symbols*http://msdl.microsoft.com/download/symbols" -if errorlevel 1 goto haderror - - - - - -goto finished - - - - -:haderror -echo An error was encountered -pause - - - - -:finished diff --git a/Tools/MCADefrag/CMakeLists.txt b/Tools/MCADefrag/CMakeLists.txt index 2a021049f..42b42018b 100644 --- a/Tools/MCADefrag/CMakeLists.txt +++ b/Tools/MCADefrag/CMakeLists.txt @@ -39,14 +39,12 @@ set_exe_flags() set(SHARED_SRC ../../src/StringCompression.cpp ../../src/StringUtils.cpp - ../../src/Log.cpp - ../../src/MCLogger.cpp + ../../src/LoggerListeners.cpp + ../../src/Logger.cpp ) set(SHARED_HDR ../../src/ByteBuffer.h ../../src/StringUtils.h - ../../src/Log.h - ../../src/MCLogger.h ) flatten_files(SHARED_SRC) flatten_files(SHARED_HDR) diff --git a/Tools/MCADefrag/MCADefrag.cpp b/Tools/MCADefrag/MCADefrag.cpp index a2de7f957..d5d233fd2 100644 --- a/Tools/MCADefrag/MCADefrag.cpp +++ b/Tools/MCADefrag/MCADefrag.cpp @@ -5,7 +5,8 @@ #include "Globals.h" #include "MCADefrag.h" -#include "MCLogger.h" +#include "Logger.h" +#include "LoggerListeners.h" #include "zlib/zlib.h" @@ -21,7 +22,13 @@ static const Byte g_Zeroes[4096] = {0}; int main(int argc, char ** argv) { - new cMCLogger(Printf("Defrag_%08x.log", time(NULL))); + cLogger::cListener * consoleLogListener = MakeConsoleListener(); + cLogger::cListener * fileLogListener = new cFileListener(); + cLogger::GetInstance().AttachListener(consoleLogListener); + cLogger::GetInstance().AttachListener(fileLogListener); + + cLogger::InitiateMultithreading(); + cMCADefrag Defrag; if (!Defrag.Init(argc, argv)) { @@ -30,6 +37,11 @@ int main(int argc, char ** argv) Defrag.Run(); + cLogger::GetInstance().DetachListener(consoleLogListener); + delete consoleLogListener; + cLogger::GetInstance().DetachListener(fileLogListener); + delete fileLogListener; + return 0; } diff --git a/Tools/ProtoProxy/CMakeLists.txt b/Tools/ProtoProxy/CMakeLists.txt index f0796363c..bc3923d90 100644 --- a/Tools/ProtoProxy/CMakeLists.txt +++ b/Tools/ProtoProxy/CMakeLists.txt @@ -34,20 +34,18 @@ set_exe_flags() set(SHARED_SRC ../../src/ByteBuffer.cpp ../../src/StringUtils.cpp - ../../src/Log.cpp - ../../src/MCLogger.cpp ../../src/PolarSSL++/AesCfb128Decryptor.cpp ../../src/PolarSSL++/AesCfb128Encryptor.cpp ../../src/PolarSSL++/CryptoKey.cpp ../../src/PolarSSL++/CtrDrbgContext.cpp ../../src/PolarSSL++/EntropyContext.cpp ../../src/PolarSSL++/RsaPrivateKey.cpp + ../../src/LoggerListeners.cpp + ../../src/Logger.cpp ) set(SHARED_HDR ../../src/ByteBuffer.h ../../src/StringUtils.h - ../../src/Log.h - ../../src/MCLogger.h ../../src/PolarSSL++/AesCfb128Decryptor.h ../../src/PolarSSL++/AesCfb128Encryptor.h ../../src/PolarSSL++/CryptoKey.h diff --git a/Tools/ProtoProxy/Connection.cpp b/Tools/ProtoProxy/Connection.cpp index c5916c1ca..eaf4fab02 100644 --- a/Tools/ProtoProxy/Connection.cpp +++ b/Tools/ProtoProxy/Connection.cpp @@ -1819,8 +1819,7 @@ bool cConnection::HandleServerKick(void) Reason.append(Split[4]); Reason.push_back(0); Reason.append(Split[5]); - AString ReasonBE16; - UTF8ToRawBEUTF16(Reason.data(), Reason.size(), ReasonBE16); + AString ReasonBE16 = UTF8ToRawBEUTF16(Reason.data(), Reason.size()); AString PacketStart("\xff"); PacketStart.push_back((ReasonBE16.size() / 2) / 256); PacketStart.push_back((ReasonBE16.size() / 2) % 256); diff --git a/Tools/QtBiomeVisualiser/.gitignore b/Tools/QtBiomeVisualiser/.gitignore new file mode 100644 index 000000000..c1b62a8a7 --- /dev/null +++ b/Tools/QtBiomeVisualiser/.gitignore @@ -0,0 +1,2 @@ +*.pro.user +*.pro.user.* diff --git a/Tools/QtBiomeVisualiser/BiomeView.cpp b/Tools/QtBiomeVisualiser/BiomeView.cpp new file mode 100644 index 000000000..b44b935d7 --- /dev/null +++ b/Tools/QtBiomeVisualiser/BiomeView.cpp @@ -0,0 +1,414 @@ +#include "Globals.h" +#include "BiomeView.h" +#include "QtChunk.h" +#include <QPainter> +#include <QResizeEvent> + + + + + +static const int DELTA_STEP = 120; // The normal per-notch wheel delta + + + + + +BiomeView::BiomeView(QWidget * parent) : + super(parent), + m_X(0), + m_Z(0), + m_Zoom(1), + m_IsMouseDragging(false), + m_MouseWheelDelta(0) +{ + // Create the image used for undefined chunks: + int offset = 0; + for (int y = 0; y < 16; y++) + { + for (int x = 0; x < 16; x++) + { + uchar color = (((x & 8) ^ (y & 8)) == 0) ? 0x44 : 0x88; + m_EmptyChunkImage[offset++] = color; + m_EmptyChunkImage[offset++] = color; + m_EmptyChunkImage[offset++] = color; + m_EmptyChunkImage[offset++] = 0xff; + } + } + + // Create the startup image: + redraw(); + + // Add a chunk-update callback mechanism: + connect(&m_Cache, SIGNAL(chunkAvailable(int, int)), this, SLOT(chunkAvailable(int, int))); + + // Allow mouse and keyboard interaction: + setFocusPolicy(Qt::StrongFocus); + setMouseTracking(true); +} + + + + +QSize BiomeView::minimumSizeHint() const +{ + return QSize(300, 300); +} + + + + + +QSize BiomeView::sizeHint() const +{ + return QSize(800, 600); +} + + + + + +void BiomeView::setChunkSource(std::shared_ptr<ChunkSource> a_ChunkSource) +{ + // Replace the source in the cache: + m_Cache.setChunkSource(a_ChunkSource); + + // Redraw with the new source: + redraw(); +} + + + + + +void BiomeView::setPosition(int a_BlockX, int a_BlockZ) +{ + m_X = a_BlockX; + m_Z = a_BlockZ; + redraw(); +} + + + + + +void BiomeView::setZoomLevel(double a_ZoomLevel) +{ + m_Zoom = a_ZoomLevel; + redraw(); +} + + + + + +void BiomeView::redraw() +{ + if (!hasData()) + { + // No data means no image is displayed, no need to compose: + update(); + return; + } + + int chunksize = 16 * m_Zoom; + + // first find the center block position + int centerchunkx = floor(m_X / 16); + int centerchunkz = floor(m_Z / 16); + // and the center of the screen + int centerx = m_Image.width() / 2; + int centery = m_Image.height() / 2; + // and align for panning + centerx -= (m_X - centerchunkx * 16) * m_Zoom; + centery -= (m_Z - centerchunkz * 16) * m_Zoom; + // now calculate the topleft block on the screen + int startx = centerchunkx - centerx / chunksize - 1; + int startz = centerchunkz - centery / chunksize - 1; + // and the dimensions of the screen in blocks + int blockswide = m_Image.width() / chunksize + 3; + int blockstall = m_Image.height() / chunksize + 3; + + for (int z = startz; z < startz + blockstall; z++) + { + for (int x = startx; x < startx + blockswide; x++) + { + drawChunk(x, z); + } + } + update(); +} + + + + + +void BiomeView::chunkAvailable(int a_ChunkX, int a_ChunkZ) +{ + drawChunk(a_ChunkX, a_ChunkZ); + update(); +} + + + + + +void BiomeView::reload() +{ + if (!hasData()) + { + return; + } + m_Cache.reload(); + + redraw(); +} + + + + + +void BiomeView::drawChunk(int a_ChunkX, int a_ChunkZ) +{ + if (!hasData()) + { + return; + } + + //fetch the chunk: + ChunkPtr chunk = m_Cache.fetch(a_ChunkX, a_ChunkZ); + + // Figure out where on the screen this chunk should be drawn: + // first find the center chunk + int centerchunkx = floor(m_X / 16); + int centerchunkz = floor(m_Z / 16); + // and the center chunk screen coordinates + int centerx = m_Image.width() / 2; + int centery = m_Image.height() / 2; + // which need to be shifted to account for panning inside that chunk + centerx -= (m_X - centerchunkx * 16) * m_Zoom; + centery -= (m_Z - centerchunkz * 16) * m_Zoom; + // centerx,y now points to the top left corner of the center chunk + // so now calculate our x,y in relation + double chunksize = 16 * m_Zoom; + centerx += (a_ChunkX - centerchunkx) * chunksize; + centery += (a_ChunkZ - centerchunkz) * chunksize; + + int srcoffset = 0; + uchar * bits = m_Image.bits(); + int imgstride = m_Image.bytesPerLine(); + + int skipx = 0,skipy = 0; + int blockwidth = chunksize, blockheight = chunksize; + // now if we're off the screen we need to crop + if (centerx < 0) + { + skipx = -centerx; + centerx = 0; + } + if (centery < 0) + { + skipy = -centery; + centery = 0; + } + // or the other side, we need to trim + if (centerx + blockwidth > m_Image.width()) + { + blockwidth = m_Image.width() - centerx; + } + if (centery + blockheight > m_Image.height()) + { + blockheight = m_Image.height() - centery; + } + if ((blockwidth <= 0) || (skipx >= blockwidth)) + { + return; + } + int imgoffset = centerx * 4 + centery * imgstride; + + // If the chunk is valid, use its data; otherwise use the empty placeholder: + const uchar * src = m_EmptyChunkImage; + if (chunk.get() != nullptr) + { + src = chunk->getImage(); + } + + // Blit or scale-blit the image: + for (int z = skipy; z < blockheight; z++, imgoffset += imgstride) + { + srcoffset = floor((double)z / m_Zoom) * 16 * 4; + if (m_Zoom == 1.0) + { + memcpy(bits + imgoffset, src + srcoffset + skipx * 4, (blockwidth - skipx) * 4); + } + else + { + int xofs = 0; + for (int x = skipx; x < blockwidth; x++, xofs +=4) + { + memcpy(bits + imgoffset + xofs, src + srcoffset + (int)floor((double)x / m_Zoom) * 4, 4); + } + } + } +} + + + + + +void BiomeView::resizeEvent(QResizeEvent * a_Event) +{ + m_Image = QImage(a_Event->size(), QImage::Format_RGB32); + redraw(); +} + + + + + +void BiomeView::paintEvent(QPaintEvent * a_Event) +{ + QPainter p(this); + if (hasData()) + { + p.drawImage(QPoint(0, 0), m_Image); + } + else + { + p.drawText(a_Event->rect(), Qt::AlignCenter, "No chunk source selected"); + } + p.end(); +} + + + + + +void BiomeView::mousePressEvent(QMouseEvent * a_Event) +{ + m_LastX = a_Event->x(); + m_LastY = a_Event->y(); + m_IsMouseDragging = true; +} + + + + + +void BiomeView::mouseMoveEvent(QMouseEvent * a_Event) +{ + // If there's no data displayed, bail out: + if (!hasData()) + { + return; + } + + if (m_IsMouseDragging) + { + // The user is dragging the mouse, move the view around: + m_X += (m_LastX - a_Event->x()) / m_Zoom; + m_Z += (m_LastY - a_Event->y()) / m_Zoom; + m_LastX = a_Event->x(); + m_LastY = a_Event->y(); + redraw(); + return; + } + + // Update the status bar info text: + int blockX = floor((a_Event->x() - width() / 2) / m_Zoom + m_X); + int blockZ = floor((a_Event->y() - height() / 2) / m_Zoom + m_Z); + int chunkX, chunkZ; + int relX = blockX, relY, relZ = blockZ; + cChunkDef::AbsoluteToRelative(relX, relY, relZ, chunkX, chunkZ); + auto chunk = m_Cache.fetch(chunkX, chunkZ); + int biome = (chunk.get() != nullptr) ? chunk->getBiome(relX, relZ) : biInvalidBiome; + emit hoverChanged(blockX, blockZ, biome); +} + + + + + +void BiomeView::mouseReleaseEvent(QMouseEvent *) +{ + m_IsMouseDragging = false; +} + + + + + +void BiomeView::wheelEvent(QWheelEvent * a_Event) +{ + m_MouseWheelDelta += a_Event->delta(); + while (m_MouseWheelDelta >= DELTA_STEP) + { + emit wheelUp(); + m_MouseWheelDelta -= DELTA_STEP; + } + while (m_MouseWheelDelta <= -DELTA_STEP) + { + emit wheelDown(); + m_MouseWheelDelta += DELTA_STEP; + } +} + + + + + +void BiomeView::keyPressEvent(QKeyEvent * a_Event) +{ + switch (a_Event->key()) + { + case Qt::Key_Up: + case Qt::Key_W: + { + m_Z -= 10.0 / m_Zoom; + redraw(); + break; + } + + case Qt::Key_Down: + case Qt::Key_S: + { + m_Z += 10.0 / m_Zoom; + redraw(); + break; + } + + case Qt::Key_Left: + case Qt::Key_A: + { + m_X -= 10.0 / m_Zoom; + redraw(); + break; + } + + case Qt::Key_Right: + case Qt::Key_D: + { + m_X += 10.0 / m_Zoom; + redraw(); + break; + } + + case Qt::Key_PageUp: + case Qt::Key_Q: + { + emit increaseZoom(); + break; + } + + case Qt::Key_PageDown: + case Qt::Key_E: + { + emit decreaseZoom(); + break; + } + } +} + + + + diff --git a/Tools/QtBiomeVisualiser/BiomeView.h b/Tools/QtBiomeVisualiser/BiomeView.h new file mode 100644 index 000000000..40d8b96ae --- /dev/null +++ b/Tools/QtBiomeVisualiser/BiomeView.h @@ -0,0 +1,114 @@ +#pragma once + +#include <QWidget> +#include <memory> +#include "ChunkCache.h" +#include "ChunkSource.h" + + + + + +class BiomeView : + public QWidget +{ + typedef QWidget super; + Q_OBJECT + +public: + explicit BiomeView(QWidget * parent = NULL); + + QSize minimumSizeHint() const; + QSize sizeHint() const; + + /** Replaces the chunk source used by the biome view to get the chunk biome data. + The entire view is then invalidated and regenerated. */ + void setChunkSource(std::shared_ptr<ChunkSource> a_ChunkSource); + + /** Sets the position of the central pixel of the map to the specified point and redraws the view. */ + void setPosition(int a_BlockX, int a_BlockZ); + + /** Sets the zoom level to the specified value and redraws the view. */ + void setZoomLevel(double a_ZoomLevel); + +signals: + /** Signalled when the user uses the wheel to scroll upwards. */ + void wheelUp(); + + /** Signalled when the user uses the wheel to scroll downwards. */ + void wheelDown(); + + /** Signalled when the user presses a key to increase zoom. */ + void increaseZoom(); + + /** Signalled when the user presses a key to decrease zoom. */ + void decreaseZoom(); + + /** Emitted when the user moves the mouse, to reflect the current block under the cursor. */ + void hoverChanged(int a_BlockX, int a_BlockZ, int a_Biome); + +public slots: + /** Redraw the entire widget area. */ + void redraw(); + + /** A specified chunk has become available, redraw it. */ + void chunkAvailable(int a_ChunkX, int a_ChunkZ); + + /** Reloads the current chunk source and redraws the entire workspace. */ + void reload(); + +protected: + double m_X, m_Z; + double m_Zoom; + + /** Cache for the loaded chunk data. */ + ChunkCache m_Cache; + + /** The entire view's contents in an offscreen image. */ + QImage m_Image; + + /** Coords of the mouse for the previous position, used while dragging. */ + int m_LastX, m_LastY; + + /** Set to true when the user has a mouse button depressed, and is dragging the view. */ + bool m_IsMouseDragging; + + /** Accumulator for the mouse wheel's delta. When the accumulator hits a threshold, the view zooms. */ + int m_MouseWheelDelta; + + /** Data used for rendering a chunk that hasn't been loaded yet */ + uchar m_EmptyChunkImage[16 * 16 * 4]; + + + /** Draws the specified chunk into m_Image */ + void drawChunk(int a_ChunkX, int a_ChunkZ); + + /** Returns true iff the biome view has been initialized to contain proper biome data. */ + bool hasData(void) const { return m_Cache.hasData(); } + + /** Called when the widget is resized */ + virtual void resizeEvent(QResizeEvent *) override; + + /** Paints the entire widget */ + virtual void paintEvent(QPaintEvent *) override; + + /** Called when the user presses any mouse button. */ + virtual void mousePressEvent(QMouseEvent * a_Event); + + /** Called when the user moves the mouse. */ + virtual void mouseMoveEvent(QMouseEvent * a_Event); + + /** Called when the user releases a previously held mouse button. */ + virtual void mouseReleaseEvent(QMouseEvent * a_Event) override; + + /** Called when the user rotates the mouse wheel. */ + virtual void wheelEvent(QWheelEvent * a_Event) override; + + /** Called when the user presses a key. */ + virtual void keyPressEvent(QKeyEvent * a_Event) override; +}; + + + + + diff --git a/Tools/QtBiomeVisualiser/ChunkCache.cpp b/Tools/QtBiomeVisualiser/ChunkCache.cpp new file mode 100644 index 000000000..05c267d30 --- /dev/null +++ b/Tools/QtBiomeVisualiser/ChunkCache.cpp @@ -0,0 +1,126 @@ +#include "Globals.h" +#include "ChunkCache.h" +#include <QMutexLocker> +#include <QThreadPool> +#include "ChunkSource.h" +#include "ChunkLoader.h" + + + + + +ChunkCache::ChunkCache(QObject * parent) : + super(parent) +{ + m_Cache.setMaxCost(1024 * 1024 * 1024); // 1 GiB of memory for the cache +} + + + + + +ChunkPtr ChunkCache::fetch(int a_ChunkX, int a_ChunkZ) +{ + // Retrieve from the cache: + quint32 hash = getChunkHash(a_ChunkX, a_ChunkZ); + ChunkPtr * res; + { + QMutexLocker lock(&m_Mtx); + res = m_Cache[hash]; + // If succesful and chunk loaded, return the retrieved value: + if ((res != nullptr) && (*res)->isValid()) + { + return *res; + } + } + + // If the chunk is in cache but not valid, it means it has been already queued for rendering, do nothing now: + if (res != nullptr) + { + return ChunkPtr(nullptr); + } + + // There's no such item in the cache, create it now: + res = new ChunkPtr(new Chunk); + if (res == nullptr) + { + return ChunkPtr(nullptr); + } + { + QMutexLocker lock(&m_Mtx); + m_Cache.insert(hash, res, sizeof(Chunk)); + } + + // Queue the chunk for rendering: + queueChunkRender(a_ChunkX, a_ChunkZ, *res); + + // Return failure, the chunk is not yet rendered: + return ChunkPtr(nullptr); +} + + + + + +void ChunkCache::setChunkSource(std::shared_ptr<ChunkSource> a_ChunkSource) +{ + // Replace the chunk source: + m_ChunkSource = a_ChunkSource; + + // Clear the cache: + QMutexLocker lock(&m_Mtx); + m_Cache.clear(); +} + + + + + +void ChunkCache::reload() +{ + assert(m_ChunkSource.get() != nullptr); + + // Reload the chunk source: + m_ChunkSource->reload(); + + // Clear the cache: + QMutexLocker lock(&m_Mtx); + m_Cache.clear(); +} + + + + + +void ChunkCache::gotChunk(int a_ChunkX, int a_ChunkZ) +{ + emit chunkAvailable(a_ChunkX, a_ChunkZ); +} + + + + + +quint32 ChunkCache::getChunkHash(int a_ChunkX, int a_ChunkZ) +{ + // Simply join the two coords into a single int + // The coords will never be larger than 16-bits, so we can do this safely + return (((static_cast<quint32>(a_ChunkX) & 0xffff) << 16) | (static_cast<quint32>(a_ChunkZ) & 0xffff)); +} + + + + + +void ChunkCache::queueChunkRender(int a_ChunkX, int a_ChunkZ, ChunkPtr & a_Chunk) +{ + // Create a new loader task: + ChunkLoader * loader = new ChunkLoader(a_ChunkX, a_ChunkZ, a_Chunk, m_ChunkSource); + connect(loader, SIGNAL(loaded(int, int)), this, SLOT(gotChunk(int, int))); + + QThreadPool::globalInstance()->start(loader); +} + + + + diff --git a/Tools/QtBiomeVisualiser/ChunkCache.h b/Tools/QtBiomeVisualiser/ChunkCache.h new file mode 100644 index 000000000..8d198f02f --- /dev/null +++ b/Tools/QtBiomeVisualiser/ChunkCache.h @@ -0,0 +1,72 @@ +#pragma once + +#include <QObject> +#include <QCache> +#include <QMutex> +#include <memory> + + + + + +class Chunk; +typedef std::shared_ptr<Chunk> ChunkPtr; + +class ChunkSource; + + + + + +/** Caches chunk data for reuse */ +class ChunkCache : + public QObject +{ + typedef QObject super; + Q_OBJECT + +public: + explicit ChunkCache(QObject * parent = NULL); + + /** Retrieves the specified chunk from the cache. + Only returns valid chunks; if the chunk is invalid, queues it for rendering and returns an empty ptr. */ + ChunkPtr fetch(int a_ChunkX, int a_ChunkZ); + + /** Replaces the chunk source used by the biome view to get the chunk biome data. + The cache is then invalidated. */ + void setChunkSource(std::shared_ptr<ChunkSource> a_ChunkSource); + + /** Returns true iff the chunk source has been initialized. */ + bool hasData() const { return (m_ChunkSource.get() != nullptr); } + + /** Reloads the current chunk source. */ + void reload(); + +signals: + void chunkAvailable(int a_ChunkX, int a_ChunkZ); + +protected slots: + void gotChunk(int a_ChunkX, int a_ChunkZ); + +protected: + /** The cache of the chunks */ + QCache<quint32, ChunkPtr> m_Cache; + + /** Locks te cache against multithreaded access */ + QMutex m_Mtx; + + /** The source used to get the biome data. */ + std::shared_ptr<ChunkSource> m_ChunkSource; + + + /** Returns the hash used by the chunk in the cache */ + quint32 getChunkHash(int a_ChunkX, int a_ChunkZ); + + /** Queues the specified chunk for rendering by m_ChunkSource. */ + void queueChunkRender(int a_ChunkX, int a_ChunkZ, ChunkPtr & a_Chunk); +}; + + + + + diff --git a/Tools/QtBiomeVisualiser/ChunkLoader.cpp b/Tools/QtBiomeVisualiser/ChunkLoader.cpp new file mode 100644 index 000000000..3d0123b23 --- /dev/null +++ b/Tools/QtBiomeVisualiser/ChunkLoader.cpp @@ -0,0 +1,29 @@ +#include "Globals.h" +#include "ChunkLoader.h" +#include "ChunkSource.h" + + + + + +ChunkLoader::ChunkLoader(int a_ChunkX, int a_ChunkZ, ChunkPtr a_Chunk, ChunkSourcePtr a_ChunkSource) : + m_ChunkX(a_ChunkX), + m_ChunkZ(a_ChunkZ), + m_Chunk(a_Chunk), + m_ChunkSource(a_ChunkSource) +{ +} + + + + + +void ChunkLoader::run() +{ + m_ChunkSource->getChunkBiomes(m_ChunkX, m_ChunkZ, m_Chunk); + emit loaded(m_ChunkX, m_ChunkZ); +} + + + + diff --git a/Tools/QtBiomeVisualiser/ChunkLoader.h b/Tools/QtBiomeVisualiser/ChunkLoader.h new file mode 100644 index 000000000..4d026a45e --- /dev/null +++ b/Tools/QtBiomeVisualiser/ChunkLoader.h @@ -0,0 +1,45 @@ +#pragma once + +#include <QObject> +#include <QRunnable> +#include <memory> + + + + +// fwd: +class Chunk; +typedef std::shared_ptr<Chunk> ChunkPtr; + +class ChunkSource; +typedef std::shared_ptr<ChunkSource> ChunkSourcePtr; + + + + + +class ChunkLoader : + public QObject, + public QRunnable +{ + Q_OBJECT + +public: + ChunkLoader(int a_ChunkX, int a_ChunkZ, ChunkPtr a_Chunk, ChunkSourcePtr a_ChunkSource); + virtual ~ChunkLoader() {} + +signals: + void loaded(int a_ChunkX, int a_ChunkZ); + +protected: + virtual void run() override; + +private: + int m_ChunkX, m_ChunkZ; + ChunkPtr m_Chunk; + ChunkSourcePtr m_ChunkSource; +}; + + + + diff --git a/Tools/QtBiomeVisualiser/ChunkSource.cpp b/Tools/QtBiomeVisualiser/ChunkSource.cpp new file mode 100644 index 000000000..e5cd7a75a --- /dev/null +++ b/Tools/QtBiomeVisualiser/ChunkSource.cpp @@ -0,0 +1,284 @@ +#include "Globals.h" +#include "ChunkSource.h" +#include <QThread> +#include "src/Generating/BioGen.h" +#include "src/StringCompression.h" +#include "src/WorldStorage/FastNBT.h" +#include "inifile/iniFile.h" + + + + + +//////////////////////////////////////////////////////////////////////////////// +// BioGenSource: + +BioGenSource::BioGenSource(cIniFilePtr a_IniFile) : + m_IniFile(a_IniFile), + m_Mtx(QMutex::Recursive) +{ + reload(); +} + + + + + +void BioGenSource::getChunkBiomes(int a_ChunkX, int a_ChunkZ, ChunkPtr a_DestChunk) +{ + cChunkDef::BiomeMap biomes; + { + QMutexLocker lock(&m_Mtx); + m_BiomeGen->GenBiomes(a_ChunkX, a_ChunkZ, biomes); + } + a_DestChunk->setBiomes(biomes); +} + + + + + +void BioGenSource::reload() +{ + int seed = m_IniFile->GetValueSetI("Seed", "Seed", 0); + bool unused = false; + QMutexLocker lock(&m_Mtx); + m_BiomeGen.reset(cBiomeGen::CreateBiomeGen(*m_IniFile, seed, unused)); +} + + + + + +//////////////////////////////////////////////////////////////////////////////// +// AnvilSource::AnvilFile + +class AnvilSource::AnvilFile +{ +public: + /** Coordinates of the region file. */ + int m_RegionX, m_RegionZ; + + /** True iff the file contains proper data. */ + bool m_IsValid; + + + + /** Creates a new instance with the specified region coords. Reads the file header. */ + AnvilFile(int a_RegionX, int a_RegionZ, const AString & a_WorldPath) : + m_RegionX(a_RegionX), + m_RegionZ(a_RegionZ), + m_IsValid(false) + { + readFile(Printf("%s/r.%d.%d.mca", a_WorldPath.c_str(), a_RegionX, a_RegionZ)); + } + + + + /** Returns the compressed data of the specified chunk. + Returns an empty string when chunk not present. */ + AString getChunkData(int a_ChunkX, int a_ChunkZ) + { + if (!m_IsValid) + { + return ""; + } + + // Translate to local coords: + int RelChunkX = a_ChunkX - m_RegionX * 32; + int RelChunkZ = a_ChunkZ - m_RegionZ * 32; + ASSERT((RelChunkX >= 0) && (RelChunkX < 32)); + ASSERT((RelChunkZ >= 0) && (RelChunkZ < 32)); + + // Get the chunk data location: + UInt32 chunkOffset = m_Header[RelChunkX + 32 * RelChunkZ] >> 8; + UInt32 numChunkSectors = m_Header[RelChunkX + 32 * RelChunkZ] & 0xff; + if ((chunkOffset < 2) || (numChunkSectors == 0)) + { + return ""; + } + + // Get the real data size: + const char * chunkData = m_FileData.data() + chunkOffset * 4096; + UInt32 chunkSize = GetBEInt(chunkData); + if ((chunkSize < 2) || (chunkSize / 4096 > numChunkSectors)) + { + // Bad data, bail out + return ""; + } + + // Check the compression method: + if (chunkData[4] != 2) + { + // Chunk is in an unknown compression + return ""; + } + chunkSize--; + + // Read the chunk data: + return m_FileData.substr(chunkOffset * 4096 + 5, chunkSize); + } + +protected: + AString m_FileData; + UInt32 m_Header[2048]; + + + /** Reads the whole specified file contents and parses the header. */ + void readFile(const AString & a_FileName) + { + // Read the entire file: + m_FileData = cFile::ReadWholeFile(a_FileName); + if (m_FileData.size() < sizeof(m_Header)) + { + return; + } + + // Parse the header - change endianness: + const char * hdr = m_FileData.data(); + for (size_t i = 0; i < ARRAYCOUNT(m_Header); i++) + { + m_Header[i] = GetBEInt(hdr + 4 * i); + } + m_IsValid = true; + } +}; + + + + + +//////////////////////////////////////////////////////////////////////////////// +// AnvilSource: + +AnvilSource::AnvilSource(QString a_WorldRegionFolder) : + m_WorldRegionFolder(a_WorldRegionFolder) +{ +} + + + + + +void AnvilSource::getChunkBiomes(int a_ChunkX, int a_ChunkZ, ChunkPtr a_DestChunk) +{ + // Load the compressed data: + AString compressedChunkData = getCompressedChunkData(a_ChunkX, a_ChunkZ); + if (compressedChunkData.empty()) + { + return; + } + + // Uncompress the chunk data: + AString uncompressed; + int res = InflateString(compressedChunkData.data(), compressedChunkData.size(), uncompressed); + if (res != Z_OK) + { + return; + } + + // Parse the NBT data: + cParsedNBT nbt(uncompressed.data(), uncompressed.size()); + if (!nbt.IsValid()) + { + return; + } + + // Get the biomes out of the NBT: + int Level = nbt.FindChildByName(0, "Level"); + if (Level < 0) + { + return; + } + cChunkDef::BiomeMap biomeMap; + int mcsBiomes = nbt.FindChildByName(Level, "MCSBiomes"); + if ((mcsBiomes >= 0) && (nbt.GetDataLength(mcsBiomes) == sizeof(biomeMap))) + { + // Convert the biomes from BigEndian to platform native numbers: + const char * beBiomes = nbt.GetData(mcsBiomes); + for (size_t i = 0; i < ARRAYCOUNT(biomeMap); i++) + { + biomeMap[i] = (EMCSBiome)GetBEInt(beBiomes + 4 * i); + } + a_DestChunk->setBiomes(biomeMap); + return; + } + + // MCS biomes not found, load Vanilla biomes instead: + int biomes = nbt.FindChildByName(Level, "Biomes"); + if ((biomes < 0) || (nbt.GetDataLength(biomes) != ARRAYCOUNT(biomeMap))) + { + return; + } + // Convert the biomes from Vanilla to EMCSBiome: + const char * vanillaBiomes = nbt.GetData(biomes); + for (size_t i = 0; i < ARRAYCOUNT(biomeMap); i++) + { + biomeMap[i] = EMCSBiome(vanillaBiomes[i]); + } + a_DestChunk->setBiomes(biomeMap); +} + + + + + +void AnvilSource::reload() +{ + // Remove all files from the cache: + QMutexLocker lock(&m_Mtx); + m_Files.clear(); +} + + + + + +void AnvilSource::chunkToRegion(int a_ChunkX, int a_ChunkZ, int & a_RegionX, int & a_RegionZ) +{ + a_RegionX = a_ChunkX >> 5; + a_RegionZ = a_ChunkZ >> 5; +} + + + + + +AString AnvilSource::getCompressedChunkData(int a_ChunkX, int a_ChunkZ) +{ + return getAnvilFile(a_ChunkX, a_ChunkZ)->getChunkData(a_ChunkX, a_ChunkZ); +} + + + + + +AnvilSource::AnvilFilePtr AnvilSource::getAnvilFile(int a_ChunkX, int a_ChunkZ) +{ + int RegionX, RegionZ; + chunkToRegion(a_ChunkX, a_ChunkZ, RegionX, RegionZ); + + // Search the cache for the file: + QMutexLocker lock(&m_Mtx); + for (auto itr = m_Files.cbegin(), end = m_Files.cend(); itr != end; ++itr) + { + if (((*itr)->m_RegionX == RegionX) && ((*itr)->m_RegionZ == RegionZ)) + { + // Found the file in the cache, move it to front and return it: + AnvilFilePtr file(*itr); + m_Files.erase(itr); + m_Files.push_front(file); + return file; + } + } + + // File not in cache, create it: + AnvilFilePtr file(new AnvilFile(RegionX, RegionZ, m_WorldRegionFolder.toStdString())); + m_Files.push_front(file); + return file; +} + + + + + diff --git a/Tools/QtBiomeVisualiser/ChunkSource.h b/Tools/QtBiomeVisualiser/ChunkSource.h new file mode 100644 index 000000000..7bd1865ff --- /dev/null +++ b/Tools/QtBiomeVisualiser/ChunkSource.h @@ -0,0 +1,107 @@ +#pragma once +#include "Globals.h" +#include <QString> +#include <QMutex> +#include "QtChunk.h" + + + + + +// fwd: +class cBiomeGen; +typedef std::shared_ptr<cBiomeGen> cBiomeGenPtr; +class cIniFile; +typedef std::shared_ptr<cIniFile> cIniFilePtr; + + + + + +/** Abstract interface for getting biome data for chunks. */ +class ChunkSource +{ +public: + virtual ~ChunkSource() {} + + /** Fills the a_DestChunk with the biomes for the specified coords. + It is expected to be thread-safe and re-entrant. Usually QThread::idealThreadCount() threads are used. */ + virtual void getChunkBiomes(int a_ChunkX, int a_ChunkZ, ChunkPtr a_DestChunk) = 0; + + /** Forces a fresh reload of the source. Useful mainly for the generator, whose underlying definition file may have been changed. */ + virtual void reload() = 0; +}; + + + + + + +class BioGenSource : + public ChunkSource +{ +public: + /** Constructs a new BioGenSource based on the biome generator that is defined in the specified world.ini file. */ + BioGenSource(cIniFilePtr a_IniFile); + + // ChunkSource overrides: + virtual void getChunkBiomes(int a_ChunkX, int a_ChunkZ, ChunkPtr a_DestChunk) override; + virtual void reload(void) override; + +protected: + /** The world.ini contents from which the generator is created and re-created on reload(). */ + cIniFilePtr m_IniFile; + + /** The generator used for generating biomes. */ + std::unique_ptr<cBiomeGen> m_BiomeGen; + + /** Guards m_BiomeGen against multithreaded access. */ + QMutex m_Mtx; +}; + + + + +class AnvilSource : + public ChunkSource +{ +public: + /** Constructs a new AnvilSource based on the world path. */ + AnvilSource(QString a_WorldRegionFolder); + + // ChunkSource overrides: + virtual void getChunkBiomes(int a_ChunkX, int a_ChunkZ, ChunkPtr a_DestChunk) override; + virtual void reload() override; + +protected: + class AnvilFile; + typedef std::shared_ptr<AnvilFile> AnvilFilePtr; + + + /** Folder where the individual Anvil Region files are located. */ + QString m_WorldRegionFolder; + + /** List of currently loaded files. Acts as a cache so that a file is not opened and closed over and over again. + Protected against multithreaded access by m_Mtx. */ + std::list<AnvilFilePtr> m_Files; + + /** Guards m_Files agains multithreaded access. */ + QMutex m_Mtx; + + + /** Converts chunk coords to region coords. */ + void chunkToRegion(int a_ChunkX, int a_ChunkZ, int & a_RegionX, int & a_RegionZ); + + /** Returns the compressed data of the specified chunk. + Returns an empty string if the chunk is not available. */ + AString getCompressedChunkData(int a_ChunkX, int a_ChunkZ); + + /** Returns the file object that contains the specified chunk. + The file is taken from the cache if available there, otherwise it is created anew. */ + AnvilFilePtr getAnvilFile(int a_ChunkX, int a_ChunkZ); + +}; + + + + diff --git a/Tools/QtBiomeVisualiser/GeneratorSetup.cpp b/Tools/QtBiomeVisualiser/GeneratorSetup.cpp new file mode 100644 index 000000000..d6348ee00 --- /dev/null +++ b/Tools/QtBiomeVisualiser/GeneratorSetup.cpp @@ -0,0 +1,158 @@ +#include "Globals.h" +#include "GeneratorSetup.h" +#include <QLabel> +#include <QLineEdit> +#include "src/Generating/BioGen.h" +#include "inifile/iniFile.h" + + + + + +static const QString s_GeneratorNames[] = +{ + QString("Checkerboard"), + QString("Constant"), + QString("DistortedVoronoi"), + QString("MultiStepMap"), + QString("TwoLevel"), + QString("Voronoi"), +}; + + + + + +GeneratorSetup::GeneratorSetup(const AString & a_IniFileName, QWidget * a_Parent) : + super(a_Parent), + m_IniFile(new cIniFile()) +{ + // The seed and generator name is in a separate form layout at the top, always present: + m_eSeed = new QLineEdit(); + m_eSeed->setValidator(new QIntValidator()); + m_eSeed->setText("0"); + m_eSeed->setProperty("INI.SectionName", QVariant("Seed")); + m_eSeed->setProperty("INI.ItemName", QVariant("Seed")); + m_cbGenerator = new QComboBox(); + m_cbGenerator->setMinimumWidth(120); + for (size_t i = 0; i < ARRAYCOUNT(s_GeneratorNames); i++) + { + m_cbGenerator->addItem(s_GeneratorNames[i]); + } + QFormLayout * baseLayout = new QFormLayout(); + baseLayout->addRow(new QLabel(tr("Seed")), m_eSeed); + baseLayout->addRow(new QLabel(tr("Generator")), m_cbGenerator); + + // The rest of the controls are in a dynamically created form layout: + m_FormLayout = new QFormLayout(); + + // The main layout joins these two vertically: + m_MainLayout = new QVBoxLayout(); + m_MainLayout->addLayout(baseLayout); + m_MainLayout->addLayout(m_FormLayout); + m_MainLayout->addStretch(); + setLayout(m_MainLayout); + + // Load the INI file, if specified, otherwise set defaults: + if (a_IniFileName.empty() || !m_IniFile->ReadFile(a_IniFileName)) + { + m_IniFile->SetValue("Generator", "Generator", "Composable"); + m_IniFile->SetValue("Generator", "BiomeGen", m_cbGenerator->currentText().toStdString()); + bool dummy; + delete cBiomeGen::CreateBiomeGen(*m_IniFile, 0, dummy); + } + updateFromIni(); + + // Connect the change events only after the data has been loaded: + connect(m_cbGenerator, SIGNAL(currentIndexChanged(QString)), this, SLOT(generatorChanged(QString))); + connect(m_eSeed, SIGNAL(textChanged(QString)), this, SLOT(editChanged(QString))); +} + + + + + +void GeneratorSetup::generatorChanged(const QString & a_NewName) +{ + // Clear the current contents of the form layout by assigning it to a stack temporary: + { + m_MainLayout->takeAt(1); + QWidget().setLayout(m_FormLayout); + } + + // Re-create the layout: + m_FormLayout = new QFormLayout(); + m_MainLayout->insertLayout(1, m_FormLayout); + + // Recreate the INI file: + m_IniFile->Clear(); + m_IniFile->SetValue("Generator", "Generator", "Composable"); + m_IniFile->SetValue("Generator", "BiomeGen", a_NewName.toStdString()); + + // Create a dummy biome gen from the INI file, this will create the defaults in the INI file: + bool dummy; + delete cBiomeGen::CreateBiomeGen(*m_IniFile, m_Seed, dummy); + + // Read all values from the INI file and put them into the form layout: + updateFromIni(); + + // Notify of the changes: + emit generatorUpdated(); +} + + + + + +void GeneratorSetup::editChanged(const QString & a_NewValue) +{ + QString sectionName = sender()->property("INI.SectionName").toString(); + QString itemName = sender()->property("INI.ItemName").toString(); + m_IniFile->SetValue(sectionName.toStdString(), itemName.toStdString(), a_NewValue.toStdString()); + emit generatorUpdated(); +} + + + + + +void GeneratorSetup::updateFromIni() +{ + m_eSeed->setText(QString::number(m_IniFile->GetValueI("Seed", "Seed", 0))); + int keyID = m_IniFile->FindKey("Generator"); + if (keyID <= -1) + { + return; + } + int numItems = m_IniFile->GetNumValues(keyID); + AString generatorName = m_IniFile->GetValue("Generator", "BiomeGen"); + size_t generatorNameLen = generatorName.length(); + for (int i = 0; i < numItems; i++) + { + AString itemName = m_IniFile->GetValueName(keyID, i); + if ((itemName == "Generator") || (itemName == "BiomeGen")) + { + // These special cases are not to be added + continue; + } + AString itemValue = m_IniFile->GetValue(keyID, i); + + QLineEdit * edit = new QLineEdit(); + edit->setText(QString::fromStdString(itemValue)); + edit->setProperty("INI.SectionName", QVariant("Generator")); + edit->setProperty("INI.ItemName", QVariant(QString::fromStdString(itemName))); + + // Remove the generator name prefix from the item name, for clarity purposes: + if (NoCaseCompare(itemName.substr(0, generatorNameLen), generatorName) == 0) + { + itemName.erase(0, generatorNameLen); + } + + connect(edit, SIGNAL(textChanged(QString)), this, SLOT(editChanged(QString))); + m_FormLayout->addRow(new QLabel(QString::fromStdString(itemName)), edit); + } // for i - INI values[] +} + + + + diff --git a/Tools/QtBiomeVisualiser/GeneratorSetup.h b/Tools/QtBiomeVisualiser/GeneratorSetup.h new file mode 100644 index 000000000..e72d3abbc --- /dev/null +++ b/Tools/QtBiomeVisualiser/GeneratorSetup.h @@ -0,0 +1,64 @@ +#pragma once + +#include <memory> +#include <QDialog> +#include <QComboBox> +#include <QVBoxLayout> +#include <QFormLayout> + + + + + +class cIniFile; +typedef std::shared_ptr<cIniFile> cIniFilePtr; + + + + + +class GeneratorSetup : + public QWidget +{ + typedef QWidget super; + + Q_OBJECT + +public: + /** Creates the widget and loads the contents of the INI file, if not empty. */ + explicit GeneratorSetup(const std::string & a_IniFileName, QWidget * parent = nullptr); + + /** Returns the cIniFile instance that is being edited by this widget. */ + cIniFilePtr getIniFile() { return m_IniFile; } + +signals: + /** Emitted when the generator parameters have changed. */ + void generatorUpdated(); + +public slots: + /** Called when the user selects a different generator from the top combobox. + Re-creates m_IniFile and updates the form layout. */ + void generatorChanged(const QString & a_NewName); + +protected slots: + /** Called when any of the edit widgets are changed. */ + void editChanged(const QString & a_NewValue); + +protected: + QComboBox * m_cbGenerator; + QLineEdit * m_eSeed; + QVBoxLayout * m_MainLayout; + QFormLayout * m_FormLayout; + + cIniFilePtr m_IniFile; + + int m_Seed; + + + /** Updates the form layout with the values from m_IniFile. */ + void updateFromIni(); +}; + + + + diff --git a/Tools/QtBiomeVisualiser/Globals.h b/Tools/QtBiomeVisualiser/Globals.h new file mode 100644 index 000000000..e2e9a9970 --- /dev/null +++ b/Tools/QtBiomeVisualiser/Globals.h @@ -0,0 +1,395 @@ +#pragma once + + + + + +// Compiler-dependent stuff: +#if defined(_MSC_VER) + // MSVC produces warning C4481 on the override keyword usage, so disable the warning altogether + #pragma warning(disable:4481) + + // Disable some warnings that we don't care about: + #pragma warning(disable:4100) // Unreferenced formal parameter + + // Useful warnings from warning level 4: + #pragma warning(3 : 4127) // Conditional expression is constant + #pragma warning(3 : 4189) // Local variable is initialized but not referenced + #pragma warning(3 : 4245) // Conversion from 'type1' to 'type2', signed/unsigned mismatch + #pragma warning(3 : 4310) // Cast truncates constant value + #pragma warning(3 : 4389) // Signed/unsigned mismatch + #pragma warning(3 : 4505) // Unreferenced local function has been removed + #pragma warning(3 : 4701) // Potentially unitialized local variable used + #pragma warning(3 : 4702) // Unreachable code + #pragma warning(3 : 4706) // Assignment within conditional expression + + // Disabling this warning, because we know what we're doing when we're doing this: + #pragma warning(disable: 4355) // 'this' used in initializer list + + // Disabled because it's useless: + #pragma warning(disable: 4512) // 'class': assignment operator could not be generated - reported for each class that has a reference-type member + + // 2014_01_06 xoft: Disabled this warning because MSVC is stupid and reports it in obviously wrong places + // #pragma warning(3 : 4244) // Conversion from 'type1' to 'type2', possible loss of data + + #define OBSOLETE __declspec(deprecated) + + // No alignment needed in MSVC + #define ALIGN_8 + #define ALIGN_16 + + #define FORMATSTRING(formatIndex, va_argsIndex) + + // MSVC has its own custom version of zu format + #define SIZE_T_FMT "%Iu" + #define SIZE_T_FMT_PRECISION(x) "%" #x "Iu" + #define SIZE_T_FMT_HEX "%Ix" + + #define NORETURN __declspec(noreturn) + +#elif defined(__GNUC__) + + // TODO: Can GCC explicitly mark classes as abstract (no instances can be created)? + #define abstract + + // override is part of c++11 + #if __cplusplus < 201103L + #define override + #endif + + #define OBSOLETE __attribute__((deprecated)) + + #define ALIGN_8 __attribute__((aligned(8))) + #define ALIGN_16 __attribute__((aligned(16))) + + // Some portability macros :) + #define stricmp strcasecmp + + #define FORMATSTRING(formatIndex, va_argsIndex) __attribute__((format (printf, formatIndex, va_argsIndex))) + + #if defined(_WIN32) + // We're compiling on MinGW, which uses an old MSVCRT library that has no support for size_t printfing. + // We need direct size formats: + #if defined(_WIN64) + #define SIZE_T_FMT "%I64u" + #define SIZE_T_FMT_PRECISION(x) "%" #x "I64u" + #define SIZE_T_FMT_HEX "%I64x" + #else + #define SIZE_T_FMT "%u" + #define SIZE_T_FMT_PRECISION(x) "%" #x "u" + #define SIZE_T_FMT_HEX "%x" + #endif + #else + // We're compiling on Linux, so we can use libc's size_t printf format: + #define SIZE_T_FMT "%zu" + #define SIZE_T_FMT_PRECISION(x) "%" #x "zu" + #define SIZE_T_FMT_HEX "%zx" + #endif + + #define NORETURN __attribute((__noreturn__)) + +#else + + #error "You are using an unsupported compiler, you might need to #define some stuff here for your compiler" + + /* + // Copy and uncomment this into another #elif section based on your compiler identification + + // Explicitly mark classes as abstract (no instances can be created) + #define abstract + + // Mark virtual methods as overriding (forcing them to have a virtual function of the same signature in the base class) + #define override + + // Mark functions as obsolete, so that their usage results in a compile-time warning + #define OBSOLETE + + // Mark types / variables for alignment. Do the platforms need it? + #define ALIGN_8 + #define ALIGN_16 + */ + +#endif + + +#ifdef _DEBUG + #define NORETURNDEBUG NORETURN +#else + #define NORETURNDEBUG +#endif + + +#include <stddef.h> + + +// Integral types with predefined sizes: +typedef long long Int64; +typedef int Int32; +typedef short Int16; + +typedef unsigned long long UInt64; +typedef unsigned int UInt32; +typedef unsigned short UInt16; + +typedef unsigned char Byte; + + +// If you get an error about specialization check the size of integral types +template <typename T, size_t Size, bool x = sizeof(T) == Size> +class SizeChecker; + +template <typename T, size_t Size> +class SizeChecker<T, Size, true> +{ + T v; +}; + +template class SizeChecker<Int64, 8>; +template class SizeChecker<Int32, 4>; +template class SizeChecker<Int16, 2>; + +template class SizeChecker<UInt64, 8>; +template class SizeChecker<UInt32, 4>; +template class SizeChecker<UInt16, 2>; + +// A macro to disallow the copy constructor and operator = functions +// This should be used in the private: declarations for any class that shouldn't allow copying itself +#define DISALLOW_COPY_AND_ASSIGN(TypeName) \ + TypeName(const TypeName &); \ + void operator =(const TypeName &) + +// A macro that is used to mark unused local variables, to avoid pedantic warnings in gcc / clang / MSVC +// Note that in MSVC it requires the full type of X to be known +#define UNUSED_VAR(X) (void)(X) + +// A macro that is used to mark unused function parameters, to avoid pedantic warnings in gcc +// Written so that the full type of param needn't be known +#ifdef _MSC_VER + #define UNUSED(X) +#else + #define UNUSED UNUSED_VAR +#endif + + + + +// OS-dependent stuff: +#ifdef _WIN32 + #define WIN32_LEAN_AND_MEAN + + #define _WIN32_WINNT 0x501 // We want to target WinXP and higher + + #include <Windows.h> + #include <winsock2.h> + #include <Ws2tcpip.h> // IPv6 stuff + + // Windows SDK defines min and max macros, messing up with our std::min and std::max usage + #undef min + #undef max + + // Windows SDK defines GetFreeSpace as a constant, probably a Win16 API remnant + #ifdef GetFreeSpace + #undef GetFreeSpace + #endif // GetFreeSpace +#else + #include <sys/types.h> + #include <sys/time.h> + #include <sys/socket.h> + #include <netinet/in.h> + #include <arpa/inet.h> + #include <netdb.h> + #include <time.h> + #include <dirent.h> + #include <errno.h> + #include <iostream> + #include <cstdio> + #include <cstring> + #include <pthread.h> + #include <semaphore.h> + #include <errno.h> + #include <fcntl.h> +#endif + +#if defined(ANDROID_NDK) + #define FILE_IO_PREFIX "/sdcard/mcserver/" +#else + #define FILE_IO_PREFIX "" +#endif + + + + + +// CRT stuff: +#include <sys/stat.h> +#include <assert.h> +#include <stdio.h> +#include <math.h> +#include <stdarg.h> + + + + + +// STL stuff: +#include <vector> +#include <list> +#include <deque> +#include <string> +#include <map> +#include <algorithm> +#include <memory> +#include <set> +#include <queue> +#include <limits> + + + +#ifndef TEST_GLOBALS + // Common headers (part 1, without macros): + #include "src/StringUtils.h" + #include "src/OSSupport/Sleep.h" + #include "src/OSSupport/CriticalSection.h" + #include "src/OSSupport/Semaphore.h" + #include "src/OSSupport/Event.h" + #include "src/OSSupport/Thread.h" + #include "src/OSSupport/File.h" + #include "src/Logger.h" +#else + // Logging functions +void inline LOGERROR(const char* a_Format, ...) FORMATSTRING(1, 2); + +void inline LOGERROR(const char* a_Format, ...) +{ + va_list argList; + va_start(argList, a_Format); + vprintf(a_Format, argList); + va_end(argList); +} +#endif + + + + + +// Common definitions: + +/// Evaluates to the number of elements in an array (compile-time!) +#define ARRAYCOUNT(X) (sizeof(X) / sizeof(*(X))) + +/// Allows arithmetic expressions like "32 KiB" (but consider using parenthesis around it, "(32 KiB)") +#define KiB * 1024 +#define MiB * 1024 * 1024 + +/// Faster than (int)floorf((float)x / (float)div) +#define FAST_FLOOR_DIV( x, div) (((x) - (((x) < 0) ? ((div) - 1) : 0)) / (div)) + +// Own version of assert() that writes failed assertions to the log for review +#ifdef TEST_GLOBALS + + class cAssertFailure + { + }; + + #ifdef _WIN32 + #if (defined(_MSC_VER) && defined(_DEBUG)) + #define DBG_BREAK _CrtDbgBreak() + #else + #define DBG_BREAK + #endif + #define REPORT_ERROR(FMT, ...) \ + { \ + AString msg = Printf(FMT, __VA_ARGS__); \ + puts(msg.c_str()); \ + fflush(stdout); \ + OutputDebugStringA(msg.c_str()); \ + DBG_BREAK; \ + } + #else + #define REPORT_ERROR(FMT, ...) \ + { \ + AString msg = Printf(FMT, __VA_ARGS__); \ + puts(msg.c_str()); \ + fflush(stdout); \ + } + #endif + #define ASSERT(x) do { if (!(x)) { throw cAssertFailure();} } while (0) + #define testassert(x) do { if (!(x)) { REPORT_ERROR("Test failure: %s, file %s, line %d\n", #x, __FILE__, __LINE__); exit(1); } } while (0) + #define CheckAsserts(x) do { try {x} catch (cAssertFailure) { break; } REPORT_ERROR("Test failure: assert didn't fire for %s, file %s, line %d\n", #x, __FILE__, __LINE__); exit(1); } while (0) + +#else + #ifdef _DEBUG + #define ASSERT( x) ( !!(x) || ( LOGERROR("Assertion failed: %s, file %s, line %i", #x, __FILE__, __LINE__), assert(0), 0)) + #else + #define ASSERT(x) ((void)(x)) + #endif +#endif + +// Pretty much the same as ASSERT() but stays in Release builds +#define VERIFY( x) ( !!(x) || ( LOGERROR("Verification failed: %s, file %s, line %i", #x, __FILE__, __LINE__), exit(1), 0)) + +// Same as assert but in all Self test builds +#ifdef SELF_TEST + #define assert_test(x) ( !!(x) || (assert(!#x), exit(1), 0)) +#endif + +// Allow both Older versions of MSVC and newer versions of everything use a shared_ptr: +// Note that we cannot typedef, because C++ doesn't allow (partial) templates to be typedeffed. +#if (defined(_MSC_VER) && (_MSC_VER < 1600)) + // MSVC before 2010 doesn't have std::shared_ptr, but has std::tr1::shared_ptr, defined in <memory> included earlier + #define SharedPtr std::tr1::shared_ptr +#elif (defined(_MSC_VER) || (__cplusplus >= 201103L)) + // C++11 has std::shared_ptr in <memory>, included earlier + #define SharedPtr std::shared_ptr +#else + // C++03 has std::tr1::shared_ptr in <tr1/memory> + #include <tr1/memory> + #define SharedPtr std::tr1::shared_ptr +#endif + + + + + +/** A generic interface used mainly in ForEach() functions */ +template <typename Type> class cItemCallback +{ +public: + virtual ~cItemCallback() {} + + /** Called for each item in the internal list; return true to stop the loop, or false to continue enumerating */ + virtual bool Item(Type * a_Type) = 0; +} ; + + + + +/** Clamp X to the specified range. */ +template <typename T> +T Clamp(T a_Value, T a_Min, T a_Max) +{ + return (a_Value < a_Min) ? a_Min : ((a_Value > a_Max) ? a_Max : a_Value); +} + + + + + +#ifndef TOLUA_TEMPLATE_BIND + #define TOLUA_TEMPLATE_BIND(x) +#endif + + + + + +// Common headers (part 2, with macros): +#include "src/ChunkDef.h" +#include "src/BiomeDef.h" +#include "src/BlockID.h" +#include "src/BlockInfo.h" + + + + + diff --git a/Tools/QtBiomeVisualiser/MainWindow.cpp b/Tools/QtBiomeVisualiser/MainWindow.cpp new file mode 100644 index 000000000..63d72f992 --- /dev/null +++ b/Tools/QtBiomeVisualiser/MainWindow.cpp @@ -0,0 +1,440 @@ +#include "Globals.h" +#include "MainWindow.h" +#include <QVBoxLayout> +#include <QAction> +#include <QMenuBar> +#include <QApplication> +#include <QFileDialog> +#include <QSettings> +#include <QDirIterator> +#include <QStatusBar> +#include "inifile/iniFile.h" +#include "ChunkSource.h" +#include "src/Generating/BioGen.h" +#include "src/StringCompression.h" +#include "src/WorldStorage/FastNBT.h" +#include "GeneratorSetup.h" + + + + + +const double MainWindow::m_ViewZooms[] = +{ + 0.0625, 0.125, 0.25, 0.5, 1, 2, 4, 8, 16, 24, +}; + + + + + +MainWindow::MainWindow(QWidget * parent) : + QMainWindow(parent), + m_GeneratorSetup(nullptr), + m_LineSeparator(nullptr) +{ + initMinecraftPath(); + + m_BiomeView = new BiomeView(); + connect(m_BiomeView, SIGNAL(increaseZoom()), this, SLOT(increaseZoom())); + connect(m_BiomeView, SIGNAL(decreaseZoom()), this, SLOT(decreaseZoom())); + connect(m_BiomeView, SIGNAL(wheelUp()), this, SLOT(increaseZoom())); + connect(m_BiomeView, SIGNAL(wheelDown()), this, SLOT(decreaseZoom())); + + m_StatusBar = new QStatusBar(); + this->setStatusBar(m_StatusBar); + m_StatusBlockX = new QLabel(tr("X")); + m_StatusBlockZ = new QLabel(tr("Z")); + m_StatusBiome = new QLabel(tr("B")); + m_StatusBar->addPermanentWidget(m_StatusBlockX); + m_StatusBar->addPermanentWidget(m_StatusBlockZ); + m_StatusBar->addPermanentWidget(m_StatusBiome); + + m_MainLayout = new QHBoxLayout(); + m_MainLayout->addWidget(m_BiomeView, 1); + m_MainLayout->setMenuBar(menuBar()); + m_MainLayout->setMargin(0); + QWidget * central = new QWidget(); + central->setLayout(m_MainLayout); + setCentralWidget(central); + + createActions(); + createMenus(); + + connect(m_BiomeView, SIGNAL(hoverChanged(int, int, int)), this, SLOT(hoverChanged(int, int, int))); +} + + + + + +MainWindow::~MainWindow() +{ + +} + + + + + +void MainWindow::newGenerator() +{ + // (Re-)open the generator setup dialog with empty settings: + openGeneratorSetup(""); + + // Set the chunk source: + cIniFilePtr iniFile = m_GeneratorSetup->getIniFile(); + m_BiomeView->setChunkSource(std::shared_ptr<BioGenSource>(new BioGenSource(iniFile))); + m_BiomeView->redraw(); +} + + + + + +void MainWindow::openGenerator() +{ + // Let the user specify the world.ini file: + QString worldIni = QFileDialog::getOpenFileName(this, tr("Open world.ini"), QString(), tr("world.ini (world.ini)")); + if (worldIni.isEmpty()) + { + return; + } + + // (Re-)open the generator setup dialog: + openGeneratorSetup(worldIni.toStdString()); + + // Set the chunk source: + m_BiomeView->setChunkSource(std::shared_ptr<BioGenSource>(new BioGenSource(m_GeneratorSetup->getIniFile()))); + m_BiomeView->redraw(); +} + + + + + +void MainWindow::openWorld() +{ + // Let the user specify the world: + QString regionFolder = QFileDialog::getExistingDirectory(this, tr("Select the region folder"), QString()); + if (regionFolder.isEmpty()) + { + return; + } + + // Remove the generator setup dialog, if open: + closeGeneratorSetup(); + + // Set the chunk source: + m_BiomeView->setChunkSource(std::shared_ptr<AnvilSource>(new AnvilSource(regionFolder))); + m_BiomeView->redraw(); +} + + + + + +void MainWindow::openVanillaWorld() +{ + // The world is stored in the sender action's data, retrieve it: + QAction * action = qobject_cast<QAction *>(sender()); + if (action == nullptr) + { + return; + } + + // Remove the generator setup dialog, if open: + closeGeneratorSetup(); + + // Set the chunk source: + m_BiomeView->setChunkSource(std::shared_ptr<AnvilSource>(new AnvilSource(action->data().toString()))); + m_BiomeView->redraw(); +} + + + + + +void MainWindow::centerView() +{ + m_BiomeView->setPosition(0, 0); +} + + + + + +void MainWindow::setViewZoom() +{ + // The zoom level is stored in the sender action's data, retrieve it: + QAction * action = qobject_cast<QAction *>(sender()); + if (action == nullptr) + { + return; + } + double newZoom = m_ViewZooms[action->data().toInt()]; + m_BiomeView->setZoomLevel(newZoom); + action->setChecked(true); +} + + + + + +void MainWindow::increaseZoom() +{ + // If already at max zoom, bail out: + if (m_CurrentZoomLevel >= ARRAYCOUNT(m_ViewZooms) - 1) + { + return; + } + + // Increase the zoom level: + m_CurrentZoomLevel += 1; + m_actViewZoom[m_CurrentZoomLevel]->setChecked(true); + m_BiomeView->setZoomLevel(m_ViewZooms[m_CurrentZoomLevel]); +} + + + + + +void MainWindow::decreaseZoom() +{ + // If already at min zoom, bail out: + if (m_CurrentZoomLevel == 0) + { + return; + } + + // Decrease the zoom level: + m_CurrentZoomLevel -= 1; + m_actViewZoom[m_CurrentZoomLevel]->setChecked(true); + m_BiomeView->setZoomLevel(m_ViewZooms[m_CurrentZoomLevel]); +} + + + + + +void MainWindow::hoverChanged(int a_BlockX, int a_BlockZ, int a_Biome) +{ + m_StatusBlockX->setText(tr("X: %1").arg(a_BlockX)); + m_StatusBlockZ->setText(tr("Z: %1").arg(a_BlockZ)); + m_StatusBiome->setText (tr("B: %1 (%2)").arg(BiomeToString(a_Biome).c_str()).arg(a_Biome)); +} + + + + + +void MainWindow::initMinecraftPath() +{ + #ifdef Q_OS_MAC + m_MinecraftPath = QDir::homePath() + QDir::toNativeSeparators("/Library/Application Support/minecraft"); + #elif defined Q_OS_WIN32 + QSettings ini(QSettings::IniFormat, QSettings::UserScope, ".minecraft", "minecraft1"); + m_MinecraftPath = QFileInfo(ini.fileName()).absolutePath(); + #else + m_MinecraftPath = QDir::homePath() + QDir::toNativeSeparators("/.minecraft"); + #endif +} + + + + + +void MainWindow::createActions() +{ + // Map menu: + createWorldActions(); + + m_actNewGen = new QAction(tr("&New generator"), this); + m_actNewGen->setShortcut(tr("Ctrl+N")); + m_actNewGen->setStatusTip(tr("Open a generator INI file and display the generated biomes")); + connect(m_actNewGen, SIGNAL(triggered()), this, SLOT(newGenerator())); + + m_actOpenGen = new QAction(tr("&Open generator..."), this); + m_actOpenGen->setShortcut(tr("Ctrl+G")); + m_actOpenGen->setStatusTip(tr("Open a generator INI file and display the generated biomes")); + connect(m_actOpenGen, SIGNAL(triggered()), this, SLOT(openGenerator())); + + m_actOpenWorld = new QAction(tr("&Open world..."), this); + m_actOpenWorld->setShortcut(tr("Ctrl+O")); + m_actOpenWorld->setStatusTip(tr("Open an existing world and display its biomes")); + connect(m_actOpenWorld, SIGNAL(triggered()), this, SLOT(openWorld())); + + m_actReload = new QAction(tr("&Reload"), this); + m_actReload->setShortcut(tr("F5")); + m_actReload->setStatusTip(tr("Clear the view cache and force a reload of all the data")); + connect(m_actReload, SIGNAL(triggered()), m_BiomeView, SLOT(reload())); + + m_actExit = new QAction(tr("E&xit"), this); + m_actExit->setShortcut(tr("Alt+X")); + m_actExit->setStatusTip(tr("Exit %1").arg(QApplication::instance()->applicationName())); + connect(m_actExit, SIGNAL(triggered()), this, SLOT(close())); + + // View menu: + m_actViewCenter = new QAction(tr("&Reset to center"), this); + m_actViewCenter->setStatusTip(tr("Scrolls the view back to the map center")); + connect(m_actViewCenter, SIGNAL(triggered()), this, SLOT(centerView())); + + QActionGroup * zoomGroup = new QActionGroup(this); + for (int i = 0; i < ARRAYCOUNT(m_ViewZooms); i++) + { + m_actViewZoom[i] = new QAction(tr("&Zoom %1%").arg(std::floor(m_ViewZooms[i] * 100)), this); + m_actViewZoom[i]->setCheckable(true); + if ((int)(m_ViewZooms[i] * 16) == 16) + { + m_actViewZoom[i]->setChecked(true); + m_CurrentZoomLevel = i; + } + m_actViewZoom[i]->setData(QVariant(i)); + zoomGroup->addAction(m_actViewZoom[i]); + connect(m_actViewZoom[i], SIGNAL(triggered()), this, SLOT(setViewZoom())); + } +} + + + + + +void MainWindow::createWorldActions() +{ + QDir mc(m_MinecraftPath); + if (!mc.cd("saves")) + { + return; + } + + QDirIterator it(mc); + int key = 1; + while (it.hasNext()) + { + it.next(); + if (!it.fileInfo().isDir()) + { + continue; + } + QString name = getWorldName(it.filePath().toStdString()); + if (name.isEmpty()) + { + continue; + } + QAction * w = new QAction(this); + w->setText(name); + w->setData(it.filePath() + "/region"); + if (key < 10) + { + w->setShortcut("Ctrl+" + QString::number(key)); + key++; + } + connect(w, SIGNAL(triggered()), this, SLOT(openVanillaWorld())); + m_WorldActions.append(w); + } +} + + + + + +void MainWindow::createMenus() +{ + // Map menu: + QMenu * file = menuBar()->addMenu(tr("&Map")); + file->addAction(m_actNewGen); + file->addAction(m_actOpenGen); + file->addSeparator(); + QMenu * worlds = file->addMenu(tr("Open &existing")); + worlds->addActions(m_WorldActions); + if (m_WorldActions.empty()) + { + worlds->setEnabled(false); + } + file->addAction(m_actOpenWorld); + file->addSeparator(); + file->addAction(m_actReload); + file->addSeparator(); + file->addAction(m_actExit); + + // View menu: + QMenu * view = menuBar()->addMenu(tr("&View")); + view->addAction(m_actViewCenter); + view->addSeparator(); + for (size_t i = 0; i < ARRAYCOUNT(m_actViewZoom); i++) + { + view->addAction(m_actViewZoom[i]); + } +} + + + + + +QString MainWindow::getWorldName(const AString & a_Path) +{ + AString levelData = cFile::ReadWholeFile(a_Path + "/level.dat"); + if (levelData.empty()) + { + // No such file / no data + return QString(); + } + + AString uncompressed; + if (UncompressStringGZIP(levelData.data(), levelData.size(), uncompressed) != Z_OK) + { + return QString(); + } + cParsedNBT nbt(uncompressed.data(), uncompressed.size()); + if (!nbt.IsValid()) + { + return QString(); + } + AString name = nbt.GetName(1); + int levelNameTag = nbt.FindTagByPath(nbt.GetRoot(), "Data\\LevelName"); + if ((levelNameTag <= 0) || (nbt.GetType(levelNameTag) != TAG_String)) + { + return QString(); + } + return QString::fromStdString(nbt.GetString(levelNameTag)); +} + + + + + +void MainWindow::openGeneratorSetup(const AString & a_IniFileName) +{ + // Close any previous editor: + closeGeneratorSetup(); + + // Open up a new editor: + m_GeneratorSetup = new GeneratorSetup(a_IniFileName); + m_LineSeparator = new QWidget(); + m_LineSeparator->setFixedWidth(2); + m_LineSeparator->setSizePolicy(QSizePolicy::Fixed, QSizePolicy::Expanding); + m_LineSeparator->setStyleSheet(QString("background-color: #c0c0c0;")); + m_MainLayout->addWidget(m_LineSeparator); + m_MainLayout->addWidget(m_GeneratorSetup); + + // Connect the signals from the setup pane: + connect(m_GeneratorSetup, SIGNAL(generatorUpdated()), m_BiomeView, SLOT(reload())); +} + + + + + +void MainWindow::closeGeneratorSetup() +{ + delete m_MainLayout->takeAt(2); + delete m_MainLayout->takeAt(1); + delete m_GeneratorSetup; + delete m_LineSeparator; + m_GeneratorSetup = nullptr; + m_LineSeparator = nullptr; +} + + + + diff --git a/Tools/QtBiomeVisualiser/MainWindow.h b/Tools/QtBiomeVisualiser/MainWindow.h new file mode 100644 index 000000000..27faae7a8 --- /dev/null +++ b/Tools/QtBiomeVisualiser/MainWindow.h @@ -0,0 +1,127 @@ +#pragma once + +#include <memory> +#include <QList> +#include <QMainWindow> +#include <QHBoxLayout> +#include <QLabel> +#include "BiomeView.h" + + + + + +// fwd: +class GeneratorSetup; + + + + + +class MainWindow : + public QMainWindow +{ + Q_OBJECT + +public: + MainWindow(QWidget * parent = nullptr); + ~MainWindow(); + +private slots: + /** Creates a generator definition from scratch, lets user modify generator params in realtime. */ + void newGenerator(); + + /** Opens a generator definition and generates the biomes based on that. */ + void openGenerator(); + + /** Opens an existing world and displays the loaded biomes. */ + void openWorld(); + + /** Opens a vanilla world that is specified by the calling action. */ + void openVanillaWorld(); + + /** Moves the view to the map's center. */ + void centerView(); + + /** Sets the zoom level specified in the triggering action. */ + void setViewZoom(); + + /** Sets a zoom level one step larger than current, if allowed. */ + void increaseZoom(); + + /** Sets a zoom level one step smaller than current, if allowed. */ + void decreaseZoom(); + + /** Updates the statusbar for the specified info about the current block under the cursor. */ + void hoverChanged(int a_BlockX, int a_BlockZ, int a_Biome); + +protected: + /** The zoom levels */ + static const double m_ViewZooms[10]; + + // Actions: + QAction * m_actNewGen; + QAction * m_actOpenGen; + QAction * m_actOpenWorld; + QAction * m_actReload; + QAction * m_actExit; + QAction * m_actViewCenter; + QAction * m_actViewZoom[ARRAYCOUNT(m_ViewZooms)]; + + /** List of actions that open the specific vanilla world. */ + QList<QAction *> m_WorldActions; + + /** Path to the vanilla folder. */ + QString m_MinecraftPath; + + /** The pane for setting up the generator, available when visualising a generator. */ + GeneratorSetup * m_GeneratorSetup; + + /** The main biome display widget. */ + BiomeView * m_BiomeView; + + /** The layout for the window. */ + QHBoxLayout * m_MainLayout; + + /** The status bar that displays the current hover information. */ + QStatusBar * m_StatusBar; + + QLabel * m_StatusBlockX; + QLabel * m_StatusBlockZ; + QLabel * m_StatusBiome; + + /** The separator line between biome view and generator setup. */ + QWidget * m_LineSeparator; + + /** Index into m_ViewZooms[] for the current zoom level. */ + size_t m_CurrentZoomLevel; + + + /** Initializes the m_MinecraftPath based on the proper MC path */ + void initMinecraftPath(); + + /** Creates the actions that the UI supports. */ + void createActions(); + + /** Creates the actions that open a specific vanilla world. Iterates over the minecraft saves folder. */ + void createWorldActions(); + + /** Creates the menu bar and connects its events. */ + void createMenus(); + + /** Returns the name of the vanilla world in the specified path. + Reads the level.dat file for the name. Returns an empty string on failure. */ + QString getWorldName(const AString & a_Path); + + /** Opens the generator setup pane, if not already open, and loads the specified INI file to it. */ + void openGeneratorSetup(const AString & a_IniFileName); + + /** Closes and destroys the generator setup pane, if there is one. */ + void closeGeneratorSetup(); +}; + + + + + + diff --git a/Tools/QtBiomeVisualiser/QtBiomeVisualiser.cpp b/Tools/QtBiomeVisualiser/QtBiomeVisualiser.cpp new file mode 100644 index 000000000..f41cdcfb2 --- /dev/null +++ b/Tools/QtBiomeVisualiser/QtBiomeVisualiser.cpp @@ -0,0 +1,20 @@ +#include "Globals.h" +#include "MainWindow.h" +#include <QApplication> + + + + + +int main(int argc, char *argv[]) +{ + QApplication a(argc, argv); + MainWindow w; + w.show(); + + return a.exec(); +} + + + + diff --git a/Tools/QtBiomeVisualiser/QtBiomeVisualiser.pro b/Tools/QtBiomeVisualiser/QtBiomeVisualiser.pro new file mode 100644 index 000000000..9e5d1303c --- /dev/null +++ b/Tools/QtBiomeVisualiser/QtBiomeVisualiser.pro @@ -0,0 +1,100 @@ +#------------------------------------------------- +# +# Project created by QtCreator 2014-09-11T15:22:43 +# +#------------------------------------------------- + +QT += core gui + +greaterThan(QT_MAJOR_VERSION, 4): QT += widgets + +TARGET = QtBiomeVisualiser +TEMPLATE = app + + +SOURCES +=\ + MainWindow.cpp \ + BiomeView.cpp \ + ../../src/Generating/BioGen.cpp \ + ../../src/VoronoiMap.cpp \ + ../../src/Noise.cpp \ + ../../src/StringUtils.cpp \ + ../../src/LoggerListeners.cpp \ + ../../src/Logger.cpp \ + ../../lib/inifile/iniFile.cpp \ + ../../src/OSSupport/File.cpp \ + ../../src/OSSupport/CriticalSection.cpp \ + ../../src/OSSupport/IsThread.cpp \ + ../../src/BiomeDef.cpp \ + ChunkCache.cpp \ + ChunkSource.cpp \ + ChunkLoader.cpp \ + ../../src/StringCompression.cpp \ + ../../src/WorldStorage/FastNBT.cpp \ + ../../lib/zlib/adler32.c \ + ../../lib/zlib/compress.c \ + ../../lib/zlib/crc32.c \ + ../../lib/zlib/deflate.c \ + ../../lib/zlib/gzclose.c \ + ../../lib/zlib/gzlib.c \ + ../../lib/zlib/gzread.c \ + ../../lib/zlib/gzwrite.c \ + ../../lib/zlib/infback.c \ + ../../lib/zlib/inffast.c \ + ../../lib/zlib/inflate.c \ + ../../lib/zlib/inftrees.c \ + ../../lib/zlib/trees.c \ + ../../lib/zlib/uncompr.c \ + ../../lib/zlib/zutil.c \ + GeneratorSetup.cpp \ + QtBiomeVisualiser.cpp \ + QtChunk.cpp + +HEADERS += MainWindow.h \ + Globals.h \ + BiomeView.h \ + ../../src/Generating/BioGen.h \ + ../../src/VoronoiMap.h \ + ../../src/Noise.h \ + ../../src/StringUtils.h \ + ../../src/LoggerListeners.h \ + ../../src/Logger.h \ + ../../lib/inifile/iniFile.h \ + ../../src/OSSupport/File.h \ + ../../src/OSSupport/CriticalSection.h \ + ../../src/OSSupport/IsThread.h \ + ../../src/BiomeDef.h \ + ChunkCache.h \ + ChunkSource.h \ + ChunkLoader.h \ + ../../src/StringCompression.h \ + ../../src/WorldStorage/FastNBT.h \ + ../../lib/zlib/crc32.h \ + ../../lib/zlib/deflate.h \ + ../../lib/zlib/gzguts.h \ + ../../lib/zlib/inffast.h \ + ../../lib/zlib/inffixed.h \ + ../../lib/zlib/inflate.h \ + ../../lib/zlib/inftrees.h \ + ../../lib/zlib/trees.h \ + ../../lib/zlib/zconf.h \ + ../../lib/zlib/zlib.h \ + ../../lib/zlib/zutil.h \ + GeneratorSetup.h \ + QtChunk.h + +INCLUDEPATH += $$_PRO_FILE_PWD_ \ + $$_PRO_FILE_PWD_/../../lib \ + $$_PRO_FILE_PWD_/../../lib/jsoncpp/include \ + $$_PRO_FILE_PWD_/../../lib/polarssl/include \ + $$_PRO_FILE_PWD_/../../lib/sqlite \ + $$_PRO_FILE_PWD_/../../lib/SQLiteCpp/include \ + $$_PRO_FILE_PWD_/../../ + + + +CONFIG += C++11 + +OTHER_FILES += + + diff --git a/Tools/QtBiomeVisualiser/QtChunk.cpp b/Tools/QtBiomeVisualiser/QtChunk.cpp new file mode 100644 index 000000000..031aa3654 --- /dev/null +++ b/Tools/QtBiomeVisualiser/QtChunk.cpp @@ -0,0 +1,190 @@ +#include "Globals.h" +#include "QtChunk.h" + + + + + +/** Map for converting biome values to colors. Initialized from biomeColors[]. */ +static uchar biomeToColor[256 * 4]; + +/** Map for converting biome values to colors. Used to initialize biomeToColor[].*/ +static struct +{ + EMCSBiome m_Biome; + uchar m_Color[3]; +} biomeColors[] = +{ + { biOcean, { 0x00, 0x00, 0x70 }, }, + { biPlains, { 0x8d, 0xb3, 0x60 }, }, + { biDesert, { 0xfa, 0x94, 0x18 }, }, + { biExtremeHills, { 0x60, 0x60, 0x60 }, }, + { biForest, { 0x05, 0x66, 0x21 }, }, + { biTaiga, { 0x0b, 0x66, 0x59 }, }, + { biSwampland, { 0x2f, 0xff, 0xda }, }, + { biRiver, { 0x30, 0x30, 0xaf }, }, + { biHell, { 0x7f, 0x00, 0x00 }, }, + { biSky, { 0x00, 0x7f, 0xff }, }, + { biFrozenOcean, { 0xa0, 0xa0, 0xdf }, }, + { biFrozenRiver, { 0xa0, 0xa0, 0xff }, }, + { biIcePlains, { 0xff, 0xff, 0xff }, }, + { biIceMountains, { 0xa0, 0xa0, 0xa0 }, }, + { biMushroomIsland, { 0xff, 0x00, 0xff }, }, + { biMushroomShore, { 0xa0, 0x00, 0xff }, }, + { biBeach, { 0xfa, 0xde, 0x55 }, }, + { biDesertHills, { 0xd2, 0x5f, 0x12 }, }, + { biForestHills, { 0x22, 0x55, 0x1c }, }, + { biTaigaHills, { 0x16, 0x39, 0x33 }, }, + { biExtremeHillsEdge, { 0x7f, 0x8f, 0x7f }, }, + { biJungle, { 0x53, 0x7b, 0x09 }, }, + { biJungleHills, { 0x2c, 0x42, 0x05 }, }, + + { biJungleEdge, { 0x62, 0x8b, 0x17 }, }, + { biDeepOcean, { 0x00, 0x00, 0x30 }, }, + { biStoneBeach, { 0xa2, 0xa2, 0x84 }, }, + { biColdBeach, { 0xfa, 0xf0, 0xc0 }, }, + { biBirchForest, { 0x30, 0x74, 0x44 }, }, + { biBirchForestHills, { 0x1f, 0x5f, 0x32 }, }, + { biRoofedForest, { 0x40, 0x51, 0x1a }, }, + { biColdTaiga, { 0x31, 0x55, 0x4a }, }, + { biColdTaigaHills, { 0x59, 0x7d, 0x72 }, }, + { biMegaTaiga, { 0x59, 0x66, 0x51 }, }, + { biMegaTaigaHills, { 0x59, 0x66, 0x59 }, }, + { biExtremeHillsPlus, { 0x50, 0x70, 0x50 }, }, + { biSavanna, { 0xbd, 0xb2, 0x5f }, }, + { biSavannaPlateau, { 0xa7, 0x9d, 0x64 }, }, + { biMesa, { 0xd9, 0x45, 0x15 }, }, + { biMesaPlateauF, { 0xb0, 0x97, 0x65 }, }, + { biMesaPlateau, { 0xca, 0x8c, 0x65 }, }, + + // M variants: + { biSunflowerPlains, { 0xb5, 0xdb, 0x88 }, }, + { biDesertM, { 0xff, 0xbc, 0x40 }, }, + { biExtremeHillsM, { 0x88, 0x88, 0x88 }, }, + { biFlowerForest, { 0x2d, 0x8e, 0x49 }, }, + { biTaigaM, { 0x33, 0x8e, 0x81 }, }, + { biSwamplandM, { 0x07, 0xf9, 0xb2 }, }, + { biIcePlainsSpikes, { 0xb4, 0xdc, 0xdc }, }, + { biJungleM, { 0x7b, 0xa3, 0x31 }, }, + { biJungleEdgeM, { 0x62, 0x8b, 0x17 }, }, + { biBirchForestM, { 0x58, 0x9c, 0x6c }, }, + { biBirchForestHillsM, { 0x47, 0x87, 0x5a }, }, + { biRoofedForestM, { 0x68, 0x79, 0x42 }, }, + { biColdTaigaM, { 0x24, 0x3f, 0x36 }, }, + { biMegaSpruceTaiga, { 0x45, 0x4f, 0x3e }, }, + { biMegaSpruceTaigaHills, { 0x45, 0x4f, 0x4e }, }, + { biExtremeHillsPlusM, { 0x78, 0x98, 0x78 }, }, + { biSavannaM, { 0xe5, 0xda, 0x87 }, }, + { biSavannaPlateauM, { 0xa7, 0x9d, 0x74 }, }, + { biMesaBryce, { 0xff, 0x6d, 0x3d }, }, + { biMesaPlateauFM, { 0xd8, 0xbf, 0x8d }, }, + { biMesaPlateauM, { 0xf2, 0xb4, 0x8d }, }, +} ; + + + + + +static class BiomeColorsInitializer +{ +public: + BiomeColorsInitializer(void) + { + // Reset all colors to gray: + for (size_t i = 0; i < ARRAYCOUNT(biomeToColor); i++) + { + biomeToColor[i] = 0x7f; + } + + // Set known biomes to their colors: + for (size_t i = 0; i < ARRAYCOUNT(biomeColors); i++) + { + uchar * color = &biomeToColor[4 * biomeColors[i].m_Biome]; + color[0] = biomeColors[i].m_Color[2]; + color[1] = biomeColors[i].m_Color[1]; + color[2] = biomeColors[i].m_Color[0]; + color[3] = 0xff; + } + } +} biomeColorInitializer; + + + + + +/** Converts biomes in an array into the chunk image data. */ +static void biomesToImage(const cChunkDef::BiomeMap & a_Biomes, Chunk::Image & a_Image) +{ + // Make sure the two arrays are of the same size, compile-time. + // Note that a_Image is actually 4 items per pixel, so the array is 4 times bigger: + static const char Check1[4 * ARRAYCOUNT(a_Biomes) - ARRAYCOUNT(a_Image) + 1] = {}; + static const char Check2[ARRAYCOUNT(a_Image) - 4 * ARRAYCOUNT(a_Biomes) + 1] = {}; + + // Convert the biomes into color: + for (size_t i = 0; i < ARRAYCOUNT(a_Biomes); i++) + { + a_Image[4 * i + 0] = biomeToColor[4 * a_Biomes[i] + 0]; + a_Image[4 * i + 1] = biomeToColor[4 * a_Biomes[i] + 1]; + a_Image[4 * i + 2] = biomeToColor[4 * a_Biomes[i] + 2]; + a_Image[4 * i + 3] = biomeToColor[4 * a_Biomes[i] + 3]; + } +} + + + + + +//////////////////////////////////////////////////////////////////////////////// +// Chunk: + +Chunk::Chunk() : + m_IsValid(false) +{ +} + + + + + +const uchar * Chunk::getImage(void) const +{ + ASSERT(m_IsValid); + return m_Image; +} + + + + + +void Chunk::setBiomes(const cChunkDef::BiomeMap & a_Biomes) +{ + memcpy(m_Biomes, a_Biomes, sizeof(m_Biomes)); + renderBiomes(); + m_IsValid = true; +} + + + + + +EMCSBiome Chunk::getBiome(int a_RelX, int a_RelZ) +{ + if (!m_IsValid) + { + return biInvalidBiome; + } + return cChunkDef::GetBiome(m_Biomes, a_RelX, a_RelZ); +} + + + + + +void Chunk::renderBiomes() +{ + biomesToImage(m_Biomes, m_Image); +} + + + + diff --git a/Tools/QtBiomeVisualiser/QtChunk.h b/Tools/QtBiomeVisualiser/QtChunk.h new file mode 100644 index 000000000..74321577a --- /dev/null +++ b/Tools/QtBiomeVisualiser/QtChunk.h @@ -0,0 +1,51 @@ +#pragma once + +#include <qglobal.h> + + + + + +class Chunk +{ +public: + /** The type used for storing image data for a chunk. */ + typedef uchar Image[16 * 16 * 4]; + + + Chunk(void); + + /** Returns true iff the chunk data is valid - loaded or generated. */ + bool isValid(void) const { return m_IsValid; } + + /** Returns the image of the chunk's biomes. Assumes that the chunk is valid. */ + const uchar * getImage(void) const; + + /** Sets the biomes to m_Biomes and renders them into m_Image. */ + void setBiomes(const cChunkDef::BiomeMap & a_Biomes); + + /** Returns the biome at the specified relative coords, or biInvalidBiome if not valid. + Coords must be valid inside this chunk. */ + EMCSBiome getBiome(int a_RelX, int a_RelZ); + +protected: + /** Flag that specifies if the chunk data is valid - loaded or generated. */ + bool m_IsValid; + + /** Cached rendered image of this chunk's biomes. Updated in render(). */ + Image m_Image; + + /** Biomes comprising the chunk, in the X + 16 * Z ordering. */ + cChunkDef::BiomeMap m_Biomes; + + + /** Renders biomes from m_Biomes into m_Image. */ + void renderBiomes(); +}; + +typedef std::shared_ptr<Chunk> ChunkPtr; + + + + + diff --git a/lib/SQLiteCpp b/lib/SQLiteCpp new file mode 160000 +Subproject 55edadd56d0d6f506954ad00c3b9a5d425814a2 diff --git a/lib/inifile/iniFile.cpp b/lib/inifile/iniFile.cpp index 2bf6c91ed..7cfe7661f 100644 --- a/lib/inifile/iniFile.cpp +++ b/lib/inifile/iniFile.cpp @@ -668,6 +668,24 @@ void cIniFile::Clear(void) +bool cIniFile::HasValue(const AString & a_KeyName, const AString & a_ValueName) +{ + // Find the key: + int keyID = FindKey(a_KeyName); + if (keyID == noID) + { + return false; + } + + // Find the value: + int valueID = FindValue(keyID, a_ValueName); + return (valueID != noID); +} + + + + + void cIniFile::AddHeaderComment(const AString & comment) { comments.push_back(comment); diff --git a/lib/inifile/iniFile.h b/lib/inifile/iniFile.h index 58fecd0cf..33229bff0 100644 --- a/lib/inifile/iniFile.h +++ b/lib/inifile/iniFile.h @@ -53,7 +53,9 @@ private: /// Removes the UTF-8 BOMs (Byte order makers), if present. void RemoveBom(AString & a_line) const; + public: + enum errors { noID = -1, @@ -79,6 +81,9 @@ public: /// Deletes all stored ini data (but doesn't touch the file) void Clear(void); + + /** Returns true iff the specified value exists. */ + bool HasValue(const AString & a_KeyName, const AString & a_ValueName); /// Returns index of specified key, or noID if not found int FindKey(const AString & keyname) const; diff --git a/lib/tolua++/include/tolua++.h b/lib/tolua++/include/tolua++.h index 8da427fe3..c8b654ae6 100644 --- a/lib/tolua++/include/tolua++.h +++ b/lib/tolua++/include/tolua++.h @@ -36,7 +36,9 @@ extern "C" { #define TEMPLATE_BIND(p) #endif -#define TOLUA_TEMPLATE_BIND(p) +#ifndef TOLUA_TEMPLATE_BIND + #define TOLUA_TEMPLATE_BIND(p) +#endif #define TOLUA_PROTECTED_DESTRUCTOR #define TOLUA_PROPERTY_TYPE(p) diff --git a/lib/tolua++/src/bin/lua/_driver.lua b/lib/tolua++/src/bin/lua/_driver.lua index 87ecd42ea..1ca18862b 100644 --- a/lib/tolua++/src/bin/lua/_driver.lua +++ b/lib/tolua++/src/bin/lua/_driver.lua @@ -3,6 +3,9 @@ local mobdebugfound, mobdebug = pcall(require, "mobdebug") if mobdebugfound then mobdebug.start() end +-- Disable buffering for stdout, so that the results appear immediately: +io.output():setvbuf("no") + -- The list of valid arguments that the ToLua scripts can process: local KnownArgs = { ['v'] = true, diff --git a/lib/tolua++/src/lib/tolua_push.c b/lib/tolua++/src/lib/tolua_push.c index 947f0e7a5..73a5f6ec0 100644 --- a/lib/tolua++/src/lib/tolua_push.c +++ b/lib/tolua++/src/lib/tolua_push.c @@ -16,6 +16,7 @@ #include "../../../lua/src/lauxlib.h" #include <stdlib.h> +#include <assert.h> TOLUA_API void tolua_pushvalue (lua_State* L, int lo) { @@ -55,12 +56,14 @@ TOLUA_API void tolua_pushusertype (lua_State* L, void* value, const char* type) else { luaL_getmetatable(L, type); + assert(!lua_isnil(L, -1)); /* Failure here means that the usertype is unknown to ToLua. Check what type you're pushing. */ lua_pushstring(L,"tolua_ubox"); lua_rawget(L,-2); /* stack: mt ubox */ - if (lua_isnil(L, -1)) { - lua_pop(L, 1); - lua_pushstring(L, "tolua_ubox"); - lua_rawget(L, LUA_REGISTRYINDEX); + if (lua_isnil(L, -1)) + { + lua_pop(L, 1); + lua_pushstring(L, "tolua_ubox"); + lua_rawget(L, LUA_REGISTRYINDEX); }; lua_pushlightuserdata(L,value); lua_rawget(L,-2); /* stack: mt ubox ubox[u] */ diff --git a/src/AllocationPool.h b/src/AllocationPool.h index 3c9dbe8c9..61431a548 100644 --- a/src/AllocationPool.h +++ b/src/AllocationPool.h @@ -3,7 +3,7 @@ #include <memory> -template<class T> +template <class T> class cAllocationPool { public: @@ -34,7 +34,7 @@ public: /** Allocates memory storing unused elements in a linked list. Keeps at least NumElementsInReserve elements in the list unless malloc fails so that the program has a reserve to handle OOM.**/ -template<class T, size_t NumElementsInReserve> +template <class T, size_t NumElementsInReserve> class cListAllocationPool : public cAllocationPool<T> { public: diff --git a/src/Bindings/AllToLua.pkg b/src/Bindings/AllToLua.pkg index 1e5dfd2fe..73de98e22 100644 --- a/src/Bindings/AllToLua.pkg +++ b/src/Bindings/AllToLua.pkg @@ -27,6 +27,7 @@ $cfile "WebPlugin.h" $cfile "LuaWindow.h" $cfile "../BlockID.h" +$cfile "../Mobs/MonsterTypes.h" $cfile "../BlockInfo.h" $cfile "../StringUtils.h" $cfile "../Defines.h" @@ -47,6 +48,7 @@ $cfile "../Inventory.h" $cfile "../Enchantments.h" $cfile "../Item.h" $cfile "../ItemGrid.h" +$cfile "../BlockEntities/BeaconEntity.h" $cfile "../BlockEntities/BlockEntity.h" $cfile "../BlockEntities/BlockEntityWithItems.h" $cfile "../BlockEntities/ChestEntity.h" @@ -66,7 +68,6 @@ $cfile "../Root.h" $cfile "../Cuboid.h" $cfile "../BoundingBox.h" $cfile "../Tracer.h" -$cfile "../Group.h" $cfile "../BlockArea.h" $cfile "../Generating/ChunkDesc.h" $cfile "../CraftingRecipes.h" @@ -77,6 +78,7 @@ $cfile "../Map.h" $cfile "../MapManager.h" $cfile "../Scoreboard.h" $cfile "../Statistics.h" +$cfile "../Protocol/MojangAPI.h" diff --git a/src/Bindings/CMakeLists.txt b/src/Bindings/CMakeLists.txt index 2ea2fa8c0..930ee9771 100644 --- a/src/Bindings/CMakeLists.txt +++ b/src/Bindings/CMakeLists.txt @@ -11,6 +11,7 @@ SET (SRCS LuaState.cpp LuaWindow.cpp ManualBindings.cpp + ManualBindings_RankManager.cpp Plugin.cpp PluginLua.cpp PluginManager.cpp @@ -45,7 +46,6 @@ set(BINDING_DEPENDENCIES ../Bindings/AllToLua.pkg ../Bindings/gen_LuaState_Call.lua ../Bindings/LuaFunctions.h - ../Bindings/LuaState_Call.inc ../Bindings/LuaWindow.h ../Bindings/Plugin.h ../Bindings/PluginLua.h @@ -53,6 +53,7 @@ set(BINDING_DEPENDENCIES ../Bindings/WebPlugin.h ../BiomeDef.h ../BlockArea.h + ../BlockEntities/BeaconEntity.h ../BlockEntities/BlockEntity.h ../BlockEntities/BlockEntityWithItems.h ../BlockEntities/ChestEntity.h @@ -96,7 +97,6 @@ set(BINDING_DEPENDENCIES ../Entities/HangingEntity.h ../Entities/ItemFrame.h ../Generating/ChunkDesc.h - ../Group.h ../Inventory.h ../Item.h ../ItemGrid.h @@ -125,8 +125,11 @@ if (NOT MSVC) DEPENDS ${BINDING_DEPENDENCIES} ) endif () -set_source_files_properties(Bindings/Bindings.cpp PROPERTIES GENERATED TRUE) -set_source_files_properties(Bindings/Bindings.h PROPERTIES GENERATED TRUE) +set_source_files_properties(${CMAKE_SOURCE_DIR}/src/Bindings/Bindings.cpp PROPERTIES GENERATED TRUE) +set_source_files_properties(${CMAKE_SOURCE_DIR}/src/Bindings/Bindings.h PROPERTIES GENERATED TRUE) +set_source_files_properties(${CMAKE_SOURCE_DIR}/src/Bindings/LuaState_Call.inc PROPERTIES GENERATED TRUE) + +set_source_files_properties(${CMAKE_SOURCE_DIR}/src/Bindings/Bindings.cpp PROPERTIES COMPILE_FLAGS -Wno-error) if(NOT MSVC) add_library(Bindings ${SRCS} ${HDRS}) diff --git a/src/Bindings/DeprecatedBindings.cpp b/src/Bindings/DeprecatedBindings.cpp index 36243bc92..02aa15be4 100644 --- a/src/Bindings/DeprecatedBindings.cpp +++ b/src/Bindings/DeprecatedBindings.cpp @@ -5,11 +5,6 @@ #undef TOLUA_TEMPLATE_BIND #include "tolua++/include/tolua++.h" -#include "Plugin.h" -#include "PluginLua.h" -#include "PluginManager.h" -#include "LuaWindow.h" -#include "LuaChunkStay.h" #include "../BlockInfo.h" diff --git a/src/Bindings/LuaChunkStay.cpp b/src/Bindings/LuaChunkStay.cpp index 59b02d8f7..a3d3a8090 100644 --- a/src/Bindings/LuaChunkStay.cpp +++ b/src/Bindings/LuaChunkStay.cpp @@ -6,7 +6,6 @@ #include "Globals.h" #include "LuaChunkStay.h" #include "PluginLua.h" -#include "../World.h" @@ -107,7 +106,7 @@ void cLuaChunkStay::AddChunkCoord(cLuaState & L, int a_Index) } } // for itr - m_Chunks[] - m_Chunks.push_back(cChunkCoords(ChunkX, ZERO_CHUNK_Y, ChunkZ)); + m_Chunks.push_back(cChunkCoords(ChunkX, ChunkZ)); } diff --git a/src/Bindings/LuaChunkStay.h b/src/Bindings/LuaChunkStay.h index 49ab9a0ad..d76b67de9 100644 --- a/src/Bindings/LuaChunkStay.h +++ b/src/Bindings/LuaChunkStay.h @@ -18,6 +18,7 @@ // fwd: class cPluginLua; +class cChunkMap; diff --git a/src/Bindings/LuaFunctions.h b/src/Bindings/LuaFunctions.h index 2ea37d7a4..be1d9aaa9 100644 --- a/src/Bindings/LuaFunctions.h +++ b/src/Bindings/LuaFunctions.h @@ -1,6 +1,6 @@ #pragma once -#include "../MCLogger.h" +#include "Logger.h" #include <time.h> // tolua_begin diff --git a/src/Bindings/LuaState.cpp b/src/Bindings/LuaState.cpp index e123a87c9..85e3f9fc5 100644 --- a/src/Bindings/LuaState.cpp +++ b/src/Bindings/LuaState.cpp @@ -460,7 +460,43 @@ void cLuaState::Push(const Vector3d & a_Vector) { ASSERT(IsValid()); - tolua_pushusertype(m_LuaState, (void *)&a_Vector, "Vector3d"); + tolua_pushusertype(m_LuaState, (void *)&a_Vector, "Vector3<double>"); + m_NumCurrentFunctionArgs += 1; +} + + + + + +void cLuaState::Push(const Vector3d * a_Vector) +{ + ASSERT(IsValid()); + + tolua_pushusertype(m_LuaState, (void *)a_Vector, "Vector3<double>"); + m_NumCurrentFunctionArgs += 1; +} + + + + + +void cLuaState::Push(const Vector3i & a_Vector) +{ + ASSERT(IsValid()); + + tolua_pushusertype(m_LuaState, (void *)&a_Vector, "Vector3<int>"); + m_NumCurrentFunctionArgs += 1; +} + + + + + +void cLuaState::Push(const Vector3i * a_Vector) +{ + ASSERT(IsValid()); + + tolua_pushusertype(m_LuaState, (void *)a_Vector, "Vector3<int>"); m_NumCurrentFunctionArgs += 1; } @@ -708,11 +744,11 @@ void cLuaState::Push(TakeDamageInfo * a_TDI) -void cLuaState::Push(Vector3i * a_Vector) +void cLuaState::Push(Vector3d * a_Vector) { ASSERT(IsValid()); - tolua_pushusertype(m_LuaState, a_Vector, "Vector3i"); + tolua_pushusertype(m_LuaState, a_Vector, "Vector3<double>"); m_NumCurrentFunctionArgs += 1; } @@ -720,11 +756,11 @@ void cLuaState::Push(Vector3i * a_Vector) -void cLuaState::Push(Vector3d * a_Vector) +void cLuaState::Push(Vector3i * a_Vector) { ASSERT(IsValid()); - tolua_pushusertype(m_LuaState, a_Vector, "Vector3d"); + tolua_pushusertype(m_LuaState, a_Vector, "Vector3<int>"); m_NumCurrentFunctionArgs += 1; } @@ -823,6 +859,42 @@ void cLuaState::GetStackValue(int a_StackPos, eWeather & a_ReturnedVal) +void cLuaState::GetStackValue(int a_StackPos, pBoundingBox & a_ReturnedVal) +{ + if (lua_isnil(m_LuaState, a_StackPos)) + { + a_ReturnedVal = NULL; + return; + } + tolua_Error err; + if (tolua_isusertype(m_LuaState, a_StackPos, "cBoundingBox", false, &err)) + { + a_ReturnedVal = *((cBoundingBox **)lua_touserdata(m_LuaState, a_StackPos)); + } +} + + + + + +void cLuaState::GetStackValue(int a_StackPos, pWorld & a_ReturnedVal) +{ + if (lua_isnil(m_LuaState, a_StackPos)) + { + a_ReturnedVal = NULL; + return; + } + tolua_Error err; + if (tolua_isusertype(m_LuaState, a_StackPos, "cWorld", false, &err)) + { + a_ReturnedVal = *((cWorld **)lua_touserdata(m_LuaState, a_StackPos)); + } +} + + + + + bool cLuaState::CallFunction(int a_NumResults) { ASSERT (m_NumCurrentFunctionArgs >= 0); // A function must be pushed to stack first @@ -1334,10 +1406,8 @@ void cLuaState::LogStack(const char * a_Header) void cLuaState::LogStack(lua_State * a_LuaState, const char * a_Header) { - UNUSED(a_Header); // The param seems unused when compiling for release, so the compiler warns - // Format string consisting only of %s is used to appease the compiler - LOGD("%s", (a_Header != NULL) ? a_Header : "Lua C API Stack contents:"); + LOG("%s", (a_Header != NULL) ? a_Header : "Lua C API Stack contents:"); for (int i = lua_gettop(a_LuaState); i > 0; i--) { AString Value; diff --git a/src/Bindings/LuaState.h b/src/Bindings/LuaState.h index afac77ce8..ef87c3efc 100644 --- a/src/Bindings/LuaState.h +++ b/src/Bindings/LuaState.h @@ -56,9 +56,12 @@ struct HTTPRequest; class cWebAdmin; struct HTTPTemplateRequest; class cTNTEntity; -class cCreeper; class cHopperEntity; class cBlockEntity; +class cBoundingBox; + +typedef cBoundingBox * pBoundingBox; +typedef cWorld * pWorld; @@ -186,6 +189,9 @@ public: void Push(const HTTPRequest * a_Request); void Push(const HTTPTemplateRequest * a_Request); void Push(const Vector3d & a_Vector); + void Push(const Vector3d * a_Vector); + void Push(const Vector3i & a_Vector); + void Push(const Vector3i * a_Vector); // Push a value onto the stack (keep alpha-sorted): void Push(bool a_Value); @@ -227,6 +233,12 @@ public: /** Retrieve value at a_StackPos, if it is a valid number, converting and clamping it to eWeather. If not, a_Value is unchanged. */ void GetStackValue(int a_StackPos, eWeather & a_Value); + + /** Retrieve value at a_StackPos, if it is a valid cBoundingBox class. If not, a_Value is unchanged */ + void GetStackValue(int a_StackPos, pBoundingBox & a_Value); + + /** Retrieve value at a_StackPos, if it is a valid cWorld class. If not, a_Value is unchanged */ + void GetStackValue(int a_StackPos, pWorld & a_Value); // Include the cLuaState::Call() overload implementation that is generated by the gen_LuaState_Call.lua script: @@ -292,7 +304,7 @@ public: void ToString(int a_StackPos, AString & a_String); /** Logs all the elements' types on the API stack, with an optional header for the listing. */ - void LogStack(const char * a_Header); + void LogStack(const char * a_Header = NULL); /** Logs all the elements' types on the API stack, with an optional header for the listing. */ static void LogStack(lua_State * a_LuaState, const char * a_Header = NULL); @@ -325,6 +337,14 @@ protected: */ bool PushFunction(int a_FnRef); + /** Pushes a function that has been saved as a reference. + Returns true if successful. Logs a warning on failure + */ + bool PushFunction(const cRef & a_FnRef) + { + return PushFunction((int)a_FnRef); + } + /** Pushes a function that is stored in a referenced table by name Returns true if successful. Logs a warning on failure */ diff --git a/src/Bindings/LuaWindow.cpp b/src/Bindings/LuaWindow.cpp index 1a2582ab0..c4d03b86b 100644 --- a/src/Bindings/LuaWindow.cpp +++ b/src/Bindings/LuaWindow.cpp @@ -6,7 +6,6 @@ #include "LuaWindow.h" #include "../UI/SlotArea.h" #include "PluginLua.h" -#include "../Entities/Player.h" #include "lua/src/lauxlib.h" // Needed for LUA_REFNIL diff --git a/src/Bindings/ManualBindings.cpp b/src/Bindings/ManualBindings.cpp index df9687fc0..f643f06ec 100644 --- a/src/Bindings/ManualBindings.cpp +++ b/src/Bindings/ManualBindings.cpp @@ -5,7 +5,6 @@ #undef TOLUA_TEMPLATE_BIND #include "tolua++/include/tolua++.h" #include "polarssl/md5.h" -#include "Plugin.h" #include "PluginLua.h" #include "PluginManager.h" #include "LuaWindow.h" @@ -16,6 +15,7 @@ #include "../WebAdmin.h" #include "../ClientHandle.h" #include "../BlockArea.h" +#include "../BlockEntities/BeaconEntity.h" #include "../BlockEntities/ChestEntity.h" #include "../BlockEntities/CommandBlockEntity.h" #include "../BlockEntities/DispenserEntity.h" @@ -80,6 +80,33 @@ static int lua_do_error(lua_State* L, const char * a_pFormat, ...) // Lua bound functions with special return types +static int tolua_Clamp(lua_State * tolua_S) +{ + cLuaState LuaState(tolua_S); + int NumArgs = lua_gettop(LuaState); + if (NumArgs != 3) + { + return lua_do_error(LuaState, "Error in function call '#funcname#': Requires 3 arguments, got %i", NumArgs); + } + + if (!lua_isnumber(LuaState, 1) || !lua_isnumber(LuaState, 2) || !lua_isnumber(LuaState, 3)) + { + return lua_do_error(LuaState, "Error in function call '#funcname#': Expected a number for parameters #1, #2 and #3"); + } + + lua_Number Number = tolua_tonumber(LuaState, 1, 0); + lua_Number Min = tolua_tonumber(LuaState, 2, 0); + lua_Number Max = tolua_tonumber(LuaState, 3, 0); + + lua_Number Result = Clamp(Number, Min, Max); + LuaState.Push(Result); + return 1; +} + + + + + static int tolua_StringSplit(lua_State * tolua_S) { cLuaState LuaState(tolua_S); @@ -139,7 +166,7 @@ static AString GetLogMessage(lua_State * tolua_S) static int tolua_LOG(lua_State * tolua_S) { // If the param is a cCompositeChat, read the log level from it: - cMCLogger::eLogLevel LogLevel = cMCLogger::llRegular; + cLogger::eLogLevel LogLevel = cLogger::llRegular; tolua_Error err; if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err)) { @@ -147,7 +174,7 @@ static int tolua_LOG(lua_State * tolua_S) } // Log the message: - cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), LogLevel); + cLogger::GetInstance().LogSimple(GetLogMessage(tolua_S).c_str(), LogLevel); return 0; } @@ -157,7 +184,7 @@ static int tolua_LOG(lua_State * tolua_S) static int tolua_LOGINFO(lua_State * tolua_S) { - cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llInfo); + cLogger::GetInstance().LogSimple(GetLogMessage(tolua_S).c_str(), cLogger::llInfo); return 0; } @@ -167,7 +194,7 @@ static int tolua_LOGINFO(lua_State * tolua_S) static int tolua_LOGWARN(lua_State * tolua_S) { - cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llWarning); + cLogger::GetInstance().LogSimple(GetLogMessage(tolua_S).c_str(), cLogger::llWarning); return 0; } @@ -177,7 +204,7 @@ static int tolua_LOGWARN(lua_State * tolua_S) static int tolua_LOGERROR(lua_State * tolua_S) { - cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llError); + cLogger::GetInstance().LogSimple(GetLogMessage(tolua_S).c_str(), cLogger::llError); return 0; } @@ -272,11 +299,11 @@ static int tolua_cFile_GetFolderContents(lua_State * tolua_S) -template< +template < class Ty1, class Ty2, bool (Ty1::*Func1)(const AString &, cItemCallback<Ty2> &) - > +> static int tolua_DoWith(lua_State* tolua_S) { int NumArgs = lua_gettop(tolua_S) - 1; /* This includes 'self' */ @@ -366,7 +393,7 @@ static int tolua_DoWith(lua_State* tolua_S) -template< +template < class Ty1, class Ty2, bool (Ty1::*Func1)(int, cItemCallback<Ty2> &) @@ -456,7 +483,7 @@ static int tolua_DoWithID(lua_State* tolua_S) -template< +template < class Ty1, class Ty2, bool (Ty1::*Func1)(int, int, int, cItemCallback<Ty2> &) @@ -478,7 +505,6 @@ static int tolua_DoWithXYZ(lua_State* tolua_S) int ItemX = ((int)tolua_tonumber(tolua_S, 2, 0)); int ItemY = ((int)tolua_tonumber(tolua_S, 3, 0)); int ItemZ = ((int)tolua_tonumber(tolua_S, 4, 0)); - LOG("x %i y %i z %i", ItemX, ItemY, ItemZ); if (!lua_isfunction( tolua_S, 5)) { return lua_do_error(tolua_S, "Error in function call '#funcname#': Expected a function for parameter #4"); @@ -552,7 +578,7 @@ static int tolua_DoWithXYZ(lua_State* tolua_S) -template< +template < class Ty1, class Ty2, bool (Ty1::*Func1)(int, int, cItemCallback<Ty2> &) @@ -648,7 +674,80 @@ static int tolua_ForEachInChunk(lua_State * tolua_S) -template< +template < + class Ty1, + class Ty2, + bool (Ty1::*Func1)(const cBoundingBox &, cItemCallback<Ty2> &) +> +static int tolua_ForEachInBox(lua_State * tolua_S) +{ + // Check params: + cLuaState L(tolua_S); + if ( + !L.CheckParamUserType(1, "cWorld") || + !L.CheckParamUserType(2, "cBoundingBox") || + !L.CheckParamFunction(3) || + !L.CheckParamEnd(4) + ) + { + return 0; + } + + // Get the params: + Ty1 * Self = NULL; + cBoundingBox * Box = NULL; + L.GetStackValues(1, Self, Box); + if ((Self == NULL) || (Box == NULL)) + { + LOGWARNING("Invalid world (%p) or boundingbox (%p)", Self, Box); + L.LogStackTrace(); + return 0; + } + + // Create a reference for the function: + cLuaState::cRef FnRef(L, 3); + + // Callback wrapper for the Lua function: + class cLuaCallback : public cItemCallback<Ty2> + { + public: + cLuaCallback(cLuaState & a_LuaState, cLuaState::cRef & a_FuncRef) : + m_LuaState(a_LuaState), + m_FnRef(a_FuncRef) + {} + + private: + // cItemCallback<Ty2> overrides: + virtual bool Item(Ty2 * a_Item) override + { + bool res = false; + if (!m_LuaState.Call(m_FnRef, a_Item, cLuaState::Return, res)) + { + LOGWARNING("Failed to call Lua callback"); + m_LuaState.LogStackTrace(); + return true; // Abort enumeration + } + + return res; + } + cLuaState & m_LuaState; + cLuaState::cRef & m_FnRef; + } Callback(L, FnRef); + + bool bRetVal = (Self->*Func1)(*Box, Callback); + + FnRef.UnRef(); + + /* Push return value on stack */ + tolua_pushboolean(tolua_S, bRetVal); + return 1; +} + + + + + +template < class Ty1, class Ty2, bool (Ty1::*Func1)(cItemCallback<Ty2> &) @@ -1775,49 +1874,30 @@ static int tolua_cWorld_ChunkStay(lua_State * tolua_S) -static int tolua_cPlayer_GetGroups(lua_State * tolua_S) +static int tolua_cPlayer_GetPermissions(lua_State * tolua_S) { - cPlayer * self = (cPlayer *)tolua_tousertype(tolua_S, 1, NULL); - - const cPlayer::GroupList & AllGroups = self->GetGroups(); + // Function signature: cPlayer:GetPermissions() -> {permissions-array} - lua_createtable(tolua_S, (int)AllGroups.size(), 0); - int newTable = lua_gettop(tolua_S); - int index = 1; - cPlayer::GroupList::const_iterator iter = AllGroups.begin(); - while (iter != AllGroups.end()) + // Check the params: + cLuaState L(tolua_S); + if ( + !L.CheckParamUserType(1, "cPlayer") || + !L.CheckParamEnd (2) + ) { - const cGroup * Group = *iter; - tolua_pushusertype(tolua_S, (void *)Group, "const cGroup"); - lua_rawseti(tolua_S, newTable, index); - ++iter; - ++index; + return 0; } - return 1; -} - - - - -static int tolua_cPlayer_GetResolvedPermissions(lua_State * tolua_S) -{ - cPlayer * self = (cPlayer*) tolua_tousertype(tolua_S, 1, NULL); - - cPlayer::StringList AllPermissions = self->GetResolvedPermissions(); - - lua_createtable(tolua_S, (int)AllPermissions.size(), 0); - int newTable = lua_gettop(tolua_S); - int index = 1; - cPlayer::StringList::iterator iter = AllPermissions.begin(); - while (iter != AllPermissions.end()) + // Get the params: + cPlayer * self = (cPlayer *)tolua_tousertype(tolua_S, 1, NULL); + if (self == NULL) { - std::string & Permission = *iter; - lua_pushlstring(tolua_S, Permission.c_str(), Permission.length()); - lua_rawseti(tolua_S, newTable, index); - ++iter; - ++index; + LOGWARNING("%s: invalid self (%p)", __FUNCTION__, self); + return 0; } + + // Push the permissions: + L.Push(self->GetPermissions()); return 1; } @@ -1874,6 +1954,34 @@ static int tolua_cPlayer_OpenWindow(lua_State * tolua_S) +static int tolua_cPlayer_PermissionMatches(lua_State * tolua_S) +{ + // Function signature: cPlayer:PermissionMatches(PermissionStr, TemplateStr) -> bool + + // Check the params: + cLuaState L(tolua_S); + if ( + !L.CheckParamUserTable(1, "cPlayer") || + !L.CheckParamString (2, 3) || + !L.CheckParamEnd (4) + ) + { + return 0; + } + + // Get the params: + AString Permission, Template; + L.GetStackValues(2, Permission, Template); + + // Push the result of the match: + L.Push(cPlayer::PermissionMatches(StringSplit(Permission, "."), StringSplit(Template, "."))); + return 1; +} + + + + + template < class OBJTYPE, void (OBJTYPE::*SetCallback)(cPluginLua * a_Plugin, int a_FnRef) @@ -2100,6 +2208,62 @@ static int tolua_cWebAdmin_GetPlugins(lua_State * tolua_S) +/** Binding for cWebAdmin::GetHTMLEscapedString. +Manual code required because ToLua generates an extra return value */ +static int tolua_AllToLua_cWebAdmin_GetHTMLEscapedString(lua_State * tolua_S) +{ + // Check the param types: + cLuaState S(tolua_S); + if ( + !S.CheckParamUserTable(1, "cWebAdmin") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the parameters: + AString Input; + S.GetStackValue(2, Input); + + // Convert and return: + S.Push(cWebAdmin::GetHTMLEscapedString(Input)); + return 1; +} + + + + + +/** Binding for cWebAdmin::GetURLEncodedString. +Manual code required because ToLua generates an extra return value */ +static int tolua_AllToLua_cWebAdmin_GetURLEncodedString(lua_State * tolua_S) +{ + // Check the param types: + cLuaState S(tolua_S); + if ( + !S.CheckParamUserTable(1, "cWebAdmin") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the parameters: + AString Input; + S.GetStackValue(2, Input); + + // Convert and return: + S.Push(cWebAdmin::GetURLEncodedString(Input)); + return 1; +} + + + + + static int tolua_cWebPlugin_GetTabNames(lua_State * tolua_S) { cWebPlugin* self = (cWebPlugin*) tolua_tousertype(tolua_S, 1, NULL); @@ -2156,6 +2320,221 @@ static int tolua_cClientHandle_SendPluginMessage(lua_State * L) +static int tolua_cMojangAPI_AddPlayerNameToUUIDMapping(lua_State * L) +{ + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cMojangAPI") || + !S.CheckParamString(2) || + !S.CheckParamString(3) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Retrieve the parameters: + AString UUID, PlayerName; + S.GetStackValue(2, PlayerName); + S.GetStackValue(3, UUID); + + // Store in the cache: + cRoot::Get()->GetMojangAPI().AddPlayerNameToUUIDMapping(PlayerName, UUID); + return 0; +} + + + + + +static int tolua_cMojangAPI_GetPlayerNameFromUUID(lua_State * L) +{ + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cMojangAPI") || + !S.CheckParamString(2) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + AString UUID; + S.GetStackValue(2, UUID); + + // If the UseOnlyCached param was given, read it; default to false + bool ShouldUseCacheOnly = false; + if (lua_gettop(L) == 3) + { + ShouldUseCacheOnly = (lua_toboolean(L, 3) != 0); + lua_pop(L, 1); + } + + // Return the PlayerName: + AString PlayerName = cRoot::Get()->GetMojangAPI().GetPlayerNameFromUUID(UUID, ShouldUseCacheOnly); + S.Push(PlayerName); + return 1; +} + + + + + +static int tolua_cMojangAPI_GetUUIDFromPlayerName(lua_State * L) +{ + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cMojangAPI") || + !S.CheckParamString(2) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + AString PlayerName; + S.GetStackValue(2, PlayerName); + + // If the UseOnlyCached param was given, read it; default to false + bool ShouldUseCacheOnly = false; + if (lua_gettop(L) == 3) + { + ShouldUseCacheOnly = (lua_toboolean(L, 3) != 0); + lua_pop(L, 1); + } + + // Return the UUID: + AString UUID = cRoot::Get()->GetMojangAPI().GetUUIDFromPlayerName(PlayerName, ShouldUseCacheOnly); + S.Push(UUID); + return 1; +} + + + + + +static int tolua_cMojangAPI_GetUUIDsFromPlayerNames(lua_State * L) +{ + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cMojangAPI") || + !S.CheckParamTable(2) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Convert the input table into AStringVector: + AStringVector PlayerNames; + int NumNames = luaL_getn(L, 2); + PlayerNames.reserve(NumNames); + for (int i = 1; i <= NumNames; i++) + { + lua_rawgeti(L, 2, i); + AString Name; + S.GetStackValue(-1, Name); + if (!Name.empty()) + { + PlayerNames.push_back(Name); + } + lua_pop(L, 1); + } + + // If the UseOnlyCached param was given, read it; default to false + bool ShouldUseCacheOnly = false; + if (lua_gettop(L) == 3) + { + ShouldUseCacheOnly = (lua_toboolean(L, 3) != 0); + lua_pop(L, 1); + } + + // Push the output table onto the stack: + lua_newtable(L); + + // Get the UUIDs: + AStringVector UUIDs = cRoot::Get()->GetMojangAPI().GetUUIDsFromPlayerNames(PlayerNames, ShouldUseCacheOnly); + if (UUIDs.size() != PlayerNames.size()) + { + // A hard error has occured while processing the request, no UUIDs were returned. Return an empty table: + return 1; + } + + // Convert to output table, PlayerName -> UUID: + size_t len = UUIDs.size(); + for (size_t i = 0; i < len; i++) + { + if (UUIDs[i].empty()) + { + // No UUID was provided for PlayerName[i], skip it in the resulting table + continue; + } + lua_pushlstring(L, UUIDs[i].c_str(), UUIDs[i].length()); + lua_setfield(L, 3, PlayerNames[i].c_str()); + } + return 1; +} + + + + + +static int tolua_cMojangAPI_MakeUUIDDashed(lua_State * L) +{ + // Function signature: cMojangAPI:MakeUUIDDashed(UUID) -> string + + // Check params: + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cMojangAPI") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString UUID; + S.GetStackValue(2, UUID); + + // Push the result: + S.Push(cRoot::Get()->GetMojangAPI().MakeUUIDDashed(UUID)); + return 1; +} + + + + + +static int tolua_cMojangAPI_MakeUUIDShort(lua_State * L) +{ + // Function signature: cMojangAPI:MakeUUIDShort(UUID) -> string + + // Check params: + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cMojangAPI") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString UUID; + S.GetStackValue(2, UUID); + + // Push the result: + S.Push(cRoot::Get()->GetMojangAPI().MakeUUIDShort(UUID)); + return 1; +} + + + + + static int Lua_ItemGrid_GetSlotCoords(lua_State * L) { tolua_Error tolua_err; @@ -2349,7 +2728,7 @@ static int tolua_cRoot_GetFurnaceRecipe(lua_State * tolua_S) // Get the recipe for the input cFurnaceRecipe * FR = cRoot::Get()->GetFurnaceRecipe(); - const cFurnaceRecipe::Recipe * Recipe = FR->GetRecipeFrom(*Input); + const cFurnaceRecipe::cRecipe * Recipe = FR->GetRecipeFrom(*Input); if (Recipe == NULL) { // There is no such furnace recipe for this input, return no value @@ -2942,6 +3321,7 @@ static int tolua_cCompositeChat_UnderlineUrls(lua_State * tolua_S) void ManualBindings::Bind(lua_State * tolua_S) { tolua_beginmodule(tolua_S, NULL); + tolua_function(tolua_S, "Clamp", tolua_Clamp); tolua_function(tolua_S, "StringSplit", tolua_StringSplit); tolua_function(tolua_S, "StringSplitAndTrim", tolua_StringSplitAndTrim); tolua_function(tolua_S, "LOG", tolua_LOG); @@ -2996,6 +3376,7 @@ void ManualBindings::Bind(lua_State * tolua_S) tolua_beginmodule(tolua_S, "cWorld"); tolua_function(tolua_S, "ChunkStay", tolua_cWorld_ChunkStay); tolua_function(tolua_S, "DoWithBlockEntityAt", tolua_DoWithXYZ<cWorld, cBlockEntity, &cWorld::DoWithBlockEntityAt>); + tolua_function(tolua_S, "DoWithBeaconAt", tolua_DoWithXYZ<cWorld, cBeaconEntity, &cWorld::DoWithBeaconAt>); tolua_function(tolua_S, "DoWithChestAt", tolua_DoWithXYZ<cWorld, cChestEntity, &cWorld::DoWithChestAt>); tolua_function(tolua_S, "DoWithDispenserAt", tolua_DoWithXYZ<cWorld, cDispenserEntity, &cWorld::DoWithDispenserAt>); tolua_function(tolua_S, "DoWithDropSpenserAt", tolua_DoWithXYZ<cWorld, cDropSpenserEntity, &cWorld::DoWithDropSpenserAt>); @@ -3011,6 +3392,7 @@ void ManualBindings::Bind(lua_State * tolua_S) tolua_function(tolua_S, "ForEachBlockEntityInChunk", tolua_ForEachInChunk<cWorld, cBlockEntity, &cWorld::ForEachBlockEntityInChunk>); tolua_function(tolua_S, "ForEachChestInChunk", tolua_ForEachInChunk<cWorld, cChestEntity, &cWorld::ForEachChestInChunk>); tolua_function(tolua_S, "ForEachEntity", tolua_ForEach< cWorld, cEntity, &cWorld::ForEachEntity>); + tolua_function(tolua_S, "ForEachEntityInBox", tolua_ForEachInBox< cWorld, cEntity, &cWorld::ForEachEntityInBox>); tolua_function(tolua_S, "ForEachEntityInChunk", tolua_ForEachInChunk<cWorld, cEntity, &cWorld::ForEachEntityInChunk>); tolua_function(tolua_S, "ForEachFurnaceInChunk", tolua_ForEachInChunk<cWorld, cFurnaceEntity, &cWorld::ForEachFurnaceInChunk>); tolua_function(tolua_S, "ForEachPlayer", tolua_ForEach< cWorld, cPlayer, &cWorld::ForEachPlayer>); @@ -3050,9 +3432,9 @@ void ManualBindings::Bind(lua_State * tolua_S) tolua_endmodule(tolua_S); tolua_beginmodule(tolua_S, "cPlayer"); - tolua_function(tolua_S, "GetGroups", tolua_cPlayer_GetGroups); - tolua_function(tolua_S, "GetResolvedPermissions", tolua_cPlayer_GetResolvedPermissions); - tolua_function(tolua_S, "OpenWindow", tolua_cPlayer_OpenWindow); + tolua_function(tolua_S, "GetPermissions", tolua_cPlayer_GetPermissions); + tolua_function(tolua_S, "OpenWindow", tolua_cPlayer_OpenWindow); + tolua_function(tolua_S, "PermissionMatches", tolua_cPlayer_PermissionMatches); tolua_endmodule(tolua_S); tolua_beginmodule(tolua_S, "cLuaWindow"); @@ -3075,7 +3457,9 @@ void ManualBindings::Bind(lua_State * tolua_S) tolua_endmodule(tolua_S); tolua_beginmodule(tolua_S, "cWebAdmin"); - tolua_function(tolua_S, "GetPlugins", tolua_cWebAdmin_GetPlugins); + tolua_function(tolua_S, "GetHTMLEscapedString", tolua_AllToLua_cWebAdmin_GetHTMLEscapedString); + tolua_function(tolua_S, "GetPlugins", tolua_cWebAdmin_GetPlugins); + tolua_function(tolua_S, "GetURLEncodedString", tolua_AllToLua_cWebAdmin_GetURLEncodedString); tolua_endmodule(tolua_S); tolua_beginmodule(tolua_S, "cWebPlugin"); @@ -3088,11 +3472,22 @@ void ManualBindings::Bind(lua_State * tolua_S) tolua_function(tolua_S, "SendPluginMessage", tolua_cClientHandle_SendPluginMessage); tolua_endmodule(tolua_S); + tolua_beginmodule(tolua_S, "cMojangAPI"); + tolua_function(tolua_S, "AddPlayerNameToUUIDMapping", tolua_cMojangAPI_AddPlayerNameToUUIDMapping); + tolua_function(tolua_S, "GetPlayerNameFromUUID", tolua_cMojangAPI_GetPlayerNameFromUUID); + tolua_function(tolua_S, "GetUUIDFromPlayerName", tolua_cMojangAPI_GetUUIDFromPlayerName); + tolua_function(tolua_S, "GetUUIDsFromPlayerNames", tolua_cMojangAPI_GetUUIDsFromPlayerNames); + tolua_function(tolua_S, "MakeUUIDDashed", tolua_cMojangAPI_MakeUUIDDashed); + tolua_function(tolua_S, "MakeUUIDShort", tolua_cMojangAPI_MakeUUIDShort); + tolua_endmodule(tolua_S); + tolua_beginmodule(tolua_S, "cItemGrid"); tolua_function(tolua_S, "GetSlotCoords", Lua_ItemGrid_GetSlotCoords); tolua_endmodule(tolua_S); tolua_function(tolua_S, "md5", tolua_md5); + + BindRankManager(tolua_S); tolua_endmodule(tolua_S); } diff --git a/src/Bindings/ManualBindings.h b/src/Bindings/ManualBindings.h index 36161c6a2..1b6e65654 100644 --- a/src/Bindings/ManualBindings.h +++ b/src/Bindings/ManualBindings.h @@ -1,8 +1,24 @@ #pragma once struct lua_State; + + + + + +/** Provides namespace for the bindings. */ class ManualBindings { public: - static void Bind( lua_State* tolua_S); + /** Binds all the manually implemented functions to tolua_S. */ + static void Bind(lua_State * tolua_S); + +protected: + /** Binds the manually implemented cRankManager glue code to tolua_S. + Implemented in ManualBindings_RankManager.cpp. */ + static void BindRankManager(lua_State * tolua_S); }; + + + + diff --git a/src/Bindings/ManualBindings_RankManager.cpp b/src/Bindings/ManualBindings_RankManager.cpp new file mode 100644 index 000000000..3c58a0a92 --- /dev/null +++ b/src/Bindings/ManualBindings_RankManager.cpp @@ -0,0 +1,1090 @@ + +// ManualBindings_RankManager.cpp + +// Implements the cRankManager Lua bindings + +#include "Globals.h" +#include "ManualBindings.h" +#include "../Root.h" +#include "tolua++/include/tolua++.h" +#include "LuaState.h" + + + + + +/** Binds cRankManager::AddGroup */ +static int tolua_cRankManager_AddGroup(lua_State * L) +{ + // Function signature: + // cRankManager:AddGroup(GroupName) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Read the params: + AString GroupName; + S.GetStackValue(2, GroupName); + + // Add the group: + cRoot::Get()->GetRankManager().AddGroup(GroupName); + return 0; +} + + + + + +/** Binds cRankManager::AddGroupToRank */ +static int tolua_cRankManager_AddGroupToRank(lua_State * L) +{ + // Function signature: + // cRankManager:AddGroupToRank(GroupName, RankName) -> bool + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 3) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Read the params: + AString GroupName, RankName; + S.GetStackValues(2, GroupName, RankName); + + // Add the group to the rank: + S.Push(cRoot::Get()->GetRankManager().AddGroupToRank(GroupName, RankName)); + return 1; +} + + + + + +/** Binds cRankManager::AddPermissionToGroup */ +static int tolua_cRankManager_AddPermissionToGroup(lua_State * L) +{ + // Function signature: + // cRankManager:AddPermissionToGroup(Permission, GroupName) -> bool + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 3) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Read the params: + AString GroupName, Permission; + S.GetStackValues(2, Permission, GroupName); + + // Add the group to the rank: + S.Push(cRoot::Get()->GetRankManager().AddPermissionToGroup(Permission, GroupName)); + return 1; +} + + + + + +/** Binds cRankManager::AddRank */ +static int tolua_cRankManager_AddRank(lua_State * L) +{ + // Function signature: + // cRankManager:AddRank(RankName) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 5) || + !S.CheckParamEnd(6) + ) + { + return 0; + } + + // Read the params: + AString RankName, MsgPrefix, MsgSuffix, MsgNameColorCode; + S.GetStackValues(2, RankName, MsgPrefix, MsgSuffix, MsgNameColorCode); + + // Add the rank: + cRoot::Get()->GetRankManager().AddRank(RankName, MsgPrefix, MsgSuffix, MsgNameColorCode); + return 0; +} + + + + + +/** Binds cRankManager::ClearPlayerRanks */ +static int tolua_cRankManager_ClearPlayerRanks(lua_State * L) +{ + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamEnd(2) + ) + { + return 0; + } + + // Remove all players: + cRoot::Get()->GetRankManager().ClearPlayerRanks(); + return 1; +} + + + + + +/** Binds cRankManager::GetAllGroups */ +static int tolua_cRankManager_GetAllGroups(lua_State * L) +{ + // Function signature: + // cRankManager:GetAllGroups() -> arraytable of GroupNames + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamEnd(2) + ) + { + return 0; + } + + // Get the groups: + AStringVector Groups = cRoot::Get()->GetRankManager().GetAllGroups(); + + // Push the results: + S.Push(Groups); + return 1; +} + + + + + +/** Binds cRankManager::GetAllPermissions */ +static int tolua_cRankManager_GetAllPermissions(lua_State * L) +{ + // Function signature: + // cRankManager:GetAllPermissions() -> arraytable of Permissions + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamEnd(2) + ) + { + return 0; + } + + // Get the permissions: + AStringVector Permissions = cRoot::Get()->GetRankManager().GetAllPermissions(); + + // Push the results: + S.Push(Permissions); + return 1; +} + + + + + +/** Binds cRankManager::GetAllPlayerUUIDs */ +static int tolua_cRankManager_GetAllPlayerUUIDs(lua_State * L) +{ + // Function signature: + // cRankManager:GetAllPlayerUUIDs() -> arraytable of Player UUID's + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamEnd(2) + ) + { + return 0; + } + + // Get the player uuid's: + AStringVector Players = cRoot::Get()->GetRankManager().GetAllPlayerUUIDs(); + + // Push the results: + S.Push(Players); + return 1; +} + + + + + +/** Binds cRankManager::GetAllRanks */ +static int tolua_cRankManager_GetAllRanks(lua_State * L) +{ + // Function signature: + // cRankManager:GetAllRanks() -> arraytable of RankNames + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamEnd(2) + ) + { + return 0; + } + + // Get the ranks: + AStringVector Ranks = cRoot::Get()->GetRankManager().GetAllRanks(); + + // Push the results: + S.Push(Ranks); + return 1; +} + + + + + +/** Binds cRankManager::GetDefaultRank */ +static int tolua_cRankManager_GetDefaultRank(lua_State * L) +{ + // Function signature: + // cRankManager:GetDefaultRank() -> string + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamEnd(2) + ) + { + return 0; + } + + // Return the rank name: + S.Push(cRoot::Get()->GetRankManager().GetDefaultRank()); + return 1; +} + + + + + +/** Binds cRankManager::GetGroupPermissions */ +static int tolua_cRankManager_GetGroupPermissions(lua_State * L) +{ + // Function signature: + // cRankManager:GetGroupPermissions(GroupName) -> arraytable of permissions + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString GroupName; + S.GetStackValue(2, GroupName); + + // Get the permissions: + AStringVector Permissions = cRoot::Get()->GetRankManager().GetGroupPermissions(GroupName); + + // Push the results: + S.Push(Permissions); + return 1; +} + + + + + +/** Binds cRankManager::GetPlayerGroups */ +static int tolua_cRankManager_GetPlayerGroups(lua_State * L) +{ + // Function signature: + // cRankManager:GetPlayerGroups(PlayerUUID) -> arraytable of GroupNames + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString PlayerUUID; + S.GetStackValue(2, PlayerUUID); + + // Get the groups: + AStringVector Groups = cRoot::Get()->GetRankManager().GetPlayerGroups(PlayerUUID); + + // Push the results: + S.Push(Groups); + return 1; +} + + + + + +/** Binds cRankManager::GetPlayerMsgVisuals */ +static int tolua_cRankManager_GetPlayerMsgVisuals(lua_State * L) +{ + // Function signature: + // cRankManager:GetPlayerMsgVisuals(PlayerUUID) -> string, string, string + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString PlayerUUID; + S.GetStackValue(2, PlayerUUID); + + // Get the permissions: + AString MsgPrefix, MsgSuffix, MsgNameColorCode; + if (!cRoot::Get()->GetRankManager().GetPlayerMsgVisuals(PlayerUUID, MsgPrefix, MsgSuffix, MsgNameColorCode)) + { + return 0; + } + + // Push the results: + S.Push(MsgPrefix); + S.Push(MsgSuffix); + S.Push(MsgNameColorCode); + return 3; +} + + + + + +/** Binds cRankManager::GetPlayerPermissions */ +static int tolua_cRankManager_GetPlayerPermissions(lua_State * L) +{ + // Function signature: + // cRankManager:GetPlayerPermissions(PlayerUUID) -> arraytable of permissions + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString PlayerUUID; + S.GetStackValue(2, PlayerUUID); + + // Get the permissions: + AStringVector Permissions = cRoot::Get()->GetRankManager().GetPlayerPermissions(PlayerUUID); + + // Push the results: + S.Push(Permissions); + return 1; +} + + + + + +/** Binds cRankManager::GetPlayerRankName */ +static int tolua_cRankManager_GetPlayerRankName(lua_State * L) +{ + // Function signature: + // cRankManager:GetPlayerRankName(PlayerUUID) -> string + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString PlayerUUID; + S.GetStackValue(2, PlayerUUID); + + // Get the rank name: + AString RankName = cRoot::Get()->GetRankManager().GetPlayerRankName(PlayerUUID); + + // Push the result: + S.Push(RankName); + return 1; +} + + + + + +/** Binds cRankManager::GetPlayerName */ +static int tolua_cRankManager_GetPlayerName(lua_State * L) +{ + // Function signature: + // cRankManager:GetPlayerName(PlayerUUID) -> string + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString PlayerUUID; + S.GetStackValue(2, PlayerUUID); + + // Get the player name: + AString PlayerName = cRoot::Get()->GetRankManager().GetPlayerName(PlayerUUID); + + // Push the result: + S.Push(PlayerName); + return 1; +} + + + + + +/** Binds cRankManager::GetRankGroups */ +static int tolua_cRankManager_GetRankGroups(lua_State * L) +{ + // Function signature: + // cRankManager:GetRankGroups(RankName) -> arraytable of groupnames + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString RankName; + S.GetStackValue(2, RankName); + + // Get the groups: + AStringVector Groups = cRoot::Get()->GetRankManager().GetRankGroups(RankName); + + // Push the results: + S.Push(Groups); + return 1; +} + + + + + +/** Binds cRankManager::GetRankPermissions */ +static int tolua_cRankManager_GetRankPermissions(lua_State * L) +{ + // Function signature: + // cRankManager:GetRankPermissions(RankName) -> arraytable of permissions + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString RankName; + S.GetStackValue(2, RankName); + + // Get the permissions: + AStringVector Permissions = cRoot::Get()->GetRankManager().GetRankPermissions(RankName); + + // Push the results: + S.Push(Permissions); + return 1; +} + + + + + +/** Binds cRankManager::GetRankVisuals */ +static int tolua_cRankManager_GetRankVisuals(lua_State * L) +{ + // Function signature: + // cRankManager:GetRankVisuals(RankName) -> MsgPrefix, MsgSuffix, MsgNameColorCode + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString RankName; + S.GetStackValue(2, RankName); + + // Get the visuals: + AString MsgPrefix, MsgSuffix, MsgNameColorCode; + if (!cRoot::Get()->GetRankManager().GetRankVisuals(RankName, MsgPrefix, MsgSuffix, MsgNameColorCode)) + { + // No such rank, return nothing: + return 0; + } + + // Push the results: + S.Push(MsgPrefix); + S.Push(MsgSuffix); + S.Push(MsgNameColorCode); + return 3; +} + + + + + +/** Binds cRankManager::GroupExists */ +static int tolua_cRankManager_GroupExists(lua_State * L) +{ + // Function signature: + // cRankManager:GroupExists(GroupName) -> bool + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString GroupName; + S.GetStackValue(2, GroupName); + + // Get the response: + bool res = cRoot::Get()->GetRankManager().GroupExists(GroupName); + + // Push the result: + S.Push(res); + return 1; +} + + + + + +/** Binds cRankManager::IsGroupInRank */ +static int tolua_cRankManager_IsGroupInRank(lua_State * L) +{ + // Function signature: + // cRankManager:IsGroupInRank(GroupName, RankName) -> bool + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 3) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Get the params: + AString GroupName, RankName; + S.GetStackValues(2, GroupName, RankName); + + // Get the response: + bool res = cRoot::Get()->GetRankManager().IsGroupInRank(GroupName, RankName); + + // Push the result: + S.Push(res); + return 1; +} + + + + + +/** Binds cRankManager::IsPermissionInGroup */ +static int tolua_cRankManager_IsPermissionInGroup(lua_State * L) +{ + // Function signature: + // cRankManager:IsPermissionInGroup(Permission, GroupName) -> bool + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 3) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Get the params: + AString GroupName, Permission; + S.GetStackValues(2, Permission, GroupName); + + // Get the response: + bool res = cRoot::Get()->GetRankManager().IsPermissionInGroup(Permission, GroupName); + + // Push the result: + S.Push(res); + return 1; +} + + + + + +/** Binds cRankManager::IsPlayerRankSet */ +static int tolua_cRankManager_IsPlayerRankSet(lua_State * L) +{ + // Function signature: + // cRankManager:IsPlayerRankSet(PlayerUUID) -> bool + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString PlayerUUID; + S.GetStackValue(2, PlayerUUID); + + // Get the response: + bool res = cRoot::Get()->GetRankManager().IsPlayerRankSet(PlayerUUID); + + // Push the result: + S.Push(res); + return 1; +} + + + + + +/** Binds cRankManager::RankExists */ +static int tolua_cRankManager_RankExists(lua_State * L) +{ + // Function signature: + // cRankManager:RankExists(RankName) -> bool + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString RankName; + S.GetStackValue(2, RankName); + + // Get the response: + bool res = cRoot::Get()->GetRankManager().RankExists(RankName); + + // Push the result: + S.Push(res); + return 1; +} + + + + + +/** Binds cRankManager::RemoveGroup */ +static int tolua_cRankManager_RemoveGroup(lua_State * L) +{ + // Function signature: + // cRankManager:RemoveGroup(GroupName) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString GroupName; + S.GetStackValue(2, GroupName); + + // Remove the group: + cRoot::Get()->GetRankManager().RemoveGroup(GroupName); + return 0; +} + + + + + +/** Binds cRankManager::RemoveGroupFromRank */ +static int tolua_cRankManager_RemoveGroupFromRank(lua_State * L) +{ + // Function signature: + // cRankManager:RemoveGroupFromRank(GroupName, RankName) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 3) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Get the params: + AString GroupName, RankName; + S.GetStackValues(2, GroupName, RankName); + + // Remove the group: + cRoot::Get()->GetRankManager().RemoveGroupFromRank(GroupName, RankName); + return 0; +} + + + + + +/** Binds cRankManager::RemovePermissionFromGroup */ +static int tolua_cRankManager_RemovePermissionFromGroup(lua_State * L) +{ + // Function signature: + // cRankManager:RemovePermissionFromGroup(Permission, GroupName) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 3) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Get the params: + AString GroupName, Permission; + S.GetStackValues(2, Permission, GroupName); + + // Remove the group: + cRoot::Get()->GetRankManager().RemovePermissionFromGroup(Permission, GroupName); + return 0; +} + + + + + +/** Binds cRankManager::RemovePlayerRank */ +static int tolua_cRankManager_RemovePlayerRank(lua_State * L) +{ + // Function signature: + // cRankManager:RemovePlayerRank(PlayerUUID) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString PlayerUUID; + S.GetStackValue(2, PlayerUUID); + + // Remove the player's rank: + cRoot::Get()->GetRankManager().RemovePlayerRank(PlayerUUID); + return 0; +} + + + + + +/** Binds cRankManager::RemoveRank */ +static int tolua_cRankManager_RemoveRank(lua_State * L) +{ + // Function signature: + // cRankManager:RemoveRank(RankName, [ReplacementRankName]) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + // Param 3 is otpional, defaults to nil -> empty string + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Get the params: + AString RankName, ReplacementRankName; + S.GetStackValues(2, RankName, ReplacementRankName); + + // Remove the rank: + cRoot::Get()->GetRankManager().RemoveRank(RankName, ReplacementRankName); + return 0; +} + + + + + +/** Binds cRankManager::RenameGroup */ +static int tolua_cRankManager_RenameGroup(lua_State * L) +{ + // Function signature: + // cRankManager:RenameGroup(OldName, NewName) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 3) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Get the params: + AString OldName, NewName; + S.GetStackValues(2, OldName, NewName); + + // Remove the group: + bool res = cRoot::Get()->GetRankManager().RenameGroup(OldName, NewName); + + // Push the result: + S.Push(res); + return 1; +} + + + + + +/** Binds cRankManager::RenameRank */ +static int tolua_cRankManager_RenameRank(lua_State * L) +{ + // Function signature: + // cRankManager:RenameRank(OldName, NewName) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 3) || + !S.CheckParamEnd(4) + ) + { + return 0; + } + + // Get the params: + AString OldName, NewName; + S.GetStackValues(2, OldName, NewName); + + // Remove the rank: + bool res = cRoot::Get()->GetRankManager().RenameRank(OldName, NewName); + + // Push the result: + S.Push(res); + return 1; +} + + + + + +/** Binds cRankManager::SetDefaultRank */ +static int tolua_cRankManager_SetDefaultRank(lua_State * L) +{ + // Function signature: + // cRankManager:SetDefaultRank(RankName) -> bool + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2) || + !S.CheckParamEnd(3) + ) + { + return 0; + } + + // Get the params: + AString RankName; + S.GetStackValue(2, RankName); + + // Set the rank, return the result: + S.Push(cRoot::Get()->GetRankManager().SetDefaultRank(RankName)); + return 1; +} + + + + + +/** Binds cRankManager::SetPlayerRank */ +static int tolua_cRankManager_SetPlayerRank(lua_State * L) +{ + // Function signature: + // cRankManager:SetPlayerRank(PlayerUUID, PlayerName, RankName) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 4) || + !S.CheckParamEnd(5) + ) + { + return 0; + } + + // Get the params: + AString PlayerUUID, PlayerName, RankName; + S.GetStackValues(2, PlayerUUID, PlayerName, RankName); + + // Set the rank: + cRoot::Get()->GetRankManager().SetPlayerRank(PlayerUUID, PlayerName, RankName); + return 0; +} + + + + + +/** Binds cRankManager::SetRankVisuals */ +static int tolua_cRankManager_SetRankVisuals(lua_State * L) +{ + // Function signature: + // cRankManager:SetRankVisuals(RankName, MsgPrefix, MsgSuffix, MsgNameColorCode) + + cLuaState S(L); + if ( + !S.CheckParamUserTable(1, "cRankManager") || + !S.CheckParamString(2, 5) || + !S.CheckParamEnd(6) + ) + { + return 0; + } + + // Get the params: + AString RankName, MsgPrefix, MsgSuffix, MsgNameColorCode; + S.GetStackValues(2, RankName, MsgPrefix, MsgSuffix, MsgNameColorCode); + + // Set the visuals: + cRoot::Get()->GetRankManager().SetRankVisuals(RankName, MsgPrefix, MsgSuffix, MsgNameColorCode); + return 0; +} + + + + + +void ManualBindings::BindRankManager(lua_State * tolua_S) +{ + // Create the cRankManager class in the API: + tolua_usertype(tolua_S, "cRankManager"); + tolua_cclass(tolua_S, "cRankManager", "cRankManager", "", NULL); + + // Fill in the functions (alpha-sorted): + tolua_beginmodule(tolua_S, "cRankManager"); + tolua_function(tolua_S, "AddGroup", tolua_cRankManager_AddGroup); + tolua_function(tolua_S, "AddGroupToRank", tolua_cRankManager_AddGroupToRank); + tolua_function(tolua_S, "AddPermissionToGroup", tolua_cRankManager_AddPermissionToGroup); + tolua_function(tolua_S, "AddRank", tolua_cRankManager_AddRank); + tolua_function(tolua_S, "ClearPlayerRanks", tolua_cRankManager_ClearPlayerRanks); + tolua_function(tolua_S, "GetAllGroups", tolua_cRankManager_GetAllGroups); + tolua_function(tolua_S, "GetAllPermissions", tolua_cRankManager_GetAllPermissions); + tolua_function(tolua_S, "GetAllPlayerUUIDs", tolua_cRankManager_GetAllPlayerUUIDs); + tolua_function(tolua_S, "GetAllRanks", tolua_cRankManager_GetAllRanks); + tolua_function(tolua_S, "GetDefaultRank", tolua_cRankManager_GetDefaultRank); + tolua_function(tolua_S, "GetGroupPermissions", tolua_cRankManager_GetGroupPermissions); + tolua_function(tolua_S, "GetPlayerGroups", tolua_cRankManager_GetPlayerGroups); + tolua_function(tolua_S, "GetPlayerMsgVisuals", tolua_cRankManager_GetPlayerMsgVisuals); + tolua_function(tolua_S, "GetPlayerPermissions", tolua_cRankManager_GetPlayerPermissions); + tolua_function(tolua_S, "GetPlayerRankName", tolua_cRankManager_GetPlayerRankName); + tolua_function(tolua_S, "GetPlayerName", tolua_cRankManager_GetPlayerName); + tolua_function(tolua_S, "GetRankGroups", tolua_cRankManager_GetRankGroups); + tolua_function(tolua_S, "GetRankPermissions", tolua_cRankManager_GetRankPermissions); + tolua_function(tolua_S, "GetRankVisuals", tolua_cRankManager_GetRankVisuals); + tolua_function(tolua_S, "GroupExists", tolua_cRankManager_GroupExists); + tolua_function(tolua_S, "IsGroupInRank", tolua_cRankManager_IsGroupInRank); + tolua_function(tolua_S, "IsPermissionInGroup", tolua_cRankManager_IsPermissionInGroup); + tolua_function(tolua_S, "IsPlayerRankSet", tolua_cRankManager_IsPlayerRankSet); + tolua_function(tolua_S, "RankExists", tolua_cRankManager_RankExists); + tolua_function(tolua_S, "RemoveGroup", tolua_cRankManager_RemoveGroup); + tolua_function(tolua_S, "RemoveGroupFromRank", tolua_cRankManager_RemoveGroupFromRank); + tolua_function(tolua_S, "RemovePermissionFromGroup", tolua_cRankManager_RemovePermissionFromGroup); + tolua_function(tolua_S, "RemovePlayerRank", tolua_cRankManager_RemovePlayerRank); + tolua_function(tolua_S, "RemoveRank", tolua_cRankManager_RemoveRank); + tolua_function(tolua_S, "RenameGroup", tolua_cRankManager_RenameGroup); + tolua_function(tolua_S, "RenameRank", tolua_cRankManager_RenameRank); + tolua_function(tolua_S, "SetDefaultRank", tolua_cRankManager_SetDefaultRank); + tolua_function(tolua_S, "SetPlayerRank", tolua_cRankManager_SetPlayerRank); + tolua_function(tolua_S, "SetRankVisuals", tolua_cRankManager_SetRankVisuals); + tolua_endmodule(tolua_S); +} + + + + diff --git a/src/Bindings/Plugin.h b/src/Bindings/Plugin.h index 39d53674b..fb22dd33e 100644 --- a/src/Bindings/Plugin.h +++ b/src/Bindings/Plugin.h @@ -1,23 +1,25 @@ #pragma once -#include "PluginManager.h" - +#include "Defines.h" +class cCommandOutputCallback; +class cItems; +class cHopperEntity; +class cBlockEntityWithItems; class cClientHandle; -class cPlayer; class cPickup; -class cItem; +class cPlayer; +class cProjectileEntity; class cEntity; +class cMonster; class cWorld; class cChunkDesc; struct TakeDamageInfo; -// fwd: cPlayer.h -class cPlayer; // fwd: CraftingRecipes.h class cCraftingGrid; @@ -73,7 +75,7 @@ public: virtual bool OnPlayerFoodLevelChange (cPlayer & a_Player, int a_NewFoodLevel) = 0; virtual bool OnPlayerJoined (cPlayer & a_Player) = 0; virtual bool OnPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status) = 0; - virtual bool OnPlayerMoved (cPlayer & a_Player) = 0; + virtual bool OnPlayerMoving (cPlayer & a_Player, const Vector3d & a_OldPosition, const Vector3d & a_NewPosition) = 0; virtual bool OnPlayerPlacedBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) = 0; virtual bool OnPlayerPlacingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) = 0; virtual bool OnPlayerRightClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) = 0; @@ -91,6 +93,7 @@ public: virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0; virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Face, const Vector3d & a_BlockHitPos) = 0; virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) = 0; + virtual bool OnServerPing (cClientHandle & a_ClientHandle, AString & a_ServerDescription, int & a_OnlinePlayersCount, int & a_MaxPlayersCount, AString & a_Favicon) = 0; virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) = 0; virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) = 0; virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) = 0; diff --git a/src/Bindings/PluginLua.cpp b/src/Bindings/PluginLua.cpp index 0f3f25d75..2629eb641 100644 --- a/src/Bindings/PluginLua.cpp +++ b/src/Bindings/PluginLua.cpp @@ -12,10 +12,12 @@ #endif #include "PluginLua.h" #include "../CommandOutput.h" +#include "PluginManager.h" +#include "../Item.h" extern "C" { - #include "lua/src/lualib.h" + #include "lua/src/lauxlib.h" } #undef TOLUA_TEMPLATE_BIND @@ -835,14 +837,14 @@ bool cPluginLua::OnPlayerLeftClick(cPlayer & a_Player, int a_BlockX, int a_Block -bool cPluginLua::OnPlayerMoved(cPlayer & a_Player) +bool cPluginLua::OnPlayerMoving(cPlayer & a_Player, const Vector3d & a_OldPosition, const Vector3d & a_NewPosition) { cCSLock Lock(m_CriticalSection); bool res = false; cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PLAYER_MOVING]; for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr) { - m_LuaState.Call((int)(**itr), &a_Player, cLuaState::Return, res); + m_LuaState.Call((int)(**itr), &a_Player, a_OldPosition, a_NewPosition, cLuaState::Return, res); if (res) { return true; @@ -1193,6 +1195,26 @@ bool cPluginLua::OnProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity +bool cPluginLua::OnServerPing(cClientHandle & a_ClientHandle, AString & a_ServerDescription, int & a_OnlinePlayersCount, int & a_MaxPlayersCount, AString & a_Favicon) +{ + cCSLock Lock(m_CriticalSection); + bool res = false; + cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_SERVER_PING]; + for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr) + { + m_LuaState.Call((int)(**itr), &a_ClientHandle, a_ServerDescription, a_OnlinePlayersCount, a_MaxPlayersCount, a_Favicon, cLuaState::Return, res, a_ServerDescription, a_OnlinePlayersCount, a_MaxPlayersCount, a_Favicon); + if (res) + { + return true; + } + } + return false; +} + + + + + bool cPluginLua::OnSpawnedEntity(cWorld & a_World, cEntity & a_Entity) { cCSLock Lock(m_CriticalSection); @@ -1570,6 +1592,7 @@ const char * cPluginLua::GetHookFnName(int a_HookType) case cPluginManager::HOOK_PLUGINS_LOADED: return "OnPluginsLoaded"; case cPluginManager::HOOK_POST_CRAFTING: return "OnPostCrafting"; case cPluginManager::HOOK_PRE_CRAFTING: return "OnPreCrafting"; + case cPluginManager::HOOK_SERVER_PING: return "OnServerPing"; case cPluginManager::HOOK_SPAWNED_ENTITY: return "OnSpawnedEntity"; case cPluginManager::HOOK_SPAWNED_MONSTER: return "OnSpawnedMonster"; case cPluginManager::HOOK_SPAWNING_ENTITY: return "OnSpawningEntity"; diff --git a/src/Bindings/PluginLua.h b/src/Bindings/PluginLua.h index 2cea644c1..eda65b76c 100644 --- a/src/Bindings/PluginLua.h +++ b/src/Bindings/PluginLua.h @@ -98,8 +98,8 @@ public: virtual bool OnPlayerFishing (cPlayer & a_Player, cItems & a_Reward) override; virtual bool OnPlayerFoodLevelChange (cPlayer & a_Player, int a_NewFoodLevel) override; virtual bool OnPlayerJoined (cPlayer & a_Player) override; - virtual bool OnPlayerMoved (cPlayer & a_Player) override; virtual bool OnPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status) override; + virtual bool OnPlayerMoving (cPlayer & a_Player, const Vector3d & a_OldPosition, const Vector3d & a_NewPosition) override; virtual bool OnPlayerPlacedBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override; virtual bool OnPlayerPlacingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override; virtual bool OnPlayerRightClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override; @@ -117,6 +117,7 @@ public: virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override; virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Face, const Vector3d & a_BlockHitPos) override; virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) override; + virtual bool OnServerPing (cClientHandle & a_ClientHandle, AString & a_ServerDescription, int & a_OnlinePlayersCount, int & a_MaxPlayersCount, AString & a_Favicon) override; virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) override; virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) override; virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) override; diff --git a/src/Bindings/PluginManager.cpp b/src/Bindings/PluginManager.cpp index 3560b8660..e0faa838a 100644 --- a/src/Bindings/PluginManager.cpp +++ b/src/Bindings/PluginManager.cpp @@ -4,12 +4,10 @@ #include "PluginManager.h" #include "Plugin.h" #include "PluginLua.h" -#include "../WebAdmin.h" #include "../Item.h" #include "../Root.h" #include "../Server.h" #include "../CommandOutput.h" -#include "../ChatColor.h" #include "inifile/iniFile.h" #include "../Entities/Player.h" @@ -124,44 +122,58 @@ void cPluginManager::ReloadPluginsNow(cIniFile & a_SettingsIni) // Check if the Plugins section exists. int KeyNum = a_SettingsIni.FindKey("Plugins"); - // If it does, how many plugins are there? - int NumPlugins = ((KeyNum != -1) ? (a_SettingsIni.GetNumValues(KeyNum)) : 0); - if (KeyNum == -1) { InsertDefaultPlugins(a_SettingsIni); + KeyNum = a_SettingsIni.FindKey("Plugins"); } - else if (NumPlugins > 0) + + // How many plugins are there? + int NumPlugins = a_SettingsIni.GetNumValues(KeyNum); + + for (int i = 0; i < NumPlugins; i++) { - for (int i = 0; i < NumPlugins; i++) + AString ValueName = a_SettingsIni.GetValueName(KeyNum, i); + if (ValueName.compare("Plugin") == 0) { - AString ValueName = a_SettingsIni.GetValueName(KeyNum, i); - if (ValueName.compare("Plugin") == 0) + AString PluginFile = a_SettingsIni.GetValue(KeyNum, i); + if (!PluginFile.empty()) { - AString PluginFile = a_SettingsIni.GetValue(KeyNum, i); - if (!PluginFile.empty()) + if (m_Plugins.find(PluginFile) != m_Plugins.end()) { - if (m_Plugins.find(PluginFile) != m_Plugins.end()) - { - LoadPlugin(PluginFile); - } + LoadPlugin(PluginFile); } } } } + + // Remove invalid plugins from the PluginMap. + for (PluginMap::iterator itr = m_Plugins.begin(); itr != m_Plugins.end();) + { + if (itr->second == NULL) + { + PluginMap::iterator thiz = itr; + ++thiz; + m_Plugins.erase(itr); + itr = thiz; + continue; + } + ++itr; + } + size_t NumLoadedPlugins = GetNumPlugins(); if (NumLoadedPlugins == 0) { LOG("-- No Plugins Loaded --"); } - else if (NumLoadedPlugins > 1) + else if (NumLoadedPlugins == 1) { - LOG("-- Loaded %i Plugins --", (int)NumLoadedPlugins); + LOG("-- Loaded 1 Plugin --"); } else { - LOG("-- Loaded 1 Plugin --"); + LOG("-- Loaded %i Plugins --", (int)NumLoadedPlugins); } CallHookPluginsLoaded(); } @@ -835,14 +847,14 @@ bool cPluginManager::CallHookPlayerLeftClick(cPlayer & a_Player, int a_BlockX, i -bool cPluginManager::CallHookPlayerMoving(cPlayer & a_Player) +bool cPluginManager::CallHookPlayerMoving(cPlayer & a_Player, const Vector3d a_OldPosition, const Vector3d a_NewPosition) { FIND_HOOK(HOOK_PLAYER_MOVING); VERIFY_HOOK; for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr) { - if ((*itr)->OnPlayerMoved(a_Player)) + if ((*itr)->OnPlayerMoving(a_Player, a_OldPosition, a_NewPosition)) { return true; } @@ -1175,6 +1187,25 @@ bool cPluginManager::CallHookProjectileHitEntity(cProjectileEntity & a_Projectil +bool cPluginManager::CallHookServerPing(cClientHandle & a_ClientHandle, AString & a_ServerDescription, int & a_OnlinePlayersCount, int & a_MaxPlayersCount, AString & a_Favicon) +{ + FIND_HOOK(HOOK_SERVER_PING); + VERIFY_HOOK; + + for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr) + { + if ((*itr)->OnServerPing(a_ClientHandle, a_ServerDescription, a_OnlinePlayersCount, a_MaxPlayersCount, a_Favicon)) + { + return true; + } + } + return false; +} + + + + + bool cPluginManager::CallHookSpawnedEntity(cWorld & a_World, cEntity & a_Entity) { FIND_HOOK(HOOK_SPAWNED_ENTITY); diff --git a/src/Bindings/PluginManager.h b/src/Bindings/PluginManager.h index 44a94e316..fff3bc323 100644 --- a/src/Bindings/PluginManager.h +++ b/src/Bindings/PluginManager.h @@ -1,9 +1,8 @@ #pragma once -#include "../Item.h" - +#include "Defines.h" @@ -36,7 +35,6 @@ class cPickup; // fwd: Pawn.h struct TakeDamageInfo; -class cPawn; // fwd: CommandOutput.h class cCommandOutputCallback; @@ -49,6 +47,8 @@ class cBlockEntityWithItems; +class cItems; + // tolua_begin @@ -120,6 +120,7 @@ public: HOOK_PRE_CRAFTING, HOOK_PROJECTILE_HIT_BLOCK, HOOK_PROJECTILE_HIT_ENTITY, + HOOK_SERVER_PING, HOOK_SPAWNED_ENTITY, HOOK_SPAWNED_MONSTER, HOOK_SPAWNING_ENTITY, @@ -206,7 +207,7 @@ public: bool CallHookPlayerFishing (cPlayer & a_Player, cItems a_Reward); bool CallHookPlayerFoodLevelChange (cPlayer & a_Player, int a_NewFoodLevel); bool CallHookPlayerJoined (cPlayer & a_Player); - bool CallHookPlayerMoving (cPlayer & a_Player); + bool CallHookPlayerMoving (cPlayer & a_Player, const Vector3d a_OldPosition, const Vector3d a_NewPosition); bool CallHookPlayerLeftClick (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, char a_Status); bool CallHookPlayerPlacedBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta); bool CallHookPlayerPlacingBlock (cPlayer & a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, char a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta); @@ -225,6 +226,7 @@ public: bool CallHookPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe); bool CallHookProjectileHitBlock (cProjectileEntity & a_Projectile, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Face, const Vector3d & a_BlockHitPos); bool CallHookProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity); + bool CallHookServerPing (cClientHandle & a_ClientHandle, AString & a_ServerDescription, int & a_OnlinePlayersCount, int & a_MaxPlayersCount, AString & a_Favicon); bool CallHookSpawnedEntity (cWorld & a_World, cEntity & a_Entity); bool CallHookSpawnedMonster (cWorld & a_World, cMonster & a_Monster); bool CallHookSpawningEntity (cWorld & a_World, cEntity & a_Entity); diff --git a/src/Bindings/WebPlugin.cpp b/src/Bindings/WebPlugin.cpp index 1178c127a..eca1c74e6 100644 --- a/src/Bindings/WebPlugin.cpp +++ b/src/Bindings/WebPlugin.cpp @@ -3,7 +3,6 @@ #include "WebPlugin.h" #include "../WebAdmin.h" -#include "../Server.h" #include "../Root.h" @@ -81,7 +80,9 @@ std::pair< AString, AString > cWebPlugin::GetTabNameForRequest(const HTTPRequest else // Otherwise show the first tab { if (GetTabs().size() > 0) + { Tab = *GetTabs().begin(); + } } if (Tab != NULL) diff --git a/src/Bindings/WebPlugin.h b/src/Bindings/WebPlugin.h index 46bc0cd2d..9b825b918 100644 --- a/src/Bindings/WebPlugin.h +++ b/src/Bindings/WebPlugin.h @@ -1,7 +1,6 @@ #pragma once -struct lua_State; struct HTTPRequest; diff --git a/src/Bindings/gen_LuaState_Call.lua b/src/Bindings/gen_LuaState_Call.lua index fb1797dc0..7f62573c7 100644 --- a/src/Bindings/gen_LuaState_Call.lua +++ b/src/Bindings/gen_LuaState_Call.lua @@ -13,7 +13,7 @@ separate the arguments from the return values, a special type of cLuaState::cRet -print("Generating LuaState_Call.inc...") +print("Generating LuaState_Call.inc . . .") @@ -54,6 +54,7 @@ local Combinations = {9, 2}, -- Special combinations: + {5, 5}, {7, 3}, {8, 3}, {9, 5}, @@ -108,7 +109,7 @@ local function WriteOverload(f, a_NumParams, a_NumReturns) -- Write the function signature: f:write("bool Call(") - f:write("FnT a_Function") + f:write("const FnT & a_Function") for i = 1, a_NumParams do f:write(", ParamT", i, " a_Param", i) end @@ -182,6 +183,33 @@ for _, combination in ipairs(Combinations) do WriteOverload(f, combination[1], combination[2]) end +-- Generate the cLuaState::GetStackValues() multi-param templates: +for i = 2, 6 do + f:write("/** Reads ", i, " consecutive values off the stack */\ntemplate <\n") + + -- Write the template function header: + local txt = {} + for idx = 1, i do + table.insert(txt, "\ttypename ArgT" .. idx) + end + f:write(table.concat(txt, ",\n")) + + -- Write the argument declarations: + txt = {} + f:write("\n>\nvoid GetStackValues(\n\tint a_BeginPos,\n") + for idx = 1, i do + table.insert(txt, "\tArgT" .. idx .. " & Arg" .. idx) + end + f:write(table.concat(txt, ",\n")) + + -- Write the function body: + f:write("\n)\n{\n") + for idx = 1, i do + f:write("\tGetStackValue(a_BeginPos + ", idx - 1, ", Arg", idx, ");\n") + end + f:write("}\n\n\n\n\n\n") +end + -- Close the generated file f:close() @@ -189,7 +217,7 @@ f:close() -print("LuaState_Call.inc generated") +print("LuaState_Call.inc generated.") diff --git a/src/BlockArea.cpp b/src/BlockArea.cpp index a0dcb5ec8..ba55528b8 100644 --- a/src/BlockArea.cpp +++ b/src/BlockArea.cpp @@ -28,7 +28,7 @@ typedef void (CombinatorFunc)(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLE // This wild construct allows us to pass a function argument and still have it inlined by the compiler :) /// Merges two blocktypes and blockmetas of the specified sizes and offsets using the specified combinator function -template<bool MetasValid, CombinatorFunc Combinator> +template <bool MetasValid, CombinatorFunc Combinator> void InternalMergeBlocks( BLOCKTYPE * a_DstTypes, const BLOCKTYPE * a_SrcTypes, NIBBLETYPE * a_DstMetas, const NIBBLETYPE * a_SrcMetas, @@ -74,7 +74,7 @@ void InternalMergeBlocks( /// Combinator used for cBlockArea::msOverwrite merging -template<bool MetaValid> +template <bool MetaValid> void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { a_DstType = a_SrcType; @@ -89,7 +89,7 @@ void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLE /// Combinator used for cBlockArea::msFillAir merging -template<bool MetaValid> +template <bool MetaValid> void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { if (a_DstType == E_BLOCK_AIR) @@ -108,7 +108,7 @@ void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETY /// Combinator used for cBlockArea::msImprint merging -template<bool MetaValid> +template <bool MetaValid> void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { if (a_SrcType != E_BLOCK_AIR) @@ -127,7 +127,7 @@ void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETY /// Combinator used for cBlockArea::msLake merging -template<bool MetaValid> +template <bool MetaValid> void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { // Sponge is the NOP block @@ -201,7 +201,7 @@ void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE /** Combinator used for cBlockArea::msSpongePrint merging */ -template<bool MetaValid> +template <bool MetaValid> void MergeCombinatorSpongePrint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { // Sponge overwrites nothing, everything else overwrites anything @@ -220,7 +220,7 @@ void MergeCombinatorSpongePrint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBB /** Combinator used for cBlockArea::msDifference merging */ -template<bool MetaValid> +template <bool MetaValid> void MergeCombinatorDifference(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { if ((a_DstType == a_SrcType) && (!MetaValid || (a_DstMeta == a_SrcMeta))) @@ -246,7 +246,7 @@ void MergeCombinatorDifference(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBL /** Combinator used for cBlockArea::msMask merging */ -template<bool MetaValid> +template <bool MetaValid> void MergeCombinatorMask(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta) { // If the blocks are the same, keep the dest; otherwise replace with air @@ -1764,7 +1764,9 @@ NIBBLETYPE cBlockArea::GetNibble(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBL cBlockArea::cChunkReader::cChunkReader(cBlockArea & a_Area) : m_Area(a_Area), - m_Origin(a_Area.m_Origin.x, a_Area.m_Origin.y, a_Area.m_Origin.z) + m_Origin(a_Area.m_Origin.x, a_Area.m_Origin.y, a_Area.m_Origin.z), + m_CurrentChunkX(0), + m_CurrentChunkZ(0) { } @@ -2119,7 +2121,7 @@ void cBlockArea::RelSetData( -template<bool MetasValid> +template <bool MetasValid> void cBlockArea::MergeByStrategy(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_RelZ, eMergeStrategy a_Strategy, const NIBBLETYPE * SrcMetas, NIBBLETYPE * DstMetas) { // Block types are compulsory, block metas are voluntary diff --git a/src/BlockArea.h b/src/BlockArea.h index a95ba7788..86f7c4f2d 100644 --- a/src/BlockArea.h +++ b/src/BlockArea.h @@ -362,7 +362,7 @@ protected: NIBBLETYPE a_BlockLight, NIBBLETYPE a_BlockSkyLight ); - template<bool MetasValid> + template <bool MetasValid> void MergeByStrategy(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_RelZ, eMergeStrategy a_Strategy, const NIBBLETYPE * SrcMetas, NIBBLETYPE * DstMetas); // tolua_begin } ; diff --git a/src/BlockEntities/BeaconEntity.cpp b/src/BlockEntities/BeaconEntity.cpp index 4b9662797..02f45a097 100644 --- a/src/BlockEntities/BeaconEntity.cpp +++ b/src/BlockEntities/BeaconEntity.cpp @@ -3,33 +3,31 @@ #include "BeaconEntity.h" #include "../BlockArea.h" +#include "../Entities/Player.h" -cBeaconEntity::cBeaconEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World) : - super(E_BLOCK_BEACON, a_BlockX, a_BlockY, a_BlockZ, a_World) +cBeaconEntity::cBeaconEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World) + : super(E_BLOCK_BEACON, a_BlockX, a_BlockY, a_BlockZ, 1, 1, a_World) + , m_IsActive(false) + , m_BeaconLevel(0) + , m_PrimaryEffect(cEntityEffect::effNoEffect) + , m_SecondaryEffect(cEntityEffect::effNoEffect) { + UpdateBeacon(); } -int cBeaconEntity::GetPyramidLevel(void) +char cBeaconEntity::CalculatePyramidLevel(void) { cBlockArea Area; - int MinY = GetPosY() - 4; - if (MinY < 0) - { - MinY = 0; - } - int MaxY = GetPosY() - 1; - if (MaxY < 0) - { - MaxY = 0; - } + int MinY = std::max(GetPosY() - 4, 0); + int MaxY = std::max(GetPosY() - 1, 0); Area.Read( m_World, @@ -42,7 +40,7 @@ int cBeaconEntity::GetPyramidLevel(void) int Layer = 1; int MiddleXZ = 4; - for (int Y = Area.GetSizeY() - 1; Y > 0; Y--) + for (int Y = (Area.GetSizeY() - 1); Y >= 0; Y--) { for (int X = MiddleXZ - Layer; X <= (MiddleXZ + Layer); X++) { @@ -50,14 +48,99 @@ int cBeaconEntity::GetPyramidLevel(void) { if (!IsMineralBlock(Area.GetRelBlockType(X, Y, Z))) { - return Layer - 1; + return (Layer - 1); } } } Layer++; } - return Layer - 1; + return (Layer - 1); +} + + + + + +bool cBeaconEntity::IsValidEffect(cEntityEffect::eType a_Effect, char a_BeaconLevel) +{ + switch (a_Effect) + { + case cEntityEffect::effRegeneration: return (a_BeaconLevel >= 4); + case cEntityEffect::effStrength: return (a_BeaconLevel >= 3); + case cEntityEffect::effResistance: return (a_BeaconLevel >= 2); + case cEntityEffect::effJumpBoost: return (a_BeaconLevel >= 2); + case cEntityEffect::effSpeed: return (a_BeaconLevel >= 1); + case cEntityEffect::effHaste: return (a_BeaconLevel >= 1); + case cEntityEffect::effNoEffect: return true; + + default: + { + LOGD("%s: Invalid beacon effect: %d", __FUNCTION__, (int)a_Effect); + return false; + } + } +} + + + + + +bool cBeaconEntity::SetPrimaryEffect(cEntityEffect::eType a_Effect) +{ + if (!IsValidEffect(a_Effect, m_BeaconLevel)) + { + m_PrimaryEffect = cEntityEffect::effNoEffect; + return false; + } + + m_PrimaryEffect = a_Effect; + + // Send window update: + if (GetWindow() != NULL) + { + GetWindow()->SetProperty(1, m_PrimaryEffect); + } + return true; +} + + + + + +bool cBeaconEntity::SetSecondaryEffect(cEntityEffect::eType a_Effect) +{ + if (!IsValidEffect(a_Effect, m_BeaconLevel)) + { + m_SecondaryEffect = cEntityEffect::effNoEffect; + return false; + } + + m_SecondaryEffect = a_Effect; + + // Send window update: + if (GetWindow() != NULL) + { + GetWindow()->SetProperty(2, m_SecondaryEffect); + } + return true; +} + + + + + +bool cBeaconEntity::IsBeaconBlocked(void) +{ + for (int Y = m_PosY; Y < cChunkDef::Height; ++Y) + { + BLOCKTYPE Block = m_World->GetBlock(m_PosX, Y, m_PosZ); + if (!cBlockInfo::IsTransparent(Block)) + { + return true; + } + } + return false; } @@ -83,24 +166,114 @@ bool cBeaconEntity::IsMineralBlock(BLOCKTYPE a_BlockType) -bool cBeaconEntity::Tick(float a_Dt, cChunk & a_Chunk) +void cBeaconEntity::UpdateBeacon(void) { - return false; + int OldBeaconLevel = m_BeaconLevel; + + if (IsBeaconBlocked()) + { + m_IsActive = false; + m_BeaconLevel = 0; + } + else + { + m_BeaconLevel = CalculatePyramidLevel(); + m_IsActive = (m_BeaconLevel > 0); + } + + if (m_BeaconLevel != OldBeaconLevel) + { + // Send window update: + if (GetWindow() != NULL) + { + GetWindow()->SetProperty(0, m_BeaconLevel); + } + } + + // TODO: Add achievement } -void cBeaconEntity::SaveToJson(Json::Value& a_Value) +void cBeaconEntity::GiveEffects(void) { + if (!m_IsActive || (m_BeaconLevel < 0)) + { + return; + } + + int Radius = m_BeaconLevel * 10 + 10; + short EffectLevel = 0; + if ((m_BeaconLevel >= 4) && (m_PrimaryEffect == m_SecondaryEffect)) + { + EffectLevel = 1; + } + + cEntityEffect::eType SecondaryEffect = cEntityEffect::effNoEffect; + if ((m_BeaconLevel >= 4) && (m_PrimaryEffect != m_SecondaryEffect) && (m_SecondaryEffect > 0)) + { + SecondaryEffect = m_SecondaryEffect; + } + + class cPlayerCallback : public cPlayerListCallback + { + int m_Radius; + int m_PosX, m_PosY, m_PosZ; + cEntityEffect::eType m_PrimaryEffect, m_SecondaryEffect; + short m_EffectLevel; + + virtual bool Item(cPlayer * a_Player) + { + Vector3d PlayerPosition = Vector3d(a_Player->GetPosition()); + if (PlayerPosition.y > (double)m_PosY) + { + PlayerPosition.y = (double)m_PosY; + } + + // TODO: Vanilla minecraft uses an AABB check instead of a radius one + Vector3d BeaconPosition = Vector3d(m_PosX, m_PosY, m_PosZ); + if ((PlayerPosition - BeaconPosition).Length() <= m_Radius) + { + a_Player->AddEntityEffect(m_PrimaryEffect, 180, m_EffectLevel); + + if (m_SecondaryEffect != cEntityEffect::effNoEffect) + { + a_Player->AddEntityEffect(m_SecondaryEffect, 180, 0); + } + } + return false; + } + + public: + cPlayerCallback(int a_Radius, int a_PosX, int a_PosY, int a_PosZ, cEntityEffect::eType a_PrimaryEffect, cEntityEffect::eType a_SecondaryEffect, short a_EffectLevel) + : m_Radius(a_Radius) + , m_PosX(a_PosX) + , m_PosY(a_PosY) + , m_PosZ(a_PosZ) + , m_PrimaryEffect(a_PrimaryEffect) + , m_SecondaryEffect(a_SecondaryEffect) + , m_EffectLevel(a_EffectLevel) + {}; + + } PlayerCallback(Radius, m_PosX, m_PosY, m_PosZ, m_PrimaryEffect, SecondaryEffect, EffectLevel); + GetWorld()->ForEachPlayer(PlayerCallback); } -void cBeaconEntity::SendTo(cClientHandle & a_Client) + +bool cBeaconEntity::Tick(float a_Dt, cChunk & a_Chunk) { + // Update the beacon every 4 seconds + if ((GetWorld()->GetWorldAge() % 80) == 0) + { + UpdateBeacon(); + GiveEffects(); + } + return false; } @@ -109,6 +282,30 @@ void cBeaconEntity::SendTo(cClientHandle & a_Client) void cBeaconEntity::UsedBy(cPlayer * a_Player) { + cWindow * Window = GetWindow(); + if (Window == NULL) + { + OpenWindow(new cBeaconWindow(m_PosX, m_PosY, m_PosZ, this)); + Window = GetWindow(); + } + + if (Window != NULL) + { + // if (a_Player->GetWindow() != Window) + // -> Because mojang doesn't send a 'close window' packet when you click the cancel button in the beacon inventory ... + { + a_Player->OpenWindow(Window); + } + } +} + + + + + +void cBeaconEntity::SendTo(cClientHandle & a_Client) +{ + a_Client.SendUpdateBlockEntity(*this); } diff --git a/src/BlockEntities/BeaconEntity.h b/src/BlockEntities/BeaconEntity.h index ee1eda391..8c2dad254 100644 --- a/src/BlockEntities/BeaconEntity.h +++ b/src/BlockEntities/BeaconEntity.h @@ -1,7 +1,14 @@ +// BeaconEntity.h + +// Declares the cBeaconEntity class representing a single beacon in the world + + + + #pragma once -#include "BlockEntity.h" +#include "BlockEntityWithItems.h" @@ -16,28 +23,68 @@ namespace Json +// tolua_begin class cBeaconEntity : - public cBlockEntity + public cBlockEntityWithItems { - typedef cBlockEntity super; + typedef cBlockEntityWithItems super; public: - - /** The initial constructor */ + // tolua_end + cBeaconEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World); - - /** Returns the amount of layers the pyramid below the beacon has. */ - int GetPyramidLevel(void); + + // cBlockEntity overrides: + virtual void SendTo(cClientHandle & a_Client) override; + virtual bool Tick(float a_Dt, cChunk & a_Chunk) override; + virtual void UsedBy(cPlayer * a_Player) override; + + /** Modify the beacon level. (It is needed to load the beacon corectly) */ + void SetBeaconLevel(char a_Level) { m_BeaconLevel = a_Level; } + + // tolua_begin + + /** Is the beacon active? */ + bool IsActive(void) const { return m_IsActive; } + + /** Returns the beacon level. (0 - 4) */ + char GetBeaconLevel(void) const { return m_BeaconLevel; } + + cEntityEffect::eType GetPrimaryEffect(void) const { return m_PrimaryEffect; } + cEntityEffect::eType GetSecondaryEffect(void) const { return m_SecondaryEffect; } + + /** Sets the primary effect. Returns false when the effect is invalid. */ + bool SetPrimaryEffect(cEntityEffect::eType a_Effect); + + /** Sets the secondary effect. Returns false when the effect is invalid. */ + bool SetSecondaryEffect(cEntityEffect::eType a_Effect); + + /** Calculate the amount of layers the pyramid below the beacon has. */ + char CalculatePyramidLevel(void); + + /** Is the beacon blocked by non-transparent blocks that are higher than the beacon? */ + bool IsBeaconBlocked(void); + + /** Update the beacon. */ + void UpdateBeacon(void); + + /** Give the near-players the effects. */ + void GiveEffects(void); /** Returns true if the block is a diamond block, a golden block, an iron block or an emerald block. */ static bool IsMineralBlock(BLOCKTYPE a_BlockType); - - // cBlockEntity overrides: - virtual void SaveToJson(Json::Value& a_Value) override; - virtual void SendTo(cClientHandle & a_Client) override; - virtual void UsedBy(cPlayer * a_Player) override; - virtual bool Tick(float a_Dt, cChunk & /* a_Chunk */) override; -} ; + + /** Returns true if the effect can be used. */ + static bool IsValidEffect(cEntityEffect::eType a_Effect, char a_BeaconLevel); + + // tolua_end + +protected: + bool m_IsActive; + char m_BeaconLevel; + + cEntityEffect::eType m_PrimaryEffect, m_SecondaryEffect; +} ; // tolua_export diff --git a/src/BlockEntities/BlockEntity.h b/src/BlockEntities/BlockEntity.h index 5710f8543..54ab40f3e 100644 --- a/src/BlockEntities/BlockEntity.h +++ b/src/BlockEntities/BlockEntity.h @@ -1,8 +1,6 @@ #pragma once -#include "../ClientHandle.h" -#include "../World.h" @@ -13,8 +11,9 @@ namespace Json class Value; }; +class cChunk; class cPlayer; -class cPacket; +class cWorld; @@ -75,8 +74,6 @@ public: int GetRelZ(void) const { return m_RelZ; } // tolua_end - - virtual void SaveToJson (Json::Value & a_Value) = 0; /// Called when a player uses this entity; should open the UI window virtual void UsedBy( cPlayer * a_Player) = 0; diff --git a/src/BlockEntities/BlockEntityWithItems.h b/src/BlockEntities/BlockEntityWithItems.h index 5f1639d45..00173cbcb 100644 --- a/src/BlockEntities/BlockEntityWithItems.h +++ b/src/BlockEntities/BlockEntityWithItems.h @@ -12,6 +12,7 @@ #include "BlockEntity.h" #include "../ItemGrid.h" #include "../UI/WindowOwner.h" +#include "World.h" @@ -19,12 +20,9 @@ // tolua_begin class cBlockEntityWithItems : - public cBlockEntity - // tolua_end - // tolua doesn't seem to support multiple inheritance? - , public cItemGrid::cListener - , public cBlockEntityWindowOwner - // tolua_begin + public cBlockEntity, + public cItemGrid::cListener, + public cBlockEntityWindowOwner { typedef cBlockEntity super; @@ -38,6 +36,7 @@ public: cWorld * a_World // Optional world to assign to the entity ) : super(a_BlockType, a_BlockX, a_BlockY, a_BlockZ, a_World), + cBlockEntityWindowOwner(this), m_Contents(a_ItemGridWidth, a_ItemGridHeight) { m_Contents.AddListener(*this); diff --git a/src/BlockEntities/ChestEntity.cpp b/src/BlockEntities/ChestEntity.cpp index 21e1f6ba2..19d88b646 100644 --- a/src/BlockEntities/ChestEntity.cpp +++ b/src/BlockEntities/ChestEntity.cpp @@ -5,7 +5,6 @@ #include "../Item.h" #include "../Entities/Player.h" #include "../UI/Window.h" -#include "json/json.h" @@ -15,7 +14,6 @@ cChestEntity::cChestEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_ super(a_Type, a_BlockX, a_BlockY, a_BlockZ, ContentsWidth, ContentsHeight, a_World), m_NumActivePlayers(0) { - cBlockEntityWindowOwner::SetBlockEntity(this); } @@ -35,48 +33,6 @@ cChestEntity::~cChestEntity() -bool cChestEntity::LoadFromJson(const Json::Value & a_Value) -{ - m_PosX = a_Value.get("x", 0).asInt(); - m_PosY = a_Value.get("y", 0).asInt(); - m_PosZ = a_Value.get("z", 0).asInt(); - - Json::Value AllSlots = a_Value.get("Slots", 0); - int SlotIdx = 0; - for (Json::Value::iterator itr = AllSlots.begin(); itr != AllSlots.end(); ++itr) - { - cItem Item; - Item.FromJson(*itr); - SetSlot(SlotIdx, Item); - SlotIdx++; - } - return true; -} - - - - - -void cChestEntity::SaveToJson(Json::Value & a_Value) -{ - a_Value["x"] = m_PosX; - a_Value["y"] = m_PosY; - a_Value["z"] = m_PosZ; - - Json::Value AllSlots; - for (int i = m_Contents.GetNumSlots() - 1; i >= 0; i--) - { - Json::Value Slot; - m_Contents.GetSlot(i).GetJson(Slot); - AllSlots.append(Slot); - } - a_Value["Slots"] = AllSlots; -} - - - - - void cChestEntity::SendTo(cClientHandle & a_Client) { // The chest entity doesn't need anything sent to the client when it's created / gets in the viewdistance diff --git a/src/BlockEntities/ChestEntity.h b/src/BlockEntities/ChestEntity.h index cd06b3e2c..af5d851a8 100644 --- a/src/BlockEntities/ChestEntity.h +++ b/src/BlockEntities/ChestEntity.h @@ -13,8 +13,6 @@ namespace Json }; class cClientHandle; -class cServer; -class cNBTData; @@ -41,11 +39,8 @@ public: virtual ~cChestEntity(); static const char * GetClassStatic(void) { return "cChestEntity"; } - - bool LoadFromJson(const Json::Value & a_Value); // cBlockEntity overrides: - virtual void SaveToJson(Json::Value & a_Value) override; virtual void SendTo(cClientHandle & a_Client) override; virtual void UsedBy(cPlayer * a_Player) override; diff --git a/src/BlockEntities/CommandBlockEntity.cpp b/src/BlockEntities/CommandBlockEntity.cpp index 45f8a3e4d..1a5a3f01e 100644 --- a/src/BlockEntities/CommandBlockEntity.cpp +++ b/src/BlockEntities/CommandBlockEntity.cpp @@ -4,15 +4,14 @@ // Implements the cCommandBlockEntity class representing a single command block in the world #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules -#include "json/json.h" #include "CommandBlockEntity.h" -#include "../Entities/Player.h" -#include "../WorldStorage/FastNBT.h" #include "../CommandOutput.h" #include "../Root.h" #include "../Server.h" // ExecuteConsoleCommand() -#include "../Chunk.h" +#include "../ChatColor.h" +#include "../World.h" +#include "../ClientHandle.h" @@ -153,46 +152,13 @@ void cCommandBlockEntity::SendTo(cClientHandle & a_Client) -bool cCommandBlockEntity::LoadFromJson(const Json::Value & a_Value) -{ - m_PosX = a_Value.get("x", 0).asInt(); - m_PosY = a_Value.get("y", 0).asInt(); - m_PosZ = a_Value.get("z", 0).asInt(); - - m_Command = a_Value.get("Command", "").asString(); - m_LastOutput = a_Value.get("LastOutput", "").asString(); - m_Result = (NIBBLETYPE)a_Value.get("SuccessCount", 0).asInt(); - - return true; -} - - - - - -void cCommandBlockEntity::SaveToJson(Json::Value & a_Value) -{ - a_Value["x"] = m_PosX; - a_Value["y"] = m_PosY; - a_Value["z"] = m_PosZ; - - a_Value["Command"] = m_Command; - a_Value["LastOutput"] = m_LastOutput; - a_Value["SuccessCount"] = m_Result; -} - - - - - void cCommandBlockEntity::Execute() { - if (m_World != NULL) + ASSERT(m_World != NULL); // Execute should not be called before the command block is attached to a world + + if (!m_World->AreCommandBlocksEnabled()) { - if (!m_World->AreCommandBlocksEnabled()) - { - return; - } + return; } class CommandBlockOutCb : @@ -206,15 +172,28 @@ void cCommandBlockEntity::Execute() virtual void Out(const AString & a_Text) { // Overwrite field - m_CmdBlock->SetLastOutput(a_Text); + m_CmdBlock->SetLastOutput(cClientHandle::FormatChatPrefix(m_CmdBlock->GetWorld()->ShouldUseChatPrefixes(), "SUCCESS", cChatColor::Green, cChatColor::White) + a_Text); } } CmdBlockOutCb(this); - LOGD("cCommandBlockEntity: Executing command %s", m_Command.c_str()); - - cServer * Server = cRoot::Get()->GetServer(); - - Server->ExecuteConsoleCommand(m_Command, CmdBlockOutCb); + // Administrator commands are not executable by command blocks: + if ( + (m_Command != "stop") && + (m_Command != "restart") && + (m_Command != "kick") && + (m_Command != "ban") && + (m_Command != "ipban") + ) + { + cServer * Server = cRoot::Get()->GetServer(); + LOGD("cCommandBlockEntity: Executing command %s", m_Command.c_str()); + Server->ExecuteConsoleCommand(m_Command, CmdBlockOutCb); + } + else + { + SetLastOutput(cClientHandle::FormatChatPrefix(GetWorld()->ShouldUseChatPrefixes(), "FAILURE", cChatColor::Rose, cChatColor::White) + "Adminstration commands can not be executed"); + LOGD("cCommandBlockEntity: Prevented execution of administration command %s", m_Command.c_str()); + } // TODO 2014-01-18 xdot: Update the signal strength. m_Result = 0; diff --git a/src/BlockEntities/CommandBlockEntity.h b/src/BlockEntities/CommandBlockEntity.h index d02bf7d7b..939f38610 100644 --- a/src/BlockEntities/CommandBlockEntity.h +++ b/src/BlockEntities/CommandBlockEntity.h @@ -10,7 +10,7 @@ #pragma once #include "BlockEntity.h" - +#include "RedstonePoweredEntity.h" @@ -27,7 +27,8 @@ namespace Json // tolua_begin class cCommandBlockEntity : - public cBlockEntity + public cBlockEntity, + public cRedstonePoweredEntity { typedef cBlockEntity super; @@ -38,9 +39,6 @@ public: /// Creates a new empty command block entity cCommandBlockEntity(int a_X, int a_Y, int a_Z, cWorld * a_World); - bool LoadFromJson( const Json::Value& a_Value); - virtual void SaveToJson(Json::Value& a_Value) override; - virtual bool Tick(float a_Dt, cChunk & a_Chunk) override; virtual void SendTo(cClientHandle & a_Client) override; virtual void UsedBy(cPlayer * a_Player) override; @@ -52,7 +50,7 @@ public: // tolua_begin /// Sets the internal redstone power flag to "on" or "off", depending on the parameter. Calls Activate() if appropriate - void SetRedstonePower(bool a_IsPowered); + virtual void SetRedstonePower(bool a_IsPowered) override; /// Sets the command block to execute a command in the next tick void Activate(void); diff --git a/src/BlockEntities/DispenserEntity.cpp b/src/BlockEntities/DispenserEntity.cpp index c02c68afa..aea854dc2 100644 --- a/src/BlockEntities/DispenserEntity.cpp +++ b/src/BlockEntities/DispenserEntity.cpp @@ -2,13 +2,10 @@ #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules #include "DispenserEntity.h" -#include "../Entities/Player.h" #include "../Simulator/FluidSimulator.h" #include "../Chunk.h" #include "../World.h" -#include "../Entities/ArrowEntity.h" -#include "../Entities/FireChargeEntity.h" #include "../Entities/ProjectileEntity.h" @@ -17,7 +14,6 @@ cDispenserEntity::cDispenserEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World) : super(E_BLOCK_DISPENSER, a_BlockX, a_BlockY, a_BlockZ, a_World) { - SetBlockEntity(this); // cBlockEntityWindowOwner } @@ -109,7 +105,7 @@ void cDispenserEntity::DropSpenseFromSlot(cChunk & a_Chunk, int a_SlotNum) { double MobX = 0.5 + (DispX + DispChunk->GetPosX() * cChunkDef::Width); double MobZ = 0.5 + (DispZ + DispChunk->GetPosZ() * cChunkDef::Width); - if (m_World->SpawnMob(MobX, DispY, MobZ, (cMonster::eType)m_Contents.GetSlot(a_SlotNum).m_ItemDamage) >= 0) + if (m_World->SpawnMob(MobX, DispY, MobZ, (eMonsterType)m_Contents.GetSlot(a_SlotNum).m_ItemDamage) >= 0) { m_Contents.ChangeSlotCount(a_SlotNum, -1); } @@ -203,7 +199,7 @@ void cDispenserEntity::SpawnProjectileFromDispenser(int a_BlockX, int a_BlockY, Vector3d cDispenserEntity::GetShootVector(NIBBLETYPE a_Meta) { - switch (a_Meta) + switch (a_Meta & 0x7) { case E_META_DROPSPENSER_FACING_YP: return Vector3d( 0, 1, 0); case E_META_DROPSPENSER_FACING_YM: return Vector3d( 0, -1, 0); diff --git a/src/BlockEntities/DropSpenserEntity.cpp b/src/BlockEntities/DropSpenserEntity.cpp index dc38e3e9b..dac951b27 100644 --- a/src/BlockEntities/DropSpenserEntity.cpp +++ b/src/BlockEntities/DropSpenserEntity.cpp @@ -8,7 +8,6 @@ #include "DropSpenserEntity.h" #include "../Entities/Player.h" #include "../Chunk.h" -#include "json/json.h" @@ -19,7 +18,6 @@ cDropSpenserEntity::cDropSpenserEntity(BLOCKTYPE a_BlockType, int a_BlockX, int m_ShouldDropSpense(false), m_IsPowered(false) { - SetBlockEntity(this); // cBlockEntityWindowOwner } @@ -144,54 +142,6 @@ bool cDropSpenserEntity::Tick(float a_Dt, cChunk & a_Chunk) -bool cDropSpenserEntity::LoadFromJson(const Json::Value & a_Value) -{ - m_PosX = a_Value.get("x", 0).asInt(); - m_PosY = a_Value.get("y", 0).asInt(); - m_PosZ = a_Value.get("z", 0).asInt(); - - Json::Value AllSlots = a_Value.get("Slots", 0); - int SlotIdx = 0; - for (Json::Value::iterator itr = AllSlots.begin(); itr != AllSlots.end(); ++itr) - { - cItem Contents; - Contents.FromJson(*itr); - m_Contents.SetSlot(SlotIdx, Contents); - SlotIdx++; - if (SlotIdx >= m_Contents.GetNumSlots()) - { - return true; - } - } - - return true; -} - - - - - -void cDropSpenserEntity::SaveToJson(Json::Value & a_Value) -{ - a_Value["x"] = m_PosX; - a_Value["y"] = m_PosY; - a_Value["z"] = m_PosZ; - - Json::Value AllSlots; - int NumSlots = m_Contents.GetNumSlots(); - for (int i = 0; i < NumSlots; i++) - { - Json::Value Slot; - m_Contents.GetSlot(i).GetJson(Slot); - AllSlots.append(Slot); - } - a_Value["Slots"] = AllSlots; -} - - - - - void cDropSpenserEntity::SendTo(cClientHandle & a_Client) { // Nothing needs to be sent diff --git a/src/BlockEntities/DropSpenserEntity.h b/src/BlockEntities/DropSpenserEntity.h index 9f58d0b07..23f0ae89a 100644 --- a/src/BlockEntities/DropSpenserEntity.h +++ b/src/BlockEntities/DropSpenserEntity.h @@ -11,7 +11,7 @@ #pragma once #include "BlockEntityWithItems.h" - +#include "RedstonePoweredEntity.h" @@ -22,7 +22,6 @@ namespace Json } class cClientHandle; -class cServer; @@ -31,6 +30,9 @@ class cServer; // tolua_begin class cDropSpenserEntity : public cBlockEntityWithItems + // tolua_end + , public cRedstonePoweredEntity + // tolua_begin { typedef cBlockEntityWithItems super; @@ -47,11 +49,8 @@ public: virtual ~cDropSpenserEntity(); static const char * GetClassStatic(void) { return "cDropSpenserEntity"; } - - bool LoadFromJson(const Json::Value & a_Value); // cBlockEntity overrides: - virtual void SaveToJson(Json::Value & a_Value) override; virtual bool Tick(float a_Dt, cChunk & a_Chunk) override; virtual void SendTo(cClientHandle & a_Client) override; virtual void UsedBy(cPlayer * a_Player) override; @@ -64,10 +63,10 @@ public: /// Sets the dropspenser to dropspense an item in the next tick void Activate(void); - /// Sets the internal redstone power flag to "on" or "off", depending on the parameter. Calls Activate() if appropriate - void SetRedstonePower(bool a_IsPowered); - // tolua_end + + /// Sets the internal redstone power flag to "on" or "off", depending on the parameter. Calls Activate() if appropriate + virtual void SetRedstonePower(bool a_IsPowered) override; protected: bool m_ShouldDropSpense; ///< If true, the dropspenser will dropspense an item in the next tick diff --git a/src/BlockEntities/DropperEntity.cpp b/src/BlockEntities/DropperEntity.cpp index 5d4a8ad97..38d1aa988 100644 --- a/src/BlockEntities/DropperEntity.cpp +++ b/src/BlockEntities/DropperEntity.cpp @@ -5,8 +5,6 @@ #include "Globals.h" #include "DropperEntity.h" -#include "../Entities/Player.h" -#include "../Simulator/FluidSimulator.h" @@ -15,7 +13,6 @@ cDropperEntity::cDropperEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World) : super(E_BLOCK_DROPPER, a_BlockX, a_BlockY, a_BlockZ, a_World) { - SetBlockEntity(this); // cBlockEntityWindowOwner } diff --git a/src/BlockEntities/EnderChestEntity.cpp b/src/BlockEntities/EnderChestEntity.cpp index 17816d63e..0654d97dd 100644 --- a/src/BlockEntities/EnderChestEntity.cpp +++ b/src/BlockEntities/EnderChestEntity.cpp @@ -5,14 +5,14 @@ #include "../Item.h" #include "../Entities/Player.h" #include "../UI/Window.h" -#include "json/json.h" cEnderChestEntity::cEnderChestEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World) : - super(E_BLOCK_ENDER_CHEST, a_BlockX, a_BlockY, a_BlockZ, a_World) + super(E_BLOCK_ENDER_CHEST, a_BlockX, a_BlockY, a_BlockZ, a_World), + cBlockEntityWindowOwner(this) { } diff --git a/src/BlockEntities/EnderChestEntity.h b/src/BlockEntities/EnderChestEntity.h index ed178f6fc..2719eb5e4 100644 --- a/src/BlockEntities/EnderChestEntity.h +++ b/src/BlockEntities/EnderChestEntity.h @@ -3,7 +3,6 @@ #include "BlockEntity.h" #include "UI/WindowOwner.h" -#include "json/json.h" @@ -26,7 +25,6 @@ public: // cBlockEntity overrides: virtual void UsedBy(cPlayer * a_Player) override; - virtual void SaveToJson(Json::Value & a_Value) override { UNUSED(a_Value); } virtual void SendTo(cClientHandle & a_Client) override { UNUSED(a_Client); } static void LoadFromJson(const Json::Value & a_Value, cItemGrid & a_Grid); diff --git a/src/BlockEntities/FlowerPotEntity.cpp b/src/BlockEntities/FlowerPotEntity.cpp index 87bf8b921..01560f814 100644 --- a/src/BlockEntities/FlowerPotEntity.cpp +++ b/src/BlockEntities/FlowerPotEntity.cpp @@ -1,10 +1,9 @@ // FlowerPotEntity.cpp -// Implements the cFlowerPotEntity class representing a single sign in the world +// Implements the cFlowerPotEntity class representing a single flower pot in the world #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules -#include "json/json.h" #include "FlowerPotEntity.h" #include "../Entities/Player.h" #include "../Item.h" @@ -73,37 +72,6 @@ void cFlowerPotEntity::Destroy(void) -bool cFlowerPotEntity::LoadFromJson(const Json::Value & a_Value) -{ - m_PosX = a_Value.get("x", 0).asInt(); - m_PosY = a_Value.get("y", 0).asInt(); - m_PosZ = a_Value.get("z", 0).asInt(); - - m_Item = cItem(); - m_Item.FromJson(a_Value.get("Item", 0)); - - return true; -} - - - - - -void cFlowerPotEntity::SaveToJson(Json::Value & a_Value) -{ - a_Value["x"] = m_PosX; - a_Value["y"] = m_PosY; - a_Value["z"] = m_PosZ; - - Json::Value Item; - m_Item.GetJson(Item); - a_Value["Item"] = Item; -} - - - - - bool cFlowerPotEntity::IsFlower(short m_ItemType, short m_ItemData) { switch (m_ItemType) diff --git a/src/BlockEntities/FlowerPotEntity.h b/src/BlockEntities/FlowerPotEntity.h index 89901cf2d..b68d3b118 100644 --- a/src/BlockEntities/FlowerPotEntity.h +++ b/src/BlockEntities/FlowerPotEntity.h @@ -9,8 +9,8 @@ #pragma once #include "BlockEntity.h" +#include "Item.h" -class cItem; @@ -38,9 +38,6 @@ public: /** Creates a new flowerpot entity at the specified block coords. a_World may be NULL */ cFlowerPotEntity(int a_BlocX, int a_BlockY, int a_BlockZ, cWorld * a_World); - - bool LoadFromJson( const Json::Value& a_Value); - virtual void SaveToJson(Json::Value& a_Value) override; virtual void Destroy(void) override; diff --git a/src/BlockEntities/FurnaceEntity.cpp b/src/BlockEntities/FurnaceEntity.cpp index 72fd7f2b3..4452fc00a 100644 --- a/src/BlockEntities/FurnaceEntity.cpp +++ b/src/BlockEntities/FurnaceEntity.cpp @@ -5,8 +5,6 @@ #include "../UI/Window.h" #include "../Entities/Player.h" #include "../Root.h" -#include "../Chunk.h" -#include "json/json.h" @@ -36,7 +34,6 @@ cFurnaceEntity::cFurnaceEntity(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTY m_LastProgressFuel(0), m_LastProgressCook(0) { - cBlockEntityWindowOwner::SetBlockEntity(this); m_Contents.AddListener(*this); } @@ -132,60 +129,6 @@ bool cFurnaceEntity::Tick(float a_Dt, cChunk & a_Chunk) -bool cFurnaceEntity::LoadFromJson(const Json::Value & a_Value) -{ - m_PosX = a_Value.get("x", 0).asInt(); - m_PosY = a_Value.get("y", 0).asInt(); - m_PosZ = a_Value.get("z", 0).asInt(); - - Json::Value AllSlots = a_Value.get("Slots", 0); - int SlotIdx = 0; - for (Json::Value::iterator itr = AllSlots.begin(); itr != AllSlots.end(); ++itr) - { - cItem Item; - Item.FromJson(*itr); - SetSlot(SlotIdx, Item); - SlotIdx++; - } - - m_NeedCookTime = (int)(a_Value.get("CookTime", 0).asDouble() / 50); - m_TimeCooked = (int)(a_Value.get("TimeCooked", 0).asDouble() / 50); - m_FuelBurnTime = (int)(a_Value.get("BurnTime", 0).asDouble() / 50); - m_TimeBurned = (int)(a_Value.get("TimeBurned", 0).asDouble() / 50); - - return true; -} - - - - - -void cFurnaceEntity::SaveToJson( Json::Value& a_Value) -{ - a_Value["x"] = m_PosX; - a_Value["y"] = m_PosY; - a_Value["z"] = m_PosZ; - - Json::Value AllSlots; - int NumSlots = m_Contents.GetNumSlots(); - for (int i = 0; i < NumSlots; i++) - { - Json::Value Slot; - m_Contents.GetSlot(i).GetJson(Slot); - AllSlots.append(Slot); - } - a_Value["Slots"] = AllSlots; - - a_Value["CookTime"] = m_NeedCookTime * 50; - a_Value["TimeCooked"] = m_TimeCooked * 50; - a_Value["BurnTime"] = m_FuelBurnTime * 50; - a_Value["TimeBurned"] = m_TimeBurned * 50; -} - - - - - void cFurnaceEntity::SendTo(cClientHandle & a_Client) { // Nothing needs to be sent diff --git a/src/BlockEntities/FurnaceEntity.h b/src/BlockEntities/FurnaceEntity.h index 4f935a74b..ed3317af6 100644 --- a/src/BlockEntities/FurnaceEntity.h +++ b/src/BlockEntities/FurnaceEntity.h @@ -14,7 +14,6 @@ namespace Json } class cClientHandle; -class cServer; @@ -45,11 +44,8 @@ public: virtual ~cFurnaceEntity(); static const char * GetClassStatic() { return "cFurnaceEntity"; } - - bool LoadFromJson(const Json::Value & a_Value); // cBlockEntity overrides: - virtual void SaveToJson(Json::Value & a_Value) override; virtual void SendTo(cClientHandle & a_Client) override; virtual bool Tick(float a_Dt, cChunk & a_Chunk) override; virtual void UsedBy(cPlayer * a_Player) override; @@ -105,7 +101,7 @@ protected: NIBBLETYPE m_BlockMeta; /// The recipe for the current input slot - const cFurnaceRecipe::Recipe * m_CurrentRecipe; + const cFurnaceRecipe::cRecipe * m_CurrentRecipe; /// The item that is being smelted cItem m_LastInput; diff --git a/src/BlockEntities/HopperEntity.cpp b/src/BlockEntities/HopperEntity.cpp index 48d3b8dcc..103f516fc 100644 --- a/src/BlockEntities/HopperEntity.cpp +++ b/src/BlockEntities/HopperEntity.cpp @@ -10,10 +10,7 @@ #include "../Entities/Pickup.h" #include "../Bindings/PluginManager.h" #include "ChestEntity.h" -#include "DropSpenserEntity.h" #include "FurnaceEntity.h" -#include "../BoundingBox.h" -#include "json/json.h" @@ -73,17 +70,6 @@ bool cHopperEntity::Tick(float a_Dt, cChunk & a_Chunk) -void cHopperEntity::SaveToJson(Json::Value & a_Value) -{ - UNUSED(a_Value); - // TODO - LOGWARNING("%s: Not implemented yet", __FUNCTION__); -} - - - - - void cHopperEntity::SendTo(cClientHandle & a_Client) { // The hopper entity doesn't need anything sent to the client when it's created / gets in the viewdistance @@ -549,13 +535,13 @@ bool cHopperEntity::MoveItemsFromSlot(cBlockEntityWithItems & a_Entity, int a_Sl bool cHopperEntity::MoveItemsToChest(cChunk & a_Chunk, int a_BlockX, int a_BlockY, int a_BlockZ) { // Try the chest directly connected to the hopper: - cChestEntity * Chest = (cChestEntity *)a_Chunk.GetBlockEntity(a_BlockX, a_BlockY, a_BlockZ); - if (Chest == NULL) + cChestEntity * ConnectedChest = (cChestEntity *)a_Chunk.GetBlockEntity(a_BlockX, a_BlockY, a_BlockZ); + if (ConnectedChest == NULL) { LOGWARNING("%s: A chest entity was not found where expected, at {%d, %d, %d}", __FUNCTION__, a_BlockX, a_BlockY, a_BlockZ); return false; } - if (MoveItemsToGrid(*Chest)) + if (MoveItemsToGrid(*ConnectedChest)) { // Chest block directly connected was not full return true; @@ -586,13 +572,13 @@ bool cHopperEntity::MoveItemsToChest(cChunk & a_Chunk, int a_BlockX, int a_Block } BLOCKTYPE Block = Neighbor->GetBlock(x, a_BlockY, z); - if (Block != Chest->GetBlockType()) + if (Block != ConnectedChest->GetBlockType()) { // Not the same kind of chest continue; } - Chest = (cChestEntity *)Neighbor->GetBlockEntity(a_BlockX + Coords[i].x, a_BlockY, a_BlockZ + Coords[i].z); + cChestEntity * Chest = (cChestEntity *)Neighbor->GetBlockEntity(a_BlockX + Coords[i].x, a_BlockY, a_BlockZ + Coords[i].z); if (Chest == NULL) { LOGWARNING("%s: A chest entity was not found where expected, at {%d, %d, %d} (%d, %d)", __FUNCTION__, a_BlockX + Coords[i].x, a_BlockY, a_BlockZ + Coords[i].z, x, z); diff --git a/src/BlockEntities/HopperEntity.h b/src/BlockEntities/HopperEntity.h index 8e856fcda..5d06581c2 100644 --- a/src/BlockEntities/HopperEntity.h +++ b/src/BlockEntities/HopperEntity.h @@ -49,7 +49,6 @@ protected: // cBlockEntity overrides: virtual bool Tick(float a_Dt, cChunk & a_Chunk) override; - virtual void SaveToJson(Json::Value & a_Value) override; virtual void SendTo(cClientHandle & a_Client) override; virtual void UsedBy(cPlayer * a_Player) override; diff --git a/src/BlockEntities/JukeboxEntity.cpp b/src/BlockEntities/JukeboxEntity.cpp index c96253b11..bb9b335e0 100644 --- a/src/BlockEntities/JukeboxEntity.cpp +++ b/src/BlockEntities/JukeboxEntity.cpp @@ -3,8 +3,8 @@ #include "JukeboxEntity.h" #include "../World.h" -#include "json/json.h" - +#include "json/value.h" +#include "Entities/Player.h" @@ -117,31 +117,3 @@ void cJukeboxEntity::SetRecord(int a_Record) - -bool cJukeboxEntity::LoadFromJson(const Json::Value & a_Value) -{ - m_PosX = a_Value.get("x", 0).asInt(); - m_PosY = a_Value.get("y", 0).asInt(); - m_PosZ = a_Value.get("z", 0).asInt(); - - m_Record = a_Value.get("Record", 0).asInt(); - - return true; -} - - - - - -void cJukeboxEntity::SaveToJson(Json::Value & a_Value) -{ - a_Value["x"] = m_PosX; - a_Value["y"] = m_PosY; - a_Value["z"] = m_PosZ; - - a_Value["Record"] = m_Record; -} - - - - diff --git a/src/BlockEntities/JukeboxEntity.h b/src/BlockEntities/JukeboxEntity.h index d677d340f..49d2faa89 100644 --- a/src/BlockEntities/JukeboxEntity.h +++ b/src/BlockEntities/JukeboxEntity.h @@ -2,7 +2,6 @@ #pragma once #include "BlockEntity.h" -#include "../Entities/Player.h" @@ -30,9 +29,6 @@ public: cJukeboxEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World); virtual ~cJukeboxEntity(); - bool LoadFromJson(const Json::Value & a_Value); - virtual void SaveToJson(Json::Value & a_Value) override; - // tolua_begin int GetRecord(void); diff --git a/src/BlockEntities/MobHeadEntity.cpp b/src/BlockEntities/MobHeadEntity.cpp index ce895eb6f..67e13ffb2 100644 --- a/src/BlockEntities/MobHeadEntity.cpp +++ b/src/BlockEntities/MobHeadEntity.cpp @@ -4,7 +4,6 @@ // Implements the cMobHeadEntity class representing a single skull/head in the world #include "Globals.h" -#include "json/json.h" #include "MobHeadEntity.h" #include "../Entities/Player.h" @@ -78,35 +77,3 @@ void cMobHeadEntity::SendTo(cClientHandle & a_Client) - -bool cMobHeadEntity::LoadFromJson(const Json::Value & a_Value) -{ - m_PosX = a_Value.get("x", 0).asInt(); - m_PosY = a_Value.get("y", 0).asInt(); - m_PosZ = a_Value.get("z", 0).asInt(); - - m_Type = static_cast<eMobHeadType>(a_Value.get("Type", 0).asInt()); - m_Rotation = static_cast<eMobHeadRotation>(a_Value.get("Rotation", 0).asInt()); - m_Owner = a_Value.get("Owner", "").asString(); - - return true; -} - - - - - -void cMobHeadEntity::SaveToJson(Json::Value & a_Value) -{ - a_Value["x"] = m_PosX; - a_Value["y"] = m_PosY; - a_Value["z"] = m_PosZ; - - a_Value["Type"] = m_Type; - a_Value["Rotation"] = m_Rotation; - a_Value["Owner"] = m_Owner; -} - - - - diff --git a/src/BlockEntities/MobHeadEntity.h b/src/BlockEntities/MobHeadEntity.h index f91a3cc9e..fcdeaa8a6 100644 --- a/src/BlockEntities/MobHeadEntity.h +++ b/src/BlockEntities/MobHeadEntity.h @@ -9,7 +9,7 @@ #pragma once #include "BlockEntity.h" - +#include "Defines.h" @@ -37,9 +37,6 @@ public: /** Creates a new mob head entity at the specified block coords. a_World may be NULL */ cMobHeadEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cWorld * a_World); - bool LoadFromJson( const Json::Value& a_Value); - virtual void SaveToJson(Json::Value& a_Value) override; - // tolua_begin /** Set the Type */ diff --git a/src/BlockEntities/NoteEntity.cpp b/src/BlockEntities/NoteEntity.cpp index 95145c117..a9af13c55 100644 --- a/src/BlockEntities/NoteEntity.cpp +++ b/src/BlockEntities/NoteEntity.cpp @@ -3,7 +3,7 @@ #include "NoteEntity.h" #include "../World.h" -#include "json/json.h" +#include "json/value.h" @@ -124,32 +124,3 @@ void cNoteEntity::IncrementPitch(void) - -bool cNoteEntity::LoadFromJson(const Json::Value & a_Value) -{ - - m_PosX = a_Value.get("x", 0).asInt(); - m_PosY = a_Value.get("y", 0).asInt(); - m_PosZ = a_Value.get("z", 0).asInt(); - - m_Pitch = (char)a_Value.get("p", 0).asInt(); - - return true; -} - - - - - -void cNoteEntity::SaveToJson(Json::Value & a_Value) -{ - a_Value["x"] = m_PosX; - a_Value["y"] = m_PosY; - a_Value["z"] = m_PosZ; - - a_Value["p"] = m_Pitch; -} - - - - diff --git a/src/BlockEntities/NoteEntity.h b/src/BlockEntities/NoteEntity.h index e8497da3e..d1ffa126a 100644 --- a/src/BlockEntities/NoteEntity.h +++ b/src/BlockEntities/NoteEntity.h @@ -2,6 +2,7 @@ #pragma once #include "BlockEntity.h" +#include "RedstonePoweredEntity.h" namespace Json @@ -30,6 +31,9 @@ enum ENUM_NOTE_INSTRUMENTS class cNoteEntity : public cBlockEntity + // tolua_end + , public cRedstonePoweredEntity + // tolua_begin { typedef cBlockEntity super; public: @@ -38,9 +42,7 @@ public: /// Creates a new note entity. a_World may be NULL cNoteEntity(int a_X, int a_Y, int a_Z, cWorld * a_World); - - bool LoadFromJson(const Json::Value & a_Value); - virtual void SaveToJson(Json::Value & a_Value) override; + virtual ~cNoteEntity() {} // tolua_begin @@ -53,6 +55,14 @@ public: virtual void UsedBy(cPlayer * a_Player) override; virtual void SendTo(cClientHandle &) override {} + + virtual void SetRedstonePower(bool a_Value) + { + if (a_Value) + { + MakeSound(); + } + } static const char * GetClassStatic(void) { return "cNoteEntity"; } diff --git a/src/BlockEntities/RedstonePoweredEntity.h b/src/BlockEntities/RedstonePoweredEntity.h new file mode 100644 index 000000000..eac4e35d4 --- /dev/null +++ b/src/BlockEntities/RedstonePoweredEntity.h @@ -0,0 +1,13 @@ + +#pragma once + +// Interface class representing a blockEntity that responds to redstone +class cRedstonePoweredEntity +{ +public: + + virtual ~cRedstonePoweredEntity() {} + + /// Sets the internal redstone power flag to "on" or "off", depending on the parameter. Calls Activate() if appropriate + virtual void SetRedstonePower(bool a_IsPowered) = 0; +}; diff --git a/src/BlockEntities/SignEntity.cpp b/src/BlockEntities/SignEntity.cpp index 97fed0f04..d048d0218 100644 --- a/src/BlockEntities/SignEntity.cpp +++ b/src/BlockEntities/SignEntity.cpp @@ -4,9 +4,9 @@ // Implements the cSignEntity class representing a single sign in the world #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules -#include "json/json.h" +#include "json/value.h" #include "SignEntity.h" -#include "../Entities/Player.h" +#include "../ClientHandle.h" @@ -15,13 +15,13 @@ cSignEntity::cSignEntity(BLOCKTYPE a_BlockType, int a_X, int a_Y, int a_Z, cWorld * a_World) : super(a_BlockType, a_X, a_Y, a_Z, a_World) { + ASSERT((a_Y >= 0) && (a_Y < cChunkDef::Height)); } -// It don't do anything when 'used' void cSignEntity::UsedBy(cPlayer * a_Player) { UNUSED(a_Player); @@ -79,37 +79,3 @@ void cSignEntity::SendTo(cClientHandle & a_Client) - -bool cSignEntity::LoadFromJson(const Json::Value & a_Value) -{ - m_PosX = a_Value.get("x", 0).asInt(); - m_PosY = a_Value.get("y", 0).asInt(); - m_PosZ = a_Value.get("z", 0).asInt(); - - m_Line[0] = a_Value.get("Line1", "").asString(); - m_Line[1] = a_Value.get("Line2", "").asString(); - m_Line[2] = a_Value.get("Line3", "").asString(); - m_Line[3] = a_Value.get("Line4", "").asString(); - - return true; -} - - - - - -void cSignEntity::SaveToJson(Json::Value & a_Value) -{ - a_Value["x"] = m_PosX; - a_Value["y"] = m_PosY; - a_Value["z"] = m_PosZ; - - a_Value["Line1"] = m_Line[0]; - a_Value["Line2"] = m_Line[1]; - a_Value["Line3"] = m_Line[2]; - a_Value["Line4"] = m_Line[3]; -} - - - - diff --git a/src/BlockEntities/SignEntity.h b/src/BlockEntities/SignEntity.h index 33af100a4..53c43b758 100644 --- a/src/BlockEntities/SignEntity.h +++ b/src/BlockEntities/SignEntity.h @@ -37,9 +37,6 @@ public: /// Creates a new empty sign entity at the specified block coords and block type (wall or standing). a_World may be NULL cSignEntity(BLOCKTYPE a_BlockType, int a_X, int a_Y, int a_Z, cWorld * a_World); - bool LoadFromJson( const Json::Value& a_Value); - virtual void SaveToJson(Json::Value& a_Value) override; - // tolua_begin /// Sets all the sign's lines diff --git a/src/BlockID.cpp b/src/BlockID.cpp index d145a2e5b..755c721db 100644 --- a/src/BlockID.cpp +++ b/src/BlockID.cpp @@ -17,7 +17,7 @@ class cBlockIDMap // Making the map case-insensitive: struct Comparator { - bool operator()(const AString & a_Item1, const AString & a_Item2) const + bool operator ()(const AString & a_Item1, const AString & a_Item2) const { return (NoCaseCompare(a_Item1, a_Item2) > 0); } @@ -253,57 +253,6 @@ AString ItemToFullString(const cItem & a_Item) -int StringToMobType(const AString & a_MobString) -{ - static struct - { - int m_MobType; - const char * m_String; - } MobMap [] = - { - {cMonster::mtCreeper, "Creeper"}, - {cMonster::mtSkeleton, "Skeleton"}, - {cMonster::mtSpider, "Spider"}, - {cMonster::mtGiant, "Giant"}, - {cMonster::mtZombie, "Zombie"}, - {cMonster::mtSlime, "Slime"}, - {cMonster::mtGhast, "Ghast"}, - {cMonster::mtZombiePigman, "ZombiePigman"}, - {cMonster::mtEnderman, "Enderman"}, - {cMonster::mtCaveSpider, "CaveSpider"}, - {cMonster::mtSilverfish, "SilverFish"}, - {cMonster::mtBlaze, "Blaze"}, - {cMonster::mtMagmaCube, "MagmaCube"}, - {cMonster::mtEnderDragon, "EnderDragon"}, - {cMonster::mtWither, "Wither"}, - {cMonster::mtBat, "Bat"}, - {cMonster::mtWitch, "Witch"}, - {cMonster::mtPig, "Pig"}, - {cMonster::mtSheep, "Sheep"}, - {cMonster::mtCow, "Cow"}, - {cMonster::mtChicken, "Chicken"}, - {cMonster::mtSquid, "Squid"}, - {cMonster::mtWolf, "Wolf"}, - {cMonster::mtMooshroom, "Mooshroom"}, - {cMonster::mtSnowGolem, "SnowGolem"}, - {cMonster::mtOcelot, "Ocelot"}, - {cMonster::mtIronGolem, "IronGolem"}, - {cMonster::mtVillager, "Villager"}, - }; - for (size_t i = 0; i < ARRAYCOUNT(MobMap); i++) - { - if (NoCaseCompare(MobMap[i].m_String, a_MobString) == 0) - { - return MobMap[i].m_MobType; - } - } // for i - MobMap[] - return -1; -} - - - - - eDimension StringToDimension(const AString & a_DimensionString) { // First try decoding as a number diff --git a/src/BlockID.h b/src/BlockID.h index f1aee3f4a..bb06722d2 100644 --- a/src/BlockID.h +++ b/src/BlockID.h @@ -175,12 +175,39 @@ enum ENUM_BLOCK_ID E_BLOCK_NEW_LOG = 162, E_BLOCK_ACACIA_WOOD_STAIRS = 163, E_BLOCK_DARK_OAK_WOOD_STAIRS = 164, + E_BLOCK_SLIME_BLOCK = 165, + E_BLOCK_BARRIER = 166, + E_BLOCK_IRON_TRAPDOOR = 167, + E_BLOCK_PRISMARINE_BLOCK = 168, + E_BLOCK_SEA_LANTERN = 169, E_BLOCK_HAY_BALE = 170, E_BLOCK_CARPET = 171, E_BLOCK_HARDENED_CLAY = 172, E_BLOCK_BLOCK_OF_COAL = 173, E_BLOCK_PACKED_ICE = 174, E_BLOCK_BIG_FLOWER = 175, + E_BLOCK_STANDING_BANNER = 176, + E_BLOCK_WALL_BANNER = 177, + E_BLOCK_INVERTED_DAYLIGHT_SENSOR = 178, + E_BLOCK_RED_SANDSTONE = 179, + E_BLOCK_RED_SANDSTONE_STAIRS = 180, + E_BLOCK_DOUBLE_NEW_STONE_SLAB= 181, + E_BLOCK_NEW_STONE_SLAB = 182, + E_BLOCK_SPRUCE_FENCE_GATE = 183, + E_BLOCK_BIRCH_FENCE_GATE = 184, + E_BLOCK_JUNGLE_FENCE_GATE = 185, + E_BLOCK_DARK_OAK_FENCE_GATE = 186, + E_BLOCK_ACACIA_FENCE_GATE = 187, + E_BLOCK_SPRUCE_FENCE = 188, + E_BLOCK_BIRCH_FENCE = 189, + E_BLOCK_JUNGLE_FENCE = 190, + E_BLOCK_DARK_OAK_FENCE = 191, + E_BLOCK_ACACIA_FENCE = 192, + E_BLOCK_SPRUCE_DOOR = 193, + E_BLOCK_BIRCH_DOOR = 194, + E_BLOCK_JUNGLE_DOOR = 195, + E_BLOCK_ACACIA_DOOR = 196, + E_BLOCK_DARK_OAK_DOOR = 197, // Keep these two as the last values, without a number - they will get their correct number assigned automagically by C++ // IsValidBlock() depends on this @@ -356,12 +383,28 @@ enum ENUM_ITEM_ID E_ITEM_NETHER_QUARTZ = 406, E_ITEM_MINECART_WITH_TNT = 407, E_ITEM_MINECART_WITH_HOPPER = 408, + E_ITEM_PRISMARINE_SHARD = 409, + E_ITEM_PRISMARINE_CRYSTALS = 410, + E_ITEM_RAW_RABBIT = 411, + E_ITEM_COOKED_RABBIT = 412, + E_ITEM_RABBIT_STEW = 413, + E_ITEM_RABBITS_FOOT = 414, + E_ITEM_RABBIT_HIDE = 415, + E_ITEM_ARMOR_STAND = 416, E_ITEM_IRON_HORSE_ARMOR = 417, E_ITEM_GOLD_HORSE_ARMOR = 418, E_ITEM_DIAMOND_HORSE_ARMOR = 419, E_ITEM_LEAD = 420, E_ITEM_NAME_TAG = 421, E_ITEM_MINECART_WITH_COMMAND_BLOCK = 422, + E_ITEM_RAW_MUTTON = 423, + E_ITEM_COOKED_MUTTON = 424, + E_ITEM_BANNER = 425, + E_ITEM_SPRUCE_DOOR = 427, + E_ITEM_BIRCH_DOOR = 428, + E_ITEM_JUNGLE_DOOR = 429, + E_ITEM_ACACIA_DOOR = 430, + E_ITEM_DARK_OAK_DOOR = 431, // Keep these two as the last values of the consecutive list, without a number - they will get their correct number assigned automagically by C++ // IsValidItem() depends on this! @@ -417,7 +460,7 @@ enum E_BLOCK_BED_OCCUPIED = 4, E_BLOCK_BED_BED_HEAD = 8, - // E_BLOCK_BIG_FLOWER metas + // E_BLOCK_BIG_FLOWER metas: E_META_BIG_FLOWER_SUNFLOWER = 0, E_META_BIG_FLOWER_LILAC = 1, E_META_BIG_FLOWER_DOUBLE_TALL_GRASS = 2, @@ -466,6 +509,7 @@ enum // E_BLOCK_DIRT metas: E_META_DIRT_NORMAL = 0, E_META_DIRT_GRASSLESS = 1, + E_META_DIRT_COARSE = 1, E_META_DIRT_PODZOL = 2, // E_BLOCK_DISPENSER / E_BLOCK_DROPPER metas: @@ -489,7 +533,7 @@ enum E_META_DOUBLE_STONE_SLAB_SMOOTH_SANDSTONE = 9, E_META_DOUBLE_STONE_SLAB_TILE_QUARTZ = 10, - // E_BLOCK_FLOWER metas + // E_BLOCK_FLOWER metas: E_META_FLOWER_POPPY = 0, E_META_FLOWER_BLUE_ORCHID = 1, E_META_FLOWER_ALLIUM = 2, @@ -499,7 +543,7 @@ enum E_META_FLOWER_PINK_TULIP = 7, E_META_FLOWER_OXEYE_DAISY = 8, - // E_BLOCK_JUKEBOX metas + // E_BLOCK_JUKEBOX metas: E_META_JUKEBOX_OFF = 0, E_META_JUKEBOX_ON = 1, @@ -539,11 +583,11 @@ enum E_META_LOG_BIRCH = 2, E_META_LOG_JUNGLE = 3, - // E_BLOCK_NEW_LEAVES metas + // E_BLOCK_NEW_LEAVES metas: E_META_NEW_LEAVES_ACACIA_WOOD = 0, E_META_NEW_LEAVES_DARK_OAK_WOOD = 1, - // E_BLOCK_NEW_LOG metas + // E_BLOCK_NEW_LOG metas: E_META_NEW_LOG_ACACIA_WOOD = 0, E_META_NEW_LOG_DARK_OAK_WOOD = 1, @@ -569,6 +613,11 @@ enum E_META_PRESSURE_PLATE_RAISED = 0, E_META_PRESSURE_PLATE_DEPRESSED = 1, + // E_BLOCK_PRISMARINE_BLOCK metas: + E_META_PRISMARINE_BLOCK_ROUGH = 0, + E_META_PRISMARINE_BLOCK_BRICKS = 1, + E_META_PRISMARINE_BLOCK_DARK = 2, + // E_BLOCK_QUARTZ_BLOCK metas: E_META_QUARTZ_NORMAL = 0, E_META_QUARTZ_CHISELLED = 1, @@ -586,6 +635,11 @@ enum E_META_RAIL_CURVED_ZM_XM = 8, E_META_RAIL_CURVED_ZM_XP = 9, + // E_BLOCK_RED_SANDSTONE metas: + E_META_RED_SANDSTONE_NORMAL = 0, + E_META_RED_SANDSTONE_ORNAMENT = 1, + E_META_RED_SANDSTONE_SMOOTH = 2, + // E_BLOCK_SAND metas: E_META_SAND_NORMAL = 0, E_META_SAND_RED = 1, @@ -618,7 +672,7 @@ enum E_META_SNOW_LAYER_SEVEN = 6, E_META_SNOW_LAYER_EIGHT = 7, - // E_BLOCK_STAINED_CLAY metas + // E_BLOCK_STAINED_CLAY metas: E_META_STAINED_CLAY_WHITE = 0, E_META_STAINED_CLAY_ORANGE = 1, E_META_STAINED_CLAY_MAGENTA = 2, @@ -636,7 +690,7 @@ enum E_META_STAINED_CLAY_RED = 14, E_META_STAINED_CLAY_BLACK = 15, - // E_BLOCK_STAINED_GLASS metas + // E_BLOCK_STAINED_GLASS metas: E_META_STAINED_GLASS_WHITE = 0, E_META_STAINED_GLASS_ORANGE = 1, E_META_STAINED_GLASS_MAGENTA = 2, @@ -654,7 +708,7 @@ enum E_META_STAINED_GLASS_RED = 14, E_META_STAINED_GLASS_BLACK = 15, - // E_BLOCK_STAINED_GLASS_PANE metas + // E_BLOCK_STAINED_GLASS_PANE metas: E_META_STAINED_GLASS_PANE_WHITE = 0, E_META_STAINED_GLASS_PANE_ORANGE = 1, E_META_STAINED_GLASS_PANE_MAGENTA = 2, @@ -787,6 +841,24 @@ enum //////////////////////////////////////////////////////////////////////////////// // Item metas: + // E_ITEM_BANNER metas: + E_META_BANNER_BLACK = 0, + E_META_BANNER_RED = 1, + E_META_BANNER_GREEN = 2, + E_META_BANNER_BROWN = 3, + E_META_BANNER_BLUE = 4, + E_META_BANNER_PURPLE = 5, + E_META_BANNER_CYAN = 6, + E_META_BANNER_LIGHTGRAY = 7, + E_META_BANNER_GRAY = 8, + E_META_BANNER_PINK = 9, + E_META_BANNER_LIGHTGREEN = 10, + E_META_BANNER_YELLOW = 11, + E_META_BANNER_LIGHTBLUE = 12, + E_META_BANNER_MAGENTA = 13, + E_META_BANNER_ORANGE = 14, + E_META_BANNER_WHITE = 15, + // E_ITEM_COAL metas: E_META_COAL_NORMAL = 0, E_META_COAL_CHARCOAL = 1, @@ -813,6 +885,13 @@ enum E_META_GOLDEN_APPLE_NORMAL = 0, E_META_GOLDEN_APPLE_ENCHANTED = 1, + // E_ITEM_HEAD metas: + E_META_HEAD_SKELETON = 0, + E_META_HEAD_WITHER = 1, + E_META_HEAD_ZOMBIE = 2, + E_META_HEAD_PLAYER = 3, + E_META_HEAD_CREEPER = 4, + // E_ITEM_RAW_FISH metas: E_META_RAW_FISH_FISH = 0, E_META_RAW_FISH_SALMON = 1, @@ -822,8 +901,6 @@ enum // E_ITEM_COOKED_FISH metas: E_META_COOKED_FISH_FISH = 0, E_META_COOKED_FISH_SALMON = 1, - E_META_COOKED_FISH_CLOWNFISH = 2, - E_META_COOKED_FISH_PUFFERFISH = 3, // E_ITEM_MINECART_TRACKS metas: E_META_TRACKS_X = 1, @@ -1023,9 +1100,6 @@ extern AString ItemTypeToString(short a_ItemType); /// Translates a full item into a fully-specified string (including meta and count). If the ItemType is not recognized, the ItemType number is output into the string. extern AString ItemToFullString(const cItem & a_Item); -/// Translates a mob string ("ocelot") to mobtype (E_ENTITY_TYPE_OCELOT) -extern int StringToMobType(const AString & a_MobString); - /// Translates a dimension string to dimension enum. Takes either a number or a dimension alias (built-in). Returns dimOverworld on failure extern eDimension StringToDimension(const AString & a_DimensionString); diff --git a/src/BlockInfo.cpp b/src/BlockInfo.cpp index 602deb26d..bdd3a9c26 100644 --- a/src/BlockInfo.cpp +++ b/src/BlockInfo.cpp @@ -6,24 +6,6 @@ - - -cBlockInfo::cBlockInfo() - : m_LightValue(0x00) - , m_SpreadLightFalloff(0x0f) - , m_Transparent(false) - , m_OneHitDig(false) - , m_PistonBreakable(false) - , m_IsSnowable(false) - , m_IsSolid(true) - , m_FullyOccupiesVoxel(false) - , m_Handler(NULL) -{} - - - - - cBlockInfo::~cBlockInfo() { delete m_Handler; @@ -31,28 +13,6 @@ cBlockInfo::~cBlockInfo() } - - - -/** This accessor makes sure that the cBlockInfo structures are properly initialized exactly once. -It does so by using the C++ singleton approximation - storing the actual singleton as the function's static variable. -It works only if it is called for the first time before the app spawns other threads. */ -cBlockInfo & cBlockInfo::Get(BLOCKTYPE a_Type) -{ - static cBlockInfo ms_Info[256]; - static bool IsBlockInfoInitialized = false; - if (!IsBlockInfoInitialized) - { - cBlockInfo::Initialize(ms_Info); - IsBlockInfoInitialized = true; - } - return ms_Info[a_Type]; -} - - - - - void cBlockInfo::Initialize(cBlockInfoArray & a_Info) { for (unsigned int i = 0; i < 256; ++i) @@ -82,18 +42,26 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_LightValue = 9; a_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_LightValue = 9; a_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_LightValue = 7; + a_Info[E_BLOCK_SEA_LANTERN ].m_LightValue = 15; a_Info[E_BLOCK_STATIONARY_LAVA ].m_LightValue = 15; a_Info[E_BLOCK_TORCH ].m_LightValue = 14; // Spread blocks + a_Info[E_BLOCK_ACACIA_DOOR ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_ACACIA_FENCE ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_ACACIA_FENCE_GATE ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_ACTIVATOR_RAIL ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_AIR ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_ANVIL ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_BARRIER ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_BEACON ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_BED ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_BIG_FLOWER ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_BIRCH_DOOR ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_BIRCH_FENCE ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_BIRCH_FENCE_GATE ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_BROWN_MUSHROOM ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_BREWING_STAND ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_CACTUS ].m_SpreadLightFalloff = 1; @@ -107,6 +75,9 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_COBWEB ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_CROPS ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_DANDELION ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_DARK_OAK_DOOR ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_DARK_OAK_FENCE ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_DARK_OAK_FENCE_GATE ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_DAYLIGHT_SENSOR ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_DEAD_BUSH ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_DETECTOR_RAIL ].m_SpreadLightFalloff = 1; @@ -128,8 +99,13 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_HOPPER ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_ICE ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_INVERTED_DAYLIGHT_SENSOR ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_IRON_BARS ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_IRON_DOOR ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_IRON_TRAPDOOR ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_JUNGLE_DOOR ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_JUNGLE_FENCE ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_JUNGLE_FENCE_GATE ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_LADDER ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_LEAVES ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_LEVER ].m_SpreadLightFalloff = 1; @@ -140,6 +116,7 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_NETHER_PORTAL ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_NETHER_WART ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_NEW_LEAVES ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_NEW_STONE_SLAB ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_PISTON ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_PISTON_EXTENSION ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_PISTON_MOVED_BLOCK ].m_SpreadLightFalloff = 1; @@ -156,8 +133,12 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_SAPLING ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_SIGN_POST ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_SNOW ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_SPRUCE_DOOR ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_SPRUCE_FENCE ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_SPRUCE_FENCE_GATE ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_STAINED_GLASS ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_STAINED_GLASS_PANE ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_STANDING_BANNER ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_STICKY_PISTON ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_STONE_BUTTON ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_SpreadLightFalloff = 1; @@ -170,6 +151,7 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_TRIPWIRE ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_TRIPWIRE_HOOK ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_VINES ].m_SpreadLightFalloff = 1; + a_Info[E_BLOCK_WALL_BANNER ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_WALLSIGN ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_WOODEN_BUTTON ].m_SpreadLightFalloff = 1; a_Info[E_BLOCK_WOODEN_DOOR ].m_SpreadLightFalloff = 1; @@ -184,13 +166,20 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) // Transparent blocks + a_Info[E_BLOCK_ACACIA_DOOR ].m_Transparent = true; + a_Info[E_BLOCK_ACACIA_FENCE ].m_Transparent = true; + a_Info[E_BLOCK_ACACIA_FENCE_GATE ].m_Transparent = true; a_Info[E_BLOCK_ACTIVATOR_RAIL ].m_Transparent = true; a_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_Transparent = true; a_Info[E_BLOCK_AIR ].m_Transparent = true; a_Info[E_BLOCK_ANVIL ].m_Transparent = true; + a_Info[E_BLOCK_BARRIER ].m_Transparent = true; a_Info[E_BLOCK_BEACON ].m_Transparent = true; a_Info[E_BLOCK_BED ].m_Transparent = true; a_Info[E_BLOCK_BIG_FLOWER ].m_Transparent = true; + a_Info[E_BLOCK_BIRCH_DOOR ].m_Transparent = true; + a_Info[E_BLOCK_BIRCH_FENCE ].m_Transparent = true; + a_Info[E_BLOCK_BIRCH_FENCE_GATE ].m_Transparent = true; a_Info[E_BLOCK_BROWN_MUSHROOM ].m_Transparent = true; a_Info[E_BLOCK_BREWING_STAND ].m_Transparent = true; a_Info[E_BLOCK_CACTUS ].m_Transparent = true; @@ -204,6 +193,9 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_COBWEB ].m_Transparent = true; a_Info[E_BLOCK_CROPS ].m_Transparent = true; a_Info[E_BLOCK_DANDELION ].m_Transparent = true; + a_Info[E_BLOCK_DARK_OAK_DOOR ].m_Transparent = true; + a_Info[E_BLOCK_DARK_OAK_FENCE ].m_Transparent = true; + a_Info[E_BLOCK_DARK_OAK_FENCE_GATE ].m_Transparent = true; a_Info[E_BLOCK_DAYLIGHT_SENSOR ].m_Transparent = true; a_Info[E_BLOCK_DEAD_BUSH ].m_Transparent = true; a_Info[E_BLOCK_DETECTOR_RAIL ].m_Transparent = true; @@ -227,6 +219,10 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_Transparent = true; a_Info[E_BLOCK_IRON_BARS ].m_Transparent = true; a_Info[E_BLOCK_IRON_DOOR ].m_Transparent = true; + a_Info[E_BLOCK_IRON_TRAPDOOR ].m_Transparent = true; + a_Info[E_BLOCK_JUNGLE_DOOR ].m_Transparent = true; + a_Info[E_BLOCK_JUNGLE_FENCE ].m_Transparent = true; + a_Info[E_BLOCK_JUNGLE_FENCE_GATE ].m_Transparent = true; a_Info[E_BLOCK_LADDER ].m_Transparent = true; a_Info[E_BLOCK_LAVA ].m_Transparent = true; a_Info[E_BLOCK_LEAVES ].m_Transparent = true; @@ -239,6 +235,7 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_NETHER_PORTAL ].m_Transparent = true; a_Info[E_BLOCK_NETHER_WART ].m_Transparent = true; a_Info[E_BLOCK_NEW_LEAVES ].m_Transparent = true; + a_Info[E_BLOCK_NEW_STONE_SLAB ].m_Transparent = true; a_Info[E_BLOCK_PISTON ].m_Transparent = true; a_Info[E_BLOCK_PISTON_EXTENSION ].m_Transparent = true; a_Info[E_BLOCK_PISTON_MOVED_BLOCK ].m_Transparent = true; @@ -255,10 +252,14 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_SAPLING ].m_Transparent = true; a_Info[E_BLOCK_SIGN_POST ].m_Transparent = true; a_Info[E_BLOCK_SNOW ].m_Transparent = true; + a_Info[E_BLOCK_SPRUCE_DOOR ].m_Transparent = true; + a_Info[E_BLOCK_SPRUCE_FENCE ].m_Transparent = true; + a_Info[E_BLOCK_SPRUCE_FENCE_GATE ].m_Transparent = true; a_Info[E_BLOCK_STAINED_GLASS ].m_Transparent = true; a_Info[E_BLOCK_STAINED_GLASS_PANE ].m_Transparent = true; a_Info[E_BLOCK_STATIONARY_LAVA ].m_Transparent = true; a_Info[E_BLOCK_STATIONARY_WATER ].m_Transparent = true; + a_Info[E_BLOCK_STANDING_BANNER ].m_Transparent = true; a_Info[E_BLOCK_STICKY_PISTON ].m_Transparent = true; a_Info[E_BLOCK_STONE_BUTTON ].m_Transparent = true; a_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_Transparent = true; @@ -271,6 +272,7 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_TRIPWIRE ].m_Transparent = true; a_Info[E_BLOCK_TRIPWIRE_HOOK ].m_Transparent = true; a_Info[E_BLOCK_VINES ].m_Transparent = true; + a_Info[E_BLOCK_WALL_BANNER ].m_Transparent = true; a_Info[E_BLOCK_WALLSIGN ].m_Transparent = true; a_Info[E_BLOCK_WATER ].m_Transparent = true; a_Info[E_BLOCK_WOODEN_BUTTON ].m_Transparent = true; @@ -293,6 +295,7 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_OneHitDig = true; a_Info[E_BLOCK_LILY_PAD ].m_OneHitDig = true; a_Info[E_BLOCK_MELON_STEM ].m_OneHitDig = true; + a_Info[E_BLOCK_NETHER_WART ].m_OneHitDig = true; a_Info[E_BLOCK_POTATOES ].m_OneHitDig = true; a_Info[E_BLOCK_PUMPKIN_STEM ].m_OneHitDig = true; a_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_OneHitDig = true; @@ -331,6 +334,7 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_PistonBreakable = true; a_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_PistonBreakable = true; a_Info[E_BLOCK_IRON_DOOR ].m_PistonBreakable = true; + a_Info[E_BLOCK_IRON_TRAPDOOR ].m_PistonBreakable = true; a_Info[E_BLOCK_JACK_O_LANTERN ].m_PistonBreakable = true; a_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_PistonBreakable = true; a_Info[E_BLOCK_LILY_PAD ].m_PistonBreakable = true; @@ -385,6 +389,7 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_DIAMOND_ORE ].m_IsSnowable = true; a_Info[E_BLOCK_DIRT ].m_IsSnowable = true; a_Info[E_BLOCK_DISPENSER ].m_IsSnowable = true; + a_Info[E_BLOCK_DOUBLE_NEW_STONE_SLAB].m_IsSnowable = true; a_Info[E_BLOCK_DOUBLE_STONE_SLAB ].m_IsSnowable = true; a_Info[E_BLOCK_DOUBLE_WOODEN_SLAB ].m_IsSnowable = true; a_Info[E_BLOCK_DROPPER ].m_IsSnowable = true; @@ -421,14 +426,17 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_NOTE_BLOCK ].m_IsSnowable = true; a_Info[E_BLOCK_OBSIDIAN ].m_IsSnowable = true; a_Info[E_BLOCK_PLANKS ].m_IsSnowable = true; + a_Info[E_BLOCK_PRISMARINE_BLOCK ].m_IsSnowable = true; a_Info[E_BLOCK_PUMPKIN ].m_IsSnowable = true; a_Info[E_BLOCK_QUARTZ_BLOCK ].m_IsSnowable = true; + a_Info[E_BLOCK_RED_SANDSTONE ].m_IsSnowable = true; a_Info[E_BLOCK_REDSTONE_LAMP_OFF ].m_IsSnowable = true; a_Info[E_BLOCK_REDSTONE_LAMP_ON ].m_IsSnowable = true; a_Info[E_BLOCK_REDSTONE_ORE ].m_IsSnowable = true; a_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_IsSnowable = true; a_Info[E_BLOCK_SAND ].m_IsSnowable = true; a_Info[E_BLOCK_SANDSTONE ].m_IsSnowable = true; + a_Info[E_BLOCK_SEA_LANTERN ].m_IsSnowable = true; a_Info[E_BLOCK_SILVERFISH_EGG ].m_IsSnowable = true; a_Info[E_BLOCK_SNOW_BLOCK ].m_IsSnowable = true; a_Info[E_BLOCK_SOULSAND ].m_IsSnowable = true; @@ -472,12 +480,14 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_SNOW ].m_IsSolid = false; a_Info[E_BLOCK_STATIONARY_LAVA ].m_IsSolid = false; a_Info[E_BLOCK_STATIONARY_WATER ].m_IsSolid = false; + a_Info[E_BLOCK_STANDING_BANNER ].m_IsSolid = false; a_Info[E_BLOCK_STONE_BUTTON ].m_IsSolid = false; a_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_IsSolid = false; a_Info[E_BLOCK_TALL_GRASS ].m_IsSolid = false; a_Info[E_BLOCK_TORCH ].m_IsSolid = false; a_Info[E_BLOCK_TRIPWIRE ].m_IsSolid = false; a_Info[E_BLOCK_VINES ].m_IsSolid = false; + a_Info[E_BLOCK_WALL_BANNER ].m_IsSolid = false; a_Info[E_BLOCK_WALLSIGN ].m_IsSolid = false; a_Info[E_BLOCK_WATER ].m_IsSolid = false; a_Info[E_BLOCK_WOODEN_BUTTON ].m_IsSolid = false; @@ -485,7 +495,7 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) // Blocks that fully occupy their voxel - used as a guide for torch placeable blocks, amongst other things: - a_Info[E_BLOCK_NEW_LOG ].m_FullyOccupiesVoxel = true; + a_Info[E_BLOCK_BARRIER ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_BEDROCK ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_BLOCK_OF_COAL ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_BLOCK_OF_REDSTONE ].m_FullyOccupiesVoxel = true; @@ -525,17 +535,21 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_LAPIS_ORE ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_LOG ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_MELON ].m_FullyOccupiesVoxel = true; + a_Info[E_BLOCK_MOB_SPAWNER ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_MOSSY_COBBLESTONE ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_MYCELIUM ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_NETHERRACK ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_NETHER_BRICK ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_NETHER_QUARTZ_ORE ].m_FullyOccupiesVoxel = true; + a_Info[E_BLOCK_NEW_LOG ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_NOTE_BLOCK ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_OBSIDIAN ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_PACKED_ICE ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_PLANKS ].m_FullyOccupiesVoxel = true; + a_Info[E_BLOCK_PRISMARINE_BLOCK ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_PUMPKIN ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_QUARTZ_BLOCK ].m_FullyOccupiesVoxel = true; + a_Info[E_BLOCK_RED_SANDSTONE ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_REDSTONE_LAMP_OFF ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_REDSTONE_LAMP_ON ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_REDSTONE_ORE ].m_FullyOccupiesVoxel = true; @@ -548,6 +562,218 @@ void cBlockInfo::Initialize(cBlockInfoArray & a_Info) a_Info[E_BLOCK_STONE ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_STONE_BRICKS ].m_FullyOccupiesVoxel = true; a_Info[E_BLOCK_WOOL ].m_FullyOccupiesVoxel = true; + + + // Blocks that can be terraformed + a_Info[E_BLOCK_COAL_ORE ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_COBBLESTONE ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_DIAMOND_ORE ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_DIRT ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_GOLD_ORE ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_GRASS ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_GRAVEL ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_HARDENED_CLAY ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_IRON_ORE ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_MYCELIUM ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_NETHERRACK ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_REDSTONE_ORE ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_CanBeTerraformed = true; + a_Info[E_BLOCK_SAND ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_SANDSTONE ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_SOULSAND ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_STAINED_CLAY ].m_CanBeTerraformed = true; + a_Info[E_BLOCK_STONE ].m_CanBeTerraformed = true; + + + // Block place sounds: + a_Info[E_BLOCK_STONE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_GRASS ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_DIRT ].m_PlaceSound = "dig.gravel"; + a_Info[E_BLOCK_COBBLESTONE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_PLANKS ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_SAPLING ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_BEDROCK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_SAND ].m_PlaceSound = "dig.sand"; + a_Info[E_BLOCK_GRAVEL ].m_PlaceSound = "dig.gravel"; + a_Info[E_BLOCK_GOLD_ORE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_IRON_ORE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_COAL_ORE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_LOG ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_LEAVES ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_SPONGE ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_GLASS ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_LAPIS_ORE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_LAPIS_BLOCK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_DISPENSER ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_SANDSTONE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_NOTE_BLOCK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_POWERED_RAIL ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_DETECTOR_RAIL ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_STICKY_PISTON ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_COBWEB ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_TALL_GRASS ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_DEAD_BUSH ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_PISTON ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_PISTON_EXTENSION ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_WOOL ].m_PlaceSound = "dig.cloth"; + a_Info[E_BLOCK_PISTON_MOVED_BLOCK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_DANDELION ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_FLOWER ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_BROWN_MUSHROOM ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_RED_MUSHROOM ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_GOLD_BLOCK ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_IRON_BLOCK ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_DOUBLE_STONE_SLAB ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_STONE_SLAB ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_BRICK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_TNT ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_BOOKCASE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_MOSSY_COBBLESTONE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_OBSIDIAN ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_TORCH ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_FIRE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_MOB_SPAWNER ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_WOODEN_STAIRS ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_CHEST ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_REDSTONE_WIRE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_DIAMOND_ORE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_DIAMOND_BLOCK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_CRAFTING_TABLE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_FARMLAND ].m_PlaceSound = "dig.gravel"; + a_Info[E_BLOCK_FURNACE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_LIT_FURNACE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_SIGN_POST ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_WOODEN_DOOR ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_LADDER ].m_PlaceSound = "dig.ladder"; + a_Info[E_BLOCK_RAIL ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_COBBLESTONE_STAIRS ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_WALLSIGN ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_LEVER ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_STONE_PRESSURE_PLATE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_IRON_DOOR ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_WOODEN_PRESSURE_PLATE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_REDSTONE_ORE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_REDSTONE_ORE_GLOWING ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_STONE_BUTTON ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_SNOW ].m_PlaceSound = "dig.snow"; + a_Info[E_BLOCK_ICE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_SNOW_BLOCK ].m_PlaceSound = "dig.snow"; + a_Info[E_BLOCK_CACTUS ].m_PlaceSound = "dig.cloth"; + a_Info[E_BLOCK_CLAY ].m_PlaceSound = "dig.gravel"; + a_Info[E_BLOCK_SUGARCANE ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_JUKEBOX ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_FENCE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_PUMPKIN ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_NETHERRACK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_SOULSAND ].m_PlaceSound = "dig.sand"; + a_Info[E_BLOCK_GLOWSTONE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_NETHER_PORTAL ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_JACK_O_LANTERN ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_CAKE ].m_PlaceSound = "dig.snow"; + a_Info[E_BLOCK_REDSTONE_REPEATER_OFF ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_REDSTONE_REPEATER_ON ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_STAINED_GLASS ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_TRAPDOOR ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_SILVERFISH_EGG ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_STONE_BRICKS ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_HUGE_BROWN_MUSHROOM ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_HUGE_RED_MUSHROOM ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_IRON_BARS ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_GLASS_PANE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_MELON ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_PUMPKIN_STEM ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_MELON_STEM ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_VINES ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_FENCE_GATE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_BRICK_STAIRS ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_STONE_BRICK_STAIRS ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_MYCELIUM ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_LILY_PAD ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_NETHER_BRICK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_NETHER_BRICK_FENCE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_NETHER_BRICK_STAIRS ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_NETHER_WART ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_ENCHANTMENT_TABLE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_BREWING_STAND ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_CAULDRON ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_END_PORTAL ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_END_PORTAL_FRAME ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_END_STONE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_DRAGON_EGG ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_REDSTONE_LAMP_OFF ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_REDSTONE_LAMP_ON ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_DOUBLE_WOODEN_SLAB ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_WOODEN_SLAB ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_COCOA_POD ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_SANDSTONE_STAIRS ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_EMERALD_ORE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_ENDER_CHEST ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_TRIPWIRE_HOOK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_TRIPWIRE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_EMERALD_BLOCK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_SPRUCE_WOOD_STAIRS ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_BIRCH_WOOD_STAIRS ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_JUNGLE_WOOD_STAIRS ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_COMMAND_BLOCK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_BEACON ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_COBBLESTONE_WALL ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_FLOWER_POT ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_CARROTS ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_POTATOES ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_HEAD ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_ANVIL ].m_PlaceSound = "random.anvil_land"; + a_Info[E_BLOCK_TRAPPED_CHEST ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_DAYLIGHT_SENSOR ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_BLOCK_OF_REDSTONE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_NETHER_QUARTZ_ORE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_HOPPER ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_QUARTZ_BLOCK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_QUARTZ_STAIRS ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_ACTIVATOR_RAIL ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_DROPPER ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_STAINED_CLAY ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_STAINED_GLASS_PANE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_NEW_LEAVES ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_NEW_LOG ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_ACACIA_WOOD_STAIRS ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_DARK_OAK_WOOD_STAIRS ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_SLIME_BLOCK ].m_PlaceSound = "mob.slime.big"; + a_Info[E_BLOCK_BARRIER ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_IRON_TRAPDOOR ].m_PlaceSound = "dig.metal"; + a_Info[E_BLOCK_PRISMARINE_BLOCK ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_SEA_LANTERN ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_HAY_BALE ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_CARPET ].m_PlaceSound = "dig.cloth"; + a_Info[E_BLOCK_HARDENED_CLAY ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_BLOCK_OF_COAL ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_PACKED_ICE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_BIG_FLOWER ].m_PlaceSound = "dig.grass"; + a_Info[E_BLOCK_STANDING_BANNER ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_WALL_BANNER ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_RED_SANDSTONE ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_RED_SANDSTONE_STAIRS ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_NEW_STONE_SLAB ].m_PlaceSound = "dig.stone"; + a_Info[E_BLOCK_SPRUCE_FENCE_GATE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_BIRCH_FENCE_GATE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_JUNGLE_FENCE_GATE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_DARK_OAK_FENCE_GATE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_ACACIA_FENCE_GATE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_SPRUCE_FENCE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_BIRCH_FENCE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_JUNGLE_FENCE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_DARK_OAK_FENCE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_ACACIA_FENCE ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_SPRUCE_DOOR ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_BIRCH_DOOR ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_JUNGLE_DOOR ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_ACACIA_DOOR ].m_PlaceSound = "dig.wood"; + a_Info[E_BLOCK_DARK_OAK_DOOR ].m_PlaceSound = "dig.wood"; } diff --git a/src/BlockInfo.h b/src/BlockInfo.h index e6ce566c5..1e4cf2ca0 100644 --- a/src/BlockInfo.h +++ b/src/BlockInfo.h @@ -11,14 +11,27 @@ class cBlockHandler; - // tolua_begin class cBlockInfo { public: /** Returns the associated BlockInfo structure for the specified block type. */ - static cBlockInfo & Get(BLOCKTYPE a_Type); + + /** This accessor makes sure that the cBlockInfo structures are properly initialized exactly once. + It does so by using the C++ singleton approximation - storing the actual singleton as the function's static variable. + It works only if it is called for the first time before the app spawns other threads. */ + static cBlockInfo & Get(BLOCKTYPE a_Type) + { + static cBlockInfo ms_Info[256]; + static bool IsBlockInfoInitialized = false; + if (!IsBlockInfoInitialized) + { + cBlockInfo::Initialize(ms_Info); + IsBlockInfoInitialized = true; + } + return ms_Info[a_Type]; + } /** How much light do the blocks emit on their own? */ @@ -45,6 +58,12 @@ public: /** Does this block fully occupy its voxel - is it a 'full' block? */ bool m_FullyOccupiesVoxel; + /** Can a finisher change it? */ + bool m_CanBeTerraformed; + + /** Sound when placing this block */ + AString m_PlaceSound; + // tolua_end /** Associated block handler. */ @@ -60,6 +79,8 @@ public: inline static bool IsSnowable (BLOCKTYPE a_Type) { return Get(a_Type).m_IsSnowable; } inline static bool IsSolid (BLOCKTYPE a_Type) { return Get(a_Type).m_IsSolid; } inline static bool FullyOccupiesVoxel (BLOCKTYPE a_Type) { return Get(a_Type).m_FullyOccupiesVoxel; } + inline static bool CanBeTerraformed (BLOCKTYPE a_Type) { return Get(a_Type).m_CanBeTerraformed; } + inline static AString GetPlaceSound (BLOCKTYPE a_Type) { return Get(a_Type).m_PlaceSound; } // tolua_end @@ -70,7 +91,19 @@ protected: typedef cBlockInfo cBlockInfoArray[256]; /** Creates a default BlockInfo structure, initializes all values to their defaults */ - cBlockInfo(); + cBlockInfo() + : m_LightValue(0x00) + , m_SpreadLightFalloff(0x0f) + , m_Transparent(false) + , m_OneHitDig(false) + , m_PistonBreakable(false) + , m_IsSnowable(false) + , m_IsSolid(true) + , m_FullyOccupiesVoxel(false) + , m_CanBeTerraformed(false) + , m_PlaceSound("") + , m_Handler(NULL) + {} /** Cleans up the stored values */ ~cBlockInfo(); diff --git a/src/Blocks/BlockAnvil.h b/src/Blocks/BlockAnvil.h index 5c4661c11..20514580e 100644 --- a/src/Blocks/BlockAnvil.h +++ b/src/Blocks/BlockAnvil.h @@ -40,14 +40,15 @@ public: ) override { a_BlockType = m_BlockType; - NIBBLETYPE HighBits = a_BlockMeta & 0x0c; // Only highest two bits are preserved + NIBBLETYPE Meta = (NIBBLETYPE)a_Player->GetEquippedItem().m_ItemDamage; int Direction = (int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 1.5) & 0x3; + switch (Direction) { - case 0: a_BlockMeta = 0x2 | HighBits; break; - case 1: a_BlockMeta = 0x3 | HighBits; break; - case 2: a_BlockMeta = 0x0 | HighBits; break; - case 3: a_BlockMeta = 0x1 | HighBits; break; + case 0: a_BlockMeta = 0x2 | Meta << 2; break; + case 1: a_BlockMeta = 0x3 | Meta << 2; break; + case 2: a_BlockMeta = 0x0 | Meta << 2; break; + case 3: a_BlockMeta = 0x1 | Meta << 2; break; default: { return false; diff --git a/src/Blocks/BlockBed.cpp b/src/Blocks/BlockBed.cpp index cd5783f58..3b6328b38 100644 --- a/src/Blocks/BlockBed.cpp +++ b/src/Blocks/BlockBed.cpp @@ -4,6 +4,15 @@ +#include "BroadcastInterface.h" +#include "ChunkInterface.h" +#include "Entities/../World.h" +#include "Entities/Player.h" +#include "WorldInterface.h" + + + + void cBlockBedHandler::OnPlacedByPlayer( cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, @@ -15,7 +24,7 @@ void cBlockBedHandler::OnPlacedByPlayer( if (a_BlockMeta < 8) { Vector3i Direction = MetaDataToDirection(a_BlockMeta); - a_ChunkInterface.SetBlock(a_WorldInterface, a_BlockX + Direction.x, a_BlockY, a_BlockZ + Direction.z, E_BLOCK_BED, a_BlockMeta | 0x8); + a_ChunkInterface.SetBlock(a_BlockX + Direction.x, a_BlockY, a_BlockZ + Direction.z, E_BLOCK_BED, a_BlockMeta | 0x8); } } diff --git a/src/Blocks/BlockBed.h b/src/Blocks/BlockBed.h index bf9d9c01d..9fd45644b 100644 --- a/src/Blocks/BlockBed.h +++ b/src/Blocks/BlockBed.h @@ -2,12 +2,14 @@ #pragma once #include "BlockHandler.h" -#include "ChunkInterface.h" -#include "WorldInterface.h" #include "MetaRotator.h" -#include "../Entities/Player.h" +#include "Item.h" +class cChunkInterface; +class cPlayer; +class cWorldInterface; + diff --git a/src/Blocks/BlockBigFlower.h b/src/Blocks/BlockBigFlower.h index 0b6ac9d8a..3577bdd40 100644 --- a/src/Blocks/BlockBigFlower.h +++ b/src/Blocks/BlockBigFlower.h @@ -2,7 +2,7 @@ #pragma once #include "BlockHandler.h" - +#include "ChunkInterface.h" @@ -19,16 +19,16 @@ public: } - virtual void DropBlock(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_BlockPluginInterface, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, bool a_CanDrop, bool a_DropVerbatim) override + virtual void DropBlock(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_BlockPluginInterface, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, bool a_CanDrop) override { NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); if (Meta & 0x8) { - super::DropBlock(a_ChunkInterface, a_WorldInterface, a_BlockPluginInterface, a_Digger, a_BlockX, a_BlockY - 1, a_BlockZ, a_CanDrop, a_DropVerbatim); + super::DropBlock(a_ChunkInterface, a_WorldInterface, a_BlockPluginInterface, a_Digger, a_BlockX, a_BlockY - 1, a_BlockZ, a_CanDrop); } else { - super::DropBlock(a_ChunkInterface, a_WorldInterface, a_BlockPluginInterface, a_Digger, a_BlockX, a_BlockY, a_BlockZ, a_CanDrop, a_DropVerbatim); + super::DropBlock(a_ChunkInterface, a_WorldInterface, a_BlockPluginInterface, a_Digger, a_BlockX, a_BlockY, a_BlockZ, a_CanDrop); } } @@ -37,7 +37,7 @@ public: { NIBBLETYPE Meta = a_BlockMeta & 0x7; - if ((Meta == 2) || (Meta == 3)) + if ((Meta == E_META_BIG_FLOWER_DOUBLE_TALL_GRASS) || (Meta == E_META_BIG_FLOWER_LARGE_FERN)) { return; } @@ -63,11 +63,11 @@ public: if (r1.randInt(10) == 5) { cItems Pickups; - if (FlowerMeta == 2) + if (FlowerMeta == E_META_BIG_FLOWER_DOUBLE_TALL_GRASS) { Pickups.Add(E_BLOCK_TALL_GRASS, 2, 1); } - else if (FlowerMeta == 3) + else if (FlowerMeta == E_META_BIG_FLOWER_LARGE_FERN) { Pickups.Add(E_BLOCK_TALL_GRASS, 2, 2); } @@ -118,12 +118,6 @@ public: } } } - - - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } } ; diff --git a/src/Blocks/BlockButton.h b/src/Blocks/BlockButton.h index 3b45afff8..8e4f04740 100644 --- a/src/Blocks/BlockButton.h +++ b/src/Blocks/BlockButton.h @@ -57,12 +57,6 @@ public: } - virtual const char * GetStepSound(void) override - { - return m_BlockType == E_BLOCK_WOODEN_BUTTON ? "step.wood" : "step.stone"; - } - - inline static NIBBLETYPE BlockFaceToMetaData(eBlockFace a_BlockFace) { switch (a_BlockFace) diff --git a/src/Blocks/BlockCactus.h b/src/Blocks/BlockCactus.h index ed441517d..910966c43 100644 --- a/src/Blocks/BlockCactus.h +++ b/src/Blocks/BlockCactus.h @@ -69,12 +69,6 @@ public: { a_Chunk.GetWorld()->GrowCactus(a_RelX + a_Chunk.GetPosX() * cChunkDef::Width, a_RelY, a_RelZ + a_Chunk.GetPosZ() * cChunkDef::Width, 1); } - - - virtual const char * GetStepSound(void) override - { - return "step.cloth"; - } } ; diff --git a/src/Blocks/BlockCake.h b/src/Blocks/BlockCake.h index 36e133388..3a754ce18 100644 --- a/src/Blocks/BlockCake.h +++ b/src/Blocks/BlockCake.h @@ -19,7 +19,7 @@ public: { NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); - if (!a_Player->Feed(2, 0.1)) + if (!a_Player->Feed(2, 0.4)) { return; } @@ -43,11 +43,6 @@ public: { return true; } - - virtual const char * GetStepSound(void) override - { - return "step.cloth"; - } } ; diff --git a/src/Blocks/BlockCarpet.h b/src/Blocks/BlockCarpet.h index d1aa52687..4b287c664 100644 --- a/src/Blocks/BlockCarpet.h +++ b/src/Blocks/BlockCarpet.h @@ -22,12 +22,6 @@ public: cBlockHandler(a_BlockType) { } - - - virtual const char * GetStepSound(void) override - { - return "step.cloth"; - } virtual bool GetPlacementBlockTypeMeta( diff --git a/src/Blocks/BlockChest.h b/src/Blocks/BlockChest.h index 28adbed4f..201f2309b 100644 --- a/src/Blocks/BlockChest.h +++ b/src/Blocks/BlockChest.h @@ -106,12 +106,6 @@ public: // Single chest, no further processing needed } - - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } - virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override { int BlockX = a_RelX + a_Chunk.GetPosX() * cChunkDef::Width; diff --git a/src/Blocks/BlockCloth.h b/src/Blocks/BlockCloth.h index 3c1ae7c25..525176725 100644 --- a/src/Blocks/BlockCloth.h +++ b/src/Blocks/BlockCloth.h @@ -15,11 +15,6 @@ public: : cBlockHandler(a_BlockType) { } - - virtual const char * GetStepSound(void) override - { - return "step.cloth"; - } } ; diff --git a/src/Blocks/BlockCommandBlock.h b/src/Blocks/BlockCommandBlock.h index cf0103765..b66def201 100644 --- a/src/Blocks/BlockCommandBlock.h +++ b/src/Blocks/BlockCommandBlock.h @@ -20,11 +20,6 @@ public: { a_Pickups.push_back(cItem(E_BLOCK_AIR, 8, 0)); } - - virtual const char * GetStepSound(void) override - { - return "step.stone"; - } } ; diff --git a/src/Blocks/BlockComparator.h b/src/Blocks/BlockComparator.h index 6caaaab13..3443fc69e 100644 --- a/src/Blocks/BlockComparator.h +++ b/src/Blocks/BlockComparator.h @@ -64,12 +64,6 @@ public: a_BlockMeta = cBlockRedstoneRepeaterHandler::RepeaterRotationToMetaData(a_Player->GetYaw()); return true; } - - - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } } ; diff --git a/src/Blocks/BlockCrops.h b/src/Blocks/BlockCrops.h index ae6e490e1..53e996683 100644 --- a/src/Blocks/BlockCrops.h +++ b/src/Blocks/BlockCrops.h @@ -100,12 +100,6 @@ public: { return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) == E_BLOCK_FARMLAND)); } - - - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } } ; diff --git a/src/Blocks/BlockDirt.h b/src/Blocks/BlockDirt.h index 2d4fccbac..19f889372 100644 --- a/src/Blocks/BlockDirt.h +++ b/src/Blocks/BlockDirt.h @@ -3,8 +3,8 @@ #include "BlockHandler.h" #include "../FastRandom.h" - - +#include "Root.h" +#include "Bindings/PluginManager.h" @@ -21,7 +21,15 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - a_Pickups.push_back(cItem(E_BLOCK_DIRT, 1, 0)); + if (a_BlockMeta == E_META_DIRT_COARSE) + { + // Drop the coarse block (dirt, meta 1) + a_Pickups.Add(E_BLOCK_DIRT, 1, E_META_DIRT_COARSE); + } + else + { + a_Pickups.Add(E_BLOCK_DIRT, 1, E_META_DIRT_NORMAL); + } } @@ -81,19 +89,13 @@ public: Chunk->GetBlockTypeMeta(BlockX, BlockY + 1, BlockZ, AboveDest, AboveMeta); if (cBlockInfo::GetHandler(AboveDest)->CanDirtGrowGrass(AboveMeta)) { - if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, BlockX * cChunkDef::Width, BlockY, BlockZ * cChunkDef::Width, ssGrassSpread)) + if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread(Chunk->GetWorld(), Chunk->GetPosX() * cChunkDef::Width + BlockX, BlockY, Chunk->GetPosZ() * cChunkDef::Width + BlockZ, ssGrassSpread)) { Chunk->FastSetBlock(BlockX, BlockY, BlockZ, E_BLOCK_GRASS, 0); } } } // for i - repeat twice } - - - virtual const char * GetStepSound(void) override - { - return "step.gravel"; - } } ; diff --git a/src/Blocks/BlockDoor.cpp b/src/Blocks/BlockDoor.cpp index e80473cb5..96345a2df 100644 --- a/src/Blocks/BlockDoor.cpp +++ b/src/Blocks/BlockDoor.cpp @@ -1,7 +1,6 @@ #include "Globals.h" #include "BlockDoor.h" -#include "../Item.h" #include "../Entities/Player.h" @@ -102,16 +101,7 @@ void cBlockDoorHandler::OnPlacedByPlayer( { a_TopBlockMeta = 9; } - a_ChunkInterface.SetBlock(a_WorldInterface, a_BlockX, a_BlockY + 1, a_BlockZ, m_BlockType, a_TopBlockMeta); -} - - - - - -const char * cBlockDoorHandler::GetStepSound(void) -{ - return (m_BlockType == E_BLOCK_WOODEN_DOOR) ? "step.wood" : "step.stone"; + a_ChunkInterface.SetBlock(a_BlockX, a_BlockY + 1, a_BlockZ, m_BlockType, a_TopBlockMeta); } diff --git a/src/Blocks/BlockDoor.h b/src/Blocks/BlockDoor.h index c86fe829b..92ad8da12 100644 --- a/src/Blocks/BlockDoor.h +++ b/src/Blocks/BlockDoor.h @@ -5,6 +5,7 @@ #include "../Entities/Player.h" #include "Chunk.h" #include "MetaRotator.h" +#include "ChunkInterface.h" @@ -19,7 +20,6 @@ public: virtual void OnDestroyed(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ) override; virtual void OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override; virtual void OnCancelRightClick(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override; - virtual const char * GetStepSound(void) override; virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override; virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override; @@ -55,7 +55,49 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - a_Pickups.push_back(cItem((m_BlockType == E_BLOCK_WOODEN_DOOR) ? E_ITEM_WOODEN_DOOR : E_ITEM_IRON_DOOR, 1, 0)); + switch (m_BlockType) + { + case E_BLOCK_WOODEN_DOOR: + { + a_Pickups.Add(E_ITEM_WOODEN_DOOR); + break; + } + case E_BLOCK_ACACIA_DOOR: + { + a_Pickups.Add(E_ITEM_ACACIA_DOOR); + break; + } + case E_BLOCK_BIRCH_DOOR: + { + a_Pickups.Add(E_ITEM_BIRCH_DOOR); + break; + } + case E_BLOCK_DARK_OAK_DOOR: + { + a_Pickups.Add(E_ITEM_DARK_OAK_DOOR); + break; + } + case E_BLOCK_JUNGLE_DOOR: + { + a_Pickups.Add(E_ITEM_JUNGLE_DOOR); + break; + } + case E_BLOCK_SPRUCE_DOOR: + { + a_Pickups.Add(E_ITEM_SPRUCE_DOOR); + break; + } + case E_BLOCK_IRON_DOOR: + { + a_Pickups.Add(E_ITEM_IRON_DOOR); + break; + } + default: + { + ASSERT(!"Unhandled door type!"); + break; + } + } } @@ -131,7 +173,23 @@ public: /** Returns true if the specified blocktype is any kind of door */ inline static bool IsDoor(BLOCKTYPE a_Block) { - return (a_Block == E_BLOCK_WOODEN_DOOR) || (a_Block == E_BLOCK_IRON_DOOR); + switch (a_Block) + { + case E_BLOCK_ACACIA_DOOR: + case E_BLOCK_BIRCH_DOOR: + case E_BLOCK_DARK_OAK_DOOR: + case E_BLOCK_IRON_DOOR: + case E_BLOCK_JUNGLE_DOOR: + case E_BLOCK_SPRUCE_DOOR: + case E_BLOCK_WOODEN_DOOR: + { + return true; + } + default: + { + return false; + } + } } diff --git a/src/Blocks/BlockEnderchest.h b/src/Blocks/BlockEnderchest.h index 4672f1459..0bc67a8f5 100644 --- a/src/Blocks/BlockEnderchest.h +++ b/src/Blocks/BlockEnderchest.h @@ -33,11 +33,6 @@ public: a_BlockMeta = RotationToMetaData(a_Player->GetYaw()); return true; } - - virtual const char * GetStepSound(void) override - { - return "step.stone"; - } static NIBBLETYPE RotationToMetaData(double a_Rotation) { diff --git a/src/Blocks/BlockFarmland.h b/src/Blocks/BlockFarmland.h index ed0592acd..02a48a4af 100644 --- a/src/Blocks/BlockFarmland.h +++ b/src/Blocks/BlockFarmland.h @@ -28,52 +28,12 @@ public: virtual void OnUpdate(cChunkInterface & cChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_PluginInterface, cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) override { - bool Found = false; - - EMCSBiome Biome = a_Chunk.GetBiomeAt(a_RelX, a_RelZ); - if (a_Chunk.GetWorld()->IsWeatherWet() && !IsBiomeNoDownfall(Biome)) - { - // Rain hydrates farmland, too, except in Desert biomes. - Found = true; - } - else - { - // Search for water in a close proximity: - // Ref.: http://www.minecraftwiki.net/wiki/Farmland#Hydrated_Farmland_Tiles - // TODO: Rewrite this to use the chunk and its neighbors directly - cBlockArea Area; - int BlockX = a_RelX + a_Chunk.GetPosX() * cChunkDef::Width; - int BlockZ = a_RelZ + a_Chunk.GetPosZ() * cChunkDef::Width; - if (!Area.Read(a_Chunk.GetWorld(), BlockX - 4, BlockX + 4, a_RelY, a_RelY + 1, BlockZ - 4, BlockZ + 4)) - { - // Too close to the world edge, cannot check surroundings; don't tick at all - return; - } - - size_t NumBlocks = Area.GetBlockCount(); - BLOCKTYPE * BlockTypes = Area.GetBlockTypes(); - for (size_t i = 0; i < NumBlocks; i++) - { - if ( - (BlockTypes[i] == E_BLOCK_WATER) || - (BlockTypes[i] == E_BLOCK_STATIONARY_WATER) - ) - { - Found = true; - break; - } - } // for i - BlockTypes[] - } - NIBBLETYPE BlockMeta = a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ); - - if (Found) + + if (IsWaterInNear(a_Chunk, a_RelX, a_RelY, a_RelZ)) { - // Water was found, hydrate the block until hydration reaches 7: - if (BlockMeta < 7) - { - a_Chunk.FastSetBlock(a_RelX, a_RelY, a_RelZ, m_BlockType, ++BlockMeta); - } + // Water was found, set block meta to 7 + a_Chunk.FastSetBlock(a_RelX, a_RelY, a_RelZ, m_BlockType, 7); return; } @@ -83,9 +43,10 @@ public: a_Chunk.FastSetBlock(a_RelX, a_RelY, a_RelZ, E_BLOCK_FARMLAND, --BlockMeta); return; } - + // Farmland too dry. If nothing is growing on top, turn back to dirt: - switch (a_Chunk.GetBlock(a_RelX, a_RelY + 1, a_RelZ)) + BLOCKTYPE UpperBlock = (a_RelY >= cChunkDef::Height) ? E_BLOCK_AIR : a_Chunk.GetBlock(a_RelX, a_RelY + 1, a_RelZ); + switch (UpperBlock) { case E_BLOCK_CROPS: case E_BLOCK_POTATOES: @@ -98,16 +59,63 @@ public: } default: { - a_Chunk.FastSetBlock(a_RelX, a_RelY, a_RelZ, E_BLOCK_DIRT, 0); + a_Chunk.SetBlock(a_RelX, a_RelY, a_RelZ, E_BLOCK_DIRT, 0); break; } } } + virtual void OnNeighborChanged(cChunkInterface & a_ChunkInterface, int a_BlockX, int a_BlockY, int a_BlockZ) override + { + if (a_BlockY >= cChunkDef::Height) + { + return; + } + + BLOCKTYPE UpperBlock = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY + 1, a_BlockZ); + if (cBlockInfo::FullyOccupiesVoxel(UpperBlock)) + { + a_ChunkInterface.SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_DIRT, 0); + } + } + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { a_Pickups.Add(E_BLOCK_DIRT, 1, 0); // Reset meta } + + bool IsWaterInNear(cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) + { + if (a_Chunk.GetWorld()->IsWeatherWetAt(a_RelX, a_RelZ)) + { + // Rain hydrates farmland, too, except in Desert biomes. + return true; + } + + // Search for water in a close proximity: + // Ref.: http://www.minecraftwiki.net/wiki/Farmland#Hydrated_Farmland_Tiles + // TODO: Rewrite this to use the chunk and its neighbors directly + cBlockArea Area; + int BlockX = a_RelX + a_Chunk.GetPosX() * cChunkDef::Width; + int BlockZ = a_RelZ + a_Chunk.GetPosZ() * cChunkDef::Width; + if (!Area.Read(a_Chunk.GetWorld(), BlockX - 4, BlockX + 4, a_RelY, a_RelY + 1, BlockZ - 4, BlockZ + 4)) + { + // Too close to the world edge, cannot check surroundings + return false; + } + + size_t NumBlocks = Area.GetBlockCount(); + BLOCKTYPE * BlockTypes = Area.GetBlockTypes(); + for (size_t i = 0; i < NumBlocks; i++) + { + if (IsBlockWater(BlockTypes[i])) + { + return true; + } + } // for i - BlockTypes[] + + return false; + } } ; diff --git a/src/Blocks/BlockFenceGate.h b/src/Blocks/BlockFenceGate.h index 433531275..b5c1323bd 100644 --- a/src/Blocks/BlockFenceGate.h +++ b/src/Blocks/BlockFenceGate.h @@ -17,6 +17,12 @@ public: } + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override + { + a_Pickups.Add(m_BlockType, 1, 0); // Reset meta to zero + } + + virtual bool GetPlacementBlockTypeMeta( cChunkInterface & a_ChunkInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, @@ -35,6 +41,7 @@ public: NIBBLETYPE OldMetaData = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); NIBBLETYPE NewMetaData = PlayerYawToMetaData(a_Player->GetYaw()); OldMetaData ^= 4; // Toggle the gate + if ((OldMetaData & 1) == (NewMetaData & 1)) { // Standing in front of the gate - apply new direction diff --git a/src/Blocks/BlockFire.h b/src/Blocks/BlockFire.h index f52825362..07fcefe16 100644 --- a/src/Blocks/BlockFire.h +++ b/src/Blocks/BlockFire.h @@ -40,11 +40,6 @@ public: FindAndSetPortalFrame(a_BlockX, a_BlockY - 1, a_BlockZ, a_ChunkInterface, a_WorldInterface); } - virtual void OnDigging(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override - { - a_ChunkInterface.DigBlock(a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ); - } - virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { // No pickups from this block @@ -55,13 +50,8 @@ public: return true; } - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } - - /// Traces along YP until it finds an obsidian block, returns Y difference or 0 if no portal, and -1 for border - /// Takes the X, Y, and Z of the base block; with an optional MaxY for portal border finding + /** Traces along YP until it finds an obsidian block, returns Y difference or 0 if no portal, and -1 for border + Takes the X, Y, and Z of the base block; with an optional MaxY for portal border finding */ int FindObsidianCeiling(int X, int Y, int Z, cChunkInterface & a_ChunkInterface, int MaxY = 0) { if (a_ChunkInterface.GetBlock(X, Y, Z) != E_BLOCK_OBSIDIAN) @@ -91,13 +81,12 @@ public: return newY; } } - else { return 0; } } return 0; } - /// Evaluates if coords have a valid border on top, based on MaxY + /** Evaluates if coords have a valid border on top, based on MaxY */ bool EvaluatePortalBorder(int X, int FoundObsidianY, int Z, int MaxY, cChunkInterface & a_ChunkInterface) { for (int checkBorder = FoundObsidianY + 1; checkBorder <= MaxY - 1; checkBorder++) // FoundObsidianY + 1: FoundObsidianY has already been checked in FindObsidianCeiling; MaxY - 1: portal doesn't need corners @@ -137,11 +126,11 @@ public: { if (Dir == 1) { - a_ChunkInterface.SetBlock(a_WorldInterface, Width, Height, Z, E_BLOCK_NETHER_PORTAL, Dir); + a_ChunkInterface.SetBlock(Width, Height, Z, E_BLOCK_NETHER_PORTAL, Dir); } else { - a_ChunkInterface.SetBlock(a_WorldInterface, X, Height, Width, E_BLOCK_NETHER_PORTAL, Dir); + a_ChunkInterface.SetBlock(X, Height, Width, E_BLOCK_NETHER_PORTAL, Dir); } } } @@ -149,8 +138,8 @@ public: return; } - /// Evaluates if coordinates are a portal going XP/XM; returns true if so, and writes boundaries to variable - /// Takes coordinates of base block and Y coord of target obsidian ceiling + /** Evaluates if coordinates are a portal going XP/XM; returns true if so, and writes boundaries to variable + Takes coordinates of base block and Y coord of target obsidian ceiling */ bool FindPortalSliceX(int X1, int X2, int Y, int Z, int MaxY, cChunkInterface & a_ChunkInterface) { Dir = 1; // Set assumed direction (will change if portal turns out to be facing the other direction) @@ -168,7 +157,8 @@ public: { return false; // Not valid slice, no portal can be formed } - } XZP = X1 - 1; // Set boundary of frame interior + } + XZP = X1 - 1; // Set boundary of frame interior for (; ((a_ChunkInterface.GetBlock(X2, Y, Z) == E_BLOCK_OBSIDIAN) || (a_ChunkInterface.GetBlock(X2, Y + 1, Z) == E_BLOCK_OBSIDIAN)); X2--) // Go the other direction (XM) { int Value = FindObsidianCeiling(X2, Y, Z, a_ChunkInterface, MaxY); @@ -182,7 +172,9 @@ public: { return false; } - } XZM = X2 + 1; // Set boundary, see previous + } + XZM = X2 + 1; // Set boundary, see previous + return (FoundFrameXP && FoundFrameXM); } @@ -204,7 +196,8 @@ public: { return false; } - } XZP = Z1 - 1; + } + XZP = Z1 - 1; for (; ((a_ChunkInterface.GetBlock(X, Y, Z2) == E_BLOCK_OBSIDIAN) || (a_ChunkInterface.GetBlock(X, Y + 1, Z2) == E_BLOCK_OBSIDIAN)); Z2--) { int Value = FindObsidianCeiling(X, Y, Z2, a_ChunkInterface, MaxY); @@ -218,7 +211,9 @@ public: { return false; } - } XZM = Z2 + 1; + } + XZM = Z2 + 1; + return (FoundFrameZP && FoundFrameZM); } }; diff --git a/src/Blocks/BlockFlower.h b/src/Blocks/BlockFlower.h index e8fd4c7f6..3eb8a0baa 100644 --- a/src/Blocks/BlockFlower.h +++ b/src/Blocks/BlockFlower.h @@ -19,7 +19,7 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - // Reset meta to 0 + // Reset meta to zero a_Pickups.push_back(cItem(m_BlockType, 1, 0)); } @@ -28,12 +28,6 @@ public: { return (a_RelY > 0) && IsBlockTypeOfDirt(a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ)); } - - - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } } ; diff --git a/src/Blocks/BlockGlowstone.h b/src/Blocks/BlockGlowstone.h index 6c198efc4..d1353e29a 100644 --- a/src/Blocks/BlockGlowstone.h +++ b/src/Blocks/BlockGlowstone.h @@ -15,13 +15,13 @@ public: : cBlockHandler(a_BlockType) { } - + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { // Reset meta to 0 - MTRand r1; - a_Pickups.push_back(cItem(E_ITEM_GLOWSTONE_DUST, (char)(2 + r1.randInt(2)), 0)); + cFastRandom Random; + a_Pickups.push_back(cItem(E_ITEM_GLOWSTONE_DUST, (char)(2 + Random.NextInt(3)), 0)); } } ; diff --git a/src/Blocks/BlockGravel.h b/src/Blocks/BlockGravel.h index e1c9ff390..d076306fb 100644 --- a/src/Blocks/BlockGravel.h +++ b/src/Blocks/BlockGravel.h @@ -16,9 +16,17 @@ public: { } - virtual const char * GetStepSound(void) override + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - return "step.gravel"; + cFastRandom Random; + if (Random.NextInt(30) == 0) + { + a_Pickups.Add(E_ITEM_FLINT, 1, 0); + } + else + { + a_Pickups.Add(E_BLOCK_GRAVEL, 1, 0); + } } } ; diff --git a/src/Blocks/BlockHandler.cpp b/src/Blocks/BlockHandler.cpp index ddb0186c9..904e0a921 100644 --- a/src/Blocks/BlockHandler.cpp +++ b/src/Blocks/BlockHandler.cpp @@ -3,8 +3,6 @@ #include "BlockHandler.h" #include "../Item.h" #include "../World.h" -#include "../Root.h" -#include "../Bindings/PluginManager.h" #include "../Chunk.h" #include "BlockAnvil.h" #include "BlockBed.h" @@ -38,20 +36,18 @@ #include "BlockGlass.h" #include "BlockGlowstone.h" #include "BlockGravel.h" -#include "BlockHayBale.h" #include "BlockMobHead.h" #include "BlockHopper.h" #include "BlockIce.h" #include "BlockLadder.h" #include "BlockLeaves.h" #include "BlockLilypad.h" -#include "BlockNewLeaves.h" #include "BlockLever.h" #include "BlockMelon.h" +#include "BlockMobSpawner.h" #include "BlockMushroom.h" #include "BlockMycelium.h" #include "BlockNetherWart.h" -#include "BlockNote.h" #include "BlockOre.h" #include "BlockPiston.h" #include "BlockPlanks.h" @@ -69,6 +65,7 @@ #include "BlockTripwireHook.h" #include "BlockSand.h" #include "BlockSapling.h" +#include "BlockSeaLantern.h" #include "BlockSideways.h" #include "BlockSignPost.h" #include "BlockSlab.h" @@ -85,6 +82,8 @@ #include "BlockWorkbench.h" +#include "BlockPluginInterface.h" + @@ -178,11 +177,16 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) switch (a_BlockType) { // Block handlers, alphabetically sorted: + case E_BLOCK_ACACIA_DOOR: return new cBlockDoorHandler (a_BlockType); + case E_BLOCK_ACACIA_FENCE_GATE: return new cBlockFenceGateHandler (a_BlockType); case E_BLOCK_ACACIA_WOOD_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_ACTIVATOR_RAIL: return new cBlockRailHandler (a_BlockType); case E_BLOCK_ANVIL: return new cBlockAnvilHandler (a_BlockType); + case E_BLOCK_BEACON: return new cBlockEntityHandler (a_BlockType); case E_BLOCK_BED: return new cBlockBedHandler (a_BlockType); case E_BLOCK_BIG_FLOWER: return new cBlockBigFlowerHandler (a_BlockType); + case E_BLOCK_BIRCH_DOOR: return new cBlockDoorHandler (a_BlockType); + case E_BLOCK_BIRCH_FENCE_GATE: return new cBlockFenceGateHandler (a_BlockType); case E_BLOCK_BIRCH_WOOD_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_BREWING_STAND: return new cBlockBrewingStandHandler (a_BlockType); case E_BLOCK_BRICK_STAIRS: return new cBlockStairsHandler (a_BlockType); @@ -200,12 +204,15 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) case E_BLOCK_COBBLESTONE_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_COBWEB: return new cBlockCobWebHandler (a_BlockType); case E_BLOCK_CROPS: return new cBlockCropsHandler (a_BlockType); + case E_BLOCK_DARK_OAK_DOOR: return new cBlockDoorHandler (a_BlockType); + case E_BLOCK_DARK_OAK_FENCE_GATE: return new cBlockFenceGateHandler (a_BlockType); case E_BLOCK_DARK_OAK_WOOD_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_DEAD_BUSH: return new cBlockDeadBushHandler (a_BlockType); case E_BLOCK_DETECTOR_RAIL: return new cBlockRailHandler (a_BlockType); case E_BLOCK_DIAMOND_ORE: return new cBlockOreHandler (a_BlockType); case E_BLOCK_DIRT: return new cBlockDirtHandler (a_BlockType); case E_BLOCK_DISPENSER: return new cBlockDropSpenserHandler (a_BlockType); + case E_BLOCK_DOUBLE_NEW_STONE_SLAB: return new cBlockDoubleSlabHandler (a_BlockType); case E_BLOCK_DOUBLE_STONE_SLAB: return new cBlockDoubleSlabHandler (a_BlockType); case E_BLOCK_DOUBLE_WOODEN_SLAB: return new cBlockDoubleSlabHandler (a_BlockType); case E_BLOCK_DROPPER: return new cBlockDropSpenserHandler (a_BlockType); @@ -223,7 +230,7 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) case E_BLOCK_GLASS_PANE: return new cBlockGlassHandler (a_BlockType); case E_BLOCK_GRASS: return new cBlockDirtHandler (a_BlockType); case E_BLOCK_GRAVEL: return new cBlockGravelHandler (a_BlockType); - case E_BLOCK_HAY_BALE: return new cBlockHayBaleHandler (a_BlockType); + case E_BLOCK_HAY_BALE: return new cBlockSidewaysHandler (a_BlockType); case E_BLOCK_HEAD: return new cBlockMobHeadHandler (a_BlockType); case E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE: return new cBlockPressurePlateHandler(a_BlockType); case E_BLOCK_HOPPER: return new cBlockHopperHandler (a_BlockType); @@ -231,8 +238,11 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) case E_BLOCK_INACTIVE_COMPARATOR: return new cBlockComparatorHandler (a_BlockType); case E_BLOCK_IRON_DOOR: return new cBlockDoorHandler (a_BlockType); case E_BLOCK_IRON_ORE: return new cBlockOreHandler (a_BlockType); + case E_BLOCK_IRON_TRAPDOOR: return new cBlockTrapdoorHandler (a_BlockType); case E_BLOCK_JACK_O_LANTERN: return new cBlockPumpkinHandler (a_BlockType); case E_BLOCK_JUKEBOX: return new cBlockEntityHandler (a_BlockType); + case E_BLOCK_JUNGLE_DOOR: return new cBlockDoorHandler (a_BlockType); + case E_BLOCK_JUNGLE_FENCE_GATE: return new cBlockFenceGateHandler (a_BlockType); case E_BLOCK_JUNGLE_WOOD_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_LADDER: return new cBlockLadderHandler (a_BlockType); case E_BLOCK_LEVER: return new cBlockLeverHandler (a_BlockType); @@ -245,14 +255,16 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) case E_BLOCK_LOG: return new cBlockSidewaysHandler (a_BlockType); case E_BLOCK_MELON: return new cBlockMelonHandler (a_BlockType); case E_BLOCK_MELON_STEM: return new cBlockStemsHandler (a_BlockType); + case E_BLOCK_MOB_SPAWNER: return new cBlockMobSpawnerHandler (a_BlockType); case E_BLOCK_MYCELIUM: return new cBlockMyceliumHandler (a_BlockType); case E_BLOCK_NETHER_BRICK_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_NETHER_PORTAL: return new cBlockPortalHandler (a_BlockType); case E_BLOCK_NETHER_WART: return new cBlockNetherWartHandler (a_BlockType); case E_BLOCK_NETHER_QUARTZ_ORE: return new cBlockOreHandler (a_BlockType); - case E_BLOCK_NEW_LEAVES: return new cBlockNewLeavesHandler (a_BlockType); + case E_BLOCK_NEW_LEAVES: return new cBlockLeavesHandler (a_BlockType); case E_BLOCK_NEW_LOG: return new cBlockSidewaysHandler (a_BlockType); - case E_BLOCK_NOTE_BLOCK: return new cBlockNoteHandler (a_BlockType); + case E_BLOCK_NEW_STONE_SLAB: return new cBlockSlabHandler (a_BlockType); + case E_BLOCK_NOTE_BLOCK: return new cBlockEntityHandler (a_BlockType); case E_BLOCK_PISTON: return new cBlockPistonHandler (a_BlockType); case E_BLOCK_PISTON_EXTENSION: return new cBlockPistonHeadHandler; case E_BLOCK_PLANKS: return new cBlockPlanksHandler (a_BlockType); @@ -263,6 +275,7 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) case E_BLOCK_QUARTZ_BLOCK: return new cBlockQuartzHandler (a_BlockType); case E_BLOCK_QUARTZ_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_RAIL: return new cBlockRailHandler (a_BlockType); + case E_BLOCK_RED_SANDSTONE_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_REDSTONE_LAMP_ON: return new cBlockRedstoneLampHandler (a_BlockType); case E_BLOCK_REDSTONE_ORE: return new cBlockOreHandler (a_BlockType); case E_BLOCK_REDSTONE_ORE_GLOWING: return new cBlockOreHandler (a_BlockType); @@ -276,8 +289,11 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) case E_BLOCK_SAND: return new cBlockSandHandler (a_BlockType); case E_BLOCK_SANDSTONE_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_SAPLING: return new cBlockSaplingHandler (a_BlockType); + case E_BLOCK_SEA_LANTERN: return new cBlockSeaLanternHandler (a_BlockType); case E_BLOCK_SIGN_POST: return new cBlockSignPostHandler (a_BlockType); case E_BLOCK_SNOW: return new cBlockSnowHandler (a_BlockType); + case E_BLOCK_SPRUCE_DOOR: return new cBlockDoorHandler (a_BlockType); + case E_BLOCK_SPRUCE_FENCE_GATE: return new cBlockFenceGateHandler (a_BlockType); case E_BLOCK_SPRUCE_WOOD_STAIRS: return new cBlockStairsHandler (a_BlockType); case E_BLOCK_STAINED_GLASS: return new cBlockGlassHandler (a_BlockType); case E_BLOCK_STAINED_GLASS_PANE: return new cBlockGlassHandler (a_BlockType); @@ -418,24 +434,47 @@ void cBlockHandler::ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) -void cBlockHandler::DropBlock(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_BlockPluginInterface, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, bool a_CanDrop, bool a_DropVerbatim) +void cBlockHandler::DropBlock(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_BlockPluginInterface, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, bool a_CanDrop) { cItems Pickups; NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); if (a_CanDrop) { - if (!a_DropVerbatim) + if ((a_Digger != NULL) && (a_Digger->GetEquippedWeapon().m_Enchantments.GetLevel(cEnchantments::enchSilkTouch) > 0)) { - ConvertToPickups(Pickups, Meta); + switch (m_BlockType) + { + case E_BLOCK_CAKE: + case E_BLOCK_CARROTS: + case E_BLOCK_COCOA_POD: + case E_BLOCK_DOUBLE_STONE_SLAB: + case E_BLOCK_DOUBLE_WOODEN_SLAB: + case E_BLOCK_FIRE: + case E_BLOCK_FARMLAND: + case E_BLOCK_MELON_STEM: + case E_BLOCK_MOB_SPAWNER: + case E_BLOCK_NETHER_WART: + case E_BLOCK_POTATOES: + case E_BLOCK_PUMPKIN_STEM: + case E_BLOCK_SNOW: + case E_BLOCK_SUGARCANE: + case E_BLOCK_TALL_GRASS: + case E_BLOCK_CROPS: + { + // Silktouch can't be used for these blocks + ConvertToPickups(Pickups, Meta); + break; + } + default: Pickups.Add(m_BlockType, 1, Meta); break; + } } else { - // TODO: Add a proper overridable function for this - Pickups.Add(m_BlockType, 1, Meta); + ConvertToPickups(Pickups, Meta); } } - + // Allow plugins to modify the pickups: a_BlockPluginInterface.CallHookBlockToPickups(a_Digger, a_BlockX, a_BlockY, a_BlockZ, m_BlockType, Meta, Pickups); @@ -461,15 +500,6 @@ void cBlockHandler::DropBlock(cChunkInterface & a_ChunkInterface, cWorldInterfac -const char * cBlockHandler::GetStepSound() -{ - return "step.stone"; -} - - - - - bool cBlockHandler::CanBeAt(cChunkInterface & a_ChunkInterface, int a_BlockX, int a_BlockY, int a_BlockZ, const cChunk & a_Chunk) { return true; diff --git a/src/Blocks/BlockHandler.h b/src/Blocks/BlockHandler.h index de90ce55b..83de836cb 100644 --- a/src/Blocks/BlockHandler.h +++ b/src/Blocks/BlockHandler.h @@ -2,10 +2,6 @@ #pragma once #include "../Defines.h" -#include "../Item.h" -#include "WorldInterface.h" -#include "ChunkInterface.h" -#include "BlockPluginInterface.h" @@ -14,6 +10,10 @@ // fwd: class cPlayer; class cChunk; +class cBlockPluginInterface; +class cChunkInterface; +class cWorldInterface; +class cItems; @@ -82,10 +82,7 @@ public: @param a_CanDrop Informs the handler whether the block should be dropped at all. One example when this is false is when stone is destroyed by hand @param a_DropVerbatim Calls ConvertToVerbatimPickups() instead of its counterpart, meaning the block itself is dropped by default (due to a speical tool or enchantment) */ - virtual void DropBlock(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_BlockPluginInterface, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, bool a_CanDrop = true, bool a_DropVerbatim = false); - - /// Returns step sound name of block - virtual const char * GetStepSound(void); + virtual void DropBlock(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_BlockPluginInterface, cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, bool a_CanDrop = true); /// Checks if the block can stay at the specified relative coords in the chunk virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk); diff --git a/src/Blocks/BlockHayBale.h b/src/Blocks/BlockHayBale.h deleted file mode 100644 index 3c6472adb..000000000 --- a/src/Blocks/BlockHayBale.h +++ /dev/null @@ -1,28 +0,0 @@ - -#pragma once - -#include "BlockSideways.h" - - - - - -class cBlockHayBaleHandler : - public cBlockSidewaysHandler -{ -public: - cBlockHayBaleHandler(BLOCKTYPE a_BlockType) - : cBlockSidewaysHandler(a_BlockType) - { - } - - - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } -} ; - - - - diff --git a/src/Blocks/BlockIce.h b/src/Blocks/BlockIce.h index c50623594..47a84e5a7 100644 --- a/src/Blocks/BlockIce.h +++ b/src/Blocks/BlockIce.h @@ -24,14 +24,24 @@ public: } - virtual void OnDestroyed(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ) override + virtual void OnDestroyedByPlayer(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override { - // TODO: Ice destroyed with air below it should turn into air instead of water - a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_WATER, 0); - // This is called later than the real destroying of this ice block + if (a_Player->IsGameModeCreative() || (a_BlockY <= 0)) + { + return; + } + + cEnchantments Enchantments = a_Player->GetInventory().GetEquippedItem().m_Enchantments; + if (Enchantments.GetLevel(cEnchantments::enchSilkTouch) == 0) + { + BLOCKTYPE BlockBelow = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ); + if (!cBlockInfo::FullyOccupiesVoxel(BlockBelow) && !IsBlockLiquid(BlockBelow)) + { + return; + } + + a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_WATER, 0); + // This is called later than the real destroying of this ice block + } } } ; - - - - diff --git a/src/Blocks/BlockLadder.h b/src/Blocks/BlockLadder.h index 284d1d732..ab3f55439 100644 --- a/src/Blocks/BlockLadder.h +++ b/src/Blocks/BlockLadder.h @@ -111,12 +111,6 @@ public: int BlockZ = a_RelZ + a_Chunk.GetPosZ() * cChunkDef::Width; return LadderCanBePlacedAt(a_ChunkInterface, BlockX, a_RelY, BlockZ, BlockFace); } - - - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } } ; diff --git a/src/Blocks/BlockLeaves.h b/src/Blocks/BlockLeaves.h index 972dd6232..add571675 100644 --- a/src/Blocks/BlockLeaves.h +++ b/src/Blocks/BlockLeaves.h @@ -112,12 +112,6 @@ public: DropBlock(a_ChunkInterface, a_WorldInterface, a_PluginInterface, NULL, BlockX, a_RelY, BlockZ); a_ChunkInterface.DigBlock(a_WorldInterface, BlockX, a_RelY, BlockZ); } - - - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } } ; @@ -152,7 +146,7 @@ bool HasNearLog(cBlockArea & a_Area, int a_BlockX, int a_BlockY, int a_BlockZ) a_Area.SetBlockType(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_SPONGE); for (int i = 0; i < LEAVES_CHECK_DISTANCE; i++) { - for (int y = a_BlockY - i; y <= a_BlockY + i; y++) + for (int y = std::max(a_BlockY - i, 0); y <= std::min(a_BlockY + i, 255); y++) { for (int z = a_BlockZ - i; z <= a_BlockZ + i; z++) { diff --git a/src/Blocks/BlockLever.h b/src/Blocks/BlockLever.h index 4316fd06b..3b63b396c 100644 --- a/src/Blocks/BlockLever.h +++ b/src/Blocks/BlockLever.h @@ -70,12 +70,6 @@ public: } - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } - - inline static eBlockFace BlockMetaDataToBlockFace(NIBBLETYPE a_Meta) { switch (a_Meta & 0x7) diff --git a/src/Blocks/BlockMelon.h b/src/Blocks/BlockMelon.h index 2f7d9a461..22cdb4d29 100644 --- a/src/Blocks/BlockMelon.h +++ b/src/Blocks/BlockMelon.h @@ -19,14 +19,8 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - MTRand r1; - a_Pickups.push_back(cItem(E_ITEM_MELON_SLICE, (char)(3 + r1.randInt(4)), 0)); - } - - - virtual const char * GetStepSound(void) override - { - return "step.wood"; + cFastRandom Random; + a_Pickups.push_back(cItem(E_ITEM_MELON_SLICE, (char)(3 + Random.NextInt(5)), 0)); } } ; diff --git a/src/Blocks/BlockMobHead.h b/src/Blocks/BlockMobHead.h index ff1ef97bf..e21e42334 100644 --- a/src/Blocks/BlockMobHead.h +++ b/src/Blocks/BlockMobHead.h @@ -146,12 +146,12 @@ public: a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0); // Block entities - a_ChunkInterface.SetBlock(a_WorldInterface, a_BlockX + 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); - a_ChunkInterface.SetBlock(a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); - a_ChunkInterface.SetBlock(a_WorldInterface, a_BlockX - 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.SetBlock(a_BlockX + 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.SetBlock(a_BlockX - 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); // Spawn the wither: - a_WorldInterface.SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither); + a_WorldInterface.SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, mtWither); // Award Achievement a_WorldInterface.ForEachPlayer(PlayerCallback); @@ -176,12 +176,12 @@ public: a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0); // Block entities - a_ChunkInterface.SetBlock(a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ + 1, E_BLOCK_AIR, 0); - a_ChunkInterface.SetBlock(a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); - a_ChunkInterface.SetBlock(a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ - 1, E_BLOCK_AIR, 0); + a_ChunkInterface.SetBlock(a_BlockX, a_BlockY, a_BlockZ + 1, E_BLOCK_AIR, 0); + a_ChunkInterface.SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); + a_ChunkInterface.SetBlock(a_BlockX, a_BlockY, a_BlockZ - 1, E_BLOCK_AIR, 0); // Spawn the wither: - a_WorldInterface.SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither); + a_WorldInterface.SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, mtWither); // Award Achievement a_WorldInterface.ForEachPlayer(PlayerCallback); diff --git a/src/Blocks/BlockMobSpawner.h b/src/Blocks/BlockMobSpawner.h new file mode 100644 index 000000000..a51fbaafc --- /dev/null +++ b/src/Blocks/BlockMobSpawner.h @@ -0,0 +1,40 @@ + +#pragma once + +#include "BlockHandler.h" +#include "../World.h" +#include "../Items/ItemHandler.h" + + + + + +class cBlockMobSpawnerHandler : + public cBlockHandler +{ +public: + cBlockMobSpawnerHandler(BLOCKTYPE a_BlockType) + : cBlockHandler(a_BlockType) + { + } + + + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override + { + // No pickups + } + + + virtual void OnDestroyedByPlayer(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override + { + cItemHandler * Handler = a_Player->GetEquippedItem().GetHandler(); + if (a_Player->IsGameModeCreative() || !Handler->CanHarvestBlock(E_BLOCK_MOB_SPAWNER)) + { + return; + } + + cFastRandom Random; + int Reward = 15 + Random.NextInt(15) + Random.NextInt(15); + a_WorldInterface.SpawnExperienceOrb((double)a_BlockX, (double)a_BlockY + 1, (double)a_BlockZ, Reward); + } +} ; diff --git a/src/Blocks/BlockMushroom.h b/src/Blocks/BlockMushroom.h index 135d418d7..7c06fcc74 100644 --- a/src/Blocks/BlockMushroom.h +++ b/src/Blocks/BlockMushroom.h @@ -50,12 +50,6 @@ public: } return true; } - - - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } } ; diff --git a/src/Blocks/BlockMycelium.h b/src/Blocks/BlockMycelium.h index 2a8ef5fca..628e87181 100644 --- a/src/Blocks/BlockMycelium.h +++ b/src/Blocks/BlockMycelium.h @@ -22,11 +22,6 @@ public: { a_Pickups.push_back(cItem(E_BLOCK_DIRT, 1, 0)); } - - virtual const char * GetStepSound(void) override - { - return "step.gravel"; - } } ; diff --git a/src/Blocks/BlockNewLeaves.h b/src/Blocks/BlockNewLeaves.h deleted file mode 100644 index 5a267e8c6..000000000 --- a/src/Blocks/BlockNewLeaves.h +++ /dev/null @@ -1,42 +0,0 @@ -#pragma once -#include "BlockHandler.h" -#include "BlockLeaves.h" -#include "../World.h" - - - - - - -class cBlockNewLeavesHandler : - public cBlockLeavesHandler -{ -public: - cBlockNewLeavesHandler(BLOCKTYPE a_BlockType) - : cBlockLeavesHandler(a_BlockType) - { - } - - - virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override - { - MTRand rand; - - // Only the first 2 bits contain the display information, the others are for growing - if (rand.randInt(5) == 0) - { - a_Pickups.push_back(cItem(E_BLOCK_SAPLING, 1, (a_BlockMeta & 3) + 4)); - } - } - - - void OnDestroyed(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ) override - { - cBlockHandler::OnDestroyed(a_ChunkInterface, a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ); - } -} ; - - - - - diff --git a/src/Blocks/BlockNote.h b/src/Blocks/BlockNote.h deleted file mode 100644 index fef38d845..000000000 --- a/src/Blocks/BlockNote.h +++ /dev/null @@ -1,13 +0,0 @@ -#pragma once -#include "BlockHandler.h" -#include "BlockEntity.h" - -class cBlockNoteHandler : public cBlockEntityHandler -{ -public: - cBlockNoteHandler(BLOCKTYPE a_BlockType) - : cBlockEntityHandler(a_BlockType) - { - } - -}; diff --git a/src/Blocks/BlockOre.h b/src/Blocks/BlockOre.h index 9684dbb19..f6ea3aa3c 100644 --- a/src/Blocks/BlockOre.h +++ b/src/Blocks/BlockOre.h @@ -2,7 +2,6 @@ #pragma once #include "BlockHandler.h" -#include "../MersenneTwister.h" #include "../World.h" @@ -20,58 +19,42 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - short ItemType = m_BlockType; - char Count = 1; - short Meta = 0; - - MTRand r1; + cFastRandom Random; + switch (m_BlockType) { case E_BLOCK_LAPIS_ORE: { - ItemType = E_ITEM_DYE; - Count = 4 + (char)r1.randInt(4); - Meta = 4; + a_Pickups.push_back(cItem(E_ITEM_DYE, (char)(4 + Random.NextInt(5)), 4)); break; } case E_BLOCK_REDSTONE_ORE: case E_BLOCK_REDSTONE_ORE_GLOWING: { - Count = 4 + (char)r1.randInt(1); - break; - } - default: - { - Count = 1; + a_Pickups.push_back(cItem(E_ITEM_REDSTONE_DUST, (char)(4 + Random.NextInt(2)), 0)); break; } - } - - switch (m_BlockType) - { case E_BLOCK_DIAMOND_ORE: { - ItemType = E_ITEM_DIAMOND; + a_Pickups.push_back(cItem(E_ITEM_DIAMOND)); break; } - case E_BLOCK_REDSTONE_ORE: - case E_BLOCK_REDSTONE_ORE_GLOWING: + case E_BLOCK_EMERALD_ORE: { - ItemType = E_ITEM_REDSTONE_DUST; + a_Pickups.push_back(cItem(E_ITEM_EMERALD)); break; } - case E_BLOCK_EMERALD_ORE: + case E_BLOCK_COAL_ORE: { - ItemType = E_ITEM_EMERALD; + a_Pickups.push_back(cItem(E_ITEM_COAL)); break; } - case E_BLOCK_COAL_ORE: + default: { - ItemType = E_ITEM_COAL; + a_Pickups.push_back(cItem(m_BlockType)); break; } } - a_Pickups.push_back(cItem(ItemType, Count, Meta)); } } ; diff --git a/src/Blocks/BlockPiston.cpp b/src/Blocks/BlockPiston.cpp index 164967621..34d11f675 100644 --- a/src/Blocks/BlockPiston.cpp +++ b/src/Blocks/BlockPiston.cpp @@ -5,6 +5,7 @@ #include "../World.h" #include "../Entities/Player.h" #include "BlockInServerPluginInterface.h" +#include "ChunkInterface.h" @@ -52,7 +53,7 @@ void cBlockPistonHandler::OnDestroyed(cChunkInterface & a_ChunkInterface, cWorld if (a_ChunkInterface.GetBlock(newX, newY, newZ) == E_BLOCK_PISTON_EXTENSION) { - a_ChunkInterface.SetBlock(a_WorldInterface, newX, newY, newZ, E_BLOCK_AIR, 0); + a_ChunkInterface.SetBlock(newX, newY, newZ, E_BLOCK_AIR, 0); } } diff --git a/src/Blocks/BlockPiston.h b/src/Blocks/BlockPiston.h index bbb8af75b..f868f4d8e 100644 --- a/src/Blocks/BlockPiston.h +++ b/src/Blocks/BlockPiston.h @@ -4,7 +4,7 @@ #include "BlockHandler.h" - +class cWorld; class cBlockPistonHandler : @@ -94,10 +94,13 @@ private: switch (a_BlockType) { case E_BLOCK_ANVIL: + case E_BLOCK_BARRIER: + case E_BLOCK_BEACON: case E_BLOCK_BEDROCK: case E_BLOCK_BREWING_STAND: case E_BLOCK_CHEST: case E_BLOCK_COMMAND_BLOCK: + case E_BLOCK_DAYLIGHT_SENSOR: case E_BLOCK_DISPENSER: case E_BLOCK_DROPPER: case E_BLOCK_ENCHANTMENT_TABLE: @@ -106,6 +109,7 @@ private: // Notice the lack of an E_BLOCK_ENDER_CHEST here; its because ender chests can totally be pushed/pulled in MCS :) case E_BLOCK_FURNACE: case E_BLOCK_LIT_FURNACE: + case E_BLOCK_INVERTED_DAYLIGHT_SENSOR: case E_BLOCK_HOPPER: case E_BLOCK_JUKEBOX: case E_BLOCK_MOB_SPAWNER: @@ -113,7 +117,9 @@ private: case E_BLOCK_NOTE_BLOCK: case E_BLOCK_OBSIDIAN: case E_BLOCK_PISTON_EXTENSION: + case E_BLOCK_STANDING_BANNER: case E_BLOCK_TRAPPED_CHEST: + case E_BLOCK_WALL_BANNER: { return false; } diff --git a/src/Blocks/BlockPlanks.h b/src/Blocks/BlockPlanks.h index de84ed319..3c243ebdc 100644 --- a/src/Blocks/BlockPlanks.h +++ b/src/Blocks/BlockPlanks.h @@ -24,16 +24,9 @@ public: ) override { a_BlockType = m_BlockType; - NIBBLETYPE Meta = (NIBBLETYPE)(a_Player->GetEquippedItem().m_ItemDamage); - a_BlockMeta = Meta; + a_BlockMeta = (NIBBLETYPE)(a_Player->GetEquippedItem().m_ItemDamage); return true; } - - - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } } ; diff --git a/src/Blocks/BlockPortal.h b/src/Blocks/BlockPortal.h index fc74e89d0..97ba26ee3 100644 --- a/src/Blocks/BlockPortal.h +++ b/src/Blocks/BlockPortal.h @@ -36,7 +36,7 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - return; // No pickups + // No pickups } virtual void OnUpdate(cChunkInterface & cChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_PluginInterface, cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) override @@ -47,15 +47,15 @@ public: return; } - int PosX = a_Chunk.GetPosX() * 16 + a_RelX; - int PosZ = a_Chunk.GetPosZ() * 16 + a_RelZ; + int PosX = a_Chunk.GetPosX() * cChunkDef::Width + a_RelX; + int PosZ = a_Chunk.GetPosZ() * cChunkDef::Width + a_RelZ; - a_WorldInterface.SpawnMob(PosX, a_RelY, PosZ, cMonster::mtZombiePigman); + a_WorldInterface.SpawnMob(PosX, a_RelY, PosZ, mtZombiePigman); } virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override { - if ((a_RelY - 1 < 0) || (a_RelY + 1 > cChunkDef::Height)) + if ((a_RelY <= 0) || (a_RelY >= cChunkDef::Height)) { return false; // In case someone places a portal with meta 1 or 2 at boundaries, and server tries to get invalid coords at Y - 1 or Y + 1 } diff --git a/src/Blocks/BlockPressurePlate.h b/src/Blocks/BlockPressurePlate.h index adec36eb6..a5c34a776 100644 --- a/src/Blocks/BlockPressurePlate.h +++ b/src/Blocks/BlockPressurePlate.h @@ -17,7 +17,7 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - // Reset meta to 0 + // Reset meta to zero a_Pickups.push_back(cItem(m_BlockType, 1, 0)); } @@ -29,7 +29,7 @@ public: } BLOCKTYPE BlockBelow = a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ); - return ((BlockBelow == E_BLOCK_FENCE_GATE) || (BlockBelow == E_BLOCK_FENCE) || cBlockInfo::IsSolid(BlockBelow)); + return (cBlockInfo::IsSolid(BlockBelow)); } } ; diff --git a/src/Blocks/BlockPumpkin.h b/src/Blocks/BlockPumpkin.h index 15ac80fd7..275d1422a 100644 --- a/src/Blocks/BlockPumpkin.h +++ b/src/Blocks/BlockPumpkin.h @@ -36,7 +36,7 @@ public: a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0); a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0); a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0); - a_WorldInterface.SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtSnowGolem); + a_WorldInterface.SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, mtSnowGolem); return; } @@ -61,7 +61,7 @@ public: a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0); // Spawn the golem: - a_WorldInterface.SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtIronGolem); + a_WorldInterface.SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, mtIronGolem); } else if ( (a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1) == E_BLOCK_IRON_BLOCK) && @@ -76,7 +76,7 @@ public: a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0); // Spawn the golem: - a_WorldInterface.SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtIronGolem); + a_WorldInterface.SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, mtIronGolem); } } diff --git a/src/Blocks/BlockQuartz.h b/src/Blocks/BlockQuartz.h index 2ce7e71e4..edc4fb9c5 100644 --- a/src/Blocks/BlockQuartz.h +++ b/src/Blocks/BlockQuartz.h @@ -25,6 +25,7 @@ public: { a_BlockType = m_BlockType; NIBBLETYPE Meta = (NIBBLETYPE)(a_Player->GetEquippedItem().m_ItemDamage); + if (Meta != E_META_QUARTZ_PILLAR) // Check if the block is a pillar block. { a_BlockMeta = Meta; diff --git a/src/Blocks/BlockRedstone.h b/src/Blocks/BlockRedstone.h index a898c9acb..37d61ed73 100644 --- a/src/Blocks/BlockRedstone.h +++ b/src/Blocks/BlockRedstone.h @@ -26,8 +26,8 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - // Reset meta to 0 - a_Pickups.push_back(cItem(E_ITEM_REDSTONE_DUST, 1)); + // Reset meta to zero + a_Pickups.push_back(cItem(E_ITEM_REDSTONE_DUST, 1, 0)); } } ; diff --git a/src/Blocks/BlockRedstoneRepeater.h b/src/Blocks/BlockRedstoneRepeater.h index 4c8a6a087..1eb67f714 100644 --- a/src/Blocks/BlockRedstoneRepeater.h +++ b/src/Blocks/BlockRedstoneRepeater.h @@ -4,7 +4,7 @@ #include "BlockHandler.h" #include "Chunk.h" #include "MetaRotator.h" - +#include "ChunkInterface.h" @@ -23,7 +23,7 @@ public: int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta - ) override + ) override { a_BlockType = m_BlockType; a_BlockMeta = RepeaterRotationToMetaData(a_Player->GetYaw()); @@ -46,7 +46,7 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - // Reset meta to 0 + // Reset meta to zero a_Pickups.push_back(cItem(E_ITEM_REDSTONE_REPEATER, 1, 0)); } @@ -59,13 +59,7 @@ public: virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override { - return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) != E_BLOCK_AIR)); - } - - - virtual const char * GetStepSound(void) override - { - return "step.wood"; + return ((a_RelY > 0) && cBlockInfo::IsSolid(a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ))); } diff --git a/src/Blocks/BlockRedstoneTorch.h b/src/Blocks/BlockRedstoneTorch.h index cb897ba3f..8416a415c 100644 --- a/src/Blocks/BlockRedstoneTorch.h +++ b/src/Blocks/BlockRedstoneTorch.h @@ -23,12 +23,6 @@ public: // Always drop the ON torch, meta 0 a_Pickups.push_back(cItem(E_BLOCK_REDSTONE_TORCH_ON, 1, 0)); } - - - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } } ; diff --git a/src/Blocks/BlockSand.h b/src/Blocks/BlockSand.h index 3fc271483..48beab138 100644 --- a/src/Blocks/BlockSand.h +++ b/src/Blocks/BlockSand.h @@ -15,12 +15,6 @@ public: : cBlockHandler(a_BlockType) { } - - virtual const char * GetStepSound(void) override - { - return "step.sand"; - } - }; diff --git a/src/Blocks/BlockSapling.h b/src/Blocks/BlockSapling.h index de28273d5..bec79c6f3 100644 --- a/src/Blocks/BlockSapling.h +++ b/src/Blocks/BlockSapling.h @@ -46,12 +46,6 @@ public: a_Chunk.SetMeta(a_RelX, a_RelY, a_RelZ, Meta | 0x08); } } - - - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } } ; diff --git a/src/Blocks/BlockSeaLantern.h b/src/Blocks/BlockSeaLantern.h new file mode 100644 index 000000000..a9259d1d6 --- /dev/null +++ b/src/Blocks/BlockSeaLantern.h @@ -0,0 +1,30 @@ + +#pragma once + +#include "BlockHandler.h" + + + + + +class cBlockSeaLanternHandler : + public cBlockHandler +{ +public: + cBlockSeaLanternHandler(BLOCKTYPE a_BlockType) + : cBlockHandler(a_BlockType) + { + } + + + virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override + { + // Reset meta to 0 + cFastRandom Random; + a_Pickups.push_back(cItem(E_ITEM_PRISMARINE_CRYSTALS, (char)(2 + Random.NextInt(2)), 0)); + } +} ; + + + + diff --git a/src/Blocks/BlockSideways.h b/src/Blocks/BlockSideways.h index f5f10899d..4b1e38d6d 100644 --- a/src/Blocks/BlockSideways.h +++ b/src/Blocks/BlockSideways.h @@ -65,12 +65,6 @@ public: } } } - - - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } } ; diff --git a/src/Blocks/BlockSignPost.h b/src/Blocks/BlockSignPost.h index ee65d099a..40e15c253 100644 --- a/src/Blocks/BlockSignPost.h +++ b/src/Blocks/BlockSignPost.h @@ -27,20 +27,15 @@ public: } - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } - - virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override { if (a_RelY <= 0) { return false; } + BLOCKTYPE Type = a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ); - return (cBlockInfo::IsSolid(a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ))); + return ((Type == E_BLOCK_SIGN_POST) || cBlockInfo::IsSolid(Type)); } diff --git a/src/Blocks/BlockSlab.h b/src/Blocks/BlockSlab.h index 214445eda..ffe2414f7 100644 --- a/src/Blocks/BlockSlab.h +++ b/src/Blocks/BlockSlab.h @@ -12,6 +12,7 @@ #include "BlockHandler.h" #include "../Items/ItemHandler.h" #include "Root.h" +#include "ChunkInterface.h" @@ -85,18 +86,6 @@ public: return true; } - - - virtual const char * GetStepSound(void) override - { - switch (m_BlockType) - { - case E_BLOCK_WOODEN_SLAB: return "step.wood"; - case E_BLOCK_STONE_SLAB: return "step.stone"; - } - ASSERT(!"Unhandled slab type!"); - return ""; - } virtual bool CanDirtGrowGrass(NIBBLETYPE a_Meta) override @@ -108,7 +97,19 @@ public: /// Returns true if the specified blocktype is one of the slabs handled by this handler static bool IsAnySlabType(BLOCKTYPE a_BlockType) { - return ((a_BlockType == E_BLOCK_WOODEN_SLAB) || (a_BlockType == E_BLOCK_STONE_SLAB)); + return ((a_BlockType == E_BLOCK_WOODEN_SLAB) || (a_BlockType == E_BLOCK_STONE_SLAB) || (a_BlockType == E_BLOCK_NEW_STONE_SLAB)); + } + + + virtual void OnCancelRightClick(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override + { + if ((a_BlockFace == BLOCK_FACE_NONE) || (a_Player->GetEquippedItem().m_ItemType != (short)m_BlockType)) + { + return; + } + + // Sends the slab back to the client. It's to refuse a doubleslab placement. + a_Player->GetWorld()->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, a_Player); } @@ -119,6 +120,7 @@ public: { case E_BLOCK_STONE_SLAB: return E_BLOCK_DOUBLE_STONE_SLAB; case E_BLOCK_WOODEN_SLAB: return E_BLOCK_DOUBLE_WOODEN_SLAB; + case E_BLOCK_NEW_STONE_SLAB: return E_BLOCK_DOUBLE_NEW_STONE_SLAB; } ASSERT(!"Unhandled slab type!"); return E_BLOCK_AIR; @@ -158,21 +160,11 @@ public: { case E_BLOCK_DOUBLE_STONE_SLAB: return E_BLOCK_STONE_SLAB; case E_BLOCK_DOUBLE_WOODEN_SLAB: return E_BLOCK_WOODEN_SLAB; + case E_BLOCK_DOUBLE_NEW_STONE_SLAB: return E_BLOCK_NEW_STONE_SLAB; } ASSERT(!"Unhandled double slab type!"); return a_BlockType; } - - virtual const char * GetStepSound(void) override - { - switch (m_BlockType) - { - case E_BLOCK_DOUBLE_STONE_SLAB: return "step.stone"; - case E_BLOCK_DOUBLE_WOODEN_SLAB: return "step.wood"; - } - ASSERT(!"Unhandled double slab type!"); - return ""; - } } ; diff --git a/src/Blocks/BlockSnow.h b/src/Blocks/BlockSnow.h index 977f19a16..7b6094c9f 100644 --- a/src/Blocks/BlockSnow.h +++ b/src/Blocks/BlockSnow.h @@ -87,12 +87,6 @@ public: { return false; } - - - virtual const char * GetStepSound(void) override - { - return "step.cloth"; - } } ; diff --git a/src/Blocks/BlockStairs.h b/src/Blocks/BlockStairs.h index a7ccf1714..d396204e0 100644 --- a/src/Blocks/BlockStairs.h +++ b/src/Blocks/BlockStairs.h @@ -16,8 +16,8 @@ public: { } - - + + virtual bool GetPlacementBlockTypeMeta( cChunkInterface & a_ChunkInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, @@ -53,36 +53,21 @@ public: } return true; } - - - virtual const char * GetStepSound(void) override - { - if ( - (m_BlockType == E_BLOCK_WOODEN_STAIRS) || - (m_BlockType == E_BLOCK_SPRUCE_WOOD_STAIRS) || - (m_BlockType == E_BLOCK_JUNGLE_WOOD_STAIRS) || - (m_BlockType == E_BLOCK_ACACIA_WOOD_STAIRS) || - (m_BlockType == E_BLOCK_BIRCH_WOOD_STAIRS) || - (m_BlockType == E_BLOCK_DARK_OAK_WOOD_STAIRS) - ) - { - return "step.wood"; - } - return "step.stone"; - } virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - // Reset meta to 0 + // Reset meta to zero a_Pickups.push_back(cItem(m_BlockType, 1, 0)); } + virtual bool CanDirtGrowGrass(NIBBLETYPE a_Meta) override { return true; } - + + static NIBBLETYPE RotationToMetaData(double a_Rotation) { a_Rotation += 90 + 45; // So its not aligned with axis @@ -108,14 +93,11 @@ public: } } - virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override { // Toggle bit 3: return (a_Meta & 0x0b) | ((~a_Meta) & 0x04); } - - } ; diff --git a/src/Blocks/BlockStems.h b/src/Blocks/BlockStems.h index b726a0901..860c7dd45 100644 --- a/src/Blocks/BlockStems.h +++ b/src/Blocks/BlockStems.h @@ -47,12 +47,6 @@ public: { return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) == E_BLOCK_FARMLAND)); } - - - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } } ; diff --git a/src/Blocks/BlockStone.h b/src/Blocks/BlockStone.h index cd5230f49..e52599c0f 100644 --- a/src/Blocks/BlockStone.h +++ b/src/Blocks/BlockStone.h @@ -2,7 +2,7 @@ #pragma once #include "BlockHandler.h" - +#include "BlockID.h" @@ -18,9 +18,14 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - a_Pickups.push_back(cItem(E_BLOCK_COBBLESTONE, 1, 0)); + if (a_BlockMeta == E_META_STONE) + { + a_Pickups.push_back(cItem(E_BLOCK_COBBLESTONE, 1, 0)); + return; + } + a_Pickups.push_back(cItem(E_BLOCK_STONE, 1, a_BlockMeta)); } -} ; +}; diff --git a/src/Blocks/BlockSugarcane.h b/src/Blocks/BlockSugarcane.h index 84d3b2e7d..c832ff218 100644 --- a/src/Blocks/BlockSugarcane.h +++ b/src/Blocks/BlockSugarcane.h @@ -29,6 +29,7 @@ public: { return false; } + switch (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ)) { case E_BLOCK_DIRT: @@ -77,12 +78,6 @@ public: { a_Chunk.GetWorld()->GrowSugarcane(a_RelX + a_Chunk.GetPosX() * cChunkDef::Width, a_RelY, a_RelZ + a_Chunk.GetPosZ() * cChunkDef::Width, 1); } - - - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } } ; diff --git a/src/Blocks/BlockTNT.h b/src/Blocks/BlockTNT.h index 283a03730..3a573ae67 100644 --- a/src/Blocks/BlockTNT.h +++ b/src/Blocks/BlockTNT.h @@ -16,11 +16,6 @@ public: { } - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } - virtual void OnCancelRightClick(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override { a_WorldInterface.SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, a_Player); diff --git a/src/Blocks/BlockTallGrass.h b/src/Blocks/BlockTallGrass.h index 9c008f793..f520414a7 100644 --- a/src/Blocks/BlockTallGrass.h +++ b/src/Blocks/BlockTallGrass.h @@ -53,12 +53,6 @@ public: { return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) != E_BLOCK_AIR)); } - - - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } } ; diff --git a/src/Blocks/BlockTorch.h b/src/Blocks/BlockTorch.h index c73118870..e77bbd1b8 100644 --- a/src/Blocks/BlockTorch.h +++ b/src/Blocks/BlockTorch.h @@ -24,32 +24,23 @@ public: BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta ) override { - // Find proper placement of torch + BLOCKTYPE Block; + NIBBLETYPE Meta; + AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, true); // Set to clicked block + a_ChunkInterface.GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, Block, Meta); - if ((a_BlockFace == BLOCK_FACE_TOP) || (a_BlockFace == BLOCK_FACE_BOTTOM)) + if (!CanBePlacedOn(Block, Meta, a_BlockFace)) // Try to preserve original direction { - a_BlockFace = FindSuitableFace(a_ChunkInterface, a_BlockX, a_BlockY, a_BlockZ); // Top or bottom faces clicked, find a suitable face + // Torch couldn't be placed on whatever face was clicked, last ditch resort - find another face + + AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, false); // Reset to torch block + a_BlockFace = FindSuitableFace(a_ChunkInterface, a_BlockX, a_BlockY, a_BlockZ); // Set a_BlockFace to a valid direction which will be converted later to a metadata if (a_BlockFace == BLOCK_FACE_NONE) { - // Client wouldn't have sent anything anyway, but whatever + // No attachable face found - don't place the torch return false; } } - else - { - // Not top or bottom faces, try to preserve whatever face was clicked - AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, true); // Set to clicked block - if (!CanBePlacedOn(a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ), a_BlockFace)) - { - AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, false); // Reset to torch block - // Torch couldn't be placed on whatever face was clicked, last ditch resort - find another face - a_BlockFace = FindSuitableFace(a_ChunkInterface, a_BlockX, a_BlockY, a_BlockZ); - if (a_BlockFace == BLOCK_FACE_NONE) - { - return false; - } - } - } a_BlockType = m_BlockType; a_BlockMeta = DirectionToMetaData(a_BlockFace); @@ -97,42 +88,57 @@ public: } - static bool CanBePlacedOn(BLOCKTYPE a_BlockType, eBlockFace a_BlockFace) + static bool CanBePlacedOn(BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, eBlockFace a_BlockFace) { - if (!cBlockInfo::FullyOccupiesVoxel(a_BlockType)) - { - return (a_BlockFace == BLOCK_FACE_TOP); // Allow placement only when torch upright (for glass, etc.); exceptions won't even be sent by client, no need to handle - } - else + switch (a_BlockType) { - return true; + case E_BLOCK_END_PORTAL_FRAME: + case E_BLOCK_SOULSAND: + { + // Exceptional vanilla behaviour + return true; + } + case E_BLOCK_GLASS: + case E_BLOCK_STAINED_GLASS: + case E_BLOCK_FENCE: + case E_BLOCK_NETHER_BRICK_FENCE: + case E_BLOCK_COBBLESTONE_WALL: + { + // Torches can only be placed on top of these blocks + return (a_BlockFace == BLOCK_FACE_YP); + } + case E_BLOCK_STONE_SLAB: + case E_BLOCK_WOODEN_SLAB: + { + // Toches can be placed on the top of these slabs only if the occupy the top half of the voxel + return ((a_BlockFace == BLOCK_FACE_YP) && ((a_BlockMeta & 0x08) == 0x08)); + } + default: + { + if (cBlockInfo::FullyOccupiesVoxel(a_BlockType)) + { + // Torches can be placed on all sides of full blocks except the bottom + return (a_BlockFace != BLOCK_FACE_YM); + } + return false; + } } } - /// Finds a suitable face to place the torch, returning BLOCK_FACE_NONE on failure + /** Finds a suitable face to place the torch, returning BLOCK_FACE_NONE on failure */ static eBlockFace FindSuitableFace(cChunkInterface & a_ChunkInterface, int a_BlockX, int a_BlockY, int a_BlockZ) { for (int i = BLOCK_FACE_YM; i <= BLOCK_FACE_XP; i++) // Loop through all directions { eBlockFace Face = static_cast<eBlockFace>(i); AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, Face, true); - BLOCKTYPE BlockInQuestion = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ); - - // If on a block that can only hold a torch if torch is standing on it, return that face - if ( - ((BlockInQuestion == E_BLOCK_GLASS) || - (BlockInQuestion == E_BLOCK_FENCE) || - (BlockInQuestion == E_BLOCK_NETHER_BRICK_FENCE) || - (BlockInQuestion == E_BLOCK_COBBLESTONE_WALL)) && - (Face == BLOCK_FACE_TOP) - ) - { - return Face; - } - else if (cBlockInfo::FullyOccupiesVoxel(BlockInQuestion) && (i != BLOCK_FACE_BOTTOM)) + BLOCKTYPE BlockInQuestion; + NIBBLETYPE BlockInQuestionMeta; + a_ChunkInterface.GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, BlockInQuestion, BlockInQuestionMeta); + + if (CanBePlacedOn(BlockInQuestion, BlockInQuestionMeta, Face)) { - // Otherwise, if block in that direction is torch placeable and we haven't gotten to it via the bottom face, return that face return Face; } else @@ -148,34 +154,16 @@ public: virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override { eBlockFace Face = MetaDataToDirection(a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ)); - AddFaceDirection(a_RelX, a_RelY, a_RelZ, Face, true); + BLOCKTYPE BlockInQuestion; - a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockInQuestion); - - if ( - (BlockInQuestion == E_BLOCK_GLASS) || - (BlockInQuestion == E_BLOCK_STAINED_GLASS) || - (BlockInQuestion == E_BLOCK_FENCE) || - (BlockInQuestion == E_BLOCK_SOULSAND) || - (BlockInQuestion == E_BLOCK_MOB_SPAWNER) || - (BlockInQuestion == E_BLOCK_END_PORTAL_FRAME) || // Actual vanilla behaviour - (BlockInQuestion == E_BLOCK_NETHER_BRICK_FENCE) || - (BlockInQuestion == E_BLOCK_COBBLESTONE_WALL) - ) - { - // Torches can be placed on tops of glass and fences, despite them being 'untorcheable' - // No need to check for upright orientation, it was done when the torch was placed - return true; - } - else if (!cBlockInfo::FullyOccupiesVoxel(BlockInQuestion)) + NIBBLETYPE BlockInQuestionMeta; + if (!a_Chunk.UnboundedRelGetBlock(a_RelX, a_RelY, a_RelZ, BlockInQuestion, BlockInQuestionMeta)) { return false; } - else - { - return true; - } + + return CanBePlacedOn(BlockInQuestion, BlockInQuestionMeta, Face); } @@ -184,12 +172,6 @@ public: // Always drop meta = 0 a_Pickups.push_back(cItem(m_BlockType, 1, 0)); } - - - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } } ; diff --git a/src/Blocks/BlockTrapdoor.h b/src/Blocks/BlockTrapdoor.h index 6a36ab874..8c96de0f1 100644 --- a/src/Blocks/BlockTrapdoor.h +++ b/src/Blocks/BlockTrapdoor.h @@ -16,14 +16,9 @@ public: { } - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } - virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - // Reset meta to 0 + // Reset meta to zero a_Pickups.push_back(cItem(m_BlockType, 1, 0)); } @@ -34,6 +29,12 @@ public: virtual void OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override { + if (m_BlockType == E_BLOCK_IRON_TRAPDOOR) + { + // Iron doors can only be toggled by redstone, not by right-clicking + return; + } + // Flip the ON bit on/off using the XOR bitwise operation NIBBLETYPE Meta = (a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) ^ 0x04); a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta); @@ -53,7 +54,7 @@ public: int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta - ) override + ) override { a_BlockType = m_BlockType; a_BlockMeta = BlockFaceToMetaData(a_BlockFace); @@ -103,9 +104,10 @@ public: a_Chunk.UnboundedRelGetBlockMeta(a_RelX, a_RelY, a_RelZ, Meta); AddFaceDirection(a_RelX, a_RelY, a_RelZ, BlockMetaDataToBlockFace(Meta), true); - BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn); + BLOCKTYPE BlockIsOn; + a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn); - return (a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn); + return ((a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn)); } }; diff --git a/src/Blocks/BlockTripwire.h b/src/Blocks/BlockTripwire.h index 3ab17bf4a..d03f37537 100644 --- a/src/Blocks/BlockTripwire.h +++ b/src/Blocks/BlockTripwire.h @@ -20,11 +20,6 @@ public: { a_Pickups.push_back(cItem(E_ITEM_STRING, 1, 0)); } - - virtual const char * GetStepSound(void) override - { - return ""; - } }; diff --git a/src/Blocks/BlockTripwireHook.h b/src/Blocks/BlockTripwireHook.h index f849fb8ad..88d389711 100644 --- a/src/Blocks/BlockTripwireHook.h +++ b/src/Blocks/BlockTripwireHook.h @@ -21,10 +21,9 @@ public: int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta - ) override + ) override { a_BlockType = m_BlockType; - a_BlockMeta = DirectionToMetadata(a_BlockFace); return true; @@ -56,7 +55,7 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - // Reset meta to 0 + // Reset meta to zero a_Pickups.push_back(cItem(E_BLOCK_TRIPWIRE_HOOK, 1, 0)); } @@ -66,14 +65,10 @@ public: a_Chunk.UnboundedRelGetBlockMeta(a_RelX, a_RelY, a_RelZ, Meta); AddFaceDirection(a_RelX, a_RelY, a_RelZ, MetadataToDirection(Meta), true); - BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn); - - return (a_RelY > 0) && cBlockInfo::FullyOccupiesVoxel(BlockIsOn); - } + BLOCKTYPE BlockIsOn; + a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn); - virtual const char * GetStepSound(void) override - { - return "step.wood"; + return ((a_RelY > 0) && cBlockInfo::FullyOccupiesVoxel(BlockIsOn)); } }; diff --git a/src/Blocks/BlockVine.h b/src/Blocks/BlockVine.h index 1e1f6d8d2..06d84f2d4 100644 --- a/src/Blocks/BlockVine.h +++ b/src/Blocks/BlockVine.h @@ -2,7 +2,7 @@ #include "BlockHandler.h" #include "MetaRotator.h" - +#include "Bindings/PluginManager.h" @@ -46,7 +46,7 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - // Reset meta to 0 + // Reset meta to zero a_Pickups.push_back(cItem(E_BLOCK_VINES, 1, 0)); } @@ -80,7 +80,7 @@ public: /// Returns true if the specified block type is good for vines to attach to static bool IsBlockAttachable(BLOCKTYPE a_BlockType) { - return (a_BlockType == E_BLOCK_LEAVES) || (a_BlockType == E_BLOCK_NEW_LEAVES) || cBlockInfo::IsSolid(a_BlockType); + return ((a_BlockType == E_BLOCK_LEAVES) || (a_BlockType == E_BLOCK_NEW_LEAVES) || cBlockInfo::IsSolid(a_BlockType)); } @@ -159,12 +159,6 @@ public: { return true; } - - - virtual const char * GetStepSound(void) override - { - return "step.grass"; - } virtual bool DoesDropOnUnsuitable(void) override @@ -182,7 +176,7 @@ public: a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY - 1, a_RelZ, Block); if (Block == E_BLOCK_AIR) { - if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, a_RelX * cChunkDef::Width, a_RelY - 1, a_RelZ * cChunkDef::Width, ssVineSpread)) + if (!cRoot::Get()->GetPluginManager()->CallHookBlockSpread((cWorld*) &a_WorldInterface, a_RelX + a_Chunk.GetPosX() * cChunkDef::Width, a_RelY - 1, a_RelZ + a_Chunk.GetPosZ() * cChunkDef::Width, ssVineSpread)) { a_Chunk.UnboundedRelSetBlock(a_RelX, a_RelY - 1, a_RelZ, E_BLOCK_VINES, a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ)); } diff --git a/src/Blocks/BlockWallSign.h b/src/Blocks/BlockWallSign.h index e837b315e..0abe9c52c 100644 --- a/src/Blocks/BlockWallSign.h +++ b/src/Blocks/BlockWallSign.h @@ -27,12 +27,6 @@ public: } - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } - - virtual void OnPlacedByPlayer( cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, @@ -49,8 +43,9 @@ public: int BlockX = (a_Chunk.GetPosX() * cChunkDef::Width) + a_RelX; int BlockZ = (a_Chunk.GetPosZ() * cChunkDef::Width) + a_RelZ; GetBlockCoordsBehindTheSign(a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ), BlockX, BlockZ); + BLOCKTYPE Type = a_ChunkInterface.GetBlock(BlockX, a_RelY, BlockZ); - return (cBlockInfo::IsSolid(a_ChunkInterface.GetBlock(BlockX, a_RelY, BlockZ))); + return ((Type == E_BLOCK_WALLSIGN) || (Type == E_BLOCK_SIGN_POST) || cBlockInfo::IsSolid(Type)); } diff --git a/src/Blocks/BlockWorkbench.h b/src/Blocks/BlockWorkbench.h index 70468369c..699badaf2 100644 --- a/src/Blocks/BlockWorkbench.h +++ b/src/Blocks/BlockWorkbench.h @@ -30,12 +30,6 @@ public: { return true; } - - - virtual const char * GetStepSound(void) override - { - return "step.wood"; - } } ; diff --git a/src/Blocks/CMakeLists.txt b/src/Blocks/CMakeLists.txt index 05b7bfab4..eed949aab 100644 --- a/src/Blocks/CMakeLists.txt +++ b/src/Blocks/CMakeLists.txt @@ -45,7 +45,6 @@ SET (HDRS BlockGlowstone.h BlockGravel.h BlockHandler.h - BlockHayBale.h BlockHopper.h BlockIce.h BlockLadder.h @@ -57,8 +56,6 @@ SET (HDRS BlockMushroom.h BlockMycelium.h BlockNetherWart.h - BlockNewLeaves.h - BlockNote.h BlockOre.h BlockPiston.h BlockPlanks.h diff --git a/src/Blocks/ChunkInterface.cpp b/src/Blocks/ChunkInterface.cpp index 540581ae7..817640e98 100644 --- a/src/Blocks/ChunkInterface.cpp +++ b/src/Blocks/ChunkInterface.cpp @@ -2,7 +2,139 @@ #include "Globals.h" #include "ChunkInterface.h" +#include "ChunkMap.h" #include "BlockHandler.h" +#include "WorldInterface.h" + + + + + + +BLOCKTYPE cChunkInterface::GetBlock(int a_BlockX, int a_BlockY, int a_BlockZ) +{ + return m_ChunkMap->GetBlock(a_BlockX, a_BlockY, a_BlockZ); +} + + + + + +BLOCKTYPE cChunkInterface::GetBlock(const Vector3i & a_Pos) +{ + return GetBlock(a_Pos.x, a_Pos.y, a_Pos.z); +} + + + + + +NIBBLETYPE cChunkInterface::GetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ) +{ + return m_ChunkMap->GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); +} + + + + + + +bool cChunkInterface::GetBlockTypeMeta(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) +{ + return m_ChunkMap->GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta); +} + + + + + + +/** Sets the block at the specified coords to the specified value. +Full processing, incl. updating neighbors, is performed. +*/ +void cChunkInterface::SetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) +{ + m_ChunkMap->SetBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta); +} + + + + + + +void cChunkInterface::SetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE a_MetaData) +{ + m_ChunkMap->SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, a_MetaData); +} + + + + + + +void cChunkInterface::QueueSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, int a_TickDelay, BLOCKTYPE a_PreviousBlockType, cWorldInterface & a_WorldInterface) +{ + m_ChunkMap->QueueSetBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta, a_WorldInterface.GetWorldAge() + a_TickDelay, a_PreviousBlockType); +} + + + + + + +/** Sets the block at the specified coords to the specified value. +The replacement doesn't trigger block updates. +The replaced blocks aren't checked for block entities (block entity is leaked if it exists at this block) +*/ +void cChunkInterface::FastSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) +{ + m_ChunkMap->FastSetBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta); +} + + + + + + +void cChunkInterface::FastSetBlock(const Vector3i & a_Pos, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) +{ + FastSetBlock( a_Pos.x, a_Pos.y, a_Pos.z, a_BlockType, a_BlockMeta); +} + + + + + + +void cChunkInterface::UseBlockEntity(cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) +{ + m_ChunkMap->UseBlockEntity(a_Player, a_BlockX, a_BlockY, a_BlockZ); +} + + + + + + +bool cChunkInterface::ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) +{ + return m_ChunkMap->ForEachChunkInRect(a_MinChunkX, a_MaxChunkX, a_MinChunkZ, a_MaxChunkZ, a_Callback); +} + + + + + + +bool cChunkInterface::WriteBlockArea(cBlockArea & a_Area, int a_MinBlockX, int a_MinBlockY, int a_MinBlockZ, int a_DataTypes) +{ + return m_ChunkMap->WriteBlockArea(a_Area, a_MinBlockX, a_MinBlockY, a_MinBlockZ, a_DataTypes); +} + + + + + bool cChunkInterface::DigBlock(cWorldInterface & a_WorldInterface, int a_X, int a_Y, int a_Z) { @@ -10,3 +142,4 @@ bool cChunkInterface::DigBlock(cWorldInterface & a_WorldInterface, int a_X, int Handler->OnDestroyed(*this, a_WorldInterface, a_X, a_Y, a_Z); return m_ChunkMap->DigBlock(a_X, a_Y, a_Z); } + diff --git a/src/Blocks/ChunkInterface.h b/src/Blocks/ChunkInterface.h index dea9d7c7e..2f0cfea11 100644 --- a/src/Blocks/ChunkInterface.h +++ b/src/Blocks/ChunkInterface.h @@ -1,13 +1,13 @@ #pragma once -#include "../ChunkMap.h" #include "../ForEachChunkProvider.h" -#include "WorldInterface.h" - +class cChunkMap; +class cWorldInterface; +class cPlayer; class cChunkInterface: public cForEachChunkProvider @@ -16,70 +16,34 @@ public: cChunkInterface(cChunkMap * a_ChunkMap) : m_ChunkMap(a_ChunkMap) {} - BLOCKTYPE GetBlock(int a_BlockX, int a_BlockY, int a_BlockZ) - { - return m_ChunkMap->GetBlock(a_BlockX, a_BlockY, a_BlockZ); - } - BLOCKTYPE GetBlock(const Vector3i & a_Pos) - { - return GetBlock(a_Pos.x, a_Pos.y, a_Pos.z); - } - NIBBLETYPE GetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ) - { - return m_ChunkMap->GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ); - } + BLOCKTYPE GetBlock(int a_BlockX, int a_BlockY, int a_BlockZ); + BLOCKTYPE GetBlock(const Vector3i & a_Pos); + NIBBLETYPE GetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ); - bool GetBlockTypeMeta(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) - { - return m_ChunkMap->GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta); - } + bool GetBlockTypeMeta(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta); /** Sets the block at the specified coords to the specified value. Full processing, incl. updating neighbors, is performed. */ - void SetBlock(cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) - { - m_ChunkMap->SetBlock(a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta); - } + void SetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta); - void SetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE a_MetaData) - { - m_ChunkMap->SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, a_MetaData); - } + void SetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE a_MetaData); - void QueueSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, int a_TickDelay, BLOCKTYPE a_PreviousBlockType, cWorldInterface & a_WorldInterface) - { - m_ChunkMap->QueueSetBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta, a_WorldInterface.GetWorldAge() + a_TickDelay, a_PreviousBlockType); - } + void QueueSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, int a_TickDelay, BLOCKTYPE a_PreviousBlockType, cWorldInterface & a_WorldInterface); /** Sets the block at the specified coords to the specified value. The replacement doesn't trigger block updates. The replaced blocks aren't checked for block entities (block entity is leaked if it exists at this block) */ - void FastSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) - { - m_ChunkMap->FastSetBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta); - } + void FastSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta); - void FastSetBlock(const Vector3i & a_Pos, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) - { - FastSetBlock( a_Pos.x, a_Pos.y, a_Pos.z, a_BlockType, a_BlockMeta); - } + void FastSetBlock(const Vector3i & a_Pos, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta); - void UseBlockEntity(cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) - { - m_ChunkMap->UseBlockEntity(a_Player, a_BlockX, a_BlockY, a_BlockZ); - } + void UseBlockEntity(cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ); - virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) override - { - return m_ChunkMap->ForEachChunkInRect(a_MinChunkX, a_MaxChunkX, a_MinChunkZ, a_MaxChunkZ, a_Callback); - } + virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) override; - virtual bool WriteBlockArea(cBlockArea & a_Area, int a_MinBlockX, int a_MinBlockY, int a_MinBlockZ, int a_DataTypes) override - { - return m_ChunkMap->WriteBlockArea(a_Area, a_MinBlockX, a_MinBlockY, a_MinBlockZ, a_DataTypes); - } + virtual bool WriteBlockArea(cBlockArea & a_Area, int a_MinBlockX, int a_MinBlockY, int a_MinBlockZ, int a_DataTypes) override; bool DigBlock(cWorldInterface & a_WorldInterface, int a_X, int a_Y, int a_Z); diff --git a/src/Blocks/ClearMetaOnDrop.h b/src/Blocks/ClearMetaOnDrop.h index f2afbc6ea..aa4f23848 100644 --- a/src/Blocks/ClearMetaOnDrop.h +++ b/src/Blocks/ClearMetaOnDrop.h @@ -7,7 +7,7 @@ // For example to use in class Foo which should inherit Bar use // class Foo : public cClearMetaOnDrop<Bar>; -template<class Base> +template <class Base> class cClearMetaOnDrop : public Base { public: diff --git a/src/Blocks/GetHandlerCompileTimeTemplate.h b/src/Blocks/GetHandlerCompileTimeTemplate.h new file mode 100644 index 000000000..3466b5426 --- /dev/null +++ b/src/Blocks/GetHandlerCompileTimeTemplate.h @@ -0,0 +1,91 @@ + +#pragma once + +class cBlockTorchHandler; +class cBlockLeverHandler; +class cBlockButtonHandler; +class cBlockTripwireHookHandler; +class cBlockDoorHandler; +class cBlockPistonHandler; + + + + + + +template<BLOCKTYPE T> +class GetHandlerCompileTime; + + + + + + + +template<> +class GetHandlerCompileTime<E_BLOCK_TORCH> +{ +public: + typedef cBlockTorchHandler type; +}; + + + + + + +template<> +class GetHandlerCompileTime<E_BLOCK_LEVER> +{ +public: + typedef cBlockLeverHandler type; +}; + + + + + + +template<> +class GetHandlerCompileTime<E_BLOCK_STONE_BUTTON> +{ +public: + typedef cBlockButtonHandler type; +}; + + + + + + +template<> +class GetHandlerCompileTime<E_BLOCK_TRIPWIRE_HOOK> +{ +public: + typedef cBlockTripwireHookHandler type; +}; + + + + + + +template<> +class GetHandlerCompileTime<E_BLOCK_WOODEN_DOOR> +{ +public: + typedef cBlockDoorHandler type; +}; + + + + + + +template<> +class GetHandlerCompileTime<E_BLOCK_PISTON> +{ +public: + typedef cBlockPistonHandler type; +}; + diff --git a/src/Blocks/MetaRotator.h b/src/Blocks/MetaRotator.h index 599aa7ef9..4c268077a 100644 --- a/src/Blocks/MetaRotator.h +++ b/src/Blocks/MetaRotator.h @@ -20,7 +20,7 @@ Usage: Inherit from this class providing your base class as Base, the BitMask for the direction bits in bitmask and the masked value for the directions in North, East, South, West. There is also an aptional parameter AssertIfNotMatched. Set this if it is invalid for a block to exist in any other state. */ -template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched = false> +template <class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched = false> class cMetaRotator : public Base { public: @@ -41,7 +41,7 @@ public: -template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> +template <class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCW(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); @@ -63,7 +63,7 @@ NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatc -template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> +template <class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCCW(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); @@ -85,7 +85,7 @@ NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatc -template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> +template <class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorXY(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); @@ -102,7 +102,7 @@ NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatc -template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> +template <class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched> NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorYZ(NIBBLETYPE a_Meta) { NIBBLETYPE OtherMeta = a_Meta & (~BitMask); diff --git a/src/Blocks/WorldInterface.h b/src/Blocks/WorldInterface.h index d1c6f9bfc..106c314e7 100644 --- a/src/Blocks/WorldInterface.h +++ b/src/Blocks/WorldInterface.h @@ -2,14 +2,15 @@ #pragma once #include "BroadcastInterface.h" -#include "../Mobs/Monster.h" +#include "../Mobs/MonsterTypes.h" class cItems; typedef cItemCallback<cBlockEntity> cBlockEntityCallback; - +class cMonster; +class cPlayer; class cWorldInterface @@ -17,7 +18,7 @@ class cWorldInterface public: virtual ~cWorldInterface() {} - virtual Int64 GetTimeOfDay(void) const = 0; + virtual int GetTimeOfDay(void) const = 0; virtual Int64 GetWorldAge(void) const = 0; virtual eDimension GetDimension(void) const = 0; @@ -33,7 +34,10 @@ public: virtual void SpawnItemPickups(const cItems & a_Pickups, double a_BlockX, double a_BlockY, double a_BlockZ, double a_SpeedX, double a_SpeedY, double a_SpeedZ, bool IsPlayerCreated = false) = 0; /** Spawns a mob of the specified type. Returns the mob's EntityID if recognized and spawned, <0 otherwise */ - virtual int SpawnMob(double a_PosX, double a_PosY, double a_PosZ, cMonster::eType a_MonsterType) = 0; + virtual int SpawnMob(double a_PosX, double a_PosY, double a_PosZ, eMonsterType a_MonsterType) = 0; + + /** Spawns an experience orb at the given location with the given reward. It returns the UniqueID of the spawned experience orb. */ + virtual int SpawnExperienceOrb(double a_X, double a_Y, double a_Z, int a_Reward) = 0; /** Calls the callback for the block entity at the specified coords; returns false if there's no block entity at those coords, true if found */ virtual bool DoWithBlockEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBlockEntityCallback & a_Callback) = 0; @@ -44,7 +48,7 @@ public: /** Calls the callback for each player in the list; returns true if all players processed, false if the callback aborted by returning true */ virtual bool ForEachPlayer(cItemCallback<cPlayer> & a_Callback) = 0; - virtual void SetTimeOfDay(Int64 a_TimeOfDay) = 0; + virtual void SetTimeOfDay(int a_TimeOfDay) = 0; /** Returns true if it is raining, stormy or snowing at the specified location. This takes into account biomes. */ virtual bool IsWeatherWetAt(int a_BlockX, int a_BlockZ) = 0; diff --git a/src/BoundingBox.h b/src/BoundingBox.h index 793466302..928e62afa 100644 --- a/src/BoundingBox.h +++ b/src/BoundingBox.h @@ -80,6 +80,17 @@ public: /// Calculates the intersection of the two bounding boxes; returns true if nonempty bool Intersect(const cBoundingBox & a_Other, cBoundingBox & a_Intersection); + double GetMinX(void) const { return m_Min.x; } + double GetMinY(void) const { return m_Min.y; } + double GetMinZ(void) const { return m_Min.z; } + + double GetMaxX(void) const { return m_Max.x; } + double GetMaxY(void) const { return m_Max.y; } + double GetMaxZ(void) const { return m_Max.z; } + + const Vector3d & GetMin(void) const { return m_Min; } + const Vector3d & GetMax(void) const { return m_Max; } + protected: Vector3d m_Min; Vector3d m_Max; diff --git a/src/BuildInfo.h.cmake b/src/BuildInfo.h.cmake new file mode 100644 index 000000000..6337dab3e --- /dev/null +++ b/src/BuildInfo.h.cmake @@ -0,0 +1,15 @@ + +#pragma once + +#cmakedefine BUILD_ID + +#ifdef BUILD_ID + +#undef BUILD_ID + +#define BUILD_SERIES_NAME "@BUILD_SERIES_NAME@" +#define BUILD_ID "@BUILD_ID@" +#define BUILD_COMMIT_ID "@BUILD_COMMIT_ID@" +#define BUILD_DATETIME "@BUILD_DATETIME@" +#endif + diff --git a/src/ByteBuffer.cpp b/src/ByteBuffer.cpp index 64b31c60b..dc6b32a44 100644 --- a/src/ByteBuffer.cpp +++ b/src/ByteBuffer.cpp @@ -27,7 +27,7 @@ ) #define IS_LITTLE_ENDIAN #elif ( \ - defined (__ARMEB__) || defined(__sparc) \ + defined (__ARMEB__) || defined(__sparc) || defined(__powerpc__) || defined(__POWERPC__) \ ) #define IS_BIG_ENDIAN #else @@ -267,7 +267,7 @@ size_t cByteBuffer::GetReadableSpace(void) const } // Single readable space partition: ASSERT(m_WritePos >= m_ReadPos); - return m_WritePos - m_ReadPos ; + return m_WritePos - m_ReadPos; } @@ -489,6 +489,30 @@ bool cByteBuffer::ReadLEInt(int & a_Value) +bool cByteBuffer::ReadPosition(int & a_BlockX, int & a_BlockY, int & a_BlockZ) +{ + Int64 Value; + if (!ReadBEInt64(Value)) + { + return false; + } + + // Convert the 64 received bits into 3 coords: + UInt32 BlockXRaw = (Value >> 38) & 0x03ffffff; // Top 26 bits + UInt32 BlockYRaw = (Value >> 26) & 0x0fff; // Middle 12 bits + UInt32 BlockZRaw = (Value & 0x03ffffff); // Bottom 26 bits + + // If the highest bit in the number's range is set, convert the number into negative: + a_BlockX = ((BlockXRaw & 0x02000000) == 0) ? BlockXRaw : -(0x04000000 - (int)BlockXRaw); + a_BlockY = ((BlockYRaw & 0x0800) == 0) ? BlockYRaw : -(0x0800 - (int)BlockYRaw); + a_BlockZ = ((BlockZRaw & 0x02000000) == 0) ? BlockZRaw : -(0x04000000 - (int)BlockZRaw); + return true; +} + + + + + bool cByteBuffer::WriteChar(char a_Value) { CHECK_THREAD; @@ -526,6 +550,19 @@ bool cByteBuffer::WriteBEShort(short a_Value) +bool cByteBuffer::WriteBEUShort(unsigned short a_Value) +{ + CHECK_THREAD; + CheckValid(); + PUTBYTES(2); + u_short Converted = htons((u_short)a_Value); + return WriteBuf(&Converted, 2); +} + + + + + bool cByteBuffer::WriteBEInt(int a_Value) { CHECK_THREAD; @@ -590,23 +627,6 @@ bool cByteBuffer::WriteBool(bool a_Value) -bool cByteBuffer::WriteBEUTF16String16(const AString & a_Value) -{ - CHECK_THREAD; - CheckValid(); - PUTBYTES(2); - AString UTF16BE; - UTF8ToRawBEUTF16(a_Value.data(), a_Value.size(), UTF16BE); - WriteBEShort((short)(UTF16BE.size() / 2)); - PUTBYTES(UTF16BE.size()); - WriteBuf(UTF16BE.data(), UTF16BE.size()); - return true; -} - - - - - bool cByteBuffer::WriteVarInt(UInt32 a_Value) { CHECK_THREAD; @@ -661,6 +681,15 @@ bool cByteBuffer::WriteLEInt(int a_Value) +bool cByteBuffer::WritePosition(int a_BlockX, int a_BlockY, int a_BlockZ) +{ + return WriteBEInt64(((Int64)a_BlockX & 0x3FFFFFF) << 38 | ((Int64)a_BlockY & 0xFFF) << 26 | ((Int64)a_BlockZ & 0x3FFFFFF)); +} + + + + + bool cByteBuffer::ReadBuf(void * a_Buffer, size_t a_Count) { CHECK_THREAD; diff --git a/src/ByteBuffer.h b/src/ByteBuffer.h index adaa00330..70de419f0 100644 --- a/src/ByteBuffer.h +++ b/src/ByteBuffer.h @@ -64,6 +64,7 @@ public: bool ReadVarInt (UInt32 & a_Value); bool ReadVarUTF8String (AString & a_Value); // string length as VarInt, then string as UTF-8 bool ReadLEInt (int & a_Value); + bool ReadPosition (int & a_BlockX, int & a_BlockY, int & a_BlockZ); /** Reads VarInt, assigns it to anything that can be assigned from an UInt32 (unsigned short, char, Byte, double, ...) */ template <typename T> bool ReadVarInt(T & a_Value) @@ -81,15 +82,16 @@ public: bool WriteChar (char a_Value); bool WriteByte (unsigned char a_Value); bool WriteBEShort (short a_Value); + bool WriteBEUShort (unsigned short a_Value); bool WriteBEInt (int a_Value); bool WriteBEInt64 (Int64 a_Value); bool WriteBEFloat (float a_Value); bool WriteBEDouble (double a_Value); bool WriteBool (bool a_Value); - bool WriteBEUTF16String16(const AString & a_Value); // string length as BE short, then string as UTF-16BE bool WriteVarInt (UInt32 a_Value); bool WriteVarUTF8String (const AString & a_Value); // string length as VarInt, then string as UTF-8 bool WriteLEInt (int a_Value); + bool WritePosition (int a_BlockX, int a_BlockY, int a_BlockZ); /** Reads a_Count bytes into a_Buffer; returns true if successful */ bool ReadBuf(void * a_Buffer, size_t a_Count); diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt index 29337cb2e..9d0e2cede 100644 --- a/src/CMakeLists.txt +++ b/src/CMakeLists.txt @@ -1,6 +1,7 @@ cmake_minimum_required (VERSION 2.8.2) project (MCServer) + include_directories (SYSTEM "${CMAKE_CURRENT_SOURCE_DIR}/../lib/") include_directories (SYSTEM "${CMAKE_CURRENT_SOURCE_DIR}/../lib/jsoncpp/include") include_directories (SYSTEM "${CMAKE_CURRENT_SOURCE_DIR}/../lib/polarssl/include") @@ -33,16 +34,14 @@ SET (SRCS FastRandom.cpp FurnaceRecipe.cpp Globals.cpp - Group.cpp - GroupManager.cpp Inventory.cpp Item.cpp ItemGrid.cpp LightingThread.cpp LineBlockTracer.cpp LinearInterpolation.cpp - Log.cpp - MCLogger.cpp + LoggerListeners.cpp + Logger.cpp Map.cpp MapManager.cpp MobCensus.cpp @@ -52,6 +51,7 @@ SET (SRCS MonsterConfig.cpp Noise.cpp ProbabDistrib.cpp + RankManager.cpp RCONServer.cpp Root.cpp Scoreboard.cpp @@ -75,6 +75,7 @@ SET (HDRS BlockInfo.h BlockTracer.h BoundingBox.h + BuildInfo.h.cmake ByteBuffer.h ChatColor.h Chunk.h @@ -97,8 +98,6 @@ SET (HDRS ForEachChunkProvider.h FurnaceRecipe.h Globals.h - Group.h - GroupManager.h Inventory.h Item.h ItemGrid.h @@ -107,8 +106,8 @@ SET (HDRS LineBlockTracer.h LinearInterpolation.h LinearUpscale.h - Log.h - MCLogger.h + Logger.h + LoggerListeners.h Map.h MapManager.h Matrix4.h @@ -121,6 +120,7 @@ SET (HDRS MonsterConfig.h Noise.h ProbabDistrib.h + RankManager.h RCONServer.h Root.h Scoreboard.h @@ -138,6 +138,10 @@ SET (HDRS XMLParser.h) include_directories(".") +include_directories ("${CMAKE_CURRENT_SOURCE_DIR}/../lib/sqlite") +include_directories ("${CMAKE_CURRENT_SOURCE_DIR}/../lib/SQLiteCpp/include") + +configure_file("BuildInfo.h.cmake" "${CMAKE_CURRENT_SOURCE_DIR}/BuildInfo.h") if (NOT MSVC) # Bindings need to reference other folders, so they are done here instead @@ -151,10 +155,10 @@ if (NOT MSVC) get_directory_property(BINDING_DEPENDENCIES DIRECTORY "Bindings" DEFINITION BINDING_DEPENDENCIES) #clear file - file(WRITE ${CMAKE_CURRENT_SOURCE_DIR}/Bindings/BindingDependecies.txt) - foreach(dependecy ${BINDING_DEPENDECIES}) - #write each dependecy on a seperate line - file(APPEND ${CMAKE_CURRENT_SOURCE_DIR}/Bindings/BindingDependecies.txt "${dependecy}\n") + file(WRITE ${CMAKE_CURRENT_SOURCE_DIR}/Bindings/BindingDependencies.txt) + foreach(dependency ${BINDING_DEPENDENCIES}) + #write each dependency on a seperate line + file(APPEND ${CMAKE_CURRENT_SOURCE_DIR}/Bindings/BindingDependencies.txt "${dependency}\n") endforeach() set_directory_properties(PROPERTIES ADDITIONAL_MAKE_CLEAN_FILES "Bindings.cpp Bindings.h") @@ -232,7 +236,7 @@ endif() # Generate a list of all source files: -set(ALLFILES "") +set(ALLFILES "${SRCS}" "${HDRS}") foreach(folder ${FOLDERS}) get_directory_property(FOLDER_SRCS DIRECTORY ${folder} DEFINITION SRCS) foreach (src ${FOLDER_SRCS}) @@ -255,6 +259,11 @@ set(EXECUTABLE MCServer) if (MSVC) get_directory_property(BINDING_OUTPUTS DIRECTORY "Bindings" DEFINITION BINDING_OUTPUTS) get_directory_property(BINDING_DEPENDENCIES DIRECTORY "Bindings" DEFINITION BINDING_DEPENDENCIES) + + # The paths in BINDING_DEPENDENCIES are relative to the Bindings folder, convert them relative to this folder: + foreach (dep ${BINDING_DEPENDENCIES}) + list (APPEND BINDINGS_DEPENDENCIES "Bindings/${dep}") + endforeach(dep) ADD_CUSTOM_COMMAND( OUTPUT ${BINDING_OUTPUTS} @@ -267,7 +276,7 @@ if (MSVC) WORKING_DIRECTORY ${CMAKE_CURRENT_SOURCE_DIR}/Bindings/ # add any new generation dependencies here - DEPENDS ${BINDING_DEPENDENCIES} + DEPENDS ${BINDINGS_DEPENDENCIES} ) endif() @@ -311,4 +320,4 @@ endif () if (WIN32) target_link_libraries(${EXECUTABLE} expat tolualib ws2_32.lib Psapi.lib) endif() -target_link_libraries(${EXECUTABLE} luaexpat iniFile jsoncpp polarssl zlib sqlite lua) +target_link_libraries(${EXECUTABLE} luaexpat iniFile jsoncpp polarssl zlib sqlite lua SQLiteCpp) diff --git a/src/CheckBasicStyle.lua b/src/CheckBasicStyle.lua index 13a6d15d2..b244b1fbc 100644 --- a/src/CheckBasicStyle.lua +++ b/src/CheckBasicStyle.lua @@ -10,10 +10,11 @@ Checks that all source files (*.cpp, *.h) use the basic style requirements of th - Spaces after comma, not before - Opening braces not at the end of a code line - Spaces after if, for, while + - Line dividers (////...) exactly 80 slashes + - Multi-level indent change - (TODO) Spaces before *, /, & - (TODO) Hex numbers with even digit length - (TODO) Hex numbers in lowercase - - (TODO) Line dividers (////...) exactly 80 slashes - (TODO) Not using "* "-style doxy comment continuation lines Violations that cannot be checked easily: @@ -107,7 +108,7 @@ local g_ViolationPatterns = -- Check that all commas have spaces after them and not in front of them: {" ,", "Extra space before a \",\""}, - {",[^%s\"%%]", "Needs a space after a \",\""}, -- Report all except >> "," << needed for splitting and >>,%s<< needed for formatting + {",[^%s\"%%\']", "Needs a space after a \",\""}, -- Report all except >> "," << needed for splitting and >>,%s<< needed for formatting -- Check that opening braces are not at the end of a code line: {"[^%s].-{\n?$", "Brace should be on a separate line"}, @@ -118,6 +119,7 @@ local g_ViolationPatterns = {"while%(", "Needs a space after \"while\""}, {"switch%(", "Needs a space after \"switch\""}, {"catch%(", "Needs a space after \"catch\""}, + {"template<", "Needs a space after \"template\""}, -- No space after keyword's parenthesis: {"[^%a#]if %( ", "Remove the space after \"(\""}, @@ -158,6 +160,7 @@ local function ProcessFile(a_FileName) -- Process each line separately: -- Ref.: http://stackoverflow.com/questions/10416869/iterate-over-possibly-empty-lines-in-a-way-that-matches-the-expectations-of-exis local lineCounter = 1 + local lastIndentLevel = 0 all:gsub("\r\n", "\n") -- normalize CRLF into LF-only string.gsub(all .. "\n", "[^\n]*\n", -- Iterate over each line, while preserving empty lines function(a_Line) @@ -165,6 +168,35 @@ local function ProcessFile(a_FileName) for _, pat in ipairs(g_ViolationPatterns) do ReportViolationIfFound(a_Line, a_FileName, lineCounter, pat[1], pat[2]) end + + -- Check that divider comments are well formed - 80 slashes plus optional indent: + local dividerStart, dividerEnd = a_Line:find("/////*") + if (dividerStart) then + if (dividerEnd ~= dividerStart + 79) then + ReportViolation(a_FileName, lineCounter, 1, 80, "Divider comment should have exactly 80 slashes") + end + if (dividerStart > 1) then + if ( + (a_Line:sub(1, dividerStart - 1) ~= string.rep("\t", dividerStart - 1)) or -- The divider should have only indent in front of it + (a_Line:len() > dividerEnd + 1) -- The divider should have no other text following it + ) then + ReportViolation(a_FileName, lineCounter, 1, 80, "Divider comment shouldn't have any extra text around it") + end + end + end + + -- Check the indent level change from the last line, if it's too much, report: + local indentStart, indentEnd = a_Line:find("\t+") + local indentLevel = 0 + if (indentStart) then + indentLevel = indentEnd - indentStart + end + if (indentLevel > 0) then + if ((lastIndentLevel - indentLevel >= 2) or (lastIndentLevel - indentLevel <= -2)) then + ReportViolation(a_FileName, lineCounter, 1, indentStart or 1, "Indent changed more than a single level between the previous line and this one: from " .. lastIndentLevel .. " to " .. indentLevel) + end + lastIndentLevel = indentLevel + end lineCounter = lineCounter + 1 end diff --git a/src/Chunk.cpp b/src/Chunk.cpp index b83036b6d..96b8eda4e 100644 --- a/src/Chunk.cpp +++ b/src/Chunk.cpp @@ -1,3 +1,4 @@ + #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules #ifndef _WIN32 @@ -11,6 +12,7 @@ #include "Server.h" #include "zlib/zlib.h" #include "Defines.h" +#include "BlockEntities/BeaconEntity.h" #include "BlockEntities/ChestEntity.h" #include "BlockEntities/DispenserEntity.h" #include "BlockEntities/DropperEntity.h" @@ -35,6 +37,8 @@ #include "MobSpawner.h" #include "BlockInServerPluginInterface.h" #include "SetChunkData.h" +#include "BoundingBox.h" +#include "Blocks/ChunkInterface.h" #include "json/json.h" @@ -63,19 +67,18 @@ sSetBlock::sSetBlock( int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_Bloc // cChunk: cChunk::cChunk( - int a_ChunkX, int a_ChunkY, int a_ChunkZ, + int a_ChunkX, int a_ChunkZ, cChunkMap * a_ChunkMap, cWorld * a_World, cChunk * a_NeighborXM, cChunk * a_NeighborXP, cChunk * a_NeighborZM, cChunk * a_NeighborZP, cAllocationPool<cChunkData::sChunkSection> & a_Pool ) : - m_IsValid(false), + m_Presence(cpInvalid), m_IsLightValid(false), m_IsDirty(false), m_IsSaving(false), m_HasLoadFailed(false), m_StayCount(0), m_PosX(a_ChunkX), - m_PosY(a_ChunkY), m_PosZ(a_ChunkZ), m_World(a_World), m_ChunkMap(a_ChunkMap), @@ -89,6 +92,7 @@ cChunk::cChunk( m_NeighborZP(a_NeighborZP), m_WaterSimulatorData(a_World->GetWaterSimulator()->CreateChunkData()), m_LavaSimulatorData (a_World->GetLavaSimulator ()->CreateChunkData()), + m_RedstoneSimulatorData(a_World->GetRedstoneSimulator()->CreateChunkData()), m_AlwaysTicked(0) { if (a_NeighborXM != NULL) @@ -157,17 +161,30 @@ cChunk::~cChunk() m_WaterSimulatorData = NULL; delete m_LavaSimulatorData; m_LavaSimulatorData = NULL; + delete m_RedstoneSimulatorData; + m_RedstoneSimulatorData = NULL; } -void cChunk::SetValid(void) +void cChunk::SetPresence(cChunk::ePresence a_Presence) { - m_IsValid = true; - - m_World->GetChunkMap()->ChunkValidated(); + m_Presence = a_Presence; + if (a_Presence == cpPresent) + { + m_World->GetChunkMap()->ChunkValidated(); + } +} + + + + + +void cChunk::SetShouldGenerateIfLoadFailed(bool a_ShouldGenerateIfLoadFailed) +{ + m_ShouldGenerateIfLoadFailed = a_ShouldGenerateIfLoadFailed; } @@ -176,6 +193,9 @@ void cChunk::SetValid(void) void cChunk::MarkRegenerating(void) { + // Set as queued again: + SetPresence(cpQueued); + // Tell all clients attached to this chunk that they want this chunk: for (cClientHandleList::iterator itr = m_LoadedByClient.begin(); itr != m_LoadedByClient.end(); ++itr) { @@ -189,7 +209,11 @@ void cChunk::MarkRegenerating(void) bool cChunk::CanUnload(void) { - return m_LoadedByClient.empty() && !m_IsDirty && (m_StayCount == 0); + return + m_LoadedByClient.empty() && // The chunk is not used by any client + !m_IsDirty && // The chunk has been saved properly or hasn't been touched since the load / gen + (m_StayCount == 0) && // The chunk is not in a ChunkStay + (m_Presence != cpQueued) ; // The chunk is not queued for loading / generating (otherwise multi-load / multi-gen could occur) } @@ -221,7 +245,7 @@ void cChunk::MarkSaved(void) void cChunk::MarkLoaded(void) { m_IsDirty = false; - SetValid(); + SetPresence(cpPresent); } @@ -230,12 +254,17 @@ void cChunk::MarkLoaded(void) void cChunk::MarkLoadFailed(void) { - if (m_IsValid) + ASSERT(m_Presence == cpQueued); + + // If the chunk is marked as needed, generate it: + if (m_ShouldGenerateIfLoadFailed) { - return; + m_World->GetGenerator().QueueGenerateChunk(m_PosX, m_PosZ, false); + } + else + { + m_Presence = cpInvalid; } - - m_HasLoadFailed = true; } @@ -244,6 +273,8 @@ void cChunk::MarkLoadFailed(void) void cChunk::GetAllData(cChunkDataCallback & a_Callback) { + ASSERT(m_Presence == cpPresent); + a_Callback.HeightMap(&m_HeightMap); a_Callback.BiomeData(&m_BiomeMap); @@ -270,6 +301,7 @@ void cChunk::SetAllData(cSetChunkData & a_SetChunkData) { ASSERT(a_SetChunkData.IsHeightMapValid()); ASSERT(a_SetChunkData.AreBiomesValid()); + ASSERT(IsQueued()); memcpy(m_BiomeMap, a_SetChunkData.GetBiomes(), sizeof(m_BiomeMap)); memcpy(m_HeightMap, a_SetChunkData.GetHeightMap(), sizeof(m_HeightMap)); @@ -294,6 +326,16 @@ void cChunk::SetAllData(cSetChunkData & a_SetChunkData) } m_BlockEntities.clear(); std::swap(a_SetChunkData.GetBlockEntities(), m_BlockEntities); + + // Check that all block entities have a valid blocktype at their respective coords (DEBUG-mode only): + #ifdef _DEBUG + for (cBlockEntityList::iterator itr = m_BlockEntities.begin(); itr != m_BlockEntities.end(); ++itr) + { + BLOCKTYPE EntityBlockType = (*itr)->GetBlockType(); + BLOCKTYPE WorldBlockType = GetBlock((*itr)->GetRelX(), (*itr)->GetPosY(), (*itr)->GetRelZ()); + ASSERT(EntityBlockType == WorldBlockType); + } // for itr - m_BlockEntities + #endif // _DEBUG // Set all block entities' World variable: for (cBlockEntityList::iterator itr = m_BlockEntities.begin(); itr != m_BlockEntities.end(); ++itr) @@ -305,7 +347,7 @@ void cChunk::SetAllData(cSetChunkData & a_SetChunkData) CreateBlockEntities(); // Set the chunk data as valid. This may be needed for some simulators that perform actions upon block adding (Vaporize) - SetValid(); + SetPresence(cpPresent); // Wake up all simulators for their respective blocks: WakeUpSimulators(); @@ -578,7 +620,7 @@ void cChunk::Tick(float a_Dt) } for (cEntityList::iterator itr = m_Entities.begin(); itr != m_Entities.end();) - { + { if (!((*itr)->IsMob())) // Mobs are ticked inside cWorld::TickMobs() (as we don't have to tick them if they are far away from players) { // Tick all entities in this chunk (except mobs): @@ -593,17 +635,19 @@ void cChunk::Tick(float a_Dt) itr = m_Entities.erase(itr); delete ToDelete; } - else if ((*itr)->IsWorldTravellingFrom(m_World)) // Remove all entities that are travelling to another world: + else if ((*itr)->IsWorldTravellingFrom(m_World)) { + // Remove all entities that are travelling to another world MarkDirty(); (*itr)->SetWorldTravellingFrom(NULL); itr = m_Entities.erase(itr); } - else if ( // If any entity moved out of the chunk, move it to the neighbor: + else if ( ((*itr)->GetChunkX() != m_PosX) || ((*itr)->GetChunkZ() != m_PosZ) ) { + // The entity moved out of the chunk, move it to the neighbor MarkDirty(); MoveEntityToNewChunk(*itr); itr = m_Entities.erase(itr); @@ -639,7 +683,7 @@ void cChunk::MoveEntityToNewChunk(cEntity * a_Entity) cChunk * Neighbor = GetNeighborChunk(a_Entity->GetChunkX() * cChunkDef::Width, a_Entity->GetChunkZ() * cChunkDef::Width); if (Neighbor == NULL) { - Neighbor = m_ChunkMap->GetChunkNoLoad(a_Entity->GetChunkX(), ZERO_CHUNK_Y, a_Entity->GetChunkZ()); + Neighbor = m_ChunkMap->GetChunkNoLoad(a_Entity->GetChunkX(), a_Entity->GetChunkZ()); if (Neighbor == NULL) { // TODO: What to do with this? @@ -884,14 +928,14 @@ void cChunk::ApplyWeatherToTop() SetBlock(X, Height, Z, E_BLOCK_ICE, 0); } else if ( - (m_World->IsDeepSnowEnabled()) && - ( - (TopBlock == E_BLOCK_RED_ROSE) || - (TopBlock == E_BLOCK_YELLOW_FLOWER) || - (TopBlock == E_BLOCK_RED_MUSHROOM) || - (TopBlock == E_BLOCK_BROWN_MUSHROOM) - ) + (m_World->IsDeepSnowEnabled()) && + ( + (TopBlock == E_BLOCK_RED_ROSE) || + (TopBlock == E_BLOCK_YELLOW_FLOWER) || + (TopBlock == E_BLOCK_RED_MUSHROOM) || + (TopBlock == E_BLOCK_BROWN_MUSHROOM) ) + ) { SetBlock(X, Height, Z, E_BLOCK_SNOW, 0); } @@ -1305,11 +1349,11 @@ void cChunk::CreateBlockEntities(void) case E_BLOCK_JUKEBOX: case E_BLOCK_FLOWER_POT: { - if (!HasBlockEntityAt(x + m_PosX * Width, y + m_PosY * Height, z + m_PosZ * Width)) + if (!HasBlockEntityAt(x + m_PosX * Width, y, z + m_PosZ * Width)) { m_BlockEntities.push_back(cBlockEntity::CreateByBlockType( BlockType, GetMeta(x, y, z), - x + m_PosX * Width, y + m_PosY * Height, z + m_PosZ * Width, m_World + x + m_PosX * Width, y, z + m_PosZ * Width, m_World )); } break; @@ -1326,9 +1370,9 @@ void cChunk::CreateBlockEntities(void) void cChunk::WakeUpSimulators(void) { - cSimulator * WaterSimulator = m_World->GetWaterSimulator(); - cSimulator * LavaSimulator = m_World->GetLavaSimulator(); - cSimulator * RedstoneSimulator = m_World->GetRedstoneSimulator(); + cSimulator<cChunk, cWorld> * WaterSimulator = m_World->GetWaterSimulator(); + cSimulator<cChunk, cWorld> * LavaSimulator = m_World->GetLavaSimulator(); + cSimulator<cChunk, cWorld> * RedstoneSimulator = m_World->GetRedstoneSimulator(); int BaseX = m_PosX * cChunkDef::Width; int BaseZ = m_PosZ * cChunkDef::Width; for (int x = 0; x < Width; x++) @@ -1946,6 +1990,30 @@ bool cChunk::ForEachEntity(cEntityCallback & a_Callback) +bool cChunk::ForEachEntityInBox(const cBoundingBox & a_Box, cEntityCallback & a_Callback) +{ + // The entity list is locked by the parent chunkmap's CS + for (cEntityList::iterator itr = m_Entities.begin(), itr2 = itr; itr != m_Entities.end(); itr = itr2) + { + ++itr2; + cBoundingBox EntBox((*itr)->GetPosition(), (*itr)->GetWidth() / 2, (*itr)->GetHeight()); + if (!EntBox.DoesIntersect(a_Box)) + { + // The entity is not in the specified box + continue; + } + if (a_Callback.Item(*itr)) + { + return false; + } + } // for itr - m_Entitites[] + return true; +} + + + + + bool cChunk::DoWithEntityByID(int a_EntityID, cEntityCallback & a_Callback, bool & a_CallbackResult) { // The entity list is locked by the parent chunkmap's CS @@ -2126,6 +2194,77 @@ bool cChunk::DoWithBlockEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBloc +bool cChunk::DoWithRedstonePoweredEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cRedstonePoweredCallback & a_Callback) +{ + // The blockentity list is locked by the parent chunkmap's CS + for (cBlockEntityList::iterator itr = m_BlockEntities.begin(), itr2 = itr; itr != m_BlockEntities.end(); itr = itr2) + { + ++itr2; + if (((*itr)->GetPosX() != a_BlockX) || ((*itr)->GetPosY() != a_BlockY) || ((*itr)->GetPosZ() != a_BlockZ)) + { + continue; + } + switch ((*itr)->GetBlockType()) + { + case E_BLOCK_DROPPER: + case E_BLOCK_DISPENSER: + case E_BLOCK_NOTE_BLOCK: + { + break; + } + default: + { + // There is a block entity here, but of different type. No other block entity can be here, so we can safely bail out + return false; + } + } + + if (a_Callback.Item(dynamic_cast<cRedstonePoweredEntity *>(*itr))) // Needs dynamic_cast due to multiple inheritance + { + return false; + } + return true; + } // for itr - m_BlockEntitites[] + + // Not found: + return false; +} + + + + +bool cChunk::DoWithBeaconAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBeaconCallback & a_Callback) +{ + // The blockentity list is locked by the parent chunkmap's CS + for (cBlockEntityList::iterator itr = m_BlockEntities.begin(), itr2 = itr; itr != m_BlockEntities.end(); itr = itr2) + { + ++itr2; + if (((*itr)->GetPosX() != a_BlockX) || ((*itr)->GetPosY() != a_BlockY) || ((*itr)->GetPosZ() != a_BlockZ)) + { + continue; + } + if ((*itr)->GetBlockType() != E_BLOCK_BEACON) + { + // There is a block entity here, but of different type. No other block entity can be here, so we can safely bail out + return false; + } + + // The correct block entity is here + if (a_Callback.Item((cBeaconEntity *)*itr)) + { + return false; + } + return true; + } // for itr - m_BlockEntitites[] + + // Not found: + return false; +} + + + + + bool cChunk::DoWithChestAt(int a_BlockX, int a_BlockY, int a_BlockZ, cChestCallback & a_Callback) { // The blockentity list is locked by the parent chunkmap's CS @@ -2518,7 +2657,7 @@ cChunk * cChunk::GetRelNeighborChunk(int a_RelX, int a_RelZ) int BlockZ = m_PosZ * cChunkDef::Width + a_RelZ; int ChunkX, ChunkZ; BlockToChunk(BlockX, BlockZ, ChunkX, ChunkZ); - return m_ChunkMap->GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + return m_ChunkMap->GetChunkNoLoad(ChunkX, ChunkZ); } // Walk the neighbors: @@ -2908,7 +3047,7 @@ void cChunk::BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation -void cChunk::BroadcastParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude) +void cChunk::BroadcastParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount, cClientHandle * a_Exclude) { for (cClientHandleList::iterator itr = m_LoadedByClient.begin(); itr != m_LoadedByClient.end(); ++itr) { @@ -2916,7 +3055,7 @@ void cChunk::BroadcastParticleEffect(const AString & a_ParticleName, float a_Src { continue; } - (*itr)->SendParticleEffect(a_ParticleName, a_SrcX, a_SrcY, a_SrcZ, a_OffsetX, a_OffsetY, a_OffsetZ, a_ParticleData, a_ParticleAmmount); + (*itr)->SendParticleEffect(a_ParticleName, a_SrcX, a_SrcY, a_SrcZ, a_OffsetX, a_OffsetY, a_OffsetZ, a_ParticleData, a_ParticleAmount); } // for itr - LoadedByClient[] } @@ -3043,7 +3182,7 @@ void cChunk::PositionToWorldPosition(int a_RelX, int a_RelY, int a_RelZ, int & a Vector3i cChunk::PositionToWorldPosition(int a_RelX, int a_RelY, int a_RelZ) { - return Vector3i(m_PosX * Width + a_RelX, m_PosY * Height + a_RelY, m_PosZ * Width + a_RelZ); + return Vector3i(m_PosX * Width + a_RelX, a_RelY, m_PosZ * Width + a_RelZ); } diff --git a/src/Chunk.h b/src/Chunk.h index 7eee3999c..bc66b6528 100644 --- a/src/Chunk.h +++ b/src/Chunk.h @@ -9,7 +9,9 @@ #include "Simulator/SandSimulator.h" #include "Simulator/IncrementalRedstoneSimulator.h" +#include "Blocks/GetHandlerCompileTimeTemplate.h" +#include "ChunkMap.h" @@ -28,7 +30,11 @@ class cServer; class MTRand; class cPlayer; class cChunkMap; +class cBeaconEntity; +class cBoundingBox; class cChestEntity; +class cCHunkDataCallback; +class cCommandBlockEntity; class cDispenserEntity; class cFurnaceEntity; class cNoteEntity; @@ -42,9 +48,12 @@ class cBlockArea; class cFluidSimulatorData; class cMobCensus; class cMobSpawner; +class cRedstonePoweredEntity; +class cSetChunkData; typedef std::list<cClientHandle *> cClientHandleList; typedef cItemCallback<cEntity> cEntityCallback; +typedef cItemCallback<cBeaconEntity> cBeaconCallback; typedef cItemCallback<cChestEntity> cChestCallback; typedef cItemCallback<cDispenserEntity> cDispenserCallback; typedef cItemCallback<cFurnaceEntity> cFurnaceCallback; @@ -52,6 +61,7 @@ typedef cItemCallback<cNoteEntity> cNoteBlockCallback; typedef cItemCallback<cCommandBlockEntity> cCommandBlockCallback; typedef cItemCallback<cMobHeadEntity> cMobHeadCallback; typedef cItemCallback<cFlowerPotEntity> cFlowerPotCallback; +typedef cItemCallback<cRedstonePoweredEntity> cRedstonePoweredCallback; @@ -62,8 +72,16 @@ class cChunk : public cChunkDef // The inheritance is "misused" here only to inherit the functions and constants defined in cChunkDef { public: + /** Represents the presence state of the chunk */ + enum ePresence + { + cpInvalid, /**< The chunk is not present at all and is not queued in the loader / generator */ + cpQueued, /**< The chunk is not present, but is queued for loading / generation */ + cpPresent, /**< The chunk is present */ + }; + cChunk( - int a_ChunkX, int a_ChunkY, int a_ChunkZ, // Chunk coords + int a_ChunkX, int a_ChunkZ, // Chunk coords cChunkMap * a_ChunkMap, cWorld * a_World, // Parent objects cChunk * a_NeighborXM, cChunk * a_NeighborXP, cChunk * a_NeighborZM, cChunk * a_NeighborZP, // Neighbor chunks cAllocationPool<cChunkData::sChunkSection> & a_Pool @@ -71,11 +89,25 @@ public: cChunk(cChunk & other); ~cChunk(); - bool IsValid(void) const {return m_IsValid; } // Returns true if the chunk block data is valid (loaded / generated) - void SetValid(void); // Also wakes up any calls to cChunkMap::GetHeight() - void MarkRegenerating(void); // Marks all clients attached to this chunk as wanting this chunk - bool IsDirty(void) const {return m_IsDirty; } // Returns true if the chunk has changed since it was last saved - bool HasLoadFailed(void) const {return m_HasLoadFailed; } // Returns true if the chunk failed to load and hasn't been generated since then + /** Returns true iff the chunk block data is valid (loaded / generated) */ + bool IsValid(void) const {return (m_Presence == cpPresent); } + + /** Returns true iff the chunk is in the queue for loading / generating */ + bool IsQueued(void) const {return (m_Presence == cpQueued); } + + /** Sets the chunk's presence. + Wakes up any calls to cChunkMap::GetHeight() when setting to cpPresent. */ + void SetPresence(ePresence a_Presence); + + /** Called to indicate whether the chunk should be queued in the generator if it fails to load. Set by cChunkMap::GetChunk(). */ + void SetShouldGenerateIfLoadFailed(bool a_ShouldGenerateIfLoadFailed); + + /** Marks all clients attached to this chunk as wanting this chunk. Also sets presence to cpQueued. */ + void MarkRegenerating(void); + + /** Returns true iff the chunk has changed since it was last saved. */ + bool IsDirty(void) const {return m_IsDirty; } + bool CanUnload(void); bool IsLightValid(void) const {return m_IsLightValid; } @@ -90,7 +122,10 @@ public: void MarkSaving(void); // Marks the chunk as being saved. void MarkSaved(void); // Marks the chunk as saved, if it didn't change from the last call to MarkSaving() void MarkLoaded(void); // Marks the chunk as freshly loaded. Fails if the chunk is already valid - void MarkLoadFailed(void); // Marks the chunk as failed to load. Ignored is the chunk is already valid + + /** Marks the chunk as failed to load. + If m_ShouldGenerateIfLoadFailed is set, queues the chunk for generating. */ + void MarkLoadFailed(void); /** Gets all chunk data, calls the a_Callback's methods for each data type */ void GetAllData(cChunkDataCallback & a_Callback); @@ -131,7 +166,6 @@ public: void TickBlock(int a_RelX, int a_RelY, int a_RelZ); int GetPosX(void) const { return m_PosX; } - int GetPosY(void) const { return m_PosY; } int GetPosZ(void) const { return m_PosZ; } cWorld * GetWorld(void) const { return m_World; } @@ -151,7 +185,7 @@ public: void FastSetBlock(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE a_BlockType, BLOCKTYPE a_BlockMeta, bool a_SendToClients = true); // Doesn't force block updates on neighbors, use for simple changes such as grass growing etc. BLOCKTYPE GetBlock(int a_RelX, int a_RelY, int a_RelZ) const; - BLOCKTYPE GetBlock(Vector3i a_cords) const { return GetBlock(a_cords.x, a_cords.y, a_cords.z);} + BLOCKTYPE GetBlock(const Vector3i & a_RelCoords) const { return GetBlock(a_RelCoords.x, a_RelCoords.y, a_RelCoords.z); } void GetBlockTypeMeta(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta); void GetBlockInfo (int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_Meta, NIBBLETYPE & a_SkyLight, NIBBLETYPE & a_BlockLight); @@ -212,6 +246,10 @@ public: /** Calls the callback for each entity; returns true if all entities processed, false if the callback aborted by returning true */ bool ForEachEntity(cEntityCallback & a_Callback); // Lua-accessible + /** Calls the callback for each entity that has a nonempty intersection with the specified boundingbox. + Returns true if all entities processed, false if the callback aborted by returning true. */ + bool ForEachEntityInBox(const cBoundingBox & a_Box, cEntityCallback & a_Callback); // Lua-accessible + /** Calls the callback if the entity with the specified ID is found, with the entity object as the callback param. Returns true if entity found. */ bool DoWithEntityByID(int a_EntityID, cEntityCallback & a_Callback, bool & a_CallbackResult); // Lua-accessible @@ -235,6 +273,11 @@ public: /** Calls the callback for the block entity at the specified coords; returns false if there's no block entity at those coords, true if found */ bool DoWithBlockEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBlockEntityCallback & a_Callback); // Lua-acessible + + /** Calls the callback for the redstone powered entity at the specified coords; returns false if there's no redstone powered entity at those coords, true if found */ + bool DoWithRedstonePoweredEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cRedstonePoweredCallback & a_Callback); + /** Calls the callback for the beacon at the specified coords; returns false if there's no beacon at those coords, true if found */ + bool DoWithBeaconAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBeaconCallback & a_Callback); // Lua-acessible /** Calls the callback for the chest at the specified coords; returns false if there's no chest at those coords, true if found */ bool DoWithChestAt(int a_BlockX, int a_BlockY, int a_BlockZ, cChestCallback & a_Callback); // Lua-acessible @@ -289,7 +332,7 @@ public: void BroadcastEntityStatus (const cEntity & a_Entity, char a_Status, const cClientHandle * a_Exclude = NULL); void BroadcastEntityVelocity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); void BroadcastEntityAnimation (const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL); - void BroadcastParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL); + void BroadcastParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount, cClientHandle * a_Exclude = NULL); void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL); void BroadcastSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL); void BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL); @@ -377,12 +420,8 @@ public: cFluidSimulatorData * GetLavaSimulatorData (void) { return m_LavaSimulatorData; } cSandSimulatorChunkData & GetSandSimulatorData (void) { return m_SandSimulatorData; } - cRedstoneSimulatorChunkData * GetRedstoneSimulatorData(void) { return &m_RedstoneSimulatorData; } - cRedstoneSimulatorChunkData * GetRedstoneSimulatorQueuedData(void) { return &m_RedstoneSimulatorQueuedData; } - cIncrementalRedstoneSimulator::PoweredBlocksList * GetRedstoneSimulatorPoweredBlocksList(void) { return &m_RedstoneSimulatorPoweredBlocksList; } - cIncrementalRedstoneSimulator::LinkedBlocksList * GetRedstoneSimulatorLinkedBlocksList(void) { return &m_RedstoneSimulatorLinkedBlocksList; } - cIncrementalRedstoneSimulator::SimulatedPlayerToggleableList * GetRedstoneSimulatorSimulatedPlayerToggleableList(void) { return &m_RedstoneSimulatorSimulatedPlayerToggleableList; } - cIncrementalRedstoneSimulator::RepeatersDelayList * GetRedstoneSimulatorRepeatersDelayList(void) { return &m_RedstoneSimulatorRepeatersDelayList; } + cRedstoneSimulatorChunkData * GetRedstoneSimulatorData(void) { return m_RedstoneSimulatorData; } + void SetRedstoneSimulatorData(cRedstoneSimulatorChunkData * a_Data) { m_RedstoneSimulatorData = a_Data; } bool IsRedstoneDirty(void) const { return m_IsRedstoneDirty; } void SetIsRedstoneDirty(bool a_Flag) { m_IsRedstoneDirty = a_Flag; } @@ -421,7 +460,12 @@ private: typedef std::vector<sSetBlockQueueItem> sSetBlockQueueVector; - bool m_IsValid; // True if the chunk is loaded / generated + /** Holds the presence status of the chunk - if it is present, or in the loader / generator queue, or unloaded */ + ePresence m_Presence; + + /** If the chunk fails to load, should it be queued in the generator or reset back to invalid? */ + bool m_ShouldGenerateIfLoadFailed; + bool m_IsLightValid; // True if the blocklight and skylight are calculated bool m_IsDirty; // True if the chunk has changed since it was last saved bool m_IsSaving; // True if the chunk is being saved @@ -440,7 +484,7 @@ private: /** Number of times the chunk has been requested to stay (by various cChunkStay objects); if zero, the chunk can be unloaded */ int m_StayCount; - int m_PosX, m_PosY, m_PosZ; + int m_PosX, m_PosZ; cWorld * m_World; cChunkMap * m_ChunkMap; @@ -462,12 +506,8 @@ private: cFluidSimulatorData * m_LavaSimulatorData; cSandSimulatorChunkData m_SandSimulatorData; - cRedstoneSimulatorChunkData m_RedstoneSimulatorData; - cRedstoneSimulatorChunkData m_RedstoneSimulatorQueuedData; - cIncrementalRedstoneSimulator::PoweredBlocksList m_RedstoneSimulatorPoweredBlocksList; - cIncrementalRedstoneSimulator::LinkedBlocksList m_RedstoneSimulatorLinkedBlocksList; - cIncrementalRedstoneSimulator::SimulatedPlayerToggleableList m_RedstoneSimulatorSimulatedPlayerToggleableList; - cIncrementalRedstoneSimulator::RepeatersDelayList m_RedstoneSimulatorRepeatersDelayList; + cRedstoneSimulatorChunkData * m_RedstoneSimulatorData; + /** Indicates if simulate-once blocks should be updated by the redstone simulator */ bool m_IsRedstoneDirty; diff --git a/src/ChunkDef.h b/src/ChunkDef.h index dbb782d26..f4ed66c4b 100644 --- a/src/ChunkDef.h +++ b/src/ChunkDef.h @@ -16,11 +16,6 @@ -/** This is really only a placeholder to be used in places where we need to "make up" a chunk's Y coord. -It will help us when the new chunk format comes out and we need to patch everything up for compatibility. -*/ -#define ZERO_CHUNK_Y 0 - // Used to smoothly convert to new axis ordering. One will be removed when deemed stable. #define AXIS_ORDER_YZX 1 // Original (1.1-) #define AXIS_ORDER_XZY 2 // New (1.2+) @@ -197,32 +192,32 @@ public: inline static int GetHeight(const HeightMap & a_HeightMap, int a_X, int a_Z) { - ASSERT((a_X >= 0) && (a_X <= Width)); - ASSERT((a_Z >= 0) && (a_Z <= Width)); + ASSERT((a_X >= 0) && (a_X < Width)); + ASSERT((a_Z >= 0) && (a_Z < Width)); return a_HeightMap[a_X + Width * a_Z]; } inline static void SetHeight(HeightMap & a_HeightMap, int a_X, int a_Z, unsigned char a_Height) { - ASSERT((a_X >= 0) && (a_X <= Width)); - ASSERT((a_Z >= 0) && (a_Z <= Width)); + ASSERT((a_X >= 0) && (a_X < Width)); + ASSERT((a_Z >= 0) && (a_Z < Width)); a_HeightMap[a_X + Width * a_Z] = a_Height; } inline static EMCSBiome GetBiome(const BiomeMap & a_BiomeMap, int a_X, int a_Z) { - ASSERT((a_X >= 0) && (a_X <= Width)); - ASSERT((a_Z >= 0) && (a_Z <= Width)); + ASSERT((a_X >= 0) && (a_X < Width)); + ASSERT((a_Z >= 0) && (a_Z < Width)); return a_BiomeMap[a_X + Width * a_Z]; } inline static void SetBiome(BiomeMap & a_BiomeMap, int a_X, int a_Z, EMCSBiome a_Biome) { - ASSERT((a_X >= 0) && (a_X <= Width)); - ASSERT((a_Z >= 0) && (a_Z <= Width)); + ASSERT((a_X >= 0) && (a_X < Width)); + ASSERT((a_Z >= 0) && (a_Z < Width)); a_BiomeMap[a_X + Width * a_Z] = a_Biome; } @@ -377,14 +372,13 @@ class cChunkCoords { public: int m_ChunkX; - int m_ChunkY; int m_ChunkZ; - cChunkCoords(int a_ChunkX, int a_ChunkY, int a_ChunkZ) : m_ChunkX(a_ChunkX), m_ChunkY(a_ChunkY), m_ChunkZ(a_ChunkZ) {} + cChunkCoords(int a_ChunkX, int a_ChunkZ) : m_ChunkX(a_ChunkX), m_ChunkZ(a_ChunkZ) {} bool operator == (const cChunkCoords & a_Other) const { - return ((m_ChunkX == a_Other.m_ChunkX) && (m_ChunkY == a_Other.m_ChunkY) && (m_ChunkZ == a_Other.m_ChunkZ)); + return ((m_ChunkX == a_Other.m_ChunkX) && (m_ChunkZ == a_Other.m_ChunkZ)); } } ; @@ -395,6 +389,27 @@ typedef std::vector<cChunkCoords> cChunkCoordsVector; +class cChunkCoordsWithBool +{ +public: + int m_ChunkX; + int m_ChunkZ; + bool m_ForceGenerate; + + cChunkCoordsWithBool(int a_ChunkX, int a_ChunkZ, bool a_ForceGenerate) : m_ChunkX(a_ChunkX), m_ChunkZ(a_ChunkZ), m_ForceGenerate(a_ForceGenerate){} + + bool operator == (const cChunkCoordsWithBool & a_Other) const + { + return ((m_ChunkX == a_Other.m_ChunkX) && (m_ChunkZ == a_Other.m_ChunkZ) && (m_ForceGenerate == a_Other.m_ForceGenerate)); + } +}; + +typedef std::list<cChunkCoordsWithBool> cChunkCoordsWithBoolList; + + + + + /// Interface class used as a callback for operations that involve chunk coords class cChunkCoordCallback { @@ -419,7 +434,7 @@ public: X Data; cCoordWithData(int a_X, int a_Y, int a_Z) : - x(a_X), y(a_Y), z(a_Z) + x(a_X), y(a_Y), z(a_Z), Data() { } diff --git a/src/ChunkMap.cpp b/src/ChunkMap.cpp index 05d219918..299fe0eca 100644 --- a/src/ChunkMap.cpp +++ b/src/ChunkMap.cpp @@ -17,7 +17,7 @@ #include "MobSpawner.h" #include "BoundingBox.h" #include "SetChunkData.h" - +#include "Blocks/ChunkInterface.h" #include "Entities/Pickup.h" #ifndef _WIN32 @@ -143,26 +143,27 @@ cChunkMap::cChunkLayer * cChunkMap::GetLayerForChunk(int a_ChunkX, int a_ChunkZ) -cChunkPtr cChunkMap::GetChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +cChunkPtr cChunkMap::GetChunk(int a_ChunkX, int a_ChunkZ) { - // No need to lock m_CSLayers, since it's already locked by the operation that called us - ASSERT(m_CSLayers.IsLockedByCurrentThread()); + ASSERT(m_CSLayers.IsLockedByCurrentThread()); // m_CSLayers should already be locked by the operation that called us - cChunkLayer * Layer = GetLayerForChunk( a_ChunkX, a_ChunkZ); + cChunkLayer * Layer = GetLayerForChunk(a_ChunkX, a_ChunkZ); if (Layer == NULL) { // An error must have occurred, since layers are automatically created if they don't exist return NULL; } - cChunkPtr Chunk = Layer->GetChunk(a_ChunkX, a_ChunkY, a_ChunkZ); + cChunkPtr Chunk = Layer->GetChunk(a_ChunkX, a_ChunkZ); if (Chunk == NULL) { return NULL; } - if (!(Chunk->IsValid())) + if (!Chunk->IsValid() && !Chunk->IsQueued()) { - m_World->GetStorage().QueueLoadChunk(a_ChunkX, a_ChunkY, a_ChunkZ, true); + Chunk->SetPresence(cChunk::cpQueued); + Chunk->SetShouldGenerateIfLoadFailed(true); + m_World->GetStorage().QueueLoadChunk(a_ChunkX, a_ChunkZ); } return Chunk; } @@ -171,24 +172,26 @@ cChunkPtr cChunkMap::GetChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) -cChunkPtr cChunkMap::GetChunkNoGen( int a_ChunkX, int a_ChunkY, int a_ChunkZ) +cChunkPtr cChunkMap::GetChunkNoGen(int a_ChunkX, int a_ChunkZ) { - // No need to lock m_CSLayers, since it's already locked by the operation that called us - cChunkLayer * Layer = GetLayerForChunk( a_ChunkX, a_ChunkZ); + ASSERT(m_CSLayers.IsLockedByCurrentThread()); // m_CSLayers should already be locked by the operation that called us + + cChunkLayer * Layer = GetLayerForChunk(a_ChunkX, a_ChunkZ); if (Layer == NULL) { // An error must have occurred, since layers are automatically created if they don't exist return NULL; } - cChunkPtr Chunk = Layer->GetChunk(a_ChunkX, a_ChunkY, a_ChunkZ); + cChunkPtr Chunk = Layer->GetChunk(a_ChunkX, a_ChunkZ); if (Chunk == NULL) { return NULL; } - if (!(Chunk->IsValid())) + if (!Chunk->IsValid() && !Chunk->IsQueued()) { - m_World->GetStorage().QueueLoadChunk(a_ChunkX, a_ChunkY, a_ChunkZ, false); + Chunk->SetPresence(cChunk::cpQueued); + m_World->GetStorage().QueueLoadChunk(a_ChunkX, a_ChunkZ); } return Chunk; @@ -198,9 +201,10 @@ cChunkPtr cChunkMap::GetChunkNoGen( int a_ChunkX, int a_ChunkY, int a_ChunkZ) -cChunkPtr cChunkMap::GetChunkNoLoad( int a_ChunkX, int a_ChunkY, int a_ChunkZ) +cChunkPtr cChunkMap::GetChunkNoLoad( int a_ChunkX, int a_ChunkZ) { - // No need to lock m_CSLayers, since it's already locked by the operation that called us + ASSERT(m_CSLayers.IsLockedByCurrentThread()); // m_CSLayers should already be locked by the operation that called us + cChunkLayer * Layer = GetLayerForChunk( a_ChunkX, a_ChunkZ); if (Layer == NULL) { @@ -208,7 +212,7 @@ cChunkPtr cChunkMap::GetChunkNoLoad( int a_ChunkX, int a_ChunkY, int a_ChunkZ) return NULL; } - return Layer->GetChunk(a_ChunkX, a_ChunkY, a_ChunkZ); + return Layer->GetChunk(a_ChunkX, a_ChunkZ); } @@ -222,7 +226,7 @@ bool cChunkMap::LockedGetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTY int ChunkX, ChunkZ; cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk == NULL) { return false; @@ -244,7 +248,7 @@ bool cChunkMap::LockedGetBlockType(int a_BlockX, int a_BlockY, int a_BlockZ, BLO int ChunkX, ChunkZ; cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk == NULL) { return false; @@ -265,7 +269,7 @@ bool cChunkMap::LockedGetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ, NIB int ChunkX, ChunkZ; cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk == NULL) { return false; @@ -284,7 +288,7 @@ bool cChunkMap::LockedSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTY // We already have m_CSLayers locked since this can be called only from within the tick thread int ChunkX, ChunkZ; cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk == NULL) { return false; @@ -303,7 +307,7 @@ bool cChunkMap::LockedFastSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLO // We already have m_CSLayers locked since this can be called only from within the tick thread int ChunkX, ChunkZ; cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk == NULL) { return false; @@ -336,7 +340,7 @@ cChunk * cChunkMap::FindChunk(int a_ChunkX, int a_ChunkZ) void cChunkMap::BroadcastAttachEntity(const cEntity & a_Entity, const cEntity * a_Vehicle) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -356,7 +360,7 @@ void cChunkMap::BroadcastBlockAction(int a_BlockX, int a_BlockY, int a_BlockZ, c x = a_BlockX; z = a_BlockZ; cChunkDef::BlockToChunk(x, z, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if (Chunk == NULL) { return; @@ -375,7 +379,7 @@ void cChunkMap::BroadcastBlockBreakAnimation(int a_entityID, int a_blockX, int a int ChunkX, ChunkZ; cChunkDef::BlockToChunk(a_blockX, a_blockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if (Chunk == NULL) { return; @@ -393,7 +397,7 @@ void cChunkMap::BroadcastBlockEntity(int a_BlockX, int a_BlockY, int a_BlockZ, c cCSLock Lock(m_CSLayers); int ChunkX, ChunkZ; cChunkDef::BlockToChunk(a_BlockX, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return; @@ -408,7 +412,7 @@ void cChunkMap::BroadcastBlockEntity(int a_BlockX, int a_BlockY, int a_BlockZ, c void cChunkMap::BroadcastChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, 0, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if (Chunk == NULL) { return; @@ -424,7 +428,7 @@ void cChunkMap::BroadcastChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataSeriali void cChunkMap::BroadcastCollectEntity(const cEntity & a_Entity, const cPlayer & a_Player, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -440,7 +444,7 @@ void cChunkMap::BroadcastCollectEntity(const cEntity & a_Entity, const cPlayer & void cChunkMap::BroadcastDestroyEntity(const cEntity & a_Entity, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -456,7 +460,7 @@ void cChunkMap::BroadcastDestroyEntity(const cEntity & a_Entity, const cClientHa void cChunkMap::BroadcastEntityEffect(const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -472,7 +476,7 @@ void cChunkMap::BroadcastEntityEffect(const cEntity & a_Entity, int a_EffectID, void cChunkMap::BroadcastEntityEquipment(const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -488,7 +492,7 @@ void cChunkMap::BroadcastEntityEquipment(const cEntity & a_Entity, short a_SlotN void cChunkMap::BroadcastEntityHeadLook(const cEntity & a_Entity, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -504,7 +508,7 @@ void cChunkMap::BroadcastEntityHeadLook(const cEntity & a_Entity, const cClientH void cChunkMap::BroadcastEntityLook(const cEntity & a_Entity, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -520,7 +524,7 @@ void cChunkMap::BroadcastEntityLook(const cEntity & a_Entity, const cClientHandl void cChunkMap::BroadcastEntityMetadata(const cEntity & a_Entity, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -536,7 +540,7 @@ void cChunkMap::BroadcastEntityMetadata(const cEntity & a_Entity, const cClientH void cChunkMap::BroadcastEntityRelMove(const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -552,7 +556,7 @@ void cChunkMap::BroadcastEntityRelMove(const cEntity & a_Entity, char a_RelX, ch void cChunkMap::BroadcastEntityRelMoveLook(const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -568,7 +572,7 @@ void cChunkMap::BroadcastEntityRelMoveLook(const cEntity & a_Entity, char a_RelX void cChunkMap::BroadcastEntityStatus(const cEntity & a_Entity, char a_Status, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -584,7 +588,7 @@ void cChunkMap::BroadcastEntityStatus(const cEntity & a_Entity, char a_Status, c void cChunkMap::BroadcastEntityVelocity(const cEntity & a_Entity, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -600,7 +604,7 @@ void cChunkMap::BroadcastEntityVelocity(const cEntity & a_Entity, const cClientH void cChunkMap::BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -613,19 +617,19 @@ void cChunkMap::BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animat -void cChunkMap::BroadcastParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude) +void cChunkMap::BroadcastParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount, cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); int ChunkX, ChunkZ; cChunkDef::BlockToChunk((int) a_SrcX, (int) a_SrcZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if (Chunk == NULL) { return; } // It's perfectly legal to broadcast packets even to invalid chunks! - Chunk->BroadcastParticleEffect(a_ParticleName, a_SrcX, a_SrcY, a_SrcZ, a_OffsetX, a_OffsetY, a_OffsetZ, a_ParticleData, a_ParticleAmmount, a_Exclude); + Chunk->BroadcastParticleEffect(a_ParticleName, a_SrcX, a_SrcY, a_SrcZ, a_OffsetX, a_OffsetY, a_OffsetZ, a_ParticleData, a_ParticleAmount, a_Exclude); } @@ -636,7 +640,7 @@ void cChunkMap::BroadcastRemoveEntityEffect(const cEntity & a_Entity, int a_Effe { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -655,7 +659,7 @@ void cChunkMap::BroadcastSoundEffect(const AString & a_SoundName, double a_X, do int ChunkX, ChunkZ; cChunkDef::BlockToChunk((int)std::floor(a_X), (int)std::floor(a_Z), ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if (Chunk == NULL) { return; @@ -674,7 +678,7 @@ void cChunkMap::BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_S int ChunkX, ChunkZ; cChunkDef::BlockToChunk(a_SrcX, a_SrcZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if (Chunk == NULL) { return; @@ -690,7 +694,7 @@ void cChunkMap::BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_S void cChunkMap::BroadcastSpawnEntity(cEntity & a_Entity, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), ZERO_CHUNK_Y, a_Entity.GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity.GetChunkX(), a_Entity.GetChunkZ()); if (Chunk == NULL) { return; @@ -708,7 +712,7 @@ void cChunkMap::BroadcastThunderbolt(int a_BlockX, int a_BlockY, int a_BlockZ, c cCSLock Lock(m_CSLayers); int ChunkX, ChunkZ; cChunkDef::BlockToChunk(a_BlockX, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if (Chunk == NULL) { return; @@ -727,7 +731,7 @@ void cChunkMap::BroadcastUseBed(const cEntity & a_Entity, int a_BlockX, int a_Bl int ChunkX, ChunkZ; cChunkDef::BlockToChunk(a_BlockX, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if (Chunk == NULL) { return; @@ -745,7 +749,7 @@ void cChunkMap::SendBlockEntity(int a_BlockX, int a_BlockY, int a_BlockZ, cClien cCSLock Lock(m_CSLayers); int ChunkX, ChunkZ; cChunkDef::BlockToChunk(a_BlockX, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return; @@ -763,7 +767,7 @@ void cChunkMap::UseBlockEntity(cPlayer * a_Player, int a_BlockX, int a_BlockY, i cCSLock Lock(m_CSLayers); int ChunkX, ChunkZ; cChunkDef::BlockToChunk(a_BlockX, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return; @@ -778,7 +782,7 @@ void cChunkMap::UseBlockEntity(cPlayer * a_Player, int a_BlockX, int a_BlockY, i bool cChunkMap::DoWithChunk(int a_ChunkX, int a_ChunkZ, cChunkCallback & a_Callback) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, a_ChunkZ); if (Chunk == NULL) { return false; @@ -795,7 +799,7 @@ void cChunkMap::WakeUpSimulators(int a_BlockX, int a_BlockY, int a_BlockZ) cCSLock Lock(m_CSLayers); int ChunkX, ChunkZ; cChunkDef::BlockToChunk(a_BlockX, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, 0, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return; @@ -824,7 +828,7 @@ void cChunkMap::WakeUpSimulatorsInArea(int a_MinBlockX, int a_MaxBlockX, int a_M int MaxZ = std::min(a_MaxBlockZ, z * cChunkDef::Width + cChunkDef::Width - 1); for (int x = MinChunkX; x <= MaxChunkX; x++) { - cChunkPtr Chunk = GetChunkNoGen(x, 0, z); + cChunkPtr Chunk = GetChunkNoGen(x, z); if ((Chunk == NULL) || !Chunk->IsValid()) { continue; @@ -852,7 +856,7 @@ void cChunkMap::WakeUpSimulatorsInArea(int a_MinBlockX, int a_MaxBlockX, int a_M void cChunkMap::MarkRedstoneDirty(int a_ChunkX, int a_ChunkZ) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return; @@ -867,7 +871,7 @@ void cChunkMap::MarkRedstoneDirty(int a_ChunkX, int a_ChunkZ) void cChunkMap::MarkChunkDirty(int a_ChunkX, int a_ChunkZ, bool a_MarkRedstoneDirty) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return; @@ -886,7 +890,7 @@ void cChunkMap::MarkChunkDirty(int a_ChunkX, int a_ChunkZ, bool a_MarkRedstoneDi void cChunkMap::MarkChunkSaving(int a_ChunkX, int a_ChunkZ) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return; @@ -901,7 +905,7 @@ void cChunkMap::MarkChunkSaving(int a_ChunkX, int a_ChunkZ) void cChunkMap::MarkChunkSaved (int a_ChunkX, int a_ChunkZ) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return; @@ -919,7 +923,7 @@ void cChunkMap::SetChunkData(cSetChunkData & a_SetChunkData) int ChunkZ = a_SetChunkData.GetChunkZ(); { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk == NULL) { return; @@ -964,7 +968,7 @@ void cChunkMap::ChunkLighted( ) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, a_ChunkZ); if (Chunk == NULL) { return; @@ -980,7 +984,7 @@ void cChunkMap::ChunkLighted( bool cChunkMap::GetChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataCallback & a_Callback) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -996,7 +1000,7 @@ bool cChunkMap::GetChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataCallback & a_ bool cChunkMap::GetChunkBlockTypes(int a_ChunkX, int a_ChunkZ, BLOCKTYPE * a_BlockTypes) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -1009,10 +1013,21 @@ bool cChunkMap::GetChunkBlockTypes(int a_ChunkX, int a_ChunkZ, BLOCKTYPE * a_Blo +bool cChunkMap::IsChunkQueued(int a_ChunkX, int a_ChunkZ) +{ + cCSLock Lock(m_CSLayers); + cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, a_ChunkZ); + return (Chunk != NULL) && Chunk->IsQueued(); +} + + + + + bool cChunkMap::IsChunkValid(int a_ChunkX, int a_ChunkZ) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, a_ChunkZ); return (Chunk != NULL) && Chunk->IsValid(); } @@ -1023,7 +1038,7 @@ bool cChunkMap::IsChunkValid(int a_ChunkX, int a_ChunkZ) bool cChunkMap::HasChunkAnyClients(int a_ChunkX, int a_ChunkZ) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); return (Chunk != NULL) && Chunk->HasAnyClients(); } @@ -1038,7 +1053,7 @@ int cChunkMap::GetHeight(int a_BlockX, int a_BlockZ) cCSLock Lock(m_CSLayers); int ChunkX, ChunkZ, BlockY = 0; cChunkDef::AbsoluteToRelative(a_BlockX, BlockY, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunk(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk(ChunkX, ChunkZ); if (Chunk == NULL) { return 0; @@ -1065,7 +1080,7 @@ bool cChunkMap::TryGetHeight(int a_BlockX, int a_BlockZ, int & a_Height) cCSLock Lock(m_CSLayers); int ChunkX, ChunkZ, BlockY = 0; cChunkDef::AbsoluteToRelative(a_BlockX, BlockY, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -1088,7 +1103,7 @@ void cChunkMap::FastSetBlocks(sSetBlockList & a_BlockList) int ChunkX = a_BlockList.front().ChunkX; int ChunkZ = a_BlockList.front().ChunkZ; cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { for (sSetBlockList::iterator itr = a_BlockList.begin(); itr != a_BlockList.end();) @@ -1135,7 +1150,7 @@ void cChunkMap::CollectPickupsByPlayer(cPlayer * a_Player) int BlockX = (int)(a_Player->GetPosX()); // Truncating doesn't matter much; we're scanning entire chunks anyway int BlockY = (int)(a_Player->GetPosY()); int BlockZ = (int)(a_Player->GetPosZ()); - int ChunkX, ChunkZ, ChunkY = ZERO_CHUNK_Y; + int ChunkX = 0, ChunkZ = 0; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); int OtherChunkX = ChunkX + ((BlockX > 8) ? 1 : -1); int OtherChunkZ = ChunkZ + ((BlockZ > 8) ? 1 : -1); @@ -1144,13 +1159,13 @@ void cChunkMap::CollectPickupsByPlayer(cPlayer * a_Player) // The only time the chunks are not valid is when the player is downloading the initial world and they should not call this at that moment cCSLock Lock(m_CSLayers); - GetChunkNoLoad(ChunkX, ChunkY, ChunkZ)->CollectPickupsByPlayer(a_Player); + GetChunkNoLoad(ChunkX, ChunkZ)->CollectPickupsByPlayer(a_Player); // Check the neighboring chunks as well: - GetChunkNoLoad(OtherChunkX, ChunkY, ChunkZ)->CollectPickupsByPlayer (a_Player); - GetChunkNoLoad(OtherChunkX, ChunkY, OtherChunkZ)->CollectPickupsByPlayer(a_Player); - GetChunkNoLoad(ChunkX, ChunkY, ChunkZ)->CollectPickupsByPlayer (a_Player); - GetChunkNoLoad(ChunkX, ChunkY, OtherChunkZ)->CollectPickupsByPlayer(a_Player); + GetChunkNoLoad(OtherChunkX, ChunkZ)->CollectPickupsByPlayer (a_Player); + GetChunkNoLoad(OtherChunkX, OtherChunkZ)->CollectPickupsByPlayer(a_Player); + GetChunkNoLoad(ChunkX, ChunkZ)->CollectPickupsByPlayer (a_Player); + GetChunkNoLoad(ChunkX, OtherChunkZ)->CollectPickupsByPlayer(a_Player); } @@ -1177,7 +1192,7 @@ BLOCKTYPE cChunkMap::GetBlock(int a_BlockX, int a_BlockY, int a_BlockZ) cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk(ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { return Chunk->GetBlock(a_BlockX, a_BlockY, a_BlockZ); @@ -1206,7 +1221,7 @@ NIBBLETYPE cChunkMap::GetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ) cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk( ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk( ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { return Chunk->GetMeta(a_BlockX, a_BlockY, a_BlockZ); @@ -1224,7 +1239,7 @@ NIBBLETYPE cChunkMap::GetBlockSkyLight(int a_BlockX, int a_BlockY, int a_BlockZ) cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk( ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk( ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { return Chunk->GetSkyLight(a_BlockX, a_BlockY, a_BlockZ); @@ -1242,7 +1257,7 @@ NIBBLETYPE cChunkMap::GetBlockBlockLight(int a_BlockX, int a_BlockY, int a_Block cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk( ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk( ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { return Chunk->GetBlockLight(a_BlockX, a_BlockY, a_BlockZ); @@ -1261,7 +1276,7 @@ void cChunkMap::SetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYP // a_BlockXYZ now contains relative coords! cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk(ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { Chunk->SetMeta(a_BlockX, a_BlockY, a_BlockZ, a_BlockMeta); @@ -1272,25 +1287,25 @@ void cChunkMap::SetBlockMeta(int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYP -void cChunkMap::SetBlock(cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, bool a_SendToClients) +void cChunkMap::SetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, bool a_SendToClients) { cChunkInterface ChunkInterface(this); if (a_BlockType == E_BLOCK_AIR) { - BlockHandler(GetBlock(a_BlockX, a_BlockY, a_BlockZ))->OnDestroyed(ChunkInterface, a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ); + BlockHandler(GetBlock(a_BlockX, a_BlockY, a_BlockZ))->OnDestroyed(ChunkInterface, *m_World, a_BlockX, a_BlockY, a_BlockZ); } int ChunkX, ChunkZ, X = a_BlockX, Y = a_BlockY, Z = a_BlockZ; cChunkDef::AbsoluteToRelative( X, Y, Z, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk( ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk( ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { Chunk->SetBlock(X, Y, Z, a_BlockType, a_BlockMeta, a_SendToClients); m_World->GetSimulatorManager()->WakeUp(a_BlockX, a_BlockY, a_BlockZ, Chunk); } - BlockHandler(a_BlockType)->OnPlaced(ChunkInterface, a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta); + BlockHandler(a_BlockType)->OnPlaced(ChunkInterface, *m_World, a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta); } @@ -1303,7 +1318,7 @@ void cChunkMap::QueueSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYP cChunkDef::AbsoluteToRelative(X, Y, Z, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk(ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { Chunk->QueueSetBlock(X, Y, Z, a_BlockType, a_BlockMeta, a_Tick, a_PreviousBlockType); @@ -1320,7 +1335,7 @@ bool cChunkMap::GetBlockTypeMeta(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCK cChunkDef::AbsoluteToRelative( X, Y, Z, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk( ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk( ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { Chunk->GetBlockTypeMeta(X, Y, Z, a_BlockType, a_BlockMeta); @@ -1339,7 +1354,7 @@ bool cChunkMap::GetBlockInfo(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE cChunkDef::AbsoluteToRelative( X, Y, Z, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk( ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk( ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { Chunk->GetBlockInfo(X, Y, Z, a_BlockType, a_Meta, a_SkyLight, a_BlockLight); @@ -1357,7 +1372,7 @@ void cChunkMap::ReplaceBlocks(const sSetBlockVector & a_Blocks, BLOCKTYPE a_Filt cCSLock Lock(m_CSLayers); for (sSetBlockVector::const_iterator itr = a_Blocks.begin(); itr != a_Blocks.end(); ++itr) { - cChunkPtr Chunk = GetChunk(itr->ChunkX, ZERO_CHUNK_Y, itr->ChunkZ); + cChunkPtr Chunk = GetChunk(itr->ChunkX, itr->ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { continue; @@ -1378,7 +1393,7 @@ void cChunkMap::ReplaceTreeBlocks(const sSetBlockVector & a_Blocks) cCSLock Lock(m_CSLayers); for (sSetBlockVector::const_iterator itr = a_Blocks.begin(); itr != a_Blocks.end(); ++itr) { - cChunkPtr Chunk = GetChunk(itr->ChunkX, ZERO_CHUNK_Y, itr->ChunkZ); + cChunkPtr Chunk = GetChunk(itr->ChunkX, itr->ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { continue; @@ -1413,7 +1428,7 @@ EMCSBiome cChunkMap::GetBiomeAt (int a_BlockX, int a_BlockZ) cChunkDef::AbsoluteToRelative(X, Y, Z, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk(ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { return Chunk->GetBiomeAt(X, Z); @@ -1434,7 +1449,7 @@ bool cChunkMap::SetBiomeAt(int a_BlockX, int a_BlockZ, EMCSBiome a_Biome) cChunkDef::AbsoluteToRelative(X, Y, Z, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk(ChunkX, ChunkZ); if ((Chunk != NULL) && Chunk->IsValid()) { Chunk->SetBiomeAt(X, Z, a_Biome); @@ -1467,7 +1482,7 @@ bool cChunkMap::SetAreaBiome(int a_MinX, int a_MaxX, int a_MinZ, int a_MaxZ, EMC { int MinRelZ = (z == MinChunkZ) ? MinZ : 0; int MaxRelZ = (z == MaxChunkZ) ? MaxZ : cChunkDef::Width - 1; - cChunkPtr Chunk = GetChunkNoLoad(x, ZERO_CHUNK_Y, z); + cChunkPtr Chunk = GetChunkNoLoad(x, z); if ((Chunk != NULL) && Chunk->IsValid()) { Chunk->SetAreaBiome(MinRelX, MaxRelX, MinRelZ, MaxRelZ, a_Biome); @@ -1491,7 +1506,7 @@ bool cChunkMap::GetBlocks(sSetBlockVector & a_Blocks, bool a_ContinueOnFailure) cCSLock Lock(m_CSLayers); for (sSetBlockVector::iterator itr = a_Blocks.begin(); itr != a_Blocks.end(); ++itr) { - cChunkPtr Chunk = GetChunk(itr->ChunkX, ZERO_CHUNK_Y, itr->ChunkZ); + cChunkPtr Chunk = GetChunk(itr->ChunkX, itr->ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { if (!a_ContinueOnFailure) @@ -1519,7 +1534,7 @@ bool cChunkMap::DigBlock(int a_X, int a_Y, int a_Z) { cCSLock Lock(m_CSLayers); - cChunkPtr DestChunk = GetChunk( ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr DestChunk = GetChunk( ChunkX, ChunkZ); if ((DestChunk == NULL) || !DestChunk->IsValid()) { return false; @@ -1542,7 +1557,7 @@ void cChunkMap::SendBlockTo(int a_X, int a_Y, int a_Z, cPlayer * a_Player) cChunkDef::AbsoluteToRelative(a_X, a_Y, a_Z, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunk(ChunkX, ChunkZ); if ((Chunk != NULL) && (Chunk->IsValid())) { Chunk->SendBlockTo(a_X, a_Y, a_Z, a_Player->GetClientHandle()); @@ -1556,12 +1571,12 @@ void cChunkMap::SendBlockTo(int a_X, int a_Y, int a_Z, cPlayer * a_Player) void cChunkMap::CompareChunkClients(int a_ChunkX1, int a_ChunkZ1, int a_ChunkX2, int a_ChunkZ2, cClientDiffCallback & a_Callback) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk1 = GetChunkNoGen(a_ChunkX1, ZERO_CHUNK_Y, a_ChunkZ1); + cChunkPtr Chunk1 = GetChunkNoGen(a_ChunkX1, a_ChunkZ1); if (Chunk1 == NULL) { return; } - cChunkPtr Chunk2 = GetChunkNoGen(a_ChunkX2, ZERO_CHUNK_Y, a_ChunkZ2); + cChunkPtr Chunk2 = GetChunkNoGen(a_ChunkX2, a_ChunkZ2); if (Chunk2 == NULL) { return; @@ -1623,7 +1638,7 @@ void cChunkMap::CompareChunkClients(cChunk * a_Chunk1, cChunk * a_Chunk2, cClien bool cChunkMap::AddChunkClient(int a_ChunkX, int a_ChunkZ, cClientHandle * a_Client) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunk(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunk(a_ChunkX, a_ChunkZ); if (Chunk == NULL) { return false; @@ -1638,7 +1653,7 @@ bool cChunkMap::AddChunkClient(int a_ChunkX, int a_ChunkZ, cClientHandle * a_Cli void cChunkMap::RemoveChunkClient(int a_ChunkX, int a_ChunkZ, cClientHandle * a_Client) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if (Chunk == NULL) { return; @@ -1667,7 +1682,7 @@ void cChunkMap::RemoveClientFromChunks(cClientHandle * a_Client) void cChunkMap::AddEntity(cEntity * a_Entity) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity->GetChunkX(), ZERO_CHUNK_Y, a_Entity->GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity->GetChunkX(), a_Entity->GetChunkZ()); if ( (Chunk == NULL) || // Chunk not present at all (!Chunk->IsValid() && !a_Entity->IsPlayer()) // Chunk present, but no valid data; players need to spawn in such chunks (#953) @@ -1688,7 +1703,7 @@ void cChunkMap::AddEntity(cEntity * a_Entity) void cChunkMap::AddEntityIfNotPresent(cEntity * a_Entity) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity->GetChunkX(), ZERO_CHUNK_Y, a_Entity->GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity->GetChunkX(), a_Entity->GetChunkZ()); if ( (Chunk == NULL) || // Chunk not present at all (!Chunk->IsValid() && !a_Entity->IsPlayer()) // Chunk present, but no valid data; players need to spawn in such chunks (#953) @@ -1729,7 +1744,7 @@ bool cChunkMap::HasEntity(int a_UniqueID) void cChunkMap::RemoveEntity(cEntity * a_Entity) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_Entity->GetChunkX(), ZERO_CHUNK_Y, a_Entity->GetChunkZ()); + cChunkPtr Chunk = GetChunkNoGen(a_Entity->GetChunkX(), a_Entity->GetChunkZ()); // Even if a chunk is not valid, it may still contain entities such as players; make sure to remove them (#1190) if (Chunk == NULL) @@ -1763,7 +1778,7 @@ bool cChunkMap::ForEachEntity(cEntityCallback & a_Callback) bool cChunkMap::ForEachEntityInChunk(int a_ChunkX, int a_ChunkZ, cEntityCallback & a_Callback) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -1775,6 +1790,38 @@ bool cChunkMap::ForEachEntityInChunk(int a_ChunkX, int a_ChunkZ, cEntityCallback +bool cChunkMap::ForEachEntityInBox(const cBoundingBox & a_Box, cEntityCallback & a_Callback) +{ + // Calculate the chunk range for the box: + int MinChunkX = (int)floor(a_Box.GetMinX() / cChunkDef::Width); + int MinChunkZ = (int)floor(a_Box.GetMinZ() / cChunkDef::Width); + int MaxChunkX = (int)floor((a_Box.GetMaxX() + cChunkDef::Width) / cChunkDef::Width); + int MaxChunkZ = (int)floor((a_Box.GetMaxZ() + cChunkDef::Width) / cChunkDef::Width); + + // Iterate over each chunk in the range: + cCSLock Lock(m_CSLayers); + for (int z = MinChunkZ; z <= MaxChunkZ; z++) + { + for (int x = MinChunkX; x <= MaxChunkX; x++) + { + cChunkPtr Chunk = GetChunkNoGen(x, z); + if ((Chunk == NULL) || !Chunk->IsValid()) + { + continue; + } + if (!Chunk->ForEachEntityInBox(a_Box, a_Callback)) + { + return false; + } + } // for x + } // for z + return true; +} + + + + + void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_BlockY, double a_BlockZ, cVector3iArray & a_BlocksAffected) { // Don't explode if outside of Y range (prevents the following test running into unallocated memory): @@ -1839,7 +1886,9 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_ } case E_BLOCK_OBSIDIAN: + case E_BLOCK_BEACON: case E_BLOCK_BEDROCK: + case E_BLOCK_BARRIER: case E_BLOCK_WATER: case E_BLOCK_LAVA: { @@ -1879,21 +1928,19 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_ } else if ((m_World->GetTNTShrapnelLevel() > slNone) && (m_World->GetTickRandomNumber(100) < 20)) // 20% chance of flinging stuff around { - if (!cBlockInfo::FullyOccupiesVoxel(Block)) - { - break; - } - else if ((m_World->GetTNTShrapnelLevel() == slGravityAffectedOnly) && ((Block != E_BLOCK_SAND) && (Block != E_BLOCK_GRAVEL))) + // If the block is shrapnel-able, make a falling block entity out of it: + if ( + ((m_World->GetTNTShrapnelLevel() == slAll) && cBlockInfo::FullyOccupiesVoxel(Block)) || + ((m_World->GetTNTShrapnelLevel() == slGravityAffectedOnly) && ((Block == E_BLOCK_SAND) || (Block == E_BLOCK_GRAVEL))) + ) { - break; + m_World->SpawnFallingBlock(bx + x, by + y + 5, bz + z, Block, area.GetBlockMeta(bx + x, by + y, bz + z)); } - m_World->SpawnFallingBlock(bx + x, by + y + 5, bz + z, Block, area.GetBlockMeta(bx + x, by + y, bz + z)); } area.SetBlockTypeMeta(bx + x, by + y, bz + z, E_BLOCK_AIR, 0); a_BlocksAffected.push_back(Vector3i(bx + x, by + y, bz + z)); break; - } } // switch (BlockType) } // for z @@ -1915,51 +1962,31 @@ void cChunkMap::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_ virtual bool Item(cEntity * a_Entity) override { - if (a_Entity->IsPickup()) - { - if (((cPickup *)a_Entity)->GetAge() < 20) // If pickup age is smaller than one second, it is invincible (so we don't kill pickups that were just spawned) - { - return false; - } - } - - Vector3d EntityPos = a_Entity->GetPosition(); - cBoundingBox bbEntity(EntityPos, a_Entity->GetWidth() / 2, a_Entity->GetHeight()); - - if (!m_bbTNT.IsInside(bbEntity)) // IsInside actually acts like DoesSurround + if (a_Entity->IsPickup() && (a_Entity->GetTicksAlive() < 20)) { + // If pickup age is smaller than one second, it is invincible (so we don't kill pickups that were just spawned) return false; } - - Vector3d AbsoluteEntityPos(abs(EntityPos.x), abs(EntityPos.y), abs(EntityPos.z)); - - // Work out how far we are from the edge of the TNT's explosive effect - AbsoluteEntityPos -= m_ExplosionPos; - - // All to positive - AbsoluteEntityPos.x = abs(AbsoluteEntityPos.x); - AbsoluteEntityPos.y = abs(AbsoluteEntityPos.y); - AbsoluteEntityPos.z = abs(AbsoluteEntityPos.z); - - double FinalDamage = (((1 / AbsoluteEntityPos.x) + (1 / AbsoluteEntityPos.y) + (1 / AbsoluteEntityPos.z)) * 2) * m_ExplosionSize; - - // Clip damage values - FinalDamage = Clamp(FinalDamage, 0.0, (double)a_Entity->GetMaxHealth()); + Vector3d DistanceFromExplosion = a_Entity->GetPosition() - m_ExplosionPos; + if (!a_Entity->IsTNT() && !a_Entity->IsFallingBlock()) // Don't apply damage to other TNT entities and falling blocks, they should be invincible { - a_Entity->TakeDamage(dtExplosion, NULL, (int)FinalDamage, 0); - } + cBoundingBox bbEntity(a_Entity->GetPosition(), a_Entity->GetWidth() / 2, a_Entity->GetHeight()); - // Apply force to entities around the explosion - code modified from World.cpp DoExplosionAt() - Vector3d distance_explosion = a_Entity->GetPosition() - m_ExplosionPos; - if (distance_explosion.SqrLength() < 4096.0) - { - distance_explosion.Normalize(); - distance_explosion *= m_ExplosionSize * m_ExplosionSize; + if (!m_bbTNT.IsInside(bbEntity)) // If bbEntity is inside bbTNT, not vice versa! + { + return false; + } - a_Entity->AddSpeed(distance_explosion); + // Ensure that the damage dealt is inversely proportional to the distance to the TNT centre - the closer a player is, the harder they are hit + a_Entity->TakeDamage(dtExplosion, NULL, (int)((1 / DistanceFromExplosion.Length()) * 6 * m_ExplosionSize), 0); } + + // Apply force to entities around the explosion - code modified from World.cpp DoExplosionAt() + DistanceFromExplosion.Normalize(); + DistanceFromExplosion *= m_ExplosionSize * m_ExplosionSize; + a_Entity->AddSpeed(DistanceFromExplosion); return false; } @@ -2010,7 +2037,7 @@ bool cChunkMap::DoWithEntityByID(int a_UniqueID, cEntityCallback & a_Callback) bool cChunkMap::ForEachBlockEntityInChunk(int a_ChunkX, int a_ChunkZ, cBlockEntityCallback & a_Callback) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2025,7 +2052,7 @@ bool cChunkMap::ForEachBlockEntityInChunk(int a_ChunkX, int a_ChunkZ, cBlockEnti bool cChunkMap::ForEachChestInChunk(int a_ChunkX, int a_ChunkZ, cChestCallback & a_Callback) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2040,7 +2067,7 @@ bool cChunkMap::ForEachChestInChunk(int a_ChunkX, int a_ChunkZ, cChestCallback & bool cChunkMap::ForEachDispenserInChunk(int a_ChunkX, int a_ChunkZ, cDispenserCallback & a_Callback) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2055,7 +2082,7 @@ bool cChunkMap::ForEachDispenserInChunk(int a_ChunkX, int a_ChunkZ, cDispenserCa bool cChunkMap::ForEachDropperInChunk(int a_ChunkX, int a_ChunkZ, cDropperCallback & a_Callback) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2070,7 +2097,7 @@ bool cChunkMap::ForEachDropperInChunk(int a_ChunkX, int a_ChunkZ, cDropperCallba bool cChunkMap::ForEachDropSpenserInChunk(int a_ChunkX, int a_ChunkZ, cDropSpenserCallback & a_Callback) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2085,7 +2112,7 @@ bool cChunkMap::ForEachDropSpenserInChunk(int a_ChunkX, int a_ChunkZ, cDropSpens bool cChunkMap::ForEachFurnaceInChunk(int a_ChunkX, int a_ChunkZ, cFurnaceCallback & a_Callback) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2103,7 +2130,7 @@ bool cChunkMap::DoWithBlockEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cB int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2115,13 +2142,31 @@ bool cChunkMap::DoWithBlockEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cB +bool cChunkMap::DoWithBeaconAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBeaconCallback & a_Callback) +{ + int ChunkX, ChunkZ; + int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; + cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); + cCSLock Lock(m_CSLayers); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); + if ((Chunk == NULL) || !Chunk->IsValid()) + { + return false; + } + return Chunk->DoWithBeaconAt(a_BlockX, a_BlockY, a_BlockZ, a_Callback); +} + + + + + bool cChunkMap::DoWithChestAt(int a_BlockX, int a_BlockY, int a_BlockZ, cChestCallback & a_Callback) { int ChunkX, ChunkZ; int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2139,7 +2184,7 @@ bool cChunkMap::DoWithDispenserAt(int a_BlockX, int a_BlockY, int a_BlockZ, cDis int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2157,7 +2202,7 @@ bool cChunkMap::DoWithDropperAt(int a_BlockX, int a_BlockY, int a_BlockZ, cDropp int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2175,7 +2220,7 @@ bool cChunkMap::DoWithDropSpenserAt(int a_BlockX, int a_BlockY, int a_BlockZ, cD int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2193,7 +2238,7 @@ bool cChunkMap::DoWithFurnaceAt(int a_BlockX, int a_BlockY, int a_BlockZ, cFurna int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2210,7 +2255,7 @@ bool cChunkMap::DoWithNoteBlockAt(int a_BlockX, int a_BlockY, int a_BlockZ, cNot int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2227,7 +2272,7 @@ bool cChunkMap::DoWithCommandBlockAt(int a_BlockX, int a_BlockY, int a_BlockZ, c int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2245,7 +2290,7 @@ bool cChunkMap::DoWithMobHeadAt(int a_BlockX, int a_BlockY, int a_BlockZ, cMobHe int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2263,7 +2308,7 @@ bool cChunkMap::DoWithFlowerPotAt(int a_BlockX, int a_BlockY, int a_BlockZ, cFlo int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2281,7 +2326,7 @@ bool cChunkMap::GetSignLines(int a_BlockX, int a_BlockY, int a_BlockZ, AString & int BlockX = a_BlockX, BlockY = a_BlockY, BlockZ = a_BlockZ; cChunkDef::AbsoluteToRelative(BlockX, BlockY, BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2293,62 +2338,20 @@ bool cChunkMap::GetSignLines(int a_BlockX, int a_BlockY, int a_BlockZ, AString & -void cChunkMap::TouchChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +void cChunkMap::TouchChunk(int a_ChunkX, int a_ChunkZ) { cCSLock Lock(m_CSLayers); - GetChunk(a_ChunkX, a_ChunkY, a_ChunkZ); -} - - - - - -/// Loads the chunk synchronously, if not already loaded. Doesn't generate. Returns true if chunk valid (even if already loaded before) -bool cChunkMap::LoadChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) -{ - { - cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoGen(a_ChunkX, a_ChunkY, a_ChunkZ); - if (Chunk == NULL) - { - // Internal error - return false; - } - if (Chunk->IsValid()) - { - // Already loaded - return true; - } - if (Chunk->HasLoadFailed()) - { - // Already tried loading and it failed - return false; - } - } - return m_World->GetStorage().LoadChunk(a_ChunkX, a_ChunkY, a_ChunkZ); -} - - - - - -/// Loads the chunks specified. Doesn't report failure, other than chunks being !IsValid() -void cChunkMap::LoadChunks(const cChunkCoordsList & a_Chunks) -{ - for (cChunkCoordsList::const_iterator itr = a_Chunks.begin(); itr != a_Chunks.end(); ++itr) - { - LoadChunk(itr->m_ChunkX, itr->m_ChunkY, itr->m_ChunkZ); - } // for itr - a_Chunks[] + GetChunk(a_ChunkX, a_ChunkZ); } -void cChunkMap::ChunkLoadFailed(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +void cChunkMap::ChunkLoadFailed(int a_ChunkX, int a_ChunkZ) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, a_ChunkY, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, a_ChunkZ); if (Chunk == NULL) { return; @@ -2365,7 +2368,7 @@ bool cChunkMap::SetSignLines(int a_BlockX, int a_BlockY, int a_BlockZ, const ASt cCSLock Lock(m_CSLayers); int ChunkX, ChunkZ; cChunkDef::BlockToChunk(a_BlockX, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoGen(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoGen(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return false; @@ -2380,7 +2383,7 @@ bool cChunkMap::SetSignLines(int a_BlockX, int a_BlockY, int a_BlockZ, const ASt void cChunkMap::MarkChunkRegenerating(int a_ChunkX, int a_ChunkZ) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, a_ChunkZ); if (Chunk == NULL) { // Not present @@ -2396,7 +2399,7 @@ void cChunkMap::MarkChunkRegenerating(int a_ChunkX, int a_ChunkZ) bool cChunkMap::IsChunkLighted(int a_ChunkX, int a_ChunkZ) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, a_ChunkZ); if (Chunk == NULL) { // Not present @@ -2417,7 +2420,7 @@ bool cChunkMap::ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinCh { for (int x = a_MinChunkX; x <= a_MaxChunkX; x++) { - cChunkPtr Chunk = GetChunkNoLoad(x, ZERO_CHUNK_Y, z); + cChunkPtr Chunk = GetChunkNoLoad(x, z); if ((Chunk == NULL) || (!Chunk->IsValid())) { // Not present / not valid @@ -2459,7 +2462,7 @@ bool cChunkMap::WriteBlockArea(cBlockArea & a_Area, int a_MinBlockX, int a_MinBl { for (int x = MinChunkX; x <= MaxChunkX; x++) { - cChunkPtr Chunk = GetChunkNoLoad(x, ZERO_CHUNK_Y, z); + cChunkPtr Chunk = GetChunkNoLoad(x, z); if ((Chunk == NULL) || (!Chunk->IsValid())) { // Not present / not valid @@ -2500,7 +2503,7 @@ void cChunkMap::GrowMelonPumpkin(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCK cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk != NULL) { Chunk->GrowMelonPumpkin(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_Rand); @@ -2517,7 +2520,7 @@ void cChunkMap::GrowSugarcane(int a_BlockX, int a_BlockY, int a_BlockZ, int a_Nu cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk != NULL) { Chunk->GrowSugarcane(a_BlockX, a_BlockY, a_BlockZ, a_NumBlocksToGrow); @@ -2534,7 +2537,7 @@ void cChunkMap::GrowCactus(int a_BlockX, int a_BlockY, int a_BlockZ, int a_NumBl cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk != NULL) { Chunk->GrowCactus(a_BlockX, a_BlockY, a_BlockZ, a_NumBlocksToGrow); @@ -2551,7 +2554,7 @@ void cChunkMap::SetNextBlockTick(int a_BlockX, int a_BlockY, int a_BlockZ) cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk != NULL) { Chunk->SetNextBlockTick(a_BlockX, a_BlockY, a_BlockZ); @@ -2606,7 +2609,7 @@ void cChunkMap::TickBlock(int a_BlockX, int a_BlockY, int a_BlockZ) cCSLock Lock(m_CSLayers); int ChunkX, ChunkZ; cChunkDef::AbsoluteToRelative(a_BlockX, a_BlockY, a_BlockZ, ChunkX, ChunkZ); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if ((Chunk == NULL) || !Chunk->IsValid()) { return; @@ -2675,7 +2678,7 @@ void cChunkMap::QueueTickBlock(int a_BlockX, int a_BlockY, int a_BlockZ) // a_BlockXYZ now contains relative coords! cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ZERO_CHUNK_Y, ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(ChunkX, ChunkZ); if (Chunk != NULL) { Chunk->QueueTickBlock(a_BlockX, a_BlockY, a_BlockZ); @@ -2689,7 +2692,7 @@ void cChunkMap::QueueTickBlock(int a_BlockX, int a_BlockY, int a_BlockZ) void cChunkMap::SetChunkAlwaysTicked(int a_ChunkX, int a_ChunkZ, bool a_AlwaysTicked) { cCSLock Lock(m_CSLayers); - cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(a_ChunkX, a_ChunkZ); if (Chunk != NULL) { Chunk->SetAlwaysTicked(a_AlwaysTicked); @@ -2734,7 +2737,7 @@ cChunkMap::cChunkLayer::~cChunkLayer() -cChunkPtr cChunkMap::cChunkLayer::GetChunk( int a_ChunkX, int a_ChunkY, int a_ChunkZ) +cChunkPtr cChunkMap::cChunkLayer::GetChunk( int a_ChunkX, int a_ChunkZ) { // Always returns an assigned chunkptr, but the chunk needn't be valid (loaded / generated) - callers must check @@ -2754,7 +2757,7 @@ cChunkPtr cChunkMap::cChunkLayer::GetChunk( int a_ChunkX, int a_ChunkY, int a_Ch cChunk * neixp = (LocalX < LAYER_SIZE - 1) ? m_Chunks[Index + 1] : m_Parent->FindChunk(a_ChunkX + 1, a_ChunkZ); cChunk * neizm = (LocalZ > 0) ? m_Chunks[Index - LAYER_SIZE] : m_Parent->FindChunk(a_ChunkX, a_ChunkZ - 1); cChunk * neizp = (LocalZ < LAYER_SIZE - 1) ? m_Chunks[Index + LAYER_SIZE] : m_Parent->FindChunk(a_ChunkX, a_ChunkZ + 1); - m_Chunks[Index] = new cChunk(a_ChunkX, 0, a_ChunkZ, m_Parent, m_Parent->GetWorld(), neixm, neixp, neizm, neizp, m_Pool); + m_Chunks[Index] = new cChunk(a_ChunkX, a_ChunkZ, m_Parent, m_Parent->GetWorld(), neixm, neixp, neizm, neizp, m_Pool); } return m_Chunks[Index]; } @@ -2954,7 +2957,7 @@ void cChunkMap::cChunkLayer::Save(void) { if ((m_Chunks[i] != NULL) && m_Chunks[i]->IsValid() && m_Chunks[i]->IsDirty()) { - World->GetStorage().QueueSaveChunk(m_Chunks[i]->GetPosX(), m_Chunks[i]->GetPosY(), m_Chunks[i]->GetPosZ()); + World->GetStorage().QueueSaveChunk(m_Chunks[i]->GetPosX(), m_Chunks[i]->GetPosZ()); } } // for i - m_Chunks[] } @@ -3027,7 +3030,7 @@ void cChunkMap::AddChunkStay(cChunkStay & a_ChunkStay) const cChunkCoordsVector & WantedChunks = a_ChunkStay.GetChunks(); for (cChunkCoordsVector::const_iterator itr = WantedChunks.begin(); itr != WantedChunks.end(); ++itr) { - cChunkPtr Chunk = GetChunk(itr->m_ChunkX, itr->m_ChunkY, itr->m_ChunkZ); + cChunkPtr Chunk = GetChunk(itr->m_ChunkX, itr->m_ChunkZ); if (Chunk == NULL) { continue; @@ -3076,7 +3079,7 @@ void cChunkMap::DelChunkStay(cChunkStay & a_ChunkStay) const cChunkCoordsVector & Chunks = a_ChunkStay.GetChunks(); for (cChunkCoordsVector::const_iterator itr = Chunks.begin(), end = Chunks.end(); itr != end; ++itr) { - cChunkPtr Chunk = GetChunkNoLoad(itr->m_ChunkX, itr->m_ChunkY, itr->m_ChunkZ); + cChunkPtr Chunk = GetChunkNoLoad(itr->m_ChunkX, itr->m_ChunkZ); if (Chunk == NULL) { continue; diff --git a/src/ChunkMap.h b/src/ChunkMap.h index e33d9f894..6e92833f1 100644 --- a/src/ChunkMap.h +++ b/src/ChunkMap.h @@ -19,6 +19,7 @@ class MTRand; class cChunkStay; class cChunk; class cPlayer; +class cBeaconEntity; class cChestEntity; class cDispenserEntity; class cDropperEntity; @@ -35,11 +36,13 @@ class cBlockArea; class cMobCensus; class cMobSpawner; class cSetChunkData; +class cBoundingBox; typedef std::list<cClientHandle *> cClientHandleList; typedef cChunk * cChunkPtr; typedef cItemCallback<cEntity> cEntityCallback; typedef cItemCallback<cBlockEntity> cBlockEntityCallback; +typedef cItemCallback<cBeaconEntity> cBeaconCallback; typedef cItemCallback<cChestEntity> cChestCallback; typedef cItemCallback<cDispenserEntity> cDispenserCallback; typedef cItemCallback<cDropperEntity> cDropperCallback; @@ -84,7 +87,7 @@ public: void BroadcastEntityStatus(const cEntity & a_Entity, char a_Status, const cClientHandle * a_Exclude = NULL); void BroadcastEntityVelocity(const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL); - void BroadcastParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL); + void BroadcastParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount, cClientHandle * a_Exclude = NULL); void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL); void BroadcastSoundEffect(const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL); void BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL); @@ -130,6 +133,9 @@ public: /** Copies the chunk's blocktypes into a_Blocks; returns true if successful */ bool GetChunkBlockTypes (int a_ChunkX, int a_ChunkZ, BLOCKTYPE * a_Blocks); + /** Returns true iff the chunk is in the loader / generator queue. */ + bool IsChunkQueued(int a_ChunkX, int a_ChunkZ); + bool IsChunkValid (int a_ChunkX, int a_ChunkZ); bool HasChunkAnyClients (int a_ChunkX, int a_ChunkZ); int GetHeight (int a_BlockX, int a_BlockZ); // Waits for the chunk to get loaded / generated @@ -145,8 +151,8 @@ public: NIBBLETYPE GetBlockSkyLight (int a_BlockX, int a_BlockY, int a_BlockZ); NIBBLETYPE GetBlockBlockLight(int a_BlockX, int a_BlockY, int a_BlockZ); void SetBlockMeta (int a_BlockX, int a_BlockY, int a_BlockZ, NIBBLETYPE a_BlockMeta); - void SetBlock (cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, bool a_SendToClients = true); - void QueueSetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, Int64 a_Tick, BLOCKTYPE a_PreviousBlockType = E_BLOCK_AIR); + void SetBlock (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, bool a_SendToClients = true); + void QueueSetBlock (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, Int64 a_Tick, BLOCKTYPE a_PreviousBlockType = E_BLOCK_AIR); bool GetBlockTypeMeta (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta); bool GetBlockInfo (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_Meta, NIBBLETYPE & a_SkyLight, NIBBLETYPE & a_BlockLight); @@ -207,6 +213,11 @@ public: /** Calls the callback for each entity in the specified chunk; returns true if all entities processed, false if the callback aborted by returning true */ bool ForEachEntityInChunk(int a_ChunkX, int a_ChunkZ, cEntityCallback & a_Callback); // Lua-accessible + /** Calls the callback for each entity that has a nonempty intersection with the specified boundingbox. + Returns true if all entities processed, false if the callback aborted by returning true. + If any chunk in the box is missing, ignores the entities in that chunk silently. */ + bool ForEachEntityInBox(const cBoundingBox & a_Box, cEntityCallback & a_Callback); // Lua-accessible + /** Destroys and returns a list of blocks destroyed in the explosion at the specified coordinates */ void DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_BlockY, double a_BlockZ, cVector3iArray & a_BlockAffected); @@ -234,6 +245,9 @@ public: /** Calls the callback for the block entity at the specified coords; returns false if there's no block entity at those coords, true if found */ bool DoWithBlockEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBlockEntityCallback & a_Callback); // Lua-acessible + /** Calls the callback for the beacon at the specified coords; returns false if there's no beacon at those coords, true if found */ + bool DoWithBeaconAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBeaconCallback & a_Callback); // Lua-acessible + /** Calls the callback for the chest at the specified coords; returns false if there's no chest at those coords, true if found */ bool DoWithChestAt(int a_BlockX, int a_BlockY, int a_BlockZ, cChestCallback & a_Callback); // Lua-acessible @@ -265,16 +279,10 @@ public: bool GetSignLines (int a_BlockX, int a_BlockY, int a_BlockZ, AString & a_Line1, AString & a_Line2, AString & a_Line3, AString & a_Line4); // Lua-accessible /** Touches the chunk, causing it to be loaded or generated */ - void TouchChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ); + void TouchChunk(int a_ChunkX, int a_ChunkZ); - /** Loads the chunk, if not already loaded. Doesn't generate. Returns true if chunk valid (even if already loaded before) */ - bool LoadChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ); - - /** Loads the chunks specified. Doesn't report failure, other than chunks being !IsValid() */ - void LoadChunks(const cChunkCoordsList & a_Chunks); - /** Marks the chunk as failed-to-load */ - void ChunkLoadFailed(int a_ChunkX, int a_ChunkY, int a_ChunkZ); + void ChunkLoadFailed(int a_ChunkX, int a_ChunkZ); /** Sets the sign text. Returns true if sign text changed. */ bool SetSignLines(int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4); @@ -358,7 +366,7 @@ private: ~cChunkLayer(); /** Always returns an assigned chunkptr, but the chunk needn't be valid (loaded / generated) - callers must check */ - cChunkPtr GetChunk( int a_ChunkX, int a_ChunkY, int a_ChunkZ); + cChunkPtr GetChunk( int a_ChunkX, int a_ChunkZ); /** Returns the specified chunk, or NULL if not created yet */ cChunk * FindChunk(int a_ChunkX, int a_ChunkZ); @@ -451,9 +459,9 @@ private: std::auto_ptr<cAllocationPool<cChunkData::sChunkSection> > m_Pool; - cChunkPtr GetChunk (int a_ChunkX, int a_ChunkY, int a_ChunkZ); // Also queues the chunk for loading / generating if not valid - cChunkPtr GetChunkNoGen (int a_ChunkX, int a_ChunkY, int a_ChunkZ); // Also queues the chunk for loading if not valid; doesn't generate - cChunkPtr GetChunkNoLoad(int a_ChunkX, int a_ChunkY, int a_ChunkZ); // Doesn't load, doesn't generate + cChunkPtr GetChunk (int a_ChunkX, int a_ChunkZ); // Also queues the chunk for loading / generating if not valid + cChunkPtr GetChunkNoGen (int a_ChunkX, int a_ChunkZ); // Also queues the chunk for loading if not valid; doesn't generate + cChunkPtr GetChunkNoLoad(int a_ChunkX, int a_ChunkZ); // Doesn't load, doesn't generate /** Gets a block in any chunk while in the cChunk's Tick() method; returns true if successful, false if chunk not loaded (doesn't queue load) */ bool LockedGetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta); diff --git a/src/ChunkSender.cpp b/src/ChunkSender.cpp index ebcf0e272..a3151eb3f 100644 --- a/src/ChunkSender.cpp +++ b/src/ChunkSender.cpp @@ -12,6 +12,7 @@ #include "World.h" #include "BlockEntities/BlockEntity.h" #include "Protocol/ChunkDataSerializer.h" +#include "ClientHandle.h" @@ -81,7 +82,7 @@ void cChunkSender::ChunkReady(int a_ChunkX, int a_ChunkZ) // This is probably never gonna be called twice for the same chunk, and if it is, we don't mind, so we don't check { cCSLock Lock(m_CS); - m_ChunksReady.push_back(cChunkCoords(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ)); + m_ChunksReady.push_back(cChunkCoords(a_ChunkX, a_ChunkZ)); } m_evtQueue.Set(); } @@ -95,12 +96,12 @@ void cChunkSender::QueueSendChunkTo(int a_ChunkX, int a_ChunkZ, cClientHandle * ASSERT(a_Client != NULL); { cCSLock Lock(m_CS); - if (std::find(m_SendChunks.begin(), m_SendChunks.end(), sSendChunk(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ, a_Client)) != m_SendChunks.end()) + if (std::find(m_SendChunks.begin(), m_SendChunks.end(), sSendChunk(a_ChunkX, a_ChunkZ, a_Client)) != m_SendChunks.end()) { // Already queued, bail out return; } - m_SendChunks.push_back(sSendChunk(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ, a_Client)); + m_SendChunks.push_back(sSendChunk(a_ChunkX, a_ChunkZ, a_Client)); } m_evtQueue.Set(); } @@ -160,7 +161,7 @@ void cChunkSender::Execute(void) m_ChunksReady.pop_front(); Lock.Unlock(); - SendChunk(Coords.m_ChunkX, Coords.m_ChunkY, Coords.m_ChunkZ, NULL); + SendChunk(Coords.m_ChunkX, Coords.m_ChunkZ, NULL); } else { @@ -169,7 +170,7 @@ void cChunkSender::Execute(void) m_SendChunks.pop_front(); Lock.Unlock(); - SendChunk(Chunk.m_ChunkX, Chunk.m_ChunkY, Chunk.m_ChunkZ, Chunk.m_Client); + SendChunk(Chunk.m_ChunkX, Chunk.m_ChunkZ, Chunk.m_Client); } Lock.Lock(); int RemoveCount = m_RemoveCount; @@ -186,14 +187,14 @@ void cChunkSender::Execute(void) -void cChunkSender::SendChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ, cClientHandle * a_Client) +void cChunkSender::SendChunk(int a_ChunkX, int a_ChunkZ, cClientHandle * a_Client) { ASSERT(m_World != NULL); // Ask the client if it still wants the chunk: if (a_Client != NULL) { - if (!a_Client->WantsSendChunk(a_ChunkX, a_ChunkY, a_ChunkZ)) + if (!a_Client->WantsSendChunk(a_ChunkX, a_ChunkZ)) { return; } diff --git a/src/ChunkSender.h b/src/ChunkSender.h index 624a3a0bd..a0e9087a9 100644 --- a/src/ChunkSender.h +++ b/src/ChunkSender.h @@ -95,13 +95,11 @@ protected: struct sSendChunk { int m_ChunkX; - int m_ChunkY; int m_ChunkZ; cClientHandle * m_Client; - sSendChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ, cClientHandle * a_Client) : + sSendChunk(int a_ChunkX, int a_ChunkZ, cClientHandle * a_Client) : m_ChunkX(a_ChunkX), - m_ChunkY(a_ChunkY), m_ChunkZ(a_ChunkZ), m_Client(a_Client) { @@ -111,7 +109,6 @@ protected: { return ( (a_Other.m_ChunkX == m_ChunkX) && - (a_Other.m_ChunkY == m_ChunkY) && (a_Other.m_ChunkZ == m_ChunkZ) && (a_Other.m_Client == m_Client) ); @@ -162,7 +159,7 @@ protected: virtual void BlockEntity (cBlockEntity * a_Entity) override; /// Sends the specified chunk to a_Client, or to all chunk clients if a_Client == NULL - void SendChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ, cClientHandle * a_Client); + void SendChunk(int a_ChunkX, int a_ChunkZ, cClientHandle * a_Client); } ; diff --git a/src/ChunkStay.cpp b/src/ChunkStay.cpp index b5002a63d..38aa89a37 100644 --- a/src/ChunkStay.cpp +++ b/src/ChunkStay.cpp @@ -51,7 +51,7 @@ void cChunkStay::Add(int a_ChunkX, int a_ChunkZ) return; } } // for itr - Chunks[] - m_Chunks.push_back(cChunkCoords(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ)); + m_Chunks.push_back(cChunkCoords(a_ChunkX, a_ChunkZ)); } diff --git a/src/ClientHandle.cpp b/src/ClientHandle.cpp index b390bf2d6..3b677460b 100644 --- a/src/ClientHandle.cpp +++ b/src/ClientHandle.cpp @@ -7,6 +7,7 @@ #include "Bindings/PluginManager.h" #include "Entities/Player.h" #include "Inventory.h" +#include "BlockEntities/BeaconEntity.h" #include "BlockEntities/ChestEntity.h" #include "BlockEntities/CommandBlockEntity.h" #include "BlockEntities/SignEntity.h" @@ -74,14 +75,25 @@ cClientHandle::cClientHandle(const cSocket * a_Socket, int a_ViewDistance) : m_TimeSinceLastPacket(0), m_Ping(1000), m_PingID(1), + m_PingStartTime(0), + m_LastPingTime(1000), m_BlockDigAnimStage(-1), + m_BlockDigAnimSpeed(0), + m_BlockDigAnimX(0), + m_BlockDigAnimY(256), // Invalid Y, so that the coords don't get picked up + m_BlockDigAnimZ(0), m_HasStartedDigging(false), + m_LastDigBlockX(0), + m_LastDigBlockY(256), // Invalid Y, so that the coords don't get picked up + m_LastDigBlockZ(0), m_State(csConnected), m_ShouldCheckDownloaded(false), m_NumExplosionsThisTick(0), + m_NumBlockChangeInteractionsThisTick(0), m_UniqueID(0), m_HasSentPlayerChunk(false), - m_Locale("en_GB") + m_Locale("en_GB"), + m_ProtocolVersion(0) { m_Protocol = new cProtocolRecognizer(this); @@ -113,13 +125,14 @@ cClientHandle::~cClientHandle() if (m_Player != NULL) { cWorld * World = m_Player->GetWorld(); - if (!m_Username.empty() && (World != NULL)) - { - // Send the Offline PlayerList packet: - World->BroadcastPlayerListItem(*m_Player, false, this); - } if (World != NULL) { + if (!m_Username.empty()) + { + // Send the Offline PlayerList packet: + World->BroadcastPlayerListRemovePlayer(*m_Player, this); + } + World->RemovePlayer(m_Player, true); // Must be called before cPlayer::Destroy() as otherwise cChunk tries to delete the player, and then we do it again m_Player->Destroy(); } @@ -233,13 +246,14 @@ AString cClientHandle::GenerateOfflineUUID(const AString & a_Username) // This guarantees that they will never collide with an online UUID and can be distinguished. // Proper format for a version 3 UUID is: // xxxxxxxx-xxxx-3xxx-yxxx-xxxxxxxxxxxx where x is any hexadecimal digit and y is one of 8, 9, A, or B + // Note that we generate a short UUID (without the dashes) // Generate an md5 checksum, and use it as base for the ID: unsigned char MD5[16]; md5((const unsigned char *)a_Username.c_str(), a_Username.length(), MD5); MD5[6] &= 0x0f; // Need to trim to 4 bits only... MD5[8] &= 0x0f; // ... otherwise %01x overflows into two chars - return Printf("%02x%02x%02x%02x-%02x%02x-3%01x%02x-8%01x%02x-%02x%02x%02x%02x%02x%02x", + return Printf("%02x%02x%02x%02x%02x%02x3%01x%02x8%01x%02x%02x%02x%02x%02x%02x%02x", MD5[0], MD5[1], MD5[2], MD5[3], MD5[4], MD5[5], MD5[6], MD5[7], MD5[8], MD5[9], MD5[10], MD5[11], @@ -300,8 +314,16 @@ void cClientHandle::Authenticate(const AString & a_Name, const AString & a_UUID, ASSERT(m_Player == NULL); m_Username = a_Name; - m_UUID = a_UUID; - m_Properties = a_Properties; + + // Only assign UUID and properties if not already pre-assigned (BungeeCord sends those in the Handshake packet): + if (m_UUID.empty()) + { + m_UUID = a_UUID; + } + if (m_Properties.empty()) + { + m_Properties = a_Properties; + } // Send login success (if the protocol supports it): m_Protocol->SendLoginSuccess(); @@ -339,8 +361,8 @@ void cClientHandle::Authenticate(const AString & a_Name, const AString & a_UUID, m_Protocol->SendWeather(World->GetWeather()); } - // Send time - m_Protocol->SendTimeUpdate(World->GetWorldAge(), World->GetTimeOfDay()); + // Send time: + m_Protocol->SendTimeUpdate(World->GetWorldAge(), World->GetTimeOfDay(), World->IsDaylightCycleEnabled()); // Send contents of the inventory window m_Protocol->SendWholeInventory(*m_Player->GetWindow()); @@ -350,7 +372,12 @@ void cClientHandle::Authenticate(const AString & a_Name, const AString & a_UUID, // Send experience m_Player->SendExperience(); - + + // Send player list items + SendPlayerListAddPlayer(*m_Player); + World->BroadcastPlayerListAddPlayer(*m_Player); + World->SendPlayerList(m_Player); + m_Player->Initialize(*World); m_State = csAuthenticated; @@ -460,13 +487,13 @@ void cClientHandle::StreamChunks(void) // For each distance touch chunks in a hollow square centered around current position: for (int i = -d; i <= d; ++i) { - World->TouchChunk(ChunkPosX + d, ZERO_CHUNK_Y, ChunkPosZ + i); - World->TouchChunk(ChunkPosX - d, ZERO_CHUNK_Y, ChunkPosZ + i); + World->TouchChunk(ChunkPosX + d, ChunkPosZ + i); + World->TouchChunk(ChunkPosX - d, ChunkPosZ + i); } // for i for (int i = -d + 1; i < d; ++i) { - World->TouchChunk(ChunkPosX + i, ZERO_CHUNK_Y, ChunkPosZ + d); - World->TouchChunk(ChunkPosX + i, ZERO_CHUNK_Y, ChunkPosZ - d); + World->TouchChunk(ChunkPosX + i, ChunkPosZ + d); + World->TouchChunk(ChunkPosX + i, ChunkPosZ - d); } // for i } // for d } @@ -489,8 +516,8 @@ void cClientHandle::StreamChunk(int a_ChunkX, int a_ChunkZ) { { cCSLock Lock(m_CSChunkLists); - m_LoadedChunks.push_back(cChunkCoords(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ)); - m_ChunksToSend.push_back(cChunkCoords(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ)); + m_LoadedChunks.push_back(cChunkCoords(a_ChunkX, a_ChunkZ)); + m_ChunksToSend.push_back(cChunkCoords(a_ChunkX, a_ChunkZ)); } World->SendChunkTo(a_ChunkX, a_ChunkZ, this); } @@ -525,6 +552,16 @@ void cClientHandle::RemoveFromAllChunks() +void cClientHandle::HandleNPCTrade(int a_SlotNum) +{ + // TODO + LOGWARNING("%s: Not implemented yet", __FUNCTION__); +} + + + + + void cClientHandle::HandlePing(void) { // Somebody tries to retrieve information about the server @@ -547,16 +584,22 @@ void cClientHandle::HandlePing(void) bool cClientHandle::HandleLogin(int a_ProtocolVersion, const AString & a_Username) { - LOGD("LOGIN %s", a_Username.c_str()); + // If the protocol version hasn't been set yet, set it now: + if (m_ProtocolVersion == 0) + { + m_ProtocolVersion = a_ProtocolVersion; + } + m_Username = a_Username; + // Let the plugins know about this event, they may refuse the player: if (cRoot::Get()->GetPluginManager()->CallHookLogin(this, a_ProtocolVersion, a_Username)) { Destroy(); return false; } - // Schedule for authentication; until then, let them wait (but do not block) + // Schedule for authentication; until then, let the player wait (but do not block) m_State = csAuthenticating; cRoot::Get()->GetAuthenticator().Authenticate(GetUniqueID(), GetUsername(), m_Protocol->GetAuthServerID()); return true; @@ -634,6 +677,7 @@ void cClientHandle::HandlePlayerPos(double a_PosX, double a_PosY, double a_PosZ, if (!m_Player->IsSwimming()) { + m_Player->GetStatManager().AddValue(statJumps, 1); m_Player->AddFoodExhaustion(m_Player->IsSprinting() ? 0.8 : 0.2); } } @@ -649,21 +693,7 @@ void cClientHandle::HandlePlayerPos(double a_PosX, double a_PosY, double a_PosZ, void cClientHandle::HandlePluginMessage(const AString & a_Channel, const AString & a_Message) { - if (a_Channel == "MC|AdvCdm") - { - // Command block, set text, Client -> Server - HandleCommandBlockMessage(a_Message.c_str(), a_Message.size()); - } - else if (a_Channel == "MC|Brand") - { - // Client <-> Server branding exchange - SendPluginMessage("MC|Brand", "MCServer"); - } - else if (a_Channel == "MC|ItemName") - { - HandleAnvilItemName(a_Message.c_str(), a_Message.size()); - } - else if (a_Channel == "REGISTER") + if (a_Channel == "REGISTER") { if (HasPluginChannel(a_Channel)) { @@ -746,52 +776,61 @@ void cClientHandle::UnregisterPluginChannels(const AStringVector & a_ChannelList -void cClientHandle::HandleCommandBlockMessage(const char * a_Data, size_t a_Length) +void cClientHandle::HandleBeaconSelection(int a_PrimaryEffect, int a_SecondaryEffect) { - if (a_Length < 14) + cWindow * Window = m_Player->GetWindow(); + if ((Window == NULL) || (Window->GetWindowType() != cWindow::wtBeacon)) { - SendChat("Failure setting command block command; bad request", mtFailure); - LOGD("Malformed MC|AdvCdm packet."); return; } + cBeaconWindow * BeaconWindow = (cBeaconWindow *) Window; - cByteBuffer Buffer(a_Length); - Buffer.Write(a_Data, a_Length); + if (Window->GetSlot(*m_Player, 0)->IsEmpty()) + { + return; + } - int BlockX, BlockY, BlockZ; + cEntityEffect::eType PrimaryEffect = cEntityEffect::effNoEffect; + if ((a_PrimaryEffect >= 0) && (a_PrimaryEffect <= (int)cEntityEffect::effSaturation)) + { + PrimaryEffect = (cEntityEffect::eType)a_PrimaryEffect; + } + cEntityEffect::eType SecondaryEffect = cEntityEffect::effNoEffect; + if ((a_SecondaryEffect >= 0) && (a_SecondaryEffect <= (int)cEntityEffect::effSaturation)) + { + SecondaryEffect = (cEntityEffect::eType)a_SecondaryEffect; + } - AString Command; + Window->SetSlot(*m_Player, 0, cItem()); + BeaconWindow->GetBeaconEntity()->SetPrimaryEffect(PrimaryEffect); - char Mode; + // Valid effect check. Vanilla don't check this, but we do it :) + if ( + (SecondaryEffect == cEntityEffect::effNoEffect) || + (SecondaryEffect == cEntityEffect::effRegeneration) || + (SecondaryEffect == BeaconWindow->GetBeaconEntity()->GetPrimaryEffect()) + ) + { + BeaconWindow->GetBeaconEntity()->SetSecondaryEffect(SecondaryEffect); + } + else + { + BeaconWindow->GetBeaconEntity()->SetSecondaryEffect(cEntityEffect::effNoEffect); + } - Buffer.ReadChar(Mode); + m_Player->CloseWindow(true); +} - switch (Mode) - { - case 0x00: - { - Buffer.ReadBEInt(BlockX); - Buffer.ReadBEInt(BlockY); - Buffer.ReadBEInt(BlockZ); - Buffer.ReadVarUTF8String(Command); - break; - } - default: - { - SendChat("Failure setting command block command; unhandled mode", mtFailure); - LOGD("Unhandled MC|AdvCdm packet mode."); - return; - } - } - cWorld * World = m_Player->GetWorld(); +void cClientHandle::HandleCommandBlockBlockChange(int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_NewCommand) +{ + cWorld * World = m_Player->GetWorld(); if (World->AreCommandBlocksEnabled()) { - World->SetCommandBlockCommand(BlockX, BlockY, BlockZ, Command); - + World->SetCommandBlockCommand(a_BlockX, a_BlockY, a_BlockZ, a_NewCommand); SendChat("Successfully set command block command", mtSuccess); } else @@ -804,22 +843,26 @@ void cClientHandle::HandleCommandBlockMessage(const char * a_Data, size_t a_Leng -void cClientHandle::HandleAnvilItemName(const char * a_Data, size_t a_Length) +void cClientHandle::HandleCommandBlockEntityChange(int a_EntityID, const AString & a_NewCommand) { - if (a_Length < 1) - { - return; - } + // TODO + LOGWARNING("%s: Not implemented yet", __FUNCTION__); +} + + + + +void cClientHandle::HandleAnvilItemName(const AString & a_ItemName) +{ if ((m_Player->GetWindow() == NULL) || (m_Player->GetWindow()->GetWindowType() != cWindow::wtAnvil)) { return; } - AString Name(a_Data, a_Length); - if (Name.length() <= 30) + if (a_ItemName.length() <= 30) { - ((cAnvilWindow *)m_Player->GetWindow())->SetRepairedItemName(Name, m_Player); + ((cAnvilWindow *)m_Player->GetWindow())->SetRepairedItemName(a_ItemName, m_Player); } } @@ -841,15 +884,36 @@ void cClientHandle::HandleLeftClick(int a_BlockX, int a_BlockY, int a_BlockZ, eB return; } - if ( - ((a_Status == DIG_STATUS_STARTED) || (a_Status == DIG_STATUS_FINISHED)) && // Only do a radius check for block destruction - things like pickup tossing send coordinates that are to be ignored - ((Diff(m_Player->GetPosX(), (double)a_BlockX) > 6) || - (Diff(m_Player->GetPosY(), (double)a_BlockY) > 6) || - (Diff(m_Player->GetPosZ(), (double)a_BlockZ) > 6)) - ) + if ((a_Status == DIG_STATUS_STARTED) || (a_Status == DIG_STATUS_FINISHED)) { - m_Player->GetWorld()->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player); - return; + if (a_BlockFace == BLOCK_FACE_NONE) + { + return; + } + + /* Check for clickthrough-blocks: + When the user breaks a fire block, the client send the wrong block location. + We must find the right block with the face direction. */ + int BlockX = a_BlockX; + int BlockY = a_BlockY; + int BlockZ = a_BlockZ; + AddFaceDirection(BlockX, BlockY, BlockZ, a_BlockFace); + if (cBlockInfo::GetHandler(m_Player->GetWorld()->GetBlock(BlockX, BlockY, BlockZ))->IsClickedThrough()) + { + a_BlockX = BlockX; + a_BlockY = BlockY; + a_BlockZ = BlockZ; + } + + if ( + ((Diff(m_Player->GetPosX(), (double)a_BlockX) > 6) || + (Diff(m_Player->GetPosY(), (double)a_BlockY) > 6) || + (Diff(m_Player->GetPosZ(), (double)a_BlockZ) > 6)) + ) + { + m_Player->GetWorld()->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player); + return; + } } cPluginManager * PlgMgr = cRoot::Get()->GetPluginManager(); @@ -957,10 +1021,11 @@ void cClientHandle::HandleBlockDigStarted(int a_BlockX, int a_BlockY, int a_Bloc if ( m_Player->IsGameModeCreative() && - ItemCategory::IsSword(m_Player->GetInventory().GetEquippedItem().m_ItemType) + ItemCategory::IsSword(m_Player->GetInventory().GetEquippedItem().m_ItemType) && + (m_Player->GetWorld()->GetBlock(a_BlockX, a_BlockY, a_BlockZ) != E_BLOCK_FIRE) ) { - // Players can't destroy blocks with a Sword in the hand. + // Players can't destroy blocks with a sword in the hand. return; } @@ -980,26 +1045,6 @@ void cClientHandle::HandleBlockDigStarted(int a_BlockX, int a_BlockY, int a_Bloc m_LastDigBlockY = a_BlockY; m_LastDigBlockZ = a_BlockZ; - // Check for clickthrough-blocks: - /* When the user breaks a fire block, the client send the wrong block location. - We must find the right block with the face direction. */ - if (a_BlockFace != BLOCK_FACE_NONE) - { - int pX = a_BlockX; - int pY = a_BlockY; - int pZ = a_BlockZ; - - AddFaceDirection(pX, pY, pZ, a_BlockFace); // Get the block in front of the clicked coordinates (m_bInverse defaulted to false) - cBlockHandler * Handler = cBlockInfo::GetHandler(m_Player->GetWorld()->GetBlock(pX, pY, pZ)); - - if (Handler->IsClickedThrough()) - { - cChunkInterface ChunkInterface(m_Player->GetWorld()->GetChunkMap()); - Handler->OnDigging(ChunkInterface, *m_Player->GetWorld(), m_Player, pX, pY, pZ); - return; - } - } - if ( (m_Player->IsGameModeCreative()) || // In creative mode, digging is done immediately cBlockInfo::IsOneHitDig(a_OldBlock) // One-hit blocks get destroyed immediately, too @@ -1051,6 +1096,20 @@ void cClientHandle::HandleBlockDigFinished(int a_BlockX, int a_BlockY, int a_Blo FinishDigAnimation(); + if (!m_Player->IsGameModeCreative()) + { + if (a_OldBlock == E_BLOCK_BEDROCK) + { + Kick("You can't break a bedrock!"); + return; + } + if (a_OldBlock == E_BLOCK_BARRIER) + { + Kick("You can't break a barrier!"); + return; + } + } + cWorld * World = m_Player->GetWorld(); cItemHandler * ItemHandler = cItemHandler::GetItemHandler(m_Player->GetEquippedItem()); @@ -1067,6 +1126,7 @@ void cClientHandle::HandleBlockDigFinished(int a_BlockX, int a_BlockY, int a_Blo return; } + m_Player->AddFoodExhaustion(0.025); ItemHandler->OnBlockDestroyed(World, m_Player, m_Player->GetEquippedItem(), a_BlockX, a_BlockY, a_BlockZ); // The ItemHandler is also responsible for spawning the pickups cChunkInterface ChunkInterface(World->GetChunkMap()); @@ -1108,50 +1168,61 @@ void cClientHandle::FinishDigAnimation() void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, const cItem & a_HeldItem) { + // TODO: Rewrite this function + LOGD("HandleRightClick: {%d, %d, %d}, face %d, HeldItem: %s", a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, ItemToFullString(a_HeldItem).c_str() ); cWorld * World = m_Player->GetWorld(); + bool AreRealCoords = (Vector3d(a_BlockX, a_BlockY, a_BlockZ) - m_Player->GetPosition()).Length() <= 5; if ( (a_BlockFace != BLOCK_FACE_NONE) && // The client is interacting with a specific block - ( - (Diff(m_Player->GetPosX(), (double)a_BlockX) > 6) || // The block is too far away - (Diff(m_Player->GetPosY(), (double)a_BlockY) > 6) || - (Diff(m_Player->GetPosZ(), (double)a_BlockZ) > 6) - ) + IsValidBlock(a_HeldItem.m_ItemType) && + !AreRealCoords ) { AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace); - World->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player); - if (a_BlockY < cChunkDef::Height - 1) - { - World->SendBlockTo(a_BlockX, a_BlockY + 1, a_BlockZ, m_Player); // 2 block high things - } - if (a_BlockY > 0) + if ((a_BlockX != -1) && (a_BlockY >= 0) && (a_BlockZ != -1)) { - World->SendBlockTo(a_BlockX, a_BlockY - 1, a_BlockZ, m_Player); // 2 block high things + World->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player); + if (a_BlockY < cChunkDef::Height - 1) + { + World->SendBlockTo(a_BlockX, a_BlockY + 1, a_BlockZ, m_Player); // 2 block high things + } + if (a_BlockY > 0) + { + World->SendBlockTo(a_BlockX, a_BlockY - 1, a_BlockZ, m_Player); // 2 block high things + } } m_Player->GetInventory().SendEquippedSlot(); return; } + if (!AreRealCoords) + { + a_BlockFace = BLOCK_FACE_NONE; + } + cPluginManager * PlgMgr = cRoot::Get()->GetPluginManager(); if (PlgMgr->CallHookPlayerRightClick(*m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ)) { // A plugin doesn't agree with the action, replace the block on the client and quit: - cChunkInterface ChunkInterface(World->GetChunkMap()); - BLOCKTYPE BlockType = World->GetBlock(a_BlockX, a_BlockY, a_BlockZ); - cBlockHandler * BlockHandler = cBlockInfo::GetHandler(BlockType); - BlockHandler->OnCancelRightClick(ChunkInterface, *World, m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace); - - if (a_BlockFace != BLOCK_FACE_NONE) + if (AreRealCoords) { - AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace); - World->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player); - World->SendBlockTo(a_BlockX, a_BlockY + 1, a_BlockZ, m_Player); // 2 block high things - m_Player->GetInventory().SendEquippedSlot(); + cChunkInterface ChunkInterface(World->GetChunkMap()); + BLOCKTYPE BlockType = World->GetBlock(a_BlockX, a_BlockY, a_BlockZ); + cBlockHandler * BlockHandler = cBlockInfo::GetHandler(BlockType); + BlockHandler->OnCancelRightClick(ChunkInterface, *World, m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace); + + if (a_BlockFace != BLOCK_FACE_NONE) + { + AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace); + World->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player); + World->SendBlockTo(a_BlockX, a_BlockY + 1, a_BlockZ, m_Player); // 2 block high things + m_Player->GetInventory().SendEquippedSlot(); + } } return; } @@ -1184,22 +1255,25 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e return; } - BLOCKTYPE BlockType; - NIBBLETYPE BlockMeta; - World->GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, BlockType, BlockMeta); - cBlockHandler * BlockHandler = cBlockInfo::GetHandler(BlockType); - - if (BlockHandler->IsUseable() && !m_Player->IsCrouched()) + if (AreRealCoords) { - if (PlgMgr->CallHookPlayerUsingBlock(*m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, BlockType, BlockMeta)) + BLOCKTYPE BlockType; + NIBBLETYPE BlockMeta; + World->GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, BlockType, BlockMeta); + cBlockHandler * BlockHandler = cBlockInfo::GetHandler(BlockType); + + if (BlockHandler->IsUseable() && !m_Player->IsCrouched()) { - // A plugin doesn't agree with using the block, abort + if (PlgMgr->CallHookPlayerUsingBlock(*m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, BlockType, BlockMeta)) + { + // A plugin doesn't agree with using the block, abort + return; + } + cChunkInterface ChunkInterface(World->GetChunkMap()); + BlockHandler->OnUse(ChunkInterface, *World, m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ); + PlgMgr->CallHookPlayerUsedBlock(*m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, BlockType, BlockMeta); return; } - cChunkInterface ChunkInterface(World->GetChunkMap()); - BlockHandler->OnUse(ChunkInterface, *World, m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ); - PlgMgr->CallHookPlayerUsedBlock(*m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, BlockType, BlockMeta); - return; } short EquippedDamage = Equipped.m_ItemDamage; @@ -1212,7 +1286,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e else if ((ItemHandler->IsFood() || ItemHandler->IsDrinkable(EquippedDamage))) { if ((m_Player->IsSatiated() || m_Player->IsGameModeCreative()) && - ItemHandler->IsFood()) + ItemHandler->IsFood() && (Equipped.m_ItemType != E_ITEM_GOLDEN_APPLE)) { // The player is satiated or in creative, and trying to eat return; @@ -1363,8 +1437,20 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e cChunkInterface ChunkInterface(World->GetChunkMap()); NewBlock->OnPlacedByPlayer(ChunkInterface, *World, m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, BlockType, BlockMeta); - // Step sound with 0.8f pitch is used as block placement sound - World->BroadcastSoundEffect(NewBlock->GetStepSound(), (double)a_BlockX, (double)a_BlockY, (double)a_BlockZ, 1.0f, 0.8f); + AString PlaceSound = cBlockInfo::GetPlaceSound(BlockType); + float Volume = 1.0f, Pitch = 0.8f; + if (PlaceSound == "dig.metal") + { + Pitch = 1.2f; + PlaceSound = "dig.stone"; + } + else if (PlaceSound == "random.anvil_land") + { + Volume = 0.65f; + } + + World->BroadcastSoundEffect(PlaceSound, a_BlockX + 0.5, a_BlockY + 0.5, a_BlockZ + 0.5, Volume, Pitch); + cRoot::Get()->GetPluginManager()->CallHookPlayerPlacedBlock(*m_Player, a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, BlockType, BlockMeta); } @@ -1611,20 +1697,6 @@ void cClientHandle::HandleRespawn(void) -void cClientHandle::HandleDisconnect(const AString & a_Reason) -{ - LOGD("Received d/c packet from %s with reason \"%s\"", m_Username.c_str(), a_Reason.c_str()); - - cRoot::Get()->GetPluginManager()->CallHookDisconnect(*this, a_Reason); - - m_HasSentDC = true; - Destroy(); -} - - - - - void cClientHandle::HandleKeepAlive(int a_KeepAliveID) { if (a_KeepAliveID == m_PingID) @@ -1972,28 +2044,17 @@ void cClientHandle::SendBlockChanges(int a_ChunkX, int a_ChunkZ, const sSetBlock void cClientHandle::SendChat(const AString & a_Message, eMessageType a_ChatPrefix, const AString & a_AdditionalData) { - bool ShouldAppendChatPrefixes = true; - - if (GetPlayer()->GetWorld() == NULL) + cWorld * World = GetPlayer()->GetWorld(); + if (World == NULL) { - cWorld * World = cRoot::Get()->GetWorld(GetPlayer()->GetLoadedWorldName()); + World = cRoot::Get()->GetWorld(GetPlayer()->GetLoadedWorldName()); if (World == NULL) { World = cRoot::Get()->GetDefaultWorld(); } - - if (!World->ShouldUseChatPrefixes()) - { - ShouldAppendChatPrefixes = false; - } - } - else if (!GetPlayer()->GetWorld()->ShouldUseChatPrefixes()) - { - ShouldAppendChatPrefixes = false; } - AString Message = FormatMessageType(ShouldAppendChatPrefixes, a_ChatPrefix, a_AdditionalData); - + AString Message = FormatMessageType(World->ShouldUseChatPrefixes(), a_ChatPrefix, a_AdditionalData); m_Protocol->SendChat(Message.append(a_Message)); } @@ -2227,18 +2288,18 @@ void cClientHandle::SendInventorySlot(char a_WindowID, short a_SlotNum, const cI -void cClientHandle::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length) +void cClientHandle::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length, unsigned int m_Scale) { - m_Protocol->SendMapColumn(a_ID, a_X, a_Y, a_Colors, a_Length); + m_Protocol->SendMapColumn(a_ID, a_X, a_Y, a_Colors, a_Length, m_Scale); } -void cClientHandle::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decorators) +void cClientHandle::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decorators, unsigned int m_Scale) { - m_Protocol->SendMapDecorators(a_ID, a_Decorators); + m_Protocol->SendMapDecorators(a_ID, a_Decorators, m_Scale); } @@ -2254,9 +2315,9 @@ void cClientHandle::SendMapInfo(int a_ID, unsigned int a_Scale) -void cClientHandle::SendParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount) +void cClientHandle::SendParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount) { - m_Protocol->SendParticleEffect(a_ParticleName, a_SrcX, a_SrcY, a_SrcZ, a_OffsetX, a_OffsetY, a_OffsetZ, a_ParticleData, a_ParticleAmmount); + m_Protocol->SendParticleEffect(a_ParticleName, a_SrcX, a_SrcY, a_SrcZ, a_OffsetX, a_OffsetY, a_OffsetZ, a_ParticleData, a_ParticleAmount); } @@ -2298,9 +2359,45 @@ void cClientHandle::SendPlayerAbilities() -void cClientHandle::SendPlayerListItem(const cPlayer & a_Player, bool a_IsOnline) +void cClientHandle::SendPlayerListAddPlayer(const cPlayer & a_Player) +{ + m_Protocol->SendPlayerListAddPlayer(a_Player); +} + + + + + +void cClientHandle::SendPlayerListRemovePlayer(const cPlayer & a_Player) +{ + m_Protocol->SendPlayerListRemovePlayer(a_Player); +} + + + + + +void cClientHandle::SendPlayerListUpdateGameMode(const cPlayer & a_Player) { - m_Protocol->SendPlayerListItem(a_Player, a_IsOnline); + m_Protocol->SendPlayerListUpdateGameMode(a_Player); +} + + + + + +void cClientHandle::SendPlayerListUpdatePing(const cPlayer & a_Player) +{ + m_Protocol->SendPlayerListUpdatePing(a_Player); +} + + + + + +void cClientHandle::SendPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName) +{ + m_Protocol->SendPlayerListUpdateDisplayName(a_Player, a_CustomName); } @@ -2520,9 +2617,9 @@ void cClientHandle::SendThunderbolt(int a_BlockX, int a_BlockY, int a_BlockZ) -void cClientHandle::SendTimeUpdate(Int64 a_WorldAge, Int64 a_TimeOfDay) +void cClientHandle::SendTimeUpdate(Int64 a_WorldAge, Int64 a_TimeOfDay, bool a_DoDaylightCycle) { - m_Protocol->SendTimeUpdate(a_WorldAge, a_TimeOfDay); + m_Protocol->SendTimeUpdate(a_WorldAge, a_TimeOfDay, a_DoDaylightCycle); } @@ -2661,7 +2758,7 @@ bool cClientHandle::HasPluginChannel(const AString & a_PluginChannel) -bool cClientHandle::WantsSendChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +bool cClientHandle::WantsSendChunk(int a_ChunkX, int a_ChunkZ) { if (m_State >= csDestroying) { @@ -2669,7 +2766,7 @@ bool cClientHandle::WantsSendChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) } cCSLock Lock(m_CSChunkLists); - return (std::find(m_ChunksToSend.begin(), m_ChunksToSend.end(), cChunkCoords(a_ChunkX, a_ChunkY, a_ChunkZ)) != m_ChunksToSend.end()); + return (std::find(m_ChunksToSend.begin(), m_ChunksToSend.end(), cChunkCoords(a_ChunkX, a_ChunkZ)) != m_ChunksToSend.end()); } @@ -2685,9 +2782,9 @@ void cClientHandle::AddWantedChunk(int a_ChunkX, int a_ChunkZ) LOGD("Adding chunk [%d, %d] to wanted chunks for client %p", a_ChunkX, a_ChunkZ, this); cCSLock Lock(m_CSChunkLists); - if (std::find(m_ChunksToSend.begin(), m_ChunksToSend.end(), cChunkCoords(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ)) == m_ChunksToSend.end()) + if (std::find(m_ChunksToSend.begin(), m_ChunksToSend.end(), cChunkCoords(a_ChunkX, a_ChunkZ)) == m_ChunksToSend.end()) { - m_ChunksToSend.push_back(cChunkCoords(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ)); + m_ChunksToSend.push_back(cChunkCoords(a_ChunkX, a_ChunkZ)); } } @@ -2785,11 +2882,27 @@ void cClientHandle::SocketClosed(void) -void cClientHandle::HandleEnchantItem(Byte & WindowID, Byte & Enchantment) +void cClientHandle::HandleEnchantItem(Byte & a_WindowID, Byte & a_Enchantment) { - cEnchantingWindow * Window = (cEnchantingWindow*)m_Player->GetWindow(); + if (a_Enchantment > 2) + { + LOGWARNING("%s attempt to crash the server with invalid enchanting selection!", GetUsername().c_str()); + Kick("Invalid enchanting!"); + return; + } + + if ( + (m_Player->GetWindow() == NULL) || + (m_Player->GetWindow()->GetWindowID() != a_WindowID) || + (m_Player->GetWindow()->GetWindowType() != cWindow::wtEnchantment) + ) + { + return; + } + + cEnchantingWindow * Window = (cEnchantingWindow*) m_Player->GetWindow(); cItem Item = *Window->m_SlotArea->GetSlot(0, *m_Player); - int BaseEnchantmentLevel = Window->GetPropertyValue(Enchantment); + int BaseEnchantmentLevel = Window->GetPropertyValue(a_Enchantment); if (Item.EnchantByXPLevels(BaseEnchantmentLevel)) { diff --git a/src/ClientHandle.h b/src/ClientHandle.h index 48eba4de1..a9cc29d50 100644 --- a/src/ClientHandle.h +++ b/src/ClientHandle.h @@ -62,15 +62,29 @@ public: cClientHandle(const cSocket * a_Socket, int a_ViewDistance); virtual ~cClientHandle(); - const AString & GetIPString(void) const { return m_IPString; } + const AString & GetIPString(void) const { return m_IPString; } // tolua_export + + /** Sets the IP string that the client is using. Overrides the IP string that was read from the socket. + Used mainly by BungeeCord compatibility code. */ + void SetIPString(const AString & a_IPString) { m_IPString = a_IPString; } cPlayer * GetPlayer(void) { return m_Player; } // tolua_export + /** Returns the player's UUID, as used by the protocol, in the short form (no dashes) */ const AString & GetUUID(void) const { return m_UUID; } // tolua_export - void SetUUID(const AString & a_UUID) { m_UUID = a_UUID; } + + /** Sets the player's UUID, as used by the protocol. Short UUID form (no dashes) is expected. + Used mainly by BungeeCord compatibility code - when authenticating is done on the BungeeCord server + and the results are passed to MCS running in offline mode. */ + void SetUUID(const AString & a_UUID) { ASSERT(a_UUID.size() == 32); m_UUID = a_UUID; } const Json::Value & GetProperties(void) const { return m_Properties; } + /** Sets the player's properties, such as skin image and signature. + Used mainly by BungeeCord compatibility code - property querying is done on the BungeeCord server + and the results are passed to MCS running in offline mode. */ + void SetProperties(const Json::Value & a_Properties) { m_Properties = a_Properties; } + /** Generates an UUID based on the username stored for this client, and stores it in the m_UUID member. This is used for the offline (non-auth) mode, when there's no UUID source. Each username generates a unique and constant UUID, so that when the player reconnects with the same name, their UUID is the same. @@ -80,7 +94,7 @@ public: /** Generates an UUID based on the player name provided. This is used for the offline (non-auth) mode, when there's no UUID source. Each username generates a unique and constant UUID, so that when the player reconnects with the same name, their UUID is the same. - Returns a 36-char UUID (with dashes). */ + Returns a 32-char UUID (no dashes). */ static AString GenerateOfflineUUID(const AString & a_Username); // tolua_export /** Returns true if the UUID is generated by online auth, false if it is an offline-generated UUID. @@ -120,73 +134,77 @@ public: // The following functions send the various packets: // (Please keep these alpha-sorted) - void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle); - void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType); - void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage); - void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta); // tolua_export - void SendBlockChanges (int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes); - void SendChat (const AString & a_Message, eMessageType a_ChatPrefix, const AString & a_AdditionalData = ""); - void SendChat (const cCompositeChat & a_Message); - void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer); - void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player); - void SendDestroyEntity (const cEntity & a_Entity); - void SendDisconnect (const AString & a_Reason); - void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ); - void SendEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration); - void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item); - void SendEntityHeadLook (const cEntity & a_Entity); - void SendEntityLook (const cEntity & a_Entity); - void SendEntityMetadata (const cEntity & a_Entity); - void SendEntityProperties (const cEntity & a_Entity); - void SendEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ); - void SendEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ); - void SendEntityStatus (const cEntity & a_Entity, char a_Status); - void SendEntityVelocity (const cEntity & a_Entity); - void SendExplosion (double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion); - void SendGameMode (eGameMode a_GameMode); - void SendHealth (void); - void SendInventorySlot (char a_WindowID, short a_SlotNum, const cItem & a_Item); - void SendMapColumn (int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length); - void SendMapDecorators (int a_ID, const cMapDecoratorList & a_Decorators); - void SendMapInfo (int a_ID, unsigned int a_Scale); - void SendPaintingSpawn (const cPainting & a_Painting); - void SendPickupSpawn (const cPickup & a_Pickup); - void SendEntityAnimation (const cEntity & a_Entity, char a_Animation); // tolua_export - void SendParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount); - void SendPlayerAbilities (void); - void SendPlayerListItem (const cPlayer & a_Player, bool a_IsOnline); - void SendPlayerMaxSpeed (void); ///< Informs the client of the maximum player speed (1.6.1+) - void SendPlayerMoveLook (void); - void SendPlayerPosition (void); - void SendPlayerSpawn (const cPlayer & a_Player); - void SendPluginMessage (const AString & a_Channel, const AString & a_Message); // Exported in ManualBindings.cpp - void SendRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID); - void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks = false); - void SendExperience (void); - void SendExperienceOrb (const cExpOrb & a_ExpOrb); - void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode); - void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode); - void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display); - void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch); // tolua_export - void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data); - void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock); - void SendSpawnMob (const cMonster & a_Mob); - void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch); - void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType = 0); - void SendStatistics (const cStatManager & a_Manager); - void SendTabCompletionResults(const AStringVector & a_Results); - void SendTeleportEntity (const cEntity & a_Entity); - void SendThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ); - void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay); - void SendUnloadChunk (int a_ChunkX, int a_ChunkZ); - void SendUpdateBlockEntity (cBlockEntity & a_BlockEntity); - void SendUpdateSign (int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4); - void SendUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ); - void SendWeather (eWeather a_Weather); - void SendWholeInventory (const cWindow & a_Window); - void SendWindowClose (const cWindow & a_Window); - void SendWindowOpen (const cWindow & a_Window); - void SendWindowProperty (const cWindow & a_Window, int a_Property, int a_Value); + void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle); + void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType); + void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage); + void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta); // tolua_export + void SendBlockChanges (int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes); + void SendChat (const AString & a_Message, eMessageType a_ChatPrefix, const AString & a_AdditionalData = ""); + void SendChat (const cCompositeChat & a_Message); + void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer); + void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player); + void SendDestroyEntity (const cEntity & a_Entity); + void SendDisconnect (const AString & a_Reason); + void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display); + void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ); + void SendEntityAnimation (const cEntity & a_Entity, char a_Animation); // tolua_export + void SendEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration); + void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item); + void SendEntityHeadLook (const cEntity & a_Entity); + void SendEntityLook (const cEntity & a_Entity); + void SendEntityMetadata (const cEntity & a_Entity); + void SendEntityProperties (const cEntity & a_Entity); + void SendEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ); + void SendEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ); + void SendEntityStatus (const cEntity & a_Entity, char a_Status); + void SendEntityVelocity (const cEntity & a_Entity); + void SendExperience (void); + void SendExperienceOrb (const cExpOrb & a_ExpOrb); + void SendExplosion (double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion); + void SendGameMode (eGameMode a_GameMode); + void SendHealth (void); + void SendInventorySlot (char a_WindowID, short a_SlotNum, const cItem & a_Item); + void SendMapColumn (int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length, unsigned int m_Scale); + void SendMapDecorators (int a_ID, const cMapDecoratorList & a_Decorators, unsigned int m_Scale); + void SendMapInfo (int a_ID, unsigned int a_Scale); + void SendPaintingSpawn (const cPainting & a_Painting); + void SendParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount); + void SendPickupSpawn (const cPickup & a_Pickup); + void SendPlayerAbilities (void); + void SendPlayerListAddPlayer (const cPlayer & a_Player); + void SendPlayerListRemovePlayer (const cPlayer & a_Player); + void SendPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName); + void SendPlayerListUpdateGameMode (const cPlayer & a_Player); + void SendPlayerListUpdatePing (const cPlayer & a_Player); + void SendPlayerMaxSpeed (void); ///< Informs the client of the maximum player speed (1.6.1+) + void SendPlayerMoveLook (void); + void SendPlayerPosition (void); + void SendPlayerSpawn (const cPlayer & a_Player); + void SendPluginMessage (const AString & a_Channel, const AString & a_Message); // Exported in ManualBindings.cpp + void SendRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID); + void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks = false); + void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode); + void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode); + void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch); // tolua_export + void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data); + void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock); + void SendSpawnMob (const cMonster & a_Mob); + void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch); + void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType = 0); + void SendStatistics (const cStatManager & a_Manager); + void SendTabCompletionResults (const AStringVector & a_Results); + void SendTeleportEntity (const cEntity & a_Entity); + void SendThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ); + void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay, bool a_DoDaylightCycle); // tolua_export + void SendUnloadChunk (int a_ChunkX, int a_ChunkZ); + void SendUpdateBlockEntity (cBlockEntity & a_BlockEntity); + void SendUpdateSign (int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4); + void SendUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ); + void SendWeather (eWeather a_Weather); + void SendWholeInventory (const cWindow & a_Window); + void SendWindowClose (const cWindow & a_Window); + void SendWindowOpen (const cWindow & a_Window); + void SendWindowProperty (const cWindow & a_Window, int a_Property, int a_Value); // tolua_begin const AString & GetUsername(void) const; @@ -204,10 +222,17 @@ public: bool HasPluginChannel(const AString & a_PluginChannel); + /** Called by the protocol when it receives the MC|Brand plugin message. Also callable by plugins. + Simply stores the string value. */ + void SetClientBrand(const AString & a_ClientBrand) { m_ClientBrand = a_ClientBrand; } + + /** Returns the client brand received in the MC|Brand plugin message or set by a plugin. */ + const AString & GetClientBrand(void) const { return m_ClientBrand; } + // tolua_end /** Returns true if the client wants the chunk specified to be sent (in m_ChunksToSend) */ - bool WantsSendChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ); + bool WantsSendChunk(int a_ChunkX, int a_ChunkZ); /** Adds the chunk specified to the list of chunks wanted for sending (m_ChunksToSend) */ void AddWantedChunk(int a_ChunkX, int a_ChunkZ); @@ -218,13 +243,31 @@ public: void PacketError(unsigned char a_PacketType); // Calls that cProtocol descendants use for handling packets: - void HandleAnimation (char a_Animation); - void HandleChat (const AString & a_Message); - void HandleCreativeInventory(short a_SlotNum, const cItem & a_HeldItem); - void HandleDisconnect (const AString & a_Reason); - void HandleEntityCrouch (int a_EntityID, bool a_IsCrouching); - void HandleEntityLeaveBed (int a_EntityID); - void HandleEntitySprinting (int a_EntityID, bool a_IsSprinting); + void HandleAnimation(char a_Animation); + + /** Called when the protocol receives a MC|ItemName plugin message, indicating that the player named + an item in the anvil UI. */ + void HandleAnvilItemName(const AString & a_ItemName); + + /** Called when the protocol receives a MC|Beacon plugin message, indicating that the player set an effect + in the beacon UI. */ + void HandleBeaconSelection(int a_PrimaryEffect, int a_SecondaryEffect); + + /** Called when the protocol detects a chat packet. */ + void HandleChat(const AString & a_Message); + + /** Called when the protocol receives a MC|AdvCdm plugin message, indicating that the player set a new + command in the command block UI, for a block-based commandblock. */ + void HandleCommandBlockBlockChange(int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_NewCommand); + + /** Called when the protocol receives a MC|AdvCdm plugin message, indicating that the player set a new + command in the command block UI, for an entity-based commandblock (minecart?). */ + void HandleCommandBlockEntityChange(int a_EntityID, const AString & a_NewCommand); + + void HandleCreativeInventory (short a_SlotNum, const cItem & a_HeldItem); + void HandleEntityCrouch (int a_EntityID, bool a_IsCrouching); + void HandleEntityLeaveBed (int a_EntityID); + void HandleEntitySprinting (int a_EntityID, bool a_IsSprinting); /** Called when the protocol handshake has been received (for protocol versions that support it; otherwise the first instant when a username is received). @@ -234,6 +277,11 @@ public: void HandleKeepAlive (int a_KeepAliveID); void HandleLeftClick (int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, char a_Status); + + /** Called when the protocol receives a MC|TrSel packet, indicating that the player used a trade in + the NPC UI. */ + void HandleNPCTrade(int a_SlotNum); + void HandlePing (void); void HandlePlayerAbilities (bool a_CanFly, bool a_IsFlying, float FlyingSpeed, float WalkingSpeed); void HandlePlayerLook (float a_Rotation, float a_Pitch, bool a_IsOnGround); @@ -267,7 +315,13 @@ public: void RemoveFromWorld(void); /** Called when the player will enchant a Item */ - void HandleEnchantItem(Byte & WindowID, Byte & Enchantment); + void HandleEnchantItem(Byte & a_WindowID, Byte & a_Enchantment); + + /** Called by the protocol recognizer when the protocol version is known. */ + void SetProtocolVersion(UInt32 a_ProtocolVersion) { m_ProtocolVersion = a_ProtocolVersion; } + + /** Returns the protocol version number of the protocol that the client is talking. Returns zero if the protocol version is not (yet) known. */ + UInt32 GetProtocolVersion(void) const { return m_ProtocolVersion; } // tolua_export private: @@ -360,7 +414,11 @@ private: int m_NumBlockChangeInteractionsThisTick; static int s_ClientCount; + + /** ID used for identification during authenticating. Assigned sequentially for each new instance. */ int m_UniqueID; + + /** Contains the UUID used by Mojang to identify the player's account. Short UUID stored here (without dashes) */ AString m_UUID; /** Set to true when the chunk where the player is is sent to the client. Used for spawning the player */ @@ -371,6 +429,12 @@ private: /** The plugin channels that the client has registered. */ cChannels m_PluginChannels; + + /** The brand identification of the client, as received in the MC|Brand plugin message or set from a plugin. */ + AString m_ClientBrand; + + /** The version of the protocol that the client is talking, or 0 if unknown. */ + UInt32 m_ProtocolVersion; /** Handles the block placing packet when it is a real block placement (not block-using, item-using or eating) */ @@ -399,13 +463,7 @@ private: /** Removes all of the channels from the list of current plugin channels. Ignores channels that are not found. */ void UnregisterPluginChannels(const AStringVector & a_ChannelList); - - /** Handles the "MC|AdvCdm" plugin message */ - void HandleCommandBlockMessage(const char * a_Data, size_t a_Length); - /** Handles the "MC|ItemName" plugin message */ - void HandleAnvilItemName(const char * a_Data, size_t a_Length); - // cSocketThreads::cCallback overrides: virtual bool DataReceived (const char * a_Data, size_t a_Size) override; // Data is received from the client virtual void GetOutgoingData(AString & a_Data) override; // Data can be sent to client diff --git a/src/CompositeChat.cpp b/src/CompositeChat.cpp index f1a797897..d1eb0b852 100644 --- a/src/CompositeChat.cpp +++ b/src/CompositeChat.cpp @@ -5,6 +5,7 @@ #include "Globals.h" #include "CompositeChat.h" +#include "ClientHandle.h" @@ -353,23 +354,23 @@ AString cCompositeChat::ExtractText(void) const -cMCLogger::eLogLevel cCompositeChat::MessageTypeToLogLevel(eMessageType a_MessageType) +cLogger::eLogLevel cCompositeChat::MessageTypeToLogLevel(eMessageType a_MessageType) { switch (a_MessageType) { - case mtCustom: return cMCLogger::llRegular; - case mtFailure: return cMCLogger::llWarning; - case mtInformation: return cMCLogger::llInfo; - case mtSuccess: return cMCLogger::llRegular; - case mtWarning: return cMCLogger::llWarning; - case mtFatal: return cMCLogger::llError; - case mtDeath: return cMCLogger::llRegular; - case mtPrivateMessage: return cMCLogger::llRegular; - case mtJoin: return cMCLogger::llRegular; - case mtLeave: return cMCLogger::llRegular; + case mtCustom: return cLogger::llRegular; + case mtFailure: return cLogger::llWarning; + case mtInformation: return cLogger::llInfo; + case mtSuccess: return cLogger::llRegular; + case mtWarning: return cLogger::llWarning; + case mtFatal: return cLogger::llError; + case mtDeath: return cLogger::llRegular; + case mtPrivateMessage: return cLogger::llRegular; + case mtJoin: return cLogger::llRegular; + case mtLeave: return cLogger::llRegular; } ASSERT(!"Unhandled MessageType"); - return cMCLogger::llError; + return cLogger::llError; } @@ -399,6 +400,183 @@ void cCompositeChat::AddStyle(AString & a_Style, const AString & a_AddStyle) +AString cCompositeChat::CreateJsonString(bool a_ShouldUseChatPrefixes) const +{ + Json::Value msg; + msg["text"] = cClientHandle::FormatMessageType(a_ShouldUseChatPrefixes, GetMessageType(), GetAdditionalMessageTypeData()); // The client crashes without this field being present + const cCompositeChat::cParts & Parts = GetParts(); + for (cCompositeChat::cParts::const_iterator itr = Parts.begin(), end = Parts.end(); itr != end; ++itr) + { + Json::Value Part; + switch ((*itr)->m_PartType) + { + case cCompositeChat::ptText: + { + Part["text"] = (*itr)->m_Text; + AddChatPartStyle(Part, (*itr)->m_Style); + break; + } + + case cCompositeChat::ptClientTranslated: + { + const cCompositeChat::cClientTranslatedPart & p = (const cCompositeChat::cClientTranslatedPart &)**itr; + Part["translate"] = p.m_Text; + Json::Value With; + for (AStringVector::const_iterator itrW = p.m_Parameters.begin(), endW = p.m_Parameters.end(); itrW != endW; ++itr) + { + With.append(*itrW); + } + if (!p.m_Parameters.empty()) + { + Part["with"] = With; + } + AddChatPartStyle(Part, p.m_Style); + break; + } + + case cCompositeChat::ptUrl: + { + const cCompositeChat::cUrlPart & p = (const cCompositeChat::cUrlPart &)**itr; + Part["text"] = p.m_Text; + Json::Value Url; + Url["action"] = "open_url"; + Url["value"] = p.m_Url; + Part["clickEvent"] = Url; + AddChatPartStyle(Part, p.m_Style); + break; + } + + case cCompositeChat::ptSuggestCommand: + case cCompositeChat::ptRunCommand: + { + const cCompositeChat::cCommandPart & p = (const cCompositeChat::cCommandPart &)**itr; + Part["text"] = p.m_Text; + Json::Value Cmd; + Cmd["action"] = (p.m_PartType == cCompositeChat::ptRunCommand) ? "run_command" : "suggest_command"; + Cmd["value"] = p.m_Command; + Part["clickEvent"] = Cmd; + AddChatPartStyle(Part, p.m_Style); + break; + } + + case cCompositeChat::ptShowAchievement: + { + const cCompositeChat::cShowAchievementPart & p = (const cCompositeChat::cShowAchievementPart &)**itr; + Part["translate"] = "chat.type.achievement"; + + Json::Value Ach; + Ach["action"] = "show_achievement"; + Ach["value"] = p.m_Text; + + Json::Value AchColourAndName; + AchColourAndName["color"] = "green"; + AchColourAndName["translate"] = p.m_Text; + AchColourAndName["hoverEvent"] = Ach; + + Json::Value Extra; + Extra.append(AchColourAndName); + + Json::Value Name; + Name["text"] = p.m_PlayerName; + + Json::Value With; + With.append(Name); + With.append(Extra); + + Part["with"] = With; + AddChatPartStyle(Part, p.m_Style); + break; + } + } + msg["extra"].append(Part); + } // for itr - Parts[] + + return msg.toStyledString(); +} + + + + + +void cCompositeChat::AddChatPartStyle(Json::Value & a_Value, const AString & a_PartStyle) const +{ + size_t len = a_PartStyle.length(); + for (size_t i = 0; i < len; i++) + { + switch (a_PartStyle[i]) + { + case 'b': + { + // bold + a_Value["bold"] = Json::Value(true); + break; + } + + case 'i': + { + // italic + a_Value["italic"] = Json::Value(true); + break; + } + + case 'u': + { + // Underlined + a_Value["underlined"] = Json::Value(true); + break; + } + + case 's': + { + // strikethrough + a_Value["strikethrough"] = Json::Value(true); + break; + } + + case 'o': + { + // obfuscated + a_Value["obfuscated"] = Json::Value(true); + break; + } + + case '@': + { + // Color, specified by the next char: + i++; + if (i >= len) + { + // String too short, didn't contain a color + break; + } + switch (a_PartStyle[i]) + { + case '0': a_Value["color"] = Json::Value("black"); break; + case '1': a_Value["color"] = Json::Value("dark_blue"); break; + case '2': a_Value["color"] = Json::Value("dark_green"); break; + case '3': a_Value["color"] = Json::Value("dark_aqua"); break; + case '4': a_Value["color"] = Json::Value("dark_red"); break; + case '5': a_Value["color"] = Json::Value("dark_purple"); break; + case '6': a_Value["color"] = Json::Value("gold"); break; + case '7': a_Value["color"] = Json::Value("gray"); break; + case '8': a_Value["color"] = Json::Value("dark_gray"); break; + case '9': a_Value["color"] = Json::Value("blue"); break; + case 'a': a_Value["color"] = Json::Value("green"); break; + case 'b': a_Value["color"] = Json::Value("aqua"); break; + case 'c': a_Value["color"] = Json::Value("red"); break; + case 'd': a_Value["color"] = Json::Value("light_purple"); break; + case 'e': a_Value["color"] = Json::Value("yellow"); break; + case 'f': a_Value["color"] = Json::Value("white"); break; + } // switch (color) + } // case '@' + } // switch (Style[i]) + } // for i - a_PartStyle[] +} + + + + + //////////////////////////////////////////////////////////////////////////////// // cCompositeChat::cBasePart: diff --git a/src/CompositeChat.h b/src/CompositeChat.h index 1ad196f1d..369eed196 100644 --- a/src/CompositeChat.h +++ b/src/CompositeChat.h @@ -4,6 +4,7 @@ // Declares the cCompositeChat class used to wrap a chat message with multiple parts (text, url, cmd) #include "Defines.h" +#include "json/json.h" @@ -189,6 +190,8 @@ public: Used for older protocols that don't support composite chat and for console-logging. */ AString ExtractText(void) const; + + AString CreateJsonString(bool a_ShouldUseChatPrefixes = true) const; // tolua_end @@ -196,7 +199,10 @@ public: /** Converts the MessageType to a LogLevel value. Used by the logging bindings when logging a cCompositeChat object. */ - static cMCLogger::eLogLevel MessageTypeToLogLevel(eMessageType a_MessageType); + static cLogger::eLogLevel MessageTypeToLogLevel(eMessageType a_MessageType); + + /** Adds the chat part's style (represented by the part's stylestring) into the Json object. */ + void AddChatPartStyle(Json::Value & a_Value, const AString & a_PartStyle) const; protected: /** All the parts that */ diff --git a/src/CraftingRecipes.cpp b/src/CraftingRecipes.cpp index 1a31a6e90..ed3409207 100644 --- a/src/CraftingRecipes.cpp +++ b/src/CraftingRecipes.cpp @@ -1,4 +1,4 @@ - + // CraftingRecipes.cpp // Interfaces to the cCraftingRecipes class representing the storage of crafting recipes @@ -83,7 +83,7 @@ cItem & cCraftingGrid::GetItem(int x, int y) const -void cCraftingGrid::SetItem(int x, int y, ENUM_ITEM_ID a_ItemType, int a_ItemCount, short a_ItemHealth) +void cCraftingGrid::SetItem(int x, int y, ENUM_ITEM_ID a_ItemType, char a_ItemCount, short a_ItemHealth) { // Accessible through scripting, must verify parameters: if ((x < 0) || (x >= m_Width) || (y < 0) || (y >= m_Height)) @@ -228,7 +228,7 @@ void cCraftingRecipe::Clear(void) -void cCraftingRecipe::SetResult(ENUM_ITEM_ID a_ItemType, int a_ItemCount, short a_ItemHealth) +void cCraftingRecipe::SetResult(ENUM_ITEM_ID a_ItemType, char a_ItemCount, short a_ItemHealth) { m_Result = cItem(a_ItemType, a_ItemCount, a_ItemHealth); } @@ -324,7 +324,11 @@ void cCraftingRecipes::LoadRecipes(void) return; } AString Everything; - f.ReadRestOfFile(Everything); + if (!f.ReadRestOfFile(Everything)) + { + LOGWARNING("Cannot read file \"crafting.txt\", no crafting recipes will be available!"); + return; + } f.Close(); // Split it into lines, then process each line as a single recipe: @@ -362,7 +366,10 @@ void cCraftingRecipes::ClearRecipes(void) void cCraftingRecipes::AddRecipeLine(int a_LineNum, const AString & a_RecipeLine) { - AStringVector Sides = StringSplit(a_RecipeLine, "="); + AString RecipeLine(a_RecipeLine); + RecipeLine.erase(std::remove_if(RecipeLine.begin(), RecipeLine.end(), isspace), RecipeLine.end()); + + AStringVector Sides = StringSplit(RecipeLine, "="); if (Sides.size() != 2) { LOGWARNING("crafting.txt: line %d: A single '=' was expected, got %d", a_LineNum, (int)Sides.size() - 1); @@ -388,8 +395,7 @@ void cCraftingRecipes::AddRecipeLine(int a_LineNum, const AString & a_RecipeLine } if (ResultSplit.size() > 1) { - Recipe->m_Result.m_ItemCount = atoi(ResultSplit[1].c_str()); - if (Recipe->m_Result.m_ItemCount == 0) + if (!StringToInteger<char>(ResultSplit[1].c_str(), Recipe->m_Result.m_ItemCount)) { LOGWARNING("crafting.txt: line %d: Cannot parse result count, ignoring the recipe.", a_LineNum); LOGINFO("Offending line: \"%s\"", a_RecipeLine.c_str()); @@ -441,8 +447,7 @@ bool cCraftingRecipes::ParseItem(const AString & a_String, cItem & a_Item) if (Split.size() > 1) { AString Damage = TrimString(Split[1]); - a_Item.m_ItemDamage = atoi(Damage.c_str()); - if ((a_Item.m_ItemDamage == 0) && (Damage.compare("0") != 0)) + if (!StringToInteger<short>(Damage.c_str(), a_Item.m_ItemDamage)) { // Parsing the number failed return false; diff --git a/src/CraftingRecipes.h b/src/CraftingRecipes.h index 0250d2f68..fe1e15817 100644 --- a/src/CraftingRecipes.h +++ b/src/CraftingRecipes.h @@ -33,7 +33,7 @@ public: int GetWidth (void) const {return m_Width; } int GetHeight(void) const {return m_Height; } cItem & GetItem (int x, int y) const; - void SetItem (int x, int y, ENUM_ITEM_ID a_ItemType, int a_ItemCount, short a_ItemHealth); + void SetItem (int x, int y, ENUM_ITEM_ID a_ItemType, char a_ItemCount, short a_ItemHealth); void SetItem (int x, int y, const cItem & a_Item); void Clear (void); @@ -72,13 +72,13 @@ public: int GetIngredientsHeight(void) const {return m_Ingredients.GetHeight(); } cItem & GetIngredient (int x, int y) const {return m_Ingredients.GetItem(x, y); } const cItem & GetResult (void) const {return m_Result; } - void SetResult (ENUM_ITEM_ID a_ItemType, int a_ItemCount, short a_ItemHealth); + void SetResult (ENUM_ITEM_ID a_ItemType, char a_ItemCount, short a_ItemHealth); void SetResult (const cItem & a_Item) { m_Result = a_Item; } - void SetIngredient (int x, int y, ENUM_ITEM_ID a_ItemType, int a_ItemCount, short a_ItemHealth) + void SetIngredient (int x, int y, ENUM_ITEM_ID a_ItemType, char a_ItemCount, short a_ItemHealth) { m_Ingredients.SetItem(x, y, a_ItemType, a_ItemCount, a_ItemHealth); } diff --git a/src/Cuboid.cpp b/src/Cuboid.cpp index 26e86c77b..8891cfcb1 100644 --- a/src/Cuboid.cpp +++ b/src/Cuboid.cpp @@ -24,7 +24,7 @@ static bool DoIntervalsIntersect(int a_Min1, int a_Max1, int a_Min2, int a_Max2) //////////////////////////////////////////////////////////////////////////////// // cCuboid: -cCuboid & cCuboid::operator=(cCuboid a_Other) +cCuboid & cCuboid::operator =(cCuboid a_Other) { std::swap(p1, a_Other.p1); std::swap(p2, a_Other.p2); diff --git a/src/Cuboid.h b/src/Cuboid.h index d62cf8063..c205156ec 100644 --- a/src/Cuboid.h +++ b/src/Cuboid.h @@ -20,7 +20,11 @@ public: cCuboid(int a_X1, int a_Y1, int a_Z1) : p1(a_X1, a_Y1, a_Z1), p2(a_X1, a_Y1, a_Z1) {} cCuboid(int a_X1, int a_Y1, int a_Z1, int a_X2, int a_Y2, int a_Z2) : p1(a_X1, a_Y1, a_Z1), p2(a_X2, a_Y2, a_Z2) {} - cCuboid & operator=(cCuboid a_Other); + // tolua_end + + cCuboid & operator =(cCuboid a_Other); + + // tolua_begin void Assign(int a_X1, int a_Y1, int a_Z1, int a_X2, int a_Y2, int a_Z2); void Assign(const cCuboid & a_SrcCuboid); diff --git a/src/DeadlockDetect.cpp b/src/DeadlockDetect.cpp index f73a45555..7f703416c 100644 --- a/src/DeadlockDetect.cpp +++ b/src/DeadlockDetect.cpp @@ -21,7 +21,8 @@ const int CYCLE_MILLISECONDS = 100; cDeadlockDetect::cDeadlockDetect(void) : - super("DeadlockDetect") + super("DeadlockDetect"), + m_IntervalSec(1000) { } @@ -136,6 +137,7 @@ void cDeadlockDetect::CheckWorldAge(const AString & a_WorldName, Int64 a_Age) void cDeadlockDetect::DeadlockDetected(void) { + LOGERROR("Deadlock detected, aborting the server"); ASSERT(!"Deadlock detected"); abort(); } diff --git a/src/Defines.h b/src/Defines.h index 0981077c4..6355b75b4 100644 --- a/src/Defines.h +++ b/src/Defines.h @@ -115,12 +115,14 @@ enum eGameMode eGameMode_Survival = 0, eGameMode_Creative = 1, eGameMode_Adventure = 2, + eGameMode_Spectator = 3, // Easier-to-use synonyms: gmNotSet = eGameMode_NotSet, gmSurvival = eGameMode_Survival, gmCreative = eGameMode_Creative, gmAdventure = eGameMode_Adventure, + gmSpectator = eGameMode_Spectator, // These two are used to check GameMode for validity when converting from integers. gmMax, // Gets automatically assigned @@ -528,7 +530,7 @@ inline float GetSpecialSignf( float a_Val) -template<class T> inline T Diff(T a_Val1, T a_Val2) +template <class T> inline T Diff(T a_Val1, T a_Val2) { return std::abs(a_Val1 - a_Val2); } diff --git a/src/Enchantments.h b/src/Enchantments.h index 98d7c0d36..824f6aa55 100644 --- a/src/Enchantments.h +++ b/src/Enchantments.h @@ -43,7 +43,7 @@ public: /** Individual enchantment IDs, corresponding to their NBT IDs: http://www.minecraftwiki.net/wiki/Data_Values#Enchantment_IDs */ - enum + enum eEnchantment { enchProtection = 0, enchFireProtection = 1, diff --git a/src/Entities/ArrowEntity.cpp b/src/Entities/ArrowEntity.cpp index 913519c4c..c265c5043 100644 --- a/src/Entities/ArrowEntity.cpp +++ b/src/Entities/ArrowEntity.cpp @@ -3,7 +3,6 @@ #include "Player.h" #include "ArrowEntity.h" #include "../Chunk.h" -#include "FastRandom.h" @@ -90,6 +89,13 @@ void cArrowEntity::OnHitSolidBlock(const Vector3d & a_HitPos, eBlockFace a_HitFa // Broadcast arrow hit sound m_World->BroadcastSoundEffect("random.bowhit", (double)X, (double)Y, (double)Z, 0.5f, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64)); + + if ((m_World->GetBlock(Hit) == E_BLOCK_TNT) && IsOnFire()) + { + m_World->SetBlock(X, Y, Z, E_BLOCK_AIR, 0); + m_World->SpawnPrimedTNT(X, Y, Z); + } + } @@ -103,8 +109,36 @@ void cArrowEntity::OnHitEntity(cEntity & a_EntityHit, const Vector3d & a_HitPos) { Damage += m_World->GetTickRandomNumber(Damage / 2 + 2); } - a_EntityHit.TakeDamage(dtRangedAttack, this, Damage, 1); + + int PowerLevel = m_CreatorData.m_Enchantments.GetLevel(cEnchantments::enchPower); + if (PowerLevel > 0) + { + int ExtraDamage = (int)ceil(0.25 * (PowerLevel + 1)); + Damage += ExtraDamage; + } + + int KnockbackAmount = 1; + int PunchLevel = m_CreatorData.m_Enchantments.GetLevel(cEnchantments::enchPunch); + if (PunchLevel > 0) + { + Vector3d LookVector = GetLookVector(); + Vector3f FinalSpeed = Vector3f(0, 0, 0); + switch (PunchLevel) + { + case 1: FinalSpeed = LookVector * Vector3d(5, 0.3, 5); break; + case 2: FinalSpeed = LookVector * Vector3d(8, 0.3, 8); break; + default: break; + } + a_EntityHit.SetSpeed(FinalSpeed); + } + + a_EntityHit.TakeDamage(dtRangedAttack, this, Damage, KnockbackAmount); + if (IsOnFire() && !a_EntityHit.IsSubmerged() && !a_EntityHit.IsSwimming()) + { + a_EntityHit.StartBurning(100); + } + // Broadcast successful hit sound GetWorld()->BroadcastSoundEffect("random.successful_hit", GetPosX(), GetPosY(), GetPosZ(), 0.5, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64)); diff --git a/src/Entities/ArrowEntity.h b/src/Entities/ArrowEntity.h index 4bfcb1f6d..a1e7a17e7 100644 --- a/src/Entities/ArrowEntity.h +++ b/src/Entities/ArrowEntity.h @@ -10,6 +10,7 @@ + // tolua_begin class cArrowEntity : @@ -46,7 +47,7 @@ public: /// Returns the damage modifier coeff. double GetDamageCoeff(void) const { return m_DamageCoeff; } - + /// Sets the damage modifier coeff void SetDamageCoeff(double a_DamageCoeff) { m_DamageCoeff = a_DamageCoeff; } @@ -89,7 +90,7 @@ protected: /// If true, the arrow is in the process of being collected - don't go to anyone else bool m_bIsCollected; - + /// Stores the block position that arrow is lodged into, sets m_IsInGround to false if it becomes air Vector3i m_HitBlockPos; diff --git a/src/Entities/Boat.cpp b/src/Entities/Boat.cpp index 8ff8866a1..328a70846 100644 --- a/src/Entities/Boat.cpp +++ b/src/Entities/Boat.cpp @@ -62,6 +62,8 @@ bool cBoat::DoTakeDamage(TakeDamageInfo & TDI) void cBoat::OnRightClicked(cPlayer & a_Player) { + super::OnRightClicked(a_Player); + if (m_Attachee != NULL) { if (m_Attachee->GetUniqueID() == a_Player.GetUniqueID()) diff --git a/src/Entities/EnderCrystal.cpp b/src/Entities/EnderCrystal.cpp index bf86a6c42..30df2c110 100644 --- a/src/Entities/EnderCrystal.cpp +++ b/src/Entities/EnderCrystal.cpp @@ -3,8 +3,8 @@ #include "EnderCrystal.h" #include "ClientHandle.h" -#include "Player.h" #include "../Chunk.h" +#include "../World.h" @@ -32,9 +32,6 @@ void cEnderCrystal::SpawnOn(cClientHandle & a_ClientHandle) void cEnderCrystal::Tick(float a_Dt, cChunk & a_Chunk) { UNUSED(a_Dt); - - a_Chunk.SetBlock(POSX_TOINT, POSY_TOINT, POSZ_TOINT, E_BLOCK_FIRE, 0); - // No further processing (physics e.t.c.) is needed } @@ -49,6 +46,9 @@ void cEnderCrystal::KilledBy(TakeDamageInfo & a_TDI) m_World->DoExplosionAt(6.0, GetPosX(), GetPosY(), GetPosZ(), true, esEnderCrystal, this); Destroy(); + + m_World->SetBlock(POSX_TOINT, POSY_TOINT, POSZ_TOINT, E_BLOCK_BEDROCK, 0); + m_World->SetBlock(POSX_TOINT, POSY_TOINT + 1, POSZ_TOINT, E_BLOCK_FIRE, 0); } diff --git a/src/Entities/Entity.cpp b/src/Entities/Entity.cpp index da578013d..da85dec50 100644 --- a/src/Entities/Entity.cpp +++ b/src/Entities/Entity.cpp @@ -3,7 +3,6 @@ #include "Entity.h" #include "../World.h" -#include "../Server.h" #include "../Root.h" #include "../Matrix4.h" #include "../ClientHandle.h" @@ -13,6 +12,7 @@ #include "../Tracer.h" #include "Player.h" #include "Items/ItemHandler.h" +#include "../FastRandom.h" @@ -134,7 +134,7 @@ const char * cEntity::GetParentClass(void) const bool cEntity::Initialize(cWorld & a_World) { - if (cPluginManager::Get()->CallHookSpawningEntity(a_World, *this)) + if (cPluginManager::Get()->CallHookSpawningEntity(a_World, *this) && !IsPlayer()) { return false; } @@ -244,9 +244,9 @@ void cEntity::TakeDamage(eDamageType a_DamageType, cEntity * a_Attacker, int a_R Vector3d Heading(0, 0, 0); if (a_Attacker != NULL) { - Heading = a_Attacker->GetLookVector() * (a_Attacker->IsSprinting() ? 10 : 8); + Heading = a_Attacker->GetLookVector() * (a_Attacker->IsSprinting() ? 16 : 11); + Heading.y = 1.6; } - Heading.y = 2; TDI.Knockback = Heading * a_KnockbackAmount; DoTakeDamage(TDI); @@ -259,7 +259,7 @@ void cEntity::TakeDamage(eDamageType a_DamageType, cEntity * a_Attacker, int a_R void cEntity::SetYawFromSpeed(void) { const double EPS = 0.0000001; - if ((abs(m_Speed.x) < EPS) && (abs(m_Speed.z) < EPS)) + if ((std::abs(m_Speed.x) < EPS) && (std::abs(m_Speed.z) < EPS)) { // atan2() may overflow or is undefined, pick any number SetYaw(0); @@ -276,7 +276,7 @@ void cEntity::SetPitchFromSpeed(void) { const double EPS = 0.0000001; double xz = sqrt(m_Speed.x * m_Speed.x + m_Speed.z * m_Speed.z); // Speed XZ-plane component - if ((abs(xz) < EPS) && (abs(m_Speed.y) < EPS)) + if ((std::abs(xz) < EPS) && (std::abs(m_Speed.y) < EPS)) { // atan2() may overflow or is undefined, pick any number SetPitch(0); @@ -316,6 +316,106 @@ bool cEntity::DoTakeDamage(TakeDamageInfo & a_TDI) // IsOnGround() only is false if the player is moving downwards // TODO: Better damage increase, and check for enchantments (and use magic critical instead of plain) + const cEnchantments & Enchantments = Player->GetEquippedItem().m_Enchantments; + + int SharpnessLevel = Enchantments.GetLevel(cEnchantments::enchSharpness); + int SmiteLevel = Enchantments.GetLevel(cEnchantments::enchSmite); + int BaneOfArthropodsLevel = Enchantments.GetLevel(cEnchantments::enchBaneOfArthropods); + + if (SharpnessLevel > 0) + { + a_TDI.FinalDamage += (int)ceil(1.25 * SharpnessLevel); + } + else if (SmiteLevel > 0) + { + if (IsMob()) + { + cMonster * Monster = (cMonster *)this; + switch (Monster->GetMobType()) + { + case mtSkeleton: + case mtZombie: + case mtWither: + case mtZombiePigman: + { + a_TDI.FinalDamage += (int)ceil(2.5 * SmiteLevel); + break; + } + default: break; + } + } + } + else if (BaneOfArthropodsLevel > 0) + { + if (IsMob()) + { + cMonster * Monster = (cMonster *)this; + switch (Monster->GetMobType()) + { + case mtSpider: + case mtCaveSpider: + case mtSilverfish: + { + a_TDI.RawDamage += (int)ceil(2.5 * BaneOfArthropodsLevel); + // TODO: Add slowness effect + + break; + }; + default: break; + } + } + } + + int FireAspectLevel = Enchantments.GetLevel(cEnchantments::enchFireAspect); + if (FireAspectLevel > 0) + { + int BurnTicks = 3; + + if (FireAspectLevel > 1) + { + BurnTicks += 4 * (FireAspectLevel - 1); + } + if (!IsMob() && !IsSubmerged() && !IsSwimming()) + { + StartBurning(BurnTicks * 20); + } + else if (IsMob() && !IsSubmerged() && !IsSwimming()) + { + cMonster * Monster = (cMonster *)this; + switch (Monster->GetMobType()) + { + case mtGhast: + case mtZombiePigman: + case mtMagmaCube: + { + break; + }; + default: StartBurning(BurnTicks * 20); + } + } + } + + int ThornsLevel = 0; + const cItem ArmorItems[] = { GetEquippedHelmet(), GetEquippedChestplate(), GetEquippedLeggings(), GetEquippedBoots() }; + for (size_t i = 0; i < ARRAYCOUNT(ArmorItems); i++) + { + const cItem & Item = ArmorItems[i]; + ThornsLevel = std::max(ThornsLevel, Item.m_Enchantments.GetLevel(cEnchantments::enchThorns)); + } + + if (ThornsLevel > 0) + { + int Chance = ThornsLevel * 15; + + cFastRandom Random; + int RandomValue = Random.GenerateRandomInteger(0, 100); + + if (RandomValue <= Chance) + { + a_TDI.Attacker->TakeDamage(dtAttack, this, 0, Random.GenerateRandomInteger(1, 4), 0); + } + } + if (!Player->IsOnGround()) { if ((a_TDI.DamageType == dtAttack) || (a_TDI.DamageType == dtArrowAttack)) @@ -328,13 +428,123 @@ bool cEntity::DoTakeDamage(TakeDamageInfo & a_TDI) Player->GetStatManager().AddValue(statDamageDealt, (StatValue)floor(a_TDI.FinalDamage * 10 + 0.5)); } + if (IsPlayer()) + { + double TotalEPF = 0.0; + double EPFProtection = 0.00; + double EPFFireProtection = 0.00; + double EPFBlastProtection = 0.00; + double EPFProjectileProtection = 0.00; + double EPFFeatherFalling = 0.00; + + const cItem ArmorItems[] = { GetEquippedHelmet(), GetEquippedChestplate(), GetEquippedLeggings(), GetEquippedBoots() }; + for (size_t i = 0; i < ARRAYCOUNT(ArmorItems); i++) + { + const cItem & Item = ArmorItems[i]; + int Level = Item.m_Enchantments.GetLevel(cEnchantments::enchProtection); + if (Level > 0) + { + EPFProtection += (6 + Level * Level) * 0.75 / 3; + } + + Level = Item.m_Enchantments.GetLevel(cEnchantments::enchFireProtection); + if (Level > 0) + { + EPFFireProtection += (6 + Level * Level) * 1.25 / 3; + } + + Level = Item.m_Enchantments.GetLevel(cEnchantments::enchFeatherFalling); + if (Level > 0) + { + EPFFeatherFalling += (6 + Level * Level) * 2.5 / 3; + } + + Level = Item.m_Enchantments.GetLevel(cEnchantments::enchBlastProtection); + if (Level > 0) + { + EPFBlastProtection += (6 + Level * Level) * 1.5 / 3; + } + + Level = Item.m_Enchantments.GetLevel(cEnchantments::enchProjectileProtection); + if (Level > 0) + { + EPFProjectileProtection += (6 + Level * Level) * 1.5 / 3; + } + + } + + TotalEPF = EPFProtection + EPFFireProtection + EPFFeatherFalling + EPFBlastProtection + EPFProjectileProtection; + + EPFProtection = EPFProtection / TotalEPF; + EPFFireProtection = EPFFireProtection / TotalEPF; + EPFFeatherFalling = EPFFeatherFalling / TotalEPF; + EPFBlastProtection = EPFBlastProtection / TotalEPF; + EPFProjectileProtection = EPFProjectileProtection / TotalEPF; + + if (TotalEPF > 25) + { + TotalEPF = 25; + } + + cFastRandom Random; + float RandomValue = Random.GenerateRandomInteger(50, 100) * 0.01f; + + TotalEPF = ceil(TotalEPF * RandomValue); + + if (TotalEPF > 20) + { + TotalEPF = 20; + } + + EPFProtection = TotalEPF * EPFProtection; + EPFFireProtection = TotalEPF * EPFFireProtection; + EPFFeatherFalling = TotalEPF * EPFFeatherFalling; + EPFBlastProtection = TotalEPF * EPFBlastProtection; + EPFProjectileProtection = TotalEPF * EPFProjectileProtection; + + int RemovedDamage = 0; + + if ((a_TDI.DamageType != dtInVoid) && (a_TDI.DamageType != dtAdmin)) + { + RemovedDamage += (int)ceil(EPFProtection * 0.04 * a_TDI.FinalDamage); + } + + if ((a_TDI.DamageType == dtFalling) || (a_TDI.DamageType == dtFall) || (a_TDI.DamageType == dtEnderPearl)) + { + RemovedDamage += (int)ceil(EPFFeatherFalling * 0.04 * a_TDI.FinalDamage); + } + + if (a_TDI.DamageType == dtBurning) + { + RemovedDamage += (int)ceil(EPFFireProtection * 0.04 * a_TDI.FinalDamage); + } + + if (a_TDI.DamageType == dtExplosion) + { + RemovedDamage += (int)ceil(EPFBlastProtection * 0.04 * a_TDI.FinalDamage); + } + + if (a_TDI.DamageType == dtProjectile) + { + RemovedDamage += (int)ceil(EPFBlastProtection * 0.04 * a_TDI.FinalDamage); + } + + if (a_TDI.FinalDamage < RemovedDamage) + { + RemovedDamage = 0; + } + + a_TDI.FinalDamage -= RemovedDamage; + } + m_Health -= (short)a_TDI.FinalDamage; // TODO: Apply damage to armor m_Health = std::max(m_Health, 0); - if ((IsMob() || IsPlayer()) && (a_TDI.Attacker != NULL)) // Knockback for only players and mobs + // Add knockback: + if ((IsMob() || IsPlayer()) && (a_TDI.Attacker != NULL)) { int KnockbackLevel = a_TDI.Attacker->GetEquippedWeapon().m_Enchantments.GetLevel(cEnchantments::enchKnockback); // More common enchantment if (KnockbackLevel < 1) @@ -543,10 +753,7 @@ void cEntity::KilledBy(TakeDamageInfo & a_TDI) void cEntity::Heal(int a_HitPoints) { m_Health += a_HitPoints; - if (m_Health > m_MaxHealth) - { - m_Health = m_MaxHealth; - } + m_Health = std::min(m_Health, m_MaxHealth); } @@ -555,7 +762,7 @@ void cEntity::Heal(int a_HitPoints) void cEntity::SetHealth(int a_Health) { - m_Health = std::max(0, std::min(m_MaxHealth, a_Health)); + m_Health = Clamp(a_Health, 0, m_MaxHealth); } @@ -720,12 +927,13 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk) float fallspeed; if (IsBlockWater(BlockIn)) { - fallspeed = m_Gravity * a_Dt / 3; // Fall 3x slower in water. + fallspeed = m_Gravity * a_Dt / 3; // Fall 3x slower in water + ApplyFriction(NextSpeed, 0.7, a_Dt); } else if (BlockIn == E_BLOCK_COBWEB) { NextSpeed.y *= 0.05; // Reduce overall falling speed - fallspeed = 0; // No falling. + fallspeed = 0; // No falling } else { @@ -736,20 +944,7 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk) } else { - // Friction - if (NextSpeed.SqrLength() > 0.0004f) - { - NextSpeed.x *= 0.7f / (1 + a_Dt); - if (fabs(NextSpeed.x) < 0.05) - { - NextSpeed.x = 0; - } - NextSpeed.z *= 0.7f / (1 + a_Dt); - if (fabs(NextSpeed.z) < 0.05) - { - NextSpeed.z = 0; - } - } + ApplyFriction(NextSpeed, 0.7, a_Dt); } // Adjust X and Z speed for COBWEB temporary. This speed modification should be handled inside block handlers since we @@ -820,7 +1015,7 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk) if (Tracer.HitNormal.y != 0.f) NextSpeed.y = 0.f; if (Tracer.HitNormal.z != 0.f) NextSpeed.z = 0.f; - if (Tracer.HitNormal.y == 1) // Hit BLOCK_FACE_YP, we are on the ground + if (Tracer.HitNormal.y == 1.f) // Hit BLOCK_FACE_YP, we are on the ground { m_bOnGround = true; } @@ -855,6 +1050,27 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk) +void cEntity::ApplyFriction(Vector3d & a_Speed, double a_SlowdownMultiplier, float a_Dt) +{ + if (a_Speed.SqrLength() > 0.0004f) + { + a_Speed.x *= a_SlowdownMultiplier / (1 + a_Dt); + if (fabs(a_Speed.x) < 0.05) + { + a_Speed.x = 0; + } + a_Speed.z *= a_SlowdownMultiplier / (1 + a_Dt); + if (fabs(a_Speed.z) < 0.05) + { + a_Speed.z = 0; + } + } +} + + + + + void cEntity::TickBurning(cChunk & a_Chunk) { // Remember the current burning state: @@ -1068,42 +1284,38 @@ bool cEntity::DetectPortal() } m_PortalCooldownData.m_TicksDelayed = 0; - switch (GetWorld()->GetDimension()) + if (GetWorld()->GetDimension() == dimNether) { - case dimNether: + if (GetWorld()->GetLinkedOverworldName().empty()) { - if (GetWorld()->GetLinkedOverworldName().empty()) - { - return false; - } + return false; + } - m_PortalCooldownData.m_ShouldPreventTeleportation = true; // Stop portals from working on respawn + m_PortalCooldownData.m_ShouldPreventTeleportation = true; // Stop portals from working on respawn - if (IsPlayer()) - { - ((cPlayer *)this)->GetClientHandle()->SendRespawn(dimOverworld); // Send a respawn packet before world is loaded/generated so the client isn't left in limbo - } - - return MoveToWorld(cRoot::Get()->CreateAndInitializeWorld(GetWorld()->GetLinkedOverworldName()), false); + if (IsPlayer()) + { + ((cPlayer *)this)->GetClientHandle()->SendRespawn(dimOverworld); // Send a respawn packet before world is loaded/generated so the client isn't left in limbo } - case dimOverworld: + + return MoveToWorld(cRoot::Get()->CreateAndInitializeWorld(GetWorld()->GetLinkedOverworldName()), false); + } + else + { + if (GetWorld()->GetNetherWorldName().empty()) { - if (GetWorld()->GetNetherWorldName().empty()) - { - return false; - } - - m_PortalCooldownData.m_ShouldPreventTeleportation = true; - - if (IsPlayer()) - { - ((cPlayer *)this)->AwardAchievement(achEnterPortal); - ((cPlayer *)this)->GetClientHandle()->SendRespawn(dimNether); - } - - return MoveToWorld(cRoot::Get()->CreateAndInitializeWorld(GetWorld()->GetNetherWorldName(), dimNether, GetWorld()->GetName()), false); + return false; } - default: return false; + + m_PortalCooldownData.m_ShouldPreventTeleportation = true; + + if (IsPlayer()) + { + ((cPlayer *)this)->AwardAchievement(achEnterPortal); + ((cPlayer *)this)->GetClientHandle()->SendRespawn(dimNether); + } + + return MoveToWorld(cRoot::Get()->CreateAndInitializeWorld(GetWorld()->GetNetherWorldName(), dimNether, GetWorld()->GetName()), false); } } case E_BLOCK_END_PORTAL: @@ -1113,45 +1325,43 @@ bool cEntity::DetectPortal() return false; } - switch (GetWorld()->GetDimension()) + if (GetWorld()->GetDimension() == dimEnd) { - case dimEnd: + + if (GetWorld()->GetLinkedOverworldName().empty()) { - if (GetWorld()->GetLinkedOverworldName().empty()) - { - return false; - } - - m_PortalCooldownData.m_ShouldPreventTeleportation = true; + return false; + } - if (IsPlayer()) - { - cPlayer * Player = (cPlayer *)this; - Player->TeleportToCoords(Player->GetLastBedPos().x, Player->GetLastBedPos().y, Player->GetLastBedPos().z); - Player->GetClientHandle()->SendRespawn(dimOverworld); - } + m_PortalCooldownData.m_ShouldPreventTeleportation = true; - return MoveToWorld(cRoot::Get()->CreateAndInitializeWorld(GetWorld()->GetLinkedOverworldName()), false); - } - case dimOverworld: + if (IsPlayer()) { - if (GetWorld()->GetEndWorldName().empty()) - { - return false; - } + cPlayer * Player = (cPlayer *)this; + Player->TeleportToCoords(Player->GetLastBedPos().x, Player->GetLastBedPos().y, Player->GetLastBedPos().z); + Player->GetClientHandle()->SendRespawn(dimOverworld); + } - m_PortalCooldownData.m_ShouldPreventTeleportation = true; + return MoveToWorld(cRoot::Get()->CreateAndInitializeWorld(GetWorld()->GetLinkedOverworldName()), false); + } + else + { + if (GetWorld()->GetEndWorldName().empty()) + { + return false; + } - if (IsPlayer()) - { - ((cPlayer *)this)->AwardAchievement(achEnterTheEnd); - ((cPlayer *)this)->GetClientHandle()->SendRespawn(dimEnd); - } + m_PortalCooldownData.m_ShouldPreventTeleportation = true; - return MoveToWorld(cRoot::Get()->CreateAndInitializeWorld(GetWorld()->GetEndWorldName(), dimEnd, GetWorld()->GetName()), false); + if (IsPlayer()) + { + ((cPlayer *)this)->AwardAchievement(achEnterTheEnd); + ((cPlayer *)this)->GetClientHandle()->SendRespawn(dimEnd); } - default: return false; + + return MoveToWorld(cRoot::Get()->CreateAndInitializeWorld(GetWorld()->GetEndWorldName(), dimEnd, GetWorld()->GetName()), false); } + } default: break; } @@ -1263,6 +1473,8 @@ void cEntity::HandleAir(void) // See if the entity is /submerged/ water (block above is water) // Get the type of block the entity is standing in: + int RespirationLevel = GetEquippedHelmet().m_Enchantments.GetLevel(cEnchantments::enchRespiration); + if (IsSubmerged()) { if (!IsPlayer()) // Players control themselves @@ -1270,10 +1482,15 @@ void cEntity::HandleAir(void) SetSpeedY(1); // Float in the water } - // Either reduce air level or damage player - if (m_AirLevel < 1) + if (RespirationLevel > 0) + { + ((cPawn *)this)->AddEntityEffect(cEntityEffect::effNightVision, 200, 5, 0); + } + + if (m_AirLevel <= 0) { - if (m_AirTickTimer < 1) + // Runs the air tick timer to check whether the player should be damaged + if (m_AirTickTimer <= 0) { // Damage player TakeDamage(dtDrowning, NULL, 1, 1, 0); @@ -1296,6 +1513,12 @@ void cEntity::HandleAir(void) // Set the air back to maximum m_AirLevel = MAX_AIR_LEVEL; m_AirTickTimer = DROWNING_TICKS; + + if (RespirationLevel > 0) + { + m_AirTickTimer = DROWNING_TICKS + (RespirationLevel * 15 * 20); + } + } } @@ -1558,17 +1781,10 @@ void cEntity::SetHeight(double a_Height) void cEntity::SetMass(double a_Mass) { - if (a_Mass > 0) - { - m_Mass = a_Mass; - } - else - { - // Make sure that mass is not zero. 1g is the default because we - // have to choose a number. It's perfectly legal to have a mass - // less than 1g as long as is NOT equal or less than zero. - m_Mass = 0.001; - } + // Make sure that mass is not zero. 1g is the default because we + // have to choose a number. It's perfectly legal to have a mass + // less than 1g as long as is NOT equal or less than zero. + m_Mass = std::max(a_Mass, 0.001); } @@ -1744,7 +1960,7 @@ void cEntity::SteerVehicle(float a_Forward, float a_Sideways) { return; } - if ((a_Forward != 0) || (a_Sideways != 0)) + if ((a_Forward != 0.f) || (a_Sideways != 0.f)) { m_AttachedTo->HandleSpeedFromAttachee(a_Forward, a_Sideways); } diff --git a/src/Entities/Entity.h b/src/Entities/Entity.h index e66194ca2..f0577aba2 100644 --- a/src/Entities/Entity.h +++ b/src/Entities/Entity.h @@ -27,9 +27,9 @@ return super::GetClass(); \ } -#define POSX_TOINT (int)floor(GetPosX()) -#define POSY_TOINT (int)floor(GetPosY()) -#define POSZ_TOINT (int)floor(GetPosZ()) +#define POSX_TOINT FloorC(GetPosX()) +#define POSY_TOINT FloorC(GetPosY()) +#define POSZ_TOINT FloorC(GetPosZ()) #define POS_TOINT Vector3i(POSXTOINT, POSYTOINT, POSZTOINT) #define GET_AND_VERIFY_CURRENT_CHUNK(ChunkVarName, X, Z) cChunk * ChunkVarName = a_Chunk.GetNeighborChunk(X, Z); if ((ChunkVarName == NULL) || !ChunkVarName->IsValid()) { return; } @@ -128,20 +128,20 @@ public: esFireworkExploding = 17, } ; - enum - { - FIRE_TICKS_PER_DAMAGE = 10, ///< How many ticks to wait between damaging an entity when it stands in fire - FIRE_DAMAGE = 1, ///< How much damage to deal when standing in fire - LAVA_TICKS_PER_DAMAGE = 10, ///< How many ticks to wait between damaging an entity when it stands in lava - LAVA_DAMAGE = 5, ///< How much damage to deal when standing in lava - BURN_TICKS_PER_DAMAGE = 20, ///< How many ticks to wait between damaging an entity when it is burning - BURN_DAMAGE = 1, ///< How much damage to deal when the entity is burning - BURN_TICKS = 200, ///< How long to keep an entity burning after it has stood in lava / fire - MAX_AIR_LEVEL = 300, ///< Maximum air an entity can have - DROWNING_TICKS = 20, ///< Number of ticks per heart of damage - VOID_BOUNDARY = -46, ///< At what position Y to begin applying void damage - FALL_DAMAGE_HEIGHT = 4 ///< At what position Y fall damage is applied - } ; + static const int FIRE_TICKS_PER_DAMAGE = 10; ///< Ticks to wait between damaging an entity when it stands in fire + static const int FIRE_DAMAGE = 1; ///< Damage to deal when standing in fire + static const int LAVA_TICKS_PER_DAMAGE = 10; ///< Ticks to wait between damaging an entity when it stands in lava + static const int LAVA_DAMAGE = 5; ///< Damage to deal when standing in lava + static const int BURN_TICKS_PER_DAMAGE = 20; ///< Ticks to wait between damaging an entity when it is burning + static const int BURN_DAMAGE = 1; ///< Damage to deal when the entity is burning + + static const int BURN_TICKS = 200; ///< Ticks to keep an entity burning after it has stood in lava / fire + + static const int MAX_AIR_LEVEL = 300; ///< Maximum air an entity can have + static const int DROWNING_TICKS = 20; ///< Number of ticks per heart of damage + + static const int VOID_BOUNDARY = -46; ///< Y position to begin applying void damage + static const int FALL_DAMAGE_HEIGHT = 4; ///< Y difference after which fall damage is applied cEntity(eEntityType a_EntityType, double a_X, double a_Y, double a_Z, double a_Width, double a_Height); virtual ~cEntity(); @@ -447,7 +447,7 @@ public: // tolua_end /// Called when the specified player right-clicks this entity - virtual void OnRightClicked(cPlayer &) {} + virtual void OnRightClicked(cPlayer & a_Player) {} /// Returns the list of drops for this pawn when it is killed. May check a_Killer for special handling (sword of looting etc.). Called from KilledBy(). virtual void GetDrops(cItems & a_Drops, cEntity * a_Killer = NULL) @@ -535,6 +535,12 @@ protected: virtual void Destroyed(void) {} // Called after the entity has been destroyed + /** Applies friction to an entity + @param a_Speed The speed vector to apply changes to + @param a_SlowdownMultiplier The factor to reduce the speed by + */ + static void ApplyFriction(Vector3d & a_Speed, double a_SlowdownMultiplier, float a_Dt); + /** Called in each tick to handle air-related processing i.e. drowning */ virtual void HandleAir(void); diff --git a/src/Entities/EntityEffect.cpp b/src/Entities/EntityEffect.cpp index fdcbe822e..b1ddaa30e 100644 --- a/src/Entities/EntityEffect.cpp +++ b/src/Entities/EntityEffect.cpp @@ -34,14 +34,14 @@ cEntityEffect::eType cEntityEffect::GetPotionEffectType(short a_ItemDamage) case 0x08: return cEntityEffect::effWeakness; case 0x09: return cEntityEffect::effStrength; case 0x0a: return cEntityEffect::effSlowness; + case 0x0b: return cEntityEffect::effJumpBoost; case 0x0c: return cEntityEffect::effInstantDamage; case 0x0d: return cEntityEffect::effWaterBreathing; case 0x0e: return cEntityEffect::effInvisibility; - + // No effect potions case 0x00: case 0x07: - case 0x0b: // Will be potion of leaping in 1.8 case 0x0f: { break; @@ -96,6 +96,7 @@ int cEntityEffect::GetPotionEffectDuration(short a_ItemDamage) base = 1800; break; } + default: break; } // If potion is level II, half the duration. If not, stays the same @@ -170,7 +171,7 @@ cEntityEffect::cEntityEffect(const cEntityEffect & a_OtherEffect): -cEntityEffect & cEntityEffect::operator=(cEntityEffect a_OtherEffect) +cEntityEffect & cEntityEffect::operator =(cEntityEffect a_OtherEffect) { std::swap(m_Ticks, a_OtherEffect.m_Ticks); std::swap(m_Duration, a_OtherEffect.m_Duration); @@ -233,6 +234,92 @@ void cEntityEffect::OnTick(cPawn & a_Target) //////////////////////////////////////////////////////////////////////////////// +// cEntityEffectSpeed: + +void cEntityEffectSpeed::OnActivate(cPawn & a_Target) +{ + if (a_Target.IsMob()) + { + cMonster * Mob = (cMonster*) &a_Target; + Mob->SetRelativeWalkSpeed(Mob->GetRelativeWalkSpeed() + 0.2 * m_Intensity); + } + else if (a_Target.IsPlayer()) + { + cPlayer * Player = (cPlayer*) &a_Target; + Player->SetNormalMaxSpeed(Player->GetNormalMaxSpeed() + 0.2 * m_Intensity); + Player->SetSprintingMaxSpeed(Player->GetSprintingMaxSpeed() + 0.26 * m_Intensity); + Player->SetFlyingMaxSpeed(Player->GetFlyingMaxSpeed() + 0.2 * m_Intensity); + } +} + + + + + +void cEntityEffectSpeed::OnDeactivate(cPawn & a_Target) +{ + if (a_Target.IsMob()) + { + cMonster * Mob = (cMonster*) &a_Target; + Mob->SetRelativeWalkSpeed(Mob->GetRelativeWalkSpeed() - 0.2 * m_Intensity); + } + else if (a_Target.IsPlayer()) + { + cPlayer * Player = (cPlayer*) &a_Target; + Player->SetNormalMaxSpeed(Player->GetNormalMaxSpeed() - 0.2 * m_Intensity); + Player->SetSprintingMaxSpeed(Player->GetSprintingMaxSpeed() - 0.26 * m_Intensity); + Player->SetFlyingMaxSpeed(Player->GetFlyingMaxSpeed() - 0.2 * m_Intensity); + } +} + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cEntityEffectSlowness: + +void cEntityEffectSlowness::OnActivate(cPawn & a_Target) +{ + if (a_Target.IsMob()) + { + cMonster * Mob = (cMonster*) &a_Target; + Mob->SetRelativeWalkSpeed(Mob->GetRelativeWalkSpeed() - 0.15 * m_Intensity); + } + else if (a_Target.IsPlayer()) + { + cPlayer * Player = (cPlayer*) &a_Target; + Player->SetNormalMaxSpeed(Player->GetNormalMaxSpeed() - 0.15 * m_Intensity); + Player->SetSprintingMaxSpeed(Player->GetSprintingMaxSpeed() - 0.195 * m_Intensity); + Player->SetFlyingMaxSpeed(Player->GetFlyingMaxSpeed() - 0.15 * m_Intensity); + } +} + + + + + +void cEntityEffectSlowness::OnDeactivate(cPawn & a_Target) +{ + if (a_Target.IsMob()) + { + cMonster * Mob = (cMonster*) &a_Target; + Mob->SetRelativeWalkSpeed(Mob->GetRelativeWalkSpeed() + 0.15 * m_Intensity); + } + else if (a_Target.IsPlayer()) + { + cPlayer * Player = (cPlayer*) &a_Target; + Player->SetNormalMaxSpeed(Player->GetNormalMaxSpeed() + 0.15 * m_Intensity); + Player->SetSprintingMaxSpeed(Player->GetSprintingMaxSpeed() + 0.195 * m_Intensity); + Player->SetFlyingMaxSpeed(Player->GetFlyingMaxSpeed() + 0.15 * m_Intensity); + } +} + + + + + +//////////////////////////////////////////////////////////////////////////////// // cEntityEffectInstantHealth: void cEntityEffectInstantHealth::OnActivate(cPawn & a_Target) @@ -309,7 +396,7 @@ void cEntityEffectHunger::OnTick(cPawn & a_Target) if (a_Target.IsPlayer()) { cPlayer & Target = (cPlayer &) a_Target; - Target.SetFoodExhaustionLevel(Target.GetFoodExhaustionLevel() + 0.025); // 0.5 per second = 0.025 per tick + Target.AddFoodExhaustion(0.025 * ((double)GetIntensity() + 1.0)); // 0.5 per second = 0.025 per tick } } @@ -349,8 +436,8 @@ void cEntityEffectPoison::OnTick(cPawn & a_Target) // Doesn't effect undead mobs, spiders if ( Target.IsUndead() || - (Target.GetMobType() == cMonster::mtSpider) || - (Target.GetMobType() == cMonster::mtCaveSpider) + (Target.GetMobType() == mtSpider) || + (Target.GetMobType() == mtCaveSpider) ) { return; diff --git a/src/Entities/EntityEffect.h b/src/Entities/EntityEffect.h index f9c1e4eb2..7cf9cd3d5 100644 --- a/src/Entities/EntityEffect.h +++ b/src/Entities/EntityEffect.h @@ -71,7 +71,7 @@ public: /** Creates an entity effect by copying another @param a_OtherEffect The other effect to copy */ - cEntityEffect & operator=(cEntityEffect a_OtherEffect); + cEntityEffect & operator =(cEntityEffect a_OtherEffect); virtual ~cEntityEffect(void) {} @@ -137,6 +137,10 @@ public: super(a_Duration, a_Intensity, a_DistanceModifier) { } + + virtual void OnActivate(cPawn & a_Target) override; + + virtual void OnDeactivate(cPawn & a_Target) override; }; @@ -152,6 +156,10 @@ public: super(a_Duration, a_Intensity, a_DistanceModifier) { } + + virtual void OnActivate(cPawn & a_Target) override; + + virtual void OnDeactivate(cPawn & a_Target) override; }; diff --git a/src/Entities/ExpBottleEntity.cpp b/src/Entities/ExpBottleEntity.cpp index 202dde942..ee142a5a2 100644 --- a/src/Entities/ExpBottleEntity.cpp +++ b/src/Entities/ExpBottleEntity.cpp @@ -19,9 +19,26 @@ cExpBottleEntity::cExpBottleEntity(cEntity * a_Creator, double a_X, double a_Y, void cExpBottleEntity::OnHitSolidBlock(const Vector3d & a_HitPos, eBlockFace a_HitFace) { + Break(a_HitPos); +} + + + + + +void cExpBottleEntity::OnHitEntity(cEntity & a_EntityHit, const Vector3d & a_HitPos) +{ + Break(a_HitPos); +} + + + + + +void cExpBottleEntity::Break(const Vector3d &a_HitPos) +{ // Spawn an experience orb with a reward between 3 and 11. m_World->BroadcastSoundParticleEffect(2002, POSX_TOINT, POSY_TOINT, POSZ_TOINT, 0); m_World->SpawnExperienceOrb(GetPosX(), GetPosY(), GetPosZ(), 3 + m_World->GetTickRandomNumber(8)); - Destroy(); } diff --git a/src/Entities/ExpBottleEntity.h b/src/Entities/ExpBottleEntity.h index d62a84469..d36110f97 100644 --- a/src/Entities/ExpBottleEntity.h +++ b/src/Entities/ExpBottleEntity.h @@ -29,5 +29,10 @@ protected: // cProjectileEntity overrides: virtual void OnHitSolidBlock(const Vector3d & a_HitPos, eBlockFace a_HitFace) override; + virtual void OnHitEntity (cEntity & a_EntityHit, const Vector3d & a_HitPos) override; + + /** Breaks the bottle, fires its particle effects and sounds + @param a_HitPos The position where the bottle will break */ + void Break(const Vector3d &a_HitPos); }; // tolua_export diff --git a/src/Entities/HangingEntity.cpp b/src/Entities/HangingEntity.cpp index 32d2b226d..3276bc4a0 100644 --- a/src/Entities/HangingEntity.cpp +++ b/src/Entities/HangingEntity.cpp @@ -21,18 +21,39 @@ cHangingEntity::cHangingEntity(eEntityType a_EntityType, eBlockFace a_BlockFace, +void cHangingEntity::SetDirection(eBlockFace a_BlockFace) +{ + if ((a_BlockFace < 2) || (a_BlockFace > 5)) + { + ASSERT(!"Tried to set a bad direction!"); + return; + } + + m_BlockFace = a_BlockFace; +} + + + + + void cHangingEntity::SpawnOn(cClientHandle & a_ClientHandle) { int Dir = 0; - + // The client uses different values for item frame directions and block faces. Our constants are for the block faces, so we convert them here to item frame faces switch (m_BlockFace) { - case BLOCK_FACE_ZP: break; // Initialised to zero + case BLOCK_FACE_ZP: Dir = 0; break; case BLOCK_FACE_ZM: Dir = 2; break; case BLOCK_FACE_XM: Dir = 1; break; case BLOCK_FACE_XP: Dir = 3; break; - default: ASSERT(!"Unhandled block face when trying to spawn item frame!"); return; + default: + { + LOGINFO("Invalid face (%d) in a cHangingEntity at {%d, %d, %d}, adjusting to BLOCK_FACE_XP.", + m_BlockFace, (int)GetPosX(), (int)GetPosY(), (int)GetPosZ() + ); + Dir = 3; + } } if ((Dir == 0) || (Dir == 2)) // Probably a client bug, but two directions are flipped and contrary to the norm, so we do -180 diff --git a/src/Entities/HangingEntity.h b/src/Entities/HangingEntity.h index 3593f9ede..1cc0034e1 100644 --- a/src/Entities/HangingEntity.h +++ b/src/Entities/HangingEntity.h @@ -24,7 +24,7 @@ public: eBlockFace GetDirection() const { return m_BlockFace; } // tolua_export /** Set the orientation from the hanging entity */ - void SetDirection(eBlockFace a_BlockFace) { m_BlockFace = a_BlockFace; } // tolua_export + void SetDirection(eBlockFace a_BlockFace); // tolua_export /** Returns the X coord. */ int GetTileX() const { return POSX_TOINT; } // tolua_export diff --git a/src/Entities/ItemFrame.cpp b/src/Entities/ItemFrame.cpp index f0b0c8c65..f512324eb 100644 --- a/src/Entities/ItemFrame.cpp +++ b/src/Entities/ItemFrame.cpp @@ -22,11 +22,13 @@ cItemFrame::cItemFrame(eBlockFace a_BlockFace, double a_X, double a_Y, double a_ void cItemFrame::OnRightClicked(cPlayer & a_Player) { + super::OnRightClicked(a_Player); + if (!m_Item.IsEmpty()) { // Item not empty, rotate, clipping values to zero to three inclusive m_Rotation++; - if (m_Rotation >= 4) + if (m_Rotation >= 8) { m_Rotation = 0; } @@ -55,7 +57,6 @@ void cItemFrame::KilledBy(TakeDamageInfo & a_TDI) { if (m_Item.IsEmpty()) { - SetHealth(0); super::KilledBy(a_TDI); Destroy(); return; diff --git a/src/Entities/Minecart.cpp b/src/Entities/Minecart.cpp index d4eadc5d5..f45e7bb69 100644 --- a/src/Entities/Minecart.cpp +++ b/src/Entities/Minecart.cpp @@ -7,12 +7,12 @@ #include "Globals.h" #include "Minecart.h" -#include "../World.h" #include "../ClientHandle.h" #include "../Chunk.h" #include "Player.h" #include "../BoundingBox.h" +#define NO_SPEED 0.0 #define MAX_SPEED 8 #define MAX_SPEED_NEGATIVE -MAX_SPEED @@ -220,7 +220,7 @@ void cMinecart::HandleRailPhysics(NIBBLETYPE a_RailMeta, float a_Dt) bool BlckCol = TestBlockCollision(a_RailMeta), EntCol = TestEntityCollision(a_RailMeta); if (EntCol || BlckCol) return; - if (GetSpeedZ() != 0) // Don't do anything if cart is stationary + if (GetSpeedZ() != NO_SPEED) // Don't do anything if cart is stationary { if (GetSpeedZ() > 0) { @@ -239,13 +239,13 @@ void cMinecart::HandleRailPhysics(NIBBLETYPE a_RailMeta, float a_Dt) { SetYaw(180); SetPosY(floor(GetPosY()) + 0.55); - SetSpeedY(0); - SetSpeedZ(0); + SetSpeedY(NO_SPEED); + SetSpeedZ(NO_SPEED); bool BlckCol = TestBlockCollision(a_RailMeta), EntCol = TestEntityCollision(a_RailMeta); if (EntCol || BlckCol) return; - if (GetSpeedX() != 0) + if (GetSpeedX() != NO_SPEED) { if (GetSpeedX() > 0) { @@ -305,9 +305,9 @@ void cMinecart::HandleRailPhysics(NIBBLETYPE a_RailMeta, float a_Dt) case E_META_RAIL_ASCEND_XM: // ASCEND EAST { SetYaw(180); - SetSpeedZ(0); + SetSpeedZ(NO_SPEED); - if (GetSpeedX() >= 0) + if (GetSpeedX() >= NO_SPEED) { if (GetSpeedX() <= MAX_SPEED) { @@ -424,9 +424,9 @@ void cMinecart::HandlePoweredRailPhysics(NIBBLETYPE a_RailMeta) bool BlckCol = TestBlockCollision(a_RailMeta), EntCol = TestEntityCollision(a_RailMeta); if (EntCol || BlckCol) return; - if (GetSpeedZ() != 0) + if (GetSpeedZ() != NO_SPEED) { - if (GetSpeedZ() > 0) + if (GetSpeedZ() > NO_SPEED) { AddSpeedZ(AccelDecelSpeed); } @@ -441,15 +441,15 @@ void cMinecart::HandlePoweredRailPhysics(NIBBLETYPE a_RailMeta) { SetYaw(180); SetPosY(floor(GetPosY()) + 0.55); - SetSpeedY(0); - SetSpeedZ(0); + SetSpeedY(NO_SPEED); + SetSpeedZ(NO_SPEED); bool BlckCol = TestBlockCollision(a_RailMeta), EntCol = TestEntityCollision(a_RailMeta); if (EntCol || BlckCol) return; - if (GetSpeedX() != 0) + if (GetSpeedX() != NO_SPEED) { - if (GetSpeedX() > 0) + if (GetSpeedX() > NO_SPEED) { AddSpeedX(AccelDecelSpeed); } @@ -463,9 +463,9 @@ void cMinecart::HandlePoweredRailPhysics(NIBBLETYPE a_RailMeta) case E_META_RAIL_ASCEND_XM: // ASCEND EAST { SetYaw(180); - SetSpeedZ(0); + SetSpeedZ(NO_SPEED); - if (GetSpeedX() >= 0) + if (GetSpeedX() >= NO_SPEED) { if (GetSpeedX() <= MAX_SPEED) { @@ -483,9 +483,9 @@ void cMinecart::HandlePoweredRailPhysics(NIBBLETYPE a_RailMeta) case E_META_RAIL_ASCEND_XP: // ASCEND WEST { SetYaw(180); - SetSpeedZ(0); + SetSpeedZ(NO_SPEED); - if (GetSpeedX() > 0) + if (GetSpeedX() > NO_SPEED) { AddSpeedX(AccelDecelSpeed); SetSpeedY(GetSpeedX()); @@ -503,9 +503,9 @@ void cMinecart::HandlePoweredRailPhysics(NIBBLETYPE a_RailMeta) case E_META_RAIL_ASCEND_ZM: // ASCEND NORTH { SetYaw(270); - SetSpeedX(0); + SetSpeedX(NO_SPEED); - if (GetSpeedZ() >= 0) + if (GetSpeedZ() >= NO_SPEED) { if (GetSpeedZ() <= MAX_SPEED) { @@ -523,9 +523,9 @@ void cMinecart::HandlePoweredRailPhysics(NIBBLETYPE a_RailMeta) case E_META_RAIL_ASCEND_ZP: // ASCEND SOUTH { SetYaw(270); - SetSpeedX(0); + SetSpeedX(NO_SPEED); - if (GetSpeedZ() > 0) + if (GetSpeedZ() > NO_SPEED) { AddSpeedZ(AccelDecelSpeed); SetSpeedY(GetSpeedZ()); @@ -576,7 +576,7 @@ void cMinecart::SnapToRail(NIBBLETYPE a_RailMeta) case E_META_RAIL_ASCEND_XP: case E_META_RAIL_XM_XP: { - SetSpeedZ(0); + SetSpeedZ(NO_SPEED); SetPosZ(floor(GetPosZ()) + 0.5); break; } @@ -584,7 +584,7 @@ void cMinecart::SnapToRail(NIBBLETYPE a_RailMeta) case E_META_RAIL_ASCEND_ZP: case E_META_RAIL_ZM_ZP: { - SetSpeedX(0); + SetSpeedX(NO_SPEED); SetPosX(floor(GetPosX()) + 0.5); break; } @@ -593,12 +593,12 @@ void cMinecart::SnapToRail(NIBBLETYPE a_RailMeta) { if (GetPosZ() > floor(GetPosZ()) + 0.5) { - if (GetSpeedZ() > 0) + if (GetSpeedZ() > NO_SPEED) { SetSpeedX(-GetSpeedZ() * 0.7); } - SetSpeedZ(0); + SetSpeedZ(NO_SPEED); SetPosZ(floor(GetPosZ()) + 0.5); } else if (GetPosX() > floor(GetPosX()) + 0.5) @@ -608,82 +608,82 @@ void cMinecart::SnapToRail(NIBBLETYPE a_RailMeta) SetSpeedZ(-GetSpeedX() * 0.7); } - SetSpeedX(0); + SetSpeedX(NO_SPEED); SetPosX(floor(GetPosX()) + 0.5); } - SetSpeedY(0); + SetSpeedY(NO_SPEED); break; } case E_META_RAIL_CURVED_ZM_XP: { if (GetPosZ() > floor(GetPosZ()) + 0.5) { - if (GetSpeedZ() > 0) + if (GetSpeedZ() > NO_SPEED) { SetSpeedX(GetSpeedZ() * 0.7); } - SetSpeedZ(0); + SetSpeedZ(NO_SPEED); SetPosZ(floor(GetPosZ()) + 0.5); } else if (GetPosX() < floor(GetPosX()) + 0.5) { - if (GetSpeedX() < 0) + if (GetSpeedX() < NO_SPEED) { SetSpeedZ(GetSpeedX() * 0.7); } - SetSpeedX(0); + SetSpeedX(NO_SPEED); SetPosX(floor(GetPosX()) + 0.5); } - SetSpeedY(0); + SetSpeedY(NO_SPEED); break; } case E_META_RAIL_CURVED_ZP_XM: { if (GetPosZ() < floor(GetPosZ()) + 0.5) { - if (GetSpeedZ() < 0) + if (GetSpeedZ() < NO_SPEED) { SetSpeedX(GetSpeedZ() * 0.7); } - SetSpeedZ(0); + SetSpeedZ(NO_SPEED); SetPosZ(floor(GetPosZ()) + 0.5); } else if (GetPosX() > floor(GetPosX()) + 0.5) { - if (GetSpeedX() > 0) + if (GetSpeedX() > NO_SPEED) { SetSpeedZ(GetSpeedX() * 0.7); } - SetSpeedX(0); + SetSpeedX(NO_SPEED); SetPosX(floor(GetPosX()) + 0.5); } - SetSpeedY(0); + SetSpeedY(NO_SPEED); break; } case E_META_RAIL_CURVED_ZP_XP: { if (GetPosZ() < floor(GetPosZ()) + 0.5) { - if (GetSpeedZ() < 0) + if (GetSpeedZ() < NO_SPEED) { SetSpeedX(-GetSpeedZ() * 0.7); } - SetSpeedZ(0); + SetSpeedZ(NO_SPEED); SetPosZ(floor(GetPosZ()) + 0.5); } else if (GetPosX() < floor(GetPosX()) + 0.5) { - if (GetSpeedX() < 0) + if (GetSpeedX() < NO_SPEED) { SetSpeedZ(-GetSpeedX() * 0.7); } - SetSpeedX(0); + SetSpeedX(NO_SPEED); SetPosX(floor(GetPosX()) + 0.5); } SetSpeedY(0); @@ -871,11 +871,101 @@ bool cMinecart::TestEntityCollision(NIBBLETYPE a_RailMeta) return true; } case E_META_RAIL_CURVED_ZM_XM: + case E_META_RAIL_CURVED_ZP_XP: + { + Vector3d Distance = MinecartCollisionCallback.GetCollidedEntityPosition() - Vector3d(GetPosX(), 0, GetPosZ()); + + // Prevent division by small numbers + if (std::abs(Distance.z) < 0.001) + { + Distance.z = 0.001; + } + + /* Check to which side the minecart is to be pushed. + Let's consider a z-x-coordinate system where the minecart is the center (0/0). + The minecart moves along the line x = -z, the perpendicular line to this is x = z. + In order to decide to which side the minecart is to be pushed, it must be checked on what side of the perpendicular line the pushing entity is located. */ + if ( + ((Distance.z > 0) && ((Distance.x / Distance.z) >= 1)) || + ((Distance.z < 0) && ((Distance.x / Distance.z) <= 1)) + ) + { + // Moving -X +Z + if ((-GetSpeedX() * 0.4 / sqrt(2.0)) < 0.01) + { + // ~ SpeedX >= 0 Immobile or not moving in the "right" direction. Give it a bump! + AddSpeedX(-4 / sqrt(2.0)); + AddSpeedZ(4 / sqrt(2.0)); + } + else + { + // ~ SpeedX < 0 Moving in the "right" direction. Only accelerate it a bit. + SetSpeedX(GetSpeedX() * 0.4 / sqrt(2.0)); + SetSpeedZ(GetSpeedZ() * 0.4 / sqrt(2.0)); + } + } + else if ((GetSpeedX() * 0.4 / sqrt(2.0)) < 0.01) + { + // Moving +X -Z + // ~ SpeedX <= 0 Immobile or not moving in the "right" direction + AddSpeedX(4 / sqrt(2.0)); + AddSpeedZ(-4 / sqrt(2.0)); + } + else + { + // ~ SpeedX > 0 Moving in the "right" direction + SetSpeedX(GetSpeedX() * 0.4 / sqrt(2.0)); + SetSpeedZ(GetSpeedZ() * 0.4 / sqrt(2.0)); + } + break; + } case E_META_RAIL_CURVED_ZM_XP: case E_META_RAIL_CURVED_ZP_XM: - case E_META_RAIL_CURVED_ZP_XP: { - // TODO - simply can't be bothered right now + Vector3d Distance = MinecartCollisionCallback.GetCollidedEntityPosition() - Vector3d(GetPosX(), 0, GetPosZ()); + + // Prevent division by small numbers + if (std::abs(Distance.z) < 0.001) + { + Distance.z = 0.001; + } + + /* Check to which side the minecart is to be pushed. + Let's consider a z-x-coordinate system where the minecart is the center (0/0). + The minecart moves along the line x = z, the perpendicular line to this is x = -z. + In order to decide to which side the minecart is to be pushed, it must be checked on what side of the perpendicular line the pushing entity is located. */ + if ( + ((Distance.z > 0) && ((Distance.x / Distance.z) <= -1)) || + ((Distance.z < 0) && ((Distance.x / Distance.z) >= -1)) + ) + { + // Moving +X +Z + if ((GetSpeedX() * 0.4) < 0.01) + { + // ~ SpeedX <= 0 Immobile or not moving in the "right" direction + AddSpeedX(4 / sqrt(2.0)); + AddSpeedZ(4 / sqrt(2.0)); + } + else + { + // ~ SpeedX > 0 Moving in the "right" direction + SetSpeedX(GetSpeedX() * 0.4 / sqrt(2.0)); + SetSpeedZ(GetSpeedZ() * 0.4 / sqrt(2.0)); + } + } + else if ((-GetSpeedX() * 0.4) < 0.01) + { + // Moving -X -Z + // ~ SpeedX >= 0 Immobile or not moving in the "right" direction + AddSpeedX(-4 / sqrt(2.0)); + AddSpeedZ(-4 / sqrt(2.0)); + } + else + { + // ~ SpeedX < 0 Moving in the "right" direction + SetSpeedX(GetSpeedX() * 0.4 / sqrt(2.0)); + SetSpeedZ(GetSpeedZ() * 0.4 / sqrt(2.0)); + } break; } default: break; @@ -982,6 +1072,8 @@ cRideableMinecart::cRideableMinecart(double a_X, double a_Y, double a_Z, const c void cRideableMinecart::OnRightClicked(cPlayer & a_Player) { + super::OnRightClicked(a_Player); + if (m_Attachee != NULL) { if (m_Attachee->GetUniqueID() == a_Player.GetUniqueID()) @@ -1013,29 +1105,55 @@ void cRideableMinecart::OnRightClicked(cPlayer & a_Player) // cMinecartWithChest: cMinecartWithChest::cMinecartWithChest(double a_X, double a_Y, double a_Z) : - super(mpChest, a_X, a_Y, a_Z) + super(mpChest, a_X, a_Y, a_Z), + cEntityWindowOwner(this), + m_Contents(ContentsWidth, ContentsHeight) { + m_Contents.AddListener(*this); } -void cMinecartWithChest::SetSlot(size_t a_Idx, const cItem & a_Item) +void cMinecartWithChest::OnRightClicked(cPlayer & a_Player) { - ASSERT(a_Idx < ARRAYCOUNT(m_Items)); - - m_Items[a_Idx] = a_Item; + // If the window is not created, open it anew: + cWindow * Window = GetWindow(); + if (Window == NULL) + { + OpenNewWindow(); + Window = GetWindow(); + } + + // Open the window for the player: + if (Window != NULL) + { + if (a_Player.GetWindow() != Window) + { + a_Player.OpenWindow(Window); + } + } } -void cMinecartWithChest::OnRightClicked(cPlayer & a_Player) +void cMinecartWithChest::OpenNewWindow() +{ + OpenWindow(new cMinecartWithChestWindow(this)); +} + + + + + +void cMinecartWithChest::Destroyed() { - // Show the chest UI window to the player - // TODO + cItems Pickups; + m_Contents.CopyToItems(Pickups); + GetWorld()->SpawnItemPickups(Pickups, GetPosX(), GetPosY() + 1, GetPosZ(), 4); } diff --git a/src/Entities/Minecart.h b/src/Entities/Minecart.h index 410d3c77d..6b6ad36b5 100644 --- a/src/Entities/Minecart.h +++ b/src/Entities/Minecart.h @@ -10,6 +10,8 @@ #pragma once #include "Entity.h" +#include "World.h" +#include "../UI/WindowOwner.h" @@ -108,27 +110,46 @@ protected: class cMinecartWithChest : - public cMinecart + public cMinecart, + public cItemGrid::cListener, + public cEntityWindowOwner { typedef cMinecart super; public: CLASS_PROTODEF(cMinecartWithChest) - /// Number of item slots in the chest - static const int NumSlots = 9 * 3; - cMinecartWithChest(double a_X, double a_Y, double a_Z); + + enum + { + ContentsHeight = 3, + ContentsWidth = 9, + }; - const cItem & GetSlot(int a_Idx) const { return m_Items[a_Idx]; } - cItem & GetSlot(int a_Idx) { return m_Items[a_Idx]; } - - void SetSlot(size_t a_Idx, const cItem & a_Item); + const cItem & GetSlot(int a_Idx) const { return m_Contents.GetSlot(a_Idx); } + void SetSlot(size_t a_Idx, const cItem & a_Item) { m_Contents.SetSlot(a_Idx, a_Item); } protected: + cItemGrid m_Contents; + void OpenNewWindow(void); + virtual void Destroyed() override; - /// The chest contents: - cItem m_Items[NumSlots]; + // cItemGrid::cListener overrides: + virtual void OnSlotChanged(cItemGrid * a_Grid, int a_SlotNum) + { + UNUSED(a_SlotNum); + ASSERT(a_Grid == &m_Contents); + if (m_World != NULL) + { + if (GetWindow() != NULL) + { + GetWindow()->BroadcastWholeWindow(); + } + + m_World->MarkChunkDirty(GetChunkX(), GetChunkZ()); + } + } // cEntity overrides: virtual void OnRightClicked(cPlayer & a_Player) override; diff --git a/src/Entities/Pawn.cpp b/src/Entities/Pawn.cpp index fe6c24a7a..fc8ca3d47 100644 --- a/src/Entities/Pawn.cpp +++ b/src/Entities/Pawn.cpp @@ -9,9 +9,9 @@ -cPawn::cPawn(eEntityType a_EntityType, double a_Width, double a_Height): - super(a_EntityType, 0, 0, 0, a_Width, a_Height), - m_EntityEffects(tEffectMap()) +cPawn::cPawn(eEntityType a_EntityType, double a_Width, double a_Height) : + super(a_EntityType, 0, 0, 0, a_Width, a_Height) + , m_EntityEffects(tEffectMap()) { } @@ -111,3 +111,6 @@ void cPawn::ClearEntityEffects() RemoveEntityEffect(EffectType); } } + + + diff --git a/src/Entities/Pickup.cpp b/src/Entities/Pickup.cpp index aab534f41..87b5bed07 100644 --- a/src/Entities/Pickup.cpp +++ b/src/Entities/Pickup.cpp @@ -150,10 +150,14 @@ void cPickup::Tick(float a_Dt, cChunk & a_Chunk) } } - if (!IsDestroyed() && (m_Item.m_ItemCount < m_Item.GetMaxStackSize())) // Don't combine into an already full pickup + // Try to combine the pickup with adjacent same-item pickups: + if (!IsDestroyed() && (m_Item.m_ItemCount < m_Item.GetMaxStackSize())) // Don't combine if already full { + // By using a_Chunk's ForEachEntity() instead of cWorld's, pickups don't combine across chunk boundaries. + // That is a small price to pay for not having to traverse the entire world for each entity. + // The speedup in the tick thread is quite considerable. cPickupCombiningCallback PickupCombiningCallback(GetPosition(), this); - m_World->ForEachEntity(PickupCombiningCallback); // Not ForEachEntityInChunk, otherwise pickups don't combine across chunk boundaries + a_Chunk.ForEachEntity(PickupCombiningCallback); if (PickupCombiningCallback.FoundMatchingPickup()) { m_World->BroadcastEntityMetadata(*this); diff --git a/src/Entities/Player.cpp b/src/Entities/Player.cpp index cf3322968..f58a0a016 100644 --- a/src/Entities/Player.cpp +++ b/src/Entities/Player.cpp @@ -10,13 +10,12 @@ #include "../Bindings/PluginManager.h" #include "../BlockEntities/BlockEntity.h" #include "../BlockEntities/EnderChestEntity.h" -#include "../GroupManager.h" -#include "../Group.h" #include "../Root.h" #include "../OSSupport/Timer.h" #include "../Chunk.h" #include "../Items/ItemHandler.h" #include "../Vector3.h" +#include "../FastRandom.h" #include "../WorldStorage/StatSerializer.h" #include "../CompositeChat.h" @@ -33,6 +32,15 @@ +const int cPlayer::MAX_HEALTH = 20; + +const int cPlayer::MAX_FOOD_LEVEL = 20; + +/** Number of ticks it takes to eat an item */ +const int cPlayer::EATING_TICKS = 30; + + + cPlayer::cPlayer(cClientHandle* a_Client, const AString & a_PlayerName) : @@ -50,7 +58,6 @@ cPlayer::cPlayer(cClientHandle* a_Client, const AString & a_PlayerName) : m_EnderChestContents(9, 3), m_CurrentWindow(NULL), m_InventoryWindow(NULL), - m_Color('-'), m_GameMode(eGameMode_NotSet), m_IP(""), m_ClientHandle(a_Client), @@ -74,7 +81,8 @@ cPlayer::cPlayer(cClientHandle* a_Client, const AString & a_PlayerName) : m_Team(NULL), m_TicksUntilNextSave(PLAYER_INVENTORY_SAVE_INTERVAL), m_bIsTeleporting(false), - m_UUID((a_Client != NULL) ? a_Client->GetUUID() : "") + m_UUID((a_Client != NULL) ? a_Client->GetUUID() : ""), + m_CustomName("") { m_InventoryWindow = new cInventoryWindow(*this); m_CurrentWindow = m_InventoryWindow; @@ -216,16 +224,24 @@ void cPlayer::Tick(float a_Dt, cChunk & a_Chunk) SendExperience(); } + bool CanMove = true; if (!GetPosition().EqualsEps(m_LastPos, 0.01)) // Non negligible change in position from last tick? { // Apply food exhaustion from movement: ApplyFoodExhaustionFromMovement(); - cRoot::Get()->GetPluginManager()->CallHookPlayerMoving(*this); + if (cRoot::Get()->GetPluginManager()->CallHookPlayerMoving(*this, m_LastPos, GetPosition())) + { + CanMove = false; + TeleportToCoords(m_LastPos.x, m_LastPos.y, m_LastPos.z); + } m_ClientHandle->StreamChunks(); } - BroadcastMovementUpdate(m_ClientHandle); + if (CanMove) + { + BroadcastMovementUpdate(m_ClientHandle); + } if (m_Health > 0) // make sure player is alive { @@ -251,7 +267,7 @@ void cPlayer::Tick(float a_Dt, cChunk & a_Chunk) cTimer t1; if (m_LastPlayerListTime + PLAYER_LIST_TIME_MS <= t1.GetNowTime()) { - m_World->SendPlayerList(this); + m_World->BroadcastPlayerListUpdatePing(*this); m_LastPlayerListTime = t1.GetNowTime(); } @@ -436,6 +452,11 @@ void cPlayer::CancelChargingBow(void) void cPlayer::SetTouchGround(bool a_bTouchGround) { + if (IsGameModeSpectator()) // You can fly through the ground in Spectator + { + return; + } + m_bTouchGround = a_bTouchGround; if (!m_bTouchGround) @@ -509,7 +530,7 @@ void cPlayer::Heal(int a_Health) void cPlayer::SetFoodLevel(int a_FoodLevel) { - int FoodLevel = std::max(0, std::min(a_FoodLevel, (int)MAX_FOOD_LEVEL)); + int FoodLevel = Clamp(a_FoodLevel, 0, MAX_FOOD_LEVEL); if (cRoot::Get()->GetPluginManager()->CallHookPlayerFoodLevelChange(*this, FoodLevel)) { @@ -527,7 +548,7 @@ void cPlayer::SetFoodLevel(int a_FoodLevel) void cPlayer::SetFoodSaturationLevel(double a_FoodSaturationLevel) { - m_FoodSaturationLevel = std::max(0.0, std::min(a_FoodSaturationLevel, (double)m_FoodLevel)); + m_FoodSaturationLevel = Clamp(a_FoodSaturationLevel, 0.0, (double) m_FoodLevel); } @@ -545,7 +566,7 @@ void cPlayer::SetFoodTickTimer(int a_FoodTickTimer) void cPlayer::SetFoodExhaustionLevel(double a_FoodExhaustionLevel) { - m_FoodExhaustionLevel = std::max(0.0, std::min(a_FoodExhaustionLevel, 4.0)); + m_FoodExhaustionLevel = Clamp(a_FoodExhaustionLevel, 0.0, 40.0); } @@ -568,9 +589,12 @@ bool cPlayer::Feed(int a_Food, double a_Saturation) -void cPlayer::FoodPoison(int a_NumTicks) +void cPlayer::AddFoodExhaustion(double a_Exhaustion) { - AddEntityEffect(cEntityEffect::effHunger, a_NumTicks, 0, 1); + if (!(IsGameModeCreative() || IsGameModeSpectator())) + { + m_FoodExhaustionLevel = std::min(m_FoodExhaustionLevel + a_Exhaustion, 40.0); + } } @@ -598,7 +622,6 @@ void cPlayer::FinishEating(void) // Send the packets: m_ClientHandle->SendEntityStatus(*this, esPlayerEatingAccepted); - m_World->BroadcastEntityAnimation(*this, 0); m_World->BroadcastEntityMetadata(*this); // consume the item: @@ -610,15 +633,6 @@ void cPlayer::FinishEating(void) return; } ItemHandler->OnFoodEaten(m_World, this, &Item); - - GetInventory().RemoveOneEquippedItem(); - - // if the food is mushroom soup, return a bowl to the inventory - if (Item.m_ItemType == E_ITEM_MUSHROOM_SOUP) - { - cItem emptyBowl(E_ITEM_BOWL, 1, 0, ""); - GetInventory().AddItem(emptyBowl, true, true); - } } @@ -628,7 +642,6 @@ void cPlayer::FinishEating(void) void cPlayer::AbortEating(void) { m_EatingFinishTick = -1; - m_World->BroadcastEntityAnimation(*this, 0); m_World->BroadcastEntityMetadata(*this); } @@ -697,16 +710,13 @@ double cPlayer::GetMaxSpeed(void) const { return m_FlyingMaxSpeed; } + else if (m_IsSprinting) + { + return m_SprintingMaxSpeed; + } else { - if (m_IsSprinting) - { - return m_SprintingMaxSpeed; - } - else - { - return m_NormalMaxSpeed; - } + return m_NormalMaxSpeed; } } @@ -800,6 +810,29 @@ void cPlayer::SetCanFly(bool a_CanFly) +void cPlayer::SetCustomName(const AString & a_CustomName) +{ + if (m_CustomName == a_CustomName) + { + return; + } + + m_World->BroadcastPlayerListRemovePlayer(*this); + + m_CustomName = a_CustomName; + if (m_CustomName.length() > 16) + { + m_CustomName = m_CustomName.substr(0, 16); + } + + m_World->BroadcastPlayerListAddPlayer(*this); + m_World->BroadcastSpawnEntity(*this, GetClientHandle()); +} + + + + + void cPlayer::SetFlying(bool a_IsFlying) { if (a_IsFlying == m_IsFlying) @@ -819,9 +852,9 @@ bool cPlayer::DoTakeDamage(TakeDamageInfo & a_TDI) { if ((a_TDI.DamageType != dtInVoid) && (a_TDI.DamageType != dtPlugin)) { - if (IsGameModeCreative()) + if (IsGameModeCreative() || IsGameModeSpectator()) { - // No damage / health in creative mode if not void or plugin damage + // No damage / health in creative or spectator mode if not void or plugin damage return false; } } @@ -877,12 +910,12 @@ void cPlayer::KilledBy(TakeDamageInfo & a_TDI) Pickups.Add(cItem(E_ITEM_RED_APPLE)); } - m_Stats.AddValue(statItemsDropped, Pickups.Size()); + m_Stats.AddValue(statItemsDropped, (StatValue)Pickups.Size()); m_World->SpawnItemPickups(Pickups, GetPosX(), GetPosY(), GetPosZ(), 10); SaveToDisk(); // Save it, yeah the world is a tough place ! - if (a_TDI.Attacker == NULL) + if ((a_TDI.Attacker == NULL) && m_World->ShouldBroadcastDeathMessages()) { AString DamageText; switch (a_TDI.DamageType) @@ -908,6 +941,10 @@ void cPlayer::KilledBy(TakeDamageInfo & a_TDI) } GetWorld()->BroadcastChatDeath(Printf("%s %s", GetName().c_str(), DamageText.c_str())); } + else if (a_TDI.Attacker == NULL) // && !m_World->ShouldBroadcastDeathMessages() by fallthrough + { + // no-op + } else if (a_TDI.Attacker->IsPlayer()) { cPlayer * Killer = (cPlayer *)a_TDI.Attacker; @@ -1035,6 +1072,14 @@ bool cPlayer::IsGameModeAdventure(void) const +bool cPlayer::IsGameModeSpectator(void) const +{ + return (m_GameMode == gmSpectator) || // Either the player is explicitly in Spectator + ((m_GameMode == gmNotSet) && m_World->IsGameModeSpectator()); // or they inherit from the world and the world is Adventure +} + + + void cPlayer::SetTeam(cTeam * a_Team) { @@ -1150,11 +1195,13 @@ void cPlayer::SetGameMode(eGameMode a_GameMode) m_GameMode = a_GameMode; m_ClientHandle->SendGameMode(a_GameMode); - if (!IsGameModeCreative()) + if (!(IsGameModeCreative() || IsGameModeSpectator())) { SetFlying(false); SetCanFly(false); } + + m_World->BroadcastPlayerListUpdateGameMode(*this); } @@ -1200,11 +1247,13 @@ unsigned int cPlayer::AwardAchievement(const eStatistic a_Ach) } else { - // First time, announce it - cCompositeChat Msg; - Msg.SetMessageType(mtSuccess); - Msg.AddShowAchievementPart(GetName(), cStatInfo::GetName(a_Ach)); - m_World->BroadcastChat(Msg); + if (m_World->ShouldBroadcastAchievementMessages()) + { + cCompositeChat Msg; + Msg.SetMessageType(mtSuccess); + Msg.AddShowAchievementPart(GetName(), cStatInfo::GetName(a_Ach)); + m_World->BroadcastChat(Msg); + } // Increment the statistic StatValue New = m_Stats.AddValue(a_Ach); @@ -1330,6 +1379,7 @@ void cPlayer::MoveTo( const Vector3d & a_NewPos) void cPlayer::SetVisible(bool a_bVisible) { + // Need to Check if the player or other players are in gamemode spectator, but will break compatibility if (a_bVisible && !m_bVisible) // Make visible { m_bVisible = true; @@ -1346,48 +1396,6 @@ void cPlayer::SetVisible(bool a_bVisible) -void cPlayer::AddToGroup( const AString & a_GroupName) -{ - cGroup* Group = cRoot::Get()->GetGroupManager()->GetGroup( a_GroupName); - m_Groups.push_back( Group); - LOGD("Added %s to group %s", GetName().c_str(), a_GroupName.c_str()); - ResolveGroups(); - ResolvePermissions(); -} - - - - - -void cPlayer::RemoveFromGroup( const AString & a_GroupName) -{ - bool bRemoved = false; - for (GroupList::iterator itr = m_Groups.begin(); itr != m_Groups.end(); ++itr) - { - if ((*itr)->GetName().compare(a_GroupName) == 0) - { - m_Groups.erase( itr); - bRemoved = true; - break; - } - } - - if (bRemoved) - { - LOGD("Removed %s from group %s", GetName().c_str(), a_GroupName.c_str()); - ResolveGroups(); - ResolvePermissions(); - } - else - { - LOGWARN("Tried to remove %s from group %s but was not in that group", GetName().c_str(), a_GroupName.c_str()); - } -} - - - - - bool cPlayer::HasPermission(const AString & a_Permission) { if (a_Permission.empty()) @@ -1396,33 +1404,18 @@ bool cPlayer::HasPermission(const AString & a_Permission) return true; } - AStringVector Split = StringSplit( a_Permission, "."); - PermissionMap Possibilities = m_ResolvedPermissions; - // Now search the namespaces - while (Possibilities.begin() != Possibilities.end()) + AStringVector Split = StringSplit(a_Permission, "."); + + // Iterate over all granted permissions; if any matches, then return success: + for (AStringVectorVector::const_iterator itr = m_SplitPermissions.begin(), end = m_SplitPermissions.end(); itr != end; ++itr) { - PermissionMap::iterator itr = Possibilities.begin(); - if (itr->second) + if (PermissionMatches(Split, *itr)) { - AStringVector OtherSplit = StringSplit( itr->first, "."); - if (OtherSplit.size() <= Split.size()) - { - unsigned int i; - for (i = 0; i < OtherSplit.size(); ++i) - { - if (OtherSplit[i].compare( Split[i]) != 0) - { - if (OtherSplit[i].compare("*") == 0) return true; // WildCard man!! WildCard! - break; - } - } - if (i == Split.size()) return true; - } + return true; } - Possibilities.erase( itr); - } + } // for itr - m_SplitPermissions[] - // Nothing that matched :( + // No granted permission matches return false; } @@ -1430,13 +1423,34 @@ bool cPlayer::HasPermission(const AString & a_Permission) -bool cPlayer::IsInGroup( const AString & a_Group) +bool cPlayer::PermissionMatches(const AStringVector & a_Permission, const AStringVector & a_Template) { - for (GroupList::iterator itr = m_ResolvedGroups.begin(); itr != m_ResolvedGroups.end(); ++itr) + // Check the sub-items if they are the same or there's a wildcard: + size_t lenP = a_Permission.size(); + size_t lenT = a_Template.size(); + size_t minLen = std::min(lenP, lenT); + for (size_t i = 0; i < minLen; i++) { - if (a_Group.compare( (*itr)->GetName().c_str()) == 0) + if (a_Template[i] == "*") + { + // Has matched so far and now there's a wildcard in the template, so the permission matches: return true; + } + if (a_Permission[i] != a_Template[i]) + { + // Found a mismatch + return false; + } + } + + // So far all the sub-items have matched + // If the sub-item count is the same, then the permission matches: + if (lenP == lenT) + { + return true; } + + // There are more sub-items in either the permission or the template, not a match: return false; } @@ -1444,87 +1458,38 @@ bool cPlayer::IsInGroup( const AString & a_Group) -void cPlayer::ResolvePermissions() +AString cPlayer::GetColor(void) const { - m_ResolvedPermissions.clear(); // Start with an empty map - - // Copy all player specific permissions into the resolved permissions map - for (PermissionMap::iterator itr = m_Permissions.begin(); itr != m_Permissions.end(); ++itr) + if (m_MsgNameColorCode.empty() || (m_MsgNameColorCode == "-")) { - m_ResolvedPermissions[ itr->first ] = itr->second; + // Color has not been assigned, return an empty string: + return AString(); } - for (GroupList::iterator GroupItr = m_ResolvedGroups.begin(); GroupItr != m_ResolvedGroups.end(); ++GroupItr) - { - const cGroup::PermissionMap & Permissions = (*GroupItr)->GetPermissions(); - for (cGroup::PermissionMap::const_iterator itr = Permissions.begin(); itr != Permissions.end(); ++itr) - { - m_ResolvedPermissions[ itr->first ] = itr->second; - } - } + // Return the color, including the delimiter: + return cChatColor::Delimiter + m_MsgNameColorCode; } -void cPlayer::ResolveGroups() +AString cPlayer::GetPlayerListName(void) const { - // Clear resolved groups first - m_ResolvedGroups.clear(); + const AString & Color = GetColor(); - // Get a complete resolved list of all groups the player is in - std::map< cGroup*, bool > AllGroups; // Use a map, because it's faster than iterating through a list to find duplicates - GroupList ToIterate; - for (GroupList::iterator GroupItr = m_Groups.begin(); GroupItr != m_Groups.end(); ++GroupItr) + if (HasCustomName()) { - ToIterate.push_back( *GroupItr); + return m_CustomName; } - while (ToIterate.begin() != ToIterate.end()) + else if ((GetName().length() <= 14) && !Color.empty()) { - cGroup* CurrentGroup = *ToIterate.begin(); - if (AllGroups.find( CurrentGroup) != AllGroups.end()) - { - LOGWARNING("ERROR: Player \"%s\" is in the group multiple times (\"%s\"). Please fix your settings in users.ini!", - GetName().c_str(), CurrentGroup->GetName().c_str() - ); - } - else - { - AllGroups[ CurrentGroup ] = true; - m_ResolvedGroups.push_back( CurrentGroup); // Add group to resolved list - const cGroup::GroupList & Inherits = CurrentGroup->GetInherits(); - for (cGroup::GroupList::const_iterator itr = Inherits.begin(); itr != Inherits.end(); ++itr) - { - if (AllGroups.find( *itr) != AllGroups.end()) - { - LOGERROR("ERROR: Player %s is in the same group multiple times due to inheritance (%s). FIX IT!", GetName().c_str(), (*itr)->GetName().c_str()); - continue; - } - ToIterate.push_back( *itr); - } - } - ToIterate.erase( ToIterate.begin()); - } -} - - - - - -AString cPlayer::GetColor(void) const -{ - if (m_Color != '-') - { - return cChatColor::Delimiter + m_Color; + return Printf("%s%s", Color.c_str(), GetName().c_str()); } - - if (m_Groups.size() < 1) + else { - return cChatColor::White; + return GetName(); } - - return (*m_Groups.begin())->GetColor(); } @@ -1597,7 +1562,12 @@ void cPlayer::TossPickup(const cItem & a_Item) void cPlayer::TossItems(const cItems & a_Items) { - m_Stats.AddValue(statItemsDropped, a_Items.Size()); + if (IsGameModeSpectator()) // Players can't toss items in spectator + { + return; + } + + m_Stats.AddValue(statItemsDropped, (StatValue)a_Items.Size()); double vX = 0, vY = 0, vZ = 0; EulerToVector(-GetYaw(), GetPitch(), vZ, vX, vY); @@ -1640,48 +1610,9 @@ bool cPlayer::DoMoveToWorld(cWorld * a_World, bool a_ShouldSendRespawn) -void cPlayer::LoadPermissionsFromDisk() -{ - m_Groups.clear(); - m_Permissions.clear(); - - cIniFile IniFile; - if (IniFile.ReadFile("users.ini")) - { - AString Groups = IniFile.GetValueSet(GetName(), "Groups", "Default"); - AStringVector Split = StringSplitAndTrim(Groups, ","); - - for (AStringVector::const_iterator itr = Split.begin(), end = Split.end(); itr != end; ++itr) - { - if (!cRoot::Get()->GetGroupManager()->ExistsGroup(*itr)) - { - LOGWARNING("The group %s for player %s was not found!", itr->c_str(), GetName().c_str()); - } - AddToGroup(*itr); - } - - AString Color = IniFile.GetValue(GetName(), "Color", "-"); - if (!Color.empty()) - { - m_Color = Color[0]; - } - } - else - { - cGroupManager::GenerateDefaultUsersIni(IniFile); - IniFile.AddValue("Groups", GetName(), "Default"); - AddToGroup("Default"); - } - IniFile.WriteFile("users.ini"); - ResolvePermissions(); -} - - - - bool cPlayer::LoadFromDisk(cWorldPtr & a_World) { - LoadPermissionsFromDisk(); + LoadRank(); // Load from the UUID file: if (LoadFromFile(GetUUIDFileName(m_UUID), a_World)) @@ -1691,8 +1622,10 @@ bool cPlayer::LoadFromDisk(cWorldPtr & a_World) // Load from the offline UUID file, if allowed: AString OfflineUUID = cClientHandle::GenerateOfflineUUID(GetName()); + const char * OfflineUsage = " (unused)"; if (cRoot::Get()->GetServer()->ShouldLoadOfflinePlayerData()) { + OfflineUsage = ""; if (LoadFromFile(GetUUIDFileName(OfflineUUID), a_World)) { return true; @@ -1715,8 +1648,8 @@ bool cPlayer::LoadFromDisk(cWorldPtr & a_World) } // None of the files loaded successfully - LOG("Player data file not found for %s (%s, offline %s), will be reset to defaults.", - GetName().c_str(), m_UUID.c_str(), OfflineUUID.c_str() + LOG("Player data file not found for %s (%s, offline %s%s), will be reset to defaults.", + GetName().c_str(), m_UUID.c_str(), OfflineUUID.c_str(), OfflineUsage ); if (a_World == NULL) @@ -1795,7 +1728,11 @@ bool cPlayer::LoadFromFile(const AString & a_FileName, cWorldPtr & a_World) cEnderChestEntity::LoadFromJson(root["enderchestinventory"], m_EnderChestContents); m_LoadedWorldName = root.get("world", "world").asString(); - a_World = cRoot::Get()->GetWorld(GetLoadedWorldName(), true); + a_World = cRoot::Get()->GetWorld(GetLoadedWorldName(), false); + if (a_World == NULL) + { + a_World = cRoot::Get()->GetDefaultWorld(); + } m_LastBedPos.x = root.get("SpawnX", a_World->GetSpawnX()).asInt(); m_LastBedPos.y = root.get("SpawnY", a_World->GetSpawnY()).asInt(); @@ -1819,6 +1756,7 @@ bool cPlayer::LoadFromFile(const AString & a_FileName, cWorldPtr & a_World) bool cPlayer::SaveToDisk() { + cFile::CreateFolder(FILE_IO_PREFIX + AString("players/")); // Create the "players" folder, if it doesn't exist yet (#1268) cFile::CreateFolder(FILE_IO_PREFIX + AString("players/") + m_UUID.substr(0, 2)); // create the JSON data @@ -1913,31 +1851,33 @@ bool cPlayer::SaveToDisk() -cPlayer::StringList cPlayer::GetResolvedPermissions() +void cPlayer::UseEquippedItem(int a_Amount) { - StringList Permissions; + if (IsGameModeCreative() || IsGameModeSpectator()) // No damage in creative or spectator + { + return; + } - const PermissionMap& ResolvedPermissions = m_ResolvedPermissions; - for (PermissionMap::const_iterator itr = ResolvedPermissions.begin(); itr != ResolvedPermissions.end(); ++itr) + // If the item has an unbreaking enchantment, give it a random chance of not breaking: + cItem Item = GetEquippedItem(); + int UnbreakingLevel = Item.m_Enchantments.GetLevel(cEnchantments::enchUnbreaking); + if (UnbreakingLevel > 0) { - if (itr->second) + int chance; + if (ItemCategory::IsArmor(Item.m_ItemType)) { - Permissions.push_back( itr->first); + chance = 60 + (40 / (UnbreakingLevel + 1)); + } + else + { + chance = 100 / (UnbreakingLevel + 1); } - } - - return Permissions; -} - - - - -void cPlayer::UseEquippedItem(int a_Amount) -{ - if (IsGameModeCreative()) // No damage in creative - { - return; + cFastRandom Random; + if (Random.NextInt(101) <= chance) + { + return; + } } if (GetInventory().DamageEquippedItem(a_Amount)) @@ -1977,19 +1917,34 @@ void cPlayer::HandleFood(void) return; } + // Apply food exhaustion that has accumulated: + if (m_FoodExhaustionLevel > 4.0) + { + m_FoodExhaustionLevel -= 4.0; + + if (m_FoodSaturationLevel > 0.0) + { + m_FoodSaturationLevel = std::max(m_FoodSaturationLevel - 1.0, 0.0); + } + else + { + SetFoodLevel(m_FoodLevel - 1); + } + } + // Heal or damage, based on the food level, using the m_FoodTickTimer: - if ((m_FoodLevel > 17) || (m_FoodLevel <= 0)) + if ((m_FoodLevel >= 18) || (m_FoodLevel <= 0)) { m_FoodTickTimer++; if (m_FoodTickTimer >= 80) { m_FoodTickTimer = 0; - if ((m_FoodLevel > 17) && (GetHealth() < GetMaxHealth())) + if ((m_FoodLevel >= 18) && (GetHealth() < GetMaxHealth())) { // Regenerate health from food, incur 3 pts of food exhaustion: Heal(1); - m_FoodExhaustionLevel += 3.0; + AddFoodExhaustion(3.0); } else if ((m_FoodLevel <= 0) && (m_Health > 1)) { @@ -1998,20 +1953,9 @@ void cPlayer::HandleFood(void) } } } - - // Apply food exhaustion that has accumulated: - if (m_FoodExhaustionLevel >= 4.0) + else { - m_FoodExhaustionLevel -= 4.0; - - if (m_FoodSaturationLevel >= 1.0) - { - m_FoodSaturationLevel -= 1.0; - } - else - { - SetFoodLevel(m_FoodLevel - 1); - } + m_FoodTickTimer = 0; } } @@ -2086,14 +2030,17 @@ void cPlayer::UpdateMovementStats(const Vector3d & a_DeltaPos) else if (IsSubmerged()) { m_Stats.AddValue(statDistDove, Value); + AddFoodExhaustion(0.00015 * (double)Value); } else if (IsSwimming()) { m_Stats.AddValue(statDistSwum, Value); + AddFoodExhaustion(0.00015 * (double)Value); } else if (IsOnGround()) { m_Stats.AddValue(statDistWalked, Value); + AddFoodExhaustion((m_IsSprinting ? 0.001 : 0.0001) * (double)Value); } else { @@ -2114,8 +2061,8 @@ void cPlayer::UpdateMovementStats(const Vector3d & a_DeltaPos) cMonster * Monster = (cMonster *)m_AttachedTo; switch (Monster->GetMobType()) { - case cMonster::mtPig: m_Stats.AddValue(statDistPig, Value); break; - case cMonster::mtHorse: m_Stats.AddValue(statDistHorse, Value); break; + case mtPig: m_Stats.AddValue(statDistPig, Value); break; + case mtHorse: m_Stats.AddValue(statDistHorse, Value); break; default: break; } break; @@ -2184,6 +2131,36 @@ void cPlayer::ApplyFoodExhaustionFromMovement() +void cPlayer::LoadRank(void) +{ + // Load the values from cRankManager: + cRankManager & RankMgr = cRoot::Get()->GetRankManager(); + m_Rank = RankMgr.GetPlayerRankName(m_UUID); + if (m_Rank.empty()) + { + m_Rank = RankMgr.GetDefaultRank(); + } + else + { + // Update the name: + RankMgr.UpdatePlayerName(m_UUID, m_PlayerName); + } + m_Permissions = RankMgr.GetPlayerPermissions(m_UUID); + RankMgr.GetRankVisuals(m_Rank, m_MsgPrefix, m_MsgSuffix, m_MsgNameColorCode); + + // Break up the individual permissions on each dot, into m_SplitPermissions: + m_SplitPermissions.clear(); + m_SplitPermissions.reserve(m_Permissions.size()); + for (AStringVector::const_iterator itr = m_Permissions.begin(), end = m_Permissions.end(); itr != end; ++itr) + { + m_SplitPermissions.push_back(StringSplit(*itr, ".")); + } // for itr - m_Permissions[] +} + + + + + void cPlayer::Detach() { super::Detach(); @@ -2216,12 +2193,13 @@ void cPlayer::Detach() AString cPlayer::GetUUIDFileName(const AString & a_UUID) { - ASSERT(a_UUID.size() == 36); + AString UUID = cMojangAPI::MakeUUIDDashed(a_UUID); + ASSERT(UUID.length() == 36); AString res("players/"); - res.append(a_UUID, 0, 2); + res.append(UUID, 0, 2); res.push_back('/'); - res.append(a_UUID, 2, AString::npos); + res.append(UUID, 2, AString::npos); res.append(".json"); return res; } diff --git a/src/Entities/Player.h b/src/Entities/Player.h index 65c1e33a8..22d6a2ae2 100644 --- a/src/Entities/Player.h +++ b/src/Entities/Player.h @@ -13,7 +13,6 @@ -class cGroup; class cWindow; class cClientHandle; class cTeam; @@ -29,12 +28,13 @@ class cPlayer : typedef cPawn super; public: - enum - { - MAX_HEALTH = 20, - MAX_FOOD_LEVEL = 20, - EATING_TICKS = 30, ///< Number of ticks it takes to eat an item - } ; + static const int MAX_HEALTH; + + static const int MAX_FOOD_LEVEL; + + /** Number of ticks it takes to eat an item */ + static const int EATING_TICKS; + // tolua_end CLASS_PROTODEF(cPlayer) @@ -171,6 +171,9 @@ public: /** Returns true if the player is in Adventure mode, either explicitly, or by inheriting from current world */ bool IsGameModeAdventure(void) const; + /** Returns true if the player is in Spectator mode, either explicitly, or by inheriting from current world */ + bool IsGameModeSpectator(void) const; + AString GetIP(void) const { return m_IP; } // tolua_export /** Returns the associated team, NULL if none */ @@ -179,11 +182,11 @@ public: /** Sets the player team, NULL if none */ void SetTeam(cTeam * a_Team); + // tolua_end + /** Forces the player to query the scoreboard for his team */ cTeam * UpdateTeam(void); - // tolua_end - /** Return the associated statistic and achievement manager. */ cStatManager & GetStatManager() { return m_Stats; } @@ -235,26 +238,25 @@ public: // tolua_end - typedef std::list< cGroup* > GroupList; - typedef std::list< std::string > StringList; + bool HasPermission(const AString & a_Permission); // tolua_export - /** Adds a player to existing group or creates a new group when it doesn't exist */ - void AddToGroup( const AString & a_GroupName); // tolua_export - - /** Removes a player from the group, resolves permissions and group inheritance (case sensitive) */ - void RemoveFromGroup( const AString & a_GroupName); // tolua_export - - bool HasPermission( const AString & a_Permission); // tolua_export - const GroupList & GetGroups() { return m_Groups; } // >> EXPORTED IN MANUALBINDINGS << - StringList GetResolvedPermissions(); // >> EXPORTED IN MANUALBINDINGS << - bool IsInGroup( const AString & a_Group); // tolua_export + /** Returns true iff a_Permission matches the a_Template. + A match is defined by either being exactly the same, or each sub-item matches until there's a wildcard in a_Template. + Ie. {"a", "b", "c"} matches {"a", "b", "*"} but doesn't match {"a", "b"} */ + static bool PermissionMatches(const AStringVector & a_Permission, const AStringVector & a_Template); // Exported in ManualBindings with AString params + + /** Returns all the permissions that the player has assigned to them. */ + const AStringVector & GetPermissions(void) { return m_Permissions; } // Exported in ManualBindings.cpp // tolua_begin - /** Returns the full color code to use for this player, based on their primary group or set in m_Color. - The returned value includes the cChatColor::Delimiter. */ + /** Returns the full color code to use for this player, based on their rank. + The returned value either is empty, or includes the cChatColor::Delimiter. */ AString GetColor(void) const; + /** Returns the name that is used in the playerlist. */ + AString GetPlayerListName(void) const; + /** tosses the item in the selected hotbar slot */ void TossEquippedItem(char a_Amount = 1); @@ -284,13 +286,7 @@ public: bool Feed(int a_Food, double a_Saturation); /** Adds the specified exhaustion to m_FoodExhaustion. Expects only positive values. */ - void AddFoodExhaustion(double a_Exhaustion) - { - m_FoodExhaustionLevel += a_Exhaustion; - } - - /** Starts the food poisoning for the specified amount of ticks */ - void FoodPoison(int a_NumTicks); + void AddFoodExhaustion(double a_Exhaustion); /** Returns true if the player is currently in the process of eating the currently equipped item */ bool IsEating(void) const { return (m_EatingFinishTick >= 0); } @@ -352,8 +348,6 @@ public: */ bool LoadFromFile(const AString & a_FileName, cWorldPtr & a_World); - void LoadPermissionsFromDisk(void); // tolua_export - const AString & GetLoadedWorldName() { return m_LoadedWorldName; } void UseEquippedItem(int a_Amount = 1); @@ -410,6 +404,16 @@ public: /** If true the player can fly even when he's not in creative. */ void SetCanFly(bool a_CanFly); + /** Returns true if the player has a custom name. */ + bool HasCustomName(void) const { return !m_CustomName.empty(); } + + /** Returns the custom name of this player. If the player hasn't a custom name, it will return an empty string. */ + const AString & GetCustomName(void) const { return m_CustomName; } + + /** Sets the custom name of this player. If you want to disable the custom name, simply set an empty string. + The custom name will be used in the tab-list, in the player nametag and in the tab-completion. */ + void SetCustomName(const AString & a_CustomName); + /** Gets the last position that the player slept in This is initialised to the world spawn point if the player has not slept in a bed as of yet */ @@ -417,12 +421,24 @@ public: /** Sets the player's bed (home) position */ void SetBedPos(const Vector3i & a_Pos) { m_LastBedPos = a_Pos; } + + // tolua_end /** Update movement-related statistics. */ void UpdateMovementStats(const Vector3d & a_DeltaPos); + + // tolua_begin /** Returns wheter the player can fly or not. */ virtual bool CanFly(void) const { return m_CanFly; } + + /** Returns the UUID (short format) that has been read from the client, or empty string if not available. */ + const AString & GetUUID(void) const { return m_UUID; } + + /** (Re)loads the rank and permissions from the cRankManager. + Expects the m_UUID member to be valid. + Loads the m_Rank, m_Permissions, m_MsgPrefix, m_MsgSuffix and m_MsgNameColorCode members. */ + void LoadRank(void); // tolua_end @@ -434,12 +450,22 @@ public: virtual void Detach(void); protected: - typedef std::map< std::string, bool > PermissionMap; - PermissionMap m_ResolvedPermissions; - PermissionMap m_Permissions; - GroupList m_ResolvedGroups; - GroupList m_Groups; + typedef std::vector<std::vector<AString> > AStringVectorVector; + + /** The name of the rank assigned to this player. */ + AString m_Rank; + + /** All the permissions that this player has, based on their rank. */ + AStringVector m_Permissions; + + /** All the permissions that this player has, based on their rank, split into individual dot-delimited parts. + This is used mainly by the HasPermission() function to optimize the lookup. */ + AStringVectorVector m_SplitPermissions; + + // Message visuals: + AString m_MsgPrefix, m_MsgSuffix; + AString m_MsgNameColorCode; AString m_PlayerName; AString m_LoadedWorldName; @@ -484,8 +510,6 @@ protected: /** The player's last saved bed position */ Vector3i m_LastBedPos; - char m_Color; - eGameMode m_GameMode; AString m_IP; @@ -554,10 +578,12 @@ protected: */ bool m_bIsTeleporting; - /** The UUID of the player, as read from the ClientHandle. + /** The short UUID (no dashes) of the player, as read from the ClientHandle. If no ClientHandle is given, the UUID is initialized to empty. */ AString m_UUID; + AString m_CustomName; + /** Sets the speed and sends it to the client, so that they are forced to move so. */ virtual void DoSetSpeed(double a_SpeedX, double a_SpeedY, double a_SpeedZ) override; diff --git a/src/Entities/ProjectileEntity.cpp b/src/Entities/ProjectileEntity.cpp index 43023ec28..acc9bd674 100644 --- a/src/Entities/ProjectileEntity.cpp +++ b/src/Entities/ProjectileEntity.cpp @@ -222,7 +222,8 @@ cProjectileEntity::cProjectileEntity(eKind a_Kind, cEntity * a_Creator, double a m_ProjectileKind(a_Kind), m_CreatorData( ((a_Creator != NULL) ? a_Creator->GetUniqueID() : -1), - ((a_Creator != NULL) ? (a_Creator->IsPlayer() ? ((cPlayer *)a_Creator)->GetName() : "") : "") + ((a_Creator != NULL) ? (a_Creator->IsPlayer() ? ((cPlayer *)a_Creator)->GetName() : "") : ""), + ((a_Creator != NULL) ? a_Creator->GetEquippedWeapon().m_Enchantments : cEnchantments()) ), m_IsInGround(false) { @@ -235,7 +236,7 @@ cProjectileEntity::cProjectileEntity(eKind a_Kind, cEntity * a_Creator, double a cProjectileEntity::cProjectileEntity(eKind a_Kind, cEntity * a_Creator, const Vector3d & a_Pos, const Vector3d & a_Speed, double a_Width, double a_Height) : super(etProjectile, a_Pos.x, a_Pos.y, a_Pos.z, a_Width, a_Height), m_ProjectileKind(a_Kind), - m_CreatorData(a_Creator->GetUniqueID(), a_Creator->IsPlayer() ? ((cPlayer *)a_Creator)->GetName() : ""), + m_CreatorData(a_Creator->GetUniqueID(), a_Creator->IsPlayer() ? ((cPlayer *)a_Creator)->GetName() : "", a_Creator->GetEquippedWeapon().m_Enchantments), m_IsInGround(false) { SetSpeed(a_Speed); diff --git a/src/Entities/ProjectileEntity.h b/src/Entities/ProjectileEntity.h index 0ebc32f36..990136a32 100644 --- a/src/Entities/ProjectileEntity.h +++ b/src/Entities/ProjectileEntity.h @@ -94,14 +94,16 @@ protected: */ struct CreatorData { - CreatorData(int a_UniqueID, const AString & a_Name) : + CreatorData(int a_UniqueID, const AString & a_Name, const cEnchantments & a_Enchantments) : m_UniqueID(a_UniqueID), - m_Name(a_Name) + m_Name(a_Name), + m_Enchantments(a_Enchantments) { } const int m_UniqueID; AString m_Name; + cEnchantments m_Enchantments; }; /** The type of projectile I am */ diff --git a/src/Entities/ThrownEggEntity.cpp b/src/Entities/ThrownEggEntity.cpp index 456083108..5ae85bee8 100644 --- a/src/Entities/ThrownEggEntity.cpp +++ b/src/Entities/ThrownEggEntity.cpp @@ -48,13 +48,13 @@ void cThrownEggEntity::TrySpawnChicken(const Vector3d & a_HitPos) { if (m_World->GetTickRandomNumber(7) == 1) { - m_World->SpawnMob(a_HitPos.x, a_HitPos.y, a_HitPos.z, cMonster::mtChicken); + m_World->SpawnMob(a_HitPos.x, a_HitPos.y, a_HitPos.z, mtChicken); } else if (m_World->GetTickRandomNumber(32) == 1) { - m_World->SpawnMob(a_HitPos.x, a_HitPos.y, a_HitPos.z, cMonster::mtChicken); - m_World->SpawnMob(a_HitPos.x, a_HitPos.y, a_HitPos.z, cMonster::mtChicken); - m_World->SpawnMob(a_HitPos.x, a_HitPos.y, a_HitPos.z, cMonster::mtChicken); - m_World->SpawnMob(a_HitPos.x, a_HitPos.y, a_HitPos.z, cMonster::mtChicken); + m_World->SpawnMob(a_HitPos.x, a_HitPos.y, a_HitPos.z, mtChicken); + m_World->SpawnMob(a_HitPos.x, a_HitPos.y, a_HitPos.z, mtChicken); + m_World->SpawnMob(a_HitPos.x, a_HitPos.y, a_HitPos.z, mtChicken); + m_World->SpawnMob(a_HitPos.x, a_HitPos.y, a_HitPos.z, mtChicken); } } diff --git a/src/Entities/ThrownSnowballEntity.cpp b/src/Entities/ThrownSnowballEntity.cpp index d94e75898..496397100 100644 --- a/src/Entities/ThrownSnowballEntity.cpp +++ b/src/Entities/ThrownSnowballEntity.cpp @@ -32,8 +32,8 @@ void cThrownSnowballEntity::OnHitEntity(cEntity & a_EntityHit, const Vector3d & int TotalDamage = 0; if (a_EntityHit.IsMob()) { - cMonster::eType MobType = ((cMonster &) a_EntityHit).GetMobType(); - if (MobType == cMonster::mtBlaze) + eMonsterType MobType = ((cMonster &) a_EntityHit).GetMobType(); + if (MobType == mtBlaze) { TotalDamage = 3; } diff --git a/src/FastRandom.h b/src/FastRandom.h index 2061a3958..cebebad96 100644 --- a/src/FastRandom.h +++ b/src/FastRandom.h @@ -45,7 +45,7 @@ public: float NextFloat(float a_Range, int a_Salt); /** Returns a random float between 0 and 1. */ - float NextFloat(void) { return NextFloat(1); }; + float NextFloat(void) { return NextFloat(1); } /** Returns a random int in the range [a_Begin .. a_End] */ int GenerateRandomInteger(int a_Begin, int a_End); diff --git a/src/FurnaceRecipe.cpp b/src/FurnaceRecipe.cpp index ab772e97b..d200ef3d7 100644 --- a/src/FurnaceRecipe.cpp +++ b/src/FurnaceRecipe.cpp @@ -12,8 +12,8 @@ -typedef std::list< cFurnaceRecipe::Recipe > RecipeList; -typedef std::list< cFurnaceRecipe::Fuel > FuelList; +typedef std::list<cFurnaceRecipe::cRecipe> RecipeList; +typedef std::list<cFurnaceRecipe::cFuel> FuelList; @@ -30,7 +30,7 @@ struct cFurnaceRecipe::sFurnaceRecipeState cFurnaceRecipe::cFurnaceRecipe() - : m_pState( new sFurnaceRecipeState) + : m_pState(new sFurnaceRecipeState) { ReloadRecipes(); } @@ -68,12 +68,18 @@ void cFurnaceRecipe::ReloadRecipes(void) while (std::getline(f, ParsingLine)) { LineNum++; - ParsingLine.erase(std::remove_if(ParsingLine.begin(), ParsingLine.end(), isspace), ParsingLine.end()); // Remove ALL whitespace from the line if (ParsingLine.empty()) { continue; } + // Remove comments from the line: + size_t FirstCommentSymbol = ParsingLine.find('#'); + if ((FirstCommentSymbol != AString::npos) && (FirstCommentSymbol != 0)) + { + ParsingLine.erase(ParsingLine.begin() + (const long)FirstCommentSymbol, ParsingLine.end()); + } + switch (ParsingLine[0]) { case '#': @@ -103,159 +109,132 @@ void cFurnaceRecipe::ReloadRecipes(void) -void cFurnaceRecipe::AddFuelFromLine(const AString & a_Line, int a_LineNum) +void cFurnaceRecipe::AddFuelFromLine(const AString & a_Line, unsigned int a_LineNum) { - // Fuel - int IItemID = 0, IItemCount = 0, IItemHealth = 0, IBurnTime = 0; - AString::size_type BeginPos = 1; // Begin at one after exclamation mark (bang) - - if ( - !ReadMandatoryNumber(BeginPos, ":", a_Line, a_LineNum, IItemID) || // Read item ID - !ReadOptionalNumbers(BeginPos, ":", "=", a_Line, a_LineNum, IItemCount, IItemHealth) || // Read item count (and optionally health) - !ReadMandatoryNumber(BeginPos, "0123456789", a_Line, a_LineNum, IBurnTime, true) // Read item burn time - last value - ) + AString Line(a_Line); + Line.erase(Line.begin()); // Remove the beginning "!" + Line.erase(std::remove_if(Line.begin(), Line.end(), isspace), Line.end()); + + std::auto_ptr<cItem> Item(new cItem); + int BurnTime; + + const AStringVector & Sides = StringSplit(Line, "="); + if (Sides.size() != 2) { + LOGWARNING("furnace.txt: line %d: A single '=' was expected, got %d", a_LineNum, (int)Sides.size() - 1); + LOGINFO("Offending line: \"%s\"", a_Line.c_str()); return; } - // Add to fuel list: - Fuel F; - F.In = new cItem((ENUM_ITEM_ID)IItemID, (char)IItemCount, (short)IItemHealth); - F.BurnTime = IBurnTime; - m_pState->Fuel.push_back(F); -} - - - - + if (!ParseItem(Sides[0], *Item)) + { + LOGWARNING("furnace.txt: line %d: Cannot parse item \"%s\".", a_LineNum, Sides[0].c_str()); + LOGINFO("Offending line: \"%s\"", a_Line.c_str()); + return; + } -void cFurnaceRecipe::AddRecipeFromLine(const AString & a_Line, int a_LineNum) -{ - int IItemID = 0, IItemCount = 0, IItemHealth = 0, IBurnTime = 0; - int OItemID = 0, OItemCount = 0, OItemHealth = 0; - AString::size_type BeginPos = 0; // Begin at start of line - - if ( - !ReadMandatoryNumber(BeginPos, ":", a_Line, a_LineNum, IItemID) || // Read item ID - !ReadOptionalNumbers(BeginPos, ":", "@", a_Line, a_LineNum, IItemCount, IItemHealth) || // Read item count (and optionally health) - !ReadMandatoryNumber(BeginPos, "=", a_Line, a_LineNum, IBurnTime) || // Read item burn time - !ReadMandatoryNumber(BeginPos, ":", a_Line, a_LineNum, OItemID) || // Read result ID - !ReadOptionalNumbers(BeginPos, ":", "012456789", a_Line, a_LineNum, OItemCount, OItemHealth, true) // Read result count (and optionally health) - last value - ) + if (!StringToInteger<int>(Sides[1], BurnTime)) { + LOGWARNING("furnace.txt: line %d: Cannot parse burn time.", a_LineNum); + LOGINFO("Offending line: \"%s\"", a_Line.c_str()); return; } - // Add to recipe list - Recipe R; - R.In = new cItem((ENUM_ITEM_ID)IItemID, (char)IItemCount, (short)IItemHealth); - R.Out = new cItem((ENUM_ITEM_ID)OItemID, (char)OItemCount, (short)OItemHealth); - R.CookTime = IBurnTime; - m_pState->Recipes.push_back(R); + // Add to fuel list: + cFuel Fuel; + Fuel.In = Item.release(); + Fuel.BurnTime = BurnTime; + m_pState->Fuel.push_back(Fuel); } -void cFurnaceRecipe::PrintParseError(unsigned int a_Line, size_t a_Position, const AString & a_CharactersMissing) +void cFurnaceRecipe::AddRecipeFromLine(const AString & a_Line, unsigned int a_LineNum) { - LOGWARN("Error parsing furnace recipes at line %i pos " SIZE_T_FMT ": missing '%s'", a_Line, a_Position, a_CharactersMissing.c_str()); -} - - + AString Line(a_Line); + Line.erase(std::remove_if(Line.begin(), Line.end(), isspace), Line.end()); + int CookTime = 200; + std::auto_ptr<cItem> InputItem(new cItem()); + std::auto_ptr<cItem> OutputItem(new cItem()); + const AStringVector & Sides = StringSplit(Line, "="); + if (Sides.size() != 2) + { + LOGWARNING("furnace.txt: line %d: A single '=' was expected, got %d", a_LineNum, (int)Sides.size() - 1); + LOGINFO("Offending line: \"%s\"", a_Line.c_str()); + return; + } -bool cFurnaceRecipe::ReadMandatoryNumber(AString::size_type & a_Begin, const AString & a_Delimiter, const AString & a_Text, unsigned int a_Line, int & a_Value, bool a_IsLastValue) -{ - // TODO: replace atoi with std::stoi - AString::size_type End; - if (a_IsLastValue) + const AStringVector & InputSplit = StringSplit(Sides[0], "@"); + if (!ParseItem(InputSplit[0], *InputItem)) { - End = a_Text.find_first_not_of(a_Delimiter, a_Begin); + LOGWARNING("furnace.txt: line %d: Cannot parse input item \"%s\".", a_LineNum, InputSplit[0].c_str()); + LOGINFO("Offending line: \"%s\"", a_Line.c_str()); + return; } - else + + if (InputSplit.size() > 1) { - End = a_Text.find_first_of(a_Delimiter, a_Begin); - if (End == AString::npos) + if (!StringToInteger<int>(InputSplit[1], CookTime)) { - PrintParseError(a_Line, a_Begin, a_Delimiter); - return false; + LOGWARNING("furnace.txt: line %d: Cannot parse cook time \"%s\".", a_LineNum, InputSplit[1].c_str()); + LOGINFO("Offending line: \"%s\"", a_Line.c_str()); + return; } } - - // stoi won't throw an exception if the string is alphanumeric, we should check for this - if (!DoesStringContainOnlyNumbers(a_Text.substr(a_Begin, End - a_Begin))) + + if (!ParseItem(Sides[1], *OutputItem)) { - PrintParseError(a_Line, a_Begin, "number"); - return false; + LOGWARNING("furnace.txt: line %d: Cannot parse output item \"%s\".", a_LineNum, Sides[1].c_str()); + LOGINFO("Offending line: \"%s\"", a_Line.c_str()); + return; } - a_Value = atoi(a_Text.substr(a_Begin, End - a_Begin).c_str()); - a_Begin = End + 1; // Jump over delimiter - return true; + cRecipe Recipe; + Recipe.In = InputItem.release(); + Recipe.Out = OutputItem.release(); + Recipe.CookTime = CookTime; + m_pState->Recipes.push_back(Recipe); } -bool cFurnaceRecipe::ReadOptionalNumbers(AString::size_type & a_Begin, const AString & a_DelimiterOne, const AString & a_DelimiterTwo, const AString & a_Text, unsigned int a_Line, int & a_ValueOne, int & a_ValueTwo, bool a_IsLastValue) +bool cFurnaceRecipe::ParseItem(const AString & a_String, cItem & a_Item) { - // TODO: replace atoi with std::stoi - AString::size_type End, Begin = a_Begin; + AString ItemString = a_String; + + const AStringVector & SplitAmount = StringSplit(ItemString, ","); + ItemString = SplitAmount[0]; - End = a_Text.find_first_of(a_DelimiterOne, Begin); - if (End != AString::npos) - { - if (DoesStringContainOnlyNumbers(a_Text.substr(Begin, End - Begin))) - { - a_ValueOne = std::atoi(a_Text.substr(Begin, End - Begin).c_str()); - Begin = End + 1; + const AStringVector & SplitMeta = StringSplit(ItemString, ":"); + ItemString = SplitMeta[0]; - if (a_IsLastValue) - { - End = a_Text.find_first_not_of(a_DelimiterTwo, Begin); - } - else - { - End = a_Text.find_first_of(a_DelimiterTwo, Begin); - if (End == AString::npos) - { - PrintParseError(a_Line, Begin, a_DelimiterTwo); - return false; - } - } - - // stoi won't throw an exception if the string is alphanumeric, we should check for this - if (!DoesStringContainOnlyNumbers(a_Text.substr(Begin, End - Begin))) - { - PrintParseError(a_Line, Begin, "number"); - return false; - } - a_ValueTwo = atoi(a_Text.substr(Begin, End - Begin).c_str()); + if (!StringToItem(ItemString, a_Item)) + { + return false; + } - a_Begin = End + 1; // Jump over delimiter - return true; - } - else + if (SplitAmount.size() > 1) + { + if (!StringToInteger<char>(SplitAmount[1].c_str(), a_Item.m_ItemCount)) { - return ReadMandatoryNumber(a_Begin, a_DelimiterTwo, a_Text, a_Line, a_ValueOne, a_IsLastValue); + return false; } } - - return ReadMandatoryNumber(a_Begin, a_DelimiterTwo, a_Text, a_Line, a_ValueOne, a_IsLastValue); -} - - - - -bool cFurnaceRecipe::DoesStringContainOnlyNumbers(const AString & a_String) -{ - // TODO: replace this with std::all_of(a_String.begin(), a_String.end(), isdigit) - return (a_String.find_first_not_of("0123456789") == AString::npos); + if (SplitMeta.size() > 1) + { + if (!StringToInteger<short>(SplitMeta[1].c_str(), a_Item.m_ItemDamage)) + { + return false; + } + } + return true; } @@ -266,19 +245,19 @@ void cFurnaceRecipe::ClearRecipes(void) { for (RecipeList::iterator itr = m_pState->Recipes.begin(); itr != m_pState->Recipes.end(); ++itr) { - Recipe R = *itr; - delete R.In; - R.In = NULL; - delete R.Out; - R.Out = NULL; + cRecipe Recipe = *itr; + delete Recipe.In; + Recipe.In = NULL; + delete Recipe.Out; + Recipe.Out = NULL; } m_pState->Recipes.clear(); for (FuelList::iterator itr = m_pState->Fuel.begin(); itr != m_pState->Fuel.end(); ++itr) { - Fuel F = *itr; - delete F.In; - F.In = NULL; + cFuel Fuel = *itr; + delete Fuel.In; + Fuel.In = NULL; } m_pState->Fuel.clear(); } @@ -287,21 +266,21 @@ void cFurnaceRecipe::ClearRecipes(void) -const cFurnaceRecipe::Recipe * cFurnaceRecipe::GetRecipeFrom(const cItem & a_Ingredient) const +const cFurnaceRecipe::cRecipe * cFurnaceRecipe::GetRecipeFrom(const cItem & a_Ingredient) const { - const Recipe * BestRecipe = 0; + const cRecipe * BestRecipe = 0; for (RecipeList::const_iterator itr = m_pState->Recipes.begin(); itr != m_pState->Recipes.end(); ++itr) { - const Recipe & R = *itr; - if ((R.In->m_ItemType == a_Ingredient.m_ItemType) && (R.In->m_ItemCount <= a_Ingredient.m_ItemCount)) + const cRecipe & Recipe = *itr; + if ((Recipe.In->m_ItemType == a_Ingredient.m_ItemType) && (Recipe.In->m_ItemCount <= a_Ingredient.m_ItemCount)) { - if (BestRecipe && (BestRecipe->In->m_ItemCount > R.In->m_ItemCount)) + if (BestRecipe && (BestRecipe->In->m_ItemCount > Recipe.In->m_ItemCount)) { continue; } else { - BestRecipe = &R; + BestRecipe = &Recipe; } } } @@ -317,16 +296,16 @@ int cFurnaceRecipe::GetBurnTime(const cItem & a_Fuel) const int BestFuel = 0; for (FuelList::const_iterator itr = m_pState->Fuel.begin(); itr != m_pState->Fuel.end(); ++itr) { - const Fuel & F = *itr; - if ((F.In->m_ItemType == a_Fuel.m_ItemType) && (F.In->m_ItemCount <= a_Fuel.m_ItemCount)) + const cFuel & Fuel = *itr; + if ((Fuel.In->m_ItemType == a_Fuel.m_ItemType) && (Fuel.In->m_ItemCount <= a_Fuel.m_ItemCount)) { - if (BestFuel > 0 && (BestFuel > F.BurnTime)) + if (BestFuel > 0 && (BestFuel > Fuel.BurnTime)) { continue; } else { - BestFuel = F.BurnTime; + BestFuel = Fuel.BurnTime; } } } diff --git a/src/FurnaceRecipe.h b/src/FurnaceRecipe.h index 77ed35a57..6a1650695 100644 --- a/src/FurnaceRecipe.h +++ b/src/FurnaceRecipe.h @@ -19,23 +19,23 @@ public: void ReloadRecipes(void); - struct Fuel + struct cFuel { cItem * In; int BurnTime; ///< How long this fuel burns, in ticks }; - struct Recipe + struct cRecipe { cItem * In; cItem * Out; int CookTime; ///< How long this recipe takes to smelt, in ticks }; - /// Returns a recipe for the specified input, NULL if no recipe found - const Recipe * GetRecipeFrom(const cItem & a_Ingredient) const; + /** Returns a recipe for the specified input, NULL if no recipe found */ + const cRecipe * GetRecipeFrom(const cItem & a_Ingredient) const; - /// Returns the amount of time that the specified fuel burns, in ticks + /** Returns the amount of time that the specified fuel burns, in ticks */ int GetBurnTime(const cItem & a_Fuel) const; private: @@ -43,33 +43,14 @@ private: /** Parses the fuel contained in the line, adds it to m_pState's fuels. Logs a warning to the console on input error. */ - void AddFuelFromLine(const AString & a_Line, int a_LineNum); + void AddFuelFromLine(const AString & a_Line, unsigned int a_LineNum); /** Parses the recipe contained in the line, adds it to m_pState's recipes. Logs a warning to the console on input error. */ - void AddRecipeFromLine(const AString & a_Line, int a_LineNum); - - /** Calls LOGWARN with the line, position, and error */ - static void PrintParseError(unsigned int a_Line, size_t a_Position, const AString & a_CharactersMissing); - - /** Reads a number from a string given, starting at a given position and ending at a delimiter given - Updates beginning position to the delimiter found + 1, and updates the value to the one read - If it encounters a substring that is not fully numeric, it will call SetParseError() and return false; the caller should abort processing - Otherwise, the function will return true - */ - static bool ReadMandatoryNumber(AString::size_type & a_Begin, const AString & a_Delimiter, const AString & a_Text, unsigned int a_Line, int & a_Value, bool a_IsLastValue = false); - - /** Reads two numbers from a string given, starting at a given position and ending at the first delimiter given, then again (with an updated position) until the second delimiter given - Updates beginning position to the second delimiter found + 1, and updates the values to the ones read - If it encounters a substring that is not fully numeric whilst reading the second value, it will call SetParseError() and return false; the caller should abort processing - If this happens whilst reading the first value, it will call ReadMandatoryNumber() with the appropriate position, as this may legitimately occur with the optional value and AString::find_first_of finding the incorrect delimiter. It will return the result of ReadMandatoryNumber() - True will be returned definitively for an optional value that is valid - */ - static bool ReadOptionalNumbers(AString::size_type & a_Begin, const AString & a_DelimiterOne, const AString & a_DelimiterTwo, const AString & a_Text, unsigned int a_Line, int & a_ValueOne, int & a_ValueTwo, bool a_IsLastValue = false); - - /** Uses std::all_of to determine if a string contains only digits */ - static bool DoesStringContainOnlyNumbers(const AString & a_String); + void AddRecipeFromLine(const AString & a_Line, unsigned int a_LineNum); + /** Parses an item string in the format "<ItemType>[: <Damage>][, <Amount>]", returns true if successful. */ + bool ParseItem(const AString & a_String, cItem & a_Item); struct sFurnaceRecipeState; sFurnaceRecipeState * m_pState; diff --git a/src/Generating/BioGen.cpp b/src/Generating/BioGen.cpp index 8fad9f5c9..8924a7999 100644 --- a/src/Generating/BioGen.cpp +++ b/src/Generating/BioGen.cpp @@ -13,72 +13,6 @@ //////////////////////////////////////////////////////////////////////////////// -// cBiomeGen: - -cBiomeGen * cBiomeGen::CreateBiomeGen(cIniFile & a_IniFile, int a_Seed, bool & a_CacheOffByDefault) -{ - AString BiomeGenName = a_IniFile.GetValueSet("Generator", "BiomeGen", ""); - if (BiomeGenName.empty()) - { - LOGWARN("[Generator] BiomeGen value not set in world.ini, using \"MultiStepMap\"."); - BiomeGenName = "MultiStepMap"; - } - - cBiomeGen * res = NULL; - a_CacheOffByDefault = false; - if (NoCaseCompare(BiomeGenName, "constant") == 0) - { - res = new cBioGenConstant; - a_CacheOffByDefault = true; // we're generating faster than a cache would retrieve data :) - } - else if (NoCaseCompare(BiomeGenName, "checkerboard") == 0) - { - res = new cBioGenCheckerboard; - a_CacheOffByDefault = true; // we're (probably) generating faster than a cache would retrieve data - } - else if (NoCaseCompare(BiomeGenName, "voronoi") == 0) - { - res = new cBioGenVoronoi(a_Seed); - } - else if (NoCaseCompare(BiomeGenName, "distortedvoronoi") == 0) - { - res = new cBioGenDistortedVoronoi(a_Seed); - } - else if (NoCaseCompare(BiomeGenName, "twolevel") == 0) - { - res = new cBioGenTwoLevel(a_Seed); - } - else - { - if (NoCaseCompare(BiomeGenName, "multistepmap") != 0) - { - LOGWARNING("Unknown BiomeGen \"%s\", using \"MultiStepMap\" instead.", BiomeGenName.c_str()); - } - res = new cBioGenMultiStepMap(a_Seed); - - /* - // Performance-testing: - LOGINFO("Measuring performance of cBioGenMultiStepMap..."); - clock_t BeginTick = clock(); - for (int x = 0; x < 5000; x++) - { - cChunkDef::BiomeMap Biomes; - res->GenBiomes(x * 5, x * 5, Biomes); - } - clock_t Duration = clock() - BeginTick; - LOGINFO("cBioGenMultiStepMap for 5000 chunks took %d ticks (%.02f sec)", Duration, (double)Duration / CLOCKS_PER_SEC); - //*/ - } - res->InitializeBiomeGen(a_IniFile); - - return res; -} - - - - - -//////////////////////////////////////////////////////////////////////////////// // cBioGenConstant: void cBioGenConstant::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a_BiomeMap) @@ -151,7 +85,7 @@ void cBioGenCache::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a LOGD("BioGenCache: %d hits, %d misses, saved %.2f %%", m_NumHits, m_NumMisses, 100.0 * m_NumHits / (m_NumHits + m_NumMisses)); LOGD("BioGenCache: Avg cache chain length: %.2f", (float)m_TotalChain / m_NumHits); } - + for (int i = 0; i < m_CacheSize; i++) { if ( @@ -208,6 +142,59 @@ void cBioGenCache::InitializeBiomeGen(cIniFile & a_IniFile) +//////////////////////////////////////////////////////////////////////////////// +// cBioGenMulticache: + +cBioGenMulticache::cBioGenMulticache(cBiomeGen * a_BioGenToCache, size_t a_CacheSize, size_t a_CachesLength) : + m_CachesLength(a_CachesLength) +{ + m_Caches.reserve(a_CachesLength); + for (size_t i = 0; i < a_CachesLength; i++) + { + m_Caches.push_back(new cBioGenCache(a_BioGenToCache, a_CacheSize)); + } +} + + + + + +cBioGenMulticache::~cBioGenMulticache() +{ + for (cBiomeGens::iterator it = m_Caches.begin(); it != m_Caches.end(); it++) + { + delete *it; + } +} + + + + + +void cBioGenMulticache::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a_BiomeMap) +{ + const size_t coefficient = 3; + const size_t cacheIdx = ((size_t)a_ChunkX + coefficient * (size_t)a_ChunkZ) % m_CachesLength; + + m_Caches[cacheIdx]->GenBiomes(a_ChunkX, a_ChunkZ, a_BiomeMap); +} + + + + + +void cBioGenMulticache::InitializeBiomeGen(cIniFile & a_IniFile) +{ + for (cBiomeGens::iterator it = m_Caches.begin(); it != m_Caches.end(); it++) + { + cBiomeGen * tmp = *it; + tmp->InitializeBiomeGen(a_IniFile); + } +} + + + + //////////////////////////////////////////////////////////////////////////////// // cBiomeGenList: @@ -349,8 +336,13 @@ void cBioGenVoronoi::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & void cBioGenVoronoi::InitializeBiomeGen(cIniFile & a_IniFile) { super::InitializeBiomeGen(a_IniFile); - m_Voronoi.SetCellSize(a_IniFile.GetValueSetI("Generator", "VoronoiCellSize", 64)); - InitializeBiomes (a_IniFile.GetValueSet ("Generator", "VoronoiBiomes", "")); + int CellSize = a_IniFile.GetValueSetI("Generator", "VoronoiCellSize", 128); + int JitterSize = a_IniFile.GetValueSetI("Generator", "VoronoiJitterSize", CellSize); + int OddRowOffset = a_IniFile.GetValueSetI("Generator", "VoronoiOddRowOffset", 0); + m_Voronoi.SetCellSize(CellSize); + m_Voronoi.SetJitterSize(JitterSize); + m_Voronoi.SetOddRowOffset(OddRowOffset); + InitializeBiomes(a_IniFile.GetValueSet ("Generator", "VoronoiBiomes", "")); } @@ -745,8 +737,6 @@ void cBioGenMultiStepMap::FreezeWaterBiomes(cChunkDef::BiomeMap & a_BiomeMap, co cBioGenTwoLevel::cBioGenTwoLevel(int a_Seed) : m_VoronoiLarge(a_Seed + 1000), m_VoronoiSmall(a_Seed + 2000), - m_DistortX(a_Seed + 3000), - m_DistortZ(a_Seed + 4000), m_Noise1(a_Seed + 5001), m_Noise2(a_Seed + 5002), m_Noise3(a_Seed + 5003), @@ -770,19 +760,17 @@ void cBioGenTwoLevel::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap int DistortZ[cChunkDef::Width + 1][cChunkDef::Width + 1]; for (int x = 0; x <= 4; x++) for (int z = 0; z <= 4; z++) { - int BlockX = BaseX + x * 4; - int BlockZ = BaseZ + z * 4; - float BlockXF = (float)(16 * BlockX) / 128; - float BlockZF = (float)(16 * BlockZ) / 128; - double NoiseX = m_Noise1.CubicNoise2D(BlockXF / 16, BlockZF / 16); - NoiseX += 0.5 * m_Noise2.CubicNoise2D(BlockXF / 8, BlockZF / 8); - NoiseX += 0.08 * m_Noise3.CubicNoise2D(BlockXF, BlockZF); - double NoiseZ = m_Noise4.CubicNoise2D(BlockXF / 16, BlockZF / 16); - NoiseZ += 0.5 * m_Noise5.CubicNoise2D(BlockXF / 8, BlockZF / 8); - NoiseZ += 0.08 * m_Noise6.CubicNoise2D(BlockXF, BlockZF); + float BlockX = BaseX + x * 4; + float BlockZ = BaseZ + z * 4; + double NoiseX = m_AmpX1 * m_Noise1.CubicNoise2D(BlockX * m_FreqX1, BlockZ * m_FreqX1); + NoiseX += m_AmpX2 * m_Noise2.CubicNoise2D(BlockX * m_FreqX2, BlockZ * m_FreqX2); + NoiseX += m_AmpX3 * m_Noise3.CubicNoise2D(BlockX * m_FreqX3, BlockZ * m_FreqX3); + double NoiseZ = m_AmpZ1 * m_Noise4.CubicNoise2D(BlockX * m_FreqZ1, BlockZ * m_FreqZ1); + NoiseZ += m_AmpZ2 * m_Noise5.CubicNoise2D(BlockX * m_FreqZ2, BlockZ * m_FreqZ2); + NoiseZ += m_AmpZ3 * m_Noise6.CubicNoise2D(BlockX * m_FreqZ3, BlockZ * m_FreqZ3); - DistortX[4 * x][4 * z] = BlockX + (int)(64 * NoiseX); - DistortZ[4 * x][4 * z] = BlockZ + (int)(64 * NoiseZ); + DistortX[4 * x][4 * z] = (int)(BlockX + NoiseX); + DistortZ[4 * x][4 * z] = (int)(BlockZ + NoiseZ); } LinearUpscale2DArrayInPlace<cChunkDef::Width + 1, cChunkDef::Width + 1, 4, 4>(&DistortX[0][0]); @@ -793,9 +781,10 @@ void cBioGenTwoLevel::GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap { for (int x = 0; x < cChunkDef::Width; x++) { - int MinDist1, MinDist2; - int BiomeGroup = m_VoronoiLarge.GetValueAt(DistortX[x][z], DistortZ[x][z], MinDist1, MinDist2) / 7; - int BiomeIdx = m_VoronoiSmall.GetValueAt(DistortX[x][z], DistortZ[x][z], MinDist1, MinDist2) / 11; + int SeedX, SeedZ, MinDist2; + int BiomeGroup = m_VoronoiLarge.GetValueAt(DistortX[x][z], DistortZ[x][z], SeedX, SeedZ, MinDist2) / 7; + int BiomeIdx = m_VoronoiSmall.GetValueAt(DistortX[x][z], DistortZ[x][z], SeedX, SeedZ, MinDist2) / 11; + int MinDist1 = (DistortX[x][z] - SeedX) * (DistortX[x][z] - SeedX) + (DistortZ[x][z] - SeedZ) * (DistortZ[x][z] - SeedZ); cChunkDef::SetBiome(a_BiomeMap, x, z, SelectBiome(BiomeGroup, BiomeIdx, (MinDist1 < MinDist2 / 4) ? 0 : 1)); } } @@ -920,15 +909,86 @@ EMCSBiome cBioGenTwoLevel::SelectBiome(int a_BiomeGroup, int a_BiomeIdx, int a_D void cBioGenTwoLevel::InitializeBiomeGen(cIniFile & a_IniFile) { - // TODO: Read these from a file - m_VoronoiLarge.SetCellSize(1024); - m_VoronoiSmall.SetCellSize(128); - m_DistortX.AddOctave(0.01f, 16); - m_DistortX.AddOctave(0.005f, 8); - m_DistortX.AddOctave(0.0025f, 4); - m_DistortZ.AddOctave(0.01f, 16); - m_DistortZ.AddOctave(0.005f, 8); - m_DistortZ.AddOctave(0.0025f, 4); + m_VoronoiLarge.SetCellSize(a_IniFile.GetValueSetI("Generator", "TwoLevelLargeCellSize", 1024)); + m_VoronoiSmall.SetCellSize(a_IniFile.GetValueSetI("Generator", "TwoLevelSmallCellSize", 128)); + m_FreqX1 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortXOctave1Freq", 0.01); + m_AmpX1 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortXOctave1Amp", 80); + m_FreqX2 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortXOctave2Freq", 0.05); + m_AmpX2 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortXOctave2Amp", 20); + m_FreqX3 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortXOctave3Freq", 0.1), + m_AmpX3 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortXOctave3Amp", 8); + m_FreqZ1 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortZOctave1Freq", 0.01); + m_AmpZ1 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortZOctave1Amp", 80); + m_FreqZ2 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortZOctave2Freq", 0.05); + m_AmpZ2 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortZOctave2Amp", 20); + m_FreqZ3 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortZOctave3Freq", 0.1); + m_AmpZ3 = (float)a_IniFile.GetValueSetF("Generator", "TwoLevelDistortZOctave3Amp", 8); +} + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cBiomeGen: + +cBiomeGen * cBiomeGen::CreateBiomeGen(cIniFile & a_IniFile, int a_Seed, bool & a_CacheOffByDefault) +{ + AString BiomeGenName = a_IniFile.GetValueSet("Generator", "BiomeGen", ""); + if (BiomeGenName.empty()) + { + LOGWARN("[Generator] BiomeGen value not set in world.ini, using \"MultiStepMap\"."); + BiomeGenName = "MultiStepMap"; + } + + cBiomeGen * res = NULL; + a_CacheOffByDefault = false; + if (NoCaseCompare(BiomeGenName, "constant") == 0) + { + res = new cBioGenConstant; + a_CacheOffByDefault = true; // we're generating faster than a cache would retrieve data :) + } + else if (NoCaseCompare(BiomeGenName, "checkerboard") == 0) + { + res = new cBioGenCheckerboard; + a_CacheOffByDefault = true; // we're (probably) generating faster than a cache would retrieve data + } + else if (NoCaseCompare(BiomeGenName, "voronoi") == 0) + { + res = new cBioGenVoronoi(a_Seed); + } + else if (NoCaseCompare(BiomeGenName, "distortedvoronoi") == 0) + { + res = new cBioGenDistortedVoronoi(a_Seed); + } + else if (NoCaseCompare(BiomeGenName, "twolevel") == 0) + { + res = new cBioGenTwoLevel(a_Seed); + } + else + { + if (NoCaseCompare(BiomeGenName, "multistepmap") != 0) + { + LOGWARNING("Unknown BiomeGen \"%s\", using \"MultiStepMap\" instead.", BiomeGenName.c_str()); + } + res = new cBioGenMultiStepMap(a_Seed); + + /* + // Performance-testing: + LOGINFO("Measuring performance of cBioGenMultiStepMap..."); + clock_t BeginTick = clock(); + for (int x = 0; x < 5000; x++) + { + cChunkDef::BiomeMap Biomes; + res->GenBiomes(x * 5, x * 5, Biomes); + } + clock_t Duration = clock() - BeginTick; + LOGINFO("cBioGenMultiStepMap for 5000 chunks took %d ticks (%.02f sec)", Duration, (double)Duration / CLOCKS_PER_SEC); + //*/ + } + res->InitializeBiomeGen(a_IniFile); + + return res; } diff --git a/src/Generating/BioGen.h b/src/Generating/BioGen.h index 227ec97d7..22ddfae5c 100644 --- a/src/Generating/BioGen.h +++ b/src/Generating/BioGen.h @@ -80,6 +80,36 @@ protected: +class cBioGenMulticache : + public cBiomeGen +{ + + typedef cBiomeGen super; + +public: + /* + a_CacheSize defines the size of each singular cache + a_CachesLength defines how many caches are used for the multicache + */ + cBioGenMulticache(cBiomeGen * a_BioGenToCache, size_t a_CacheSize, size_t a_CachesLength); // Doesn't take ownership of a_BioGenToCache + ~cBioGenMulticache(); + +protected: + typedef std::vector<cBiomeGen *> cBiomeGens; + + + size_t m_CachesLength; + cBiomeGens m_Caches; + + + virtual void GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a_BiomeMap) override; + virtual void InitializeBiomeGen(cIniFile & a_IniFile) override; +}; + + + + + /// Base class for generators that use a list of available biomes. This class takes care of the list. class cBiomeGenList : public cBiomeGen @@ -255,12 +285,7 @@ protected: /// The Voronoi map that decides biomes inside individual biome groups cVoronoiMap m_VoronoiSmall; - /// The noise used to distort the input X coord - cPerlinNoise m_DistortX; - - /// The noise used to distort the inupt Z coord - cPerlinNoise m_DistortZ; - + // The noises used for the distortion: cNoise m_Noise1; cNoise m_Noise2; cNoise m_Noise3; @@ -268,6 +293,14 @@ protected: cNoise m_Noise5; cNoise m_Noise6; + // Frequencies and amplitudes for the distortion noises: + float m_FreqX1, m_AmpX1; + float m_FreqX2, m_AmpX2; + float m_FreqX3, m_AmpX3; + float m_FreqZ1, m_AmpZ1; + float m_FreqZ2, m_AmpZ2; + float m_FreqZ3, m_AmpZ3; + // cBiomeGen overrides: virtual void GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a_BiomeMap) override; diff --git a/src/Generating/CMakeLists.txt b/src/Generating/CMakeLists.txt index 58df9d421..33d622b42 100644 --- a/src/Generating/CMakeLists.txt +++ b/src/Generating/CMakeLists.txt @@ -12,6 +12,7 @@ SET (SRCS CompoGen.cpp ComposableGenerator.cpp DistortedHeightmap.cpp + DungeonRoomsFinisher.cpp EndGen.cpp FinishGen.cpp GridStructGen.cpp @@ -40,6 +41,7 @@ SET (HDRS CompoGen.h ComposableGenerator.h DistortedHeightmap.h + DungeonRoomsFinisher.h EndGen.h FinishGen.h GridStructGen.h diff --git a/src/Generating/Caves.cpp b/src/Generating/Caves.cpp index 3b71efb57..fc925a150 100644 --- a/src/Generating/Caves.cpp +++ b/src/Generating/Caves.cpp @@ -166,6 +166,9 @@ cCaveTunnel::cCaveTunnel( if ((a_BlockStartY <= 0) && (a_BlockEndY <= 0)) { // Don't bother detailing this cave, it's under the world anyway + m_MinBlockX = m_MaxBlockX = 0; + m_MinBlockY = m_MaxBlockY = -1; + m_MinBlockZ = m_MaxBlockZ = 0; return; } @@ -497,29 +500,9 @@ void cCaveTunnel::ProcessChunk( int SqDist = (DifX - x) * (DifX - x) + (DifY - y) * (DifY - y) + (DifZ - z) * (DifZ - z); if (4 * SqDist <= SqRad) { - switch (cChunkDef::GetBlock(a_BlockTypes, x, y, z)) + if (cBlockInfo::CanBeTerraformed(cChunkDef::GetBlock(a_BlockTypes, x, y, z))) { - // Only carve out these specific block types - case E_BLOCK_DIRT: - case E_BLOCK_GRASS: - case E_BLOCK_STONE: - case E_BLOCK_COBBLESTONE: - case E_BLOCK_GRAVEL: - case E_BLOCK_SAND: - case E_BLOCK_SANDSTONE: - case E_BLOCK_SOULSAND: - case E_BLOCK_NETHERRACK: - case E_BLOCK_COAL_ORE: - case E_BLOCK_IRON_ORE: - case E_BLOCK_GOLD_ORE: - case E_BLOCK_DIAMOND_ORE: - case E_BLOCK_REDSTONE_ORE: - case E_BLOCK_REDSTONE_ORE_GLOWING: - { - cChunkDef::SetBlock(a_BlockTypes, x, y, z, E_BLOCK_AIR); - break; - } - default: break; + cChunkDef::SetBlock(a_BlockTypes, x, y, z, E_BLOCK_AIR); } } } // for y @@ -772,7 +755,7 @@ void cStructGenDualRidgeCaves::GenFinish(cChunkDesc & a_ChunkDesc) float n2 = m_Noise2.CubicNoise3D(xx, yy, zz); float n3 = m_Noise1.CubicNoise3D(xx * 4, yy * 4, zz * 4) / 4; float n4 = m_Noise2.CubicNoise3D(xx * 4, yy * 4, zz * 4) / 4; - if ((abs(n1 + n3) * abs(n2 + n4)) > m_Threshold) + if ((std::abs(n1 + n3) * std::abs(n2 + n4)) > m_Threshold) { a_ChunkDesc.SetBlockType(x, y, z, E_BLOCK_AIR); } diff --git a/src/Generating/ChunkGenerator.cpp b/src/Generating/ChunkGenerator.cpp index 3d5af152c..d615456c1 100644 --- a/src/Generating/ChunkGenerator.cpp +++ b/src/Generating/ChunkGenerator.cpp @@ -27,6 +27,7 @@ const unsigned int QUEUE_SKIP_LIMIT = 500; cChunkGenerator::cChunkGenerator(void) : super("cChunkGenerator"), + m_Seed(0), // Will be overwritten by the actual generator m_Generator(NULL), m_PluginInterface(NULL), m_ChunkSink(NULL) @@ -51,10 +52,21 @@ bool cChunkGenerator::Start(cPluginInterface & a_PluginInterface, cChunkSink & a m_PluginInterface = &a_PluginInterface; m_ChunkSink = &a_ChunkSink; - MTRand rnd; - m_Seed = a_IniFile.GetValueSetI("Seed", "Seed", (int)rnd.randInt()); + // Get the seed; create a new one and log it if not found in the INI file: + if (a_IniFile.HasValue("Seed", "Seed")) + { + m_Seed = a_IniFile.GetValueI("Seed", "Seed"); + } + else + { + MTRand rnd; + m_Seed = rnd.randInt(); + LOGINFO("Chosen a new random seed for world: %d", m_Seed); + a_IniFile.SetValueI("Seed", "Seed", m_Seed); + } + + // Get the generator engine based on the INI file settings: AString GeneratorName = a_IniFile.GetValueSet("Generator", "Generator", "Composable"); - if (NoCaseCompare(GeneratorName, "Noise3D") == 0) { m_Generator = new cNoise3DGenerator(*this); @@ -98,15 +110,17 @@ void cChunkGenerator::Stop(void) -void cChunkGenerator::QueueGenerateChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +void cChunkGenerator::QueueGenerateChunk(int a_ChunkX, int a_ChunkZ, bool a_ForceGenerate) { + ASSERT(m_ChunkSink->IsChunkQueued(a_ChunkX, a_ChunkZ)); + { cCSLock Lock(m_CS); // Check if it is already in the queue: - for (cChunkCoordsList::iterator itr = m_Queue.begin(); itr != m_Queue.end(); ++itr) + for (cChunkCoordsWithBoolList::iterator itr = m_Queue.begin(); itr != m_Queue.end(); ++itr) { - if ((itr->m_ChunkX == a_ChunkX) && (itr->m_ChunkY == a_ChunkY) && (itr->m_ChunkZ == a_ChunkZ)) + if ((itr->m_ChunkX == a_ChunkX) && (itr->m_ChunkZ == a_ChunkZ)) { // Already in the queue, bail out return; @@ -118,7 +132,7 @@ void cChunkGenerator::QueueGenerateChunk(int a_ChunkX, int a_ChunkY, int a_Chunk { LOGWARN("WARNING: Adding chunk [%i, %i] to generation queue; Queue is too big! (" SIZE_T_FMT ")", a_ChunkX, a_ChunkZ, m_Queue.size()); } - m_Queue.push_back(cChunkCoords(a_ChunkX, a_ChunkY, a_ChunkZ)); + m_Queue.push_back(cChunkCoordsWithBool(a_ChunkX, a_ChunkZ, a_ForceGenerate)); } m_Event.Set(); @@ -228,9 +242,9 @@ void cChunkGenerator::Execute(void) continue; } - cChunkCoords coords = m_Queue.front(); // Get next coord from queue - m_Queue.erase( m_Queue.begin()); // Remove coordinate from queue + cChunkCoordsWithBool coords = m_Queue.front(); // Get next coord from queue bool SkipEnabled = (m_Queue.size() > QUEUE_SKIP_LIMIT); + m_Queue.erase(m_Queue.begin()); // Remove coordinate from queue Lock.Unlock(); // Unlock ASAP m_evtRemoved.Set(); @@ -244,8 +258,7 @@ void cChunkGenerator::Execute(void) LastReportTick = clock(); } - // Hack for regenerating chunks: if Y != 0, the chunk is considered invalid, even if it has its data set - if ((coords.m_ChunkY == 0) && m_ChunkSink->IsChunkValid(coords.m_ChunkX, coords.m_ChunkZ)) + if (!coords.m_ForceGenerate && m_ChunkSink->IsChunkValid(coords.m_ChunkX, coords.m_ChunkZ)) { LOGD("Chunk [%d, %d] already generated, skipping generation", coords.m_ChunkX, coords.m_ChunkZ); // Already generated, ignore request @@ -258,8 +271,8 @@ void cChunkGenerator::Execute(void) continue; } - LOGD("Generating chunk [%d, %d, %d]", coords.m_ChunkX, coords.m_ChunkY, coords.m_ChunkZ); - DoGenerate(coords.m_ChunkX, coords.m_ChunkY, coords.m_ChunkZ); + LOGD("Generating chunk [%d, %d]", coords.m_ChunkX, coords.m_ChunkZ); + DoGenerate(coords.m_ChunkX, coords.m_ChunkZ); NumChunksGenerated++; } // while (!bStop) @@ -268,11 +281,12 @@ void cChunkGenerator::Execute(void) -void cChunkGenerator::DoGenerate(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +void cChunkGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ) { ASSERT(m_PluginInterface != NULL); ASSERT(m_ChunkSink != NULL); - + ASSERT(m_ChunkSink->IsChunkQueued(a_ChunkX, a_ChunkZ)); + cChunkDesc ChunkDesc(a_ChunkX, a_ChunkZ); m_PluginInterface->CallHookChunkGenerating(ChunkDesc); m_Generator->DoGenerate(a_ChunkX, a_ChunkZ, ChunkDesc); diff --git a/src/Generating/ChunkGenerator.h b/src/Generating/ChunkGenerator.h index 88d71f3f9..190d9e616 100644 --- a/src/Generating/ChunkGenerator.h +++ b/src/Generating/ChunkGenerator.h @@ -106,6 +106,10 @@ public: If this callback returns false, the chunk is not generated. */ virtual bool HasChunkAnyClients(int a_ChunkX, int a_ChunkZ) = 0; + + /** Called to check whether the specified chunk is in the queued state. + Currently used only in Debug-mode asserts. */ + virtual bool IsChunkQueued(int a_ChunkX, int a_ChunkZ) = 0; } ; @@ -116,7 +120,7 @@ public: void Stop(void); /// Queues the chunk for generation; removes duplicate requests - void QueueGenerateChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ); + void QueueGenerateChunk(int a_ChunkX, int a_ChunkZ, bool a_ForceGenerate); /// Generates the biomes for the specified chunk (directly, not in a separate thread). Used by the world loader if biomes failed loading. void GenerateBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a_BiomeMap); @@ -137,10 +141,10 @@ private: int m_Seed; - cCriticalSection m_CS; - cChunkCoordsList m_Queue; - cEvent m_Event; ///< Set when an item is added to the queue or the thread should terminate - cEvent m_evtRemoved; ///< Set when an item is removed from the queue + cCriticalSection m_CS; + cChunkCoordsWithBoolList m_Queue; + cEvent m_Event; ///< Set when an item is added to the queue or the thread should terminate + cEvent m_evtRemoved; ///< Set when an item is removed from the queue cGenerator * m_Generator; ///< The actual generator engine used to generate chunks @@ -154,7 +158,7 @@ private: // cIsThread override: virtual void Execute(void) override; - void DoGenerate(int a_ChunkX, int a_ChunkY, int a_ChunkZ); + void DoGenerate(int a_ChunkX, int a_ChunkZ); }; diff --git a/src/Generating/ComposableGenerator.cpp b/src/Generating/ComposableGenerator.cpp index a7659149a..87461b944 100644 --- a/src/Generating/ComposableGenerator.cpp +++ b/src/Generating/ComposableGenerator.cpp @@ -19,6 +19,7 @@ #include "Caves.h" #include "DistortedHeightmap.h" +#include "DungeonRoomsFinisher.h" #include "EndGen.h" #include "MineShafts.h" #include "NetherFortGen.h" @@ -229,17 +230,29 @@ void cComposableGenerator::InitBiomeGen(cIniFile & a_IniFile) // Add a cache, if requested: int CacheSize = a_IniFile.GetValueSetI("Generator", "BiomeGenCacheSize", CacheOffByDefault ? 0 : 64); - if (CacheSize > 0) + + if (CacheSize <= 0) + { + return; + } + + int MultiCacheLength = a_IniFile.GetValueSetI("Generator", "BiomeGenMultiCacheLength", 4); + if (CacheSize < 4) + { + LOGWARNING("Biomegen cache size set too low, would hurt performance instead of helping. Increasing from %d to %d", + CacheSize, 4 + ); + CacheSize = 4; + } + LOGD("Using a cache for biomegen of size %d.", CacheSize); + m_UnderlyingBiomeGen = m_BiomeGen; + if (MultiCacheLength > 0) + { + LOGD("Enabling multicache for biomegen of length %d.", MultiCacheLength); + m_BiomeGen = new cBioGenMulticache(m_UnderlyingBiomeGen, CacheSize, MultiCacheLength); + } + else { - if (CacheSize < 4) - { - LOGWARNING("Biomegen cache size set too low, would hurt performance instead of helping. Increasing from %d to %d", - CacheSize, 4 - ); - CacheSize = 4; - } - LOGD("Using a cache for biomegen of size %d.", CacheSize); - m_UnderlyingBiomeGen = m_BiomeGen; m_BiomeGen = new cBioGenCache(m_UnderlyingBiomeGen, CacheSize); } } @@ -343,6 +356,14 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) float Threshold = (float)a_IniFile.GetValueSetF("Generator", "DualRidgeCavesThreshold", 0.3); m_FinishGens.push_back(new cStructGenDualRidgeCaves(Seed, Threshold)); } + else if (NoCaseCompare(*itr, "DungeonRooms") == 0) + { + int GridSize = a_IniFile.GetValueSetI("Generator", "DungeonRoomsGridSize", 48); + int MaxSize = a_IniFile.GetValueSetI("Generator", "DungeonRoomsMaxSize", 7); + int MinSize = a_IniFile.GetValueSetI("Generator", "DungeonRoomsMinSize", 5); + AString HeightDistrib = a_IniFile.GetValueSet ("Generator", "DungeonRoomsHeightDistrib", "0, 0; 10, 10; 11, 500; 40, 500; 60, 40; 90, 1"); + m_FinishGens.push_back(new cDungeonRoomsFinisher(*m_HeightGen, Seed, GridSize, MaxSize, MinSize, HeightDistrib)); + } else if (NoCaseCompare(*itr, "Ice") == 0) { m_FinishGens.push_back(new cFinishGenIce); @@ -387,6 +408,55 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) m_FinishGens.push_back(new cFinishGenSingleTopBlock(Seed, E_BLOCK_LILY_PAD, AllowedBiomes, 4, AllowedBlocks)); } + else if (NoCaseCompare(*itr, "NaturalPatches") == 0) + { + cStructGenOreNests::OreList Ores; + + // Dirt vein + cStructGenOreNests::OreInfo DirtVein; + DirtVein.BlockType = E_BLOCK_DIRT; + DirtVein.MaxHeight = 127; + DirtVein.NumNests = 20; + DirtVein.NestSize = 32; + Ores.push_back(DirtVein); + + // Gravel vein + cStructGenOreNests::OreInfo GravelVein; + GravelVein.BlockType = E_BLOCK_GRAVEL; + GravelVein.MaxHeight = 127; + GravelVein.NumNests = 20; + GravelVein.NestSize = 32; + Ores.push_back(GravelVein); + + // Granite vein + cStructGenOreNests::OreInfo GraniteVein; + GraniteVein.BlockType = E_BLOCK_STONE; + GraniteVein.BlockMeta = 1; + GraniteVein.MaxHeight = 127; + GraniteVein.NumNests = 20; + GraniteVein.NestSize = 32; + Ores.push_back(GraniteVein); + + // Diorite vein + cStructGenOreNests::OreInfo DioriteVein; + DioriteVein.BlockType = E_BLOCK_STONE; + DioriteVein.BlockMeta = 3; + DioriteVein.MaxHeight = 127; + DioriteVein.NumNests = 20; + DioriteVein.NestSize = 32; + Ores.push_back(DioriteVein); + + // Andesite vein + cStructGenOreNests::OreInfo AndesiteVein; + AndesiteVein.BlockType = E_BLOCK_STONE; + AndesiteVein.BlockMeta = 5; + AndesiteVein.MaxHeight = 127; + AndesiteVein.NumNests = 20; + AndesiteVein.NestSize = 32; + Ores.push_back(AndesiteVein); + + m_FinishGens.push_back(new cStructGenOreNests(Seed, Ores, E_BLOCK_STONE)); + } else if (NoCaseCompare(*itr, "NetherClumpFoliage") == 0) { m_FinishGens.push_back(new cFinishGenNetherClumpFoliage(Seed)); @@ -398,9 +468,74 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) int MaxDepth = a_IniFile.GetValueSetI("Generator", "NetherFortsMaxDepth", 12); m_FinishGens.push_back(new cNetherFortGen(Seed, GridSize, MaxOffset, MaxDepth)); } + else if (NoCaseCompare(*itr, "NetherOreNests") == 0) + { + cStructGenOreNests::OreList Ores; + + // Quartz vein + cStructGenOreNests::OreInfo QuartzVein; + QuartzVein.BlockType = E_BLOCK_NETHER_QUARTZ_ORE; + QuartzVein.MaxHeight = 255; + QuartzVein.NumNests = 80; + QuartzVein.NestSize = 8; + Ores.push_back(QuartzVein); + + m_FinishGens.push_back(new cStructGenOreNests(Seed, Ores, E_BLOCK_NETHERRACK)); + + } else if (NoCaseCompare(*itr, "OreNests") == 0) { - m_FinishGens.push_back(new cStructGenOreNests(Seed)); + cStructGenOreNests::OreList Ores; + + // Coal vein + cStructGenOreNests::OreInfo CoalVein; + CoalVein.BlockType = E_BLOCK_COAL_ORE; + CoalVein.MaxHeight = 127; + CoalVein.NumNests = 50; + CoalVein.NestSize = 10; + Ores.push_back(CoalVein); + + // Iron vein + cStructGenOreNests::OreInfo IronVein; + IronVein.BlockType = E_BLOCK_IRON_ORE; + IronVein.MaxHeight = 64; + IronVein.NumNests = 14; + IronVein.NestSize = 6; + Ores.push_back(IronVein); + + // Gold vein + cStructGenOreNests::OreInfo GoldVein; + GoldVein.BlockType = E_BLOCK_GOLD_ORE; + GoldVein.MaxHeight = 32; + GoldVein.NumNests = 2; + GoldVein.NestSize = 6; + Ores.push_back(GoldVein); + + // Redstone vein + cStructGenOreNests::OreInfo RedstoneVein; + RedstoneVein.BlockType = E_BLOCK_REDSTONE_ORE; + RedstoneVein.MaxHeight = 16; + RedstoneVein.NumNests = 4; + RedstoneVein.NestSize = 6; + Ores.push_back(RedstoneVein); + + // Lapis vein + cStructGenOreNests::OreInfo LapisVein; + LapisVein.BlockType = E_BLOCK_LAPIS_ORE; + LapisVein.MaxHeight = 30; + LapisVein.NumNests = 2; + LapisVein.NestSize = 5; + Ores.push_back(LapisVein); + + // Diamond vein + cStructGenOreNests::OreInfo DiamondVein; + DiamondVein.BlockType = E_BLOCK_DIAMOND_ORE; + DiamondVein.MaxHeight = 15; + DiamondVein.NumNests = 1; + DiamondVein.NestSize = 4; + Ores.push_back(DiamondVein); + + m_FinishGens.push_back(new cStructGenOreNests(Seed, Ores, E_BLOCK_STONE)); } else if (NoCaseCompare(*itr, "POCPieces") == 0) { @@ -408,7 +543,12 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) } else if (NoCaseCompare(*itr, "PreSimulator") == 0) { - m_FinishGens.push_back(new cFinishGenPreSimulator); + // Load the settings + bool PreSimulateFallingBlocks = a_IniFile.GetValueSetB("Generator", "PreSimulatorFallingBlocks", true); + bool PreSimulateWater = a_IniFile.GetValueSetB("Generator", "PreSimulatorWater", true); + bool PreSimulateLava = a_IniFile.GetValueSetB("Generator", "PreSimulatorLava", true); + + m_FinishGens.push_back(new cFinishGenPreSimulator(PreSimulateFallingBlocks, PreSimulateWater, PreSimulateLava)); } else if (NoCaseCompare(*itr, "RainbowRoads") == 0) { diff --git a/src/Generating/DistortedHeightmap.cpp b/src/Generating/DistortedHeightmap.cpp index c18c402da..bf8995dcb 100644 --- a/src/Generating/DistortedHeightmap.cpp +++ b/src/Generating/DistortedHeightmap.cpp @@ -540,10 +540,11 @@ void cDistortedHeightmap::InitializeCompoGen(cIniFile & a_IniFile) int cDistortedHeightmap::GetHeightmapAt(NOISE_DATATYPE a_X, NOISE_DATATYPE a_Z) { - int ChunkX = (int)floor(a_X / (NOISE_DATATYPE)16); - int ChunkZ = (int)floor(a_Z / (NOISE_DATATYPE)16); - int RelX = (int)(a_X - (NOISE_DATATYPE)ChunkX * cChunkDef::Width); - int RelZ = (int)(a_Z - (NOISE_DATATYPE)ChunkZ * cChunkDef::Width); + int RelX = (int)std::floor(a_X); + int RelY = 0; + int RelZ = (int)std::floor(a_Z); + int ChunkX, ChunkZ; + cChunkDef::AbsoluteToRelative(RelX, RelY, RelZ, ChunkX, ChunkZ); // If we're withing the same chunk, return the pre-cached heightmap: if ((ChunkX == m_CurChunkX) && (ChunkZ == m_CurChunkZ)) diff --git a/src/Generating/DungeonRoomsFinisher.cpp b/src/Generating/DungeonRoomsFinisher.cpp new file mode 100644 index 000000000..f213455d6 --- /dev/null +++ b/src/Generating/DungeonRoomsFinisher.cpp @@ -0,0 +1,279 @@ + +// DungeonRoomsFinisher.cpp + +// Declares the cDungeonRoomsFinisher class representing the finisher that generates dungeon rooms + +#include "Globals.h" +#include "DungeonRoomsFinisher.h" +#include "../FastRandom.h" + + + + + +/** Height, in blocks, of the internal dungeon room open space. This many air blocks Y-wise. */ +static const int ROOM_HEIGHT = 4; + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cDungeonRoom: + +class cDungeonRoom : + public cGridStructGen::cStructure +{ + typedef cGridStructGen::cStructure super; + +public: + + cDungeonRoom( + int a_GridX, int a_GridZ, + int a_OriginX, int a_OriginZ, + int a_HalfSizeX, int a_HalfSizeZ, + int a_FloorHeight, + cNoise & a_Noise + ) : + super(a_GridX, a_GridZ, a_OriginX, a_OriginZ), + m_StartX(a_OriginX - a_HalfSizeX), + m_EndX(a_OriginX + a_HalfSizeX), + m_StartZ(a_OriginZ - a_HalfSizeZ), + m_EndZ(a_OriginZ + a_HalfSizeZ), + m_FloorHeight(a_FloorHeight) + { + /* + Pick coords next to the wall for the chests. + This is done by indexing the possible coords, picking any one for the first chest + and then picking another position for the second chest that is not adjacent to the first pos + */ + int rnd = a_Noise.IntNoise2DInt(a_OriginX, a_OriginZ) / 7; + int SizeX = m_EndX - m_StartX - 1; + int SizeZ = m_EndZ - m_StartZ - 1; + int NumPositions = 2 * SizeX + 2 * SizeZ; + int FirstChestPos = rnd % NumPositions; // The corner positions are a bit more likely, but we don't mind + rnd = rnd / 512; + int SecondChestPos = (FirstChestPos + 2 + (rnd % (NumPositions - 3))) % NumPositions; + m_Chest1 = DecodeChestCoords(FirstChestPos, SizeX, SizeZ); + m_Chest2 = DecodeChestCoords(SecondChestPos, SizeX, SizeZ); + } + +protected: + + // The X range of the room, start inclusive, end exclusive: + int m_StartX, m_EndX; + + // The Z range of the room, start inclusive, end exclusive: + int m_StartZ, m_EndZ; + + /** The Y coord of the floor of the room */ + int m_FloorHeight; + + /** The (absolute) coords of the first chest. The Y coord represents the chest's Meta value (facing). */ + Vector3i m_Chest1; + + /** The (absolute) coords of the second chest. The Y coord represents the chest's Meta value (facing). */ + Vector3i m_Chest2; + + + + /** Decodes the position index along the room walls into a proper 2D position for a chest. */ + Vector3i DecodeChestCoords(int a_PosIdx, int a_SizeX, int a_SizeZ) + { + if (a_PosIdx < a_SizeX) + { + // Return a coord on the ZM side of the room: + return Vector3i(m_StartX + a_PosIdx + 1, E_META_CHEST_FACING_ZP, m_StartZ + 1); + } + a_PosIdx -= a_SizeX; + if (a_PosIdx < a_SizeZ) + { + // Return a coord on the XP side of the room: + return Vector3i(m_EndX - 1, E_META_CHEST_FACING_XM, m_StartZ + a_PosIdx + 1); + } + a_PosIdx -= a_SizeZ; + if (a_PosIdx < a_SizeX) + { + // Return a coord on the ZP side of the room: + return Vector3i(m_StartX + a_PosIdx + 1, E_META_CHEST_FACING_ZM, m_StartZ + 1); + } + a_PosIdx -= a_SizeX; + // Return a coord on the XM side of the room: + return Vector3i(m_StartX + 1, E_META_CHEST_FACING_XP, m_StartZ + a_PosIdx + 1); + } + + + + /** Fills the specified area of blocks in the chunk with the specified blocktype if they are one of the overwritten block types. + The coords are absolute, start coords are inclusive, end coords are exclusive. */ + void ReplaceCuboid(cChunkDesc & a_ChunkDesc, int a_StartX, int a_StartY, int a_StartZ, int a_EndX, int a_EndY, int a_EndZ, BLOCKTYPE a_DstBlockType) + { + int BlockX = a_ChunkDesc.GetChunkX() * cChunkDef::Width; + int BlockZ = a_ChunkDesc.GetChunkZ() * cChunkDef::Width; + int RelStartX = Clamp(a_StartX - BlockX, 0, cChunkDef::Width - 1); + int RelStartZ = Clamp(a_StartZ - BlockZ, 0, cChunkDef::Width - 1); + int RelEndX = Clamp(a_EndX - BlockX, 0, cChunkDef::Width); + int RelEndZ = Clamp(a_EndZ - BlockZ, 0, cChunkDef::Width); + for (int y = a_StartY; y < a_EndY; y++) + { + for (int z = RelStartZ; z < RelEndZ; z++) + { + for (int x = RelStartX; x < RelEndX; x++) + { + if (cBlockInfo::CanBeTerraformed(a_ChunkDesc.GetBlockType(x, y, z))) + { + a_ChunkDesc.SetBlockType(x, y, z, a_DstBlockType); + } + } // for x + } // for z + } // for z + } + + + + /** Fills the specified area of blocks in the chunk with a random pattern of the specified blocktypes, if they are one of the overwritten block types. + The coords are absolute, start coords are inclusive, end coords are exclusive. The first blocktype uses 75% chance, the second 25% chance. */ + void ReplaceCuboidRandom(cChunkDesc & a_ChunkDesc, int a_StartX, int a_StartY, int a_StartZ, int a_EndX, int a_EndY, int a_EndZ, BLOCKTYPE a_DstBlockType1, BLOCKTYPE a_DstBlockType2) + { + int BlockX = a_ChunkDesc.GetChunkX() * cChunkDef::Width; + int BlockZ = a_ChunkDesc.GetChunkZ() * cChunkDef::Width; + int RelStartX = Clamp(a_StartX - BlockX, 0, cChunkDef::Width - 1); + int RelStartZ = Clamp(a_StartZ - BlockZ, 0, cChunkDef::Width - 1); + int RelEndX = Clamp(a_EndX - BlockX, 0, cChunkDef::Width); + int RelEndZ = Clamp(a_EndZ - BlockZ, 0, cChunkDef::Width); + cFastRandom rnd; + for (int y = a_StartY; y < a_EndY; y++) + { + for (int z = RelStartZ; z < RelEndZ; z++) + { + for (int x = RelStartX; x < RelEndX; x++) + { + if (cBlockInfo::CanBeTerraformed(a_ChunkDesc.GetBlockType(x, y, z))) + { + BLOCKTYPE BlockType = (rnd.NextInt(101) < 75) ? a_DstBlockType1 : a_DstBlockType2; + a_ChunkDesc.SetBlockType(x, y, z, BlockType); + } + } // for x + } // for z + } // for z + } + + + + /** Tries to place a chest at the specified (absolute) coords. + Does nothing if the coords are outside the chunk. */ + void TryPlaceChest(cChunkDesc & a_ChunkDesc, const Vector3i & a_Chest) + { + int RelX = a_Chest.x - a_ChunkDesc.GetChunkX() * cChunkDef::Width; + int RelZ = a_Chest.z - a_ChunkDesc.GetChunkZ() * cChunkDef::Width; + if ( + (RelX < 0) || (RelX >= cChunkDef::Width) || // The X coord is not in this chunk + (RelZ < 0) || (RelZ >= cChunkDef::Width) // The Z coord is not in this chunk + ) + { + return; + } + a_ChunkDesc.SetBlockTypeMeta(RelX, m_FloorHeight + 1, RelZ, E_BLOCK_CHEST, (NIBBLETYPE)a_Chest.y); + + // TODO: Fill the chest with random loot + } + + + + // cGridStructGen::cStructure override: + virtual void DrawIntoChunk(cChunkDesc & a_ChunkDesc) override + { + if ( + (m_EndX < a_ChunkDesc.GetChunkX() * cChunkDef::Width) || + (m_StartX >= a_ChunkDesc.GetChunkX() * cChunkDef::Width + cChunkDef::Width) || + (m_EndZ < a_ChunkDesc.GetChunkZ() * cChunkDef::Width) || + (m_StartZ >= a_ChunkDesc.GetChunkZ() * cChunkDef::Width + cChunkDef::Width) + ) + { + // The chunk is not intersecting the room at all, bail out + return; + } + int b = m_FloorHeight + 1; // Bottom + int t = m_FloorHeight + 1 + ROOM_HEIGHT; // Top + ReplaceCuboidRandom(a_ChunkDesc, m_StartX, m_FloorHeight, m_StartZ, m_EndX + 1, b, m_EndZ + 1, E_BLOCK_MOSSY_COBBLESTONE, E_BLOCK_COBBLESTONE); // Floor + ReplaceCuboid(a_ChunkDesc, m_StartX + 1, b, m_StartZ + 1, m_EndX, t, m_EndZ, E_BLOCK_AIR); // Insides + + // Walls: + ReplaceCuboid(a_ChunkDesc, m_StartX, b, m_StartZ, m_StartX + 1, t, m_EndZ, E_BLOCK_COBBLESTONE); // XM wall + ReplaceCuboid(a_ChunkDesc, m_EndX, b, m_StartZ, m_EndX + 1, t, m_EndZ, E_BLOCK_COBBLESTONE); // XP wall + ReplaceCuboid(a_ChunkDesc, m_StartX, b, m_StartZ, m_EndX + 1, t, m_StartZ + 1, E_BLOCK_COBBLESTONE); // ZM wall + ReplaceCuboid(a_ChunkDesc, m_StartX, b, m_EndZ, m_EndX + 1, t, m_EndZ + 1, E_BLOCK_COBBLESTONE); // ZP wall + + // Place chests: + TryPlaceChest(a_ChunkDesc, m_Chest1); + TryPlaceChest(a_ChunkDesc, m_Chest2); + + // Place the spawner: + int CenterX = (m_StartX + m_EndX) / 2 - a_ChunkDesc.GetChunkX() * cChunkDef::Width; + int CenterZ = (m_StartZ + m_EndZ) / 2 - a_ChunkDesc.GetChunkZ() * cChunkDef::Width; + if ( + (CenterX >= 0) && (CenterX < cChunkDef::Width) && + (CenterZ >= 0) && (CenterZ < cChunkDef::Width) + ) + { + a_ChunkDesc.SetBlockTypeMeta(CenterX, b, CenterZ, E_BLOCK_MOB_SPAWNER, 0); + // TODO: Set the spawned mob + } + } +} ; + + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cDungeonRoomsFinisher: + +cDungeonRoomsFinisher::cDungeonRoomsFinisher(cTerrainHeightGen & a_HeightGen, int a_Seed, int a_GridSize, int a_MaxSize, int a_MinSize, const AString & a_HeightDistrib) : + super(a_Seed + 100, a_GridSize, a_GridSize, a_GridSize, a_GridSize, a_MaxSize, a_MaxSize, 1024), + m_HeightGen(a_HeightGen), + m_MaxHalfSize((a_MaxSize + 1) / 2), + m_MinHalfSize((a_MinSize + 1) / 2), + m_HeightProbability(cChunkDef::Height) +{ + // Initialize the height probability distribution: + m_HeightProbability.SetDefString(a_HeightDistrib); + + // Normalize the min and max size: + if (m_MinHalfSize > m_MaxHalfSize) + { + std::swap(m_MinHalfSize, m_MaxHalfSize); + } +} + + + + + + +cDungeonRoomsFinisher::cStructurePtr cDungeonRoomsFinisher::CreateStructure(int a_GridX, int a_GridZ, int a_OriginX, int a_OriginZ) +{ + // Select a random room size in each direction: + int rnd = m_Noise.IntNoise2DInt(a_OriginX, a_OriginZ) / 7; + int HalfSizeX = m_MinHalfSize + (rnd % (m_MaxHalfSize - m_MinHalfSize + 1)); + rnd = rnd / 32; + int HalfSizeZ = m_MinHalfSize + (rnd % (m_MaxHalfSize - m_MinHalfSize + 1)); + rnd = rnd / 32; + + // Select a random floor height for the room, based on the height generator: + int ChunkX, ChunkZ; + int RelX = a_OriginX, RelY = 0, RelZ = a_OriginZ; + cChunkDef::AbsoluteToRelative(RelX, RelY, RelZ, ChunkX, ChunkZ); + cChunkDef::HeightMap HeightMap; + m_HeightGen.GenHeightMap(ChunkX, ChunkZ, HeightMap); + int Height = cChunkDef::GetHeight(HeightMap, RelX, RelZ); // Max room height at {a_OriginX, a_OriginZ} + Height = Clamp(m_HeightProbability.MapValue(rnd % m_HeightProbability.GetSum()), 10, Height - 5); + + // Create the dungeon room descriptor: + return cStructurePtr(new cDungeonRoom(a_GridX, a_GridZ, a_OriginX, a_OriginZ, HalfSizeX, HalfSizeZ, Height, m_Noise)); +} + + + + diff --git a/src/Generating/DungeonRoomsFinisher.h b/src/Generating/DungeonRoomsFinisher.h new file mode 100644 index 000000000..2b52c9de6 --- /dev/null +++ b/src/Generating/DungeonRoomsFinisher.h @@ -0,0 +1,52 @@ + +// DungeonRoomsFinisher.h + +// Declares the cDungeonRoomsFinisher class representing the finisher that generates dungeon rooms + + + + + +#pragma once + +#include "GridStructGen.h" +#include "../ProbabDistrib.h" + + + + + +class cDungeonRoomsFinisher : + public cGridStructGen +{ + typedef cGridStructGen super; + +public: + /** Creates a new dungeon room finisher. + a_HeightGen is the underlying height generator, so that the rooms can always be placed under the terrain. + a_MaxSize and a_MinSize are the maximum and minimum sizes of the room's internal (air) area, in blocks across. + a_HeightDistrib is the string defining the height distribution for the rooms (cProbabDistrib format). */ + cDungeonRoomsFinisher(cTerrainHeightGen & a_HeightGen, int a_Seed, int a_GridSize, int a_MaxSize, int a_MinSize, const AString & a_HeightDistrib); + +protected: + + /** The height gen that is used for limiting the rooms' Y coords */ + cTerrainHeightGen & m_HeightGen; + + /** Maximum half-size (from center to wall) of the dungeon room's inner (air) area. Default is 3 (vanilla). */ + int m_MaxHalfSize; + + /** Minimum half-size (from center to wall) of the dungeon room's inner (air) area. Default is 2 (vanilla). */ + int m_MinHalfSize; + + /** The height probability distribution to make the spawners more common in layers 10 - 40, less common outside this range. */ + cProbabDistrib m_HeightProbability; + + + // cGridStructGen overrides: + virtual cStructurePtr CreateStructure(int a_GridX, int a_GridZ, int a_OriginX, int a_OriginZ) override; +} ; + + + + diff --git a/src/Generating/FinishGen.cpp b/src/Generating/FinishGen.cpp index f53addb68..96e3dc26b 100644 --- a/src/Generating/FinishGen.cpp +++ b/src/Generating/FinishGen.cpp @@ -15,6 +15,7 @@ #include "../Simulator/FluidSimulator.h" // for cFluidSimulator::CanWashAway() #include "../Simulator/FireSimulator.h" #include "../World.h" +#include "inifile/iniFile.h" @@ -484,8 +485,6 @@ int cFinishGenSingleTopBlock::GetNumToGen(const cChunkDef::BiomeMap & a_BiomeMap void cFinishGenSingleTopBlock::GenFinish(cChunkDesc & a_ChunkDesc) { - // Add Lilypads on top of water surface in Swampland - int NumToGen = GetNumToGen(a_ChunkDesc.GetBiomeMap()); int ChunkX = a_ChunkDesc.GetChunkX(); int ChunkZ = a_ChunkDesc.GetChunkZ(); @@ -555,7 +554,10 @@ void cFinishGenBottomLava::GenFinish(cChunkDesc & a_ChunkDesc) //////////////////////////////////////////////////////////////////////////////// // cFinishGenPreSimulator: -cFinishGenPreSimulator::cFinishGenPreSimulator(void) +cFinishGenPreSimulator::cFinishGenPreSimulator(bool a_PreSimulateFallingBlocks, bool a_PreSimulateWater, bool a_PreSimulateLava) : + m_PreSimulateFallingBlocks(a_PreSimulateFallingBlocks), + m_PreSimulateWater(a_PreSimulateWater), + m_PreSimulateLava(a_PreSimulateLava) { // Nothing needed yet } @@ -566,9 +568,20 @@ cFinishGenPreSimulator::cFinishGenPreSimulator(void) void cFinishGenPreSimulator::GenFinish(cChunkDesc & a_ChunkDesc) { - CollapseSandGravel(a_ChunkDesc.GetBlockTypes(), a_ChunkDesc.GetHeightMap()); - StationarizeFluid(a_ChunkDesc.GetBlockTypes(), a_ChunkDesc.GetHeightMap(), E_BLOCK_WATER, E_BLOCK_STATIONARY_WATER); - StationarizeFluid(a_ChunkDesc.GetBlockTypes(), a_ChunkDesc.GetHeightMap(), E_BLOCK_LAVA, E_BLOCK_STATIONARY_LAVA); + if (m_PreSimulateFallingBlocks) + { + CollapseSandGravel(a_ChunkDesc.GetBlockTypes(), a_ChunkDesc.GetHeightMap()); + } + + if (m_PreSimulateWater) + { + StationarizeFluid(a_ChunkDesc.GetBlockTypes(), a_ChunkDesc.GetHeightMap(), E_BLOCK_WATER, E_BLOCK_STATIONARY_WATER); + } + + if (m_PreSimulateLava) + { + StationarizeFluid(a_ChunkDesc.GetBlockTypes(), a_ChunkDesc.GetHeightMap(), E_BLOCK_LAVA, E_BLOCK_STATIONARY_LAVA); + } // TODO: other operations } diff --git a/src/Generating/FinishGen.h b/src/Generating/FinishGen.h index ed32768b3..4a08d70c8 100644 --- a/src/Generating/FinishGen.h +++ b/src/Generating/FinishGen.h @@ -163,7 +163,7 @@ public: m_Amount(a_Amount) { // Initialize all the block types. - for (int idx = 0; idx < ARRAYCOUNT(m_IsAllowedBelow); ++idx) + for (size_t idx = 0; idx < ARRAYCOUNT(m_IsAllowedBelow); ++idx) { m_IsAllowedBelow[idx] = false; } @@ -175,7 +175,7 @@ public: } // Initialize all the biome types. - for (int idx = 0; idx < ARRAYCOUNT(m_IsBiomeAllowed); ++idx) + for (size_t idx = 0; idx < ARRAYCOUNT(m_IsBiomeAllowed); ++idx) { m_IsBiomeAllowed[idx] = false; } @@ -240,9 +240,14 @@ class cFinishGenPreSimulator : public cFinishGen { public: - cFinishGenPreSimulator(void); + cFinishGenPreSimulator(bool a_PreSimulateFallingBlocks, bool a_PreSimulateWater, bool a_PreSimulateLava); protected: + + bool m_PreSimulateFallingBlocks; + bool m_PreSimulateWater; + bool m_PreSimulateLava; + // Drops hanging sand and gravel down to the ground, recalculates heightmap void CollapseSandGravel( cChunkDef::BlockTypes & a_BlockTypes, // Block types to read and change diff --git a/src/Generating/HeiGen.cpp b/src/Generating/HeiGen.cpp index 870ceef7f..79d529a6a 100644 --- a/src/Generating/HeiGen.cpp +++ b/src/Generating/HeiGen.cpp @@ -239,7 +239,13 @@ bool cHeiGenCache::GetHeightAt(int a_ChunkX, int a_ChunkZ, int a_RelX, int a_Rel cHeiGenClassic::cHeiGenClassic(int a_Seed) : m_Seed(a_Seed), - m_Noise(a_Seed) + m_Noise(a_Seed), + m_HeightFreq1(1.0f), + m_HeightAmp1(1.0f), + m_HeightFreq2(0.5f), + m_HeightAmp2(0.5f), + m_HeightFreq3(0.1f), + m_HeightAmp3(0.1f) { } @@ -432,7 +438,7 @@ const cHeiGenBiomal::sGenParam cHeiGenBiomal::m_GenParam[256] = /* biExtremeHillsM */ { 0.1f, 2.0f, 0.05f, 12.0f, 0.01f, 10.0f, 40}, // 131 /* biFlowerForest */ { 0.1f, 2.0f, 0.05f, 12.0f, 0.01f, 10.0f, 40}, // 132 /* biTaigaM */ { 0.1f, 2.0f, 0.05f, 12.0f, 0.01f, 10.0f, 40}, // 133 - /* biSwamplandM */ { 0.1f, 2.0f, 0.05f, 12.0f, 0.01f, 10.0f, 40}, // 134 + /* biSwamplandM */ { 1.0f, 3.0f, 1.10f, 7.0f, 0.01f, 0.01f, 60}, // 134 // Biomes 135 .. 139 unused, 5 empty placeholders here: {}, {}, {}, {}, {}, // 135 .. 139 diff --git a/src/Generating/Noise3DGenerator.cpp b/src/Generating/Noise3DGenerator.cpp index b879349ee..c3ca30384 100644 --- a/src/Generating/Noise3DGenerator.cpp +++ b/src/Generating/Noise3DGenerator.cpp @@ -236,7 +236,7 @@ void cNoise3DGenerator::GenerateNoiseArray(int a_ChunkX, int a_ChunkZ, NOISE_DAT m_Cubic.Generate2D(Height, DIM_X, DIM_Z, StartX / 25, EndX / 25, StartZ / 25, EndZ / 25); for (size_t i = 0; i < ARRAYCOUNT(Height); i++) { - Height[i] = abs(Height[i]) * m_HeightAmplification + 1; + Height[i] = std::abs(Height[i]) * m_HeightAmplification + 1; } // Modify the noise by height data: @@ -395,7 +395,7 @@ void cNoise3DComposable::GenerateNoiseArrayIfNeeded(int a_ChunkX, int a_ChunkZ) for (int x = 0; x < 17; x += UPSCALE_X) { NOISE_DATATYPE NoiseX = ((NOISE_DATATYPE)(a_ChunkX * cChunkDef::Width + x)) / m_FrequencyX; - NOISE_DATATYPE val = abs(m_Noise1.CubicNoise2D(NoiseX / 5, NoiseZ / 5)) * m_HeightAmplification + 1; + NOISE_DATATYPE val = std::abs(m_Noise1.CubicNoise2D(NoiseX / 5, NoiseZ / 5)) * m_HeightAmplification + 1; Height[x + 17 * z] = val * val * val; } } @@ -412,11 +412,12 @@ void cNoise3DComposable::GenerateNoiseArrayIfNeeded(int a_ChunkX, int a_ChunkZ) for (int x = 0; x < 17; x += UPSCALE_X) { NOISE_DATATYPE NoiseX = ((NOISE_DATATYPE)(a_ChunkX * cChunkDef::Width + x)) / m_FrequencyX; - CurFloor[x + 17 * z] = + CurFloor[x + 17 * z] = ( m_Noise1.CubicNoise3D(NoiseX, NoiseY, NoiseZ) * (NOISE_DATATYPE)0.5 + m_Noise2.CubicNoise3D(NoiseX / 2, NoiseY / 2, NoiseZ / 2) + m_Noise3.CubicNoise3D(NoiseX / 4, NoiseY / 4, NoiseZ / 4) * 2 + - AddHeight / Height[x + 17 * z]; + AddHeight / Height[x + 17 * z] + ); } } // Linear-interpolate this XZ floor: diff --git a/src/Generating/RoughRavines.cpp b/src/Generating/RoughRavines.cpp index badc7768e..2ee3704b3 100644 --- a/src/Generating/RoughRavines.cpp +++ b/src/Generating/RoughRavines.cpp @@ -201,29 +201,11 @@ protected: { continue; } - switch (a_ChunkDesc.GetBlockType(x, y, z)) + + if (cBlockInfo::CanBeTerraformed(a_ChunkDesc.GetBlockType(x, y, z))) { - // Only carve out these specific block types - case E_BLOCK_DIRT: - case E_BLOCK_GRASS: - case E_BLOCK_STONE: - case E_BLOCK_COBBLESTONE: - case E_BLOCK_GRAVEL: - case E_BLOCK_SAND: - case E_BLOCK_SANDSTONE: - case E_BLOCK_NETHERRACK: - case E_BLOCK_COAL_ORE: - case E_BLOCK_IRON_ORE: - case E_BLOCK_GOLD_ORE: - case E_BLOCK_DIAMOND_ORE: - case E_BLOCK_REDSTONE_ORE: - case E_BLOCK_REDSTONE_ORE_GLOWING: - { - a_ChunkDesc.SetBlockType(x, y, z, E_BLOCK_AIR); - break; - } - default: break; - } // switch (BlockType) + a_ChunkDesc.SetBlockType(x, y, z, E_BLOCK_AIR); + } } // for y } // for x, z - a_BlockTypes } // for itr - m_Points[] diff --git a/src/Generating/StructGen.cpp b/src/Generating/StructGen.cpp index 054eec345..c23a72621 100644 --- a/src/Generating/StructGen.cpp +++ b/src/Generating/StructGen.cpp @@ -13,45 +13,6 @@ //////////////////////////////////////////////////////////////////////////////// -// cStructGenOreNests configuration: - -const int MAX_HEIGHT_COAL = 127; -const int NUM_NESTS_COAL = 50; -const int NEST_SIZE_COAL = 10; - -const int MAX_HEIGHT_IRON = 64; -const int NUM_NESTS_IRON = 14; -const int NEST_SIZE_IRON = 6; - -const int MAX_HEIGHT_REDSTONE = 16; -const int NUM_NESTS_REDSTONE = 4; -const int NEST_SIZE_REDSTONE = 6; - -const int MAX_HEIGHT_GOLD = 32; -const int NUM_NESTS_GOLD = 2; -const int NEST_SIZE_GOLD = 6; - -const int MAX_HEIGHT_DIAMOND = 15; -const int NUM_NESTS_DIAMOND = 1; -const int NEST_SIZE_DIAMOND = 4; - -const int MAX_HEIGHT_LAPIS = 30; -const int NUM_NESTS_LAPIS = 2; -const int NEST_SIZE_LAPIS = 5; - -const int MAX_HEIGHT_DIRT = 127; -const int NUM_NESTS_DIRT = 20; -const int NEST_SIZE_DIRT = 32; - -const int MAX_HEIGHT_GRAVEL = 70; -const int NUM_NESTS_GRAVEL = 15; -const int NEST_SIZE_GRAVEL = 32; - - - - - -//////////////////////////////////////////////////////////////////////////////// // cStructGenTrees: void cStructGenTrees::GenFinish(cChunkDesc & a_ChunkDesc) @@ -311,21 +272,23 @@ void cStructGenOreNests::GenFinish(cChunkDesc & a_ChunkDesc) int ChunkX = a_ChunkDesc.GetChunkX(); int ChunkZ = a_ChunkDesc.GetChunkZ(); cChunkDef::BlockTypes & BlockTypes = a_ChunkDesc.GetBlockTypes(); - GenerateOre(ChunkX, ChunkZ, E_BLOCK_COAL_ORE, MAX_HEIGHT_COAL, NUM_NESTS_COAL, NEST_SIZE_COAL, BlockTypes, 1); - GenerateOre(ChunkX, ChunkZ, E_BLOCK_IRON_ORE, MAX_HEIGHT_IRON, NUM_NESTS_IRON, NEST_SIZE_IRON, BlockTypes, 2); - GenerateOre(ChunkX, ChunkZ, E_BLOCK_REDSTONE_ORE, MAX_HEIGHT_REDSTONE, NUM_NESTS_REDSTONE, NEST_SIZE_REDSTONE, BlockTypes, 3); - GenerateOre(ChunkX, ChunkZ, E_BLOCK_GOLD_ORE, MAX_HEIGHT_GOLD, NUM_NESTS_GOLD, NEST_SIZE_GOLD, BlockTypes, 4); - GenerateOre(ChunkX, ChunkZ, E_BLOCK_DIAMOND_ORE, MAX_HEIGHT_DIAMOND, NUM_NESTS_DIAMOND, NEST_SIZE_DIAMOND, BlockTypes, 5); - GenerateOre(ChunkX, ChunkZ, E_BLOCK_LAPIS_ORE, MAX_HEIGHT_LAPIS, NUM_NESTS_LAPIS, NEST_SIZE_LAPIS, BlockTypes, 6); - GenerateOre(ChunkX, ChunkZ, E_BLOCK_DIRT, MAX_HEIGHT_DIRT, NUM_NESTS_DIRT, NEST_SIZE_DIRT, BlockTypes, 10); - GenerateOre(ChunkX, ChunkZ, E_BLOCK_GRAVEL, MAX_HEIGHT_GRAVEL, NUM_NESTS_GRAVEL, NEST_SIZE_GRAVEL, BlockTypes, 11); + cChunkDesc::BlockNibbleBytes & BlockMetas = a_ChunkDesc.GetBlockMetasUncompressed(); + + int seq = 1; + + // Generate the ores from the ore list. + for (OreList::const_iterator itr = m_OreList.begin(); itr != m_OreList.end(); ++itr) + { + GenerateOre(ChunkX, ChunkZ, itr->BlockType, itr->BlockMeta, itr->MaxHeight, itr->NumNests, itr->NestSize, BlockTypes, BlockMetas, seq); + seq++; + } } -void cStructGenOreNests::GenerateOre(int a_ChunkX, int a_ChunkZ, BLOCKTYPE a_OreType, int a_MaxHeight, int a_NumNests, int a_NestSize, cChunkDef::BlockTypes & a_BlockTypes, int a_Seq) +void cStructGenOreNests::GenerateOre(int a_ChunkX, int a_ChunkZ, BLOCKTYPE a_OreType, NIBBLETYPE a_BlockMeta, int a_MaxHeight, int a_NumNests, int a_NestSize, cChunkDef::BlockTypes & a_BlockTypes, cChunkDesc::BlockNibbleBytes & a_BlockMetas, int a_Seq) { // This function generates several "nests" of ore, each nest consisting of number of ore blocks relatively adjacent to each other. // It does so by making a random XYZ walk and adding ore along the way in cuboids of different (random) sizes @@ -376,9 +339,10 @@ void cStructGenOreNests::GenerateOre(int a_ChunkX, int a_ChunkZ, BLOCKTYPE a_Ore } int Index = cChunkDef::MakeIndexNoCheck(BlockX, BlockY, BlockZ); - if (a_BlockTypes[Index] == E_BLOCK_STONE) + if (a_BlockTypes[Index] == m_ToReplace) { a_BlockTypes[Index] = a_OreType; + a_BlockMetas[Index] = a_BlockMeta; } Num++; } // for z @@ -585,10 +549,10 @@ void cStructGenDirectOverhangs::GenFinish(cChunkDesc & a_ChunkDesc) // First update the high floor: for (int z = 0; z <= 16 / INTERPOL_Z; z++) for (int x = 0; x <= 16 / INTERPOL_X; x++) { - FloorHi[INTERPOL_X * x + 17 * INTERPOL_Z * z] = + FloorHi[INTERPOL_X * x + 17 * INTERPOL_Z * z] = ( m_Noise1.IntNoise3DInt(BaseX + INTERPOL_X * x, Segment + SEGMENT_HEIGHT, BaseZ + INTERPOL_Z * z) * - m_Noise2.IntNoise3DInt(BaseX + INTERPOL_Z * x, Segment + SEGMENT_HEIGHT, BaseZ + INTERPOL_Z * z) / - 256; + m_Noise2.IntNoise3DInt(BaseX + INTERPOL_Z * x, Segment + SEGMENT_HEIGHT, BaseZ + INTERPOL_Z * z) / 256 + ); } // for x, z - FloorLo[] LinearUpscale2DArrayInPlace<17, 17, INTERPOL_X, INTERPOL_Z>(FloorHi); diff --git a/src/Generating/StructGen.h b/src/Generating/StructGen.h index 9176bc192..96aa3e437 100644 --- a/src/Generating/StructGen.h +++ b/src/Generating/StructGen.h @@ -76,16 +76,44 @@ class cStructGenOreNests : public cFinishGen { public: - cStructGenOreNests(int a_Seed) : m_Noise(a_Seed), m_Seed(a_Seed) {} - + struct OreInfo + { + BLOCKTYPE BlockType; // The type of the nest. + NIBBLETYPE BlockMeta; // The block meta + int MaxHeight; // The highest possible a nest can occur + int NumNests; // How many nests per chunk + int NestSize; // The amount of blocks a nest can have. + + OreInfo() : + BlockType(0), + BlockMeta(0), + MaxHeight(0), + NumNests(0), + NestSize(0) + { + } + }; + + typedef std::vector<OreInfo> OreList; + + cStructGenOreNests(int a_Seed, OreList a_OreList, BLOCKTYPE a_ToReplace) : + m_Noise(a_Seed), + m_Seed(a_Seed), + m_OreList(a_OreList), + m_ToReplace(a_ToReplace) + {} + protected: - cNoise m_Noise; - int m_Seed; + cNoise m_Noise; + int m_Seed; + + OreList m_OreList; // A list of possible ores. + BLOCKTYPE m_ToReplace; // cFinishGen override: virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; - void GenerateOre(int a_ChunkX, int a_ChunkZ, BLOCKTYPE a_OreType, int a_MaxHeight, int a_NumNests, int a_NestSize, cChunkDef::BlockTypes & a_BlockTypes, int a_Seq); + void GenerateOre(int a_ChunkX, int a_ChunkZ, BLOCKTYPE a_OreType, NIBBLETYPE a_BlockMeta, int a_MaxHeight, int a_NumNests, int a_NestSize, cChunkDef::BlockTypes & a_BlockTypes, cChunkDesc::BlockNibbleBytes & a_BlockMetas, int a_Seq); } ; diff --git a/src/Generating/Trees.cpp b/src/Generating/Trees.cpp index c40322630..7fd6d6f07 100644 --- a/src/Generating/Trees.cpp +++ b/src/Generating/Trees.cpp @@ -181,6 +181,7 @@ void GetTreeImageByBiome(int a_BlockX, int a_BlockY, int a_BlockZ, cNoise & a_No return; } + case biSwamplandM: case biSwampland: { // Swamp trees: @@ -218,14 +219,11 @@ void GetTreeImageByBiome(int a_BlockX, int a_BlockY, int a_BlockZ, cNoise & a_No return; } - case biRoofedForest: case biColdTaiga: case biColdTaigaHills: case biMegaTaiga: case biMegaTaigaHills: case biExtremeHillsPlus: - case biSavanna: - case biSavannaPlateau: case biMesa: case biMesaPlateauF: case biMesaPlateau: @@ -234,17 +232,13 @@ void GetTreeImageByBiome(int a_BlockX, int a_BlockY, int a_BlockZ, cNoise & a_No case biExtremeHillsM: case biFlowerForest: case biTaigaM: - case biSwamplandM: case biIcePlainsSpikes: case biJungleM: case biJungleEdgeM: - case biRoofedForestM: case biColdTaigaM: case biMegaSpruceTaiga: case biMegaSpruceTaigaHills: case biExtremeHillsPlusM: - case biSavannaM: - case biSavannaPlateauM: case biMesaBryce: case biMesaPlateauFM: case biMesaPlateauM: @@ -253,6 +247,22 @@ void GetTreeImageByBiome(int a_BlockX, int a_BlockY, int a_BlockZ, cNoise & a_No GetBirchTreeImage(a_BlockX, a_BlockY, a_BlockZ, a_Noise, a_Seq, a_LogBlocks, a_OtherBlocks); return; } + + case biSavanna: + case biSavannaPlateau: + case biSavannaM: + case biSavannaPlateauM: + { + GetAcaciaTreeImage(a_BlockX, a_BlockY, a_BlockZ, a_Noise, a_Seq, a_LogBlocks, a_OtherBlocks); + return; + } + + case biRoofedForest: + case biRoofedForestM: + { + GetDarkoakTreeImage(a_BlockX, a_BlockY, a_BlockZ, a_Noise, a_Seq, a_LogBlocks, a_OtherBlocks); + return; + } case biDesert: case biDesertHills: @@ -398,7 +408,72 @@ void GetBirchTreeImage(int a_BlockX, int a_BlockY, int a_BlockZ, cNoise & a_Nois void GetAcaciaTreeImage(int a_BlockX, int a_BlockY, int a_BlockZ, cNoise & a_Noise, int a_Seq, sSetBlockVector & a_LogBlocks, sSetBlockVector & a_OtherBlocks) { - // TODO + // Calculate a base height + int Height = 2 + (a_Noise.IntNoise3DInt(a_BlockX, a_BlockY, a_BlockZ) / 11 % 3); + + // Create the trunk + for (int i = 0; i < Height; i++) + { + a_LogBlocks.push_back(sSetBlock(a_BlockX, a_BlockY + i, a_BlockZ, E_BLOCK_NEW_LOG, E_META_NEW_LOG_ACACIA_WOOD)); + } + + // Array with possible directions for a branch to go to. + const Vector3i AvailableDirections[] = + { + { -1, 1, 0 }, { 0, 1, -1 }, + { -1, 1, 1 }, { -1, 1, -1 }, + { 1, 1, 1 }, { 1, 1, -1 }, + { 1, 1, 0 }, { 0, 1, 1 }, + }; + + // Set the starting point of the branch + Vector3i BranchPos = Vector3i(a_BlockX, a_BlockY + Height - 1, a_BlockZ); + + // Get a direction for the trunk to go to. + Vector3i BranchDirection = AvailableDirections[a_Noise.IntNoise3DInt(a_BlockX, a_BlockY, a_BlockZ) % 8]; + + // Calculate a height for the branch between 1 and 3 + int BranchHeight = a_Noise.IntNoise3DInt(a_BlockX, a_BlockY, a_BlockZ) % 3 + 1; + + // Place the logs of the branch. + for (int i = 0; i < BranchHeight; i++) + { + BranchPos = BranchPos + BranchDirection; + a_LogBlocks.push_back(sSetBlock(BranchPos.x, BranchPos.y, BranchPos.z, E_BLOCK_NEW_LOG, E_META_NEW_LOG_ACACIA_WOOD)); + } + + // Add the leaves to the top of the branch + PushCoordBlocks(BranchPos.x, BranchPos.y, BranchPos.z, a_OtherBlocks, BigO2, ARRAYCOUNT(BigO2), E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_ACACIA_WOOD); + PushCoordBlocks(BranchPos.x, BranchPos.y + 1, BranchPos.z, a_OtherBlocks, BigO1, ARRAYCOUNT(BigO1), E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_ACACIA_WOOD); + a_OtherBlocks.push_back(sSetBlock(BranchPos.x, BranchPos.y + 1, BranchPos.z, E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_ACACIA_WOOD)); + + // Choose if we have to add another branch + bool TwoTop = (a_Noise.IntNoise3D(a_BlockX, a_BlockY, a_BlockZ) < 0 ? true : false); + if (!TwoTop) + { + return; + } + + // Reset the starting point of the branch + BranchPos = Vector3i(a_BlockX, a_BlockY + Height - 1, a_BlockZ); + + // Invert the direction of the previous branch. + BranchDirection = Vector3d(-BranchDirection.x, 1, -BranchDirection.z); + + // Calculate a new height for the second branch + BranchHeight = a_Noise.IntNoise3DInt(a_BlockX * a_Seq, a_BlockY * a_Seq * 10, a_BlockZ * a_Seq) % 3 + 1; + + // Place the logs in the same way as the first branch + for (int i = 0; i < BranchHeight; i++) + { + BranchPos = BranchPos + BranchDirection; + a_LogBlocks.push_back(sSetBlock(BranchPos.x, BranchPos.y, BranchPos.z, E_BLOCK_NEW_LOG, E_META_NEW_LOG_ACACIA_WOOD)); + } + + // And add the leaves ontop of the second branch + PushCoordBlocks(BranchPos.x, BranchPos.y, BranchPos.z, a_OtherBlocks, BigO2, ARRAYCOUNT(BigO2), E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_ACACIA_WOOD); + PushCoordBlocks(BranchPos.x, BranchPos.y + 1, BranchPos.z, a_OtherBlocks, BigO1, ARRAYCOUNT(BigO1), E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_ACACIA_WOOD); + a_OtherBlocks.push_back(sSetBlock(BranchPos.x, BranchPos.y + 1, BranchPos.z, E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_ACACIA_WOOD)); } @@ -407,7 +482,60 @@ void GetAcaciaTreeImage(int a_BlockX, int a_BlockY, int a_BlockZ, cNoise & a_Noi void GetDarkoakTreeImage(int a_BlockX, int a_BlockY, int a_BlockZ, cNoise & a_Noise, int a_Seq, sSetBlockVector & a_LogBlocks, sSetBlockVector & a_OtherBlocks) { - // TODO + // Pick a height + int Height = 5 + (a_Noise.IntNoise3DInt(a_BlockX + 32 * a_Seq, a_BlockY, a_BlockZ + 32 * a_Seq) / 11) % 4; + + // Create the trunk + for (int i = 0; i < Height; i++) + { + a_LogBlocks.push_back(sSetBlock(a_BlockX, a_BlockY + i, a_BlockZ, E_BLOCK_NEW_LOG, E_META_NEW_LOG_DARK_OAK_WOOD)); + a_LogBlocks.push_back(sSetBlock(a_BlockX + 1, a_BlockY + i, a_BlockZ, E_BLOCK_NEW_LOG, E_META_NEW_LOG_DARK_OAK_WOOD)); + a_LogBlocks.push_back(sSetBlock(a_BlockX, a_BlockY + i, a_BlockZ + 1, E_BLOCK_NEW_LOG, E_META_NEW_LOG_DARK_OAK_WOOD)); + a_LogBlocks.push_back(sSetBlock(a_BlockX + 1, a_BlockY + i, a_BlockZ + 1, E_BLOCK_NEW_LOG, E_META_NEW_LOG_DARK_OAK_WOOD)); + } + + // Create branches + for (int i = 0; i < 3; i++) + { + int x = (a_Noise.IntNoise3DInt(a_BlockX + 32 * a_Seq, a_BlockY * i, a_BlockZ + 32 * a_Seq) % 3) - 1; + int z = (a_Noise.IntNoise3DInt(a_BlockX - 32 * a_Seq, a_BlockY * i, a_BlockZ - 32 * a_Seq) % 3) - 1; + + // The branches would end up in the trunk. + if ((x >= a_BlockX) && (x <= a_BlockX + 1) && (z >= a_BlockZ) && (z <= a_BlockZ + 1)) + { + NOISE_DATATYPE Val1 = a_Noise.IntNoise2D(x, z); + if (Val1 < 0) + { + x = a_BlockX + ((Val1 < -0.5) ? -1 : 3); + } + else + { + z = a_BlockZ + ((Val1 < 0.5) ? -1 : 3); + } + } + + int y = Height - (a_Noise.IntNoise3DInt(a_BlockX + x, a_BlockY * i, a_BlockZ - z) % (Height - (Height / 4))); + + for (int Y = y; Y < Height; Y++) + { + a_LogBlocks.push_back(sSetBlock(a_BlockX + x, a_BlockY + Y, a_BlockZ + z, E_BLOCK_NEW_LOG, E_META_NEW_LOG_DARK_OAK_WOOD)); + } + } + + int hei = a_BlockY + Height - 2; + + // The lower two leaves layers are BigO4 with log in the middle and possibly corners: + for (int i = 0; i < 2; i++) + { + PushCoordBlocks(a_BlockX, hei, a_BlockZ, a_OtherBlocks, BigO4, ARRAYCOUNT(BigO4), E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_DARK_OAK_WOOD); + PushCornerBlocks(a_BlockX, hei, a_BlockZ, a_Seq, a_Noise, 0x5fffffff, a_OtherBlocks, 3, E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_DARK_OAK_WOOD); + hei++; + } // for i < 2 + + // The top leaves layer is a BigO3 with leaves in the middle and possibly corners: + PushCoordBlocks(a_BlockX, hei, a_BlockZ, a_OtherBlocks, BigO3, ARRAYCOUNT(BigO3), E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_DARK_OAK_WOOD); + PushCornerBlocks(a_BlockX, hei, a_BlockZ, a_Seq, a_Noise, 0x5fffffff, a_OtherBlocks, 3, E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_DARK_OAK_WOOD); + a_OtherBlocks.push_back(sSetBlock(a_BlockX, hei, a_BlockZ, E_BLOCK_NEW_LEAVES, E_META_NEW_LEAVES_DARK_OAK_WOOD)); } diff --git a/src/Generating/Trees.h b/src/Generating/Trees.h index 1f6ac4dff..c9eb7de80 100644 --- a/src/Generating/Trees.h +++ b/src/Generating/Trees.h @@ -28,6 +28,7 @@ logs can overwrite others(leaves), but others shouldn't overwrite logs. This is #define CASE_TREE_ALLOWED_BLOCKS \ case E_BLOCK_AIR: \ case E_BLOCK_LEAVES: \ + case E_BLOCK_NEW_LEAVES: \ case E_BLOCK_SNOW: \ case E_BLOCK_TALL_GRASS: \ case E_BLOCK_DEAD_BUSH: \ @@ -40,6 +41,7 @@ logs can overwrite others(leaves), but others shouldn't overwrite logs. This is /* case E_BLOCK_LEAVES: LEAVES are a special case, they can be overwritten only by log. Handled in cChunkMap::ReplaceTreeBlocks(). */ \ case E_BLOCK_SNOW: \ case E_BLOCK_TALL_GRASS: \ + case E_BLOCK_BIG_FLOWER: \ case E_BLOCK_DEAD_BUSH: \ case E_BLOCK_SAPLING: \ case E_BLOCK_VINES diff --git a/src/Generating/VillageGen.cpp b/src/Generating/VillageGen.cpp index cade923c9..a7f66b75e 100644 --- a/src/Generating/VillageGen.cpp +++ b/src/Generating/VillageGen.cpp @@ -168,7 +168,7 @@ protected: /** The density for this village. Used to refrain from populating all house connectors. Range [0, 100] */ int m_Density; - /** Borders of the vilalge - no item may reach out of this cuboid. */ + /** Borders of the village - no item may reach out of this cuboid. */ cCuboid m_Borders; /** Prefabs to use for buildings */ diff --git a/src/Globals.h b/src/Globals.h index b35af9604..4ee1352eb 100644 --- a/src/Globals.h +++ b/src/Globals.h @@ -51,6 +51,9 @@ #define NORETURN __declspec(noreturn) + // Use non-standard defines in <cmath> + #define _USE_MATH_DEFINES + #elif defined(__GNUC__) // TODO: Can GCC explicitly mark classes as abstract (no instances can be created)? @@ -156,14 +159,23 @@ template class SizeChecker<UInt64, 8>; template class SizeChecker<UInt32, 4>; template class SizeChecker<UInt16, 2>; -// A macro to disallow the copy constructor and operator= functions +// A macro to disallow the copy constructor and operator = functions // This should be used in the private: declarations for any class that shouldn't allow copying itself #define DISALLOW_COPY_AND_ASSIGN(TypeName) \ TypeName(const TypeName &); \ - void operator=(const TypeName &) + void operator =(const TypeName &) + +// A macro that is used to mark unused local variables, to avoid pedantic warnings in gcc / clang / MSVC +// Note that in MSVC it requires the full type of X to be known +#define UNUSED_VAR(X) (void)(X) // A macro that is used to mark unused function parameters, to avoid pedantic warnings in gcc -#define UNUSED(X) (void)(X) +// Written so that the full type of param needn't be known +#ifdef _MSC_VER + #define UNUSED(X) +#else + #define UNUSED UNUSED_VAR +#endif @@ -217,10 +229,10 @@ template class SizeChecker<UInt16, 2>; // CRT stuff: #include <sys/stat.h> -#include <assert.h> -#include <stdio.h> -#include <math.h> -#include <stdarg.h> +#include <cassert> +#include <cstdio> +#include <cmath> +#include <cstdarg> @@ -249,7 +261,7 @@ template class SizeChecker<UInt16, 2>; #include "OSSupport/Event.h" #include "OSSupport/Thread.h" #include "OSSupport/File.h" - #include "MCLogger.h" + #include "Logger.h" #else // Logging functions void inline LOGERROR(const char* a_Format, ...) FORMATSTRING(1, 2); @@ -261,6 +273,27 @@ void inline LOGERROR(const char* a_Format, ...) vprintf(a_Format, argList); va_end(argList); } + +void inline LOGWARNING(const char* a_Format, ...) FORMATSTRING(1, 2); + +void inline LOGWARNING(const char* a_Format, ...) +{ + va_list argList; + va_start(argList, a_Format); + vprintf(a_Format, argList); + va_end(argList); +} + +void inline LOGD(const char* a_Format, ...) FORMATSTRING(1, 2); + +void inline LOGD(const char* a_Format, ...) +{ + va_list argList; + va_start(argList, a_Format); + vprintf(a_Format, argList); + va_end(argList); +} + #endif @@ -370,6 +403,24 @@ T Clamp(T a_Value, T a_Min, T a_Max) +/** Floors a value, then casts it to C (an int by default) */ +template <typename C = int, typename T> +typename std::enable_if<std::is_arithmetic<T>::value, C>::type FloorC(T a_Value) +{ + return static_cast<C>(std::floor(a_Value)); +} + +/** Ceils a value, then casts it to C (an int by default) */ +template <typename C = int, typename T> +typename std::enable_if<std::is_arithmetic<T>::value, C>::type CeilC(T a_Value) +{ + return static_cast<C>(std::ceil(a_Value)); +} + + + + + #ifndef TOLUA_TEMPLATE_BIND #define TOLUA_TEMPLATE_BIND(x) #endif diff --git a/src/Group.cpp b/src/Group.cpp deleted file mode 100644 index def585618..000000000 --- a/src/Group.cpp +++ /dev/null @@ -1,41 +0,0 @@ - -#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules - -#include "Group.h" - - - - - -void cGroup::AddCommand( const AString & a_Command) -{ - m_Commands[ a_Command ] = true; -} - - - - - -void cGroup::AddPermission( const AString & a_Permission) -{ - m_Permissions[ a_Permission ] = true; -} - - - - - -void cGroup::InheritFrom( cGroup* a_Group) -{ - m_Inherits.remove( a_Group); - m_Inherits.push_back( a_Group); -} - - - - - -void cGroup::ClearPermission() -{ - m_Permissions.clear(); -} diff --git a/src/Group.h b/src/Group.h deleted file mode 100644 index 5816f8a06..000000000 --- a/src/Group.h +++ /dev/null @@ -1,44 +0,0 @@ - -#pragma once - - - - - -// tolua_begin -class cGroup -{ -public: - // tolua_end - cGroup() {} - ~cGroup() {} - - // tolua_begin - void SetName( const AString & a_Name) { m_Name = a_Name; } - const AString & GetName() const { return m_Name; } - void SetColor( const AString & a_Color) { m_Color = a_Color; } - void AddCommand( const AString & a_Command); - void AddPermission( const AString & a_Permission); - void InheritFrom( cGroup* a_Group); - // tolua_end - - typedef std::map< AString, bool > PermissionMap; - const PermissionMap & GetPermissions() const { return m_Permissions; } - - void ClearPermission(void); - - typedef std::map< AString, bool > CommandMap; - const CommandMap & GetCommands() const { return m_Commands; } - - const AString & GetColor() const { return m_Color; } // tolua_export - - typedef std::list< cGroup* > GroupList; - const GroupList & GetInherits() const { return m_Inherits; } -private: - AString m_Name; - AString m_Color; - - PermissionMap m_Permissions; - CommandMap m_Commands; - GroupList m_Inherits; -}; // tolua_export diff --git a/src/GroupManager.cpp b/src/GroupManager.cpp deleted file mode 100644 index 32c2f1c97..000000000 --- a/src/GroupManager.cpp +++ /dev/null @@ -1,227 +0,0 @@ -#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules - -#include "GroupManager.h" -#include "Group.h" -#include "inifile/iniFile.h" -#include "ChatColor.h" -#include "Root.h" - - - - - -typedef std::map< AString, cGroup* > GroupMap; - - - - - -struct cGroupManager::sGroupManagerState -{ - GroupMap Groups; -}; - - - - - -cGroupManager::~cGroupManager() -{ - for (GroupMap::iterator itr = m_pState->Groups.begin(); itr != m_pState->Groups.end(); ++itr) - { - delete itr->second; - itr->second = NULL; - } - m_pState->Groups.clear(); - - delete m_pState; - m_pState = NULL; -} - - - - - -cGroupManager::cGroupManager() - : m_pState( new sGroupManagerState) -{ - LOGD("-- Loading Groups --"); - - if (!LoadGroups()) - { - LOGWARNING("ERROR: Groups could not load!"); - } - if (!CheckUsers()) - { - LOGWARNING("ERROR: User file could not be found!"); - } - - LOGD("-- Groups Successfully Loaded --"); -} - - - - - -void cGroupManager::GenerateDefaultUsersIni(cIniFile & a_IniFile) -{ - LOGWARN("Regenerating users.ini, all users will be reset"); - a_IniFile.AddHeaderComment(" This file stores the players' groups."); - a_IniFile.AddHeaderComment(" The format is:"); - a_IniFile.AddHeaderComment(" [PlayerName]"); - a_IniFile.AddHeaderComment(" Groups = GroupName1, GroupName2, ..."); - - a_IniFile.WriteFile("users.ini"); -} - - - - - -bool cGroupManager::CheckUsers() -{ - cIniFile IniFile; - if (!IniFile.ReadFile("users.ini")) - { - GenerateDefaultUsersIni(IniFile); - return true; - } - - int NumKeys = IniFile.GetNumKeys(); - for (int i = 0; i < NumKeys; i++) - { - AString Player = IniFile.GetKeyName(i); - AString Groups = IniFile.GetValue(Player, "Groups", ""); - if (Groups.empty()) - { - continue; - } - AStringVector Split = StringSplitAndTrim(Groups, ","); - for (AStringVector::const_iterator itr = Split.begin(), end = Split.end(); itr != end; ++itr) - { - if (!ExistsGroup(*itr)) - { - LOGWARNING("The group %s for player %s was not found!", Split[i].c_str(), Player.c_str()); - } - } // for itr - Split[] - } // for i - ini file keys - // Always return true for now, just but we can handle writefile fails later. - return true; -} - - - - - -bool cGroupManager::LoadGroups() -{ - cIniFile IniFile; - if (!IniFile.ReadFile("groups.ini")) - { - LOGWARNING("Regenerating groups.ini, all groups will be reset"); - IniFile.AddHeaderComment(" This is the MCServer permissions manager groups file"); - IniFile.AddHeaderComment(" It stores all defined groups such as Administrators, Players, or Moderators"); - - IniFile.SetValue("Owner", "Permissions", "*", true); - IniFile.SetValue("Owner", "Color", "2", true); - - IniFile.SetValue("Moderator", "Permissions", "core.time, core.item, core.tpa, core.tpaccept, core.ban, core.unban, core.save-all, core.toggledownfall"); - IniFile.SetValue("Moderator", "Color", "2", true); - IniFile.SetValue("Moderator", "Inherits", "Player", true); - - IniFile.SetValue("Player", "Permissions", "core.portal", true); - IniFile.SetValue("Player", "Color", "f", true); - IniFile.SetValue("Player", "Inherits", "Default", true); - - IniFile.SetValue("Default", "Permissions", "core.help, core.plugins, core.spawn, core.worlds, core.back, core.motd, core.build, core.locate, core.viewdistance", true); - IniFile.SetValue("Default", "Color", "f", true); - - IniFile.WriteFile("groups.ini"); - } - - int NumKeys = IniFile.GetNumKeys(); - for (int i = 0; i < NumKeys; i++) - { - AString KeyName = IniFile.GetKeyName(i); - cGroup * Group = GetGroup(KeyName.c_str()); - - Group->ClearPermission(); // Needed in case the groups are reloaded. - - LOGD("Loading group %s", KeyName.c_str()); - - Group->SetName(KeyName); - AString Color = IniFile.GetValue(KeyName, "Color", "-"); - if ((Color != "-") && (Color.length() >= 1)) - { - Group->SetColor(cChatColor::Delimiter + Color[0]); - } - else - { - Group->SetColor(cChatColor::White); - } - - AString Commands = IniFile.GetValue(KeyName, "Commands", ""); - if (!Commands.empty()) - { - AStringVector Split = StringSplitAndTrim(Commands, ","); - for (size_t i = 0; i < Split.size(); i++) - { - Group->AddCommand(Split[i]); - } - } - - AString Permissions = IniFile.GetValue(KeyName, "Permissions", ""); - if (!Permissions.empty()) - { - AStringVector Split = StringSplitAndTrim(Permissions, ","); - for (size_t i = 0; i < Split.size(); i++) - { - Group->AddPermission(Split[i]); - } - } - - AString Groups = IniFile.GetValue(KeyName, "Inherits", ""); - if (!Groups.empty()) - { - AStringVector Split = StringSplitAndTrim(Groups, ","); - for (size_t i = 0; i < Split.size(); i++) - { - Group->InheritFrom(GetGroup(Split[i].c_str())); - } - } - } - // Always return true, we can handle writefile fails later. - return true; -} - - - - - -bool cGroupManager::ExistsGroup( const AString & a_Name) -{ - GroupMap::iterator itr = m_pState->Groups.find( a_Name); - return ( itr != m_pState->Groups.end()); -} - - - - - -cGroup* cGroupManager::GetGroup( const AString & a_Name) -{ - GroupMap::iterator itr = m_pState->Groups.find( a_Name); - if (itr != m_pState->Groups.end()) - { - return itr->second; - } - - cGroup* Group = new cGroup(); - m_pState->Groups[a_Name] = Group; - - return Group; -} - - - - diff --git a/src/GroupManager.h b/src/GroupManager.h deleted file mode 100644 index d42b55c4a..000000000 --- a/src/GroupManager.h +++ /dev/null @@ -1,36 +0,0 @@ - -#pragma once - - - - - -class cGroup; - - - - - -class cGroupManager -{ -public: - bool ExistsGroup(const AString & a_Name); - cGroup * GetGroup(const AString & a_Name); - bool LoadGroups(); - bool CheckUsers(); - - /** Writes the default header to the specified ini file, and saves it as "users.ini". */ - static void GenerateDefaultUsersIni(cIniFile & a_IniFile); - -private: - friend class cRoot; - cGroupManager(); - ~cGroupManager(); - - struct sGroupManagerState; - sGroupManagerState * m_pState; -} ; - - - - diff --git a/src/HTTPServer/HTTPConnection.cpp b/src/HTTPServer/HTTPConnection.cpp index b9c762e7c..bf46bb241 100644 --- a/src/HTTPServer/HTTPConnection.cpp +++ b/src/HTTPServer/HTTPConnection.cpp @@ -15,7 +15,8 @@ cHTTPConnection::cHTTPConnection(cHTTPServer & a_HTTPServer) : m_HTTPServer(a_HTTPServer), m_State(wcsRecvHeaders), - m_CurrentRequest(NULL) + m_CurrentRequest(NULL), + m_CurrentRequestBodyRemaining(0) { // LOGD("HTTP: New connection at %p", this); } diff --git a/src/HTTPServer/HTTPFormParser.cpp b/src/HTTPServer/HTTPFormParser.cpp index 9ddfb82f1..c50c6dcf2 100644 --- a/src/HTTPServer/HTTPFormParser.cpp +++ b/src/HTTPServer/HTTPFormParser.cpp @@ -15,7 +15,9 @@ cHTTPFormParser::cHTTPFormParser(cHTTPRequest & a_Request, cCallbacks & a_Callbacks) : m_Callbacks(a_Callbacks), - m_IsValid(true) + m_IsValid(true), + m_IsCurrentPartFile(false), + m_FileHasBeenAnnounced(false) { if (a_Request.GetMethod() == "GET") { @@ -55,7 +57,9 @@ cHTTPFormParser::cHTTPFormParser(cHTTPRequest & a_Request, cCallbacks & a_Callba cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, size_t a_Size, cCallbacks & a_Callbacks) : m_Callbacks(a_Callbacks), m_Kind(a_Kind), - m_IsValid(true) + m_IsValid(true), + m_IsCurrentPartFile(false), + m_FileHasBeenAnnounced(false) { Parse(a_Data, a_Size); } diff --git a/src/HTTPServer/HTTPMessage.cpp b/src/HTTPServer/HTTPMessage.cpp index 4226352e9..65d73fd87 100644 --- a/src/HTTPServer/HTTPMessage.cpp +++ b/src/HTTPServer/HTTPMessage.cpp @@ -35,8 +35,7 @@ cHTTPMessage::cHTTPMessage(eKind a_Kind) : void cHTTPMessage::AddHeader(const AString & a_Key, const AString & a_Value) { - AString Key = a_Key; - StrToLower(Key); + AString Key = StrToLower(a_Key); cNameValueMap::iterator itr = m_Headers.find(Key); if (itr == m_Headers.end()) { diff --git a/src/HTTPServer/HTTPMessage.h b/src/HTTPServer/HTTPMessage.h index e402c8ad6..c0667030f 100644 --- a/src/HTTPServer/HTTPMessage.h +++ b/src/HTTPServer/HTTPMessage.h @@ -18,7 +18,7 @@ class cHTTPMessage { public: - enum + enum eStatus { HTTP_OK = 200, HTTP_BAD_REQUEST = 400, diff --git a/src/HTTPServer/HTTPServer.cpp b/src/HTTPServer/HTTPServer.cpp index 8eabe5cb2..0c41b54b2 100644 --- a/src/HTTPServer/HTTPServer.cpp +++ b/src/HTTPServer/HTTPServer.cpp @@ -170,7 +170,8 @@ bool cHTTPServer::Initialize(const AString & a_PortsIPv4, const AString & a_Port // Notify the admin about the HTTPS / HTTP status if (m_Cert.get() == NULL) { - LOGWARNING("WebServer: The server is running in unsecure HTTP mode."); + LOGWARNING("WebServer: The server is running in unsecured HTTP mode."); + LOGINFO("Put a valid HTTPS certificate in file 'webadmin/httpscert.crt' and its corresponding private key to 'webadmin/httpskey.pem' (without any password) to enable HTTPS support"); } else { diff --git a/src/Inventory.cpp b/src/Inventory.cpp index 8da3dea5f..832a079bc 100644 --- a/src/Inventory.cpp +++ b/src/Inventory.cpp @@ -106,7 +106,7 @@ int cInventory::AddItem(const cItem & a_Item, bool a_AllowNewStacks, bool a_tryT // When the item is a armor, try to set it directly to the armor slot. if (ItemCategory::IsArmor(a_Item.m_ItemType)) { - for (size_t i = 0; i < (size_t)m_ArmorSlots.GetNumSlots(); i++) + for (int i = 0; i < m_ArmorSlots.GetNumSlots(); i++) { if (m_ArmorSlots.GetSlot(i).IsEmpty() && cSlotAreaArmor::CanPlaceArmorInSlot(i, a_Item)) { diff --git a/src/Inventory.h b/src/Inventory.h index ed134aee4..5628fb0da 100644 --- a/src/Inventory.h +++ b/src/Inventory.h @@ -39,8 +39,8 @@ public: enum { invArmorCount = 4, - invInventoryCount = 9 * 3, - invHotbarCount = 9, + invInventoryCount = 9 * 3, + invHotbarCount = 9, invArmorOffset = 0, invInventoryOffset = invArmorOffset + invArmorCount, diff --git a/src/Item.cpp b/src/Item.cpp index 2c5deaddf..ebdf99ca5 100644 --- a/src/Item.cpp +++ b/src/Item.cpp @@ -190,31 +190,35 @@ void cItem::FromJson(const Json::Value & a_Value) -bool cItem::IsEnchantable(short item) +bool cItem::IsEnchantable(short a_ItemType, bool a_WithBook) { - if ((item >= 256) && (item <= 259)) + if ( + ItemCategory::IsAxe(a_ItemType) || + ItemCategory::IsSword(a_ItemType) || + ItemCategory::IsShovel(a_ItemType) || + ItemCategory::IsPickaxe(a_ItemType) || + (a_WithBook && ItemCategory::IsHoe(a_ItemType)) || + ItemCategory::IsArmor(a_ItemType) + ) { return true; } - if ((item >= 267) && (item <= 279)) - { - return true; - } - if ((item >= 283) && (item <= 286)) - { - return true; - } - if ((item >= 290) && (item <= 294)) - { - return true; - } - if ((item >= 298) && (item <= 317)) - { - return true; - } - if ((item == 346) || (item == 359) || (item == 261)) + + switch (a_ItemType) { - return true; + case E_ITEM_BOOK: + case E_ITEM_BOW: + case E_ITEM_FISHING_ROD: + { + return true; + } + + case E_ITEM_CARROT_ON_STICK: + case E_ITEM_SHEARS: + case E_ITEM_FLINT_AND_STEEL: + { + return a_WithBook; + } } return false; @@ -299,73 +303,77 @@ int cItem::GetEnchantability() bool cItem::EnchantByXPLevels(int a_NumXPLevels) { - if (!cItem::IsEnchantable(m_ItemType) && (m_ItemType != E_ITEM_BOOK)) + if (!cItem::IsEnchantable(m_ItemType)) { return false; } int Enchantability = GetEnchantability(); + if (Enchantability == 0) + { + return false; + } cFastRandom Random; int ModifiedEnchantmentLevel = a_NumXPLevels + (int)Random.NextFloat((float)Enchantability / 4) + (int)Random.NextFloat((float)Enchantability / 4) + 1; float RandomBonus = 1.0F + (Random.NextFloat(1) + Random.NextFloat(1) - 1.0F) * 0.15F; int FinalEnchantmentLevel = (int)(ModifiedEnchantmentLevel * RandomBonus + 0.5F); - cWeightedEnchantments enchantments; - cEnchantments::AddItemEnchantmentWeights(enchantments, m_ItemType, FinalEnchantmentLevel); + cWeightedEnchantments Enchantments; + cEnchantments::AddItemEnchantmentWeights(Enchantments, m_ItemType, FinalEnchantmentLevel); if (m_ItemType == E_ITEM_BOOK) { m_ItemType = E_ITEM_ENCHANTED_BOOK; } - cEnchantments Enchantment1 = cEnchantments::GetRandomEnchantmentFromVector(enchantments); + cEnchantments Enchantment1 = cEnchantments::GetRandomEnchantmentFromVector(Enchantments); m_Enchantments.AddFromString(Enchantment1.ToString()); - cEnchantments::RemoveEnchantmentWeightFromVector(enchantments, Enchantment1); + cEnchantments::RemoveEnchantmentWeightFromVector(Enchantments, Enchantment1); // Checking for conflicting enchantments - cEnchantments::CheckEnchantmentConflictsFromVector(enchantments, Enchantment1); + cEnchantments::CheckEnchantmentConflictsFromVector(Enchantments, Enchantment1); float NewEnchantmentLevel = (float)a_NumXPLevels; // Next Enchantment (Second) NewEnchantmentLevel = NewEnchantmentLevel / 2; float SecondEnchantmentChance = (NewEnchantmentLevel + 1) / 50 * 100; - if (enchantments.empty() || (Random.NextFloat(100) > SecondEnchantmentChance)) + if (Enchantments.empty() || (Random.NextFloat(100) > SecondEnchantmentChance)) { return true; } - cEnchantments Enchantment2 = cEnchantments::GetRandomEnchantmentFromVector(enchantments); + cEnchantments Enchantment2 = cEnchantments::GetRandomEnchantmentFromVector(Enchantments); m_Enchantments.AddFromString(Enchantment2.ToString()); - cEnchantments::RemoveEnchantmentWeightFromVector(enchantments, Enchantment2); + cEnchantments::RemoveEnchantmentWeightFromVector(Enchantments, Enchantment2); // Checking for conflicting enchantments - cEnchantments::CheckEnchantmentConflictsFromVector(enchantments, Enchantment2); + cEnchantments::CheckEnchantmentConflictsFromVector(Enchantments, Enchantment2); // Next Enchantment (Third) NewEnchantmentLevel = NewEnchantmentLevel / 2; float ThirdEnchantmentChance = (NewEnchantmentLevel + 1) / 50 * 100; - if (enchantments.empty() || (Random.NextFloat(100) > ThirdEnchantmentChance)) + if (Enchantments.empty() || (Random.NextFloat(100) > ThirdEnchantmentChance)) { return true; } - cEnchantments Enchantment3 = cEnchantments::GetRandomEnchantmentFromVector(enchantments); + cEnchantments Enchantment3 = cEnchantments::GetRandomEnchantmentFromVector(Enchantments); m_Enchantments.AddFromString(Enchantment3.ToString()); - cEnchantments::RemoveEnchantmentWeightFromVector(enchantments, Enchantment3); + cEnchantments::RemoveEnchantmentWeightFromVector(Enchantments, Enchantment3); // Checking for conflicting enchantments - cEnchantments::CheckEnchantmentConflictsFromVector(enchantments, Enchantment3); + cEnchantments::CheckEnchantmentConflictsFromVector(Enchantments, Enchantment3); // Next Enchantment (Fourth) NewEnchantmentLevel = NewEnchantmentLevel / 2; float FourthEnchantmentChance = (NewEnchantmentLevel + 1) / 50 * 100; - if (enchantments.empty() || (Random.NextFloat(100) > FourthEnchantmentChance)) + if (Enchantments.empty() || (Random.NextFloat(100) > FourthEnchantmentChance)) { return true; } - cEnchantments Enchantment4 = cEnchantments::GetRandomEnchantmentFromVector(enchantments); + cEnchantments Enchantment4 = cEnchantments::GetRandomEnchantmentFromVector(Enchantments); m_Enchantments.AddFromString(Enchantment4.ToString()); return true; diff --git a/src/Item.h b/src/Item.h index d8b9e78a0..056b5eb8a 100644 --- a/src/Item.h +++ b/src/Item.h @@ -183,8 +183,10 @@ public: /** Loads the item data from JSON representation */ void FromJson(const Json::Value & a_Value); - /** Returns true if the specified item type is enchantable (as per 1.2.5 protocol requirements) */ - static bool IsEnchantable(short a_ItemType); // tolua_export + /** Returns true if the specified item type is enchantable. + If WithBook is true, the function is used in the anvil inventory with book enchantments. + So it checks the "only book enchantments" too. Example: You can only enchant a hoe with a book. */ + static bool IsEnchantable(short a_ItemType, bool a_WithBook = false); // tolua_export /** Returns the enchantability of the item. When the item hasn't a enchantability, it will returns 0 */ int GetEnchantability(); // tolua_export diff --git a/src/Items/ItemBow.h b/src/Items/ItemBow.h index e7a77dcbc..f29cc5d59 100644 --- a/src/Items/ItemBow.h +++ b/src/Items/ItemBow.h @@ -57,6 +57,12 @@ public: } Force = std::min(Force, 1.0); + // Does the player have an arrow? + if (!a_Player->IsGameModeCreative() && !a_Player->GetInventory().HasItems(cItem(E_ITEM_ARROW))) + { + return; + } + // Create the arrow entity: cArrowEntity * Arrow = new cArrowEntity(*a_Player, Force * 2); if (Arrow == NULL) @@ -69,12 +75,26 @@ public: Arrow = NULL; return; } - a_Player->GetWorld()->BroadcastSoundEffect("random.bow", a_Player->GetPosX(), a_Player->GetPosY(), a_Player->GetPosZ(), 0.5, (float)Force); if (!a_Player->IsGameModeCreative()) { + if (a_Player->GetEquippedItem().m_Enchantments.GetLevel(cEnchantments::enchInfinity) == 0) + { + a_Player->GetInventory().RemoveItem(cItem(E_ITEM_ARROW)); + } + else + { + Arrow->SetPickupState(cArrowEntity::psNoPickup); + } + + a_Player->UseEquippedItem(); } + + if (a_Player->GetEquippedItem().m_Enchantments.GetLevel(cEnchantments::enchFlame) > 0) + { + Arrow->StartBurning(100); + } } } ; diff --git a/src/Items/ItemBucket.h b/src/Items/ItemBucket.h index a17c4838b..3a533958f 100644 --- a/src/Items/ItemBucket.h +++ b/src/Items/ItemBucket.h @@ -7,6 +7,7 @@ #include "../Blocks/BlockHandler.h" #include "../LineBlockTracer.h" #include "../BlockInServerPluginInterface.h" +#include "../Blocks/ChunkInterface.h" diff --git a/src/Items/ItemDoor.h b/src/Items/ItemDoor.h index c1b439024..cd5baf44f 100644 --- a/src/Items/ItemDoor.h +++ b/src/Items/ItemDoor.h @@ -30,7 +30,22 @@ public: BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta ) override { - a_BlockType = (m_ItemType == E_ITEM_WOODEN_DOOR) ? E_BLOCK_WOODEN_DOOR : E_BLOCK_IRON_DOOR; + switch (m_ItemType) + { + case E_ITEM_WOODEN_DOOR: a_BlockType = E_BLOCK_WOODEN_DOOR; break; + case E_ITEM_IRON_DOOR: a_BlockType = E_BLOCK_IRON_DOOR; break; + case E_ITEM_SPRUCE_DOOR: a_BlockType = E_BLOCK_SPRUCE_DOOR; break; + case E_ITEM_BIRCH_DOOR: a_BlockType = E_BLOCK_BIRCH_DOOR; break; + case E_ITEM_JUNGLE_DOOR: a_BlockType = E_BLOCK_JUNGLE_DOOR; break; + case E_ITEM_DARK_OAK_DOOR: a_BlockType = E_BLOCK_DARK_OAK_DOOR; break; + case E_ITEM_ACACIA_DOOR: a_BlockType = E_BLOCK_ACACIA_DOOR; break; + default: + { + ASSERT(!"Unhandled door type"); + return false; + } + } + cChunkInterface ChunkInterface(a_World->GetChunkMap()); bool Meta = BlockHandler(a_BlockType)->GetPlacementBlockTypeMeta( ChunkInterface, a_Player, diff --git a/src/Items/ItemFood.h b/src/Items/ItemFood.h index ff1d7991b..e7c718c77 100644 --- a/src/Items/ItemFood.h +++ b/src/Items/ItemFood.h @@ -1,3 +1,4 @@ + #pragma once #include "ItemHandler.h" @@ -29,33 +30,77 @@ public: switch (m_ItemType) { // Please keep alpha-sorted. - case E_ITEM_BAKED_POTATO: return FoodInfo(6, 7.2); + case E_ITEM_BAKED_POTATO: return FoodInfo(5, 7.2); case E_ITEM_BREAD: return FoodInfo(5, 6); // Carrots handled in ItemSeeds case E_ITEM_COOKED_CHICKEN: return FoodInfo(6, 7.2); - case E_ITEM_COOKED_FISH: return FoodInfo(5, 6); + case E_ITEM_COOKED_FISH: return FoodInfo(5, 6); // TODO: Add other fish types + case E_ITEM_COOKED_MUTTON: return FoodInfo(6, 9.6); case E_ITEM_COOKED_PORKCHOP: return FoodInfo(8, 12.8); + case E_ITEM_COOKED_RABBIT: return FoodInfo(5, 6); case E_ITEM_COOKIE: return FoodInfo(2, 0.4); - case E_ITEM_GOLDEN_APPLE: return FoodInfo(4, 9.6); + // Golden apple handled in ItemGoldenApple case E_ITEM_GOLDEN_CARROT: return FoodInfo(6, 14.4); case E_ITEM_MELON_SLICE: return FoodInfo(2, 1.2); - case E_ITEM_MUSHROOM_SOUP: return FoodInfo(6, 7.2); - case E_ITEM_POISONOUS_POTATO: return FoodInfo(2, 1.2, 60); + case E_ITEM_POISONOUS_POTATO: return FoodInfo(2, 1.2); // Potatoes handled in ItemSeeds case E_ITEM_PUMPKIN_PIE: return FoodInfo(8, 4.8); + case E_ITEM_RABBIT_STEW: return FoodInfo(10, 12); + case E_ITEM_RED_APPLE: return FoodInfo(4, 2.4); case E_ITEM_RAW_BEEF: return FoodInfo(3, 1.8); - case E_ITEM_RAW_CHICKEN: return FoodInfo(2, 1.2, 30); + case E_ITEM_RAW_CHICKEN: return FoodInfo(2, 1.2); case E_ITEM_RAW_FISH: return FoodInfo(2, 1.2); + case E_ITEM_RAW_MUTTON: return FoodInfo(2, 1.2); case E_ITEM_RAW_PORKCHOP: return FoodInfo(3, 1.8); - case E_ITEM_RED_APPLE: return FoodInfo(4, 2.4); - case E_ITEM_ROTTEN_FLESH: return FoodInfo(4, 0.8, 80); - case E_ITEM_SPIDER_EYE: return FoodInfo(2, 3.2, 100); + case E_ITEM_RAW_RABBIT: return FoodInfo(3, 1.8); + case E_ITEM_ROTTEN_FLESH: return FoodInfo(4, 0.8); + case E_ITEM_SPIDER_EYE: return FoodInfo(2, 3.2); case E_ITEM_STEAK: return FoodInfo(8, 12.8); } LOGWARNING("%s: Unknown food item (%d), returning zero nutrition", __FUNCTION__, m_ItemType); return FoodInfo(0, 0.f); } - + + virtual bool GetEatEffect(cEntityEffect::eType & a_EffectType, int & a_EffectDurationTicks, short & a_EffectIntensity, float & a_Chance) override + { + switch (m_ItemType) + { + case E_ITEM_RAW_CHICKEN: + { + a_EffectType = cEntityEffect::effHunger; + a_EffectDurationTicks = 600; + a_EffectIntensity = 0; + a_Chance = 0.3f; + return true; + } + case E_ITEM_ROTTEN_FLESH: + { + a_EffectType = cEntityEffect::effHunger; + a_EffectDurationTicks = 600; + a_EffectIntensity = 0; + a_Chance = 0.8f; + return true; + } + case E_ITEM_SPIDER_EYE: + { + a_EffectType = cEntityEffect::effPoison; + a_EffectDurationTicks = 100; + a_EffectIntensity = 0; + a_Chance = 1.0f; + return true; + } + case E_ITEM_POISONOUS_POTATO: + { + a_EffectType = cEntityEffect::effPoison; + a_EffectDurationTicks = 100; + a_EffectIntensity = 0; + a_Chance = 0.6f; + return true; + } + } + return false; + } + }; diff --git a/src/Items/ItemGoldenApple.h b/src/Items/ItemGoldenApple.h new file mode 100644 index 000000000..5f6f1de6c --- /dev/null +++ b/src/Items/ItemGoldenApple.h @@ -0,0 +1,59 @@ +#pragma once + +#include "ItemFood.h" + + + + + +class cItemGoldenAppleHandler : + public cItemFoodHandler +{ + typedef cItemFoodHandler super; + +public: + cItemGoldenAppleHandler() + : super(E_ITEM_GOLDEN_APPLE) + { + } + + + virtual bool EatItem(cPlayer * a_Player, cItem * a_Item) override + { + // Feed the player: + FoodInfo Info = GetFoodInfo(); + a_Player->Feed(Info.FoodLevel, Info.Saturation); + + // Add the effects: + a_Player->AddEntityEffect(cEntityEffect::effAbsorption, 2400, 0); + a_Player->AddEntityEffect(cEntityEffect::effRegeneration, 100, 1); + + // When the apple is a 'notch apple', give extra effects: + if (a_Item->m_ItemDamage >= E_META_GOLDEN_APPLE_ENCHANTED) + { + a_Player->AddEntityEffect(cEntityEffect::effRegeneration, 600, 4); + a_Player->AddEntityEffect(cEntityEffect::effResistance, 6000, 0); + a_Player->AddEntityEffect(cEntityEffect::effFireResistance, 6000, 0); + } + + a_Player->GetInventory().RemoveOneEquippedItem(); + return true; + } + + + virtual FoodInfo GetFoodInfo(void) override + { + return FoodInfo(4, 9.6); + } + + + virtual bool GetEatEffect(cEntityEffect::eType & a_EffectType, int & a_EffectDurationTicks, short & a_EffectIntensity, float & a_Chance) override + { + return false; + } + +}; + + + + diff --git a/src/Items/ItemHandler.cpp b/src/Items/ItemHandler.cpp index d36b5d663..912dde022 100644 --- a/src/Items/ItemHandler.cpp +++ b/src/Items/ItemHandler.cpp @@ -25,6 +25,7 @@ #include "ItemFishingRod.h" #include "ItemFlowerPot.h" #include "ItemFood.h" +#include "ItemGoldenApple.h" #include "ItemItemFrame.h" #include "ItemHoe.h" #include "ItemLeaves.h" @@ -32,6 +33,7 @@ #include "ItemLilypad.h" #include "ItemMap.h" #include "ItemMinecart.h" +#include "ItemMushroomSoup.h" #include "ItemNetherWart.h" #include "ItemPainting.h" #include "ItemPickaxe.h" @@ -65,7 +67,7 @@ cItemHandler * cItemHandler::m_ItemHandler[2268]; cItemHandler * cItemHandler::GetItemHandler(int a_ItemType) { - if ((a_ItemType < 0) || ((unsigned long)a_ItemType >= ARRAYCOUNT(m_ItemHandler))) + if ((a_ItemType < 0) || ((size_t)a_ItemType >= ARRAYCOUNT(m_ItemHandler))) { // Either nothing (-1), or bad value, both cases should return the air handler if (a_ItemType < -1) @@ -106,7 +108,7 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType) case E_ITEM_BED: return new cItemBedHandler(a_ItemType); case E_ITEM_BOAT: return new cItemBoatHandler(a_ItemType); case E_ITEM_BOTTLE_O_ENCHANTING: return new cItemBottleOEnchantingHandler(); - case E_ITEM_BOW: return new cItemBowHandler; + case E_ITEM_BOW: return new cItemBowHandler(); case E_ITEM_BREWING_STAND: return new cItemBrewingStandHandler(a_ItemType); case E_ITEM_CAKE: return new cItemCakeHandler(a_ItemType); case E_ITEM_CAULDRON: return new cItemCauldronHandler(a_ItemType); @@ -120,9 +122,11 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType) case E_ITEM_FISHING_ROD: return new cItemFishingRodHandler(a_ItemType); case E_ITEM_FLINT_AND_STEEL: return new cItemLighterHandler(a_ItemType); case E_ITEM_FLOWER_POT: return new cItemFlowerPotHandler(a_ItemType); + case E_ITEM_GOLDEN_APPLE: return new cItemGoldenAppleHandler(); case E_BLOCK_LILY_PAD: return new cItemLilypadHandler(a_ItemType); case E_ITEM_MAP: return new cItemMapHandler(); case E_ITEM_MILK: return new cItemMilkHandler(); + case E_ITEM_MUSHROOM_SOUP: return new cItemMushroomSoupHandler(a_ItemType); case E_ITEM_ITEM_FRAME: return new cItemItemFrameHandler(a_ItemType); case E_ITEM_NETHER_WART: return new cItemNetherWartHandler(a_ItemType); case E_ITEM_PAINTING: return new cItemPaintingHandler(a_ItemType); @@ -189,6 +193,11 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType) return new cItemSeedsHandler(a_ItemType); } + case E_ITEM_ACACIA_DOOR: + case E_ITEM_BIRCH_DOOR: + case E_ITEM_DARK_OAK_DOOR: + case E_ITEM_JUNGLE_DOOR: + case E_ITEM_SPRUCE_DOOR: case E_ITEM_IRON_DOOR: case E_ITEM_WOODEN_DOOR: { @@ -205,23 +214,26 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType) } // Food (please keep alpha-sorted): - // (carrots and potatoes handled in SeedHandler as both seed and food + // (carrots and potatoes handled separately in SeedHandler as they're both seed and food) case E_ITEM_BAKED_POTATO: case E_ITEM_BREAD: case E_ITEM_COOKED_CHICKEN: case E_ITEM_COOKED_FISH: + case E_ITEM_COOKED_MUTTON: case E_ITEM_COOKED_PORKCHOP: + case E_ITEM_COOKED_RABBIT: case E_ITEM_COOKIE: - case E_ITEM_GOLDEN_APPLE: case E_ITEM_GOLDEN_CARROT: case E_ITEM_MELON_SLICE: - case E_ITEM_MUSHROOM_SOUP: case E_ITEM_POISONOUS_POTATO: case E_ITEM_PUMPKIN_PIE: + case E_ITEM_RABBIT_STEW: case E_ITEM_RAW_BEEF: case E_ITEM_RAW_CHICKEN: case E_ITEM_RAW_FISH: + case E_ITEM_RAW_MUTTON: case E_ITEM_RAW_PORKCHOP: + case E_ITEM_RAW_RABBIT: case E_ITEM_RED_APPLE: case E_ITEM_ROTTEN_FLESH: case E_ITEM_SPIDER_EYE: @@ -330,7 +342,7 @@ void cItemHandler::OnBlockDestroyed(cWorld * a_World, cPlayer * a_Player, const { cChunkInterface ChunkInterface(a_World->GetChunkMap()); cBlockInServerPluginInterface PluginInterface(*a_World); - Handler->DropBlock(ChunkInterface, *a_World, PluginInterface, a_Player, a_BlockX, a_BlockY, a_BlockZ, CanHarvestBlock(Block), a_Player->GetEquippedItem().m_Enchantments.GetLevel(cEnchantments::enchSilkTouch) > 0); + Handler->DropBlock(ChunkInterface, *a_World, PluginInterface, a_Player, a_BlockX, a_BlockY, a_BlockZ, CanHarvestBlock(Block)); } if (!cBlockInfo::IsOneHitDig(Block)) @@ -388,8 +400,12 @@ char cItemHandler::GetMaxStackSize(void) switch (m_ItemType) { + case E_ITEM_ACACIA_DOOR: return 64; + case E_ITEM_ARMOR_STAND: return 16; case E_ITEM_ARROW: return 64; case E_ITEM_BAKED_POTATO: return 64; + case E_ITEM_BANNER: return 16; + case E_ITEM_BIRCH_DOOR: return 64; case E_ITEM_BLAZE_POWDER: return 64; case E_ITEM_BLAZE_ROD: return 64; case E_ITEM_BONE: return 64; @@ -400,7 +416,6 @@ char cItemHandler::GetMaxStackSize(void) case E_ITEM_BREWING_STAND: return 64; case E_ITEM_BUCKET: return 16; case E_ITEM_CARROT: return 64; - case E_ITEM_CAKE: return 1; case E_ITEM_CAULDRON: return 64; case E_ITEM_CLAY: return 64; case E_ITEM_CLAY_BRICK: return 64; @@ -411,7 +426,9 @@ char cItemHandler::GetMaxStackSize(void) case E_ITEM_COOKED_CHICKEN: return 64; case E_ITEM_COOKED_FISH: return 64; case E_ITEM_COOKED_PORKCHOP: return 64; + case E_ITEM_COOKED_MUTTON: return 64; case E_ITEM_COOKIE: return 64; + case E_ITEM_DARK_OAK_DOOR: return 64; case E_ITEM_DIAMOND: return 64; case E_ITEM_DYE: return 64; case E_ITEM_EGG: return 16; @@ -435,6 +452,7 @@ char cItemHandler::GetMaxStackSize(void) case E_ITEM_GOLD_NUGGET: return 64; case E_ITEM_GUNPOWDER: return 64; case E_ITEM_HEAD: return 64; + case E_ITEM_JUNGLE_DOOR: return 64; case E_ITEM_IRON: return 64; case E_ITEM_ITEM_FRAME: return 64; case E_ITEM_LEATHER: return 64; @@ -448,11 +466,16 @@ char cItemHandler::GetMaxStackSize(void) case E_ITEM_PAPER: return 64; case E_ITEM_POISONOUS_POTATO: return 64; case E_ITEM_POTATO: return 64; + case E_ITEM_PRISMARINE_CRYSTALS: return 64; + case E_ITEM_PRISMARINE_SHARD: return 64; case E_ITEM_PUMPKIN_PIE: return 64; case E_ITEM_PUMPKIN_SEEDS: return 64; + case E_ITEM_RABBITS_FOOT: return 64; + case E_ITEM_RABBIT_HIDE: return 64; case E_ITEM_RAW_BEEF: return 64; case E_ITEM_RAW_CHICKEN: return 64; case E_ITEM_RAW_FISH: return 64; + case E_ITEM_RAW_MUTTON: return 64; case E_ITEM_RAW_PORKCHOP: return 64; case E_ITEM_RED_APPLE: return 64; case E_ITEM_REDSTONE_DUST: return 64; @@ -464,6 +487,7 @@ char cItemHandler::GetMaxStackSize(void) case E_ITEM_SNOWBALL: return 16; case E_ITEM_SPAWN_EGG: return 64; case E_ITEM_SPIDER_EYE: return 64; + case E_ITEM_SPRUCE_DOOR: return 64; case E_ITEM_STEAK: return 64; case E_ITEM_STICK: return 64; case E_ITEM_STRING: return 64; @@ -542,41 +566,50 @@ bool cItemHandler::CanHarvestBlock(BLOCKTYPE a_BlockType) switch (a_BlockType) { case E_BLOCK_ANVIL: - case E_BLOCK_ENCHANTMENT_TABLE: - case E_BLOCK_FURNACE: - case E_BLOCK_LIT_FURNACE: + case E_BLOCK_BRICK: + case E_BLOCK_CAULDRON: case E_BLOCK_COAL_ORE: - case E_BLOCK_STONE: case E_BLOCK_COBBLESTONE: - case E_BLOCK_END_STONE: - case E_BLOCK_MOSSY_COBBLESTONE: - case E_BLOCK_SANDSTONE_STAIRS: - case E_BLOCK_SANDSTONE: - case E_BLOCK_STONE_BRICKS: - case E_BLOCK_NETHER_BRICK: - case E_BLOCK_NETHERRACK: - case E_BLOCK_STONE_SLAB: - case E_BLOCK_DOUBLE_STONE_SLAB: - case E_BLOCK_STONE_PRESSURE_PLATE: - case E_BLOCK_BRICK: case E_BLOCK_COBBLESTONE_STAIRS: case E_BLOCK_COBBLESTONE_WALL: - case E_BLOCK_STONE_BRICK_STAIRS: - case E_BLOCK_NETHER_BRICK_STAIRS: - case E_BLOCK_CAULDRON: - case E_BLOCK_OBSIDIAN: case E_BLOCK_DIAMOND_BLOCK: case E_BLOCK_DIAMOND_ORE: + case E_BLOCK_DOUBLE_NEW_STONE_SLAB: + case E_BLOCK_DOUBLE_STONE_SLAB: + case E_BLOCK_EMERALD_ORE: + case E_BLOCK_ENCHANTMENT_TABLE: + case E_BLOCK_END_STONE: + case E_BLOCK_FURNACE: case E_BLOCK_GOLD_BLOCK: case E_BLOCK_GOLD_ORE: - case E_BLOCK_REDSTONE_ORE: - case E_BLOCK_REDSTONE_ORE_GLOWING: - case E_BLOCK_EMERALD_ORE: case E_BLOCK_IRON_BLOCK: case E_BLOCK_IRON_ORE: - case E_BLOCK_LAPIS_ORE: + case E_BLOCK_IRON_TRAPDOOR: case E_BLOCK_LAPIS_BLOCK: + case E_BLOCK_LAPIS_ORE: + case E_BLOCK_LIT_FURNACE: + case E_BLOCK_MOB_SPAWNER: + case E_BLOCK_MOSSY_COBBLESTONE: + case E_BLOCK_NETHER_BRICK: + case E_BLOCK_NETHER_BRICK_STAIRS: + case E_BLOCK_NETHER_BRICK_FENCE: + case E_BLOCK_NETHERRACK: + case E_BLOCK_NEW_STONE_SLAB: + case E_BLOCK_OBSIDIAN: + case E_BLOCK_PACKED_ICE: + case E_BLOCK_PRISMARINE_BLOCK: + case E_BLOCK_RED_SANDSTONE: + case E_BLOCK_RED_SANDSTONE_STAIRS: + case E_BLOCK_REDSTONE_ORE: + case E_BLOCK_REDSTONE_ORE_GLOWING: + case E_BLOCK_SANDSTONE_STAIRS: + case E_BLOCK_SANDSTONE: case E_BLOCK_SNOW: + case E_BLOCK_STONE: + case E_BLOCK_STONE_BRICKS: + case E_BLOCK_STONE_BRICK_STAIRS: + case E_BLOCK_STONE_PRESSURE_PLATE: + case E_BLOCK_STONE_SLAB: case E_BLOCK_VINES: { return false; @@ -618,29 +651,43 @@ bool cItemHandler::GetPlacementBlockTypeMeta( +bool cItemHandler::GetEatEffect(cEntityEffect::eType & a_EffectType, int & a_EffectDurationTicks, short & a_EffectIntensity, float & a_Chance) +{ + return false; +} + + + + + bool cItemHandler::EatItem(cPlayer * a_Player, cItem * a_Item) { UNUSED(a_Item); - - FoodInfo Info = GetFoodInfo(); + if (!a_Player->IsGameModeCreative()) + { + a_Player->GetInventory().RemoveOneEquippedItem(); + } + FoodInfo Info = GetFoodInfo(); if ((Info.FoodLevel > 0) || (Info.Saturation > 0.f)) { bool Success = a_Player->Feed(Info.FoodLevel, Info.Saturation); - - // If consumed and there's chance of foodpoisoning, do it: - if (Success && (Info.PoisonChance > 0)) + + // Give effects + cEntityEffect::eType EffectType; + int EffectDurationTicks; + short EffectIntensity; + float Chance; + if (Success && GetEatEffect(EffectType, EffectDurationTicks, EffectIntensity, Chance)) { cFastRandom r1; - if ((r1.NextInt(100, a_Player->GetUniqueID()) - Info.PoisonChance) <= 0) + if (r1.NextFloat() < Chance) { - a_Player->FoodPoison(600); // Give the player food poisoning for 30 seconds. + a_Player->AddEntityEffect(EffectType, EffectDurationTicks, EffectIntensity, Chance); } } - return Success; } - return false; } diff --git a/src/Items/ItemHandler.h b/src/Items/ItemHandler.h index 1d5f59f3e..67c250a97 100644 --- a/src/Items/ItemHandler.h +++ b/src/Items/ItemHandler.h @@ -3,6 +3,7 @@ #include "../Defines.h" #include "../Item.h" +#include "../Entities/EntityEffect.h" @@ -71,23 +72,24 @@ public: struct FoodInfo { - double Saturation; int FoodLevel; - int PoisonChance; // 0 - 100, in percent. 0 = no chance of poisoning, 100 = sure poisoning + double Saturation; - FoodInfo(int a_FoodLevel, double a_Saturation, int a_PoisonChance = 0) : - Saturation(a_Saturation), + FoodInfo(int a_FoodLevel, double a_Saturation) : FoodLevel(a_FoodLevel), - PoisonChance(a_PoisonChance) + Saturation(a_Saturation) { } } ; - /** Returns the FoodInfo for this item. (FoodRecovery, Saturation and PoisionChance) */ + /** Returns the FoodInfo for this item. (FoodRecovery and Saturation) */ virtual FoodInfo GetFoodInfo(); - + + /** If this function returns true, it sets the arguments to a effect who will be activated when you eat the item. */ + virtual bool GetEatEffect(cEntityEffect::eType & a_EffectType, int & a_EffectDurationTicks, short & a_EffectIntensity, float & a_Chance); + /** Lets the player eat a selected item. Returns true if the player ate the item */ - virtual bool EatItem(cPlayer *a_Player, cItem *a_Item); + virtual bool EatItem(cPlayer * a_Player, cItem * a_Item); /** Indicates if this item is a tool */ virtual bool IsTool(void); diff --git a/src/Items/ItemHoe.h b/src/Items/ItemHoe.h index 8d0b71478..ae3723323 100644 --- a/src/Items/ItemHoe.h +++ b/src/Items/ItemHoe.h @@ -20,11 +20,40 @@ public: virtual bool OnItemUse(cWorld *a_World, cPlayer *a_Player, const cItem & a_Item, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Dir) override { - BLOCKTYPE Block = a_World->GetBlock(a_BlockX, a_BlockY, a_BlockZ); + if ((a_Dir == BLOCK_FACE_NONE) || (a_BlockY >= cChunkDef::Height)) + { + return false; + } + BLOCKTYPE UpperBlock = a_World->GetBlock(a_BlockX, a_BlockY + 1, a_BlockZ); - if ((Block == E_BLOCK_DIRT) || (Block == E_BLOCK_GRASS)) + BLOCKTYPE Block; + NIBBLETYPE BlockMeta; + a_World->GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, Block, BlockMeta); + + if (((Block == E_BLOCK_DIRT) || (Block == E_BLOCK_GRASS)) && (UpperBlock == E_BLOCK_AIR)) { - a_World->FastSetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_FARMLAND, 0); + BLOCKTYPE NewBlock = E_BLOCK_FARMLAND; + if (Block == E_BLOCK_DIRT) + { + switch (BlockMeta) + { + case E_META_DIRT_COARSE: + { + // Transform to normal dirt + NewBlock = E_BLOCK_DIRT; + break; + } + case E_META_DIRT_PODZOL: + { + // You can't transform this block with a hoe in vanilla + return false; + } + default: break; + } + } + + a_World->FastSetBlock(a_BlockX, a_BlockY, a_BlockZ, NewBlock, 0); + a_World->BroadcastSoundEffect("dig.gravel", a_BlockX + 0.5, a_BlockY + 0.5, a_BlockZ + 0.5, 1.0f, 0.8f); a_Player->UseEquippedItem(); return true; } @@ -41,4 +70,3 @@ public: - diff --git a/src/Items/ItemMilk.h b/src/Items/ItemMilk.h index db7bc13be..c9a90865a 100644 --- a/src/Items/ItemMilk.h +++ b/src/Items/ItemMilk.h @@ -21,8 +21,12 @@ public: { UNUSED(a_Item); a_Player->ClearEntityEffects(); - a_Player->GetInventory().RemoveOneEquippedItem(); - a_Player->GetInventory().AddItem(E_ITEM_BUCKET); + + if (!a_Player->IsGameModeCreative()) + { + a_Player->GetInventory().RemoveOneEquippedItem(); + a_Player->GetInventory().AddItem(E_ITEM_BUCKET); + } return true; } }; diff --git a/src/Items/ItemMushroomSoup.h b/src/Items/ItemMushroomSoup.h new file mode 100644 index 000000000..dba313ec5 --- /dev/null +++ b/src/Items/ItemMushroomSoup.h @@ -0,0 +1,53 @@ + +#pragma once + +#include "ItemHandler.h" + + + + + +class cItemMushroomSoupHandler : + public cItemHandler +{ + typedef cItemHandler super; + +public: + cItemMushroomSoupHandler(int a_ItemType) + : super(a_ItemType) + { + } + + + virtual bool IsFood(void) override + { + return true; + } + + + virtual FoodInfo GetFoodInfo(void) override + { + return FoodInfo(6, 7.2); + } + + + virtual bool EatItem(cPlayer * a_Player, cItem * a_Item) override + { + if (!super::EatItem(a_Player, a_Item)) + { + return false; + } + + // Return a bowl to the inventory + if (!a_Player->IsGameModeCreative()) + { + a_Player->GetInventory().AddItem(cItem(E_ITEM_BOWL), true, true); + } + return true; + } + +}; + + + + diff --git a/src/Items/ItemPickaxe.h b/src/Items/ItemPickaxe.h index 17fd96822..b5dc179f8 100644 --- a/src/Items/ItemPickaxe.h +++ b/src/Items/ItemPickaxe.h @@ -41,11 +41,11 @@ public: case E_BLOCK_DIAMOND_BLOCK: case E_BLOCK_DIAMOND_ORE: + case E_BLOCK_EMERALD_ORE: case E_BLOCK_GOLD_BLOCK: case E_BLOCK_GOLD_ORE: case E_BLOCK_REDSTONE_ORE: case E_BLOCK_REDSTONE_ORE_GLOWING: - case E_BLOCK_EMERALD_ORE: { return PickaxeLevel() >= 3; } @@ -59,28 +59,34 @@ public: } case E_BLOCK_ANVIL: - case E_BLOCK_ENCHANTMENT_TABLE: - case E_BLOCK_FURNACE: - case E_BLOCK_LIT_FURNACE: + case E_BLOCK_BRICK: + case E_BLOCK_CAULDRON: case E_BLOCK_COAL_ORE: - case E_BLOCK_STONE: case E_BLOCK_COBBLESTONE: + case E_BLOCK_COBBLESTONE_STAIRS: + case E_BLOCK_COBBLESTONE_WALL: + case E_BLOCK_DOUBLE_NEW_STONE_SLAB: + case E_BLOCK_DOUBLE_STONE_SLAB: + case E_BLOCK_ENCHANTMENT_TABLE: case E_BLOCK_END_STONE: + case E_BLOCK_FURNACE: + case E_BLOCK_LIT_FURNACE: + case E_BLOCK_MOB_SPAWNER: case E_BLOCK_MOSSY_COBBLESTONE: - case E_BLOCK_SANDSTONE_STAIRS: - case E_BLOCK_SANDSTONE: - case E_BLOCK_STONE_BRICKS: case E_BLOCK_NETHER_BRICK: + case E_BLOCK_NETHER_BRICK_STAIRS: case E_BLOCK_NETHERRACK: - case E_BLOCK_STONE_SLAB: - case E_BLOCK_DOUBLE_STONE_SLAB: - case E_BLOCK_STONE_PRESSURE_PLATE: - case E_BLOCK_BRICK: - case E_BLOCK_COBBLESTONE_STAIRS: - case E_BLOCK_COBBLESTONE_WALL: + case E_BLOCK_NEW_STONE_SLAB: + case E_BLOCK_PRISMARINE_BLOCK: + case E_BLOCK_RED_SANDSTONE: + case E_BLOCK_RED_SANDSTONE_STAIRS: + case E_BLOCK_SANDSTONE: + case E_BLOCK_SANDSTONE_STAIRS: + case E_BLOCK_STONE: + case E_BLOCK_STONE_BRICKS: case E_BLOCK_STONE_BRICK_STAIRS: - case E_BLOCK_NETHER_BRICK_STAIRS: - case E_BLOCK_CAULDRON: + case E_BLOCK_STONE_PRESSURE_PLATE: + case E_BLOCK_STONE_SLAB: { return PickaxeLevel() >= 1; } diff --git a/src/Items/ItemPotion.h b/src/Items/ItemPotion.h index 24614cd8a..398ef6805 100644 --- a/src/Items/ItemPotion.h +++ b/src/Items/ItemPotion.h @@ -68,8 +68,12 @@ public: cEntityEffect::GetPotionEffectDuration(PotionDamage), cEntityEffect::GetPotionEffectIntensity(PotionDamage) ); - a_Player->GetInventory().RemoveOneEquippedItem(); - a_Player->GetInventory().AddItem(E_ITEM_GLASS_BOTTLE); + + if (!a_Player->IsGameModeCreative()) + { + a_Player->GetInventory().RemoveOneEquippedItem(); + a_Player->GetInventory().AddItem(E_ITEM_GLASS_BOTTLE); + } return true; } }; diff --git a/src/Items/ItemSeeds.h b/src/Items/ItemSeeds.h index 54a1183d7..e1db7c5f4 100644 --- a/src/Items/ItemSeeds.h +++ b/src/Items/ItemSeeds.h @@ -37,7 +37,7 @@ public: { switch (m_ItemType) { - case E_ITEM_CARROT: return FoodInfo(4, 4.8); + case E_ITEM_CARROT: return FoodInfo(3, 4.8); case E_ITEM_POTATO: return FoodInfo(1, 0.6); default: return FoodInfo(0, 0); } diff --git a/src/Items/ItemShovel.h b/src/Items/ItemShovel.h index 7d5760fa9..cd235678d 100644 --- a/src/Items/ItemShovel.h +++ b/src/Items/ItemShovel.h @@ -19,7 +19,6 @@ public: cItemShovelHandler(int a_ItemType) : cItemHandler(a_ItemType) { - } virtual bool OnDiggingBlock(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_Dir) override diff --git a/src/Items/ItemSpawnEgg.h b/src/Items/ItemSpawnEgg.h index bba97afa1..617ecd808 100644 --- a/src/Items/ItemSpawnEgg.h +++ b/src/Items/ItemSpawnEgg.h @@ -33,9 +33,9 @@ public: a_BlockY--; } - cMonster::eType MonsterType = ItemDamageToMonsterType(a_Item.m_ItemDamage); + eMonsterType MonsterType = ItemDamageToMonsterType(a_Item.m_ItemDamage); if ( - (MonsterType != cMonster::mtInvalidType) && // Valid monster type + (MonsterType != mtInvalidType) && // Valid monster type (a_World->SpawnMob(a_BlockX + 0.5, a_BlockY, a_BlockZ + 0.5, MonsterType) >= 0)) // Spawning succeeded { if (!a_Player->IsGameModeCreative()) @@ -52,36 +52,36 @@ public: /** Converts the Spawn egg item damage to the monster type to spawn. Returns mtInvalidType for invalid damage values. */ - static cMonster::eType ItemDamageToMonsterType(short a_ItemDamage) + static eMonsterType ItemDamageToMonsterType(short a_ItemDamage) { switch (a_ItemDamage) { - case E_META_SPAWN_EGG_BAT: return cMonster::mtBat; - case E_META_SPAWN_EGG_BLAZE: return cMonster::mtBlaze; - case E_META_SPAWN_EGG_CAVE_SPIDER: return cMonster::mtCaveSpider; - case E_META_SPAWN_EGG_CHICKEN: return cMonster::mtChicken; - case E_META_SPAWN_EGG_COW: return cMonster::mtCow; - case E_META_SPAWN_EGG_CREEPER: return cMonster::mtCreeper; - case E_META_SPAWN_EGG_ENDERMAN: return cMonster::mtEnderman; - case E_META_SPAWN_EGG_GHAST: return cMonster::mtGhast; - case E_META_SPAWN_EGG_HORSE: return cMonster::mtHorse; - case E_META_SPAWN_EGG_MAGMA_CUBE: return cMonster::mtMagmaCube; - case E_META_SPAWN_EGG_MOOSHROOM: return cMonster::mtMooshroom; - case E_META_SPAWN_EGG_OCELOT: return cMonster::mtOcelot; - case E_META_SPAWN_EGG_PIG: return cMonster::mtPig; - case E_META_SPAWN_EGG_SHEEP: return cMonster::mtSheep; - case E_META_SPAWN_EGG_SILVERFISH: return cMonster::mtSilverfish; - case E_META_SPAWN_EGG_SKELETON: return cMonster::mtSkeleton; - case E_META_SPAWN_EGG_SLIME: return cMonster::mtSlime; - case E_META_SPAWN_EGG_SPIDER: return cMonster::mtSpider; - case E_META_SPAWN_EGG_SQUID: return cMonster::mtSquid; - case E_META_SPAWN_EGG_VILLAGER: return cMonster::mtVillager; - case E_META_SPAWN_EGG_WITCH: return cMonster::mtWitch; - case E_META_SPAWN_EGG_WOLF: return cMonster::mtWolf; - case E_META_SPAWN_EGG_ZOMBIE: return cMonster::mtZombie; - case E_META_SPAWN_EGG_ZOMBIE_PIGMAN: return cMonster::mtZombiePigman; + case E_META_SPAWN_EGG_BAT: return mtBat; + case E_META_SPAWN_EGG_BLAZE: return mtBlaze; + case E_META_SPAWN_EGG_CAVE_SPIDER: return mtCaveSpider; + case E_META_SPAWN_EGG_CHICKEN: return mtChicken; + case E_META_SPAWN_EGG_COW: return mtCow; + case E_META_SPAWN_EGG_CREEPER: return mtCreeper; + case E_META_SPAWN_EGG_ENDERMAN: return mtEnderman; + case E_META_SPAWN_EGG_GHAST: return mtGhast; + case E_META_SPAWN_EGG_HORSE: return mtHorse; + case E_META_SPAWN_EGG_MAGMA_CUBE: return mtMagmaCube; + case E_META_SPAWN_EGG_MOOSHROOM: return mtMooshroom; + case E_META_SPAWN_EGG_OCELOT: return mtOcelot; + case E_META_SPAWN_EGG_PIG: return mtPig; + case E_META_SPAWN_EGG_SHEEP: return mtSheep; + case E_META_SPAWN_EGG_SILVERFISH: return mtSilverfish; + case E_META_SPAWN_EGG_SKELETON: return mtSkeleton; + case E_META_SPAWN_EGG_SLIME: return mtSlime; + case E_META_SPAWN_EGG_SPIDER: return mtSpider; + case E_META_SPAWN_EGG_SQUID: return mtSquid; + case E_META_SPAWN_EGG_VILLAGER: return mtVillager; + case E_META_SPAWN_EGG_WITCH: return mtWitch; + case E_META_SPAWN_EGG_WOLF: return mtWolf; + case E_META_SPAWN_EGG_ZOMBIE: return mtZombie; + case E_META_SPAWN_EGG_ZOMBIE_PIGMAN: return mtZombiePigman; } - return cMonster::mtInvalidType; + return mtInvalidType; } } ; diff --git a/src/LightingThread.cpp b/src/LightingThread.cpp index 3fbbee6b5..652b03e46 100644 --- a/src/LightingThread.cpp +++ b/src/LightingThread.cpp @@ -73,6 +73,8 @@ public: HEIGHTTYPE * m_HeightMap; // 3x3 chunks of height map, organized as a single XZY blob of data (instead of 3x3 XZY blobs) cReader(BLOCKTYPE * a_BlockTypes, HEIGHTTYPE * a_HeightMap) : + m_ReadingChunkX(0), + m_ReadingChunkZ(0), m_MaxHeight(0), m_BlockTypes(a_BlockTypes), m_HeightMap(a_HeightMap) @@ -89,7 +91,9 @@ public: cLightingThread::cLightingThread(void) : super("cLightingThread"), - m_World(NULL) + m_World(NULL), + m_MaxHeight(0), + m_NumSeeds(0) { } diff --git a/src/LineBlockTracer.cpp b/src/LineBlockTracer.cpp index f03e796d1..1b42081c2 100644 --- a/src/LineBlockTracer.cpp +++ b/src/LineBlockTracer.cpp @@ -146,7 +146,7 @@ bool cLineBlockTracer::MoveToNextBlock(void) dirY, dirZ, } Direction = dirNONE; - if (abs(m_DiffX) > EPS) + if (std::abs(m_DiffX) > EPS) { double DestX = (m_DirX > 0) ? (m_CurrentX + 1) : m_CurrentX; Coeff = (DestX - m_StartX) / m_DiffX; @@ -155,7 +155,7 @@ bool cLineBlockTracer::MoveToNextBlock(void) Direction = dirX; } } - if (abs(m_DiffY) > EPS) + if (std::abs(m_DiffY) > EPS) { double DestY = (m_DirY > 0) ? (m_CurrentY + 1) : m_CurrentY; double CoeffY = (DestY - m_StartY) / m_DiffY; @@ -165,7 +165,7 @@ bool cLineBlockTracer::MoveToNextBlock(void) Direction = dirY; } } - if (abs(m_DiffZ) > EPS) + if (std::abs(m_DiffZ) > EPS) { double DestZ = (m_DirZ > 0) ? (m_CurrentZ + 1) : m_CurrentZ; double CoeffZ = (DestZ - m_StartZ) / m_DiffZ; @@ -227,9 +227,11 @@ bool cLineBlockTracer::Item(cChunk * a_Chunk) } // Update the current chunk - if (a_Chunk != NULL) + a_Chunk = a_Chunk->GetNeighborChunk(m_CurrentX, m_CurrentZ); + if (a_Chunk == NULL) { - a_Chunk = a_Chunk->GetNeighborChunk(m_CurrentX, m_CurrentZ); + m_Callbacks->OnNoChunk(); + return false; } if (a_Chunk->IsValid()) @@ -245,13 +247,10 @@ bool cLineBlockTracer::Item(cChunk * a_Chunk) return false; } } - else + else if (m_Callbacks->OnNextBlockNoData(m_CurrentX, m_CurrentY, m_CurrentZ, m_CurrentFace)) { - if (m_Callbacks->OnNextBlockNoData(m_CurrentX, m_CurrentY, m_CurrentZ, m_CurrentFace)) - { - // The callback terminated the trace - return false; - } + // The callback terminated the trace + return false; } } } diff --git a/src/LinearUpscale.h b/src/LinearUpscale.h index 0b04408cf..a49f4bdf9 100644 --- a/src/LinearUpscale.h +++ b/src/LinearUpscale.h @@ -31,7 +31,7 @@ Linearly interpolates values in the array between the equidistant anchor points Works in-place (input is already present at the correct output coords) Uses templates to make it possible for the compiler to further optimizer the loops */ -template< +template < int SizeX, int SizeY, // Dimensions of the array int AnchorStepX, int AnchorStepY, typename TYPE @@ -83,7 +83,7 @@ void LinearUpscale2DArrayInPlace(TYPE * a_Array) Linearly interpolates values in the array between the equidistant anchor points (upscales). Works on two arrays, input is packed and output is to be completely constructed. */ -template<typename TYPE> void LinearUpscale2DArray( +template <typename TYPE> void LinearUpscale2DArray( TYPE * a_Src, ///< Source array of size a_SrcSizeX x a_SrcSizeY int a_SrcSizeX, int a_SrcSizeY, ///< Dimensions of the src array TYPE * a_Dst, ///< Dest array, of size (a_SrcSizeX * a_UpscaleX + 1) x (a_SrcSizeY * a_UpscaleY + 1) @@ -153,7 +153,7 @@ template<typename TYPE> void LinearUpscale2DArray( Linearly interpolates values in the array between the equidistant anchor points (upscales). Works on two arrays, input is packed and output is to be completely constructed. */ -template<typename TYPE> void LinearUpscale3DArray( +template <typename TYPE> void LinearUpscale3DArray( TYPE * a_Src, ///< Source array of size a_SrcSizeX x a_SrcSizeY x a_SrcSizeZ int a_SrcSizeX, int a_SrcSizeY, int a_SrcSizeZ, ///< Dimensions of the src array TYPE * a_Dst, ///< Dest array, of size (a_SrcSizeX * a_UpscaleX + 1) x (a_SrcSizeY * a_UpscaleY + 1) x (a_SrcSizeZ * a_UpscaleZ + 1) diff --git a/src/Log.cpp b/src/Log.cpp deleted file mode 100644 index 7686a0fb4..000000000 --- a/src/Log.cpp +++ /dev/null @@ -1,169 +0,0 @@ - -#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules - -#include "Log.h" - -#include <fstream> -#include <ctime> -#include "OSSupport/IsThread.h" - -#if defined(ANDROID_NDK) - #include <android/log.h> - #include "ToJava.h" -#endif - - - - -cLog* cLog::s_Log = NULL; - -cLog::cLog(const AString & a_FileName) - : m_File(NULL) -{ - s_Log = this; - - // create logs directory - cFile::CreateFolder(FILE_IO_PREFIX + AString("logs")); - - OpenLog((FILE_IO_PREFIX + AString("logs/") + a_FileName).c_str()); -} - - - - - -cLog::~cLog() -{ - CloseLog(); - s_Log = NULL; -} - - - - - -cLog * cLog::GetInstance() -{ - if (s_Log != NULL) - { - return s_Log; - } - - new cLog("log.txt"); - return s_Log; -} - - - - - -void cLog::CloseLog() -{ - if (m_File) - fclose (m_File); - m_File = 0; -} - - - - - -void cLog::OpenLog( const char* a_FileName) -{ - if (m_File) fclose (m_File); - #ifdef _MSC_VER - fopen_s( &m_File, a_FileName, "a+"); - #else - m_File = fopen(a_FileName, "a+"); - #endif -} - - - - - -void cLog::ClearLog() -{ - #ifdef _MSC_VER - if (fopen_s( &m_File, "log.txt", "w") == 0) - fclose (m_File); - #else - m_File = fopen("log.txt", "w"); - if (m_File) - fclose (m_File); - #endif - m_File = NULL; -} - - - - - -void cLog::Log(const char * a_Format, va_list argList) -{ - AString Message; - AppendVPrintf(Message, a_Format, argList); - - time_t rawtime; - time ( &rawtime); - - struct tm* timeinfo; -#ifdef _MSC_VER - struct tm timeinforeal; - timeinfo = &timeinforeal; - localtime_s(timeinfo, &rawtime); -#else - timeinfo = localtime( &rawtime); -#endif - - AString Line; - #ifdef _DEBUG - Printf(Line, "[%04lx|%02d:%02d:%02d] %s", cIsThread::GetCurrentID(), timeinfo->tm_hour, timeinfo->tm_min, timeinfo->tm_sec, Message.c_str()); - #else - Printf(Line, "[%02d:%02d:%02d] %s", timeinfo->tm_hour, timeinfo->tm_min, timeinfo->tm_sec, Message.c_str()); - #endif - if (m_File) - { - fprintf(m_File, "%s\n", Line.c_str()); - fflush(m_File); - } - - // Print to console: -#if defined(ANDROID_NDK) - // __android_log_vprint(ANDROID_LOG_ERROR, "MCServer", a_Format, argList); - __android_log_print(ANDROID_LOG_ERROR, "MCServer", "%s", Line.c_str()); - // CallJavaFunction_Void_String(g_JavaThread, "AddToLog", Line); -#else - printf("%s", Line.c_str()); -#endif - - #if defined (_WIN32) && defined(_DEBUG) - // In a Windows Debug build, output the log to debug console as well: - OutputDebugStringA((Line + "\n").c_str()); - #endif // _WIN32 -} - - - - - -void cLog::Log(const char * a_Format, ...) -{ - va_list argList; - va_start(argList, a_Format); - Log(a_Format, argList); - va_end(argList); -} - - - - - -void cLog::SimpleLog(const char * a_String) -{ - Log("%s", a_String); -} - - - - diff --git a/src/Log.h b/src/Log.h deleted file mode 100644 index dc88aa92f..000000000 --- a/src/Log.h +++ /dev/null @@ -1,30 +0,0 @@ - -#pragma once - - - - - -class cLog -{ -private: - FILE * m_File; - static cLog * s_Log; - -public: - cLog(const AString & a_FileName); - ~cLog(); - void Log(const char * a_Format, va_list argList) FORMATSTRING(2, 0); - void Log(const char * a_Format, ...) FORMATSTRING(2, 3); - // tolua_begin - void SimpleLog(const char * a_String); - void OpenLog(const char * a_FileName); - void CloseLog(); - void ClearLog(); - static cLog* GetInstance(); -}; - - - - - diff --git a/src/Logger.cpp b/src/Logger.cpp new file mode 100644 index 000000000..cb528e8ab --- /dev/null +++ b/src/Logger.cpp @@ -0,0 +1,145 @@ + +#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules + +#include "OSSupport/IsThread.h" +#ifdef _WIN32 + #include <time.h> +#endif + + + + + +cLogger & cLogger::GetInstance(void) +{ + static cLogger Instance; + return Instance; +} + + + + + +void cLogger::InitiateMultithreading() +{ + GetInstance(); +} + + + + + +void cLogger::LogSimple(AString a_Message, eLogLevel a_LogLevel) +{ + time_t rawtime; + time(&rawtime); + + struct tm * timeinfo; + #ifdef _MSC_VER + struct tm timeinforeal; + timeinfo = &timeinforeal; + localtime_s(timeinfo, &rawtime); + #else + timeinfo = localtime(&rawtime); + #endif + + AString Line; + #ifdef _DEBUG + Printf(Line, "[%04lx|%02d:%02d:%02d] %s\n", cIsThread::GetCurrentID(), timeinfo->tm_hour, timeinfo->tm_min, timeinfo->tm_sec, a_Message.c_str()); + #else + Printf(Line, "[%02d:%02d:%02d] %s\n", timeinfo->tm_hour, timeinfo->tm_min, timeinfo->tm_sec, a_Message.c_str()); + #endif + + + cCSLock Lock(m_CriticalSection); + for (size_t i = 0; i < m_LogListeners.size(); i++) + { + m_LogListeners[i]->Log(Line, a_LogLevel); + } +} + + + + + +void cLogger::Log(const char * a_Format, eLogLevel a_LogLevel, va_list a_ArgList) +{ + AString Message; + AppendVPrintf(Message, a_Format, a_ArgList); + LogSimple(Message, a_LogLevel); +} + + + + + +void cLogger::AttachListener(cListener * a_Listener) +{ + cCSLock Lock(m_CriticalSection); + m_LogListeners.push_back(a_Listener); +} + + + + + +void cLogger::DetachListener(cListener * a_Listener) +{ + cCSLock Lock(m_CriticalSection); + m_LogListeners.erase(std::remove(m_LogListeners.begin(), m_LogListeners.end(), a_Listener)); +} + + + + + +//////////////////////////////////////////////////////////////////////////////// +// Global functions + +void LOG(const char * a_Format, ...) +{ + va_list argList; + va_start(argList, a_Format); + cLogger::GetInstance().Log(a_Format, cLogger::llRegular, argList); + va_end(argList); +} + + + + + +void LOGINFO(const char * a_Format, ...) +{ + va_list argList; + va_start(argList, a_Format); + cLogger::GetInstance().Log( a_Format, cLogger::llInfo, argList); + va_end(argList); +} + + + + + +void LOGWARN(const char * a_Format, ...) +{ + va_list argList; + va_start(argList, a_Format); + cLogger::GetInstance().Log( a_Format, cLogger::llWarning, argList); + va_end(argList); +} + + + + + +void LOGERROR(const char * a_Format, ...) +{ + va_list argList; + va_start(argList, a_Format); + cLogger::GetInstance().Log( a_Format, cLogger::llError, argList); + va_end(argList); +} + + + + diff --git a/src/Logger.h b/src/Logger.h new file mode 100644 index 000000000..5e65de8a8 --- /dev/null +++ b/src/Logger.h @@ -0,0 +1,73 @@ + +#pragma once + + +class cLogger +{ +public: + + enum eLogLevel + { + llRegular, + llInfo, + llWarning, + llError, + }; + + + class cListener + { + public: + virtual void Log(AString a_Message, eLogLevel a_LogLevel) = 0; + + virtual ~cListener(){} + }; + + void Log (const char * a_Format, eLogLevel a_LogLevel, va_list a_ArgList) FORMATSTRING(2, 0); + + /** Logs the simple text message at the specified log level. */ + void LogSimple(AString a_Message, eLogLevel a_LogLevel = llRegular); + + void AttachListener(cListener * a_Listener); + void DetachListener(cListener * a_Listener); + + static cLogger & GetInstance(void); + // Must be called before calling GetInstance in a multithreaded context + static void InitiateMultithreading(); +private: + + cCriticalSection m_CriticalSection; + std::vector<cListener *> m_LogListeners; + +}; + + + + + + +extern void LOG(const char* a_Format, ...) FORMATSTRING(1, 2); +extern void LOGINFO(const char* a_Format, ...) FORMATSTRING(1, 2); +extern void LOGWARN(const char* a_Format, ...) FORMATSTRING(1, 2); +extern void LOGERROR(const char* a_Format, ...) FORMATSTRING(1, 2); + + + + + +// In debug builds, translate LOGD to LOG, otherwise leave it out altogether: +#ifdef _DEBUG + #define LOGD LOG +#else + #define LOGD(...) +#endif // _DEBUG + + + + + +#define LOGWARNING LOGWARN + + + + diff --git a/src/LoggerListeners.cpp b/src/LoggerListeners.cpp new file mode 100644 index 000000000..77e2aaf67 --- /dev/null +++ b/src/LoggerListeners.cpp @@ -0,0 +1,322 @@ + +#include "Globals.h" + +#include "LoggerListeners.h" + +#if defined(_WIN32) + #include <io.h> // Needed for _isatty(), not available on Linux + #include <time.h> +#elif defined(__linux) && !defined(ANDROID_NDK) + #include <unistd.h> // Needed for isatty() on Linux +#elif defined(ANDROID_NDK) + #include <android/log.h> +#endif + + +#if defined(_WIN32) || (defined (__linux) && !defined(ANDROID_NDK)) + class cColouredConsoleListener + : public cLogger::cListener + { + protected: + + virtual void SetLogColour(cLogger::eLogLevel a_LogLevel) = 0; + virtual void SetDefaultLogColour() = 0; + + virtual void Log(AString a_Message, cLogger::eLogLevel a_LogLevel) override + { + SetLogColour(a_LogLevel); + fputs(a_Message.c_str(), stdout); + SetDefaultLogColour(); + } + }; +#endif + + + + + +#ifdef _WIN32 + class cWindowsConsoleListener + : public cColouredConsoleListener + { + typedef cColouredConsoleListener super; + public: + cWindowsConsoleListener(HANDLE a_Console, WORD a_DefaultConsoleAttrib) : + m_Console(a_Console), + m_DefaultConsoleAttrib(a_DefaultConsoleAttrib) + { + } + + #ifdef _DEBUG + virtual void Log(AString a_Message, cLogger::eLogLevel a_LogLevel) override + { + super::Log(a_Message, a_LogLevel); + // In a Windows Debug build, output the log to debug console as well: + OutputDebugStringA(a_Message.c_str()); + } + #endif + + + virtual void SetLogColour(cLogger::eLogLevel a_LogLevel) override + { + // by default, gray on black + WORD Attrib = FOREGROUND_BLUE | FOREGROUND_GREEN | FOREGROUND_RED; + switch (a_LogLevel) + { + case cLogger::llRegular: + { + // Gray on black + Attrib = FOREGROUND_BLUE | FOREGROUND_GREEN | FOREGROUND_RED; + break; + } + case cLogger::llInfo: + { + // Yellow on black + Attrib = FOREGROUND_GREEN | FOREGROUND_RED | FOREGROUND_INTENSITY; + break; + } + case cLogger::llWarning: + { + // Red on black + Attrib = FOREGROUND_RED | FOREGROUND_INTENSITY; + break; + } + case cLogger::llError: + { + // Black on red + Attrib = BACKGROUND_RED | BACKGROUND_INTENSITY; + break; + } + } + SetConsoleTextAttribute(m_Console, Attrib); + } + + + virtual void SetDefaultLogColour() override + { + SetConsoleTextAttribute(m_Console, m_DefaultConsoleAttrib); + } + + private: + + HANDLE m_Console; + WORD m_DefaultConsoleAttrib; + }; + + + +#elif defined (__linux) && !defined(ANDROID_NDK) + + + + class cLinuxConsoleListener + : public cColouredConsoleListener + { + public: + virtual void SetLogColour(cLogger::eLogLevel a_LogLevel) override + { + switch (a_LogLevel) + { + case cLogger::llRegular: + { + // Whatever the console default is + printf("\x1b[0m"); + break; + } + case cLogger::llInfo: + { + // Yellow on black + printf("\x1b[33;1m"); + break; + } + case cLogger::llWarning: + { + // Red on black + printf("\x1b[31;1m"); + break; + } + case cLogger::llError: + { + // Yellow on red + printf("\x1b[1;33;41;1m"); + break; + } + } + } + + + virtual void SetDefaultLogColour() override + { + // Whatever the console default is + printf("\x1b[0m"); + } + }; + + + +#elif defined(ANDROID_NDK) + + + + class cAndroidConsoleListener + : public cLogger::cListener + { + public: + virtual void Log(AString a_Message, cLogger::eLogLevel a_LogLevel) override + { + android_LogPriority AndroidLogLevel; + switch (a_LogLevel) + { + case cLogger::llRegular: + { + AndroidLogLevel = ANDROID_LOG_VERBOSE; + break; + } + case cLogger::llInfo: + { + AndroidLogLevel = ANDROID_LOG_INFO; + break; + } + case cLogger::llWarning: + { + AndroidLogLevel = ANDROID_LOG_WARNING; + break; + } + case cLogger::llError: + { + AndroidLogLevel = ANDROID_LOG_ERROR; + break; + } + } + __android_log_print(AndroidLogLevel, "MCServer", "%s", a_Message.c_str()); + } + }; + +#endif + + + + + +class cVanillaCPPConsoleListener + : public cLogger::cListener +{ +public: + virtual void Log(AString a_Message, cLogger::eLogLevel a_LogLevel) override + { + AString LogLevelString; + switch (a_LogLevel) + { + case cLogger::llRegular: + { + LogLevelString = "Log"; + break; + } + case cLogger::llInfo: + { + LogLevelString = "Info"; + break; + } + case cLogger::llWarning: + { + LogLevelString = "Warning"; + break; + } + case cLogger::llError: + { + LogLevelString = "Error"; + break; + } + } + printf("%s: %s", LogLevelString.c_str(), a_Message.c_str()); + } +}; + + + + + +cLogger::cListener * MakeConsoleListener(void) +{ + #ifdef _WIN32 + // See whether we are writing to a console the default console attrib: + bool ShouldColorOutput = (_isatty(_fileno(stdin)) != 0); + if (ShouldColorOutput) + { + CONSOLE_SCREEN_BUFFER_INFO sbi; + HANDLE Console = GetStdHandle(STD_OUTPUT_HANDLE); + GetConsoleScreenBufferInfo(Console, &sbi); + WORD DefaultConsoleAttrib = sbi.wAttributes; + return new cWindowsConsoleListener(Console, DefaultConsoleAttrib); + } + else + { + return new cVanillaCPPConsoleListener; + } + + #elif defined (__linux) && !defined(ANDROID_NDK) + // TODO: lookup terminal in terminfo + if (isatty(fileno(stdout))) + { + return new cLinuxConsoleListener(); + } + else + { + return new cVanillaCPPConsoleListener(); + } + #else + return new cVanillaCPPConsoleListener(); + #endif +} + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cFileListener: + +cFileListener::cFileListener(void) +{ + cFile::CreateFolder(FILE_IO_PREFIX + AString("logs")); + AString FileName; + FileName = Printf("%s%sLOG_%d.txt", FILE_IO_PREFIX, "logs/", (int)time(NULL)); + m_File.Open(FileName, cFile::fmAppend); +} + + + + + +void cFileListener::Log(AString a_Message, cLogger::eLogLevel a_LogLevel) +{ + const char * LogLevelPrefix = "Unkn "; + switch (a_LogLevel) + { + case cLogger::llRegular: + { + LogLevelPrefix = " "; + break; + } + case cLogger::llInfo: + { + LogLevelPrefix = "info "; + break; + } + case cLogger::llWarning: + { + LogLevelPrefix = "Warn "; + break; + } + case cLogger::llError: + { + LogLevelPrefix = "Err "; + break; + } + } + m_File.Printf("%s%s", LogLevelPrefix, a_Message.c_str()); +} + + + + diff --git a/src/LoggerListeners.h b/src/LoggerListeners.h new file mode 100644 index 000000000..d300184b1 --- /dev/null +++ b/src/LoggerListeners.h @@ -0,0 +1,31 @@ + +#include "Logger.h" + + + + + +class cFileListener + : public cLogger::cListener +{ +public: + + cFileListener(); + cFileListener(AString a_Filename); + + virtual void Log(AString a_Message, cLogger::eLogLevel a_LogLevel) override; + +private: + + cFile m_File; +}; + + + + + +cLogger::cListener * MakeConsoleListener(); + + + + diff --git a/src/MCLogger.cpp b/src/MCLogger.cpp deleted file mode 100644 index 044e83937..000000000 --- a/src/MCLogger.cpp +++ /dev/null @@ -1,267 +0,0 @@ - -#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules - -#include <time.h> -#include "Log.h" - - - - - -cMCLogger * cMCLogger::s_MCLogger = NULL; - -#ifdef _WIN32 - #include <io.h> // Needed for _isatty(), not available on Linux - - HANDLE g_Console = GetStdHandle(STD_OUTPUT_HANDLE); - WORD g_DefaultConsoleAttrib = 0x07; -#elif defined (__linux) && !defined(ANDROID_NDK) - #include <unistd.h> // Needed for isatty() on Linux -#endif - - - - - -cMCLogger * cMCLogger::GetInstance(void) -{ - return s_MCLogger; -} - - - - - -cMCLogger::cMCLogger(void): - m_ShouldColorOutput(false) -{ - AString FileName; - Printf(FileName, "LOG_%d.txt", (int)time(NULL)); - InitLog(FileName); -} - - - - - -cMCLogger::cMCLogger(const AString & a_FileName) -{ - InitLog(a_FileName); -} - - - - - -cMCLogger::~cMCLogger() -{ - m_Log->Log("--- Stopped Log ---\n"); - delete m_Log; - m_Log = NULL; - if (this == s_MCLogger) - { - s_MCLogger = NULL; - } -} - - - - - -void cMCLogger::InitLog(const AString & a_FileName) -{ - m_Log = new cLog(a_FileName); - m_Log->Log("--- Started Log ---\n"); - - s_MCLogger = this; - - #ifdef _WIN32 - // See whether we are writing to a console the default console attrib: - m_ShouldColorOutput = (_isatty(_fileno(stdin)) != 0); - if (m_ShouldColorOutput) - { - CONSOLE_SCREEN_BUFFER_INFO sbi; - GetConsoleScreenBufferInfo(g_Console, &sbi); - g_DefaultConsoleAttrib = sbi.wAttributes; - } - #elif defined (__linux) && !defined(ANDROID_NDK) - m_ShouldColorOutput = isatty(fileno(stdout)); - // TODO: Check if the terminal supports colors, somehow? - #endif -} - - - - - -void cMCLogger::LogSimple(const char * a_Text, eLogLevel a_LogLevel) -{ - switch (a_LogLevel) - { - case llRegular: - { - LOG("%s", a_Text); - break; - } - case llInfo: - { - LOGINFO("%s", a_Text); - break; - } - case llWarning: - { - LOGWARN("%s", a_Text); - break; - } - case llError: - { - LOGERROR("%s", a_Text); - break; - } - } -} - - - - - -void cMCLogger::Log(const char * a_Format, va_list a_ArgList) -{ - cCSLock Lock(m_CriticalSection); - SetColor(csRegular); - m_Log->Log(a_Format, a_ArgList); - ResetColor(); - puts(""); -} - - - - - -void cMCLogger::Info(const char * a_Format, va_list a_ArgList) -{ - cCSLock Lock(m_CriticalSection); - SetColor(csInfo); - m_Log->Log(a_Format, a_ArgList); - ResetColor(); - puts(""); -} - - - - - -void cMCLogger::Warn(const char * a_Format, va_list a_ArgList) -{ - cCSLock Lock(m_CriticalSection); - SetColor(csWarning); - m_Log->Log(a_Format, a_ArgList); - ResetColor(); - puts(""); -} - - - - - -void cMCLogger::Error(const char * a_Format, va_list a_ArgList) -{ - cCSLock Lock(m_CriticalSection); - SetColor(csError); - m_Log->Log(a_Format, a_ArgList); - ResetColor(); - puts(""); -} - - - - - -void cMCLogger::SetColor(eColorScheme a_Scheme) -{ - if (!m_ShouldColorOutput) - { - return; - } - #ifdef _WIN32 - WORD Attrib = 0x07; // by default, gray on black - switch (a_Scheme) - { - case csRegular: Attrib = 0x07; break; // Gray on black - case csInfo: Attrib = 0x0e; break; // Yellow on black - case csWarning: Attrib = 0x0c; break; // Read on black - case csError: Attrib = 0xc0; break; // Black on red - default: ASSERT(!"Unhandled color scheme"); - } - SetConsoleTextAttribute(g_Console, Attrib); - #elif defined(__linux) && !defined(ANDROID_NDK) - switch (a_Scheme) - { - case csRegular: printf("\x1b[0m"); break; // Whatever the console default is - case csInfo: printf("\x1b[33;1m"); break; // Yellow on black - case csWarning: printf("\x1b[31;1m"); break; // Red on black - case csError: printf("\x1b[1;33;41;1m"); break; // Yellow on red - default: ASSERT(!"Unhandled color scheme"); - } - #endif -} - - - - - -void cMCLogger::ResetColor(void) -{ - if (!m_ShouldColorOutput) - { - return; - } - #ifdef _WIN32 - SetConsoleTextAttribute(g_Console, g_DefaultConsoleAttrib); - #elif defined(__linux) && !defined(ANDROID_NDK) - printf("\x1b[0m"); - #endif -} - - - - - -//////////////////////////////////////////////////////////////////////////////// -// Global functions - -void LOG(const char* a_Format, ...) -{ - va_list argList; - va_start(argList, a_Format); - cMCLogger::GetInstance()->Log( a_Format, argList); - va_end(argList); -} - -void LOGINFO(const char* a_Format, ...) -{ - va_list argList; - va_start(argList, a_Format); - cMCLogger::GetInstance()->Info( a_Format, argList); - va_end(argList); -} - -void LOGWARN(const char* a_Format, ...) -{ - va_list argList; - va_start(argList, a_Format); - cMCLogger::GetInstance()->Warn( a_Format, argList); - va_end(argList); -} - -void LOGERROR(const char* a_Format, ...) -{ - va_list argList; - va_start(argList, a_Format); - cMCLogger::GetInstance()->Error( a_Format, argList); - va_end(argList); -} - - - - diff --git a/src/MCLogger.h b/src/MCLogger.h deleted file mode 100644 index aa3a52d02..000000000 --- a/src/MCLogger.h +++ /dev/null @@ -1,95 +0,0 @@ - -#pragma once - - - - -class cLog; - - - - - -class cMCLogger -{ -public: - enum eLogLevel - { - llRegular, - llInfo, - llWarning, - llError, - }; - // tolua_end - - /** Creates a logger with the default filename, "logs/LOG_<timestamp>.log" */ - cMCLogger(void); - - /** Creates a logger with the specified filename inside "logs" folder */ - cMCLogger(const AString & a_FileName); - - ~cMCLogger(); - - void Log (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void Info (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void Warn (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - void Error(const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0); - - /** Logs the simple text message at the specified log level. */ - void LogSimple(const char * a_Text, eLogLevel a_LogLevel = llRegular); - - static cMCLogger * GetInstance(); -private: - enum eColorScheme - { - csRegular, - csInfo, - csWarning, - csError, - } ; - - cCriticalSection m_CriticalSection; - cLog * m_Log; - static cMCLogger * s_MCLogger; - bool m_ShouldColorOutput; - - - /// Sets the specified color scheme in the terminal (TODO: if coloring available) - void SetColor(eColorScheme a_Scheme); - - /// Resets the color back to whatever is the default in the terminal - void ResetColor(void); - - /// Common initialization for all constructors, creates a logfile with the specified name and assigns s_MCLogger to this - void InitLog(const AString & a_FileName); -}; - - - - - -extern void LOG(const char* a_Format, ...) FORMATSTRING(1, 2); -extern void LOGINFO(const char* a_Format, ...) FORMATSTRING(1, 2); -extern void LOGWARN(const char* a_Format, ...) FORMATSTRING(1, 2); -extern void LOGERROR(const char* a_Format, ...) FORMATSTRING(1, 2); - - - - - -// In debug builds, translate LOGD to LOG, otherwise leave it out altogether: -#ifdef _DEBUG - #define LOGD LOG -#else - #define LOGD(...) -#endif // _DEBUG - - - - - -#define LOGWARNING LOGWARN - - - - diff --git a/src/Map.cpp b/src/Map.cpp index 8f205a606..c106ccd83 100644 --- a/src/Map.cpp +++ b/src/Map.cpp @@ -432,7 +432,7 @@ void cMap::StreamNext(cMapClient & a_Client) // This is dangerous as the player object may have been destroyed before the decorator is erased from the list UpdateDecorators(); - Handle->SendMapDecorators(m_ID, m_Decorators); + Handle->SendMapDecorators(m_ID, m_Decorators, m_Scale); a_Client.m_NextDecoratorUpdate = 0; } @@ -444,7 +444,7 @@ void cMap::StreamNext(cMapClient & a_Client) const Byte * Colors = &m_Data[Y * m_Height]; - Handle->SendMapColumn(m_ID, Y, 0, Colors, m_Height); + Handle->SendMapColumn(m_ID, Y, 0, Colors, m_Height, m_Scale); } } @@ -595,10 +595,10 @@ void cMap::SendTo(cClientHandle & a_Client) { const Byte* Colors = &m_Data[i * m_Height]; - a_Client.SendMapColumn(m_ID, i, 0, Colors, m_Height); + a_Client.SendMapColumn(m_ID, i, 0, Colors, m_Height, m_Scale); } - a_Client.SendMapDecorators(m_ID, m_Decorators); + a_Client.SendMapDecorators(m_ID, m_Decorators, m_Scale); } diff --git a/src/Matrix4.h b/src/Matrix4.h index 081847b9f..61ea60bfd 100644 --- a/src/Matrix4.h +++ b/src/Matrix4.h @@ -34,6 +34,8 @@ public: { *this = a_Rhs; } + + // tolua_end inline Matrix4 & operator = (const Matrix4 & a_Rhs) { @@ -43,6 +45,8 @@ public: } return *this; } + + // tolua_begin inline T & operator [] (int a_N) { diff --git a/src/MobSpawner.cpp b/src/MobSpawner.cpp index db05b70af..ea3fe8c72 100644 --- a/src/MobSpawner.cpp +++ b/src/MobSpawner.cpp @@ -8,12 +8,12 @@ -cMobSpawner::cMobSpawner(cMonster::eFamily a_MonsterFamily, const std::set<cMonster::eType>& a_AllowedTypes) : +cMobSpawner::cMobSpawner(cMonster::eFamily a_MonsterFamily, const std::set<eMonsterType>& a_AllowedTypes) : m_MonsterFamily(a_MonsterFamily), m_NewPack(true), - m_MobType(cMonster::mtInvalidType) + m_MobType(mtInvalidType) { - for (std::set<cMonster::eType>::const_iterator itr = a_AllowedTypes.begin(); itr != a_AllowedTypes.end(); ++itr) + for (std::set<eMonsterType>::const_iterator itr = a_AllowedTypes.begin(); itr != a_AllowedTypes.end(); ++itr) { if (cMonster::FamilyFromType(*itr) == a_MonsterFamily) { @@ -44,9 +44,9 @@ bool cMobSpawner::CheckPackCenter(BLOCKTYPE a_BlockType) -void cMobSpawner::addIfAllowed(cMonster::eType toAdd, std::set<cMonster::eType>& toAddIn) +void cMobSpawner::addIfAllowed(eMonsterType toAdd, std::set<eMonsterType>& toAddIn) { - std::set<cMonster::eType>::iterator itr = m_AllowedTypes.find(toAdd); + std::set<eMonsterType>::iterator itr = m_AllowedTypes.find(toAdd); if (itr != m_AllowedTypes.end()) { toAddIn.insert(toAdd); @@ -57,49 +57,49 @@ void cMobSpawner::addIfAllowed(cMonster::eType toAdd, std::set<cMonster::eType>& -cMonster::eType cMobSpawner::ChooseMobType(EMCSBiome a_Biome) +eMonsterType cMobSpawner::ChooseMobType(EMCSBiome a_Biome) { - std::set<cMonster::eType> allowedMobs; + std::set<eMonsterType> allowedMobs; if (a_Biome == biMushroomIsland || a_Biome == biMushroomShore) { - addIfAllowed(cMonster::mtMooshroom, allowedMobs); + addIfAllowed(mtMooshroom, allowedMobs); } else if (a_Biome == biNether) { - addIfAllowed(cMonster::mtGhast, allowedMobs); - addIfAllowed(cMonster::mtZombiePigman, allowedMobs); - addIfAllowed(cMonster::mtMagmaCube, allowedMobs); + addIfAllowed(mtGhast, allowedMobs); + addIfAllowed(mtZombiePigman, allowedMobs); + addIfAllowed(mtMagmaCube, allowedMobs); } else if (a_Biome == biEnd) { - addIfAllowed(cMonster::mtEnderman, allowedMobs); + addIfAllowed(mtEnderman, allowedMobs); } else { - addIfAllowed(cMonster::mtBat, allowedMobs); - addIfAllowed(cMonster::mtSpider, allowedMobs); - addIfAllowed(cMonster::mtZombie, allowedMobs); - addIfAllowed(cMonster::mtSkeleton, allowedMobs); - addIfAllowed(cMonster::mtCreeper, allowedMobs); - addIfAllowed(cMonster::mtSquid, allowedMobs); + addIfAllowed(mtBat, allowedMobs); + addIfAllowed(mtSpider, allowedMobs); + addIfAllowed(mtZombie, allowedMobs); + addIfAllowed(mtSkeleton, allowedMobs); + addIfAllowed(mtCreeper, allowedMobs); + addIfAllowed(mtSquid, allowedMobs); if (a_Biome != biDesert && a_Biome != biBeach && a_Biome != biOcean) { - addIfAllowed(cMonster::mtSheep, allowedMobs); - addIfAllowed(cMonster::mtPig, allowedMobs); - addIfAllowed(cMonster::mtCow, allowedMobs); - addIfAllowed(cMonster::mtChicken, allowedMobs); - addIfAllowed(cMonster::mtEnderman, allowedMobs); - addIfAllowed(cMonster::mtSlime, allowedMobs); // MG TODO : much more complicated rule + addIfAllowed(mtSheep, allowedMobs); + addIfAllowed(mtPig, allowedMobs); + addIfAllowed(mtCow, allowedMobs); + addIfAllowed(mtChicken, allowedMobs); + addIfAllowed(mtEnderman, allowedMobs); + addIfAllowed(mtSlime, allowedMobs); // MG TODO : much more complicated rule if (a_Biome == biForest || a_Biome == biForestHills || a_Biome == biTaiga || a_Biome == biTaigaHills) { - addIfAllowed(cMonster::mtWolf, allowedMobs); + addIfAllowed(mtWolf, allowedMobs); } else if (a_Biome == biJungle || a_Biome == biJungleHills) { - addIfAllowed(cMonster::mtOcelot, allowedMobs); + addIfAllowed(mtOcelot, allowedMobs); } } } @@ -107,7 +107,7 @@ cMonster::eType cMobSpawner::ChooseMobType(EMCSBiome a_Biome) size_t allowedMobsSize = allowedMobs.size(); if (allowedMobsSize > 0) { - std::set<cMonster::eType>::iterator itr = allowedMobs.begin(); + std::set<eMonsterType>::iterator itr = allowedMobs.begin(); int iRandom = m_Random.NextInt((int)allowedMobsSize, a_Biome); for (int i = 0; i < iRandom; i++) @@ -117,14 +117,14 @@ cMonster::eType cMobSpawner::ChooseMobType(EMCSBiome a_Biome) return *itr; } - return cMonster::mtInvalidType; + return mtInvalidType; } -bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_RelZ, cMonster::eType a_MobType, EMCSBiome a_Biome) +bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_RelZ, eMonsterType a_MobType, EMCSBiome a_Biome) { BLOCKTYPE TargetBlock = E_BLOCK_AIR; if (m_AllowedTypes.find(a_MobType) != m_AllowedTypes.end() && a_Chunk->UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, TargetBlock)) @@ -143,21 +143,21 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R switch (a_MobType) { - case cMonster::mtSquid: + case mtSquid: { return IsBlockWater(TargetBlock) && (a_RelY >= 45) && (a_RelY <= 62); } - case cMonster::mtBat: + case mtBat: { return (a_RelY <= 63) && (BlockLight <= 4) && (SkyLight <= 4) && (TargetBlock == E_BLOCK_AIR) && !cBlockInfo::IsTransparent(BlockAbove); } - case cMonster::mtChicken: - case cMonster::mtCow: - case cMonster::mtPig: - case cMonster::mtHorse: - case cMonster::mtSheep: + case mtChicken: + case mtCow: + case mtPig: + case mtHorse: + case mtSheep: { return ( (TargetBlock == E_BLOCK_AIR) && @@ -168,7 +168,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R ); } - case cMonster::mtOcelot: + case mtOcelot: { return ( (TargetBlock == E_BLOCK_AIR) && @@ -181,7 +181,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R ); } - case cMonster::mtEnderman: + case mtEnderman: { if (a_RelY < 250) { @@ -202,7 +202,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R break; } - case cMonster::mtSpider: + case mtSpider: { bool CanSpawn = true; bool HasFloor = false; @@ -228,9 +228,9 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R return CanSpawn && HasFloor && (SkyLight <= 7) && (BlockLight <= 7); } - case cMonster::mtCreeper: - case cMonster::mtSkeleton: - case cMonster::mtZombie: + case mtCreeper: + case mtSkeleton: + case mtZombie: { return ( (TargetBlock == E_BLOCK_AIR) && @@ -242,8 +242,8 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R ); } - case cMonster::mtMagmaCube: - case cMonster::mtSlime: + case mtMagmaCube: + case mtSlime: { return ( (TargetBlock == E_BLOCK_AIR) && @@ -255,8 +255,8 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R ); } - case cMonster::mtGhast: - case cMonster::mtZombiePigman: + case mtGhast: + case mtZombiePigman: { return ( (TargetBlock == E_BLOCK_AIR) && @@ -266,7 +266,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R ); } - case cMonster::mtWolf: + case mtWolf: { return ( (TargetBlock == E_BLOCK_GRASS) && @@ -305,15 +305,15 @@ cMonster* cMobSpawner::TryToSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, if (m_NewPack) { m_MobType = ChooseMobType(a_Biome); - if (m_MobType == cMonster::mtInvalidType) + if (m_MobType == mtInvalidType) { return toReturn; } - if (m_MobType == cMonster::mtWolf) + if (m_MobType == mtWolf) { a_MaxPackSize = 8; } - else if (m_MobType == cMonster::mtGhast) + else if (m_MobType == mtGhast) { a_MaxPackSize = 1; } diff --git a/src/MobSpawner.h b/src/MobSpawner.h index f3c56fe2d..6b3a913ec 100644 --- a/src/MobSpawner.h +++ b/src/MobSpawner.h @@ -30,7 +30,7 @@ public : // a_AllowedTypes is the set of types allowed for mobs it will spawn. Empty set // would result in no spawn at all // Allowed mobs thah are not of the right Family will not be include (no warning) - cMobSpawner(cMonster::eFamily MobFamily, const std::set<cMonster::eType> & a_AllowedTypes); + cMobSpawner(cMonster::eFamily MobFamily, const std::set<eMonsterType> & a_AllowedTypes); /// Check if specified block can be a Pack center for this spawner bool CheckPackCenter(BLOCKTYPE a_BlockType); @@ -53,20 +53,20 @@ public : protected : // return true if specified type of mob can spawn on specified block - bool CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_RelZ, cMonster::eType a_MobType, EMCSBiome a_Biome); + bool CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_RelZ, eMonsterType a_MobType, EMCSBiome a_Biome); // return a random type that can spawn on specified biome. // returns E_ENTITY_TYPE_DONOTUSE if none is possible - cMonster::eType ChooseMobType(EMCSBiome a_Biome); + eMonsterType ChooseMobType(EMCSBiome a_Biome); // add toAdd inside toAddIn, if toAdd is in m_AllowedTypes - void addIfAllowed(cMonster::eType toAdd, std::set<cMonster::eType> & toAddIn); + void addIfAllowed(eMonsterType toAdd, std::set<eMonsterType> & toAddIn); protected : cMonster::eFamily m_MonsterFamily; - std::set<cMonster::eType> m_AllowedTypes; + std::set<eMonsterType> m_AllowedTypes; bool m_NewPack; - cMonster::eType m_MobType; + eMonsterType m_MobType; std::set<cMonster*> m_Spawned; cFastRandom m_Random; } ; diff --git a/src/Mobs/AggressiveMonster.cpp b/src/Mobs/AggressiveMonster.cpp index 5f5b1853d..be2f71f7a 100644 --- a/src/Mobs/AggressiveMonster.cpp +++ b/src/Mobs/AggressiveMonster.cpp @@ -11,7 +11,7 @@ -cAggressiveMonster::cAggressiveMonster(const AString & a_ConfigName, eType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height) : +cAggressiveMonster::cAggressiveMonster(const AString & a_ConfigName, eMonsterType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height) : super(a_ConfigName, a_MobType, a_SoundHurt, a_SoundDeath, a_Width, a_Height) { m_EMPersonality = AGGRESSIVE; diff --git a/src/Mobs/AggressiveMonster.h b/src/Mobs/AggressiveMonster.h index d70ff04a3..2549ba2d3 100644 --- a/src/Mobs/AggressiveMonster.h +++ b/src/Mobs/AggressiveMonster.h @@ -14,7 +14,7 @@ class cAggressiveMonster : public: - cAggressiveMonster(const AString & a_ConfigName, eType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height); + cAggressiveMonster(const AString & a_ConfigName, eMonsterType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height); virtual void Tick (float a_Dt, cChunk & a_Chunk) override; virtual void InStateChasing(float a_Dt) override; diff --git a/src/Mobs/CMakeLists.txt b/src/Mobs/CMakeLists.txt index 2c092c15f..bbbb9287a 100644 --- a/src/Mobs/CMakeLists.txt +++ b/src/Mobs/CMakeLists.txt @@ -54,6 +54,7 @@ SET (HDRS IronGolem.h MagmaCube.h Monster.h + MonsterTypes.h Mooshroom.h Ocelot.h PassiveAggressiveMonster.h diff --git a/src/Mobs/Enderman.cpp b/src/Mobs/Enderman.cpp index becc99a86..567714382 100644 --- a/src/Mobs/Enderman.cpp +++ b/src/Mobs/Enderman.cpp @@ -2,6 +2,76 @@ #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules #include "Enderman.h" +#include "../Entities/Player.h" +#include "../Tracer.h" + + + + +//////////////////////////////////////////////////////////////////////////////// +// cPlayerLookCheck +class cPlayerLookCheck : + public cPlayerListCallback +{ +public: + cPlayerLookCheck(Vector3d a_EndermanPos, int a_SightDistance) : + m_Player(NULL), + m_EndermanPos(a_EndermanPos), + m_SightDistance(a_SightDistance) + { + } + + virtual bool Item(cPlayer * a_Player) override + { + // Don't check players who are in creative gamemode + if (a_Player->IsGameModeCreative()) + { + return false; + } + + Vector3d Direction = m_EndermanPos - a_Player->GetPosition(); + + // Don't check players who are more then SightDistance (64) blocks away + if (Direction.Length() > m_SightDistance) + { + return false; + } + + // Don't check if the player has a pumpkin on his head + if (a_Player->GetEquippedHelmet().m_ItemType == E_BLOCK_PUMPKIN) + { + return false; + } + + + Vector3d LookVector = a_Player->GetLookVector(); + double dot = Direction.Dot(LookVector); + + // 0.09 rad ~ 5 degrees + // If the player's crosshair is within 5 degrees of the enderman, it counts as looking + if (dot <= cos(0.09)) + { + return false; + } + + cTracer LineOfSight(a_Player->GetWorld()); + if (LineOfSight.Trace(m_EndermanPos, Direction, (int)Direction.Length())) + { + // No direct line of sight + return false; + } + + m_Player = a_Player; + return true; + } + + cPlayer * GetPlayer(void) const { return m_Player; } + +protected: + cPlayer * m_Player; + Vector3d m_EndermanPos; + int m_SightDistance; +} ; @@ -32,3 +102,102 @@ void cEnderman::GetDrops(cItems & a_Drops, cEntity * a_Killer) +void cEnderman::CheckEventSeePlayer() +{ + if (m_Target != NULL) + { + return; + } + + cPlayerLookCheck Callback(GetPosition(), m_SightDistance); + if (m_World->ForEachPlayer(Callback)) + { + return; + } + + ASSERT(Callback.GetPlayer() != NULL); + + if (!CheckLight()) + { + // Insufficient light for enderman to become aggravated + // TODO: Teleport to a suitable location + return; + } + + if (!Callback.GetPlayer()->IsGameModeCreative()) + { + super::EventSeePlayer(Callback.GetPlayer()); + m_EMState = CHASING; + m_bIsScreaming = true; + GetWorld()->BroadcastEntityMetadata(*this); + } +} + + + + + +void cEnderman::CheckEventLostPlayer(void) +{ + super::CheckEventLostPlayer(); + if (!CheckLight()) + { + EventLosePlayer(); + } +} + + + + + +void cEnderman::EventLosePlayer() +{ + super::EventLosePlayer(); + m_bIsScreaming = false; + GetWorld()->BroadcastEntityMetadata(*this); +} + + + + + +bool cEnderman::CheckLight() +{ + int ChunkX, ChunkZ; + cChunkDef::BlockToChunk(POSX_TOINT, POSZ_TOINT, ChunkX, ChunkZ); + + // Check if the chunk the enderman is in is lit + if (!m_World->IsChunkLighted(ChunkX, ChunkZ)) + { + m_World->QueueLightChunk(ChunkX, ChunkZ); + return true; + } + + // Enderman only attack if the skylight is lower or equal to 8 + if (m_World->GetBlockSkyLight(POSX_TOINT, POSY_TOINT, POSZ_TOINT) - GetWorld()->GetSkyDarkness() > 8) + { + return false; + } + + return true; +} + + + + + +void cEnderman::Tick(float a_Dt, cChunk & a_Chunk) +{ + super::Tick(a_Dt, a_Chunk); + + // TODO take damage in rain + + // Take damage when touching water, drowning damage seems to be most appropriate + if (IsSwimming()) + { + EventLosePlayer(); + TakeDamage(dtDrowning, NULL, 1, 0); + // TODO teleport to a safe location + } + +} diff --git a/src/Mobs/Enderman.h b/src/Mobs/Enderman.h index aa2eff682..947c32b96 100644 --- a/src/Mobs/Enderman.h +++ b/src/Mobs/Enderman.h @@ -18,11 +18,18 @@ public: CLASS_PROTODEF(cEnderman) virtual void GetDrops(cItems & a_Drops, cEntity * a_Killer = NULL) override; + virtual void CheckEventSeePlayer(void) override; + virtual void CheckEventLostPlayer(void) override; + virtual void EventLosePlayer(void) override; + virtual void Tick(float a_Dt, cChunk & a_Chunk) override; bool IsScreaming(void) const {return m_bIsScreaming; } BLOCKTYPE GetCarriedBlock(void) const {return CarriedBlock; } NIBBLETYPE GetCarriedMeta(void) const {return CarriedMeta; } + /** Returns if the current sky light level is sufficient for the enderman to become aggravated */ + bool CheckLight(void); + private: bool m_bIsScreaming; diff --git a/src/Mobs/Monster.cpp b/src/Mobs/Monster.cpp index 622a67816..73dbcb3c3 100644 --- a/src/Mobs/Monster.cpp +++ b/src/Mobs/Monster.cpp @@ -24,48 +24,58 @@ The strings need to be lowercase (for more efficient comparisons in StringToMobT */ static const struct { - cMonster::eType m_Type; + eMonsterType m_Type; const char * m_lcName; } g_MobTypeNames[] = { - {cMonster::mtBat, "bat"}, - {cMonster::mtBlaze, "blaze"}, - {cMonster::mtCaveSpider, "cavespider"}, - {cMonster::mtChicken, "chicken"}, - {cMonster::mtCow, "cow"}, - {cMonster::mtCreeper, "creeper"}, - {cMonster::mtEnderman, "enderman"}, - {cMonster::mtEnderDragon, "enderdragon"}, - {cMonster::mtGhast, "ghast"}, - {cMonster::mtHorse, "horse"}, - {cMonster::mtIronGolem, "irongolem"}, - {cMonster::mtMagmaCube, "magmacube"}, - {cMonster::mtMooshroom, "mooshroom"}, - {cMonster::mtOcelot, "ocelot"}, - {cMonster::mtPig, "pig"}, - {cMonster::mtSheep, "sheep"}, - {cMonster::mtSilverfish, "silverfish"}, - {cMonster::mtSkeleton, "skeleton"}, - {cMonster::mtSlime, "slime"}, - {cMonster::mtSnowGolem, "snowgolem"}, - {cMonster::mtSpider, "spider"}, - {cMonster::mtSquid, "squid"}, - {cMonster::mtVillager, "villager"}, - {cMonster::mtWitch, "witch"}, - {cMonster::mtWither, "wither"}, - {cMonster::mtWolf, "wolf"}, - {cMonster::mtZombie, "zombie"}, - {cMonster::mtZombiePigman, "zombiepigman"}, + {mtBat, "bat"}, + {mtBlaze, "blaze"}, + {mtCaveSpider, "cavespider"}, + {mtChicken, "chicken"}, + {mtCow, "cow"}, + {mtCreeper, "creeper"}, + {mtEnderman, "enderman"}, + {mtEnderDragon, "enderdragon"}, + {mtGhast, "ghast"}, + {mtHorse, "horse"}, + {mtIronGolem, "irongolem"}, + {mtMagmaCube, "magmacube"}, + {mtMooshroom, "mooshroom"}, + {mtOcelot, "ocelot"}, + {mtPig, "pig"}, + {mtSheep, "sheep"}, + {mtSilverfish, "silverfish"}, + {mtSkeleton, "skeleton"}, + {mtSlime, "slime"}, + {mtSnowGolem, "snowgolem"}, + {mtSpider, "spider"}, + {mtSquid, "squid"}, + {mtVillager, "villager"}, + {mtWitch, "witch"}, + {mtWither, "wither"}, + {mtWolf, "wolf"}, + {mtZombie, "zombie"}, + {mtZombiePigman, "zombiepigman"}, } ; +eMonsterType StringToMobType(const AString & a_MobString) +{ + LOGWARNING("%s: Function is obsolete, use cMonster::StringToMobType() instead", __FUNCTION__); + return cMonster::StringToMobType(a_MobString); +} + + + + + //////////////////////////////////////////////////////////////////////////////// // cMonster: -cMonster::cMonster(const AString & a_ConfigName, eType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height) +cMonster::cMonster(const AString & a_ConfigName, eMonsterType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height) : super(etMonster, a_Width, a_Height) , m_EMState(IDLE) , m_EMPersonality(AGGRESSIVE) @@ -75,6 +85,8 @@ cMonster::cMonster(const AString & a_ConfigName, eType a_MobType, const AString , m_IdleInterval(0) , m_DestroyTimer(0) , m_MobType(a_MobType) + , m_CustomName("") + , m_CustomNameAlwaysVisible(false) , m_SoundHurt(a_SoundHurt) , m_SoundDeath(a_SoundDeath) , m_AttackRate(3) @@ -89,6 +101,7 @@ cMonster::cMonster(const AString & a_ConfigName, eType a_MobType, const AString , m_DropChanceBoots(0.085f) , m_CanPickUpLoot(true) , m_BurnsInDaylight(false) + , m_RelativeWalkSpeed(1.0) { if (!a_ConfigName.empty()) { @@ -276,11 +289,13 @@ void cMonster::Tick(float a_Dt, cChunk & a_Chunk) if (DoesPosYRequireJump((int)floor(m_Destination.y))) { m_bOnGround = false; - AddSpeedY(5.2); // Jump!! + + // TODO: Change to AddSpeedY once collision detection is fixed - currently, mobs will go into blocks attempting to jump without a teleport + AddPosY(1.2); // Jump!! } } - Vector3f Distance = m_Destination - GetPosition(); + Vector3d Distance = m_Destination - GetPosition(); if (!ReachedDestination() && !ReachedFinalDestination()) // If we haven't reached any sort of destination, move { Distance.y = 0; @@ -288,22 +303,33 @@ void cMonster::Tick(float a_Dt, cChunk & a_Chunk) if (m_bOnGround) { - Distance *= 2.5; + Distance *= 2.5f; + } + else if (IsSwimming()) + { + Distance *= 1.3f; } else { // Don't let the mob move too much if he's falling. - Distance *= 0.25; + Distance *= 0.25f; } + // Apply walk speed: + Distance *= m_RelativeWalkSpeed; + AddSpeedX(Distance.x); AddSpeedZ(Distance.z); + // It's too buggy! + /* if (m_EMState == ESCAPING) - { // Runs Faster when escaping :D otherwise they just walk away + { + // Runs Faster when escaping :D otherwise they just walk away SetSpeedX (GetSpeedX() * 2.f); SetSpeedZ (GetSpeedZ() * 2.f); } + */ } else { @@ -475,50 +501,50 @@ void cMonster::KilledBy(TakeDamageInfo & a_TDI) switch (m_MobType) { // Animals - case cMonster::mtChicken: - case cMonster::mtCow: - case cMonster::mtHorse: - case cMonster::mtPig: - case cMonster::mtSheep: - case cMonster::mtSquid: - case cMonster::mtMooshroom: - case cMonster::mtOcelot: - case cMonster::mtWolf: + case mtChicken: + case mtCow: + case mtHorse: + case mtPig: + case mtSheep: + case mtSquid: + case mtMooshroom: + case mtOcelot: + case mtWolf: { Reward = m_World->GetTickRandomNumber(2) + 1; break; } // Monsters - case cMonster::mtCaveSpider: - case cMonster::mtCreeper: - case cMonster::mtEnderman: - case cMonster::mtGhast: - case cMonster::mtSilverfish: - case cMonster::mtSkeleton: - case cMonster::mtSpider: - case cMonster::mtWitch: - case cMonster::mtZombie: - case cMonster::mtZombiePigman: - case cMonster::mtSlime: - case cMonster::mtMagmaCube: + case mtCaveSpider: + case mtCreeper: + case mtEnderman: + case mtGhast: + case mtSilverfish: + case mtSkeleton: + case mtSpider: + case mtWitch: + case mtZombie: + case mtZombiePigman: + case mtSlime: + case mtMagmaCube: { Reward = 6 + (m_World->GetTickRandomNumber(2)); break; } - case cMonster::mtBlaze: + case mtBlaze: { Reward = 10; break; } // Bosses - case cMonster::mtEnderDragon: + case mtEnderDragon: { Reward = 12000; break; } - case cMonster::mtWither: + case mtWither: { Reward = 50; break; @@ -541,6 +567,25 @@ void cMonster::KilledBy(TakeDamageInfo & a_TDI) +void cMonster::OnRightClicked(cPlayer & a_Player) +{ + super::OnRightClicked(a_Player); + + const cItem & EquippedItem = a_Player.GetEquippedItem(); + if ((EquippedItem.m_ItemType == E_ITEM_NAME_TAG) && !EquippedItem.m_CustomName.empty()) + { + SetCustomName(EquippedItem.m_CustomName); + if (!a_Player.IsGameModeCreative()) + { + a_Player.GetInventory().RemoveOneEquippedItem(); + } + } +} + + + + + // Checks to see if EventSeePlayer should be fired // monster sez: Do I see the player void cMonster::CheckEventSeePlayer(void) @@ -669,6 +714,39 @@ void cMonster::InStateEscaping(float a_Dt) +void cMonster::SetCustomName(const AString & a_CustomName) +{ + m_CustomName = a_CustomName; + + // The maximal length is 64 + if (a_CustomName.length() > 64) + { + m_CustomName = a_CustomName.substr(0, 64); + } + + if (m_World != NULL) + { + m_World->BroadcastEntityMetadata(*this); + } +} + + + + + +void cMonster::SetCustomNameAlwaysVisible(bool a_CustomNameAlwaysVisible) +{ + m_CustomNameAlwaysVisible = a_CustomNameAlwaysVisible; + if (m_World != NULL) + { + m_World->BroadcastEntityMetadata(*this); + } +} + + + + + void cMonster::GetMonsterConfig(const AString & a_Name) { cRoot::Get()->GetMonsterConfig()->AssignAttributes(this, a_Name); @@ -687,7 +765,7 @@ bool cMonster::IsUndead(void) -AString cMonster::MobTypeToString(cMonster::eType a_MobType) +AString cMonster::MobTypeToString(eMonsterType a_MobType) { // Mob types aren't sorted, so we need to search linearly: for (size_t i = 0; i < ARRAYCOUNT(g_MobTypeNames); i++) @@ -706,10 +784,9 @@ AString cMonster::MobTypeToString(cMonster::eType a_MobType) -cMonster::eType cMonster::StringToMobType(const AString & a_Name) +eMonsterType cMonster::StringToMobType(const AString & a_Name) { - AString lcName(a_Name); - StrToLower(lcName); + AString lcName = StrToLower(a_Name); // Binary-search for the lowercase name: int lo = 0, hi = ARRAYCOUNT(g_MobTypeNames) - 1; @@ -748,7 +825,7 @@ cMonster::eType cMonster::StringToMobType(const AString & a_Name) -cMonster::eFamily cMonster::FamilyFromType(eType a_Type) +cMonster::eFamily cMonster::FamilyFromType(eMonsterType a_Type) { // Passive-agressive mobs are counted in mob spawning code as passive @@ -813,7 +890,7 @@ int cMonster::GetSpawnDelay(cMonster::eFamily a_MobFamily) -cMonster * cMonster::NewMonsterFromType(cMonster::eType a_MobType) +cMonster * cMonster::NewMonsterFromType(eMonsterType a_MobType) { cFastRandom Random; cMonster * toReturn = NULL; @@ -1015,7 +1092,7 @@ void cMonster::HandleDaylightBurning(cChunk & a_Chunk) (a_Chunk.GetBlock(RelX, RelY, RelZ) != E_BLOCK_SOULSAND) && // Not on soulsand (GetWorld()->GetTimeOfDay() < (12000 + 1000)) && // It is nighttime !IsOnFire() && // Not already burning - GetWorld()->IsWeatherWetAt(POSX_TOINT, POSZ_TOINT) // Not raining + GetWorld()->IsWeatherSunnyAt(POSX_TOINT, POSZ_TOINT) // Not raining ) { // Burn for 100 ticks, then decide again diff --git a/src/Mobs/Monster.h b/src/Mobs/Monster.h index cdbd26c09..9fd67d67c 100644 --- a/src/Mobs/Monster.h +++ b/src/Mobs/Monster.h @@ -6,6 +6,7 @@ #include "../BlockID.h" #include "../Item.h" #include "../Enchantments.h" +#include "MonsterTypes.h" @@ -23,41 +24,6 @@ class cMonster : { typedef cPawn super; public: - /// This identifies individual monster type, as well as their network type-ID - enum eType - { - mtInvalidType = -1, - - mtBat = E_META_SPAWN_EGG_BAT, - mtBlaze = E_META_SPAWN_EGG_BLAZE, - mtCaveSpider = E_META_SPAWN_EGG_CAVE_SPIDER, - mtChicken = E_META_SPAWN_EGG_CHICKEN, - mtCow = E_META_SPAWN_EGG_COW, - mtCreeper = E_META_SPAWN_EGG_CREEPER, - mtEnderDragon = E_META_SPAWN_EGG_ENDER_DRAGON, - mtEnderman = E_META_SPAWN_EGG_ENDERMAN, - mtGhast = E_META_SPAWN_EGG_GHAST, - mtGiant = E_META_SPAWN_EGG_GIANT, - mtHorse = E_META_SPAWN_EGG_HORSE, - mtIronGolem = E_META_SPAWN_EGG_IRON_GOLEM, - mtMagmaCube = E_META_SPAWN_EGG_MAGMA_CUBE, - mtMooshroom = E_META_SPAWN_EGG_MOOSHROOM, - mtOcelot = E_META_SPAWN_EGG_OCELOT, - mtPig = E_META_SPAWN_EGG_PIG, - mtSheep = E_META_SPAWN_EGG_SHEEP, - mtSilverfish = E_META_SPAWN_EGG_SILVERFISH, - mtSkeleton = E_META_SPAWN_EGG_SKELETON, - mtSlime = E_META_SPAWN_EGG_SLIME, - mtSnowGolem = E_META_SPAWN_EGG_SNOW_GOLEM, - mtSpider = E_META_SPAWN_EGG_SPIDER, - mtSquid = E_META_SPAWN_EGG_SQUID, - mtVillager = E_META_SPAWN_EGG_VILLAGER, - mtWitch = E_META_SPAWN_EGG_WITCH, - mtWither = E_META_SPAWN_EGG_WITHER, - mtWolf = E_META_SPAWN_EGG_WOLF, - mtZombie = E_META_SPAWN_EGG_ZOMBIE, - mtZombiePigman = E_META_SPAWN_EGG_ZOMBIE_PIGMAN, - } ; enum eFamily { @@ -80,7 +46,7 @@ public: a_MobType is the type of the mob (also used in the protocol ( http://wiki.vg/Entities#Mobs 2012_12_22)) a_SoundHurt and a_SoundDeath are assigned into m_SoundHurt and m_SoundDeath, respectively */ - cMonster(const AString & a_ConfigName, eType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height); + cMonster(const AString & a_ConfigName, eMonsterType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height); CLASS_PROTODEF(cMonster) @@ -92,11 +58,13 @@ public: virtual void KilledBy(TakeDamageInfo & a_TDI) override; + virtual void OnRightClicked(cPlayer & a_Player) override; + virtual void MoveToPosition(const Vector3d & a_Position); // tolua_export virtual bool ReachedDestination(void); // tolua_begin - eType GetMobType(void) const {return m_MobType; } + eMonsterType GetMobType(void) const {return m_MobType; } eFamily GetMobFamily(void) const; // tolua_end @@ -138,21 +106,41 @@ public: /// Sets whether the mob burns in daylight. Only evaluated at next burn-decision tick void SetBurnsInDaylight(bool a_BurnsInDaylight) { m_BurnsInDaylight = a_BurnsInDaylight; } + double GetRelativeWalkSpeed(void) const { return m_RelativeWalkSpeed; } // tolua_export + void SetRelativeWalkSpeed(double a_WalkSpeed) { m_RelativeWalkSpeed = a_WalkSpeed; } // tolua_export + // Overridables to handle ageable mobs virtual bool IsBaby (void) const { return false; } virtual bool IsTame (void) const { return false; } virtual bool IsSitting (void) const { return false; } // tolua_begin - + + /** Returns true if the monster has a custom name. */ + bool HasCustomName(void) const { return !m_CustomName.empty(); } + + /** Gets the custom name of the monster. If no custom name is set, the function returns an empty string. */ + const AString & GetCustomName(void) const { return m_CustomName; } + + /** Sets the custom name of the monster. You see the name over the monster. + If you want to disable the custom name, simply set an empty string. */ + void SetCustomName(const AString & a_CustomName); + + /** Is the custom name of this monster always visible? If not, you only see the name when you sight the mob. */ + bool IsCustomNameAlwaysVisible(void) const { return m_CustomNameAlwaysVisible; } + + /** Sets the custom name visiblity of this monster. + If it's false, you only see the name when you sight the mob. If it's true, you always see the custom name. */ + void SetCustomNameAlwaysVisible(bool a_CustomNameAlwaysVisible); + /// Translates MobType enum to a string, empty string if unknown - static AString MobTypeToString(eType a_MobType); + static AString MobTypeToString(eMonsterType a_MobType); /// Translates MobType string to the enum, mtInvalidType if not recognized - static eType StringToMobType(const AString & a_MobTypeName); + static eMonsterType StringToMobType(const AString & a_MobTypeName); /// Returns the mob family based on the type - static eFamily FamilyFromType(eType a_MobType); + static eFamily FamilyFromType(eMonsterType a_MobType); /// Returns the spawn delay (number of game ticks between spawn attempts) for the given mob family static int GetSpawnDelay(cMonster::eFamily a_MobFamily); @@ -163,7 +151,7 @@ public: a_MobType is the type of the mob to be created Asserts and returns null if mob type is not specified */ - static cMonster * NewMonsterFromType(eType a_MobType); + static cMonster * NewMonsterFromType(eMonsterType a_MobType); protected: @@ -227,7 +215,9 @@ protected: float m_IdleInterval; float m_DestroyTimer; - eType m_MobType; + eMonsterType m_MobType; + AString m_CustomName; + bool m_CustomNameAlwaysVisible; AString m_SoundHurt; AString m_SoundDeath; @@ -248,6 +238,8 @@ protected: void HandleDaylightBurning(cChunk & a_Chunk); bool m_BurnsInDaylight; + double m_RelativeWalkSpeed; + /** Adds a random number of a_Item between a_Min and a_Max to itemdrops a_Drops*/ void AddRandomDropItem(cItems & a_Drops, unsigned int a_Min, unsigned int a_Max, short a_Item, short a_ItemHealth = 0); diff --git a/src/Mobs/MonsterTypes.h b/src/Mobs/MonsterTypes.h new file mode 100644 index 000000000..852eb3446 --- /dev/null +++ b/src/Mobs/MonsterTypes.h @@ -0,0 +1,54 @@ + +#pragma once + +/// This identifies individual monster type, as well as their network type-ID +// tolua_begin +enum eMonsterType +{ + mtInvalidType = -1, + + mtBat = E_META_SPAWN_EGG_BAT, + mtBlaze = E_META_SPAWN_EGG_BLAZE, + mtCaveSpider = E_META_SPAWN_EGG_CAVE_SPIDER, + mtChicken = E_META_SPAWN_EGG_CHICKEN, + mtCow = E_META_SPAWN_EGG_COW, + mtCreeper = E_META_SPAWN_EGG_CREEPER, + mtEnderDragon = E_META_SPAWN_EGG_ENDER_DRAGON, + mtEnderman = E_META_SPAWN_EGG_ENDERMAN, + mtGhast = E_META_SPAWN_EGG_GHAST, + mtGiant = E_META_SPAWN_EGG_GIANT, + mtHorse = E_META_SPAWN_EGG_HORSE, + mtIronGolem = E_META_SPAWN_EGG_IRON_GOLEM, + mtMagmaCube = E_META_SPAWN_EGG_MAGMA_CUBE, + mtMooshroom = E_META_SPAWN_EGG_MOOSHROOM, + mtOcelot = E_META_SPAWN_EGG_OCELOT, + mtPig = E_META_SPAWN_EGG_PIG, + mtSheep = E_META_SPAWN_EGG_SHEEP, + mtSilverfish = E_META_SPAWN_EGG_SILVERFISH, + mtSkeleton = E_META_SPAWN_EGG_SKELETON, + mtSlime = E_META_SPAWN_EGG_SLIME, + mtSnowGolem = E_META_SPAWN_EGG_SNOW_GOLEM, + mtSpider = E_META_SPAWN_EGG_SPIDER, + mtSquid = E_META_SPAWN_EGG_SQUID, + mtVillager = E_META_SPAWN_EGG_VILLAGER, + mtWitch = E_META_SPAWN_EGG_WITCH, + mtWither = E_META_SPAWN_EGG_WITHER, + mtWolf = E_META_SPAWN_EGG_WOLF, + mtZombie = E_META_SPAWN_EGG_ZOMBIE, + mtZombiePigman = E_META_SPAWN_EGG_ZOMBIE_PIGMAN, +} ; + + + + + +/** Translates a mob string ("ocelot") to mobtype (mtOcelot). +OBSOLETE, use cMonster::StringToMobType() instead. +Implemented in Monster.cpp. */ +extern eMonsterType StringToMobType(const AString & a_MobString); + +// tolua_end + + + + diff --git a/src/Mobs/Mooshroom.cpp b/src/Mobs/Mooshroom.cpp index 81bd3e3b4..99958720f 100644 --- a/src/Mobs/Mooshroom.cpp +++ b/src/Mobs/Mooshroom.cpp @@ -67,7 +67,7 @@ void cMooshroom::OnRightClicked(cPlayer & a_Player) cItems Drops; Drops.push_back(cItem(E_BLOCK_RED_MUSHROOM, 5, 0)); m_World->SpawnItemPickups(Drops, GetPosX(), GetPosY(), GetPosZ(), 10); - m_World->SpawnMob(GetPosX(), GetPosY(), GetPosZ(), cMonster::mtCow); + m_World->SpawnMob(GetPosX(), GetPosY(), GetPosZ(), mtCow); Destroy(); } break; } diff --git a/src/Mobs/PassiveAggressiveMonster.cpp b/src/Mobs/PassiveAggressiveMonster.cpp index 24501b1ba..e0cc2fd21 100644 --- a/src/Mobs/PassiveAggressiveMonster.cpp +++ b/src/Mobs/PassiveAggressiveMonster.cpp @@ -9,7 +9,7 @@ -cPassiveAggressiveMonster::cPassiveAggressiveMonster(const AString & a_ConfigName, eType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height) : +cPassiveAggressiveMonster::cPassiveAggressiveMonster(const AString & a_ConfigName, eMonsterType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height) : super(a_ConfigName, a_MobType, a_SoundHurt, a_SoundDeath, a_Width, a_Height) { m_EMPersonality = PASSIVE; diff --git a/src/Mobs/PassiveAggressiveMonster.h b/src/Mobs/PassiveAggressiveMonster.h index a0da50e8e..72f472281 100644 --- a/src/Mobs/PassiveAggressiveMonster.h +++ b/src/Mobs/PassiveAggressiveMonster.h @@ -13,7 +13,7 @@ class cPassiveAggressiveMonster : typedef cAggressiveMonster super; public: - cPassiveAggressiveMonster(const AString & a_ConfigName, eType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height); + cPassiveAggressiveMonster(const AString & a_ConfigName, eMonsterType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height); virtual bool DoTakeDamage(TakeDamageInfo & a_TDI) override; } ; diff --git a/src/Mobs/PassiveMonster.cpp b/src/Mobs/PassiveMonster.cpp index 2861d7314..be3043e3d 100644 --- a/src/Mobs/PassiveMonster.cpp +++ b/src/Mobs/PassiveMonster.cpp @@ -8,7 +8,7 @@ -cPassiveMonster::cPassiveMonster(const AString & a_ConfigName, eType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height) : +cPassiveMonster::cPassiveMonster(const AString & a_ConfigName, eMonsterType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height) : super(a_ConfigName, a_MobType, a_SoundHurt, a_SoundDeath, a_Width, a_Height) { m_EMPersonality = PASSIVE; diff --git a/src/Mobs/PassiveMonster.h b/src/Mobs/PassiveMonster.h index 70574585a..9221d9a6e 100644 --- a/src/Mobs/PassiveMonster.h +++ b/src/Mobs/PassiveMonster.h @@ -13,7 +13,7 @@ class cPassiveMonster : typedef cMonster super; public: - cPassiveMonster(const AString & a_ConfigName, eType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height); + cPassiveMonster(const AString & a_ConfigName, eMonsterType a_MobType, const AString & a_SoundHurt, const AString & a_SoundDeath, double a_Width, double a_Height); virtual void Tick(float a_Dt, cChunk & a_Chunk) override; diff --git a/src/Mobs/Sheep.cpp b/src/Mobs/Sheep.cpp index 9fb47201d..cbb33cb90 100644 --- a/src/Mobs/Sheep.cpp +++ b/src/Mobs/Sheep.cpp @@ -39,6 +39,13 @@ void cSheep::GetDrops(cItems & a_Drops, cEntity * a_Killer) { a_Drops.push_back(cItem(E_BLOCK_WOOL, 1, m_WoolColor)); } + + int LootingLevel = 0; + if (a_Killer != NULL) + { + LootingLevel = a_Killer->GetEquippedWeapon().m_Enchantments.GetLevel(cEnchantments::enchLooting); + } + AddRandomDropItem(a_Drops, 1, 3 + LootingLevel, IsOnFire() ? E_ITEM_COOKED_MUTTON : E_ITEM_RAW_MUTTON); } @@ -47,6 +54,8 @@ void cSheep::GetDrops(cItems & a_Drops, cEntity * a_Killer) void cSheep::OnRightClicked(cPlayer & a_Player) { + super::OnRightClicked(a_Player); + const cItem & EquippedItem = a_Player.GetEquippedItem(); if ((EquippedItem.m_ItemType == E_ITEM_SHEARS) && !IsSheared() && !IsBaby()) { diff --git a/src/Mobs/Villager.cpp b/src/Mobs/Villager.cpp index 1cdac7c74..0efd5501e 100644 --- a/src/Mobs/Villager.cpp +++ b/src/Mobs/Villager.cpp @@ -109,11 +109,11 @@ void cVillager::HandleFarmerPrepareFarmCrops() Surrounding.Read( m_World, (int) GetPosX() - 5, - (int) GetPosX() + 5, + (int) GetPosX() + 6, (int) GetPosY() - 3, - (int) GetPosY() + 3, + (int) GetPosY() + 4, (int) GetPosZ() - 5, - (int) GetPosZ() + 5 + (int) GetPosZ() + 6 ); for (int I = 0; I < 5; I++) diff --git a/src/Mobs/Villager.h b/src/Mobs/Villager.h index aa81f0790..d3a38dbf0 100644 --- a/src/Mobs/Villager.h +++ b/src/Mobs/Villager.h @@ -2,7 +2,7 @@ #pragma once #include "PassiveMonster.h" - +#include "Blocks/ChunkInterface.h" diff --git a/src/Mobs/Wolf.cpp b/src/Mobs/Wolf.cpp index 5bb97d30e..4fe1ff1d6 100644 --- a/src/Mobs/Wolf.cpp +++ b/src/Mobs/Wolf.cpp @@ -68,6 +68,7 @@ void cWolf::OnRightClicked(cPlayer & a_Player) { if (!IsTame() && !IsAngry()) { + // If the player is holding a bone, try to tame the wolf: if (a_Player.GetEquippedItem().m_ItemType == E_ITEM_BONE) { if (!a_Player.IsGameModeCreative()) @@ -77,14 +78,16 @@ void cWolf::OnRightClicked(cPlayer & a_Player) if (m_World->GetTickRandomNumber(7) == 0) { + // Taming succeeded SetMaxHealth(20); SetIsTame(true); - SetOwner(a_Player.GetName()); + SetOwner(a_Player.GetName(), a_Player.GetUUID()); m_World->BroadcastEntityStatus(*this, esWolfTamed); m_World->BroadcastParticleEffect("heart", (float) GetPosX(), (float) GetPosY(), (float) GetPosZ(), 0, 0, 0, 0, 5); } else { + // Taming failed m_World->BroadcastEntityStatus(*this, esWolfTaming); m_World->BroadcastParticleEffect("smoke", (float) GetPosX(), (float) GetPosY(), (float) GetPosZ(), 0, 0, 0, 0, 5); } @@ -92,6 +95,7 @@ void cWolf::OnRightClicked(cPlayer & a_Player) } else if (IsTame()) { + // Feed the wolf, restoring its health, or dye its collar: switch (a_Player.GetEquippedItem().m_ItemType) { case E_ITEM_RAW_BEEF: diff --git a/src/Mobs/Wolf.h b/src/Mobs/Wolf.h index 2e83db701..7500854f8 100644 --- a/src/Mobs/Wolf.h +++ b/src/Mobs/Wolf.h @@ -29,7 +29,8 @@ public: bool IsTame (void) const { return m_IsTame; } bool IsBegging (void) const { return m_IsBegging; } bool IsAngry (void) const { return m_IsAngry; } - AString GetOwner (void) const { return m_OwnerName; } + AString GetOwnerName (void) const { return m_OwnerName; } + AString GetOwnerUUID (void) const { return m_OwnerUUID; } int GetCollarColor(void) const { return m_CollarColor; } // Set functions @@ -37,8 +38,12 @@ public: void SetIsTame (bool a_IsTame) { m_IsTame = a_IsTame; } void SetIsBegging (bool a_IsBegging) { m_IsBegging = a_IsBegging; } void SetIsAngry (bool a_IsAngry) { m_IsAngry = a_IsAngry; } - void SetOwner (const AString & a_NewOwner) { m_OwnerName = a_NewOwner; } void SetCollarColor(int a_CollarColor) { m_CollarColor = a_CollarColor; } + void SetOwner (const AString & a_NewOwnerName, const AString & a_NewOwnerUUID) + { + m_OwnerName = a_NewOwnerName; + m_OwnerUUID = a_NewOwnerUUID; + } protected: @@ -47,6 +52,7 @@ protected: bool m_IsBegging; bool m_IsAngry; AString m_OwnerName; + AString m_OwnerUUID; int m_CollarColor; } ; diff --git a/src/Noise.cpp b/src/Noise.cpp index 507d05ea5..71e801f30 100644 --- a/src/Noise.cpp +++ b/src/Noise.cpp @@ -146,6 +146,8 @@ cCubicCell2D::cCubicCell2D( ) : m_Noise(a_Noise), m_WorkRnds(&m_Workspace1), + m_CurFloorX(0), + m_CurFloorY(0), m_Array(a_Array), m_SizeX(a_SizeX), m_SizeY(a_SizeY), @@ -300,6 +302,9 @@ cCubicCell3D::cCubicCell3D( ) : m_Noise(a_Noise), m_WorkRnds(&m_Workspace1), + m_CurFloorX(0), + m_CurFloorY(0), + m_CurFloorZ(0), m_Array(a_Array), m_SizeX(a_SizeX), m_SizeY(a_SizeY), diff --git a/src/OSSupport/CMakeLists.txt b/src/OSSupport/CMakeLists.txt index a42fcbed4..429949c59 100644 --- a/src/OSSupport/CMakeLists.txt +++ b/src/OSSupport/CMakeLists.txt @@ -39,6 +39,6 @@ if(NOT MSVC) add_library(OSSupport ${SRCS} ${HDRS}) if(UNIX) - target_link_libraries(OSSupport pthread) + target_link_libraries(OSSupport pthread rt) endif() endif() diff --git a/src/OSSupport/Event.cpp b/src/OSSupport/Event.cpp index 74f823216..7cf8a826c 100644 --- a/src/OSSupport/Event.cpp +++ b/src/OSSupport/Event.cpp @@ -102,6 +102,53 @@ void cEvent::Wait(void) +bool cEvent::Wait(int a_TimeoutMSec) +{ + #ifdef _WIN32 + DWORD res = WaitForSingleObject(m_Event, (DWORD)a_TimeoutMSec); + switch (res) + { + case WAIT_OBJECT_0: return true; // Regular event signalled + case WAIT_TIMEOUT: return false; // Regular event timeout + default: + { + LOGWARN("cEvent: waiting for the event failed: %u, GLE = %u. Continuing, but server may be unstable.", (unsigned)res, (unsigned)GetLastError()); + return false; + } + } + #else + // Get the current time: + timespec timeout; + if (clock_gettime(CLOCK_REALTIME, &timeout) == -1) + { + LOGWARN("cEvent: Getting current time failed: %i, err = %s. Continuing, but the server may be unstable.", errno, GetOSErrorString(errno).c_str()); + return false; + } + + // Add the specified timeout: + timeout.tv_sec += a_TimeoutMSec / 1000; + timeout.tv_nsec += (a_TimeoutMSec % 1000) * 1000000; // 1 msec = 1000000 usec + + // Wait with timeout: + int res = sem_timedwait(m_Event, &timeout); + switch (res) + { + case 0: return true; // Regular event signalled + case ETIMEDOUT: return false; // Regular even timeout + default: + { + AString error = GetOSErrorString(errno); + LOGWARN("cEvent: waiting for the event failed: %i, err = %s. Continuing, but server may be unstable.", res, error.c_str()); + return false; + } + } + #endif +} + + + + + void cEvent::Set(void) { #ifdef _WIN32 diff --git a/src/OSSupport/Event.h b/src/OSSupport/Event.h index 71f418c0c..e2fa65a05 100644 --- a/src/OSSupport/Event.h +++ b/src/OSSupport/Event.h @@ -24,6 +24,10 @@ public: void Wait(void); void Set (void); + + /** Waits for the event until either it is signalled, or the (relative) timeout is passed. + Returns true if the event was signalled, false if the timeout was hit or there was an error. */ + bool Wait(int a_TimeoutMSec); private: diff --git a/src/OSSupport/File.cpp b/src/OSSupport/File.cpp index ff6fb5898..cb6031da6 100644 --- a/src/OSSupport/File.cpp +++ b/src/OSSupport/File.cpp @@ -70,6 +70,7 @@ bool cFile::Open(const AString & iFileName, eMode iMode) case fmRead: Mode = "rb"; break; case fmWrite: Mode = "wb"; break; case fmReadWrite: Mode = "rb+"; break; + case fmAppend: Mode = "a+"; break; } if (Mode == NULL) { @@ -255,10 +256,10 @@ int cFile::ReadRestOfFile(AString & a_Contents) return -1; } - int DataSize = GetSize() - Tell(); + size_t DataSize = GetSize() - Tell(); // HACK: This depends on the internal knowledge that AString's data() function returns the internal buffer directly - a_Contents.assign((size_t)DataSize, '\0'); + a_Contents.assign(DataSize, '\0'); return Read((void *)a_Contents.data(), DataSize); } @@ -297,7 +298,7 @@ bool cFile::Rename(const AString & a_OrigFileName, const AString & a_NewFileName bool cFile::Copy(const AString & a_SrcFileName, const AString & a_DstFileName) { #ifdef _WIN32 - return (CopyFile(a_SrcFileName.c_str(), a_DstFileName.c_str(), true) != 0); + return (CopyFileA(a_SrcFileName.c_str(), a_DstFileName.c_str(), true) != 0); #else // Other OSs don't have a direct CopyFile equivalent, do it the harder way: std::ifstream src(a_SrcFileName.c_str(), std::ios::binary); @@ -321,7 +322,7 @@ bool cFile::Copy(const AString & a_SrcFileName, const AString & a_DstFileName) bool cFile::IsFolder(const AString & a_Path) { #ifdef _WIN32 - DWORD FileAttrib = GetFileAttributes(a_Path.c_str()); + DWORD FileAttrib = GetFileAttributesA(a_Path.c_str()); return ((FileAttrib != INVALID_FILE_ATTRIBUTES) && ((FileAttrib & FILE_ATTRIBUTE_DIRECTORY) != 0)); #else struct stat st; @@ -336,7 +337,7 @@ bool cFile::IsFolder(const AString & a_Path) bool cFile::IsFile(const AString & a_Path) { #ifdef _WIN32 - DWORD FileAttrib = GetFileAttributes(a_Path.c_str()); + DWORD FileAttrib = GetFileAttributesA(a_Path.c_str()); return ((FileAttrib != INVALID_FILE_ATTRIBUTES) && ((FileAttrib & (FILE_ATTRIBUTE_DIRECTORY | FILE_ATTRIBUTE_DEVICE)) == 0)); #else struct stat st; @@ -365,7 +366,7 @@ int cFile::GetSize(const AString & a_FileName) bool cFile::CreateFolder(const AString & a_FolderPath) { #ifdef _WIN32 - return (CreateDirectory(a_FolderPath.c_str(), NULL) != 0); + return (CreateDirectoryA(a_FolderPath.c_str(), NULL) != 0); #else return (mkdir(a_FolderPath.c_str(), S_IRWXU | S_IRWXG | S_IRWXO) == 0); #endif @@ -395,13 +396,13 @@ AStringVector cFile::GetFolderContents(const AString & a_Folder) // Find all files / folders: FileFilter.append("*.*"); HANDLE hFind; - WIN32_FIND_DATA FindFileData; - if ((hFind = FindFirstFile(FileFilter.c_str(), &FindFileData)) != INVALID_HANDLE_VALUE) + WIN32_FIND_DATAA FindFileData; + if ((hFind = FindFirstFileA(FileFilter.c_str(), &FindFileData)) != INVALID_HANDLE_VALUE) { do { AllFiles.push_back(FindFileData.cFileName); - } while (FindNextFile(hFind, &FindFileData)); + } while (FindNextFileA(hFind, &FindFileData)); FindClose(hFind); } @@ -459,7 +460,7 @@ int cFile::Printf(const char * a_Fmt, ...) va_start(args, a_Fmt); AppendVPrintf(buf, a_Fmt, args); va_end(args); - return Write(buf.c_str(), (int)buf.length()); + return Write(buf.c_str(), buf.length()); } diff --git a/src/OSSupport/File.h b/src/OSSupport/File.h index 2a7ecf0ed..dfb38e839 100644 --- a/src/OSSupport/File.h +++ b/src/OSSupport/File.h @@ -60,9 +60,10 @@ public: /** The mode in which to open the file */ enum eMode { - fmRead, // Read-only. If the file doesn't exist, object will not be valid - fmWrite, // Write-only. If the file already exists, it will be overwritten - fmReadWrite // Read/write. If the file already exists, it will be left intact; writing will overwrite the data from the beginning + fmRead, // Read-only. If the file doesn't exist, object will not be valid + fmWrite, // Write-only. If the file already exists, it will be overwritten + fmReadWrite, // Read/write. If the file already exists, it will be left intact; writing will overwrite the data from the beginning + fmAppend // Write-only. If the file already exists cursor will be moved to the end of the file } ; /** Simple constructor - creates an unopened file object, use Open() to open / create a real file */ diff --git a/src/OSSupport/IsThread.h b/src/OSSupport/IsThread.h index c20fc3e7e..5de5f31c4 100644 --- a/src/OSSupport/IsThread.h +++ b/src/OSSupport/IsThread.h @@ -69,7 +69,7 @@ protected: static DWORD __stdcall thrExecute(LPVOID a_Param) { // Create a window so that the thread can be identified by 3rd party tools: - HWND IdentificationWnd = CreateWindow("STATIC", ((cIsThread *)a_Param)->m_ThreadName.c_str(), 0, 0, 0, 0, WS_OVERLAPPED, NULL, NULL, NULL, NULL); + HWND IdentificationWnd = CreateWindowA("STATIC", ((cIsThread *)a_Param)->m_ThreadName.c_str(), 0, 0, 0, 0, WS_OVERLAPPED, NULL, NULL, NULL, NULL); // Run the thread: ((cIsThread *)a_Param)->Execute(); diff --git a/src/OSSupport/Queue.h b/src/OSSupport/Queue.h index bf4d7f004..8d096fe29 100644 --- a/src/OSSupport/Queue.h +++ b/src/OSSupport/Queue.h @@ -20,7 +20,7 @@ cQueueFuncs and is used as the default behavior. */ /// This empty struct allows for the callback functions to be inlined -template<class T> +template <class T> struct cQueueFuncs { public: diff --git a/src/PolarSSL++/SslContext.cpp b/src/PolarSSL++/SslContext.cpp index c3074f197..482470c3a 100644 --- a/src/PolarSSL++/SslContext.cpp +++ b/src/PolarSSL++/SslContext.cpp @@ -16,6 +16,7 @@ cSslContext::cSslContext(void) : m_IsValid(false), m_HasHandshaken(false) { + memset(&m_Ssl, 0, sizeof(m_Ssl)); } diff --git a/src/Protocol/Authenticator.cpp b/src/Protocol/Authenticator.cpp index 2a7cbc7bc..984000795 100644 --- a/src/Protocol/Authenticator.cpp +++ b/src/Protocol/Authenticator.cpp @@ -2,6 +2,7 @@ #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules #include "Authenticator.h" +#include "MojangAPI.h" #include "../Root.h" #include "../Server.h" #include "../ClientHandle.h" @@ -18,67 +19,6 @@ #define DEFAULT_AUTH_SERVER "sessionserver.mojang.com" #define DEFAULT_AUTH_ADDRESS "/session/minecraft/hasJoined?username=%USERNAME%&serverId=%SERVERID%" -/** This is the data of the root certs for Starfield Technologies, the CA that signed sessionserver.mojang.com's cert: -Downloaded from http://certs.starfieldtech.com/repository/ */ -static const AString StarfieldCACert() -{ - return AString( - // G2 cert - "-----BEGIN CERTIFICATE-----\n" - "MIID3TCCAsWgAwIBAgIBADANBgkqhkiG9w0BAQsFADCBjzELMAkGA1UEBhMCVVMx\n" - "EDAOBgNVBAgTB0FyaXpvbmExEzARBgNVBAcTClNjb3R0c2RhbGUxJTAjBgNVBAoT\n" - "HFN0YXJmaWVsZCBUZWNobm9sb2dpZXMsIEluYy4xMjAwBgNVBAMTKVN0YXJmaWVs\n" - "ZCBSb290IENlcnRpZmljYXRlIEF1dGhvcml0eSAtIEcyMB4XDTA5MDkwMTAwMDAw\n" - "MFoXDTM3MTIzMTIzNTk1OVowgY8xCzAJBgNVBAYTAlVTMRAwDgYDVQQIEwdBcml6\n" - "b25hMRMwEQYDVQQHEwpTY290dHNkYWxlMSUwIwYDVQQKExxTdGFyZmllbGQgVGVj\n" - "aG5vbG9naWVzLCBJbmMuMTIwMAYDVQQDEylTdGFyZmllbGQgUm9vdCBDZXJ0aWZp\n" - "Y2F0ZSBBdXRob3JpdHkgLSBHMjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC\n" - "ggEBAL3twQP89o/8ArFvW59I2Z154qK3A2FWGMNHttfKPTUuiUP3oWmb3ooa/RMg\n" - "nLRJdzIpVv257IzdIvpy3Cdhl+72WoTsbhm5iSzchFvVdPtrX8WJpRBSiUZV9Lh1\n" - "HOZ/5FSuS/hVclcCGfgXcVnrHigHdMWdSL5stPSksPNkN3mSwOxGXn/hbVNMYq/N\n" - "Hwtjuzqd+/x5AJhhdM8mgkBj87JyahkNmcrUDnXMN/uLicFZ8WJ/X7NfZTD4p7dN\n" - "dloedl40wOiWVpmKs/B/pM293DIxfJHP4F8R+GuqSVzRmZTRouNjWwl2tVZi4Ut0\n" - "HZbUJtQIBFnQmA4O5t78w+wfkPECAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAO\n" - "BgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFHwMMh+n2TB/xH1oo2Kooc6rB1snMA0G\n" - "CSqGSIb3DQEBCwUAA4IBAQARWfolTwNvlJk7mh+ChTnUdgWUXuEok21iXQnCoKjU\n" - "sHU48TRqneSfioYmUeYs0cYtbpUgSpIB7LiKZ3sx4mcujJUDJi5DnUox9g61DLu3\n" - "4jd/IroAow57UvtruzvE03lRTs2Q9GcHGcg8RnoNAX3FWOdt5oUwF5okxBDgBPfg\n" - "8n/Uqgr/Qh037ZTlZFkSIHc40zI+OIF1lnP6aI+xy84fxez6nH7PfrHxBy22/L/K\n" - "pL/QlwVKvOoYKAKQvVR4CSFx09F9HdkWsKlhPdAKACL8x3vLCWRFCztAgfd9fDL1\n" - "mMpYjn0q7pBZc2T5NnReJaH1ZgUufzkVqSr7UIuOhWn0\n" - "-----END CERTIFICATE-----\n\n" - // Original (G1) cert: - "-----BEGIN CERTIFICATE-----\n" - "MIIEDzCCAvegAwIBAgIBADANBgkqhkiG9w0BAQUFADBoMQswCQYDVQQGEwJVUzEl\n" - "MCMGA1UEChMcU3RhcmZpZWxkIFRlY2hub2xvZ2llcywgSW5jLjEyMDAGA1UECxMp\n" - "U3RhcmZpZWxkIENsYXNzIDIgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkwHhcNMDQw\n" - "NjI5MTczOTE2WhcNMzQwNjI5MTczOTE2WjBoMQswCQYDVQQGEwJVUzElMCMGA1UE\n" - "ChMcU3RhcmZpZWxkIFRlY2hub2xvZ2llcywgSW5jLjEyMDAGA1UECxMpU3RhcmZp\n" - "ZWxkIENsYXNzIDIgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkwggEgMA0GCSqGSIb3\n" - "DQEBAQUAA4IBDQAwggEIAoIBAQC3Msj+6XGmBIWtDBFk385N78gDGIc/oav7PKaf\n" - "8MOh2tTYbitTkPskpD6E8J7oX+zlJ0T1KKY/e97gKvDIr1MvnsoFAZMej2YcOadN\n" - "+lq2cwQlZut3f+dZxkqZJRRU6ybH838Z1TBwj6+wRir/resp7defqgSHo9T5iaU0\n" - "X9tDkYI22WY8sbi5gv2cOj4QyDvvBmVmepsZGD3/cVE8MC5fvj13c7JdBmzDI1aa\n" - "K4UmkhynArPkPw2vCHmCuDY96pzTNbO8acr1zJ3o/WSNF4Azbl5KXZnJHoe0nRrA\n" - "1W4TNSNe35tfPe/W93bC6j67eA0cQmdrBNj41tpvi/JEoAGrAgEDo4HFMIHCMB0G\n" - "A1UdDgQWBBS/X7fRzt0fhvRbVazc1xDCDqmI5zCBkgYDVR0jBIGKMIGHgBS/X7fR\n" - "zt0fhvRbVazc1xDCDqmI56FspGowaDELMAkGA1UEBhMCVVMxJTAjBgNVBAoTHFN0\n" - "YXJmaWVsZCBUZWNobm9sb2dpZXMsIEluYy4xMjAwBgNVBAsTKVN0YXJmaWVsZCBD\n" - "bGFzcyAyIENlcnRpZmljYXRpb24gQXV0aG9yaXR5ggEAMAwGA1UdEwQFMAMBAf8w\n" - "DQYJKoZIhvcNAQEFBQADggEBAAWdP4id0ckaVaGsafPzWdqbAYcaT1epoXkJKtv3\n" - "L7IezMdeatiDh6GX70k1PncGQVhiv45YuApnP+yz3SFmH8lU+nLMPUxA2IGvd56D\n" - "eruix/U0F47ZEUD0/CwqTRV/p2JdLiXTAAsgGh1o+Re49L2L7ShZ3U0WixeDyLJl\n" - "xy16paq8U4Zt3VekyvggQQto8PT7dL5WXXp59fkdheMtlb71cZBDzI0fmgAKhynp\n" - "VSJYACPq4xJDKVtHCN2MQWplBqjlIapBtJUhlbl90TSrE9atvNziPTnNvT51cKEY\n" - "WQPJIrSPnNVeKtelttQKbfi3QBFGmh95DmK/D5fs4C8fF5Q=\n" - "-----END CERTIFICATE-----\n" - ); -} - - - - - cAuthenticator::cAuthenticator(void) : super("cAuthenticator"), m_Server(DEFAULT_AUTH_SERVER), @@ -102,8 +42,8 @@ cAuthenticator::~cAuthenticator() void cAuthenticator::ReadINI(cIniFile & IniFile) { - m_Server = IniFile.GetValueSet("Authentication", "Server", DEFAULT_AUTH_SERVER); - m_Address = IniFile.GetValueSet("Authentication", "Address", DEFAULT_AUTH_ADDRESS); + m_Server = IniFile.GetValueSet ("Authentication", "Server", DEFAULT_AUTH_SERVER); + m_Address = IniFile.GetValueSet ("Authentication", "Address", DEFAULT_AUTH_ADDRESS); m_ShouldAuthenticate = IniFile.GetValueSetB("Authentication", "Authenticate", true); } @@ -193,62 +133,6 @@ void cAuthenticator::Execute(void) -bool cAuthenticator::SecureGetFromAddress(const AString & a_CACerts, const AString & a_ExpectedPeerName, const AString & a_Data, AString & a_Response) -{ - // Connect the socket: - cBlockingSslClientSocket Socket; - Socket.SetTrustedRootCertsFromString(a_CACerts, a_ExpectedPeerName); - if (!Socket.Connect(a_ExpectedPeerName, 443)) - { - LOGWARNING("cAuthenticator: Can't connect to %s: %s", a_ExpectedPeerName.c_str(), Socket.GetLastErrorText().c_str()); - return false; - } - - if (!Socket.Send(a_Data.c_str(), a_Data.size())) - { - LOGWARNING("cAuthenticator: Writing SSL data failed: %s", Socket.GetLastErrorText().c_str()); - return false; - } - - // Read the HTTP response: - int ret; - unsigned char buf[1024]; - - for (;;) - { - ret = Socket.Receive(buf, sizeof(buf)); - - if ((ret == POLARSSL_ERR_NET_WANT_READ) || (ret == POLARSSL_ERR_NET_WANT_WRITE)) - { - // This value should never be returned, it is handled internally by cBlockingSslClientSocket - LOGWARNING("cAuthenticator: SSL reading failed internally"); - return false; - } - if (ret == POLARSSL_ERR_SSL_PEER_CLOSE_NOTIFY) - { - break; - } - if (ret < 0) - { - LOGWARNING("cAuthenticator: SSL reading failed: -0x%x", -ret); - return false; - } - if (ret == 0) - { - break; - } - - a_Response.append((const char *)buf, (size_t)ret); - } - - Socket.Disconnect(); - return true; -} - - - - - bool cAuthenticator::AuthWithYggdrasil(AString & a_UserName, const AString & a_ServerId, AString & a_UUID, Json::Value & a_Properties) { LOGD("Trying to authenticate user %s", a_UserName.c_str()); @@ -266,7 +150,7 @@ bool cAuthenticator::AuthWithYggdrasil(AString & a_UserName, const AString & a_S Request += "\r\n"; AString Response; - if (!SecureGetFromAddress(StarfieldCACert(), m_Server, Request, Response)) + if (!cMojangAPI::SecureRequest(m_Server, Request, Response)) { return false; } @@ -304,17 +188,11 @@ bool cAuthenticator::AuthWithYggdrasil(AString & a_UserName, const AString & a_S return false; } a_UserName = root.get("name", "Unknown").asString(); - a_UUID = root.get("id", "").asString(); + a_UUID = cMojangAPI::MakeUUIDShort(root.get("id", "").asString()); a_Properties = root["properties"]; - - // If the UUID doesn't contain the hashes, insert them at the proper places: - if (a_UUID.size() == 32) - { - a_UUID.insert(8, "-"); - a_UUID.insert(13, "-"); - a_UUID.insert(18, "-"); - a_UUID.insert(23, "-"); - } + + // Store the player's profile in the MojangAPI caches: + cRoot::Get()->GetMojangAPI().AddPlayerProfile(a_UserName, a_UUID, a_Properties); return true; } diff --git a/src/Protocol/Authenticator.h b/src/Protocol/Authenticator.h index 244d94c0b..853eff535 100644 --- a/src/Protocol/Authenticator.h +++ b/src/Protocol/Authenticator.h @@ -11,8 +11,6 @@ #pragma once -#ifndef CAUTHENTICATOR_H_INCLUDED -#define CAUTHENTICATOR_H_INCLUDED #include "../OSSupport/IsThread.h" @@ -52,7 +50,7 @@ public: /** Stops the authenticator thread. The thread may be started and stopped repeatedly */ void Stop(void); - + private: class cUser @@ -76,29 +74,26 @@ private: cUserList m_Queue; cEvent m_QueueNonempty; + /** The server that is to be contacted for auth / UUID conversions */ AString m_Server; + + /** The URL to use for auth, without server part. + %USERNAME% will be replaced with actual user name. + %SERVERID% will be replaced with server's ID. + For example "/session/minecraft/hasJoined?username=%USERNAME%&serverId=%SERVERID%". */ AString m_Address; + AString m_PropertiesAddress; bool m_ShouldAuthenticate; /** cIsThread override: */ virtual void Execute(void) override; - /** Connects to a hostname using SSL, sends given data, and sets the response, returning whether all was successful or not */ - bool SecureGetFromAddress(const AString & a_CACerts, const AString & a_ExpectedPeerName, const AString & a_Request, AString & a_Response); - /** Returns true if the user authenticated okay, false on error - Sets the username, UUID, and properties (i.e. skin) fields - */ + Returns the case-corrected username, UUID, and properties (eg. skin). */ bool AuthWithYggdrasil(AString & a_UserName, const AString & a_ServerId, AString & a_UUID, Json::Value & a_Properties); }; - -#endif // CAUTHENTICATOR_H_INCLUDED - - - - diff --git a/src/Protocol/CMakeLists.txt b/src/Protocol/CMakeLists.txt index ae447ce54..7c97e67bc 100644 --- a/src/Protocol/CMakeLists.txt +++ b/src/Protocol/CMakeLists.txt @@ -7,24 +7,18 @@ include_directories ("${PROJECT_SOURCE_DIR}/../") SET (SRCS Authenticator.cpp ChunkDataSerializer.cpp - Protocol125.cpp - Protocol132.cpp - Protocol14x.cpp - Protocol15x.cpp - Protocol16x.cpp + MojangAPI.cpp Protocol17x.cpp + Protocol18x.cpp ProtocolRecognizer.cpp) SET (HDRS Authenticator.h ChunkDataSerializer.h + MojangAPI.h Protocol.h - Protocol125.h - Protocol132.h - Protocol14x.h - Protocol15x.h - Protocol16x.h Protocol17x.h + Protocol18x.h ProtocolRecognizer.h) if(NOT MSVC) diff --git a/src/Protocol/ChunkDataSerializer.cpp b/src/Protocol/ChunkDataSerializer.cpp index ebe61631b..5d080656d 100644 --- a/src/Protocol/ChunkDataSerializer.cpp +++ b/src/Protocol/ChunkDataSerializer.cpp @@ -8,6 +8,8 @@ #include "Globals.h" #include "ChunkDataSerializer.h" #include "zlib/zlib.h" +#include "ByteBuffer.h" +#include "Protocol18x.h" @@ -30,7 +32,7 @@ cChunkDataSerializer::cChunkDataSerializer( -const AString & cChunkDataSerializer::Serialize(int a_Version) +const AString & cChunkDataSerializer::Serialize(int a_Version, int a_ChunkX, int a_ChunkZ) { Serializations::const_iterator itr = m_Serializations.find(a_Version); if (itr != m_Serializations.end()) @@ -43,6 +45,7 @@ const AString & cChunkDataSerializer::Serialize(int a_Version) { case RELEASE_1_2_5: Serialize29(data); break; case RELEASE_1_3_2: Serialize39(data); break; + case RELEASE_1_8_0: Serialize47(data, a_ChunkX, a_ChunkZ); break; // TODO: Other protocol versions may serialize the data differently; implement here default: @@ -52,7 +55,10 @@ const AString & cChunkDataSerializer::Serialize(int a_Version) break; } } - m_Serializations[a_Version] = data; + if (!data.empty()) + { + m_Serializations[a_Version] = data; + } return m_Serializations[a_Version]; } @@ -174,3 +180,72 @@ void cChunkDataSerializer::Serialize39(AString & a_Data) + +void cChunkDataSerializer::Serialize47(AString & a_Data, int a_ChunkX, int a_ChunkZ) +{ + // This function returns the fully compressed packet (including packet size), not the raw packet! + + // Create the packet: + cByteBuffer Packet(512 KiB); + Packet.WriteVarInt(0x21); // Packet id (Chunk Data packet) + Packet.WriteBEInt(a_ChunkX); + Packet.WriteBEInt(a_ChunkZ); + Packet.WriteBool(true); // "Ground-up continuous", or rather, "biome data present" flag + Packet.WriteBEUShort(0xffff); // We're aways sending the full chunk with no additional data, so the bitmap is 0xffff + + // Write the chunk size: + const int BiomeDataSize = cChunkDef::Width * cChunkDef::Width; + UInt32 ChunkSize = ( + (cChunkDef::NumBlocks * 2) + // Block meta + type + sizeof(m_BlockLight) + // Block light + sizeof(m_BlockSkyLight) + // Block sky light + BiomeDataSize // Biome data + ); + Packet.WriteVarInt(ChunkSize); + + // Write the block types to the packet: + for (size_t Index = 0; Index < cChunkDef::NumBlocks; Index++) + { + BLOCKTYPE BlockType = m_BlockTypes[Index] & 0xFF; + NIBBLETYPE BlockMeta = m_BlockMetas[Index / 2] >> ((Index & 1) * 4) & 0x0f; + Packet.WriteByte((unsigned char)(BlockType << 4) | BlockMeta); + Packet.WriteByte((unsigned char)(BlockType >> 4)); + } + + // Write the rest: + Packet.WriteBuf(m_BlockLight, sizeof(m_BlockLight)); + Packet.WriteBuf(m_BlockSkyLight, sizeof(m_BlockSkyLight)); + Packet.WriteBuf(m_BiomeData, BiomeDataSize); + + AString PacketData; + Packet.ReadAll(PacketData); + Packet.CommitRead(); + + cByteBuffer Buffer(20); + if (PacketData.size() >= 256) + { + if (!cProtocol180::CompressPacket(PacketData, a_Data)) + { + ASSERT(!"Packet compression failed."); + a_Data.clear(); + return; + } + } + else + { + AString PostData; + Buffer.WriteVarInt((UInt32)Packet.GetUsedSpace() + 1); + Buffer.WriteVarInt(0); + Buffer.ReadAll(PostData); + Buffer.CommitRead(); + + a_Data.clear(); + a_Data.reserve(PostData.size() + PacketData.size()); + a_Data.append(PostData.data(), PostData.size()); + a_Data.append(PacketData.data(), PacketData.size()); + } +} + + + + diff --git a/src/Protocol/ChunkDataSerializer.h b/src/Protocol/ChunkDataSerializer.h index a42856356..a082ef3d8 100644 --- a/src/Protocol/ChunkDataSerializer.h +++ b/src/Protocol/ChunkDataSerializer.h @@ -23,13 +23,15 @@ protected: Serializations m_Serializations; void Serialize29(AString & a_Data); // Release 1.2.4 and 1.2.5 - void Serialize39(AString & a_Data); // Release 1.3.1 and 1.3.2 + void Serialize39(AString & a_Data); // Release 1.3.1 to 1.7.10 + void Serialize47(AString & a_Data, int a_ChunkX, int a_ChunkZ); // Release 1.8 public: enum { RELEASE_1_2_5 = 29, RELEASE_1_3_2 = 39, + RELEASE_1_8_0 = 47, } ; cChunkDataSerializer( @@ -40,7 +42,7 @@ public: const unsigned char * a_BiomeData ); - const AString & Serialize(int a_Version); // Returns one of the internal m_Serializations[] + const AString & Serialize(int a_Version, int a_ChunkX, int a_ChunkZ); // Returns one of the internal m_Serializations[] } ; diff --git a/src/Protocol/MojangAPI.cpp b/src/Protocol/MojangAPI.cpp new file mode 100644 index 000000000..0a6716e6f --- /dev/null +++ b/src/Protocol/MojangAPI.cpp @@ -0,0 +1,911 @@ + +// MojangAPI.cpp + +// Implements the cMojangAPI class representing the various API points provided by Mojang's webservices, and a cache for their results + +#include "Globals.h" +#include "MojangAPI.h" +#include "SQLiteCpp/Database.h" +#include "SQLiteCpp/Statement.h" +#include "inifile/iniFile.h" +#include "json/json.h" +#include "PolarSSL++/BlockingSslClientSocket.h" +#include "../RankManager.h" +#include "../OSSupport/IsThread.h" +#include "../Root.h" + + + + + +/** The maximum age for items to be kept in the cache. Any item older than this will be removed. */ +const Int64 MAX_AGE = 7 * 24 * 60 * 60; // 7 days ago + +/** The maximum number of names to send in a single query */ +const int MAX_PER_QUERY = 100; + + + + + +#define DEFAULT_NAME_TO_UUID_SERVER "api.mojang.com" +#define DEFAULT_NAME_TO_UUID_ADDRESS "/profiles/minecraft" +#define DEFAULT_UUID_TO_PROFILE_SERVER "sessionserver.mojang.com" +#define DEFAULT_UUID_TO_PROFILE_ADDRESS "/session/minecraft/profile/%UUID%?unsigned=false" + + + + + + +/** This is the data of the root certs for Starfield Technologies, the CA that signed sessionserver.mojang.com's cert: +Downloaded from http://certs.starfieldtech.com/repository/ */ +static const AString & StarfieldCACert(void) +{ + static const AString Cert( + // G2 cert + "-----BEGIN CERTIFICATE-----\n" + "MIID3TCCAsWgAwIBAgIBADANBgkqhkiG9w0BAQsFADCBjzELMAkGA1UEBhMCVVMx\n" + "EDAOBgNVBAgTB0FyaXpvbmExEzARBgNVBAcTClNjb3R0c2RhbGUxJTAjBgNVBAoT\n" + "HFN0YXJmaWVsZCBUZWNobm9sb2dpZXMsIEluYy4xMjAwBgNVBAMTKVN0YXJmaWVs\n" + "ZCBSb290IENlcnRpZmljYXRlIEF1dGhvcml0eSAtIEcyMB4XDTA5MDkwMTAwMDAw\n" + "MFoXDTM3MTIzMTIzNTk1OVowgY8xCzAJBgNVBAYTAlVTMRAwDgYDVQQIEwdBcml6\n" + "b25hMRMwEQYDVQQHEwpTY290dHNkYWxlMSUwIwYDVQQKExxTdGFyZmllbGQgVGVj\n" + "aG5vbG9naWVzLCBJbmMuMTIwMAYDVQQDEylTdGFyZmllbGQgUm9vdCBDZXJ0aWZp\n" + "Y2F0ZSBBdXRob3JpdHkgLSBHMjCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoC\n" + "ggEBAL3twQP89o/8ArFvW59I2Z154qK3A2FWGMNHttfKPTUuiUP3oWmb3ooa/RMg\n" + "nLRJdzIpVv257IzdIvpy3Cdhl+72WoTsbhm5iSzchFvVdPtrX8WJpRBSiUZV9Lh1\n" + "HOZ/5FSuS/hVclcCGfgXcVnrHigHdMWdSL5stPSksPNkN3mSwOxGXn/hbVNMYq/N\n" + "Hwtjuzqd+/x5AJhhdM8mgkBj87JyahkNmcrUDnXMN/uLicFZ8WJ/X7NfZTD4p7dN\n" + "dloedl40wOiWVpmKs/B/pM293DIxfJHP4F8R+GuqSVzRmZTRouNjWwl2tVZi4Ut0\n" + "HZbUJtQIBFnQmA4O5t78w+wfkPECAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAO\n" + "BgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFHwMMh+n2TB/xH1oo2Kooc6rB1snMA0G\n" + "CSqGSIb3DQEBCwUAA4IBAQARWfolTwNvlJk7mh+ChTnUdgWUXuEok21iXQnCoKjU\n" + "sHU48TRqneSfioYmUeYs0cYtbpUgSpIB7LiKZ3sx4mcujJUDJi5DnUox9g61DLu3\n" + "4jd/IroAow57UvtruzvE03lRTs2Q9GcHGcg8RnoNAX3FWOdt5oUwF5okxBDgBPfg\n" + "8n/Uqgr/Qh037ZTlZFkSIHc40zI+OIF1lnP6aI+xy84fxez6nH7PfrHxBy22/L/K\n" + "pL/QlwVKvOoYKAKQvVR4CSFx09F9HdkWsKlhPdAKACL8x3vLCWRFCztAgfd9fDL1\n" + "mMpYjn0q7pBZc2T5NnReJaH1ZgUufzkVqSr7UIuOhWn0\n" + "-----END CERTIFICATE-----\n\n" + // Original (G1) cert: + "-----BEGIN CERTIFICATE-----\n" + "MIIEDzCCAvegAwIBAgIBADANBgkqhkiG9w0BAQUFADBoMQswCQYDVQQGEwJVUzEl\n" + "MCMGA1UEChMcU3RhcmZpZWxkIFRlY2hub2xvZ2llcywgSW5jLjEyMDAGA1UECxMp\n" + "U3RhcmZpZWxkIENsYXNzIDIgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkwHhcNMDQw\n" + "NjI5MTczOTE2WhcNMzQwNjI5MTczOTE2WjBoMQswCQYDVQQGEwJVUzElMCMGA1UE\n" + "ChMcU3RhcmZpZWxkIFRlY2hub2xvZ2llcywgSW5jLjEyMDAGA1UECxMpU3RhcmZp\n" + "ZWxkIENsYXNzIDIgQ2VydGlmaWNhdGlvbiBBdXRob3JpdHkwggEgMA0GCSqGSIb3\n" + "DQEBAQUAA4IBDQAwggEIAoIBAQC3Msj+6XGmBIWtDBFk385N78gDGIc/oav7PKaf\n" + "8MOh2tTYbitTkPskpD6E8J7oX+zlJ0T1KKY/e97gKvDIr1MvnsoFAZMej2YcOadN\n" + "+lq2cwQlZut3f+dZxkqZJRRU6ybH838Z1TBwj6+wRir/resp7defqgSHo9T5iaU0\n" + "X9tDkYI22WY8sbi5gv2cOj4QyDvvBmVmepsZGD3/cVE8MC5fvj13c7JdBmzDI1aa\n" + "K4UmkhynArPkPw2vCHmCuDY96pzTNbO8acr1zJ3o/WSNF4Azbl5KXZnJHoe0nRrA\n" + "1W4TNSNe35tfPe/W93bC6j67eA0cQmdrBNj41tpvi/JEoAGrAgEDo4HFMIHCMB0G\n" + "A1UdDgQWBBS/X7fRzt0fhvRbVazc1xDCDqmI5zCBkgYDVR0jBIGKMIGHgBS/X7fR\n" + "zt0fhvRbVazc1xDCDqmI56FspGowaDELMAkGA1UEBhMCVVMxJTAjBgNVBAoTHFN0\n" + "YXJmaWVsZCBUZWNobm9sb2dpZXMsIEluYy4xMjAwBgNVBAsTKVN0YXJmaWVsZCBD\n" + "bGFzcyAyIENlcnRpZmljYXRpb24gQXV0aG9yaXR5ggEAMAwGA1UdEwQFMAMBAf8w\n" + "DQYJKoZIhvcNAQEFBQADggEBAAWdP4id0ckaVaGsafPzWdqbAYcaT1epoXkJKtv3\n" + "L7IezMdeatiDh6GX70k1PncGQVhiv45YuApnP+yz3SFmH8lU+nLMPUxA2IGvd56D\n" + "eruix/U0F47ZEUD0/CwqTRV/p2JdLiXTAAsgGh1o+Re49L2L7ShZ3U0WixeDyLJl\n" + "xy16paq8U4Zt3VekyvggQQto8PT7dL5WXXp59fkdheMtlb71cZBDzI0fmgAKhynp\n" + "VSJYACPq4xJDKVtHCN2MQWplBqjlIapBtJUhlbl90TSrE9atvNziPTnNvT51cKEY\n" + "WQPJIrSPnNVeKtelttQKbfi3QBFGmh95DmK/D5fs4C8fF5Q=\n" + "-----END CERTIFICATE-----\n" + ); + + return Cert; +} + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cMojangAPI::sProfile: + +cMojangAPI::sProfile::sProfile( + const AString & a_PlayerName, + const AString & a_UUID, + const Json::Value & a_Properties, + Int64 a_DateTime +) : + m_PlayerName(a_PlayerName), + m_UUID(a_UUID), + m_Textures(), + m_TexturesSignature(), + m_DateTime(a_DateTime) +{ + /* + Example a_Profile contents: + "properties": + [ + { + "name": "textures", + "value": "eyJ0aW1lc3RhbXAiOjE0MDcwNzAzMjEyNzEsInByb2ZpbGVJZCI6ImIxY2FmMjQyMDJhODQxYTc4MDU1YTA3OWM0NjBlZWU3IiwicHJvZmlsZU5hbWUiOiJ4b2Z0IiwiaXNQdWJsaWMiOnRydWUsInRleHR1cmVzIjp7IlNLSU4iOnsidXJsIjoiaHR0cDovL3RleHR1cmVzLm1pbmVjcmFmdC5uZXQvdGV4dHVyZS9iNzc5YmFiZjVhNTg3Zjk0OGFkNjc0N2VhOTEyNzU0MjliNjg4Mjk1YWUzYzA3YmQwZTJmNWJmNGQwNTIifX19", + "signature": "XCty+jGEF39hEPrPhYNnCX087kPaoCjYruzYI/DS4nkL5hbjnkSM5Rh15hnUyv/FHhC8OF5rif3D1tQjtMI19KSVaXoUFXpbJM8/+PB8GDgEbX8Fc3u9nYkzOcM/xfxdYsFAdFhLQMkvase/BZLSuPhdy9DdI+TCrO7xuSTZfYmmwVuWo3w5gCY+mSIAnqltnOzaOOTcly75xvO0WYpVk7nJdnR2tvSi0wfrQPDrIg/uzhX7p0SnDqijmBU4QaNez/TNKiFxy69dAzt0RSotlQzqkDbyVKhhv9a4eY8h3pXi4UMftKEj4FAKczxLImkukJXuOn5NN15/Q+le0rJVBC60/xjKIVzltEsMN6qjWD0lQjey7WEL+4pGhCVuWY5KzuZjFvgqszuJTFz7lo+bcHiceldJtea8/fa02eTRObZvdLxbWC9ZfFY0IhpOVKfcLdno/ddDMNMQMi5kMrJ8MZZ/PcW1w5n7MMGWPGCla1kOaC55AL0QYSMGRVEZqgU9wXI5M7sHGZKGM4mWxkbEJYBkpI/p3GyxWgV6v33ZWlsz65TqlNrR1gCLaoFCm7Sif8NqPBZUAONHYon0roXhin/DyEanS93WV6i6FC1Wisscjq2AcvnOlgTo/5nN/1QsMbjNumuMGo37sqjRqlXoPb8zEUbAhhztYuJjEfQ2Rd8=" + } + ] + */ + + // Parse the Textures and TexturesSignature from the Profile: + if (!a_Properties.isArray()) + { + // Properties is not a valid array, bail out + return; + } + Json::UInt Size = a_Properties.size(); + for (Json::UInt i = 0; i < Size; i++) + { + const Json::Value & Prop = a_Properties[i]; + AString PropName = Prop.get("name", "").asString(); + if (PropName != "textures") + { + continue; + } + m_Textures = Prop.get("value", "").asString(); + m_TexturesSignature = Prop.get("signature", "").asString(); + break; + } // for i - Properties[] +} + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cMojangAPI::cUpdateThread: + +class cMojangAPI::cUpdateThread : + public cIsThread +{ + typedef cIsThread super; +public: + cUpdateThread() : + super("cMojangAPI::cUpdateThread") + { + } + + ~cUpdateThread() + { + m_evtNotify.Set(); + Stop(); + } + +protected: + cEvent m_evtNotify; + + virtual void Execute(void) override + { + do + { + cRoot::Get()->GetMojangAPI().Update(); + } while (!m_evtNotify.Wait(60 * 60 * 1000)); // Repeat every 60 minutes + } +} ; + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cMojangAPI: + +cMojangAPI::cMojangAPI(void) : + m_NameToUUIDServer(DEFAULT_NAME_TO_UUID_SERVER), + m_NameToUUIDAddress(DEFAULT_NAME_TO_UUID_ADDRESS), + m_UUIDToProfileServer(DEFAULT_UUID_TO_PROFILE_SERVER), + m_UUIDToProfileAddress(DEFAULT_UUID_TO_PROFILE_ADDRESS), + m_RankMgr(NULL), + m_UpdateThread(new cUpdateThread()) +{ +} + + + + + +cMojangAPI::~cMojangAPI() +{ + SaveCachesToDisk(); +} + + + + + +void cMojangAPI::Start(cIniFile & a_SettingsIni) +{ + m_NameToUUIDServer = a_SettingsIni.GetValueSet("MojangAPI", "NameToUUIDServer", DEFAULT_NAME_TO_UUID_SERVER); + m_NameToUUIDAddress = a_SettingsIni.GetValueSet("MojangAPI", "NameToUUIDAddress", DEFAULT_NAME_TO_UUID_ADDRESS); + m_UUIDToProfileServer = a_SettingsIni.GetValueSet("MojangAPI", "UUIDToProfileServer", DEFAULT_UUID_TO_PROFILE_SERVER); + m_UUIDToProfileAddress = a_SettingsIni.GetValueSet("MojangAPI", "UUIDToProfileAddress", DEFAULT_UUID_TO_PROFILE_ADDRESS); + LoadCachesFromDisk(); + m_UpdateThread->Start(); +} + + + + + +AString cMojangAPI::GetUUIDFromPlayerName(const AString & a_PlayerName, bool a_UseOnlyCached) +{ + // Convert the playername to lowercase: + AString lcPlayerName = StrToLower(a_PlayerName); + + // Request the cache to query the name if not yet cached: + if (!a_UseOnlyCached) + { + AStringVector PlayerNames; + PlayerNames.push_back(lcPlayerName); + CacheNamesToUUIDs(PlayerNames); + } + + // Retrieve from cache: + cCSLock Lock(m_CSNameToUUID); + cProfileMap::const_iterator itr = m_NameToUUID.find(lcPlayerName); + if (itr == m_NameToUUID.end()) + { + // No UUID found + return ""; + } + return itr->second.m_UUID; +} + + + + + +AString cMojangAPI::GetPlayerNameFromUUID(const AString & a_UUID, bool a_UseOnlyCached) +{ + // Normalize the UUID to lowercase short format that is used as the map key: + AString UUID = MakeUUIDShort(a_UUID); + + // Retrieve from caches: + { + cCSLock Lock(m_CSUUIDToProfile); + cProfileMap::const_iterator itr = m_UUIDToProfile.find(UUID); + if (itr != m_UUIDToProfile.end()) + { + return itr->second.m_PlayerName; + } + } + { + cCSLock Lock(m_CSUUIDToName); + cProfileMap::const_iterator itr = m_UUIDToName.find(UUID); + if (itr != m_UUIDToName.end()) + { + return itr->second.m_PlayerName; + } + } + + // Name not yet cached, request cache and retry: + if (!a_UseOnlyCached) + { + CacheUUIDToProfile(UUID); + return GetPlayerNameFromUUID(a_UUID, true); + } + + // No value found, none queried. Return an error: + return ""; +} + + + + + +AStringVector cMojangAPI::GetUUIDsFromPlayerNames(const AStringVector & a_PlayerNames, bool a_UseOnlyCached) +{ + // Convert all playernames to lowercase: + AStringVector PlayerNames; + for (AStringVector::const_iterator itr = a_PlayerNames.begin(), end = a_PlayerNames.end(); itr != end; ++itr) + { + PlayerNames.push_back(StrToLower(*itr)); + } // for itr - a_PlayerNames[] + + // Request the cache to populate any names not yet contained: + if (!a_UseOnlyCached) + { + CacheNamesToUUIDs(PlayerNames); + } + + // Retrieve from cache: + size_t idx = 0; + AStringVector res; + res.resize(PlayerNames.size()); + cCSLock Lock(m_CSNameToUUID); + for (AStringVector::const_iterator itr = PlayerNames.begin(), end = PlayerNames.end(); itr != end; ++itr, ++idx) + { + cProfileMap::const_iterator itrN = m_NameToUUID.find(*itr); + if (itrN != m_NameToUUID.end()) + { + res[idx] = itrN->second.m_UUID; + } + } // for itr - PlayerNames[] + return res; +} + + + + + +void cMojangAPI::AddPlayerNameToUUIDMapping(const AString & a_PlayerName, const AString & a_UUID) +{ + AString UUID = MakeUUIDShort(a_UUID); + Int64 Now = time(NULL); + { + cCSLock Lock(m_CSNameToUUID); + m_NameToUUID[StrToLower(a_PlayerName)] = sProfile(a_PlayerName, UUID, "", "", Now); + } + { + cCSLock Lock(m_CSUUIDToName); + m_UUIDToName[UUID] = sProfile(a_PlayerName, UUID, "", "", Now); + } + NotifyNameUUID(a_PlayerName, a_UUID); +} + + + + + +void cMojangAPI::AddPlayerProfile(const AString & a_PlayerName, const AString & a_UUID, const Json::Value & a_Properties) +{ + AString UUID = MakeUUIDShort(a_UUID); + Int64 Now = time(NULL); + { + cCSLock Lock(m_CSNameToUUID); + m_NameToUUID[StrToLower(a_PlayerName)] = sProfile(a_PlayerName, UUID, "", "", Now); + } + { + cCSLock Lock(m_CSUUIDToName); + m_UUIDToName[UUID] = sProfile(a_PlayerName, UUID, "", "", Now); + } + { + cCSLock Lock(m_CSUUIDToProfile); + m_UUIDToProfile[UUID] = sProfile(a_PlayerName, UUID, a_Properties, Now); + } + NotifyNameUUID(a_PlayerName, a_UUID); +} + + + + + +bool cMojangAPI::SecureRequest(const AString & a_ServerName, const AString & a_Request, AString & a_Response) +{ + // Connect the socket: + cBlockingSslClientSocket Socket; + Socket.SetTrustedRootCertsFromString(StarfieldCACert(), a_ServerName); + if (!Socket.Connect(a_ServerName, 443)) + { + LOGWARNING("%s: Can't connect to %s: %s", __FUNCTION__, a_ServerName.c_str(), Socket.GetLastErrorText().c_str()); + return false; + } + + if (!Socket.Send(a_Request.c_str(), a_Request.size())) + { + LOGWARNING("%s: Writing SSL data failed: %s", __FUNCTION__, Socket.GetLastErrorText().c_str()); + return false; + } + + // Read the HTTP response: + int ret; + unsigned char buf[1024]; + + for (;;) + { + ret = Socket.Receive(buf, sizeof(buf)); + + if ((ret == POLARSSL_ERR_NET_WANT_READ) || (ret == POLARSSL_ERR_NET_WANT_WRITE)) + { + // This value should never be returned, it is handled internally by cBlockingSslClientSocket + LOGWARNING("%s: SSL reading failed internally", __FUNCTION__); + return false; + } + if (ret == POLARSSL_ERR_SSL_PEER_CLOSE_NOTIFY) + { + break; + } + if (ret < 0) + { + LOGWARNING("%s: SSL reading failed: -0x%x", __FUNCTION__, -ret); + return false; + } + if (ret == 0) + { + break; + } + + a_Response.append((const char *)buf, (size_t)ret); + } + + Socket.Disconnect(); + return true; +} + + + + + +AString cMojangAPI::MakeUUIDShort(const AString & a_UUID) +{ + // Note: we only check the string's length, not the actual content + switch (a_UUID.size()) + { + case 32: + { + // Already is a short UUID, only lowercase + return StrToLower(a_UUID); + } + + case 36: + { + // Remove the dashes from the string by appending together the parts between them: + AString res; + res.reserve(32); + res.append(a_UUID, 0, 8); + res.append(a_UUID, 9, 4); + res.append(a_UUID, 14, 4); + res.append(a_UUID, 19, 4); + res.append(a_UUID, 24, 12); + return StrToLower(res); + } + } + LOGWARNING("%s: Not an UUID: \"%s\".", __FUNCTION__, a_UUID.c_str()); + return ""; +} + + + + + +AString cMojangAPI::MakeUUIDDashed(const AString & a_UUID) +{ + // Note: we only check the string's length, not the actual content + switch (a_UUID.size()) + { + case 36: + { + // Already is a dashed UUID, only lowercase + return StrToLower(a_UUID); + } + + case 32: + { + // Insert dashes at the proper positions: + AString res; + res.reserve(36); + res.append(a_UUID, 0, 8); + res.push_back('-'); + res.append(a_UUID, 8, 4); + res.push_back('-'); + res.append(a_UUID, 12, 4); + res.push_back('-'); + res.append(a_UUID, 16, 4); + res.push_back('-'); + res.append(a_UUID, 20, 12); + return StrToLower(res); + } + } + LOGWARNING("%s: Not an UUID: \"%s\".", __FUNCTION__, a_UUID.c_str()); + return ""; +} + + + + + +void cMojangAPI::LoadCachesFromDisk(void) +{ + try + { + // Open up the SQLite DB: + SQLite::Database db("MojangAPI.sqlite", SQLITE_OPEN_READWRITE | SQLITE_OPEN_CREATE); + db.exec("CREATE TABLE IF NOT EXISTS PlayerNameToUUID (PlayerName, UUID, DateTime)"); + db.exec("CREATE TABLE IF NOT EXISTS UUIDToProfile (UUID, PlayerName, Textures, TexturesSignature, DateTime)"); + + // Retrieve all entries: + { + SQLite::Statement stmt(db, "SELECT PlayerName, UUID, DateTime FROM PlayerNameToUUID"); + while (stmt.executeStep()) + { + AString PlayerName = stmt.getColumn(0); + AString UUID = stmt.getColumn(1); + Int64 DateTime = stmt.getColumn(2); + UUID = MakeUUIDShort(UUID); + m_NameToUUID[StrToLower(PlayerName)] = sProfile(PlayerName, UUID, "", "", DateTime); + m_UUIDToName[UUID] = sProfile(PlayerName, UUID, "", "", DateTime); + } + } + { + SQLite::Statement stmt(db, "SELECT PlayerName, UUID, Textures, TexturesSignature, DateTime FROM UUIDToProfile"); + while (stmt.executeStep()) + { + AString PlayerName = stmt.getColumn(0); + AString UUID = stmt.getColumn(1); + AString Textures = stmt.getColumn(2); + AString TexturesSignature = stmt.getColumn(2); + Int64 DateTime = stmt.getColumn(4); + UUID = MakeUUIDShort(UUID); + m_UUIDToProfile[UUID] = sProfile(PlayerName, UUID, Textures, TexturesSignature, DateTime); + } + } + } + catch (const SQLite::Exception & ex) + { + LOGINFO("Loading MojangAPI cache failed: %s", ex.what()); + } +} + + + + + +void cMojangAPI::SaveCachesToDisk(void) +{ + try + { + // Open up the SQLite DB: + SQLite::Database db("MojangAPI.sqlite", SQLITE_OPEN_READWRITE | SQLITE_OPEN_CREATE); + db.exec("CREATE TABLE IF NOT EXISTS PlayerNameToUUID (PlayerName, UUID, DateTime)"); + db.exec("CREATE TABLE IF NOT EXISTS UUIDToProfile (UUID, PlayerName, Textures, TexturesSignature, DateTime)"); + + // Remove all entries: + db.exec("DELETE FROM PlayerNameToUUID"); + db.exec("DELETE FROM UUIDToProfile"); + + // Save all cache entries - m_PlayerNameToUUID: + Int64 LimitDateTime = time(NULL) - MAX_AGE; + { + SQLite::Statement stmt(db, "INSERT INTO PlayerNameToUUID(PlayerName, UUID, DateTime) VALUES (?, ?, ?)"); + cCSLock Lock(m_CSNameToUUID); + for (cProfileMap::const_iterator itr = m_NameToUUID.begin(), end = m_NameToUUID.end(); itr != end; ++itr) + { + if (itr->second.m_DateTime < LimitDateTime) + { + // This item is too old, do not save + continue; + } + stmt.bind(1, itr->second.m_PlayerName); + stmt.bind(2, itr->second.m_UUID); + stmt.bind(3, itr->second.m_DateTime); + stmt.exec(); + stmt.reset(); + } + } + + // Save all cache entries - m_UUIDToProfile: + { + SQLite::Statement stmt(db, "INSERT INTO UUIDToProfile(UUID, PlayerName, Textures, TexturesSignature, DateTime) VALUES (?, ?, ?, ?, ?)"); + cCSLock Lock(m_CSUUIDToProfile); + for (cProfileMap::const_iterator itr = m_UUIDToProfile.begin(), end = m_UUIDToProfile.end(); itr != end; ++itr) + { + if (itr->second.m_DateTime < LimitDateTime) + { + // This item is too old, do not save + continue; + } + stmt.bind(1, itr->second.m_UUID); + stmt.bind(2, itr->second.m_PlayerName); + stmt.bind(3, itr->second.m_Textures); + stmt.bind(4, itr->second.m_TexturesSignature); + stmt.bind(5, itr->second.m_DateTime); + stmt.exec(); + stmt.reset(); + } + } + } + catch (const SQLite::Exception & ex) + { + LOGINFO("Saving MojangAPI cache failed: %s", ex.what()); + } +} + + + + + +void cMojangAPI::CacheNamesToUUIDs(const AStringVector & a_PlayerNames) +{ + // Create a list of names to query, by removing those that are already cached: + AStringVector NamesToQuery; + NamesToQuery.reserve(a_PlayerNames.size()); + { + cCSLock Lock(m_CSNameToUUID); + for (AStringVector::const_iterator itr = a_PlayerNames.begin(), end = a_PlayerNames.end(); itr != end; ++itr) + { + if (m_NameToUUID.find(*itr) == m_NameToUUID.end()) + { + NamesToQuery.push_back(*itr); + } + } // for itr - a_PlayerNames[] + } // Lock(m_CSNameToUUID) + + QueryNamesToUUIDs(NamesToQuery); +} + + + + + +void cMojangAPI::QueryNamesToUUIDs(AStringVector & a_NamesToQuery) +{ + while (!a_NamesToQuery.empty()) + { + // Create the request body - a JSON containing up to MAX_PER_QUERY playernames: + Json::Value root; + int Count = 0; + AStringVector::iterator itr = a_NamesToQuery.begin(), end = a_NamesToQuery.end(); + for (; (itr != end) && (Count < MAX_PER_QUERY); ++itr, ++Count) + { + Json::Value req(*itr); + root.append(req); + } // for itr - a_PlayerNames[] + a_NamesToQuery.erase(a_NamesToQuery.begin(), itr); + Json::FastWriter Writer; + AString RequestBody = Writer.write(root); + + // Create the HTTP request: + AString Request; + Request += "POST " + m_NameToUUIDAddress + " HTTP/1.0\r\n"; // We need to use HTTP 1.0 because we don't handle Chunked transfer encoding + Request += "Host: " + m_NameToUUIDServer + "\r\n"; + Request += "User-Agent: MCServer\r\n"; + Request += "Connection: close\r\n"; + Request += "Content-Type: application/json\r\n"; + Request += Printf("Content-Length: %u\r\n", (unsigned)RequestBody.length()); + Request += "\r\n"; + Request += RequestBody; + + // Get the response from the server: + AString Response; + if (!SecureRequest(m_NameToUUIDServer, Request, Response)) + { + continue; + } + + // Check the HTTP status line: + const AString Prefix("HTTP/1.1 200 OK"); + AString HexDump; + if (Response.compare(0, Prefix.size(), Prefix)) + { + LOGINFO("%s failed: bad HTTP status line received", __FUNCTION__); + LOGD("Response: \n%s", CreateHexDump(HexDump, Response.data(), Response.size(), 16).c_str()); + continue; + } + + // Erase the HTTP headers from the response: + size_t idxHeadersEnd = Response.find("\r\n\r\n"); + if (idxHeadersEnd == AString::npos) + { + LOGINFO("%s failed: bad HTTP response header received", __FUNCTION__); + LOGD("Response: \n%s", CreateHexDump(HexDump, Response.data(), Response.size(), 16).c_str()); + continue; + } + Response.erase(0, idxHeadersEnd + 4); + + // Parse the returned string into Json: + Json::Reader reader; + if (!reader.parse(Response, root, false) || !root.isArray()) + { + LOGWARNING("%s failed: Cannot parse received data (NameToUUID) to JSON!", __FUNCTION__); + LOGD("Response body:\n%s", CreateHexDump(HexDump, Response.data(), Response.size(), 16).c_str()); + continue; + } + + // Store the returned results into cache: + Json::Value::UInt JsonCount = root.size(); + Int64 Now = time(NULL); + { + cCSLock Lock(m_CSNameToUUID); + for (Json::Value::UInt idx = 0; idx < JsonCount; ++idx) + { + Json::Value & Val = root[idx]; + AString JsonName = Val.get("name", "").asString(); + AString JsonUUID = MakeUUIDShort(Val.get("id", "").asString()); + if (JsonUUID.empty()) + { + continue; + } + m_NameToUUID[StrToLower(JsonName)] = sProfile(JsonName, JsonUUID, "", "", Now); + NotifyNameUUID(JsonName, JsonUUID); + } // for idx - root[] + } // cCSLock (m_CSNameToUUID) + + // Also cache the UUIDToName: + { + cCSLock Lock(m_CSUUIDToName); + for (Json::Value::UInt idx = 0; idx < JsonCount; ++idx) + { + Json::Value & Val = root[idx]; + AString JsonName = Val.get("name", "").asString(); + AString JsonUUID = MakeUUIDShort(Val.get("id", "").asString()); + if (JsonUUID.empty()) + { + continue; + } + m_UUIDToName[JsonUUID] = sProfile(JsonName, JsonUUID, "", "", Now); + } // for idx - root[] + } + } // while (!NamesToQuery.empty()) +} + + + + + +void cMojangAPI::CacheUUIDToProfile(const AString & a_UUID) +{ + ASSERT(a_UUID.size() == 32); + + // Check if already present: + { + cCSLock Lock(m_CSUUIDToProfile); + if (m_UUIDToProfile.find(a_UUID) != m_UUIDToProfile.end()) + { + return; + } + } + + QueryUUIDToProfile(a_UUID); +} + + + + + +void cMojangAPI::QueryUUIDToProfile(const AString & a_UUID) +{ + // Create the request address: + AString Address = m_UUIDToProfileAddress; + ReplaceString(Address, "%UUID%", a_UUID); + + // Create the HTTP request: + AString Request; + Request += "GET " + Address + " HTTP/1.0\r\n"; // We need to use HTTP 1.0 because we don't handle Chunked transfer encoding + Request += "Host: " + m_UUIDToProfileServer + "\r\n"; + Request += "User-Agent: MCServer\r\n"; + Request += "Connection: close\r\n"; + Request += "Content-Length: 0\r\n"; + Request += "\r\n"; + + // Get the response from the server: + AString Response; + if (!SecureRequest(m_UUIDToProfileServer, Request, Response)) + { + return; + } + + // Check the HTTP status line: + const AString Prefix("HTTP/1.1 200 OK"); + AString HexDump; + if (Response.compare(0, Prefix.size(), Prefix)) + { + LOGINFO("%s failed: bad HTTP status line received", __FUNCTION__); + LOGD("Response: \n%s", CreateHexDump(HexDump, Response.data(), Response.size(), 16).c_str()); + return; + } + + // Erase the HTTP headers from the response: + size_t idxHeadersEnd = Response.find("\r\n\r\n"); + if (idxHeadersEnd == AString::npos) + { + LOGINFO("%s failed: bad HTTP response header received", __FUNCTION__); + LOGD("Response: \n%s", CreateHexDump(HexDump, Response.data(), Response.size(), 16).c_str()); + return; + } + Response.erase(0, idxHeadersEnd + 4); + + // Parse the returned string into Json: + Json::Reader reader; + Json::Value root; + if (!reader.parse(Response, root, false) || !root.isObject()) + { + LOGWARNING("%s failed: Cannot parse received data (NameToUUID) to JSON!", __FUNCTION__); + LOGD("Response body:\n%s", CreateHexDump(HexDump, Response.data(), Response.size(), 16).c_str()); + return; + } + + /* Example response: + { + "id": "b1caf24202a841a78055a079c460eee7", + "name": "xoft", + "properties": + [ + { + "name": "textures", + "value": "eyJ0aW1lc3RhbXAiOjE0MDcwNzAzMjEyNzEsInByb2ZpbGVJZCI6ImIxY2FmMjQyMDJhODQxYTc4MDU1YTA3OWM0NjBlZWU3IiwicHJvZmlsZU5hbWUiOiJ4b2Z0IiwiaXNQdWJsaWMiOnRydWUsInRleHR1cmVzIjp7IlNLSU4iOnsidXJsIjoiaHR0cDovL3RleHR1cmVzLm1pbmVjcmFmdC5uZXQvdGV4dHVyZS9iNzc5YmFiZjVhNTg3Zjk0OGFkNjc0N2VhOTEyNzU0MjliNjg4Mjk1YWUzYzA3YmQwZTJmNWJmNGQwNTIifX19", + "signature": "XCty+jGEF39hEPrPhYNnCX087kPaoCjYruzYI/DS4nkL5hbjnkSM5Rh15hnUyv/FHhC8OF5rif3D1tQjtMI19KSVaXoUFXpbJM8/+PB8GDgEbX8Fc3u9nYkzOcM/xfxdYsFAdFhLQMkvase/BZLSuPhdy9DdI+TCrO7xuSTZfYmmwVuWo3w5gCY+mSIAnqltnOzaOOTcly75xvO0WYpVk7nJdnR2tvSi0wfrQPDrIg/uzhX7p0SnDqijmBU4QaNez/TNKiFxy69dAzt0RSotlQzqkDbyVKhhv9a4eY8h3pXi4UMftKEj4FAKczxLImkukJXuOn5NN15/Q+le0rJVBC60/xjKIVzltEsMN6qjWD0lQjey7WEL+4pGhCVuWY5KzuZjFvgqszuJTFz7lo+bcHiceldJtea8/fa02eTRObZvdLxbWC9ZfFY0IhpOVKfcLdno/ddDMNMQMi5kMrJ8MZZ/PcW1w5n7MMGWPGCla1kOaC55AL0QYSMGRVEZqgU9wXI5M7sHGZKGM4mWxkbEJYBkpI/p3GyxWgV6v33ZWlsz65TqlNrR1gCLaoFCm7Sif8NqPBZUAONHYon0roXhin/DyEanS93WV6i6FC1Wisscjq2AcvnOlgTo/5nN/1QsMbjNumuMGo37sqjRqlXoPb8zEUbAhhztYuJjEfQ2Rd8=" + } + ] + } + */ + + // Store the returned result into caches: + AString PlayerName = root.get("name", "").asString(); + if (PlayerName.empty()) + { + // No valid playername, bail out + return; + } + Json::Value Properties = root.get("properties", ""); + Int64 Now = time(NULL); + { + cCSLock Lock(m_CSUUIDToProfile); + m_UUIDToProfile[a_UUID] = sProfile(PlayerName, a_UUID, Properties, Now); + } + { + cCSLock Lock(m_CSUUIDToName); + m_UUIDToName[a_UUID] = sProfile(PlayerName, a_UUID, Properties, Now); + } + { + cCSLock Lock(m_CSNameToUUID); + m_NameToUUID[StrToLower(PlayerName)] = sProfile(PlayerName, a_UUID, Properties, Now); + } + NotifyNameUUID(PlayerName, a_UUID); +} + + + + + +void cMojangAPI::NotifyNameUUID(const AString & a_PlayerName, const AString & a_UUID) +{ + // Notify the rank manager: + cCSLock Lock(m_CSRankMgr); + if (m_RankMgr != NULL) + { + m_RankMgr->NotifyNameUUID(a_PlayerName, a_UUID); + } +} + + + + + +void cMojangAPI::Update(void) +{ + Int64 LimitDateTime = time(NULL) - MAX_AGE; + + // Re-query all playernames that are stale: + AStringVector PlayerNames; + { + cCSLock Lock(m_CSNameToUUID); + for (cProfileMap::const_iterator itr = m_NameToUUID.begin(), end = m_NameToUUID.end(); itr != end; ++itr) + { + if (itr->second.m_DateTime < LimitDateTime) + { + PlayerNames.push_back(itr->first); + } + } // for itr - m_NameToUUID[] + } + if (!PlayerNames.empty()) + { + LOG("cMojangAPI: Updating name-to-uuid cache for %u names", (unsigned)PlayerNames.size()); + QueryNamesToUUIDs(PlayerNames); + } + + // Re-query all profiles that are stale: + AStringVector ProfileUUIDs; + { + cCSLock Lock(m_CSUUIDToProfile); + for (cProfileMap::const_iterator itr = m_UUIDToProfile.begin(), end = m_UUIDToProfile.end(); itr != end; ++itr) + { + if (itr->second.m_DateTime < LimitDateTime) + { + ProfileUUIDs.push_back(itr->first); + } + } // for itr - m_UUIDToProfile[] + } + if (!ProfileUUIDs.empty()) + { + LOG("cMojangAPI: Updating uuid-to-profile cache for %u uuids", (unsigned)ProfileUUIDs.size()); + for (AStringVector::const_iterator itr = ProfileUUIDs.begin(), end = ProfileUUIDs.end(); itr != end; ++itr) + { + QueryUUIDToProfile(*itr); + } + } +} + + + + diff --git a/src/Protocol/MojangAPI.h b/src/Protocol/MojangAPI.h new file mode 100644 index 000000000..fa4c16e4e --- /dev/null +++ b/src/Protocol/MojangAPI.h @@ -0,0 +1,226 @@ + +// MojangAPI.h + +// Declares the cMojangAPI class representing the various API points provided by Mojang's webservices, and a cache for their results + + + + + +#pragma once + +#include <time.h> + + + + + +// fwd: ../RankManager.h" +class cRankManager; + +namespace Json +{ + class Value; +} + + + + + +// tolua_begin +class cMojangAPI +{ +public: + // tolua_end + + cMojangAPI(void); + ~cMojangAPI(); + + /** Initializes the API; reads the settings from the specified ini file. + Loads cached results from disk. */ + void Start(cIniFile & a_SettingsIni); + + /** Connects to the specified server using SSL, sends the given request and receives the response. + Checks Mojang certificates using the hard-coded Starfield root CA certificate. + Returns true if all was successful, false on failure. */ + static bool SecureRequest(const AString & a_ServerName, const AString & a_Request, AString & a_Response); + + /** Normalizes the given UUID to its short form (32 bytes, no dashes, lowercase). + Logs a warning and returns empty string if not a UUID. + Note: only checks the string's length, not the actual content. */ + static AString MakeUUIDShort(const AString & a_UUID); + + /** Normalizes the given UUID to its dashed form (36 bytes, 4 dashes, lowercase). + Logs a warning and returns empty string if not a UUID. + Note: only checks the string's length, not the actual content. */ + static AString MakeUUIDDashed(const AString & a_UUID); + + /** Converts a player name into a UUID. + The UUID will be empty on error. + If a_UseOnlyCached is true, the function only consults the cached values. + If a_UseOnlyCached is false and the name is not found in the cache, it is looked up online, which is a blocking + operation, do not use this in world-tick thread! + If you have multiple names to resolve, use the GetUUIDsFromPlayerNames() function, it uses a single request for multiple names. */ + AString GetUUIDFromPlayerName(const AString & a_PlayerName, bool a_UseOnlyCached = false); + + /** Converts a UUID into a playername. + The returned playername will be empty on error. + Both short and dashed UUID formats are accepted. + Uses both m_UUIDToName and m_UUIDToProfile to search for the value. Uses m_UUIDToProfile for cache. + If a_UseOnlyCached is true, the function only consults the cached values. + If a_UseOnlyCached is false and the name is not found in the cache, it is looked up online, which is a blocking + operation, do not use this in world-tick thread! */ + AString GetPlayerNameFromUUID(const AString & a_UUID, bool a_UseOnlyCached = false); + + /** Converts the player names into UUIDs. + a_PlayerName[idx] will be converted to UUID and returned as idx-th value + The UUID will be empty on error. + If a_UseOnlyCached is true, only the cached values are returned. + If a_UseOnlyCached is false, the names not found in the cache are looked up online, which is a blocking + operation, do not use this in world-tick thread! */ + AStringVector GetUUIDsFromPlayerNames(const AStringVector & a_PlayerName, bool a_UseOnlyCached = false); + + /** Called by the Authenticator to add a PlayerName -> UUID mapping that it has received from + authenticating a user. This adds the cache item and "refreshes" it if existing, adjusting its datetime + stamp to now. */ + void AddPlayerNameToUUIDMapping(const AString & a_PlayerName, const AString & a_UUID); + + /** Called by the Authenticator to add a profile that it has received from authenticating a user. Adds + the profile to the respective mapping caches and updtes their datetime stamp to now. */ + void AddPlayerProfile(const AString & a_PlayerName, const AString & a_UUID, const Json::Value & a_Properties); + + /** Sets the m_RankMgr that is used for name-uuid notifications. Accepts NULL to remove the binding. */ + void SetRankManager(cRankManager * a_RankManager) { m_RankMgr = a_RankManager; } + +protected: + /** The thread that periodically checks for stale data and re-queries it from the server. */ + class cUpdateThread; + + + /** Holds data for a single player profile. */ + struct sProfile + { + AString m_PlayerName; // Case-correct playername + AString m_UUID; // Short lowercased UUID + AString m_Textures; // The Textures field of the profile properties + AString m_TexturesSignature; // The signature of the Textures field of the profile properties + Int64 m_DateTime; // UNIXtime of the profile lookup + + /** Default constructor for the container's sake. */ + sProfile(void) : + m_PlayerName(), + m_UUID(), + m_Textures(), + m_TexturesSignature(), + m_DateTime(time(NULL)) + { + } + + /** Constructor for the storage creation. */ + sProfile( + const AString & a_PlayerName, + const AString & a_UUID, + const AString & a_Textures, + const AString & a_TexturesSignature, + Int64 a_DateTime + ) : + m_PlayerName(a_PlayerName), + m_UUID(a_UUID), + m_Textures(a_Textures), + m_TexturesSignature(a_TexturesSignature), + m_DateTime(a_DateTime) + { + } + + /** Constructor that parses the values from the Json profile. */ + sProfile( + const AString & a_PlayerName, + const AString & a_UUID, + const Json::Value & a_Properties, + Int64 a_DateTime + ); + }; + typedef std::map<AString, sProfile> cProfileMap; + + + /** The server to connect to when converting player names to UUIDs. For example "api.mojang.com". */ + AString m_NameToUUIDServer; + + /** The URL to use for converting player names to UUIDs, without server part. + For example "/profiles/page/1". */ + AString m_NameToUUIDAddress; + + /** The server to connect to when converting UUID to profile. For example "sessionserver.mojang.com". */ + AString m_UUIDToProfileServer; + + /** The URL to use for converting UUID to profile, without the server part. + Will replace %UUID% with the actual UUID. For example "session/minecraft/profile/%UUID%?unsigned=false". */ + AString m_UUIDToProfileAddress; + + /** Cache for the Name-to-UUID lookups. The map key is lowercased PlayerName. Protected by m_CSNameToUUID. */ + cProfileMap m_NameToUUID; + + /** Protects m_NameToUUID against simultaneous multi-threaded access. */ + cCriticalSection m_CSNameToUUID; + + /** Cache for the Name-to-UUID lookups. The map key is lowercased short UUID. Protected by m_CSUUIDToName. */ + cProfileMap m_UUIDToName; + + /** Protects m_UUIDToName against simultaneous multi-threaded access. */ + cCriticalSection m_CSUUIDToName; + + /** Cache for the UUID-to-profile lookups. The map key is lowercased short UUID. + Protected by m_CSUUIDToProfile. */ + cProfileMap m_UUIDToProfile; + + /** Protects m_UUIDToProfile against simultaneous multi-threaded access. */ + cCriticalSection m_CSUUIDToProfile; + + /** The rank manager that is notified of the name-uuid pairings. May be NULL. Protected by m_CSRankMgr. */ + cRankManager * m_RankMgr; + + /** Protects m_RankMgr agains simultaneous multi-threaded access. */ + cCriticalSection m_CSRankMgr; + + /** The thread that periodically updates the stale data in the DB from the Mojang servers. */ + SharedPtr<cUpdateThread> m_UpdateThread; + + + /** Loads the caches from a disk storage. */ + void LoadCachesFromDisk(void); + + /** Saves the caches to a disk storage. */ + void SaveCachesToDisk(void); + + /** Makes sure all specified names are in the m_PlayerNameToUUID cache. Downloads any missing ones from Mojang API servers. + Names that are not valid are not added into the cache. + ASSUMEs that a_PlayerNames contains lowercased player names. */ + void CacheNamesToUUIDs(const AStringVector & a_PlayerNames); + + /** Queries all the specified names and stores them into the m_PlayerNameToUUID cache. + Names that are not valid are not added into the cache. + ASSUMEs that a_PlayerNames contans lowercased player names. + For performance reasons takes a non-const reference and modifies the list given to it, until empty. */ + void QueryNamesToUUIDs(AStringVector & a_PlayerNames); + + /** Makes sure the specified UUID is in the m_UUIDToProfile cache. If missing, downloads it from Mojang API servers. + UUIDs that are not valid will not be added into the cache. + ASSUMEs that a_UUID is a lowercased short UUID. */ + void CacheUUIDToProfile(const AString & a_UUID); + + /** Queries the specified UUID's profile and stores it in the m_UUIDToProfile cache. If already present, updates the cache entry. + UUIDs that are not valid will not be added into the cache. + ASSUMEs that a_UUID is a lowercased short UUID. */ + void QueryUUIDToProfile(const AString & a_UUID); + + /** Called for each name-uuid pairing that is discovered. + If assigned, notifies the m_RankManager of the event. */ + void NotifyNameUUID(const AString & a_PlayerName, const AString & a_PlayerUUID); + + /** Updates the stale values in the DB from the Mojang servers. Called from the cUpdateThread, blocks on the HTTPS API calls. */ + void Update(void); +} ; // tolua_export + + + + diff --git a/src/Protocol/Protocol.h b/src/Protocol/Protocol.h index d110f2af9..7225f663d 100644 --- a/src/Protocol/Protocol.h +++ b/src/Protocol/Protocol.h @@ -50,82 +50,87 @@ public: m_Client(a_Client) { } + virtual ~cProtocol() {} /// Called when client sends some data virtual void DataReceived(const char * a_Data, size_t a_Size) = 0; // Sending stuff to clients (alphabetically sorted): - virtual void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle) = 0; - virtual void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) = 0; - virtual void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage) = 0; - virtual void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) = 0; - virtual void SendBlockChanges (int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes) = 0; - virtual void SendChat (const AString & a_Message) = 0; - virtual void SendChat (const cCompositeChat & a_Message) = 0; - virtual void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) = 0; - virtual void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player) = 0; - virtual void SendDestroyEntity (const cEntity & a_Entity) = 0; - virtual void SendDisconnect (const AString & a_Reason) = 0; - virtual void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ) = 0; ///< Request the client to open up the sign editor for the sign (1.6+) - virtual void SendEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration) = 0; - virtual void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) = 0; - virtual void SendEntityHeadLook (const cEntity & a_Entity) = 0; - virtual void SendEntityLook (const cEntity & a_Entity) = 0; - virtual void SendEntityMetadata (const cEntity & a_Entity) = 0; - virtual void SendEntityProperties (const cEntity & a_Entity) = 0; - virtual void SendEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) = 0; - virtual void SendEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) = 0; - virtual void SendEntityStatus (const cEntity & a_Entity, char a_Status) = 0; - virtual void SendEntityVelocity (const cEntity & a_Entity) = 0; - virtual void SendExplosion (double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion) = 0; - virtual void SendGameMode (eGameMode a_GameMode) = 0; - virtual void SendHealth (void) = 0; - virtual void SendInventorySlot (char a_WindowID, short a_SlotNum, const cItem & a_Item) = 0; - virtual void SendKeepAlive (int a_PingID) = 0; - virtual void SendLogin (const cPlayer & a_Player, const cWorld & a_World) = 0; - virtual void SendLoginSuccess (void) = 0; - virtual void SendMapColumn (int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length) = 0; - virtual void SendMapDecorators (int a_ID, const cMapDecoratorList & a_Decorators) = 0; - virtual void SendMapInfo (int a_ID, unsigned int a_Scale) = 0; - virtual void SendPaintingSpawn (const cPainting & a_Painting) = 0; - virtual void SendPickupSpawn (const cPickup & a_Pickup) = 0; - virtual void SendPlayerAbilities (void) = 0; - virtual void SendEntityAnimation (const cEntity & a_Entity, char a_Animation) = 0; - virtual void SendParticleEffect (const AString & a_SoundName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount) = 0; - virtual void SendPlayerListItem (const cPlayer & a_Player, bool a_IsOnline) = 0; - virtual void SendPlayerMaxSpeed (void) = 0; ///< Informs the client of the maximum player speed (1.6.1+) - virtual void SendPlayerMoveLook (void) = 0; - virtual void SendPlayerPosition (void) = 0; - virtual void SendPlayerSpawn (const cPlayer & a_Player) = 0; - virtual void SendPluginMessage (const AString & a_Channel, const AString & a_Message) = 0; - virtual void SendRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID) = 0; - virtual void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) = 0; - virtual void SendExperience (void) = 0; - virtual void SendExperienceOrb (const cExpOrb & a_ExpOrb) = 0; - virtual void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) = 0; - virtual void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) = 0; - virtual void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) = 0; - virtual void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) = 0; - virtual void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) = 0; - virtual void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock) = 0; - virtual void SendSpawnMob (const cMonster & a_Mob) = 0; - virtual void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) = 0; - virtual void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) = 0; - virtual void SendStatistics (const cStatManager & a_Manager) = 0; - virtual void SendTabCompletionResults(const AStringVector & a_Results) = 0; - virtual void SendTeleportEntity (const cEntity & a_Entity) = 0; - virtual void SendThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ) = 0; - virtual void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay) = 0; - virtual void SendUnloadChunk (int a_ChunkX, int a_ChunkZ) = 0; - virtual void SendUpdateBlockEntity (cBlockEntity & a_BlockEntity) = 0; - virtual void SendUpdateSign (int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4) = 0; - virtual void SendUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) = 0; - virtual void SendWeather (eWeather a_Weather) = 0; - virtual void SendWholeInventory (const cWindow & a_Window) = 0; - virtual void SendWindowClose (const cWindow & a_Window) = 0; - virtual void SendWindowOpen (const cWindow & a_Window) = 0; - virtual void SendWindowProperty (const cWindow & a_Window, int a_Property, int a_Value) = 0; + virtual void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle) = 0; + virtual void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) = 0; + virtual void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage) = 0; + virtual void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) = 0; + virtual void SendBlockChanges (int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes) = 0; + virtual void SendChat (const AString & a_Message) = 0; + virtual void SendChat (const cCompositeChat & a_Message) = 0; + virtual void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) = 0; + virtual void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player) = 0; + virtual void SendDestroyEntity (const cEntity & a_Entity) = 0; + virtual void SendDisconnect (const AString & a_Reason) = 0; + virtual void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ) = 0; ///< Request the client to open up the sign editor for the sign (1.6+) + virtual void SendEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration) = 0; + virtual void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) = 0; + virtual void SendEntityHeadLook (const cEntity & a_Entity) = 0; + virtual void SendEntityLook (const cEntity & a_Entity) = 0; + virtual void SendEntityMetadata (const cEntity & a_Entity) = 0; + virtual void SendEntityProperties (const cEntity & a_Entity) = 0; + virtual void SendEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) = 0; + virtual void SendEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) = 0; + virtual void SendEntityStatus (const cEntity & a_Entity, char a_Status) = 0; + virtual void SendEntityVelocity (const cEntity & a_Entity) = 0; + virtual void SendExplosion (double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion) = 0; + virtual void SendGameMode (eGameMode a_GameMode) = 0; + virtual void SendHealth (void) = 0; + virtual void SendInventorySlot (char a_WindowID, short a_SlotNum, const cItem & a_Item) = 0; + virtual void SendKeepAlive (int a_PingID) = 0; + virtual void SendLogin (const cPlayer & a_Player, const cWorld & a_World) = 0; + virtual void SendLoginSuccess (void) = 0; + virtual void SendMapColumn (int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length, unsigned int m_Scale) = 0; + virtual void SendMapDecorators (int a_ID, const cMapDecoratorList & a_Decorators, unsigned int m_Scale) = 0; + virtual void SendMapInfo (int a_ID, unsigned int a_Scale) = 0; + virtual void SendPaintingSpawn (const cPainting & a_Painting) = 0; + virtual void SendPickupSpawn (const cPickup & a_Pickup) = 0; + virtual void SendPlayerAbilities (void) = 0; + virtual void SendEntityAnimation (const cEntity & a_Entity, char a_Animation) = 0; + virtual void SendParticleEffect (const AString & a_SoundName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount) = 0; + virtual void SendPlayerListAddPlayer (const cPlayer & a_Player) = 0; + virtual void SendPlayerListRemovePlayer (const cPlayer & a_Player) = 0; + virtual void SendPlayerListUpdateGameMode (const cPlayer & a_Player) = 0; + virtual void SendPlayerListUpdatePing (const cPlayer & a_Player) = 0; + virtual void SendPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName) = 0; + virtual void SendPlayerMaxSpeed (void) = 0; ///< Informs the client of the maximum player speed (1.6.1+) + virtual void SendPlayerMoveLook (void) = 0; + virtual void SendPlayerPosition (void) = 0; + virtual void SendPlayerSpawn (const cPlayer & a_Player) = 0; + virtual void SendPluginMessage (const AString & a_Channel, const AString & a_Message) = 0; + virtual void SendRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID) = 0; + virtual void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) = 0; + virtual void SendExperience (void) = 0; + virtual void SendExperienceOrb (const cExpOrb & a_ExpOrb) = 0; + virtual void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) = 0; + virtual void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) = 0; + virtual void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) = 0; + virtual void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) = 0; + virtual void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) = 0; + virtual void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock) = 0; + virtual void SendSpawnMob (const cMonster & a_Mob) = 0; + virtual void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) = 0; + virtual void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) = 0; + virtual void SendStatistics (const cStatManager & a_Manager) = 0; + virtual void SendTabCompletionResults (const AStringVector & a_Results) = 0; + virtual void SendTeleportEntity (const cEntity & a_Entity) = 0; + virtual void SendThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ) = 0; + virtual void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay, bool a_DoDaylightCycle) = 0; + virtual void SendUnloadChunk (int a_ChunkX, int a_ChunkZ) = 0; + virtual void SendUpdateBlockEntity (cBlockEntity & a_BlockEntity) = 0; + virtual void SendUpdateSign (int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4) = 0; + virtual void SendUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) = 0; + virtual void SendWeather (eWeather a_Weather) = 0; + virtual void SendWholeInventory (const cWindow & a_Window) = 0; + virtual void SendWindowClose (const cWindow & a_Window) = 0; + virtual void SendWindowOpen (const cWindow & a_Window) = 0; + virtual void SendWindowProperty (const cWindow & a_Window, int a_Property, int a_Value) = 0; /// Returns the ServerID used for authentication through session.minecraft.net virtual AString GetAuthServerID(void) = 0; @@ -133,108 +138,9 @@ public: protected: cClientHandle * m_Client; cCriticalSection m_CSPacket; // Each SendXYZ() function must acquire this CS in order to send the whole packet at once - + /// A generic data-sending routine, all outgoing packet data needs to be routed through this so that descendants may override it virtual void SendData(const char * a_Data, size_t a_Size) = 0; - - /// Called after writing each packet, enables descendants to flush their buffers - virtual void Flush(void) {} - - // Helpers for writing partial packet data, write using SendData() - void WriteByte(Byte a_Value) - { - SendData((const char *)&a_Value, 1); - } - - void WriteChar(char a_Value) - { - SendData(&a_Value, 1); - } - - void WriteShort(short a_Value) - { - u_short Value = htons((u_short)a_Value); - SendData((const char *)&Value, 2); - } - - /* - void WriteShort(unsigned short a_Value) - { - a_Value = htons(a_Value); - SendData((const char *)&a_Value, 2); - } - */ - - void WriteInt(int a_Value) - { - u_long Value = htonl((u_long)a_Value); - SendData((const char *)&Value, 4); - } - - void WriteUInt(unsigned int a_Value) - { - a_Value = htonl(a_Value); - SendData((const char *)&a_Value, 4); - } - - void WriteInt64 (Int64 a_Value) - { - UInt64 Value = HostToNetwork8(&a_Value); - SendData((const char *)&Value, 8); - } - - void WriteFloat (float a_Value) - { - UInt32 val = HostToNetwork4(&a_Value); - SendData((const char *)&val, 4); - } - - void WriteDouble(double a_Value) - { - UInt64 val = HostToNetwork8(&a_Value); - SendData((const char *)&val, 8); - } - - void WriteString(const AString & a_Value) - { - AString UTF16; - UTF8ToRawBEUTF16(a_Value.c_str(), a_Value.length(), UTF16); - WriteShort((short)(UTF16.size() / 2)); - SendData(UTF16.data(), UTF16.size()); - } - - void WriteBool(bool a_Value) - { - WriteByte(a_Value ? 1 : 0); - } - - void WriteVectorI(const Vector3i & a_Vector) - { - WriteInt(a_Vector.x); - WriteInt(a_Vector.y); - WriteInt(a_Vector.z); - } - - void WriteVarInt(UInt32 a_Value) - { - // A 32-bit integer can be encoded by at most 5 bytes: - unsigned char b[5]; - size_t idx = 0; - do - { - b[idx] = (a_Value & 0x7f) | ((a_Value > 0x7f) ? 0x80 : 0x00); - a_Value = a_Value >> 7; - idx++; - } while (a_Value > 0); - - SendData((const char *)b, idx); - } - - void WriteVarUTF8String(const AString & a_String) - { - WriteVarInt((UInt32)a_String.size()); - SendData(a_String.data(), a_String.size()); - } } ; diff --git a/src/Protocol/Protocol125.cpp b/src/Protocol/Protocol125.cpp deleted file mode 100644 index 538d31642..000000000 --- a/src/Protocol/Protocol125.cpp +++ /dev/null @@ -1,2128 +0,0 @@ - -// Protocol125.cpp - -// Implements the cProtocol125 class representing the release 1.2.5 protocol (#29) -/* -Documentation: - - protocol: http://wiki.vg/wiki/index.php?title=Protocol&oldid=2513 - - session handling: http://wiki.vg/wiki/index.php?title=Session&oldid=2262 - - slot format: http://wiki.vg/wiki/index.php?title=Slot_Data&oldid=2152 -*/ - -#include "Globals.h" - -#include "Protocol125.h" - -#include "../ClientHandle.h" -#include "../World.h" -#include "ChunkDataSerializer.h" -#include "../Entities/Entity.h" -#include "../Entities/ExpOrb.h" -#include "../Mobs/Monster.h" -#include "../Entities/Pickup.h" -#include "../Entities/Player.h" -#include "../ChatColor.h" -#include "../UI/Window.h" -#include "../Root.h" -#include "../Server.h" - -#include "../Entities/ArrowEntity.h" -#include "../Entities/Minecart.h" -#include "../Entities/FallingBlock.h" - -#include "../Mobs/IncludeAllMonsters.h" - -#include "../CompositeChat.h" - - - - - -enum -{ - PACKET_KEEP_ALIVE = 0x00, - PACKET_LOGIN = 0x01, - PACKET_HANDSHAKE = 0x02, - PACKET_CHAT = 0x03, - PACKET_UPDATE_TIME = 0x04, - PACKET_ENTITY_EQUIPMENT = 0x05, - PACKET_USE_ENTITY = 0x07, - PACKET_UPDATE_HEALTH = 0x08, - PACKET_RESPAWN = 0x09, - PACKET_PLAYER_ON_GROUND = 0x0a, - PACKET_PLAYER_POS = 0x0b, - PACKET_PLAYER_LOOK = 0x0c, - PACKET_PLAYER_MOVE_LOOK = 0x0d, - PACKET_BLOCK_DIG = 0x0e, - PACKET_BLOCK_PLACE = 0x0f, - PACKET_SLOT_SELECTED = 0x10, - PACKET_USE_BED = 0x11, - PACKET_ANIMATION = 0x12, - PACKET_PACKET_ENTITY_ACTION = 0x13, - PACKET_PLAYER_SPAWN = 0x14, - PACKET_PICKUP_SPAWN = 0x15, - PACKET_COLLECT_PICKUP = 0x16, - PACKET_SPAWN_OBJECT = 0x17, - PACKET_SPAWN_MOB = 0x18, - PACKET_ENTITY_VELOCITY = 0x1c, - PACKET_DESTROY_ENTITY = 0x1d, - PACKET_ENTITY = 0x1e, - PACKET_ENT_REL_MOVE = 0x1f, - PACKET_ENT_LOOK = 0x20, - PACKET_ENT_REL_MOVE_LOOK = 0x21, - PACKET_ENT_TELEPORT = 0x22, - PACKET_ENT_HEAD_LOOK = 0x23, - PACKET_ENT_STATUS = 0x26, - PACKET_ATTACH_ENTITY = 0x27, - PACKET_METADATA = 0x28, - PACKET_ENTITY_EFFECT = 0x29, - PACKET_SPAWN_EXPERIENCE_ORB = 0x1A, - PACKET_REMOVE_ENTITY_EFFECT = 0x2a, - PACKET_EXPERIENCE = 0x2b, - PACKET_PRE_CHUNK = 0x32, - PACKET_MAP_CHUNK = 0x33, - PACKET_MULTI_BLOCK = 0x34, - PACKET_BLOCK_CHANGE = 0x35, - PACKET_BLOCK_ACTION = 0x36, - PACKET_EXPLOSION = 0x3C, - PACKET_SOUND_EFFECT = 0x3e, - PACKET_SOUND_PARTICLE_EFFECT = 0x3d, - PACKET_CHANGE_GAME_STATE = 0x46, - PACKET_THUNDERBOLT = 0x47, - PACKET_WINDOW_OPEN = 0x64, - PACKET_WINDOW_CLOSE = 0x65, - PACKET_WINDOW_CLICK = 0x66, - PACKET_INVENTORY_SLOT = 0x67, - PACKET_INVENTORY_WHOLE = 0x68, - PACKET_WINDOW_PROPERTY = 0x69, - PACKET_CREATIVE_INVENTORY_ACTION = 0x6B, - PACKET_ENCHANT_ITEM = 0x6C, - PACKET_UPDATE_SIGN = 0x82, - PACKET_ITEM_DATA = 0x83, - PACKET_INCREMENT_STATISTIC = 0xC8, - PACKET_PLAYER_LIST_ITEM = 0xC9, - PACKET_PLAYER_ABILITIES = 0xca, - PACKET_PLUGIN_MESSAGE = 0xfa, - PACKET_PING = 0xfe, - PACKET_DISCONNECT = 0xff -} ; - - - - - -#define HANDLE_PACKET_READ(Proc, Type, Var) \ - Type Var; \ - { \ - if (!m_ReceivedData.Proc(Var)) \ - { \ - m_ReceivedData.CheckValid(); \ - return PARSE_INCOMPLETE; \ - } \ - m_ReceivedData.CheckValid(); \ - } - - - - -typedef unsigned char Byte; - - - - - -cProtocol125::cProtocol125(cClientHandle * a_Client) : - super(a_Client), - m_ReceivedData(32 KiB), - m_LastSentDimension(dimNotSet) -{ -} - - - - - -void cProtocol125::SendAttachEntity(const cEntity & a_Entity, const cEntity * a_Vehicle) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_ATTACH_ENTITY); - WriteInt(a_Entity.GetUniqueID()); - WriteInt((a_Vehicle == NULL) ? -1 : a_Vehicle->GetUniqueID()); - Flush(); -} - - - - - -void cProtocol125::SendBlockAction(int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) -{ - UNUSED(a_BlockType); - - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_BLOCK_ACTION); - WriteInt (a_BlockX); - WriteShort((short)a_BlockY); - WriteInt (a_BlockZ); - WriteChar (a_Byte1); - WriteChar (a_Byte2); - Flush(); -} - - - - - -void cProtocol125::SendBlockBreakAnim(int a_entityID, int a_BlockX, int a_BlockY, int a_BlockZ, char stage) -{ - // Not supported in this protocol version -} - - - - - -void cProtocol125::SendBlockChange(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_BLOCK_CHANGE); - WriteInt (a_BlockX); - WriteByte((unsigned char)a_BlockY); - WriteInt (a_BlockZ); - WriteByte(a_BlockType); - WriteByte(a_BlockMeta); - Flush(); -} - - - - - -void cProtocol125::SendBlockChanges(int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes) -{ - cCSLock Lock(m_CSPacket); - if (a_Changes.size() == 1) - { - // Special packet for single-block changes - const sSetBlock & blk = a_Changes.front(); - SendBlockChange(a_ChunkX * cChunkDef::Width + blk.x, blk.y, a_ChunkZ * cChunkDef::Width + blk.z, blk.BlockType, blk.BlockMeta); - return; - } - - WriteByte (PACKET_MULTI_BLOCK); - WriteInt (a_ChunkX); - WriteInt (a_ChunkZ); - WriteShort((short)a_Changes.size()); - WriteUInt ((UInt32)(4 * a_Changes.size())); - for (sSetBlockVector::const_iterator itr = a_Changes.begin(), end = a_Changes.end(); itr != end; ++itr) - { - UInt32 Coords = ((UInt32)itr->y) | ((UInt32)(itr->z << 8)) | ((UInt32)(itr->x << 12)); - UInt32 Blocks = ((UInt32)itr->BlockMeta) | ((UInt32)(itr->BlockType << 4)); - WriteUInt(Coords << 16 | Blocks); - } - Flush(); -} - - - - - -void cProtocol125::SendChat(const AString & a_Message) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_CHAT); - WriteString(a_Message); - Flush(); -} - - - - - -void cProtocol125::SendChat(const cCompositeChat & a_Message) -{ - // This version doesn't support composite messages, just extract each part's text and use it: - - // Send the message: - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_CHAT); - WriteString(a_Message.ExtractText()); - Flush(); -} - - - - - -void cProtocol125::SendChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) -{ - cCSLock Lock(m_CSPacket); - - // Send the pre-chunk: - SendPreChunk(a_ChunkX, a_ChunkZ, true); - - // Send the chunk data: - AString Serialized = a_Serializer.Serialize(cChunkDataSerializer::RELEASE_1_2_5); - WriteByte(PACKET_MAP_CHUNK); - WriteInt (a_ChunkX); - WriteInt (a_ChunkZ); - SendData(Serialized.data(), Serialized.size()); - Flush(); -} - - - - - -void cProtocol125::SendCollectEntity(const cEntity & a_Entity, const cPlayer & a_Player) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_COLLECT_PICKUP); - WriteInt (a_Entity.GetUniqueID()); - WriteInt (a_Player.GetUniqueID()); - Flush(); -} - - - - - -void cProtocol125::SendDestroyEntity(const cEntity & a_Entity) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_DESTROY_ENTITY); - WriteInt (a_Entity.GetUniqueID()); - Flush(); -} - - - - - -void cProtocol125::SendDisconnect(const AString & a_Reason) -{ - cCSLock Lock(m_CSPacket); - WriteByte ((unsigned char)PACKET_DISCONNECT); - WriteString(a_Reason); - Flush(); -} - - - - - -void cProtocol125::SendEditSign(int a_BlockX, int a_BlockY, int a_BlockZ) -{ - // This protocol version doesn't support this packet, sign editor is invoked by the client automatically - UNUSED(a_BlockX); - UNUSED(a_BlockY); - UNUSED(a_BlockZ); -} - - - - - -void cProtocol125::SendEntityEffect(const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_ENTITY_EFFECT); - WriteInt (a_Entity.GetUniqueID()); - WriteByte ((Byte)a_EffectID); - WriteByte ((Byte)a_Amplifier); - WriteShort(a_Duration); - Flush(); -} - - - - - -void cProtocol125::SendEntityEquipment(const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_ENTITY_EQUIPMENT); - WriteInt (a_Entity.GetUniqueID()); - WriteShort(a_SlotNum); - WriteShort(a_Item.m_ItemType); - WriteShort(a_Item.m_ItemDamage); - Flush(); -} - - - - - -void cProtocol125::SendEntityHeadLook(const cEntity & a_Entity) -{ - ASSERT(a_Entity.GetUniqueID() != m_Client->GetPlayer()->GetUniqueID()); // Must not send for self - - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_ENT_HEAD_LOOK); - WriteInt (a_Entity.GetUniqueID()); - WriteChar((char)((a_Entity.GetHeadYaw() / 360.f) * 256)); - Flush(); -} - - - - - -void cProtocol125::SendEntityLook(const cEntity & a_Entity) -{ - ASSERT(a_Entity.GetUniqueID() != m_Client->GetPlayer()->GetUniqueID()); // Must not send for self - - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_ENT_LOOK); - WriteInt (a_Entity.GetUniqueID()); - WriteChar((char)((a_Entity.GetYaw() / 360.f) * 256)); - WriteChar((char)((a_Entity.GetPitch() / 360.f) * 256)); - Flush(); -} - - - - - -void cProtocol125::SendEntityMetadata(const cEntity & a_Entity) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_METADATA); - WriteInt (a_Entity.GetUniqueID()); - - WriteCommonMetadata(a_Entity); - if (a_Entity.IsMob()) - { - WriteMobMetadata(((const cMonster &)a_Entity)); - } - else - { - WriteEntityMetadata(a_Entity); - } - WriteByte(0x7f); - - Flush(); -} - - - - - -void cProtocol125::SendEntityProperties(const cEntity & a_Entity) -{ - // Not supported in this protocol version -} - - - - - -void cProtocol125::SendEntityRelMove(const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) -{ - ASSERT(a_Entity.GetUniqueID() != m_Client->GetPlayer()->GetUniqueID()); // Must not send for self - - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_ENT_REL_MOVE); - WriteInt (a_Entity.GetUniqueID()); - WriteChar(a_RelX); - WriteChar(a_RelY); - WriteChar(a_RelZ); - Flush(); -} - - - - - -void cProtocol125::SendEntityRelMoveLook(const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) -{ - ASSERT(a_Entity.GetUniqueID() != m_Client->GetPlayer()->GetUniqueID()); // Must not send for self - - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_ENT_REL_MOVE_LOOK); - WriteInt (a_Entity.GetUniqueID()); - WriteChar(a_RelX); - WriteChar(a_RelY); - WriteChar(a_RelZ); - WriteChar((char)((a_Entity.GetYaw() / 360.f) * 256)); - WriteChar((char)((a_Entity.GetPitch() / 360.f) * 256)); - Flush(); -} - - - - - -void cProtocol125::SendEntityStatus(const cEntity & a_Entity, char a_Status) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_ENT_STATUS); - WriteInt (a_Entity.GetUniqueID()); - WriteChar(a_Status); - Flush(); -} - - - - - -void cProtocol125::SendEntityVelocity(const cEntity & a_Entity) -{ - ASSERT(a_Entity.GetUniqueID() != m_Client->GetPlayer()->GetUniqueID()); // Must not send for self - - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_ENTITY_VELOCITY); - WriteInt (a_Entity.GetUniqueID()); - WriteShort((short) (a_Entity.GetSpeedX() * 400)); // 400 = 8000 / 20 - WriteShort((short) (a_Entity.GetSpeedY() * 400)); - WriteShort((short) (a_Entity.GetSpeedZ() * 400)); - Flush(); -} - - - - - -void cProtocol125::SendExplosion(double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_EXPLOSION); - WriteDouble (a_BlockX); - WriteDouble (a_BlockY); - WriteDouble (a_BlockZ); - WriteFloat (a_Radius); - WriteInt ((Int32)a_BlocksAffected.size()); - int BlockX = (int)a_BlockX; - int BlockY = (int)a_BlockY; - int BlockZ = (int)a_BlockZ; - for (cVector3iArray::const_iterator itr = a_BlocksAffected.begin(); itr != a_BlocksAffected.end(); ++itr) - { - WriteByte((Byte)(itr->x - BlockX)); - WriteByte((Byte)(itr->y - BlockY)); - WriteByte((Byte)(itr->z - BlockZ)); - } - WriteFloat((float)a_PlayerMotion.x); - WriteFloat((float)a_PlayerMotion.y); - WriteFloat((float)a_PlayerMotion.z); - Flush(); -} - - - - - -void cProtocol125::SendGameMode(eGameMode a_GameMode) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_CHANGE_GAME_STATE); - WriteByte(3); - WriteChar((char)a_GameMode); - Flush(); -} - - - - - -void cProtocol125::SendHandshake(const AString & a_ConnectionHash) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_HANDSHAKE); - WriteString(a_ConnectionHash); - Flush(); -} - - - - - -void cProtocol125::SendHealth(void) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_UPDATE_HEALTH); - cPlayer * Player = m_Client->GetPlayer(); - WriteShort((short)Player->GetHealth()); - WriteShort((short)Player->GetFoodLevel()); - WriteFloat((float)Player->GetFoodSaturationLevel()); - Flush(); -} - - - - - -void cProtocol125::SendInventorySlot(char a_WindowID, short a_SlotNum, const cItem & a_Item) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_INVENTORY_SLOT); - WriteChar (a_WindowID); - WriteShort(a_SlotNum); - WriteItem (a_Item); - Flush(); -} - - - - - -void cProtocol125::SendKeepAlive(int a_PingID) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_KEEP_ALIVE); - WriteInt (a_PingID); - Flush(); -} - - - - - -void cProtocol125::SendLogin(const cPlayer & a_Player, const cWorld & a_World) -{ - UNUSED(a_World); - cCSLock Lock(m_CSPacket); - - WriteByte (PACKET_LOGIN); - WriteInt (a_Player.GetUniqueID()); // EntityID of the player - WriteString(""); // Username, not used - WriteString("default"); // Level type - WriteInt ((int)a_Player.GetGameMode()); - WriteInt ((int)(a_World.GetDimension())); - WriteByte (2); // TODO: Difficulty - WriteByte (0); // Unused - WriteByte (60); // Client list width or something - Flush(); - m_LastSentDimension = a_World.GetDimension(); -} - - - - - -void cProtocol125::SendLoginSuccess(void) -{ - // Not supported in this protocol version -} - - - - - -void cProtocol125::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length) -{ - cCSLock Lock(m_CSPacket); - - WriteByte (PACKET_ITEM_DATA); - WriteShort(E_ITEM_MAP); - WriteShort((short)a_ID); - WriteShort((short)(3 + a_Length)); - - WriteByte(0); - WriteChar((char)a_X); - WriteChar((char)a_Y); - - SendData((const char *)a_Colors, a_Length); - - Flush(); -} - - - - - -void cProtocol125::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decorators) -{ - cCSLock Lock(m_CSPacket); - - WriteByte (PACKET_ITEM_DATA); - WriteShort(E_ITEM_MAP); - WriteShort((short)a_ID); - WriteShort((short)(1 + (3 * a_Decorators.size()))); - - WriteByte(1); - - for (cMapDecoratorList::const_iterator it = a_Decorators.begin(); it != a_Decorators.end(); ++it) - { - WriteByte((Byte)(it->GetType() << 4) | (it->GetRot() & 0xf)); - WriteByte((Byte)it->GetPixelX()); - WriteByte((Byte)it->GetPixelZ()); - } - - Flush(); -} - - - - - - -void cProtocol125::SendMapInfo(int a_ID, unsigned int a_Scale) -{ - // This protocol doesn't support such message - UNUSED(a_ID); - UNUSED(a_Scale); -} - - - - - -void cProtocol125::SendPickupSpawn(const cPickup & a_Pickup) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_PICKUP_SPAWN); - WriteInt (a_Pickup.GetUniqueID()); - const cItem & Item = a_Pickup.GetItem(); - WriteShort (Item.m_ItemType); - WriteChar (Item.m_ItemCount); - WriteShort (Item.m_ItemDamage); - WriteVectorI((Vector3i)(a_Pickup.GetPosition() * 32)); - WriteByte ((char)(a_Pickup.GetSpeedX() * 8)); - WriteByte ((char)(a_Pickup.GetSpeedY() * 8)); - WriteByte ((char)(a_Pickup.GetSpeedZ() * 8)); - Flush(); -} - - - - - -void cProtocol125::SendEntityAnimation(const cEntity & a_Entity, char a_Animation) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_ANIMATION); - WriteInt (a_Entity.GetUniqueID()); - WriteChar(a_Animation); - Flush(); -} - - - - - -void cProtocol125::SendParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount) -{ - // Not supported by this protocol version -} - - - - - -void cProtocol125::SendPaintingSpawn(const cPainting & a_Painting) -{ - // Not implemented in this protocol version - UNUSED(a_Painting); -} - - - - - -void cProtocol125::SendPlayerListItem(const cPlayer & a_Player, bool a_IsOnline) -{ - cCSLock Lock(m_CSPacket); - AString PlayerName(a_Player.GetColor()); - PlayerName.append(a_Player.GetName()); - if (PlayerName.length() > 14) - { - PlayerName.erase(14); - } - PlayerName += cChatColor::White; - - WriteByte ((unsigned char)PACKET_PLAYER_LIST_ITEM); - WriteString(PlayerName); - WriteBool (a_IsOnline); - WriteShort (a_IsOnline ? a_Player.GetClientHandle()->GetPing() : 0); - Flush(); -} - - - - - -void cProtocol125::SendPlayerMaxSpeed(void) -{ - // Not supported by this protocol version -} - - - - - -void cProtocol125::SendPlayerMoveLook(void) -{ - cCSLock Lock(m_CSPacket); - - /* - LOGD("Sending PlayerMoveLook: {%0.2f, %0.2f, %0.2f}, stance %0.2f, OnGround: %d", - m_Player->GetPosX(), m_Player->GetPosY(), m_Player->GetPosZ(), m_Player->GetStance(), m_Player->IsOnGround() ? 1 : 0 - ); - */ - - WriteByte(PACKET_PLAYER_MOVE_LOOK); - cPlayer * Player = m_Client->GetPlayer(); - WriteDouble(Player->GetPosX()); - WriteDouble(Player->GetStance() + 0.03); // Add a small amount so that the player doesn't start inside a block - WriteDouble(Player->GetPosY() + 0.03); // Add a small amount so that the player doesn't start inside a block - WriteDouble(Player->GetPosZ()); - WriteFloat ((float)(Player->GetYaw())); - WriteFloat ((float)(Player->GetPitch())); - WriteBool (Player->IsOnGround()); - Flush(); -} - - - - - -void cProtocol125::SendPlayerPosition(void) -{ - cCSLock Lock(m_CSPacket); - LOGD("Ignore send PlayerPos"); // PlayerPos is a C->S packet only now -} - - - - - -void cProtocol125::SendPlayerSpawn(const cPlayer & a_Player) -{ - const cItem & HeldItem = a_Player.GetEquippedItem(); - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_PLAYER_SPAWN); - WriteInt (a_Player.GetUniqueID()); - WriteString(a_Player.GetName()); - WriteInt ((int)(a_Player.GetPosX() * 32)); - WriteInt ((int)(a_Player.GetPosY() * 32)); - WriteInt ((int)(a_Player.GetPosZ() * 32)); - WriteChar ((char)((a_Player.GetYaw() / 360.f) * 256)); - WriteChar ((char)((a_Player.GetPitch() / 360.f) * 256)); - WriteShort (HeldItem.IsEmpty() ? 0 : HeldItem.m_ItemType); - Flush(); -} - - - - - -void cProtocol125::SendPluginMessage(const AString & a_Channel, const AString & a_Message) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_PLUGIN_MESSAGE); - WriteString(a_Channel); - WriteShort((short)a_Message.size()); - SendData(a_Message.data(), a_Message.size()); - Flush(); -} - - - - - -void cProtocol125::SendRemoveEntityEffect(const cEntity & a_Entity, int a_EffectID) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_REMOVE_ENTITY_EFFECT); - WriteInt (a_Entity.GetUniqueID()); - WriteChar((char)a_EffectID); - Flush(); -} - - - - - -void cProtocol125::SendRespawn(eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) -{ - cCSLock Lock(m_CSPacket); - if ((m_LastSentDimension == a_Dimension) && !a_ShouldIgnoreDimensionChecks) - { - // Must not send a respawn for the world with the same dimension, the client goes cuckoo if we do (unless we are respawning from death) - return; - } - cPlayer * Player = m_Client->GetPlayer(); - WriteByte (PACKET_RESPAWN); - WriteInt ((int)(a_Dimension)); - WriteByte (2); // TODO: Difficulty; 2 = Normal - WriteChar ((char)Player->GetGameMode()); - WriteShort (256); // Current world height - WriteString("default"); - Flush(); - m_LastSentDimension = a_Dimension; -} - - - - - -void cProtocol125::SendExperience(void) -{ - cCSLock Lock(m_CSPacket); - cPlayer * Player = m_Client->GetPlayer(); - WriteByte (PACKET_EXPERIENCE); - WriteFloat (Player->GetXpPercentage()); - WriteShort (Player->GetXpLevel()); - WriteShort (Player->GetCurrentXp()); - Flush(); -} - - - - - -void cProtocol125::SendExperienceOrb(const cExpOrb & a_ExpOrb) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_SPAWN_EXPERIENCE_ORB); - WriteInt(a_ExpOrb.GetUniqueID()); - WriteInt((int) a_ExpOrb.GetPosX()); - WriteInt((int) a_ExpOrb.GetPosY()); - WriteInt((int) a_ExpOrb.GetPosZ()); - WriteShort((short)a_ExpOrb.GetReward()); - Flush(); -} - - - - - -void cProtocol125::SendScoreboardObjective(const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) -{ - // This protocol version doesn't support such message - UNUSED(a_Name); - UNUSED(a_DisplayName); - UNUSED(a_Mode); -} - - - - - -void cProtocol125::SendSoundEffect(const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) -{ - // Not needed in this protocol version -} - - - - - -void cProtocol125::SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) -{ - // Not implemented in this protocol version -} - - - - - -void cProtocol125::SendSpawnFallingBlock(const cFallingBlock & a_FallingBlock) -{ - // This protocol version implements falling blocks using the spawn object / vehicle packet: - SendSpawnObject(a_FallingBlock, 70, a_FallingBlock.GetBlockType(), 0, 0); -} - - - - - -void cProtocol125::SendSpawnMob(const cMonster & a_Mob) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_SPAWN_MOB); - WriteInt (a_Mob.GetUniqueID()); - WriteByte ((Byte)a_Mob.GetMobType()); - WriteVectorI((Vector3i)(a_Mob.GetPosition() * 32)); - WriteByte (0); - WriteByte (0); - WriteByte (0); - - WriteCommonMetadata(a_Mob); - WriteMobMetadata(a_Mob); - WriteByte(0x7f); - - Flush(); -} - - - - - -void cProtocol125::SendSpawnObject(const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) -{ - UNUSED(a_Yaw); - UNUSED(a_Pitch); - - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_SPAWN_OBJECT); - WriteInt (a_Entity.GetUniqueID()); - WriteChar(a_ObjectType); - WriteInt ((int)(a_Entity.GetPosX() * 32)); - WriteInt ((int)(a_Entity.GetPosY() * 32)); - WriteInt ((int)(a_Entity.GetPosZ() * 32)); - WriteByte(a_Pitch); - WriteByte(a_Yaw); - WriteInt (a_ObjectData); - if (a_ObjectData != 0) - { - WriteShort((short)(a_Entity.GetSpeedX() * 400)); - WriteShort((short)(a_Entity.GetSpeedY() * 400)); - WriteShort((short)(a_Entity.GetSpeedZ() * 400)); - } - Flush(); -} - - - - - -void cProtocol125::SendSpawnVehicle(const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_SPAWN_OBJECT); - WriteInt (a_Vehicle.GetUniqueID()); - WriteChar (a_VehicleType); - WriteInt ((int)(a_Vehicle.GetPosX() * 32)); - WriteInt ((int)(a_Vehicle.GetPosY() * 32)); - WriteInt ((int)(a_Vehicle.GetPosZ() * 32)); - WriteByte ((Byte)((a_Vehicle.GetPitch() / 360.f) * 256)); - WriteByte ((Byte)((a_Vehicle.GetYaw() / 360.f) * 256)); - WriteInt (a_VehicleSubType); - if (a_VehicleSubType != 0) - { - WriteShort((short)(a_Vehicle.GetSpeedX() * 400)); - WriteShort((short)(a_Vehicle.GetSpeedY() * 400)); - WriteShort((short)(a_Vehicle.GetSpeedZ() * 400)); - } - Flush(); -} - - - - - -void cProtocol125::SendStatistics(const cStatManager & a_Manager) -{ - /* NOTE: - Versions prior to minecraft 1.7 use an incremental statistic sync - method. The current setup does not allow us to implement that, because - of performance considerations. - */ -#if 0 - for (unsigned int i = 0; i < (unsigned int)statCount; ++i) - { - StatValue Value = m_Manager->GetValue((eStatistic) i); - - unsigned int StatID = cStatInfo::GetID((eStatistic) i); - - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_INCREMENT_STATISTIC); - WriteInt(StatID); - WriteByte(Value); /* Can overflow! */ - Flush(); - } -#endif -} - - - - - -void cProtocol125::SendTabCompletionResults(const AStringVector & a_Results) -{ - // This protocol version doesn't support tab completion - UNUSED(a_Results); -} - - - - - -void cProtocol125::SendTeleportEntity(const cEntity & a_Entity) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_ENT_TELEPORT); - WriteInt (a_Entity.GetUniqueID()); - WriteInt ((int)(floor(a_Entity.GetPosX() * 32))); - WriteInt ((int)(floor(a_Entity.GetPosY() * 32))); - WriteInt ((int)(floor(a_Entity.GetPosZ() * 32))); - WriteChar ((char)((a_Entity.GetYaw() / 360.f) * 256)); - WriteChar ((char)((a_Entity.GetPitch() / 360.f) * 256)); - Flush(); -} - - - - - -void cProtocol125::SendThunderbolt(int a_BlockX, int a_BlockY, int a_BlockZ) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_THUNDERBOLT); - WriteInt (0x7fffffff); // Entity ID of the thunderbolt; we use a constant one - WriteBool(true); // Unknown bool - WriteInt (a_BlockX * 32); - WriteInt (a_BlockY * 32); - WriteInt (a_BlockZ * 32); - Flush(); -} - - - - - -void cProtocol125::SendTimeUpdate(Int64 a_WorldAge, Int64 a_TimeOfDay) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_UPDATE_TIME); - // Use a_WorldAge for daycount, and a_TimeOfDay for the proper time of day: - WriteInt64((24000 * (a_WorldAge / 24000)) + (a_TimeOfDay % 24000)); - Flush(); -} - - - - - -void cProtocol125::SendUnloadChunk(int a_ChunkX, int a_ChunkZ) -{ - cCSLock Lock(m_CSPacket); - SendPreChunk(a_ChunkX, a_ChunkZ, false); -} - - - - - -void cProtocol125::SendUpdateSign( - int a_BlockX, int a_BlockY, int a_BlockZ, - const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4 -) -{ - cCSLock Lock(m_CSPacket); - WriteByte ((unsigned char)PACKET_UPDATE_SIGN); - WriteInt (a_BlockX); - WriteShort ((short)a_BlockY); - WriteInt (a_BlockZ); - WriteString(a_Line1); - WriteString(a_Line2); - WriteString(a_Line3); - WriteString(a_Line4); - Flush(); -} - - - - - -void cProtocol125::SendUseBed(const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_USE_BED); - WriteInt (a_Entity.GetUniqueID()); - WriteByte(0); // Unknown byte only 0 has been observed - WriteInt (a_BlockX); - WriteByte((Byte)a_BlockY); - WriteInt (a_BlockZ); - Flush(); -} - - - - - -void cProtocol125::SendWeather(eWeather a_Weather) -{ - cCSLock Lock(m_CSPacket); - switch (a_Weather) - { - case eWeather_Sunny: - { - WriteByte(PACKET_CHANGE_GAME_STATE); - WriteByte(2); // Stop rain - WriteByte(0); // Unused - Flush(); - break; - } - - case eWeather_Rain: - case eWeather_ThunderStorm: - { - WriteByte(PACKET_CHANGE_GAME_STATE); - WriteByte(1); // Begin rain - WriteByte(0); // Unused - Flush(); - break; - } - } -} - - - - - -void cProtocol125::SendWholeInventory(const cWindow & a_Window) -{ - cCSLock Lock(m_CSPacket); - cItems Slots; - a_Window.GetSlots(*(m_Client->GetPlayer()), Slots); - SendWindowSlots(a_Window.GetWindowID(), (int)Slots.size(), &(Slots[0])); -} - - - - - -void cProtocol125::SendWindowClose(const cWindow & a_Window) -{ - if (a_Window.GetWindowType() == cWindow::wtInventory) - { - // Do not send inventory-window-close - return; - } - - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_WINDOW_CLOSE); - WriteChar(a_Window.GetWindowID()); - Flush(); -} - - - - - -void cProtocol125::SendWindowOpen(const cWindow & a_Window) -{ - if (a_Window.GetWindowType() < 0) - { - // Do not send for inventory windows - return; - } - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_WINDOW_OPEN); - WriteChar (a_Window.GetWindowID()); - WriteByte ((Byte)a_Window.GetWindowType()); - WriteString(a_Window.GetWindowTitle()); - WriteByte ((Byte)a_Window.GetNumNonInventorySlots()); - Flush(); -} - - - - - -void cProtocol125::SendWindowProperty(const cWindow & a_Window, int a_Property, int a_Value) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_WINDOW_PROPERTY); - WriteChar (a_Window.GetWindowID()); - WriteShort(a_Property); - WriteShort(a_Value); - Flush(); -} - - - - - -AString cProtocol125::GetAuthServerID(void) -{ - // http://wiki.vg/wiki/index.php?title=Session&oldid=2262 - // The server generates a random hash and that is used for all clients, unmodified - return cRoot::Get()->GetServer()->GetServerID(); -} - - - - - -void cProtocol125::SendData(const char * a_Data, size_t a_Size) -{ - m_Client->SendData(a_Data, a_Size); -} - - - - - -void cProtocol125::DataReceived(const char * a_Data, size_t a_Size) -{ - if (!m_ReceivedData.Write(a_Data, a_Size)) - { - // Too much data in the incoming queue, report to caller: - m_Client->PacketBufferFull(); - return; - } - - // Parse and handle all complete packets in m_ReceivedData: - while (m_ReceivedData.CanReadBytes(1)) - { - unsigned char PacketType; - m_ReceivedData.ReadByte(PacketType); - switch (ParsePacket(PacketType)) - { - case PARSE_UNKNOWN: - { - // An unknown packet has been received, notify the client and abort: - m_Client->PacketUnknown(PacketType); - return; - } - case PARSE_ERROR: - { - // An error occurred while parsing a known packet, notify the client and abort: - m_Client->PacketError(PacketType); - return; - } - case PARSE_INCOMPLETE: - { - // Incomplete packet, bail out and process with the next batch of data - m_ReceivedData.ResetRead(); - return; - } - default: - { - // Packet successfully parsed, commit the read data and try again one more packet - m_ReceivedData.CommitRead(); - break; - } - } - } -} - - - - - -int cProtocol125::ParsePacket(unsigned char a_PacketType) -{ - switch (a_PacketType) - { - default: return PARSE_UNKNOWN; - case PACKET_ANIMATION: return ParseArmAnim(); - case PACKET_BLOCK_DIG: return ParseBlockDig(); - case PACKET_BLOCK_PLACE: return ParseBlockPlace(); - case PACKET_CHAT: return ParseChat(); - case PACKET_CREATIVE_INVENTORY_ACTION: return ParseCreativeInventoryAction(); - case PACKET_DISCONNECT: return ParseDisconnect(); - case PACKET_HANDSHAKE: return ParseHandshake(); - case PACKET_KEEP_ALIVE: return ParseKeepAlive(); - case PACKET_LOGIN: return ParseLogin(); - case PACKET_PACKET_ENTITY_ACTION: return ParseEntityAction(); - case PACKET_PING: return ParsePing(); - case PACKET_PLAYER_ABILITIES: return ParsePlayerAbilities(); - case PACKET_PLAYER_LOOK: return ParsePlayerLook(); - case PACKET_PLAYER_MOVE_LOOK: return ParsePlayerMoveLook(); - case PACKET_PLAYER_ON_GROUND: return ParsePlayerOnGround(); - case PACKET_PLAYER_POS: return ParsePlayerPosition(); - case PACKET_PLUGIN_MESSAGE: return ParsePluginMessage(); - case PACKET_RESPAWN: return ParseRespawn(); - case PACKET_SLOT_SELECTED: return ParseSlotSelected(); - case PACKET_UPDATE_SIGN: return ParseUpdateSign(); - case PACKET_USE_ENTITY: return ParseUseEntity(); - case PACKET_ENCHANT_ITEM: return ParseEnchantItem(); - case PACKET_WINDOW_CLICK: return ParseWindowClick(); - case PACKET_WINDOW_CLOSE: return ParseWindowClose(); - } -} - - - - - -int cProtocol125::ParseArmAnim(void) -{ - HANDLE_PACKET_READ(ReadBEInt, int, EntityID); - HANDLE_PACKET_READ(ReadChar, char, Animation); - m_Client->HandleAnimation(Animation); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseBlockDig(void) -{ - HANDLE_PACKET_READ(ReadChar, char, Status); - HANDLE_PACKET_READ(ReadBEInt, int, PosX); - HANDLE_PACKET_READ(ReadByte, Byte, PosY); - HANDLE_PACKET_READ(ReadBEInt, int, PosZ); - HANDLE_PACKET_READ(ReadChar, char, BlockFace); - m_Client->HandleLeftClick(PosX, PosY, PosZ, static_cast<eBlockFace>(BlockFace), Status); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseBlockPlace(void) -{ - HANDLE_PACKET_READ(ReadBEInt, int, PosX); - HANDLE_PACKET_READ(ReadByte, Byte, PosY); - HANDLE_PACKET_READ(ReadBEInt, int, PosZ); - HANDLE_PACKET_READ(ReadChar, char, BlockFace); - - cItem HeldItem; - int res = ParseItem(HeldItem); - if (res < 0) - { - return res; - } - - // 1.2.5 didn't have any cursor position, so use 8, 8, 8, so that halfslabs and stairs work correctly and the special value is recognizable. - m_Client->HandleRightClick(PosX, PosY, PosZ, static_cast<eBlockFace>(BlockFace), 8, 8, 8, HeldItem); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseChat(void) -{ - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Message); - m_Client->HandleChat(Message); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseCreativeInventoryAction(void) -{ - HANDLE_PACKET_READ(ReadBEShort, short, SlotNum); - cItem HeldItem; - int res = ParseItem(HeldItem); - if (res < 0) - { - return res; - } - m_Client->HandleCreativeInventory(SlotNum, HeldItem); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseDisconnect(void) -{ - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Reason); - m_Client->HandleDisconnect(Reason); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseEntityAction(void) -{ - HANDLE_PACKET_READ(ReadBEInt, int, EntityID); - HANDLE_PACKET_READ(ReadChar, char, ActionID); - - switch (ActionID) - { - case 1: m_Client->HandleEntityCrouch(EntityID, true); break; // Crouch - case 2: m_Client->HandleEntityCrouch(EntityID, false); break; // Uncrouch - case 3: m_Client->HandleEntityLeaveBed(EntityID); break; // Leave Bed - case 4: m_Client->HandleEntitySprinting(EntityID, true); break; // Start sprinting - case 5: m_Client->HandleEntitySprinting(EntityID, false); break; // Stop sprinting - } - - return PARSE_OK; -} - - - - - -int cProtocol125::ParseHandshake(void) -{ - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Username); - - AStringVector UserData = StringSplit(Username, ";"); // "FakeTruth;localhost:25565" - if (UserData.empty()) - { - m_Client->Kick("Did not receive username"); - return PARSE_OK; - } - m_Username = UserData[0]; - - LOGD("HANDSHAKE %s", Username.c_str()); - - if (!m_Client->HandleHandshake( m_Username)) - { - return PARSE_OK; // Player is not allowed into the server - } - - SendHandshake(cRoot::Get()->GetServer()->GetServerID()); - LOGD("User \"%s\" was sent a handshake response", m_Username.c_str()); - - return PARSE_OK; -} - - - - - -int cProtocol125::ParseKeepAlive(void) -{ - HANDLE_PACKET_READ(ReadBEInt, int, KeepAliveID); - m_Client->HandleKeepAlive(KeepAliveID); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseLogin(void) -{ - HANDLE_PACKET_READ(ReadBEInt, int, ProtocolVersion); - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Username); - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, LevelType); - HANDLE_PACKET_READ(ReadBEInt, int, ServerMode); - HANDLE_PACKET_READ(ReadBEInt, int, Dimension); - HANDLE_PACKET_READ(ReadChar, char, Difficulty); - HANDLE_PACKET_READ(ReadByte, Byte, WorldHeight); - HANDLE_PACKET_READ(ReadByte, Byte, MaxPlayers); - - if (ProtocolVersion < 29) - { - m_Client->Kick("Your client is outdated!"); - return PARSE_OK; - } - else if (ProtocolVersion > 29) - { - m_Client->Kick("Your client version is higher than the server!"); - return PARSE_OK; - } - - if (m_Username.compare(Username) != 0) - { - LOGWARNING("Login Username (\"%s\") does not match Handshake username (\"%s\") for client @ \"%s\", kicking", - Username.c_str(), - m_Username.c_str(), - m_Client->GetIPString().c_str() - ); - m_Client->Kick("Hacked client"); // Don't tell them why we don't want them - return PARSE_OK; - } - - m_Client->HandleLogin(ProtocolVersion, Username); - return PARSE_OK; -} - - - - - -int cProtocol125::ParsePing(void) -{ - // Packet has no more data - m_Client->HandlePing(); - return PARSE_OK; -} - - - - - - -int cProtocol125::ParsePlayerAbilities(void) -{ - HANDLE_PACKET_READ(ReadBool, bool, Invulnerable); - HANDLE_PACKET_READ(ReadBool, bool, IsFlying); - HANDLE_PACKET_READ(ReadBool, bool, CanFly); - HANDLE_PACKET_READ(ReadBool, bool, InstaMine); - // TODO: m_Client->HandlePlayerAbilities(...); - return PARSE_OK; -} - - - - - -int cProtocol125::ParsePlayerLook(void) -{ - HANDLE_PACKET_READ(ReadBEFloat, float, Rotation); - HANDLE_PACKET_READ(ReadBEFloat, float, Pitch); - HANDLE_PACKET_READ(ReadBool, bool, IsOnGround); - m_Client->HandlePlayerLook(Rotation, Pitch, IsOnGround); - return PARSE_OK; -} - - - - - -int cProtocol125::ParsePlayerMoveLook(void) -{ - HANDLE_PACKET_READ(ReadBEDouble, double, PosX); - HANDLE_PACKET_READ(ReadBEDouble, double, PosY); - HANDLE_PACKET_READ(ReadBEDouble, double, Stance); - HANDLE_PACKET_READ(ReadBEDouble, double, PosZ); - HANDLE_PACKET_READ(ReadBEFloat, float, Rotation); - HANDLE_PACKET_READ(ReadBEFloat, float, Pitch); - HANDLE_PACKET_READ(ReadBool, bool, IsOnGround); - // LOGD("Recv PML: {%0.2f, %0.2f, %0.2f}, Stance %0.2f, Gnd: %d", PosX, PosY, PosZ, Stance, IsOnGround ? 1 : 0); - m_Client->HandlePlayerMoveLook(PosX, PosY, PosZ, Stance, Rotation, Pitch, IsOnGround); - return PARSE_OK; -} - - - - - -int cProtocol125::ParsePlayerOnGround(void) -{ - HANDLE_PACKET_READ(ReadBool, bool, IsOnGround); - // TODO: m_Client->HandleFlying(IsOnGround); - return PARSE_OK; -} - - - - - -int cProtocol125::ParsePlayerPosition(void) -{ - HANDLE_PACKET_READ(ReadBEDouble, double, PosX); - HANDLE_PACKET_READ(ReadBEDouble, double, PosY); - HANDLE_PACKET_READ(ReadBEDouble, double, Stance); - HANDLE_PACKET_READ(ReadBEDouble, double, PosZ); - HANDLE_PACKET_READ(ReadBool, bool, IsOnGround); - m_Client->HandlePlayerPos(PosX, PosY, PosZ, Stance, IsOnGround); - return PARSE_OK; -} - - - - - -int cProtocol125::ParsePluginMessage(void) -{ - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, ChannelName); - HANDLE_PACKET_READ(ReadBEShort, short, Length); - AString Data; - if (!m_ReceivedData.ReadString(Data, (size_t)Length)) - { - m_ReceivedData.CheckValid(); - return PARSE_INCOMPLETE; - } - m_ReceivedData.CheckValid(); - - // TODO: Process the data - LOGD("Received %d bytes of plugin data on channel \"%s\".", Length, ChannelName.c_str()); - - return PARSE_OK; -} - - - - - -int cProtocol125::ParseRespawn(void) -{ - HANDLE_PACKET_READ(ReadBEInt, int, Dimension); - HANDLE_PACKET_READ(ReadChar, char, Difficulty); - HANDLE_PACKET_READ(ReadChar, char, CreativeMode); - HANDLE_PACKET_READ(ReadBEShort, short, WorldHeight); - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, LevelType); - m_Client->HandleRespawn(); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseSlotSelected(void) -{ - HANDLE_PACKET_READ(ReadBEShort, short, SlotNum); - m_Client->HandleSlotSelected(SlotNum); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseUpdateSign(void) -{ - HANDLE_PACKET_READ(ReadBEInt, int, BlockX); - HANDLE_PACKET_READ(ReadBEShort, short, BlockY); - HANDLE_PACKET_READ(ReadBEInt, int, BlockZ); - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Line1); - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Line2); - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Line3); - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Line4); - m_Client->HandleUpdateSign(BlockX, BlockY, BlockZ, Line1, Line2, Line3, Line4); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseUseEntity(void) -{ - HANDLE_PACKET_READ(ReadBEInt, int, SourceEntityID); - HANDLE_PACKET_READ(ReadBEInt, int, TargetEntityID); - HANDLE_PACKET_READ(ReadBool, bool, IsLeftClick); - m_Client->HandleUseEntity(TargetEntityID, IsLeftClick); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseEnchantItem(void) -{ - HANDLE_PACKET_READ(ReadByte, Byte, WindowID); - HANDLE_PACKET_READ(ReadByte, Byte, Enchantment); - - m_Client->HandleEnchantItem(WindowID, Enchantment); - - return PARSE_OK; -} - - - - - -int cProtocol125::ParseWindowClick(void) -{ - HANDLE_PACKET_READ(ReadChar, char, WindowID); - HANDLE_PACKET_READ(ReadBEShort, short, SlotNum); - HANDLE_PACKET_READ(ReadBool, bool, IsRightClick); - HANDLE_PACKET_READ(ReadBEShort, short, TransactionID); - HANDLE_PACKET_READ(ReadBool, bool, IsShiftPressed); - cItem HeldItem; - int res = ParseItem(HeldItem); - if (res < 0) - { - return res; - } - - // Convert IsShiftPressed, IsRightClick, SlotNum and HeldItem into eClickAction used in the newer protocols: - eClickAction Action; - if (IsRightClick) - { - if (IsShiftPressed) - { - Action = caShiftRightClick; - } - else - { - if (SlotNum == -999) - { - Action = (HeldItem.IsEmpty()) ? caRightClickOutsideHoldNothing : caRightClickOutside; - } - else - { - Action = caRightClick; - } - } - } - else - { - // IsLeftClick - if (IsShiftPressed) - { - Action = caShiftLeftClick; - } - else - { - if (SlotNum == -999) - { - Action = (HeldItem.IsEmpty()) ? caLeftClickOutsideHoldNothing : caRightClickOutside; - } - else - { - Action = caLeftClick; - } - } - } - m_Client->HandleWindowClick(WindowID, SlotNum, Action, HeldItem); - return PARSE_OK; -} - - - - - -int cProtocol125::ParseWindowClose(void) -{ - HANDLE_PACKET_READ(ReadChar, char, WindowID); - m_Client->HandleWindowClose(WindowID); - return PARSE_OK; -} - - - - - -void cProtocol125::SendPreChunk(int a_ChunkX, int a_ChunkZ, bool a_ShouldLoad) -{ - WriteByte(PACKET_PRE_CHUNK); - WriteInt (a_ChunkX); - WriteInt (a_ChunkZ); - WriteBool(a_ShouldLoad); - Flush(); -} - - - - - -void cProtocol125::SendWindowSlots(char a_WindowID, int a_NumItems, const cItem * a_Items) -{ - WriteByte (PACKET_INVENTORY_WHOLE); - WriteChar (a_WindowID); - WriteShort((short)a_NumItems); - - for (int j = 0; j < a_NumItems; j++) - { - WriteItem(a_Items[j]); - } - Flush(); -} - - - - - -void cProtocol125::WriteItem(const cItem & a_Item) -{ - short ItemType = a_Item.m_ItemType; - ASSERT(ItemType >= -1); // Check validity of packets in debug runtime - if (ItemType <= 0) - { - // Fix, to make sure no invalid values are sent. - ItemType = -1; - } - - WriteShort(ItemType); - if (a_Item.IsEmpty()) - { - return; - } - - WriteChar (a_Item.m_ItemCount); - WriteShort(a_Item.m_ItemDamage); - - if (cItem::IsEnchantable(a_Item.m_ItemType)) - { - // TODO: Implement enchantments - WriteShort(-1); - } -} - - - - - -int cProtocol125::ParseItem(cItem & a_Item) -{ - HANDLE_PACKET_READ(ReadBEShort, short, ItemType); - - if (ItemType <= -1) - { - a_Item.Empty(); - return PARSE_OK; - } - a_Item.m_ItemType = ItemType; - - HANDLE_PACKET_READ(ReadChar, char, ItemCount); - HANDLE_PACKET_READ(ReadBEShort, short, ItemDamage); - a_Item.m_ItemCount = ItemCount; - a_Item.m_ItemDamage = ItemDamage; - if (ItemCount <= 0) - { - a_Item.Empty(); - } - - if (!cItem::IsEnchantable(ItemType)) - { - return PARSE_OK; - } - - HANDLE_PACKET_READ(ReadBEShort, short, EnchantNumBytes); - - if (EnchantNumBytes <= 0) - { - return PARSE_OK; - } - - // TODO: Enchantment not implemented yet! - if (!m_ReceivedData.SkipRead((size_t)EnchantNumBytes)) - { - return PARSE_INCOMPLETE; - } - - return PARSE_OK; -} - - - - - -void cProtocol125::WriteCommonMetadata(const cEntity & a_Entity) -{ - Byte CommonMetadata = 0; - - if (a_Entity.IsOnFire()) - { - CommonMetadata |= 0x1; - } - if (a_Entity.IsCrouched()) - { - CommonMetadata |= 0x2; - } - if (a_Entity.IsRiding()) - { - CommonMetadata |= 0x4; - } - if (a_Entity.IsSprinting()) - { - CommonMetadata |= 0x8; - } - if (a_Entity.IsRclking()) - { - CommonMetadata |= 0x10; - } - if (a_Entity.IsInvisible()) - { - CommonMetadata |= 0x20; - } - - WriteByte(0x0); - WriteByte(CommonMetadata); -} - - - - - -void cProtocol125::WriteEntityMetadata(const cEntity & a_Entity) -{ - if (a_Entity.IsMinecart()) - { - WriteByte(0x51); - // No idea how Mojang makes their carts shakey shakey, so here is a complicated one-liner expression that does something similar - WriteInt( (((a_Entity.GetMaxHealth() / 2) - (a_Entity.GetHealth() - (a_Entity.GetMaxHealth() / 2))) * ((const cMinecart &)a_Entity).LastDamage()) * 4); - WriteByte(0x52); - WriteInt(1); // Shaking direction, doesn't seem to affect anything - WriteByte(0x73); - WriteFloat((float)(((const cMinecart &)a_Entity).LastDamage() + 10)); // Damage taken / shake effect multiplyer - - if (((cMinecart &)a_Entity).GetPayload() == cMinecart::mpFurnace) - { - WriteByte(0x10); - WriteByte(((const cMinecartWithFurnace &)a_Entity).IsFueled() ? 1 : 0); // Fueled? - } - } - else if ((a_Entity.IsProjectile() && ((cProjectileEntity &)a_Entity).GetProjectileKind() == cProjectileEntity::pkArrow)) - { - WriteByte(0x10); - WriteByte(((const cArrowEntity &)a_Entity).IsCritical() ? 1 : 0); // Critical hitting arrow? - } -} - - - - - -void cProtocol125::WriteMobMetadata(const cMonster & a_Mob) -{ - switch (a_Mob.GetMobType()) - { - case cMonster::mtCreeper: - { - WriteByte(0x10); - WriteChar(((const cCreeper &)a_Mob).IsBlowing() ? 1 : -1); // Blowing up? - WriteByte(0x11); - WriteByte(((const cCreeper &)a_Mob).IsCharged() ? 1 : 0); // Lightning-charged? - break; - } - case cMonster::mtBat: - { - WriteByte(0x10); - WriteByte(((const cBat &)a_Mob).IsHanging() ? 1 : 0); // Upside down? - break; - } - case cMonster::mtPig: - { - WriteByte(0x10); - WriteByte(((const cPig &)a_Mob).IsSaddled() ? 1 : 0); // Saddled? - break; - } - case cMonster::mtVillager: - { - WriteByte(0x50); - WriteInt(((const cVillager &)a_Mob).GetVilType()); // What sort of TESTIFICATE? - break; - } - case cMonster::mtZombie: - { - WriteByte(0xC); - WriteByte(((const cZombie &)a_Mob).IsBaby() ? 1 : 0); // Baby zombie? - WriteByte(0xD); - WriteByte(((const cZombie &)a_Mob).IsVillagerZombie() ? 1 : 0); // Converted zombie? - WriteByte(0xE); - WriteByte(((const cZombie &)a_Mob).IsConverting() ? 1 : 0); // Converted-but-converting-back zombllager? - break; - } - case cMonster::mtGhast: - { - WriteByte(0x10); - WriteByte(((const cGhast &)a_Mob).IsCharging()); // About to spit a flameball? - break; - } - case cMonster::mtWolf: - { - Byte WolfStatus = 0; - if (((const cWolf &)a_Mob).IsSitting()) - { - WolfStatus |= 0x1; - } - if (((const cWolf &)a_Mob).IsAngry()) - { - WolfStatus |= 0x2; - } - if (((const cWolf &)a_Mob).IsTame()) - { - WolfStatus |= 0x4; - } - WriteByte(0x10); - WriteByte(WolfStatus); - - WriteByte(0x72); - WriteFloat((float)(a_Mob.GetHealth())); // Tail health-o-meter (only shown when tamed, by the way) - WriteByte(0x13); - WriteByte(((const cWolf &)a_Mob).IsBegging() ? 1 : 0); // Ultra cute mode? - break; - } - case cMonster::mtSheep: - { - // [1](1111) - // [] = Is sheared? () = Color, from 0 to 15 - - WriteByte(0x10); - Byte SheepMetadata = 0; - SheepMetadata = (Byte)((const cSheep &)a_Mob).GetFurColor(); - - if (((const cSheep &)a_Mob).IsSheared()) - { - SheepMetadata |= 0x16; - } - WriteByte(SheepMetadata); - break; - } - case cMonster::mtEnderman: - { - WriteByte(0x10); - WriteByte((Byte)(((const cEnderman &)a_Mob).GetCarriedBlock())); // Block that he stole from your house - WriteByte(0x11); - WriteByte((Byte)(((const cEnderman &)a_Mob).GetCarriedMeta())); // Meta of block that he stole from your house - WriteByte(0x12); - WriteByte(((const cEnderman &)a_Mob).IsScreaming() ? 1 : 0); // Screaming at your face? - break; - } - case cMonster::mtSkeleton: - { - WriteByte(0xD); - WriteByte(((const cSkeleton &)a_Mob).IsWither() ? 1 : 0); // It's a skeleton, but it's not - break; - } - case cMonster::mtWitch: - { - WriteByte(0x15); - WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0); // Aggravated? Doesn't seem to do anything - break; - } - case cMonster::mtWither: - { - WriteByte(0x54); // Int at index 20 - WriteInt((Int32)((const cWither &)a_Mob).GetWitherInvulnerableTicks()); - WriteByte(0x66); // Float at index 6 - WriteFloat((float)(a_Mob.GetHealth())); - break; - } - case cMonster::mtSlime: - case cMonster::mtMagmaCube: - { - WriteByte(0x10); - if (a_Mob.GetMobType() == cMonster::mtSlime) - { - WriteByte((Byte)((const cSlime &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME - } - else - { - WriteByte((Byte)((const cMagmaCube &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME - } - break; - } - case cMonster::mtHorse: - { - int Flags = 0; - if (((const cHorse &)a_Mob).IsTame()) - { - Flags |= 0x2; - } - if (((const cHorse &)a_Mob).IsSaddled()) - { - Flags |= 0x4; - } - if (((const cHorse &)a_Mob).IsChested()) - { - Flags |= 0x8; - } - if (((const cHorse &)a_Mob).IsBaby()) - { - Flags |= 0x10; // IsBred flag, according to wiki.vg - don't think it does anything in multiplayer - } - if (((const cHorse &)a_Mob).IsEating()) - { - Flags |= 0x20; - } - if (((const cHorse &)a_Mob).IsRearing()) - { - Flags |= 0x40; - } - if (((const cHorse &)a_Mob).IsMthOpen()) - { - Flags |= 0x80; - } - WriteByte(0x50); - WriteInt(Flags); - - WriteByte(0x13); - WriteByte((Byte)((const cHorse &)a_Mob).GetHorseType()); // Type of horse (donkey, chestnut, etc.) - - WriteByte(0x54); - int Appearance = 0; - Appearance = ((const cHorse &)a_Mob).GetHorseColor(); // Mask FF - Appearance |= ((const cHorse &)a_Mob).GetHorseStyle() * 256; // Mask FF00, so multiply by 256 - WriteInt(Appearance); - - WriteByte(0x56); - WriteInt(((const cHorse &)a_Mob).GetHorseArmour()); // Horshey armour - break; - } - default: - { - break; - } - } -} - - - - diff --git a/src/Protocol/Protocol125.h b/src/Protocol/Protocol125.h deleted file mode 100644 index 18efeb079..000000000 --- a/src/Protocol/Protocol125.h +++ /dev/null @@ -1,181 +0,0 @@ - -// Protocol125.h - -// Interfaces to the cProtocol125 class representing the release 1.2.5 protocol (#29) - - - - - -#pragma once - -#include "Protocol.h" -#include "../ByteBuffer.h" -#include "../Entities/Painting.h" - - - - - -class cProtocol125 : - public cProtocol -{ - typedef cProtocol super; -public: - cProtocol125(cClientHandle * a_Client); - - /// Called when client sends some data: - virtual void DataReceived(const char * a_Data, size_t a_Size) override; - - /// Sending stuff to clients (alphabetically sorted): - virtual void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle) override; - virtual void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) override; - virtual void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage) override; - virtual void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override; - virtual void SendBlockChanges (int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes) override; - virtual void SendChat (const AString & a_Message) override; - virtual void SendChat (const cCompositeChat & a_Message) override; - virtual void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) override; - virtual void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player) override; - virtual void SendDestroyEntity (const cEntity & a_Entity) override; - virtual void SendDisconnect (const AString & a_Reason) override; - virtual void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ) override; ///< Request the client to open up the sign editor for the sign (1.6+) - virtual void SendEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration) override; - virtual void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) override; - virtual void SendEntityHeadLook (const cEntity & a_Entity) override; - virtual void SendEntityLook (const cEntity & a_Entity) override; - virtual void SendEntityMetadata (const cEntity & a_Entity) override; - virtual void SendEntityProperties (const cEntity & a_Entity) override; - virtual void SendEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; - virtual void SendEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; - virtual void SendEntityStatus (const cEntity & a_Entity, char a_Status) override; - virtual void SendEntityVelocity (const cEntity & a_Entity) override; - virtual void SendExplosion (double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion) override; - virtual void SendGameMode (eGameMode a_GameMode) override; - virtual void SendHealth (void) override; - virtual void SendInventorySlot (char a_WindowID, short a_SlotNum, const cItem & a_Item) override; - virtual void SendKeepAlive (int a_PingID) override; - virtual void SendLogin (const cPlayer & a_Player, const cWorld & a_World) override; - virtual void SendLoginSuccess (void) override; - virtual void SendMapColumn (int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length) override; - virtual void SendMapDecorators (int a_ID, const cMapDecoratorList & a_Decorators) override; - virtual void SendMapInfo (int a_ID, unsigned int a_Scale) override; - virtual void SendParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount) override; - virtual void SendPaintingSpawn (const cPainting & a_Painting) override; - virtual void SendPickupSpawn (const cPickup & a_Pickup) override; - virtual void SendPlayerAbilities (void) override {} // This protocol doesn't support such message - virtual void SendEntityAnimation (const cEntity & a_Entity, char a_Animation) override; - virtual void SendPlayerListItem (const cPlayer & a_Player, bool a_IsOnline) override; - virtual void SendPlayerMaxSpeed (void) override; - virtual void SendPlayerMoveLook (void) override; - virtual void SendPlayerPosition (void) override; - virtual void SendPlayerSpawn (const cPlayer & a_Player) override; - virtual void SendPluginMessage (const AString & a_Channel, const AString & a_Message) override; - virtual void SendRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID) override; - virtual void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) override; - virtual void SendExperience (void) override; - virtual void SendExperienceOrb (const cExpOrb & a_ExpOrb) override; - virtual void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) override; - virtual void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) override {} // This protocol doesn't support such message - virtual void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) override {} // This protocol doesn't support such message - virtual void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) override; - virtual void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) override; - virtual void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock) override; - virtual void SendSpawnMob (const cMonster & a_Mob) override; - virtual void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) override; - virtual void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) override; - virtual void SendStatistics (const cStatManager & a_Manager) override; - virtual void SendTabCompletionResults(const AStringVector & a_Results) override; - virtual void SendTeleportEntity (const cEntity & a_Entity) override; - virtual void SendThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ) override; - virtual void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay) override; - virtual void SendUnloadChunk (int a_ChunkX, int a_ChunkZ) override; - virtual void SendUpdateBlockEntity (cBlockEntity & a_BlockEntity) override {} - virtual void SendUpdateSign (int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4) override; - virtual void SendUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) override; - virtual void SendWeather (eWeather a_Weather) override; - virtual void SendWholeInventory (const cWindow & a_Window) override; - virtual void SendWindowClose (const cWindow & a_Window) override; - virtual void SendWindowOpen (const cWindow & a_Window) override; - virtual void SendWindowProperty (const cWindow & a_Window, int a_Property, int a_Value) override; - - virtual AString GetAuthServerID(void) override; - -protected: - /// Results of packet-parsing: - enum - { - PARSE_OK = 1, - PARSE_ERROR = -1, - PARSE_UNKNOWN = -2, - PARSE_INCOMPLETE = -3, - } ; - - cByteBuffer m_ReceivedData; ///< Buffer for the received data - - AString m_Username; ///< Stored in ParseHandshake(), compared to Login username - - /** The dimension that was last sent to a player in a Respawn or Login packet. - Used to avoid Respawning into the same dimension, which confuses the client. */ - eDimension m_LastSentDimension; - - virtual void SendData(const char * a_Data, size_t a_Size) override; - - /// Sends the Handshake packet - void SendHandshake(const AString & a_ConnectionHash); - - /// Parse the packet of the specified type from m_ReceivedData (switch into ParseXYZ()) - virtual int ParsePacket(unsigned char a_PacketType); - - // Specific packet parsers: - virtual int ParseArmAnim (void); - virtual int ParseBlockDig (void); - virtual int ParseBlockPlace (void); - virtual int ParseChat (void); - virtual int ParseCreativeInventoryAction(void); - virtual int ParseDisconnect (void); - virtual int ParseEntityAction (void); - virtual int ParseHandshake (void); - virtual int ParseKeepAlive (void); - virtual int ParseLogin (void); - virtual int ParsePing (void); - virtual int ParsePlayerAbilities (void); - virtual int ParsePlayerLook (void); - virtual int ParsePlayerMoveLook (void); - virtual int ParsePlayerOnGround (void); - virtual int ParsePlayerPosition (void); - virtual int ParsePluginMessage (void); - virtual int ParseRespawn (void); - virtual int ParseSlotSelected (void); - virtual int ParseUpdateSign (void); - virtual int ParseUseEntity (void); - virtual int ParseEnchantItem (void); - virtual int ParseWindowClick (void); - virtual int ParseWindowClose (void); - - // Utility functions: - /// Writes a "pre-chunk" packet - void SendPreChunk(int a_ChunkX, int a_ChunkZ, bool a_ShouldLoad); - - /// Writes a "set window items" packet with the specified params - void SendWindowSlots(char a_WindowID, int a_NumItems, const cItem * a_Items); - - /// Writes one item, "slot" as the protocol wiki calls it - virtual void WriteItem(const cItem & a_Item); - - /// Parses one item, "slot" as the protocol wiki calls it, from m_ReceivedData; returns the usual ParsePacket() codes - virtual int ParseItem(cItem & a_Item); - - /// Writes the COMMON entity metadata - void WriteCommonMetadata(const cEntity & a_Entity); - - /// Writes normal entity metadata - void WriteEntityMetadata(const cEntity & a_Entity); - - /// Writes mobile entity metadata - void WriteMobMetadata(const cMonster & a_Mob); -} ; - - - - diff --git a/src/Protocol/Protocol132.cpp b/src/Protocol/Protocol132.cpp deleted file mode 100644 index 5c58ab0ba..000000000 --- a/src/Protocol/Protocol132.cpp +++ /dev/null @@ -1,873 +0,0 @@ - -// Protocol132.cpp - -// Implements the cProtocol132 class representing the release 1.3.2 protocol (#39) - -#include "Globals.h" -#include "ChunkDataSerializer.h" -#include "Protocol132.h" -#include "../Root.h" -#include "../Server.h" -#include "../World.h" -#include "../ClientHandle.h" -#include "../Item.h" -#include "../Entities/Player.h" -#include "../Mobs/Monster.h" -#include "../UI/Window.h" -#include "../Entities/Pickup.h" -#include "../WorldStorage/FastNBT.h" -#include "../WorldStorage/EnchantmentSerializer.h" -#include "../StringCompression.h" -#include "PolarSSL++/Sha1Checksum.h" - - - - - -#define HANDLE_PACKET_READ(Proc, Type, Var) \ - Type Var; \ - { \ - if (!m_ReceivedData.Proc(Var)) \ - { \ - m_ReceivedData.CheckValid(); \ - return PARSE_INCOMPLETE; \ - } \ - m_ReceivedData.CheckValid(); \ - } - - - - - -const int MAX_ENC_LEN = 512; // Maximum size of the encrypted message; should be 128, but who knows... - - - - - -enum -{ - PACKET_KEEP_ALIVE = 0x00, - PACKET_LOGIN = 0x01, - PACKET_ENTITY_EQUIPMENT = 0x05, - PACKET_COMPASS = 0x06, - PACKET_PLAYER_SPAWN = 0x14, - PACKET_COLLECT_PICKUP = 0x16, - PACKET_SPAWN_MOB = 0x18, - PACKET_DESTROY_ENTITIES = 0x1d, - PACKET_CHUNK_DATA = 0x33, - PACKET_BLOCK_CHANGE = 0x35, - PACKET_BLOCK_ACTION = 0x36, - PACKET_BLOCK_BREAK_ANIM = 0x37, - PACKET_SOUND_EFFECT = 0x3e, - PACKET_SOUND_PARTICLE_EFFECT = 0x3d, - PACKET_TAB_COMPLETION = 0xcb, - PACKET_LOCALE_VIEW_DISTANCE = 0xcc, - PACKET_CLIENT_STATUSES = 0xcd, - PACKET_ENCRYPTION_KEY_RESP = 0xfc, -} ; - - - - - -//////////////////////////////////////////////////////////////////////////////// -// cProtocol132: - -cProtocol132::cProtocol132(cClientHandle * a_Client) : - super(a_Client), - m_IsEncrypted(false) -{ -} - - - - - -cProtocol132::~cProtocol132() -{ - if (!m_DataToSend.empty()) - { - LOGD("There are " SIZE_T_FMT " unsent bytes while deleting cProtocol132", m_DataToSend.size()); - } -} - - - - - -void cProtocol132::DataReceived(const char * a_Data, size_t a_Size) -{ - if (m_IsEncrypted) - { - Byte Decrypted[512]; - while (a_Size > 0) - { - size_t NumBytes = (a_Size > sizeof(Decrypted)) ? sizeof(Decrypted) : a_Size; - m_Decryptor.ProcessData(Decrypted, (Byte *)a_Data, NumBytes); - super::DataReceived((const char *)Decrypted, NumBytes); - a_Size -= NumBytes; - a_Data += NumBytes; - } - } - else - { - super::DataReceived(a_Data, a_Size); - } -} - - - - - -void cProtocol132::SendBlockAction(int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_BLOCK_ACTION); - WriteInt (a_BlockX); - WriteShort((short)a_BlockY); - WriteInt (a_BlockZ); - WriteChar (a_Byte1); - WriteChar (a_Byte2); - WriteShort(a_BlockType); - Flush(); -} - - - - - -void cProtocol132::SendBlockBreakAnim(int a_entityID, int a_BlockX, int a_BlockY, int a_BlockZ, char stage) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_BLOCK_BREAK_ANIM); - WriteInt (a_entityID); - WriteInt (a_BlockX); - WriteInt (a_BlockY); - WriteInt (a_BlockZ); - WriteChar (stage); - Flush(); -} - - - - - -void cProtocol132::SendBlockChange(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_BLOCK_CHANGE); - WriteInt (a_BlockX); - WriteByte ((unsigned char)a_BlockY); - WriteInt (a_BlockZ); - WriteShort(a_BlockType); - WriteByte (a_BlockMeta); - Flush(); -} - - - - - -void cProtocol132::SendChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) -{ - cCSLock Lock(m_CSPacket); - - // Pre-chunk not used in 1.3.2. Finally. - - // Send the chunk data: - AString Serialized = a_Serializer.Serialize(cChunkDataSerializer::RELEASE_1_3_2); - WriteByte(PACKET_CHUNK_DATA); - WriteInt (a_ChunkX); - WriteInt (a_ChunkZ); - SendData(Serialized.data(), Serialized.size()); - Flush(); -} - - - - - -void cProtocol132::SendCollectEntity(const cEntity & a_Entity, const cPlayer & a_Player) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_COLLECT_PICKUP); - WriteInt (a_Entity.GetUniqueID()); - WriteInt (a_Player.GetUniqueID()); - Flush(); -} - - - - - -void cProtocol132::SendDestroyEntity(const cEntity & a_Entity) -{ - if (a_Entity.GetUniqueID() == m_Client->GetPlayer()->GetUniqueID()) - { - // Do not send "destroy self" to the client, the client would crash (FS #254) - return; - } - - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_DESTROY_ENTITIES); - WriteByte(1); // entity count - WriteInt (a_Entity.GetUniqueID()); - Flush(); -} - - - - - -void cProtocol132::SendEntityEquipment(const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_ENTITY_EQUIPMENT); - WriteInt (a_Entity.GetUniqueID()); - WriteShort(a_SlotNum); - WriteItem (a_Item); - Flush(); -} - - - - - -void cProtocol132::SendLogin(const cPlayer & a_Player, const cWorld & a_World) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_LOGIN); - WriteInt (a_Player.GetUniqueID()); // EntityID of the player - WriteString("default"); // Level type - WriteByte ((Byte)a_Player.GetGameMode()); - WriteByte ((Byte)(a_World.GetDimension())); - WriteByte (2); // TODO: Difficulty - WriteByte (0); // Unused, used to be world height - WriteByte (8); // Client list width or something - Flush(); - m_LastSentDimension = a_World.GetDimension(); - SendCompass(a_World); -} - - - - - -void cProtocol132::SendPlayerSpawn(const cPlayer & a_Player) -{ - const cItem & HeldItem = a_Player.GetEquippedItem(); - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_PLAYER_SPAWN); - WriteInt (a_Player.GetUniqueID()); - WriteString(a_Player.GetName()); - WriteInt ((int)(a_Player.GetPosX() * 32)); - WriteInt ((int)(a_Player.GetPosY() * 32)); - WriteInt ((int)(a_Player.GetPosZ() * 32)); - WriteChar ((char)((a_Player.GetYaw() / 360.f) * 256)); - WriteChar ((char)((a_Player.GetPitch() / 360.f) * 256)); - WriteShort (HeldItem.IsEmpty() ? 0 : HeldItem.m_ItemType); - // Player metadata: just use a default metadata value, since the client doesn't like starting without any metadata: - WriteByte (0); // Index 0, byte (flags) - WriteByte (0); // Flags, empty - WriteByte (0x7f); // End of metadata - Flush(); -} - - - - - -void cProtocol132::SendSoundEffect(const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_SOUND_EFFECT); - WriteString (a_SoundName); - WriteInt ((int)(a_X * 8.0)); - WriteInt ((int)(a_Y * 8.0)); - WriteInt ((int)(a_Z * 8.0)); - WriteFloat (a_Volume); - WriteChar ((char)(a_Pitch * 63.0f)); - Flush(); -} - - - - - -void cProtocol132::SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_SOUND_PARTICLE_EFFECT); - WriteInt (a_EffectID); - WriteInt (a_SrcX); - WriteByte((Byte)a_SrcY); - WriteInt (a_SrcZ); - WriteInt (a_Data); - Flush(); -} - - - - - -void cProtocol132::SendSpawnMob(const cMonster & a_Mob) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_SPAWN_MOB); - WriteInt (a_Mob.GetUniqueID()); - WriteByte ((Byte)a_Mob.GetMobType()); - WriteVectorI((Vector3i)(a_Mob.GetPosition() * 32)); - WriteByte ((Byte)((a_Mob.GetYaw() / 360.f) * 256)); - WriteByte ((Byte)((a_Mob.GetPitch() / 360.f) * 256)); - WriteByte ((Byte)((a_Mob.GetHeadYaw() / 360.f) * 256)); - WriteShort ((short)(a_Mob.GetSpeedX() * 400)); - WriteShort ((short)(a_Mob.GetSpeedY() * 400)); - WriteShort ((short)(a_Mob.GetSpeedZ() * 400)); - - WriteCommonMetadata(a_Mob); - WriteMobMetadata(a_Mob); - WriteByte(0x7f); - - Flush(); -} - - - - - -void cProtocol132::SendTabCompletionResults(const AStringVector & a_Results) -{ - if (a_Results.empty()) - { - // No results to send - return; - } - - AString Serialized(a_Results[0]); - for (AStringVector::const_iterator itr = a_Results.begin() + 1, end = a_Results.end(); itr != end; ++itr) - { - Serialized.push_back(0); - Serialized.append(*itr); - } // for itr - a_Results[] - - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_TAB_COMPLETION); - WriteString(Serialized); - Flush(); -} - - - - - -void cProtocol132::SendUnloadChunk(int a_ChunkX, int a_ChunkZ) -{ - // Unloading the chunk is done by sending a "map chunk" packet - // with IncludeInitialize set to true and primary bitmap set to 0: - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_CHUNK_DATA); - WriteInt (a_ChunkX); - WriteInt (a_ChunkZ); - WriteBool(true); // IncludeInitialize - WriteShort(0); // Primary bitmap - WriteShort(0); // Add bitmap - WriteInt(0); - Flush(); -} - - - - - -void cProtocol132::SendWholeInventory(const cWindow & a_Window) -{ - // 1.3.2 requires player inventory slots to be sent as SetSlot packets, - // otherwise it sometimes fails to update the window - - // Send the entire window: - super::SendWholeInventory(a_Window); - - // Send the player inventory and hotbar: - cPlayer * Player = m_Client->GetPlayer(); - const cInventory & Inventory = Player->GetInventory(); - int BaseOffset = a_Window.GetNumSlots() - (cInventory::invNumSlots - cInventory::invInventoryOffset); // Number of non-inventory slots - char WindowID = a_Window.GetWindowID(); - for (short i = 0; i < cInventory::invInventoryCount; i++) - { - SendInventorySlot(WindowID, BaseOffset + i, Inventory.GetInventorySlot(i)); - } // for i - Inventory[] - BaseOffset += cInventory::invInventoryCount; - for (short i = 0; i < cInventory::invHotbarCount; i++) - { - SendInventorySlot(WindowID, BaseOffset + i, Inventory.GetHotbarSlot(i)); - } // for i - Hotbar[] - - // Send even the item being dragged: - SendInventorySlot(-1, -1, Player->GetDraggingItem()); -} - - - - - -AString cProtocol132::GetAuthServerID(void) -{ - // http://wiki.vg/wiki/index.php?title=Session&oldid=2615 - // Server uses SHA1 to mix ServerID, Client secret and server public key together - // The mixing is done in StartEncryption, the result is in m_AuthServerID - - return m_AuthServerID; -} - - - - - -int cProtocol132::ParsePacket(unsigned char a_PacketType) -{ - switch (a_PacketType) - { - default: return super::ParsePacket(a_PacketType); // off-load previously known packets into cProtocol125 - case PACKET_CLIENT_STATUSES: return ParseClientStatuses(); - case PACKET_ENCRYPTION_KEY_RESP: return ParseEncryptionKeyResponse(); - case PACKET_LOCALE_VIEW_DISTANCE: return ParseLocaleViewDistance(); - case PACKET_TAB_COMPLETION: return ParseTabCompletion(); - } -} - - - - - -int cProtocol132::ParseBlockPlace(void) -{ - HANDLE_PACKET_READ(ReadBEInt, int, PosX); - HANDLE_PACKET_READ(ReadByte, Byte, PosY); - HANDLE_PACKET_READ(ReadBEInt, int, PosZ); - HANDLE_PACKET_READ(ReadChar, char, BlockFace); - - cItem HeldItem; - int res = ParseItem(HeldItem); - if (res < 0) - { - return res; - } - - HANDLE_PACKET_READ(ReadChar, char, CursorX); - HANDLE_PACKET_READ(ReadChar, char, CursorY); - HANDLE_PACKET_READ(ReadChar, char, CursorZ); - - m_Client->HandleRightClick(PosX, PosY, PosZ, static_cast<eBlockFace>(BlockFace), CursorX, CursorY, CursorZ, HeldItem); - return PARSE_OK; -} - - - - - -int cProtocol132::ParseHandshake(void) -{ - HANDLE_PACKET_READ(ReadByte, Byte, ProtocolVersion); - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Username); - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, ServerHost); - HANDLE_PACKET_READ(ReadBEInt, int, ServerPort); - m_Username = Username; - - if (!m_Client->HandleHandshake( m_Username)) - { - return PARSE_OK; // Player is not allowed into the server - } - - // Send a 0xfd Encryption Key Request http://wiki.vg/Protocol#0xFD - SendEncryptionKeyRequest(); - - return PARSE_OK; -} - - - - - -int cProtocol132::ParseClientStatuses(void) -{ - HANDLE_PACKET_READ(ReadByte, Byte, Status); - if ((Status & 1) == 0) - { - m_Client->HandleLogin(39, m_Username); - } - else - { - m_Client->HandleRespawn(); - } - return PARSE_OK; -} - - - - - -int cProtocol132::ParseEncryptionKeyResponse(void) -{ - // Read the encryption key: - HANDLE_PACKET_READ(ReadBEShort, short, EncKeyLength); - if (EncKeyLength > MAX_ENC_LEN) - { - LOGD("Too long encryption key"); - m_Client->Kick("Hacked client"); - return PARSE_OK; - } - AString EncKey; - if (!m_ReceivedData.ReadString(EncKey, (size_t)EncKeyLength)) - { - return PARSE_INCOMPLETE; - } - - // Read the encryption nonce: - HANDLE_PACKET_READ(ReadBEShort, short, EncNonceLength); - AString EncNonce; - if (!m_ReceivedData.ReadString(EncNonce, (size_t)EncNonceLength)) - { - return PARSE_INCOMPLETE; - } - if (EncNonceLength > MAX_ENC_LEN) - { - LOGD("Too long encryption nonce"); - m_Client->Kick("Hacked client"); - return PARSE_OK; - } - - HandleEncryptionKeyResponse(EncKey, EncNonce); - return PARSE_OK; -} - - - - - -int cProtocol132::ParseLocaleViewDistance(void) -{ - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Locale); - HANDLE_PACKET_READ(ReadChar, char, ViewDistance); - HANDLE_PACKET_READ(ReadChar, char, ChatFlags); - HANDLE_PACKET_READ(ReadChar, char, ClientDifficulty); - m_Client->SetLocale(Locale); - // TODO: m_Client->HandleViewDistance(ViewDistance); - // TODO: m_Client->HandleChatFlags(ChatFlags); - // Ignoring client difficulty - return PARSE_OK; -} - - - - - -int cProtocol132::ParseLogin(void) -{ - // Login packet not used in 1.3.2 - return PARSE_ERROR; -} - - - - - -int cProtocol132::ParsePlayerAbilities(void) -{ - HANDLE_PACKET_READ(ReadBool, bool, Flags); - HANDLE_PACKET_READ(ReadChar, char, FlyingSpeed); - HANDLE_PACKET_READ(ReadChar, char, WalkingSpeed); - // TODO: m_Client->HandlePlayerAbilities(...); - return PARSE_OK; -} - - - - - -int cProtocol132::ParseTabCompletion(void) -{ - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Text); - m_Client->HandleTabCompletion(Text); - return PARSE_OK; -} - - - - - -void cProtocol132::SendData(const char * a_Data, size_t a_Size) -{ - m_DataToSend.append(a_Data, a_Size); -} - - - - - -void cProtocol132::Flush(void) -{ - ASSERT(m_CSPacket.IsLockedByCurrentThread()); // Did all packets lock the CS properly? - - if (m_DataToSend.empty()) - { - LOGD("Flushing empty"); - return; - } - const char * Data = m_DataToSend.data(); - size_t Size = m_DataToSend.size(); - if (m_IsEncrypted) - { - Byte Encrypted[8192]; // Larger buffer, we may be sending lots of data (chunks) - while (Size > 0) - { - size_t NumBytes = (Size > sizeof(Encrypted)) ? sizeof(Encrypted) : Size; - m_Encryptor.ProcessData(Encrypted, (Byte *)Data, NumBytes); - super::SendData((const char *)Encrypted, NumBytes); - Size -= NumBytes; - Data += NumBytes; - } - } - else - { - super::SendData(Data, Size); - } - m_DataToSend.clear(); -} - - - - - -void cProtocol132::WriteItem(const cItem & a_Item) -{ - short ItemType = a_Item.m_ItemType; - ASSERT(ItemType >= -1); // Check validity of packets in debug runtime - if (ItemType <= 0) - { - // Fix, to make sure no invalid values are sent. - ItemType = -1; - } - - if (a_Item.IsEmpty()) - { - WriteShort(-1); - return; - } - - WriteShort(ItemType); - WriteChar (a_Item.m_ItemCount); - WriteShort(a_Item.m_ItemDamage); - - if (a_Item.m_Enchantments.IsEmpty()) - { - WriteShort(-1); - return; - } - - // Send the enchantments: - cFastNBTWriter Writer; - const char * TagName = (a_Item.m_ItemType == E_ITEM_BOOK) ? "StoredEnchantments" : "ench"; - EnchantmentSerializer::WriteToNBTCompound(a_Item.m_Enchantments, Writer, TagName); - Writer.Finish(); - AString Compressed; - CompressStringGZIP(Writer.GetResult().data(), Writer.GetResult().size(), Compressed); - WriteShort((short)Compressed.size()); - SendData(Compressed.data(), Compressed.size()); -} - - - - - -int cProtocol132::ParseItem(cItem & a_Item) -{ - HANDLE_PACKET_READ(ReadBEShort, short, ItemType); - - if (ItemType <= -1) - { - a_Item.Empty(); - return PARSE_OK; - } - a_Item.m_ItemType = ItemType; - - HANDLE_PACKET_READ(ReadChar, char, ItemCount); - HANDLE_PACKET_READ(ReadBEShort, short, ItemDamage); - a_Item.m_ItemCount = ItemCount; - a_Item.m_ItemDamage = ItemDamage; - if (ItemCount <= 0) - { - a_Item.Empty(); - } - - HANDLE_PACKET_READ(ReadBEShort, short, MetadataLength); - if (MetadataLength <= 0) - { - return PARSE_OK; - } - - // Read the metadata - AString Metadata; - Metadata.resize((size_t)MetadataLength); - if (!m_ReceivedData.ReadBuf((void *)Metadata.data(), (size_t)MetadataLength)) - { - return PARSE_INCOMPLETE; - } - - return ParseItemMetadata(a_Item, Metadata); -} - - - - - -int cProtocol132::ParseItemMetadata(cItem & a_Item, const AString & a_Metadata) -{ - // Uncompress the GZIPped data: - AString Uncompressed; - if (UncompressStringGZIP(a_Metadata.data(), a_Metadata.size(), Uncompressed) != Z_OK) - { - AString HexDump; - CreateHexDump(HexDump, a_Metadata.data(), a_Metadata.size(), 16); - LOG("Cannot unGZIP item metadata:\n%s", HexDump.c_str()); - return PARSE_ERROR; - } - - // Parse into NBT: - cParsedNBT NBT(Uncompressed.data(), Uncompressed.size()); - if (!NBT.IsValid()) - { - AString HexDump; - CreateHexDump(HexDump, Uncompressed.data(), Uncompressed.size(), 16); - LOG("Cannot parse NBT item metadata:\n%s", HexDump.c_str()); - return PARSE_ERROR; - } - - // Load enchantments from the NBT: - for (int tag = NBT.GetFirstChild(NBT.GetRoot()); tag >= 0; tag = NBT.GetNextSibling(tag)) - { - if ( - (NBT.GetType(tag) == TAG_List) && - ( - (NBT.GetName(tag) == "ench") || - (NBT.GetName(tag) == "StoredEnchantments") - ) - ) - { - EnchantmentSerializer::ParseFromNBT(a_Item.m_Enchantments, NBT, tag); - } - } - - return PARSE_OK; -} - - - - - -void cProtocol132::SendCompass(const cWorld & a_World) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_COMPASS); - WriteInt((int)(a_World.GetSpawnX())); - WriteInt((int)(a_World.GetSpawnY())); - WriteInt((int)(a_World.GetSpawnZ())); - Flush(); -} - - - - - -void cProtocol132::SendEncryptionKeyRequest(void) -{ - cCSLock Lock(m_CSPacket); - cServer * Server = cRoot::Get()->GetServer(); - WriteByte(0xfd); - WriteString(Server->GetServerID()); - const AString & PublicKeyDER = Server->GetPublicKeyDER(); - WriteShort((short)(PublicKeyDER.size())); - SendData(PublicKeyDER.data(), PublicKeyDER.size()); - WriteShort(4); - WriteInt((int)(intptr_t)this); // Using 'this' as the cryptographic nonce, so that we don't have to generate one each time :) - Flush(); -} - - - - - -void cProtocol132::HandleEncryptionKeyResponse(const AString & a_EncKey, const AString & a_EncNonce) -{ - // Decrypt EncNonce using privkey - cRsaPrivateKey & rsaDecryptor = cRoot::Get()->GetServer()->GetPrivateKey(); - - Int32 DecryptedNonce[MAX_ENC_LEN / sizeof(Int32)]; - int res = rsaDecryptor.Decrypt((const Byte *)a_EncNonce.data(), a_EncNonce.size(), (Byte *)DecryptedNonce, sizeof(DecryptedNonce)); - if (res != 4) - { - LOGD("Bad nonce length"); - m_Client->Kick("Hacked client"); - return; - } - if (ntohl(DecryptedNonce[0]) != (unsigned)(uintptr_t)this) - { - LOGD("Bad nonce value"); - m_Client->Kick("Hacked client"); - return; - } - - // Decrypt the symmetric encryption key using privkey: - Byte DecryptedKey[MAX_ENC_LEN]; - res = rsaDecryptor.Decrypt((const Byte *)a_EncKey.data(), a_EncKey.size(), DecryptedKey, sizeof(DecryptedKey)); - if (res != 16) - { - LOGD("Bad key length"); - m_Client->Kick("Hacked client"); - return; - } - - { - // Send encryption key response: - cCSLock Lock(m_CSPacket); - WriteByte(0xfc); - WriteShort(0); - WriteShort(0); - Flush(); - } - - #ifdef _DEBUG - AString DecryptedKeyHex; - CreateHexDump(DecryptedKeyHex, DecryptedKey, res, 16); - LOGD("Received encryption key, %d bytes:\n%s", res, DecryptedKeyHex.c_str()); - #endif - - StartEncryption(DecryptedKey); - return; -} - - - - - -void cProtocol132::StartEncryption(const Byte * a_Key) -{ - m_Encryptor.Init(a_Key, a_Key); - m_Decryptor.Init(a_Key, a_Key); - m_IsEncrypted = true; - - // Prepare the m_AuthServerID: - cSha1Checksum Checksum; - cServer * Server = cRoot::Get()->GetServer(); - AString ServerID = Server->GetServerID(); - Checksum.Update((const Byte *)ServerID.c_str(), ServerID.length()); - Checksum.Update(a_Key, 16); - Checksum.Update((const Byte *)Server->GetPublicKeyDER().data(), Server->GetPublicKeyDER().size()); - Byte Digest[20]; - Checksum.Finalize(Digest); - cSha1Checksum::DigestToJava(Digest, m_AuthServerID); -} - - - - diff --git a/src/Protocol/Protocol132.h b/src/Protocol/Protocol132.h deleted file mode 100644 index 1124a7253..000000000 --- a/src/Protocol/Protocol132.h +++ /dev/null @@ -1,115 +0,0 @@ - -// Protocol132.h - -// Interfaces to the cProtocol132 class representing the release 1.3.2 protocol (#39) - - - - - -#pragma once - -#include "Protocol125.h" - -#ifdef _MSC_VER - #pragma warning(push) - #pragma warning(disable:4127) - #pragma warning(disable:4189) - #pragma warning(disable:4231) - #pragma warning(disable:4244) - #pragma warning(disable:4702) -#endif - -#ifdef _MSC_VER - #pragma warning(pop) -#endif - -#include "PolarSSL++/AesCfb128Decryptor.h" -#include "PolarSSL++/AesCfb128Encryptor.h" - - - - - -class cProtocol132 : - public cProtocol125 -{ - typedef cProtocol125 super; -public: - - cProtocol132(cClientHandle * a_Client); - virtual ~cProtocol132(); - - /// Called when client sends some data: - virtual void DataReceived(const char * a_Data, size_t a_Size) override; - - // Sending commands (alphabetically sorted): - virtual void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) override; - virtual void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage) override; - virtual void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override; - virtual void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) override; - virtual void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player) override; - virtual void SendDestroyEntity (const cEntity & a_Entity) override; - virtual void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) override; - virtual void SendLogin (const cPlayer & a_Player, const cWorld & a_World) override; - virtual void SendPlayerSpawn (const cPlayer & a_Player) override; - virtual void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) override; - virtual void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) override; - virtual void SendSpawnMob (const cMonster & a_Mob) override; - virtual void SendTabCompletionResults(const AStringVector & a_Results) override; - virtual void SendUnloadChunk (int a_ChunkX, int a_ChunkZ) override; - virtual void SendWholeInventory (const cWindow & a_Window) override; - - virtual AString GetAuthServerID(void) override; - - /// Handling of the additional packets: - virtual int ParsePacket(unsigned char a_PacketType) override; - - // Modified packets: - virtual int ParseBlockPlace (void) override; - virtual int ParseHandshake (void) override; - virtual int ParseLogin (void) override; - virtual int ParsePlayerAbilities(void) override; - - // New packets: - virtual int ParseClientStatuses (void); - virtual int ParseEncryptionKeyResponse(void); - virtual int ParseLocaleViewDistance (void); - virtual int ParseTabCompletion (void); - -protected: - bool m_IsEncrypted; - - cAesCfb128Decryptor m_Decryptor; - cAesCfb128Encryptor m_Encryptor; - - AString m_DataToSend; - - /// The ServerID used for session authentication; set in StartEncryption(), used in GetAuthServerID() - AString m_AuthServerID; - - virtual void SendData(const char * a_Data, size_t a_Size) override; - - // DEBUG: - virtual void Flush(void) override; - - // Items in slots are sent differently - virtual void WriteItem(const cItem & a_Item) override; - virtual int ParseItem(cItem & a_Item) override; - - /// Parses the metadata that may come with the item. - int ParseItemMetadata(cItem & a_Item, const AString & a_Metadata); - - virtual void SendCompass(const cWorld & a_World); - virtual void SendEncryptionKeyRequest(void); - - /// Decrypts the key and nonce, checks nonce, starts the symmetric encryption - void HandleEncryptionKeyResponse(const AString & a_EncKey, const AString & a_EncNonce); - - /// Starts the symmetric encryption with the specified key; also sets m_AuthServerID - void StartEncryption(const Byte * a_Key); -} ; - - - - diff --git a/src/Protocol/Protocol14x.cpp b/src/Protocol/Protocol14x.cpp deleted file mode 100644 index 8b177ea48..000000000 --- a/src/Protocol/Protocol14x.cpp +++ /dev/null @@ -1,265 +0,0 @@ - -// Protocol14x.cpp - -/* -Implements the 1.4.x protocol classes representing these protocols: -- cProtocol142: - - release 1.4.2 protocol (#47) - - release 1.4.4 protocol (#49) - the same protocol class is used, because the only difference is in a packet that MCServer doesn't implement yet (ITEM_DATA) - - release 1.4.5 protocol (same as 1.4.4) -- cProtocol146: - - release 1.4.6 protocol (#51) -*/ - -#include "Globals.h" -#include "Protocol14x.h" -#include "../Root.h" -#include "../Server.h" -#include "../ClientHandle.h" -#include "../Item.h" -#include "ChunkDataSerializer.h" -#include "../Entities/Player.h" -#include "../Mobs/Monster.h" -#include "../UI/Window.h" -#include "../Entities/Pickup.h" -#include "../Entities/FallingBlock.h" - -#ifdef _MSC_VER - #pragma warning(push) - #pragma warning(disable:4127) - #pragma warning(disable:4244) - #pragma warning(disable:4231) - #pragma warning(disable:4189) - #pragma warning(disable:4702) -#endif - -#ifdef _MSC_VER - #pragma warning(pop) -#endif - - -#define HANDLE_PACKET_READ(Proc, Type, Var) \ - Type Var; \ - { \ - if (!m_ReceivedData.Proc(Var)) \ - { \ - m_ReceivedData.CheckValid(); \ - return PARSE_INCOMPLETE; \ - } \ - m_ReceivedData.CheckValid(); \ - } - - - - - -enum -{ - PACKET_UPDATE_TIME = 0x04, - PACKET_PICKUP_SPAWN = 0x15, - PACKET_SPAWN_OBJECT = 0x17, - PACKET_ENTITY_METADATA = 0x28, - PACKET_SOUND_PARTICLE_EFFECT = 0x3d -} ; - - - - - -//////////////////////////////////////////////////////////////////////////////// -// cProtocol142: - -cProtocol142::cProtocol142(cClientHandle * a_Client) : - super(a_Client) -{ -} - - - - - -int cProtocol142::ParseLocaleViewDistance(void) -{ - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, Locale); - HANDLE_PACKET_READ(ReadChar, char, ViewDistance); - HANDLE_PACKET_READ(ReadChar, char, ChatFlags); - HANDLE_PACKET_READ(ReadChar, char, ClientDifficulty); - HANDLE_PACKET_READ(ReadChar, char, ShouldShowCape); // <-- new in 1.4.2 - m_Client->SetLocale(Locale); - // TODO: m_Client->HandleViewDistance(ViewDistance); - // TODO: m_Client->HandleChatFlags(ChatFlags); - // Ignoring client difficulty - return PARSE_OK; -} - - - - - -void cProtocol142::SendPickupSpawn(const cPickup & a_Pickup) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_PICKUP_SPAWN); - WriteInt (a_Pickup.GetUniqueID()); - WriteItem (a_Pickup.GetItem()); - WriteVectorI((Vector3i)(a_Pickup.GetPosition() * 32)); - WriteChar((char)(a_Pickup.GetSpeedX() * 8)); - WriteChar((char)(a_Pickup.GetSpeedY() * 8)); - WriteChar((char)(a_Pickup.GetSpeedZ() * 8)); - Flush(); -} - - - - - -void cProtocol142::SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_SOUND_PARTICLE_EFFECT); - WriteInt (a_EffectID); - WriteInt (a_SrcX); - WriteByte((Byte)a_SrcY); - WriteInt (a_SrcZ); - WriteInt (a_Data); - WriteBool(0); - Flush(); -} - - - - - -void cProtocol142::SendTimeUpdate(Int64 a_WorldAge, Int64 a_TimeOfDay) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_UPDATE_TIME); - WriteInt64(a_WorldAge); - WriteInt64(a_TimeOfDay); - Flush(); -} - - - - - - -//////////////////////////////////////////////////////////////////////////////// -// cProtocol146: - -cProtocol146::cProtocol146(cClientHandle * a_Client) : - super(a_Client) -{ -} - - - - - -void cProtocol146::SendPickupSpawn(const cPickup & a_Pickup) -{ - ASSERT(!a_Pickup.GetItem().IsEmpty()); - - cCSLock Lock(m_CSPacket); - - // Send a SPAWN_OBJECT packet for the base entity: - WriteByte(PACKET_SPAWN_OBJECT); - WriteInt (a_Pickup.GetUniqueID()); - WriteByte(0x02); - WriteInt ((int)(a_Pickup.GetPosX() * 32)); - WriteInt ((int)(a_Pickup.GetPosY() * 32)); - WriteInt ((int)(a_Pickup.GetPosZ() * 32)); - WriteInt (1); - WriteShort((short)(a_Pickup.GetSpeedX() * 32)); - WriteShort((short)(a_Pickup.GetSpeedY() * 32)); - WriteShort((short)(a_Pickup.GetSpeedZ() * 32)); - WriteByte(0); - WriteByte(0); - - // Send a ENTITY_METADATA packet with the slot info: - WriteByte(PACKET_ENTITY_METADATA); - WriteInt(a_Pickup.GetUniqueID()); - WriteByte(0xaa); // a slot value at index 10 - WriteItem(a_Pickup.GetItem()); - WriteByte(0x7f); // End of metadata - Flush(); -} - - - - - -void cProtocol146::SendSpawnFallingBlock(const cFallingBlock & a_FallingBlock) -{ - // Send a spawn object / vehicle packet - cCSLock Lock(m_CSPacket); - - WriteByte(PACKET_SPAWN_OBJECT); - WriteInt (a_FallingBlock.GetUniqueID()); - WriteByte(70); - WriteInt ((int)(a_FallingBlock.GetPosX() * 32)); - WriteInt ((int)(a_FallingBlock.GetPosY() * 32)); - WriteInt ((int)(a_FallingBlock.GetPosZ() * 32)); - WriteByte (0); // Pitch - WriteByte (0); // Yaw - WriteInt (a_FallingBlock.GetBlockType()); // data indicator = blocktype - WriteShort((short)(a_FallingBlock.GetSpeedX() * 400)); - WriteShort((short)(a_FallingBlock.GetSpeedY() * 400)); - WriteShort((short)(a_FallingBlock.GetSpeedZ() * 400)); - Flush(); -} - - - - - -void cProtocol146::SendSpawnObject(const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_SPAWN_OBJECT); - WriteInt (a_Entity.GetUniqueID()); - WriteChar(a_ObjectType); - WriteInt ((int)(a_Entity.GetPosX() * 32)); - WriteInt ((int)(a_Entity.GetPosY() * 32)); - WriteInt ((int)(a_Entity.GetPosZ() * 32)); - WriteByte(a_Pitch); - WriteByte(a_Yaw); - WriteInt (a_ObjectData); - if (a_ObjectData != 0) - { - WriteShort((short)(a_Entity.GetSpeedX() * 400)); - WriteShort((short)(a_Entity.GetSpeedY() * 400)); - WriteShort((short)(a_Entity.GetSpeedZ() * 400)); - } - Flush(); -} - - - - - -void cProtocol146::SendSpawnVehicle(const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_SPAWN_OBJECT); - WriteInt (a_Vehicle.GetUniqueID()); - WriteChar (a_VehicleType); - WriteInt ((int)(a_Vehicle.GetPosX() * 32)); - WriteInt ((int)(a_Vehicle.GetPosY() * 32)); - WriteInt ((int)(a_Vehicle.GetPosZ() * 32)); - WriteByte ((Byte)((a_Vehicle.GetPitch() / 360.f) * 256)); - WriteByte ((Byte)((a_Vehicle.GetYaw() / 360.f) * 256)); - WriteInt (a_VehicleSubType); - if (a_VehicleSubType != 0) - { - WriteShort((short)(a_Vehicle.GetSpeedX() * 400)); - WriteShort((short)(a_Vehicle.GetSpeedY() * 400)); - WriteShort((short)(a_Vehicle.GetSpeedZ() * 400)); - } - Flush(); -} - - - - - diff --git a/src/Protocol/Protocol14x.h b/src/Protocol/Protocol14x.h deleted file mode 100644 index ca497bbc1..000000000 --- a/src/Protocol/Protocol14x.h +++ /dev/null @@ -1,63 +0,0 @@ - -// Protocol14x.h - -/* -Interfaces to the 1.4.x protocol classes representing these protocols: -- cProtocol142: - - release 1.4.2 protocol (#47) - - release 1.4.4 protocol (#49) - the same protocol class is used, because the only difference is in a packet that MCServer doesn't implement yet (ITEM_DATA) - - release 1.4.5 protocol (same as 1.4.4) -- cProtocol146: - - release 1.4.6 protocol (#51) -*/ - - - - - -#pragma once - -#include "Protocol132.h" - - - - - -class cProtocol142 : - public cProtocol132 -{ - typedef cProtocol132 super; - -public: - cProtocol142(cClientHandle * a_Client); - - // Sending commands (alphabetically sorted): - virtual void SendPickupSpawn (const cPickup & a_Pickup) override; - virtual void SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) override; - virtual void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay) override; - - // Specific packet parsers: - virtual int ParseLocaleViewDistance(void) override; -} ; - - - - - -class cProtocol146 : - public cProtocol142 -{ - typedef cProtocol142 super; - -public: - cProtocol146(cClientHandle * a_Client); - - virtual void SendPickupSpawn (const cPickup & a_Pickup) override; - virtual void SendSpawnFallingBlock(const cFallingBlock & a_FallingBlock) override; - virtual void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) override; - virtual void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) override; -} ; - - - - diff --git a/src/Protocol/Protocol15x.cpp b/src/Protocol/Protocol15x.cpp deleted file mode 100644 index 2b1f01b08..000000000 --- a/src/Protocol/Protocol15x.cpp +++ /dev/null @@ -1,209 +0,0 @@ - -// Protocol15x.cpp - -/* -Implements the 1.5.x protocol classes: - - cProtocol150 - - release 1.5 protocol (#60) - - release 1.5.2 protocol (#61, no relevant changes found) -*/ - -#include "Globals.h" -#include "Protocol15x.h" -#include "../ClientHandle.h" -#include "../Item.h" -#include "../UI/Window.h" - - - - - -#define HANDLE_PACKET_READ(Proc, Type, Var) \ - Type Var; \ - { \ - if (!m_ReceivedData.Proc(Var)) \ - { \ - m_ReceivedData.CheckValid(); \ - return PARSE_INCOMPLETE; \ - } \ - m_ReceivedData.CheckValid(); \ - } - - - - - -enum -{ - PACKET_WINDOW_OPEN = 0x64, - PACKET_PARTICLE_EFFECT = 0x3F, - PACKET_SCOREBOARD_OBJECTIVE = 0xCE, - PACKET_SCORE_UPDATE = 0xCF, - PACKET_DISPLAY_OBJECTIVE = 0xD0 -} ; - - - - - - -//////////////////////////////////////////////////////////////////////////////// -// cProtocol150: - -cProtocol150::cProtocol150(cClientHandle * a_Client) : - super(a_Client) -{ -} - - - - - -void cProtocol150::SendWindowOpen(const cWindow & a_Window) -{ - if (a_Window.GetWindowType() < 0) - { - // Do not send for inventory windows - return; - } - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_WINDOW_OPEN); - WriteByte (a_Window.GetWindowID()); - WriteByte (a_Window.GetWindowType()); - WriteString(a_Window.GetWindowTitle()); - WriteByte (a_Window.GetNumNonInventorySlots()); - WriteByte (1); // Use title - Flush(); -} - - - - - -void cProtocol150::SendParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_PARTICLE_EFFECT); - WriteString(a_ParticleName); - WriteFloat(a_SrcX); - WriteFloat(a_SrcY); - WriteFloat(a_SrcZ); - WriteFloat(a_OffsetX); - WriteFloat(a_OffsetY); - WriteFloat(a_OffsetZ); - WriteFloat(a_ParticleData); - WriteInt(a_ParticleAmmount); - Flush(); -} - - - - - -void cProtocol150::SendScoreboardObjective(const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_SCOREBOARD_OBJECTIVE); - WriteString(a_Name); - WriteString(a_DisplayName); - WriteByte(a_Mode); - Flush(); -} - - - - - -void cProtocol150::SendScoreUpdate(const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_SCORE_UPDATE); - WriteString(a_Player); - WriteByte(a_Mode); - - if (a_Mode != 1) - { - WriteString(a_Objective); - WriteInt((int) a_Score); - } - - Flush(); -} - - - - - -void cProtocol150::SendDisplayObjective(const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_DISPLAY_OBJECTIVE); - WriteByte((int) a_Display); - WriteString(a_Objective); - Flush(); -} - - - - - -int cProtocol150::ParseWindowClick(void) -{ - HANDLE_PACKET_READ(ReadChar, char, WindowID); - HANDLE_PACKET_READ(ReadBEShort, short, SlotNum); - HANDLE_PACKET_READ(ReadByte, Byte, Button); - HANDLE_PACKET_READ(ReadBEShort, short, TransactionID); - HANDLE_PACKET_READ(ReadByte, Byte, Mode); - cItem HeldItem; - int res = ParseItem(HeldItem); - if (res < 0) - { - return res; - } - - // Convert Button, Mode, SlotNum and HeldItem into eClickAction: - eClickAction Action = caUnknown; - switch ((Mode << 8) | Button) - { - case 0x0000: Action = (SlotNum != -999) ? caLeftClick : caLeftClickOutside; break; - case 0x0001: Action = (SlotNum != -999) ? caRightClick : caRightClickOutside; break; - case 0x0100: Action = caShiftLeftClick; break; - case 0x0101: Action = caShiftRightClick; break; - case 0x0200: Action = caNumber1; break; - case 0x0201: Action = caNumber2; break; - case 0x0202: Action = caNumber3; break; - case 0x0203: Action = caNumber4; break; - case 0x0204: Action = caNumber5; break; - case 0x0205: Action = caNumber6; break; - case 0x0206: Action = caNumber7; break; - case 0x0207: Action = caNumber8; break; - case 0x0208: Action = caNumber9; break; - case 0x0300: Action = caMiddleClick; break; - case 0x0400: Action = (SlotNum == -999) ? caLeftClickOutsideHoldNothing : caDropKey; break; - case 0x0401: Action = (SlotNum == -999) ? caRightClickOutsideHoldNothing : caCtrlDropKey; break; - case 0x0500: Action = (SlotNum == -999) ? caLeftPaintBegin : caUnknown; break; - case 0x0501: Action = (SlotNum != -999) ? caLeftPaintProgress : caUnknown; break; - case 0x0502: Action = (SlotNum == -999) ? caLeftPaintEnd : caUnknown; break; - case 0x0504: Action = (SlotNum == -999) ? caRightPaintBegin : caUnknown; break; - case 0x0505: Action = (SlotNum != -999) ? caRightPaintProgress : caUnknown; break; - case 0x0506: Action = (SlotNum == -999) ? caRightPaintEnd : caUnknown; break; - case 0x0600: Action = caDblClick; break; - } - - if (Action == caUnknown) - { - LOGWARNING("Received an unknown click action combination: Mode = %d, Button = %d, Slot = %d, HeldItem = %s. Ignoring packet.", - Mode, Button, SlotNum, ItemToFullString(HeldItem).c_str() - ); - ASSERT(!"Unknown click action"); - return PARSE_OK; - } - - m_Client->HandleWindowClick(WindowID, SlotNum, Action, HeldItem); - return PARSE_OK; -} - - - - - diff --git a/src/Protocol/Protocol15x.h b/src/Protocol/Protocol15x.h deleted file mode 100644 index 0d171a67c..000000000 --- a/src/Protocol/Protocol15x.h +++ /dev/null @@ -1,42 +0,0 @@ - -// Protocol15x.h - -/* -Declares the 1.5.x protocol classes: - - cProtocol150 - - release 1.5 and 1.5.1 protocol (#60) - - release 1.5.2 protocol (#61; no relevant changes found) -*/ - - - - - -#pragma once - -#include "Protocol14x.h" - - - - - -class cProtocol150 : - public cProtocol146 -{ - typedef cProtocol146 super; - -public: - cProtocol150(cClientHandle * a_Client); - - virtual void SendWindowOpen (const cWindow & a_Window) override; - virtual void SendParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount) override; - virtual void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) override; - virtual void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) override; - virtual void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) override; - - virtual int ParseWindowClick(void); -} ; - - - - diff --git a/src/Protocol/Protocol16x.cpp b/src/Protocol/Protocol16x.cpp deleted file mode 100644 index 0d354a030..000000000 --- a/src/Protocol/Protocol16x.cpp +++ /dev/null @@ -1,312 +0,0 @@ - -// Protocol16x.cpp - -/* -Implements the 1.6.x protocol classes: - - cProtocol161 - - release 1.6.1 protocol (#73) - - cProtocol162 - - release 1.6.2 protocol (#74) - - release 1.6.3 protocol (#77) - no relevant changes - - release 1.6.4 protocol (#78) - no relevant changes -(others may be added later in the future for the 1.6 release series) -*/ - -#include "Globals.h" -#include "Protocol16x.h" -#include "../ClientHandle.h" -#include "../Entities/Entity.h" -#include "../Entities/Player.h" -#include "../UI/Window.h" -#include "../CompositeChat.h" - - - - - -#define HANDLE_PACKET_READ(Proc, Type, Var) \ - Type Var; \ - { \ - if (!m_ReceivedData.Proc(Var)) \ - { \ - m_ReceivedData.CheckValid(); \ - return PARSE_INCOMPLETE; \ - } \ - m_ReceivedData.CheckValid(); \ - } - - - - - -enum -{ - PACKET_CHAT = 0x03, - PACKET_UPDATE_HEALTH = 0x08, - PACKET_STEER_VEHICLE = 0x1b, - PACKET_ATTACH_ENTITY = 0x27, - PACKET_ENTITY_PROPERTIES = 0x2c, - PACKET_WINDOW_OPEN = 0x64, - PACKET_TILE_EDITOR_OPEN = 0x85, - PACKET_PLAYER_ABILITIES = 0xca, -} ; - - - - - -//////////////////////////////////////////////////////////////////////////////// -// cProtocol161: - -cProtocol161::cProtocol161(cClientHandle * a_Client) : - super(a_Client) -{ -} - - - - - -void cProtocol161::SendAttachEntity(const cEntity & a_Entity, const cEntity * a_Vehicle) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_ATTACH_ENTITY); - WriteInt(a_Entity.GetUniqueID()); - WriteInt((a_Vehicle == NULL) ? -1 : a_Vehicle->GetUniqueID()); - WriteBool(false); // TODO: "Should use leash?" -> no - Flush(); -} - - - - - -void cProtocol161::SendChat(const AString & a_Message) -{ - super::SendChat(Printf("{\"text\":\"%s\"}", EscapeString(a_Message).c_str())); -} - - - - - -void cProtocol161::SendChat(const cCompositeChat & a_Message) -{ - // This protocol version doesn't support composite messages to the full - // Just extract each part's text and use it: - - super::SendChat(Printf("{\"text\":\"%s\"}", EscapeString(a_Message.ExtractText()).c_str())); -} - - - - - -void cProtocol161::SendEditSign(int a_BlockX, int a_BlockY, int a_BlockZ) -{ - cCSLock Lock(m_CSPacket); - WriteByte(PACKET_TILE_EDITOR_OPEN); - WriteByte(0); - WriteInt(a_BlockX); - WriteInt(a_BlockY); - WriteInt(a_BlockZ); - Flush(); -} - - - - - -void cProtocol161::SendGameMode(eGameMode a_GameMode) -{ - super::SendGameMode(a_GameMode); - SendPlayerMaxSpeed(); -} - - - - - -void cProtocol161::SendHealth(void) -{ - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_UPDATE_HEALTH); - cPlayer * Player = m_Client->GetPlayer(); - WriteFloat((float)Player->GetHealth()); - WriteShort((short)Player->GetFoodLevel()); - WriteFloat((float)Player->GetFoodSaturationLevel()); - Flush(); -} - - - - - -void cProtocol161::SendPlayerMaxSpeed(void) -{ - cCSLock Lock(m_CSPacket); - cPlayer * Player = m_Client->GetPlayer(); - WriteByte(PACKET_ENTITY_PROPERTIES); - WriteInt(Player->GetUniqueID()); - WriteInt(1); - WriteString("generic.movementSpeed"); - WriteDouble(0.1 * Player->GetMaxSpeed()); - Flush(); -} - - - - - -void cProtocol161::SendRespawn(eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) -{ - // Besides sending the respawn, we need to also send the player max speed, otherwise the client reverts to super-fast - super::SendRespawn(a_Dimension, a_ShouldIgnoreDimensionChecks); - SendPlayerMaxSpeed(); -} - - - - - -void cProtocol161::SendWindowOpen(const cWindow & a_Window) -{ - if (a_Window.GetWindowType() < 0) - { - // Do not send for inventory windows - return; - } - cCSLock Lock(m_CSPacket); - WriteByte (PACKET_WINDOW_OPEN); - WriteChar (a_Window.GetWindowID()); - WriteByte ((Byte)a_Window.GetWindowType()); - WriteString(a_Window.GetWindowTitle()); - WriteByte ((Byte)a_Window.GetNumNonInventorySlots()); - WriteByte (1); // Use title - if (a_Window.GetWindowType() == cWindow::wtAnimalChest) - { - WriteInt(0); // TODO: The animal's EntityID - } - Flush(); -} - - - - - -int cProtocol161::ParseEntityAction(void) -{ - HANDLE_PACKET_READ(ReadBEInt, int, EntityID); - HANDLE_PACKET_READ(ReadChar, char, ActionID); - HANDLE_PACKET_READ(ReadBEInt, int, UnknownHorseVal); - - switch (ActionID) - { - case 1: m_Client->HandleEntityCrouch(EntityID, true); break; // Crouch - case 2: m_Client->HandleEntityCrouch(EntityID, false); break; // Uncrouch - case 3: m_Client->HandleEntityLeaveBed(EntityID); break; // Leave Bed - case 4: m_Client->HandleEntitySprinting(EntityID, true); break; // Start sprinting - case 5: m_Client->HandleEntitySprinting(EntityID, false); break; // Stop sprinting - } - - return PARSE_OK; -} - - - - - -int cProtocol161::ParseLogin(void) -{ - // The login packet is sent by Forge clients only - // Only parse the packet, do no extra processing - // Note that the types and the names have been only guessed and are not verified at all! - HANDLE_PACKET_READ(ReadBEInt, int, Int1); - HANDLE_PACKET_READ(ReadBEUTF16String16, AString, String1); - HANDLE_PACKET_READ(ReadChar, char, Char1); - HANDLE_PACKET_READ(ReadChar, char, Char2); - HANDLE_PACKET_READ(ReadChar, char, Char3); - HANDLE_PACKET_READ(ReadByte, Byte, Byte1); - HANDLE_PACKET_READ(ReadByte, Byte, Byte2); - return PARSE_OK; -} - - - - - -int cProtocol161::ParsePlayerAbilities(void) -{ - HANDLE_PACKET_READ(ReadByte, Byte, Flags); - HANDLE_PACKET_READ(ReadBEFloat, float, FlyingSpeed); - HANDLE_PACKET_READ(ReadBEFloat, float, WalkingSpeed); - // TODO: m_Client->HandlePlayerAbilities(...); - return PARSE_OK; -} - - - - - -int cProtocol161::ParseSteerVehicle(void) -{ - HANDLE_PACKET_READ(ReadBEFloat, float, Sideways); - HANDLE_PACKET_READ(ReadBEFloat, float, Forward); - HANDLE_PACKET_READ(ReadBool, bool, Jump); - HANDLE_PACKET_READ(ReadBool, bool, Unmount); - if (Unmount) - { - m_Client->HandleUnmount(); - } - else - { - m_Client->HandleSteerVehicle(Forward, Sideways); - } - return PARSE_OK; -} - - - - - -int cProtocol161::ParsePacket(unsigned char a_PacketType) -{ - switch (a_PacketType) - { - case PACKET_STEER_VEHICLE: return ParseSteerVehicle(); - default: return super::ParsePacket(a_PacketType); - } -} - - - - - -//////////////////////////////////////////////////////////////////////////////// -// cProtocol162: - -cProtocol162::cProtocol162(cClientHandle * a_Client) : - super(a_Client) -{ -} - - - - - -void cProtocol162::SendPlayerMaxSpeed(void) -{ - cCSLock Lock(m_CSPacket); - cPlayer * Player = m_Client->GetPlayer(); - WriteByte(PACKET_ENTITY_PROPERTIES); - WriteInt(Player->GetUniqueID()); - WriteInt(1); - WriteString("generic.movementSpeed"); - WriteDouble(0.1 * Player->GetMaxSpeed()); - WriteShort(0); - Flush(); -} - - - - diff --git a/src/Protocol/Protocol16x.h b/src/Protocol/Protocol16x.h deleted file mode 100644 index add761d1e..000000000 --- a/src/Protocol/Protocol16x.h +++ /dev/null @@ -1,78 +0,0 @@ - -// Protocol16x.h - -/* -Declares the 1.6.x protocol classes: - - cProtocol161 - - release 1.6.1 protocol (#73) - - cProtocol162 - - release 1.6.2 protocol (#74) - - release 1.6.3 protocol (#77) - no relevant changes - - release 1.6.4 protocol (#78) - no relevant changes -(others may be added later in the future for the 1.6 release series) -*/ - - - - - -#pragma once - -#include "Protocol15x.h" - - - - - -class cProtocol161 : - public cProtocol150 -{ - typedef cProtocol150 super; - -public: - cProtocol161(cClientHandle * a_Client); - -protected: - - // cProtocol150 overrides: - virtual void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle) override; - virtual void SendChat (const AString & a_Message) override; - virtual void SendChat (const cCompositeChat & a_Message) override; - virtual void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ) override; ///< Request the client to open up the sign editor for the sign (1.6+) - virtual void SendGameMode (eGameMode a_GameMode) override; - virtual void SendHealth (void) override; - virtual void SendPlayerMaxSpeed(void) override; - virtual void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) override; - virtual void SendWindowOpen (const cWindow & a_Window) override; - - virtual int ParseEntityAction (void) override; - virtual int ParseLogin (void) override; - virtual int ParsePlayerAbilities(void) override; - - // New packets: - virtual int ParseSteerVehicle(void); - - // Enable new packets' handling - virtual int ParsePacket(unsigned char a_PacketType) override; -} ; - - - - - -class cProtocol162 : - public cProtocol161 -{ - typedef cProtocol161 super; - -public: - cProtocol162(cClientHandle * a_Client); - -protected: - // cProtocol161 overrides: - virtual void SendPlayerMaxSpeed(void) override; -} ; - - - - diff --git a/src/Protocol/Protocol17x.cpp b/src/Protocol/Protocol17x.cpp index 45d39e0e9..a7abd240f 100644 --- a/src/Protocol/Protocol17x.cpp +++ b/src/Protocol/Protocol17x.cpp @@ -1,10 +1,12 @@ + // Protocol17x.cpp /* Implements the 1.7.x protocol classes: - cProtocol172 - release 1.7.2 protocol (#4) -(others may be added later in the future for the 1.7 release series) + - cProtocol176 + - release 1.7.6 protocol (#5) */ #include "Globals.h" @@ -37,9 +39,11 @@ Implements the 1.7.x protocol classes: #include "../Mobs/IncludeAllMonsters.h" #include "../UI/Window.h" +#include "../BlockEntities/BeaconEntity.h" #include "../BlockEntities/CommandBlockEntity.h" #include "../BlockEntities/MobHeadEntity.h" #include "../BlockEntities/FlowerPotEntity.h" +#include "Bindings/PluginManager.h" @@ -47,7 +51,10 @@ Implements the 1.7.x protocol classes: #define HANDLE_READ(ByteBuf, Proc, Type, Var) \ Type Var; \ - ByteBuf.Proc(Var); + if (!ByteBuf.Proc(Var))\ + {\ + return;\ + } @@ -95,6 +102,19 @@ cProtocol172::cProtocol172(cClientHandle * a_Client, const AString & a_ServerAdd m_IsEncrypted(false), m_LastSentDimension(dimNotSet) { + // BungeeCord handling: + // If BC is setup with ip_forward == true, it sends additional data in the login packet's ServerAddress field: + // hostname\00ip-address\00uuid\00profile-properties-as-json + AStringVector Params; + if (cRoot::Get()->GetServer()->ShouldAllowBungeeCord() && SplitZeroTerminatedStrings(a_ServerAddress, Params) && (Params.size() == 4)) + { + LOGD("Player at %s connected via BungeeCord", Params[1].c_str()); + m_ServerAddress = Params[0]; + m_Client->SetIPString(Params[1]); + m_Client->SetUUID(cMojangAPI::MakeUUIDShort(Params[2])); + m_Client->SetProperties(Params[3]); + } + // Create the comm log file, if so requested: if (g_ShouldLogCommIn || g_ShouldLogCommOut) { @@ -232,101 +252,13 @@ void cProtocol172::SendChat(const AString & a_Message) void cProtocol172::SendChat(const cCompositeChat & a_Message) { ASSERT(m_State == 3); // In game mode? - - // Compose the complete Json string to send: - Json::Value msg; + cWorld * World = m_Client->GetPlayer()->GetWorld(); - msg["text"] = cClientHandle::FormatMessageType((World == NULL) ? false : World->ShouldUseChatPrefixes(), a_Message.GetMessageType(), a_Message.GetAdditionalMessageTypeData()); // The client crashes without this field being present - const cCompositeChat::cParts & Parts = a_Message.GetParts(); - for (cCompositeChat::cParts::const_iterator itr = Parts.begin(), end = Parts.end(); itr != end; ++itr) - { - Json::Value Part; - switch ((*itr)->m_PartType) - { - case cCompositeChat::ptText: - { - Part["text"] = (*itr)->m_Text; - AddChatPartStyle(Part, (*itr)->m_Style); - break; - } - - case cCompositeChat::ptClientTranslated: - { - const cCompositeChat::cClientTranslatedPart & p = (const cCompositeChat::cClientTranslatedPart &)**itr; - Part["translate"] = p.m_Text; - Json::Value With; - for (AStringVector::const_iterator itrW = p.m_Parameters.begin(), endW = p.m_Parameters.end(); itrW != endW; ++itr) - { - With.append(*itrW); - } - if (!p.m_Parameters.empty()) - { - Part["with"] = With; - } - AddChatPartStyle(Part, p.m_Style); - break; - } - - case cCompositeChat::ptUrl: - { - const cCompositeChat::cUrlPart & p = (const cCompositeChat::cUrlPart &)**itr; - Part["text"] = p.m_Text; - Json::Value Url; - Url["action"] = "open_url"; - Url["value"] = p.m_Url; - Part["clickEvent"] = Url; - AddChatPartStyle(Part, p.m_Style); - break; - } - - case cCompositeChat::ptSuggestCommand: - case cCompositeChat::ptRunCommand: - { - const cCompositeChat::cCommandPart & p = (const cCompositeChat::cCommandPart &)**itr; - Part["text"] = p.m_Text; - Json::Value Cmd; - Cmd["action"] = (p.m_PartType == cCompositeChat::ptRunCommand) ? "run_command" : "suggest_command"; - Cmd["value"] = p.m_Command; - Part["clickEvent"] = Cmd; - AddChatPartStyle(Part, p.m_Style); - break; - } + bool ShouldUseChatPrefixes = (World == NULL) ? false : World->ShouldUseChatPrefixes(); - case cCompositeChat::ptShowAchievement: - { - const cCompositeChat::cShowAchievementPart & p = (const cCompositeChat::cShowAchievementPart &)**itr; - Part["translate"] = "chat.type.achievement"; - - Json::Value Ach; - Ach["action"] = "show_achievement"; - Ach["value"] = p.m_Text; - - Json::Value AchColourAndName; - AchColourAndName["color"] = "green"; - AchColourAndName["translate"] = p.m_Text; - AchColourAndName["hoverEvent"] = Ach; - - Json::Value Extra; - Extra.append(AchColourAndName); - - Json::Value Name; - Name["text"] = p.m_PlayerName; - - Json::Value With; - With.append(Name); - With.append(Extra); - - Part["with"] = With; - AddChatPartStyle(Part, p.m_Style); - break; - } - } - msg["extra"].append(Part); - } // for itr - Parts[] - // Send the message to the client: cPacketizer Pkt(*this, 0x02); - Pkt.WriteString(msg.toStyledString()); + Pkt.WriteString(a_Message.CreateJsonString(ShouldUseChatPrefixes)); } @@ -339,7 +271,7 @@ void cProtocol172::SendChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataSerialize // Serialize first, before creating the Packetizer (the packetizer locks a CS) // This contains the flags and bitmasks, too - const AString & ChunkData = a_Serializer.Serialize(cChunkDataSerializer::RELEASE_1_3_2); + const AString & ChunkData = a_Serializer.Serialize(cChunkDataSerializer::RELEASE_1_3_2, a_ChunkX, a_ChunkZ); cPacketizer Pkt(*this, 0x21); // Chunk Data packet Pkt.WriteInt(a_ChunkX); @@ -680,7 +612,7 @@ void cProtocol172::SendLoginSuccess(void) { cPacketizer Pkt(*this, 0x02); // Login success packet - Pkt.WriteString(m_Client->GetUUID()); + Pkt.WriteString(cMojangAPI::MakeUUIDDashed(m_Client->GetUUID())); Pkt.WriteString(m_Client->GetUsername()); } @@ -708,7 +640,7 @@ void cProtocol172::SendPaintingSpawn(const cPainting & a_Painting) -void cProtocol172::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length) +void cProtocol172::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length, unsigned int m_Scale) { ASSERT(m_State == 3); // In game mode? @@ -730,7 +662,7 @@ void cProtocol172::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colo -void cProtocol172::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decorators) +void cProtocol172::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decorators, unsigned int m_Scale) { ASSERT(m_State == 3); // In game mode? @@ -768,7 +700,6 @@ void cProtocol172::SendMapInfo(int a_ID, unsigned int a_Scale) - void cProtocol172::SendPickupSpawn(const cPickup & a_Pickup) { ASSERT(m_State == 3); // In game mode? @@ -819,7 +750,7 @@ void cProtocol172::SendPlayerAbilities(void) } Pkt.WriteByte(Flags); Pkt.WriteFloat((float)(0.05 * Player->GetFlyingMaxSpeed())); - Pkt.WriteFloat((float)(0.1 * Player->GetMaxSpeed())); + Pkt.WriteFloat((float)(0.1 * Player->GetNormalMaxSpeed())); } @@ -839,7 +770,7 @@ void cProtocol172::SendEntityAnimation(const cEntity & a_Entity, char a_Animatio -void cProtocol172::SendParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount) +void cProtocol172::SendParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount) { ASSERT(m_State == 3); // In game mode? @@ -852,21 +783,66 @@ void cProtocol172::SendParticleEffect(const AString & a_ParticleName, float a_Sr Pkt.WriteFloat(a_OffsetY); Pkt.WriteFloat(a_OffsetZ); Pkt.WriteFloat(a_ParticleData); - Pkt.WriteInt(a_ParticleAmmount); + Pkt.WriteInt(a_ParticleAmount); } -void cProtocol172::SendPlayerListItem(const cPlayer & a_Player, bool a_IsOnline) +void cProtocol172::SendPlayerListAddPlayer(const cPlayer & a_Player) { ASSERT(m_State == 3); // In game mode? - + cPacketizer Pkt(*this, 0x38); // Playerlist Item packet - Pkt.WriteString(a_Player.GetName()); - Pkt.WriteBool(a_IsOnline); - Pkt.WriteShort(a_IsOnline ? a_Player.GetClientHandle()->GetPing() : 0); + Pkt.WriteString(a_Player.GetPlayerListName()); + Pkt.WriteBool(true); + Pkt.WriteShort(a_Player.GetClientHandle()->GetPing()); +} + + + + + +void cProtocol172::SendPlayerListRemovePlayer(const cPlayer & a_Player) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x38); + Pkt.WriteString(a_Player.GetPlayerListName()); + Pkt.WriteBool(false); + Pkt.WriteShort(0); +} + + + + + +void cProtocol172::SendPlayerListUpdateGameMode(const cPlayer & a_Player) +{ + // Not implemented in this protocol version + UNUSED(a_Player); +} + + + + + +void cProtocol172::SendPlayerListUpdatePing(const cPlayer & a_Player) +{ + // It is a simple add player packet in this protocol. + SendPlayerListAddPlayer(a_Player); +} + + + + + +void cProtocol172::SendPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName) +{ + // Not implemented in this protocol version + UNUSED(a_Player); + UNUSED(a_CustomName); } @@ -940,9 +916,16 @@ void cProtocol172::SendPlayerSpawn(const cPlayer & a_Player) // Called to spawn another player for the client cPacketizer Pkt(*this, 0x0c); // Spawn Player packet - Pkt.WriteVarInt(a_Player.GetUniqueID()); - Pkt.WriteString(a_Player.GetClientHandle()->GetUUID()); - Pkt.WriteString(a_Player.GetName()); + Pkt.WriteVarInt((UInt32) a_Player.GetUniqueID()); + Pkt.WriteString(cMojangAPI::MakeUUIDDashed(a_Player.GetClientHandle()->GetUUID())); + if (a_Player.HasCustomName()) + { + Pkt.WriteString(a_Player.GetCustomName()); + } + else + { + Pkt.WriteString(a_Player.GetName()); + } Pkt.WriteFPInt(a_Player.GetPosX()); Pkt.WriteFPInt(a_Player.GetPosY()); Pkt.WriteFPInt(a_Player.GetPosZ()); @@ -1028,9 +1011,9 @@ void cProtocol172::SendExperienceOrb(const cExpOrb & a_ExpOrb) cPacketizer Pkt(*this, 0x11); Pkt.WriteVarInt(a_ExpOrb.GetUniqueID()); - Pkt.WriteInt((int) a_ExpOrb.GetPosX()); - Pkt.WriteInt((int) a_ExpOrb.GetPosY()); - Pkt.WriteInt((int) a_ExpOrb.GetPosZ()); + Pkt.WriteFPInt(a_ExpOrb.GetPosX()); + Pkt.WriteFPInt(a_ExpOrb.GetPosY()); + Pkt.WriteFPInt(a_ExpOrb.GetPosZ()); Pkt.WriteShort(a_ExpOrb.GetReward()); } @@ -1285,9 +1268,14 @@ void cProtocol172::SendThunderbolt(int a_BlockX, int a_BlockY, int a_BlockZ) -void cProtocol172::SendTimeUpdate(Int64 a_WorldAge, Int64 a_TimeOfDay) +void cProtocol172::SendTimeUpdate(Int64 a_WorldAge, Int64 a_TimeOfDay, bool a_DoDaylightCycle) { ASSERT(m_State == 3); // In game mode? + if (!a_DoDaylightCycle) + { + // When writing a "-" before the number the client ignores it but it will stop the client-side time expiration. + a_TimeOfDay = std::min(-a_TimeOfDay, -1LL); + } cPacketizer Pkt(*this, 0x03); Pkt.WriteInt64(a_WorldAge); @@ -1328,6 +1316,7 @@ void cProtocol172::SendUpdateBlockEntity(cBlockEntity & a_BlockEntity) { case E_BLOCK_MOB_SPAWNER: Action = 1; break; // Update mob spawner spinny mob thing case E_BLOCK_COMMAND_BLOCK: Action = 2; break; // Update command block text + case E_BLOCK_BEACON: Action = 3; break; // Update beacon entity case E_BLOCK_HEAD: Action = 4; break; // Update Mobhead entity case E_BLOCK_FLOWER_POT: Action = 5; break; // Update flower pot default: ASSERT(!"Unhandled or unimplemented BlockEntity update request!"); break; @@ -1344,6 +1333,7 @@ void cProtocol172::SendUpdateBlockEntity(cBlockEntity & a_BlockEntity) void cProtocol172::SendUpdateSign(int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4) { ASSERT(m_State == 3); // In game mode? + ASSERT((a_BlockY >= 0) && (a_BlockY < cChunkDef::Height)); cPacketizer Pkt(*this, 0x33); Pkt.WriteInt(a_BlockX); @@ -1489,14 +1479,14 @@ void cProtocol172::AddReceivedData(const char * a_Data, size_t a_Size) ); m_CommLogFile.Flush(); } - + if (!m_ReceivedData.Write(a_Data, a_Size)) { // Too much data in the incoming queue, report to caller: m_Client->PacketBufferFull(); return; } - + // Handle all complete packets: for (;;) { @@ -1516,10 +1506,7 @@ void cProtocol172::AddReceivedData(const char * a_Data, size_t a_Size) cByteBuffer bb(PacketLen + 1); VERIFY(m_ReceivedData.ReadToByteBuffer(bb, (int)PacketLen)); m_ReceivedData.CommitRead(); - - // Write one NUL extra, so that we can detect over-reads - bb.Write("\0", 1); - + UInt32 PacketType; if (!bb.ReadVarInt(PacketType)) { @@ -1527,6 +1514,9 @@ void cProtocol172::AddReceivedData(const char * a_Data, size_t a_Size) break; } + // Write one NUL extra, so that we can detect over-reads + bb.Write("\0", 1); + // Log the packet info into the comm log file: if (g_ShouldLogCommIn) { @@ -1534,7 +1524,7 @@ void cProtocol172::AddReceivedData(const char * a_Data, size_t a_Size) bb.ReadAll(PacketData); bb.ResetRead(); bb.ReadVarInt(PacketType); - ASSERT(PacketData.size() > 0); + ASSERT(PacketData.size() > 0); // We have written an extra NUL, so there had to be at least one byte read PacketData.resize(PacketData.size() - 1); AString PacketDataHex; CreateHexDump(PacketDataHex, PacketData.data(), PacketData.size(), 16); @@ -1542,7 +1532,7 @@ void cProtocol172::AddReceivedData(const char * a_Data, size_t a_Size) PacketType, PacketType, PacketLen, PacketLen, m_State, PacketDataHex.c_str() ); } - + if (!HandlePacket(bb, PacketType)) { // Unknown packet, already been reported, but without the length. Log the length here: @@ -1567,7 +1557,7 @@ void cProtocol172::AddReceivedData(const char * a_Data, size_t a_Size) return; } - + if (bb.GetReadableSpace() != 1) { // Read more or less than packet length, report as error @@ -1588,7 +1578,7 @@ void cProtocol172::AddReceivedData(const char * a_Data, size_t a_Size) m_Client->PacketError(PacketType); } } // for (ever) - + // Log any leftover bytes into the logfile: if (g_ShouldLogCommIn && (m_ReceivedData.GetReadableSpace() > 0)) { @@ -1698,9 +1688,8 @@ bool cProtocol172::HandlePacket(cByteBuffer & a_ByteBuffer, UInt32 a_PacketType) void cProtocol172::HandlePacketStatusPing(cByteBuffer & a_ByteBuffer) { - Int64 Timestamp; - a_ByteBuffer.ReadBEInt64(Timestamp); - + HANDLE_READ(a_ByteBuffer, ReadBEInt64, Int64, Timestamp); + cPacketizer Pkt(*this, 0x01); // Ping packet Pkt.WriteInt64(Timestamp); } @@ -1711,21 +1700,41 @@ void cProtocol172::HandlePacketStatusPing(cByteBuffer & a_ByteBuffer) void cProtocol172::HandlePacketStatusRequest(cByteBuffer & a_ByteBuffer) { - // Send the response: - AString Response = "{\"version\":{\"name\":\"1.7.2\", \"protocol\":4}, \"players\":{"; cServer * Server = cRoot::Get()->GetServer(); - AppendPrintf(Response, "\"max\":%u, \"online\":%u, \"sample\":[]},", - Server->GetMaxPlayers(), - Server->GetNumPlayers() - ); - AppendPrintf(Response, "\"description\":{\"text\":\"%s\"},", - Server->GetDescription().c_str() - ); - AppendPrintf(Response, "\"favicon\": \"data:image/png;base64,%s\"", - Server->GetFaviconData().c_str() - ); - Response.append("}"); - + AString ServerDescription = Server->GetDescription(); + int NumPlayers = Server->GetNumPlayers(); + int MaxPlayers = Server->GetMaxPlayers(); + AString Favicon = Server->GetFaviconData(); + cRoot::Get()->GetPluginManager()->CallHookServerPing(*m_Client, ServerDescription, NumPlayers, MaxPlayers, Favicon); + + // Version: + Json::Value Version; + Version["name"] = "1.7.2"; + Version["protocol"] = 4; + + // Players: + Json::Value Players; + Players["online"] = NumPlayers; + Players["max"] = MaxPlayers; + // TODO: Add "sample" + + // Description: + Json::Value Description; + Description["text"] = ServerDescription.c_str(); + + // Create the response: + Json::Value ResponseValue; + ResponseValue["version"] = Version; + ResponseValue["players"] = Players; + ResponseValue["description"] = Description; + if (!Favicon.empty()) + { + ResponseValue["favicon"] = Printf("data:image/png;base64,%s", Favicon.c_str()); + } + + Json::StyledWriter Writer; + AString Response = Writer.write(ResponseValue); + cPacketizer Pkt(*this, 0x00); // Response packet Pkt.WriteString(Response); } @@ -1794,7 +1803,11 @@ void cProtocol172::HandlePacketLoginEncryptionResponse(cByteBuffer & a_ByteBuffe void cProtocol172::HandlePacketLoginStart(cByteBuffer & a_ByteBuffer) { AString Username; - a_ByteBuffer.ReadVarUTF8String(Username); + if (!a_ByteBuffer.ReadVarUTF8String(Username)) + { + m_Client->Kick("Bad username"); + return; + } if (!m_Client->HandleHandshake(Username)) { @@ -1888,7 +1901,7 @@ void cProtocol172::HandlePacketClientSettings(cByteBuffer & a_ByteBuffer) HANDLE_READ(a_ByteBuffer, ReadByte, Byte, ShowCape); m_Client->SetLocale(Locale); - // TODO: handle in m_Client + // TODO: Do anything with the other values. } @@ -2051,8 +2064,27 @@ void cProtocol172::HandlePacketPluginMessage(cByteBuffer & a_ByteBuffer) { HANDLE_READ(a_ByteBuffer, ReadVarUTF8String, AString, Channel); HANDLE_READ(a_ByteBuffer, ReadBEShort, short, Length); + if (Length + 1 != (int)a_ByteBuffer.GetReadableSpace()) + { + LOGD("Invalid plugin message packet, payload length doesn't match packet length (exp %d, got %d)", + (int)a_ByteBuffer.GetReadableSpace() - 1, Length + ); + return; + } + + // If the plugin channel is recognized vanilla, handle it directly: + if (Channel.substr(0, 3) == "MC|") + { + HandleVanillaPluginMessage(a_ByteBuffer, Channel, Length); + return; + } + + // Read the plugin message and relay to clienthandle: AString Data; - a_ByteBuffer.ReadString(Data, Length); + if (!a_ByteBuffer.ReadString(Data, Length)) + { + return; + } m_Client->HandlePluginMessage(Channel, Data); } @@ -2201,14 +2233,76 @@ void cProtocol172::HandlePacketWindowClose(cByteBuffer & a_ByteBuffer) -void cProtocol172::WritePacket(cByteBuffer & a_Packet) +void cProtocol172::HandleVanillaPluginMessage(cByteBuffer & a_ByteBuffer, const AString & a_Channel, short a_PayloadLength) { - cCSLock Lock(m_CSPacket); - AString Pkt; - a_Packet.ReadAll(Pkt); - WriteVarInt((UInt32)Pkt.size()); - SendData(Pkt.data(), Pkt.size()); - Flush(); + if (a_Channel == "MC|AdvCdm") + { + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, Mode); + switch (Mode) + { + case 0x00: + { + // Block-based commandblock update: + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, BlockX); + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, BlockY); + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, BlockZ); + HANDLE_READ(a_ByteBuffer, ReadVarUTF8String, AString, Command); + m_Client->HandleCommandBlockBlockChange(BlockX, BlockY, BlockZ, Command); + break; + } + + // TODO: Entity-based commandblock update + + default: + { + m_Client->SendChat(Printf("Failure setting command block command; unhandled mode %d", Mode), mtFailure); + LOG("Unhandled MC|AdvCdm packet mode."); + return; + } + } // switch (Mode) + return; + } + else if (a_Channel == "MC|Brand") + { + // Read the client's brand: + AString Brand; + if (a_ByteBuffer.ReadString(Brand, a_PayloadLength)) + { + m_Client->SetClientBrand(Brand); + } + + // Send back our brand: + SendPluginMessage("MC|Brand", "MCServer"); + return; + } + else if (a_Channel == "MC|Beacon") + { + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, Effect1); + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, Effect2); + m_Client->HandleBeaconSelection(Effect1, Effect2); + return; + } + else if (a_Channel == "MC|ItemName") + { + AString ItemName; + if (a_ByteBuffer.ReadString(ItemName, a_PayloadLength)) + { + m_Client->HandleAnvilItemName(ItemName); + } + return; + } + else if (a_Channel == "MC|TrSel") + { + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, SlotNum); + m_Client->HandleNPCTrade(SlotNum); + return; + } + LOG("Unhandled vanilla plugin channel: \"%s\".", a_Channel.c_str()); + + // Read the payload and send it through to the clienthandle: + AString Message; + VERIFY(a_ByteBuffer.ReadString(Message, a_PayloadLength)); + m_Client->HandlePluginMessage(a_Channel, Message); } @@ -2239,7 +2333,6 @@ void cProtocol172::SendData(const char * a_Data, size_t a_Size) - bool cProtocol172::ReadItem(cByteBuffer & a_ByteBuffer, cItem & a_Item) { HANDLE_PACKET_READ(a_ByteBuffer, ReadBEShort, short, ItemType); @@ -2384,85 +2477,6 @@ void cProtocol172::StartEncryption(const Byte * a_Key) -void cProtocol172::AddChatPartStyle(Json::Value & a_Value, const AString & a_PartStyle) -{ - size_t len = a_PartStyle.length(); - for (size_t i = 0; i < len; i++) - { - switch (a_PartStyle[i]) - { - case 'b': - { - // bold - a_Value["bold"] = Json::Value(true); - break; - } - - case 'i': - { - // italic - a_Value["italic"] = Json::Value(true); - break; - } - - case 'u': - { - // Underlined - a_Value["underlined"] = Json::Value(true); - break; - } - - case 's': - { - // strikethrough - a_Value["strikethrough"] = Json::Value(true); - break; - } - - case 'o': - { - // obfuscated - a_Value["obfuscated"] = Json::Value(true); - break; - } - - case '@': - { - // Color, specified by the next char: - i++; - if (i >= len) - { - // String too short, didn't contain a color - break; - } - switch (a_PartStyle[i]) - { - case '0': a_Value["color"] = Json::Value("black"); break; - case '1': a_Value["color"] = Json::Value("dark_blue"); break; - case '2': a_Value["color"] = Json::Value("dark_green"); break; - case '3': a_Value["color"] = Json::Value("dark_aqua"); break; - case '4': a_Value["color"] = Json::Value("dark_red"); break; - case '5': a_Value["color"] = Json::Value("dark_purple"); break; - case '6': a_Value["color"] = Json::Value("gold"); break; - case '7': a_Value["color"] = Json::Value("gray"); break; - case '8': a_Value["color"] = Json::Value("dark_gray"); break; - case '9': a_Value["color"] = Json::Value("blue"); break; - case 'a': a_Value["color"] = Json::Value("green"); break; - case 'b': a_Value["color"] = Json::Value("aqua"); break; - case 'c': a_Value["color"] = Json::Value("red"); break; - case 'd': a_Value["color"] = Json::Value("light_purple"); break; - case 'e': a_Value["color"] = Json::Value("yellow"); break; - case 'f': a_Value["color"] = Json::Value("white"); break; - } // switch (color) - } // case '@' - } // switch (Style[i]) - } // for i - a_PartStyle[] -} - - - - - //////////////////////////////////////////////////////////////////////////////// // cProtocol172::cPacketizer: @@ -2472,6 +2486,7 @@ cProtocol172::cPacketizer::~cPacketizer() // Send the packet length UInt32 PacketLen = (UInt32)m_Out.GetUsedSpace(); + m_Protocol.m_OutPacketLenBuffer.WriteVarInt(PacketLen); m_Protocol.m_OutPacketLenBuffer.ReadAll(DataToSend); m_Protocol.SendData(DataToSend.data(), DataToSend.size()); @@ -2566,6 +2581,7 @@ void cProtocol172::cPacketizer::WriteItem(const cItem & a_Item) cFireworkItem::WriteToNBTCompound(a_Item.m_FireworkItem, Writer, (ENUM_ITEM_ID)a_Item.m_ItemType); } Writer.Finish(); + AString Compressed; CompressStringGZIP(Writer.GetResult().data(), Writer.GetResult().size(), Compressed); WriteShort((short)Compressed.size()); @@ -2575,12 +2591,26 @@ void cProtocol172::cPacketizer::WriteItem(const cItem & a_Item) + void cProtocol172::cPacketizer::WriteBlockEntity(const cBlockEntity & a_BlockEntity) { cFastNBTWriter Writer; switch (a_BlockEntity.GetBlockType()) { + case E_BLOCK_BEACON: + { + cBeaconEntity & BeaconEntity = (cBeaconEntity &)a_BlockEntity; + + Writer.AddInt("x", BeaconEntity.GetPosX()); + Writer.AddInt("y", BeaconEntity.GetPosY()); + Writer.AddInt("z", BeaconEntity.GetPosZ()); + Writer.AddInt("Primary", BeaconEntity.GetPrimaryEffect()); + Writer.AddInt("Secondary", BeaconEntity.GetSecondaryEffect()); + Writer.AddInt("Levels", BeaconEntity.GetBeaconLevel()); + Writer.AddString("id", "Beacon"); // "Tile Entity ID" - MC wiki; vanilla server always seems to send this though + break; + } case E_BLOCK_COMMAND_BLOCK: { cCommandBlockEntity & CommandBlockEntity = (cCommandBlockEntity &)a_BlockEntity; @@ -2773,7 +2803,7 @@ void cProtocol172::cPacketizer::WriteEntityMetadata(const cEntity & a_Entity) WriteByte(0xA2); WriteItem(Frame.GetItem()); WriteByte(0x3); - WriteByte(Frame.GetRotation()); + WriteByte(Frame.GetRotation() / 2); break; } default: break; @@ -2788,7 +2818,7 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) { switch (a_Mob.GetMobType()) { - case cMonster::mtCreeper: + case mtCreeper: { WriteByte(0x10); WriteByte(((const cCreeper &)a_Mob).IsBlowing() ? 1 : -1); @@ -2797,28 +2827,28 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) break; } - case cMonster::mtBat: + case mtBat: { WriteByte(0x10); WriteByte(((const cBat &)a_Mob).IsHanging() ? 1 : 0); break; } - case cMonster::mtPig: + case mtPig: { WriteByte(0x10); WriteByte(((const cPig &)a_Mob).IsSaddled() ? 1 : 0); break; } - case cMonster::mtVillager: + case mtVillager: { WriteByte(0x50); WriteInt(((const cVillager &)a_Mob).GetVilType()); break; } - case cMonster::mtZombie: + case mtZombie: { WriteByte(0x0c); WriteByte(((const cZombie &)a_Mob).IsBaby() ? 1 : 0); @@ -2829,14 +2859,14 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) break; } - case cMonster::mtGhast: + case mtGhast: { WriteByte(0x10); WriteByte(((const cGhast &)a_Mob).IsCharging()); break; } - case cMonster::mtWolf: + case mtWolf: { const cWolf & Wolf = (const cWolf &)a_Mob; Byte WolfStatus = 0; @@ -2864,7 +2894,7 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) break; } - case cMonster::mtSheep: + case mtSheep: { WriteByte(0x10); Byte SheepMetadata = 0; @@ -2877,7 +2907,7 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) break; } - case cMonster::mtEnderman: + case mtEnderman: { WriteByte(0x10); WriteByte((Byte)(((const cEnderman &)a_Mob).GetCarriedBlock())); @@ -2888,21 +2918,21 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) break; } - case cMonster::mtSkeleton: + case mtSkeleton: { WriteByte(0x0d); WriteByte(((const cSkeleton &)a_Mob).IsWither() ? 1 : 0); break; } - case cMonster::mtWitch: + case mtWitch: { WriteByte(0x15); WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0); break; } - case cMonster::mtWither: + case mtWither: { WriteByte(0x54); // Int at index 20 WriteInt(((const cWither &)a_Mob).GetWitherInvulnerableTicks()); @@ -2911,21 +2941,21 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) break; } - case cMonster::mtSlime: + case mtSlime: { WriteByte(0x10); WriteByte(((const cSlime &)a_Mob).GetSize()); break; } - case cMonster::mtMagmaCube: + case mtMagmaCube: { WriteByte(0x10); WriteByte(((const cMagmaCube &)a_Mob).GetSize()); break; } - case cMonster::mtHorse: + case mtHorse: { const cHorse & Horse = (const cHorse &)a_Mob; int Flags = 0; @@ -2971,6 +3001,15 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) break; } } // switch (a_Mob.GetType()) + + // Custom name: + if (a_Mob.HasCustomName()) + { + WriteByte(0x8a); + WriteString(a_Mob.GetCustomName()); + WriteByte(0x0b); + WriteByte(a_Mob.IsCustomNameAlwaysVisible() ? 1 : 0); + } } @@ -3014,18 +3053,24 @@ void cProtocol176::SendPlayerSpawn(const cPlayer & a_Player) // Called to spawn another player for the client cPacketizer Pkt(*this, 0x0c); // Spawn Player packet Pkt.WriteVarInt(a_Player.GetUniqueID()); - Pkt.WriteString(a_Player.GetClientHandle()->GetUUID()); - Pkt.WriteString(a_Player.GetName()); + Pkt.WriteString(cMojangAPI::MakeUUIDDashed(a_Player.GetClientHandle()->GetUUID())); + if (a_Player.HasCustomName()) + { + Pkt.WriteString(a_Player.GetCustomName()); + } + else + { + Pkt.WriteString(a_Player.GetName()); + } - const Json::Value & Properties = m_Client->GetProperties(); - const Json::Value::const_iterator End = Properties.end(); + const Json::Value & Properties = a_Player.GetClientHandle()->GetProperties(); Pkt.WriteVarInt(Properties.size()); - for (Json::Value::iterator itr = Properties.begin(); itr != End; ++itr) + for (Json::Value::iterator itr = Properties.begin(), end = Properties.end(); itr != end; ++itr) { - Pkt.WriteString(((Json::Value)*itr).get("name", "").toStyledString()); - Pkt.WriteString(((Json::Value)*itr).get("value", "").toStyledString()); - Pkt.WriteString(((Json::Value)*itr).get("signature", "").toStyledString()); + Pkt.WriteString(((Json::Value)*itr).get("name", "").asString()); + Pkt.WriteString(((Json::Value)*itr).get("value", "").asString()); + Pkt.WriteString(((Json::Value)*itr).get("signature", "").asString()); } Pkt.WriteFPInt(a_Player.GetPosX()); @@ -3046,20 +3091,41 @@ void cProtocol176::SendPlayerSpawn(const cPlayer & a_Player) void cProtocol176::HandlePacketStatusRequest(cByteBuffer & a_ByteBuffer) { - // Send the response: - AString Response = "{\"version\": {\"name\": \"1.7.6\", \"protocol\":5}, \"players\": {"; - AppendPrintf(Response, "\"max\": %u, \"online\": %u, \"sample\": []},", - cRoot::Get()->GetServer()->GetMaxPlayers(), - cRoot::Get()->GetServer()->GetNumPlayers() - ); - AppendPrintf(Response, "\"description\": {\"text\": \"%s\"},", - cRoot::Get()->GetServer()->GetDescription().c_str() - ); - AppendPrintf(Response, "\"favicon\": \"data:image/png;base64,%s\"", - cRoot::Get()->GetServer()->GetFaviconData().c_str() - ); - Response.append("}"); - + cServer * Server = cRoot::Get()->GetServer(); + AString Motd = Server->GetDescription(); + int NumPlayers = Server->GetNumPlayers(); + int MaxPlayers = Server->GetMaxPlayers(); + AString Favicon = Server->GetFaviconData(); + cRoot::Get()->GetPluginManager()->CallHookServerPing(*m_Client, Motd, NumPlayers, MaxPlayers, Favicon); + + // Version: + Json::Value Version; + Version["name"] = "1.7.6"; + Version["protocol"] = 5; + + // Players: + Json::Value Players; + Players["online"] = NumPlayers; + Players["max"] = MaxPlayers; + // TODO: Add "sample" + + // Description: + Json::Value Description; + Description["text"] = Motd.c_str(); + + // Create the response: + Json::Value ResponseValue; + ResponseValue["version"] = Version; + ResponseValue["players"] = Players; + ResponseValue["description"] = Description; + if (!Favicon.empty()) + { + ResponseValue["favicon"] = Printf("data:image/png;base64,%s", Favicon.c_str()); + } + + Json::StyledWriter Writer; + AString Response = Writer.write(ResponseValue); + cPacketizer Pkt(*this, 0x00); // Response packet Pkt.WriteString(Response); } diff --git a/src/Protocol/Protocol17x.h b/src/Protocol/Protocol17x.h index 9c9f563e0..7709df59d 100644 --- a/src/Protocol/Protocol17x.h +++ b/src/Protocol/Protocol17x.h @@ -5,7 +5,8 @@ Declares the 1.7.x protocol classes: - cProtocol172 - release 1.7.2 protocol (#4) -(others may be added later in the future for the 1.7 release series) + - cProtocol176 + - release 1.7.6 protocol (#5) */ @@ -60,76 +61,80 @@ public: virtual void DataReceived(const char * a_Data, size_t a_Size) override; /** Sending stuff to clients (alphabetically sorted): */ - virtual void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle) override; - virtual void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) override; - virtual void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage) override; - virtual void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override; - virtual void SendBlockChanges (int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes) override; - virtual void SendChat (const AString & a_Message) override; - virtual void SendChat (const cCompositeChat & a_Message) override; - virtual void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) override; - virtual void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player) override; - virtual void SendDestroyEntity (const cEntity & a_Entity) override; - virtual void SendDisconnect (const AString & a_Reason) override; - virtual void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ) override; ///< Request the client to open up the sign editor for the sign (1.6+) - virtual void SendEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration) override; - virtual void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) override; - virtual void SendEntityHeadLook (const cEntity & a_Entity) override; - virtual void SendEntityLook (const cEntity & a_Entity) override; - virtual void SendEntityMetadata (const cEntity & a_Entity) override; - virtual void SendEntityProperties (const cEntity & a_Entity) override; - virtual void SendEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; - virtual void SendEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; - virtual void SendEntityStatus (const cEntity & a_Entity, char a_Status) override; - virtual void SendEntityVelocity (const cEntity & a_Entity) override; - virtual void SendExplosion (double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion) override; - virtual void SendGameMode (eGameMode a_GameMode) override; - virtual void SendHealth (void) override; - virtual void SendInventorySlot (char a_WindowID, short a_SlotNum, const cItem & a_Item) override; - virtual void SendKeepAlive (int a_PingID) override; - virtual void SendLogin (const cPlayer & a_Player, const cWorld & a_World) override; - virtual void SendLoginSuccess (void) override; - virtual void SendMapColumn (int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length) override; - virtual void SendMapDecorators (int a_ID, const cMapDecoratorList & a_Decorators) override; - virtual void SendMapInfo (int a_ID, unsigned int a_Scale) override; - virtual void SendPaintingSpawn (const cPainting & a_Painting) override; - virtual void SendPickupSpawn (const cPickup & a_Pickup) override; - virtual void SendPlayerAbilities (void) override; - virtual void SendEntityAnimation (const cEntity & a_Entity, char a_Animation) override; - virtual void SendParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount) override; - virtual void SendPlayerListItem (const cPlayer & a_Player, bool a_IsOnline) override; - virtual void SendPlayerMaxSpeed (void) override; - virtual void SendPlayerMoveLook (void) override; - virtual void SendPlayerPosition (void) override; - virtual void SendPlayerSpawn (const cPlayer & a_Player) override; - virtual void SendPluginMessage (const AString & a_Channel, const AString & a_Message) override; - virtual void SendRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID) override; - virtual void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) override; - virtual void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) override; - virtual void SendExperience (void) override; - virtual void SendExperienceOrb (const cExpOrb & a_ExpOrb) override; - virtual void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) override; - virtual void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) override; - virtual void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) override; - virtual void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) override; - virtual void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock) override; - virtual void SendSpawnMob (const cMonster & a_Mob) override; - virtual void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) override; - virtual void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) override; - virtual void SendStatistics (const cStatManager & a_Manager) override; - virtual void SendTabCompletionResults(const AStringVector & a_Results) override; - virtual void SendTeleportEntity (const cEntity & a_Entity) override; - virtual void SendThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ) override; - virtual void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay) override; - virtual void SendUnloadChunk (int a_ChunkX, int a_ChunkZ) override; - virtual void SendUpdateBlockEntity (cBlockEntity & a_BlockEntity) override; - virtual void SendUpdateSign (int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4) override; - virtual void SendUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) override; - virtual void SendWeather (eWeather a_Weather) override; - virtual void SendWholeInventory (const cWindow & a_Window) override; - virtual void SendWindowClose (const cWindow & a_Window) override; - virtual void SendWindowOpen (const cWindow & a_Window) override; - virtual void SendWindowProperty (const cWindow & a_Window, int a_Property, int a_Value) override; + virtual void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle) override; + virtual void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) override; + virtual void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage) override; + virtual void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override; + virtual void SendBlockChanges (int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes) override; + virtual void SendChat (const AString & a_Message) override; + virtual void SendChat (const cCompositeChat & a_Message) override; + virtual void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) override; + virtual void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player) override; + virtual void SendDestroyEntity (const cEntity & a_Entity) override; + virtual void SendDisconnect (const AString & a_Reason) override; + virtual void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) override; + virtual void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ) override; ///< Request the client to open up the sign editor for the sign (1.6+) + virtual void SendEntityAnimation (const cEntity & a_Entity, char a_Animation) override; + virtual void SendEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration) override; + virtual void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) override; + virtual void SendEntityHeadLook (const cEntity & a_Entity) override; + virtual void SendEntityLook (const cEntity & a_Entity) override; + virtual void SendEntityMetadata (const cEntity & a_Entity) override; + virtual void SendEntityProperties (const cEntity & a_Entity) override; + virtual void SendEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; + virtual void SendEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; + virtual void SendEntityStatus (const cEntity & a_Entity, char a_Status) override; + virtual void SendEntityVelocity (const cEntity & a_Entity) override; + virtual void SendExperience (void) override; + virtual void SendExperienceOrb (const cExpOrb & a_ExpOrb) override; + virtual void SendExplosion (double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion) override; + virtual void SendGameMode (eGameMode a_GameMode) override; + virtual void SendHealth (void) override; + virtual void SendInventorySlot (char a_WindowID, short a_SlotNum, const cItem & a_Item) override; + virtual void SendKeepAlive (int a_PingID) override; + virtual void SendLogin (const cPlayer & a_Player, const cWorld & a_World) override; + virtual void SendLoginSuccess (void) override; + virtual void SendMapColumn (int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length, unsigned int m_Scale) override; + virtual void SendMapDecorators (int a_ID, const cMapDecoratorList & a_Decorators, unsigned int m_Scale) override; + virtual void SendMapInfo (int a_ID, unsigned int a_Scale) override; + virtual void SendPaintingSpawn (const cPainting & a_Painting) override; + virtual void SendParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount) override; + virtual void SendPickupSpawn (const cPickup & a_Pickup) override; + virtual void SendPlayerAbilities (void) override; + virtual void SendPlayerListAddPlayer (const cPlayer & a_Player) override; + virtual void SendPlayerListRemovePlayer (const cPlayer & a_Player) override; + virtual void SendPlayerListUpdateGameMode (const cPlayer & a_Player) override; + virtual void SendPlayerListUpdatePing (const cPlayer & a_Player) override; + virtual void SendPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName) override; + virtual void SendPlayerMaxSpeed (void) override; + virtual void SendPlayerMoveLook (void) override; + virtual void SendPlayerPosition (void) override; + virtual void SendPlayerSpawn (const cPlayer & a_Player) override; + virtual void SendPluginMessage (const AString & a_Channel, const AString & a_Message) override; + virtual void SendRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID) override; + virtual void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) override; + virtual void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) override; + virtual void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) override; + virtual void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) override; + virtual void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) override; + virtual void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock) override; + virtual void SendSpawnMob (const cMonster & a_Mob) override; + virtual void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) override; + virtual void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) override; + virtual void SendStatistics (const cStatManager & a_Manager) override; + virtual void SendTabCompletionResults (const AStringVector & a_Results) override; + virtual void SendTeleportEntity (const cEntity & a_Entity) override; + virtual void SendThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ) override; + virtual void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay, bool a_DoDaylightCycle) override; + virtual void SendUnloadChunk (int a_ChunkX, int a_ChunkZ) override; + virtual void SendUpdateBlockEntity (cBlockEntity & a_BlockEntity) override; + virtual void SendUpdateSign (int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4) override; + virtual void SendUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) override; + virtual void SendWeather (eWeather a_Weather) override; + virtual void SendWholeInventory (const cWindow & a_Window) override; + virtual void SendWindowClose (const cWindow & a_Window) override; + virtual void SendWindowOpen (const cWindow & a_Window) override; + virtual void SendWindowProperty (const cWindow & a_Window, int a_Property, int a_Value) override; virtual AString GetAuthServerID(void) override { return m_AuthServerID; } @@ -251,19 +256,19 @@ protected: /** Adds the received (unencrypted) data to m_ReceivedData, parses complete packets */ void AddReceivedData(const char * a_Data, size_t a_Size); - + /** Reads and handles the packet. The packet length and type have already been read. Returns true if the packet was understood, false if it was an unknown packet */ bool HandlePacket(cByteBuffer & a_ByteBuffer, UInt32 a_PacketType); - + // Packet handlers while in the Status state (m_State == 1): - void HandlePacketStatusPing (cByteBuffer & a_ByteBuffer); + void HandlePacketStatusPing(cByteBuffer & a_ByteBuffer); virtual void HandlePacketStatusRequest(cByteBuffer & a_ByteBuffer); - + // Packet handlers while in the Login state (m_State == 2): void HandlePacketLoginEncryptionResponse(cByteBuffer & a_ByteBuffer); - void HandlePacketLoginStart (cByteBuffer & a_ByteBuffer); + void HandlePacketLoginStart(cByteBuffer & a_ByteBuffer); // Packet handlers while in the Game state (m_State == 3): void HandlePacketAnimation (cByteBuffer & a_ByteBuffer); @@ -290,25 +295,23 @@ protected: void HandlePacketWindowClick (cByteBuffer & a_ByteBuffer); void HandlePacketWindowClose (cByteBuffer & a_ByteBuffer); + /** Parses Vanilla plugin messages into specific ClientHandle calls. + The message payload is still in the bytebuffer, to be read by this function. */ + void HandleVanillaPluginMessage(cByteBuffer & a_ByteBuffer, const AString & a_Channel, short a_PayloadLength); - /** Writes an entire packet into the output stream. a_Packet is expected to start with the packet type; data length is prepended here. */ - void WritePacket(cByteBuffer & a_Packet); - /** Sends the data to the client, encrypting them if needed. */ virtual void SendData(const char * a_Data, size_t a_Size) override; void SendCompass(const cWorld & a_World); /** Reads an item out of the received data, sets a_Item to the values read. Returns false if not enough received data */ - bool ReadItem(cByteBuffer & a_ByteBuffer, cItem & a_Item); + virtual bool ReadItem(cByteBuffer & a_ByteBuffer, cItem & a_Item); /** Parses item metadata as read by ReadItem(), into the item enchantments. */ void ParseItemMetadata(cItem & a_Item, const AString & a_Metadata); void StartEncryption(const Byte * a_Key); - - /** Adds the chat part's style (represented by the part's stylestring) into the Json object. */ - void AddChatPartStyle(Json::Value & a_Value, const AString & a_PartStyle); + } ; diff --git a/src/Protocol/Protocol18x.cpp b/src/Protocol/Protocol18x.cpp new file mode 100644 index 000000000..acdb48cf7 --- /dev/null +++ b/src/Protocol/Protocol18x.cpp @@ -0,0 +1,3333 @@ + +// Protocol18x.cpp + +/* +Implements the 1.8.x protocol classes: + - cProtocol180 + - release 1.8.0 protocol (#47) +(others may be added later in the future for the 1.8 release series) +*/ + +#include "Globals.h" +#include "json/json.h" +#include "Protocol18x.h" +#include "ChunkDataSerializer.h" +#include "PolarSSL++/Sha1Checksum.h" + +#include "../ClientHandle.h" +#include "../Root.h" +#include "../Server.h" +#include "../World.h" +#include "../StringCompression.h" +#include "../CompositeChat.h" +#include "../Statistics.h" + +#include "../WorldStorage/FastNBT.h" +#include "../WorldStorage/EnchantmentSerializer.h" + +#include "../Entities/ExpOrb.h" +#include "../Entities/Minecart.h" +#include "../Entities/FallingBlock.h" +#include "../Entities/Painting.h" +#include "../Entities/Pickup.h" +#include "../Entities/Player.h" +#include "../Entities/ItemFrame.h" +#include "../Entities/ArrowEntity.h" +#include "../Entities/FireworkEntity.h" + +#include "../Mobs/IncludeAllMonsters.h" +#include "../UI/Window.h" + +#include "../BlockEntities/BeaconEntity.h" +#include "../BlockEntities/CommandBlockEntity.h" +#include "../BlockEntities/MobHeadEntity.h" +#include "../BlockEntities/FlowerPotEntity.h" +#include "Bindings/PluginManager.h" + + + + + +#define HANDLE_READ(ByteBuf, Proc, Type, Var) \ + Type Var; \ + if (!ByteBuf.Proc(Var))\ + {\ + return;\ + } + + + + + +#define HANDLE_PACKET_READ(ByteBuf, Proc, Type, Var) \ + Type Var; \ + { \ + if (!ByteBuf.Proc(Var)) \ + { \ + ByteBuf.CheckValid(); \ + return false; \ + } \ + ByteBuf.CheckValid(); \ + } + + + + + +const int MAX_ENC_LEN = 512; // Maximum size of the encrypted message; should be 128, but who knows... +const uLongf MAX_COMPRESSED_PACKET_LEN = 200 KiB; // Maximum size of compressed packets. + + + + + +// fwd: main.cpp: +extern bool g_ShouldLogCommIn, g_ShouldLogCommOut; + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cProtocol180: + +cProtocol180::cProtocol180(cClientHandle * a_Client, const AString & a_ServerAddress, UInt16 a_ServerPort, UInt32 a_State) : + super(a_Client), + m_ServerAddress(a_ServerAddress), + m_ServerPort(a_ServerPort), + m_State(a_State), + m_ReceivedData(32 KiB), + m_OutPacketBuffer(64 KiB), + m_OutPacketLenBuffer(20), // 20 bytes is more than enough for one VarInt + m_IsEncrypted(false), + m_LastSentDimension(dimNotSet) +{ + // Create the comm log file, if so requested: + if (g_ShouldLogCommIn || g_ShouldLogCommOut) + { + static int sCounter = 0; + cFile::CreateFolder("CommLogs"); + AString FileName = Printf("CommLogs/%x_%d__%s.log", (unsigned)time(NULL), sCounter++, a_Client->GetIPString().c_str()); + m_CommLogFile.Open(FileName, cFile::fmWrite); + } +} + + + + + +void cProtocol180::DataReceived(const char * a_Data, size_t a_Size) +{ + if (m_IsEncrypted) + { + Byte Decrypted[512]; + while (a_Size > 0) + { + size_t NumBytes = (a_Size > sizeof(Decrypted)) ? sizeof(Decrypted) : a_Size; + m_Decryptor.ProcessData(Decrypted, (Byte *)a_Data, NumBytes); + AddReceivedData((const char *)Decrypted, NumBytes); + a_Size -= NumBytes; + a_Data += NumBytes; + } + } + else + { + AddReceivedData(a_Data, a_Size); + } +} + + + + + +void cProtocol180::SendAttachEntity(const cEntity & a_Entity, const cEntity * a_Vehicle) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x1b); // Attach Entity packet + Pkt.WriteInt(a_Entity.GetUniqueID()); + Pkt.WriteInt((a_Vehicle != NULL) ? a_Vehicle->GetUniqueID() : 0); + Pkt.WriteBool(false); +} + + + + + +void cProtocol180::SendBlockAction(int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x24); // Block Action packet + Pkt.WritePosition(a_BlockX, a_BlockY, a_BlockZ); + Pkt.WriteByte(a_Byte1); + Pkt.WriteByte(a_Byte2); + Pkt.WriteVarInt(a_BlockType); +} + + + + + +void cProtocol180::SendBlockBreakAnim(int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x25); // Block Break Animation packet + Pkt.WriteVarInt(a_EntityID); + Pkt.WritePosition(a_BlockX, a_BlockY, a_BlockZ); + Pkt.WriteChar(a_Stage); +} + + + + + +void cProtocol180::SendBlockChange(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x23); // Block Change packet + Pkt.WritePosition(a_BlockX, a_BlockY, a_BlockZ); + Pkt.WriteVarInt(((UInt32)a_BlockType << 4) | ((UInt32)a_BlockMeta & 15)); +} + + + + + +void cProtocol180::SendBlockChanges(int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x22); // Multi Block Change packet + Pkt.WriteInt(a_ChunkX); + Pkt.WriteInt(a_ChunkZ); + Pkt.WriteVarInt((UInt32)a_Changes.size()); + for (sSetBlockVector::const_iterator itr = a_Changes.begin(), end = a_Changes.end(); itr != end; ++itr) + { + short Coords = (short) (itr->y | (itr->z << 8) | (itr->x << 12)); + Pkt.WriteShort(Coords); + Pkt.WriteVarInt((itr->BlockType & 0xFFF) << 4 | (itr->BlockMeta & 0xF)); + } // for itr - a_Changes[] +} + + + + + +void cProtocol180::SendChat(const AString & a_Message) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x02); // Chat Message packet + Pkt.WriteString(Printf("{\"text\":\"%s\"}", EscapeString(a_Message).c_str())); + Pkt.WriteChar(0); +} + + + + + +void cProtocol180::SendChat(const cCompositeChat & a_Message) +{ + ASSERT(m_State == 3); // In game mode? + + cWorld * World = m_Client->GetPlayer()->GetWorld(); + bool ShouldUseChatPrefixes = (World == NULL) ? false : World->ShouldUseChatPrefixes(); + + // Send the message to the client: + cPacketizer Pkt(*this, 0x02); + Pkt.WriteString(a_Message.CreateJsonString(ShouldUseChatPrefixes)); + Pkt.WriteChar(0); +} + + + + + +void cProtocol180::SendChunkData(int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) +{ + ASSERT(m_State == 3); // In game mode? + + // Serialize first, before creating the Packetizer (the packetizer locks a CS) + // This contains the flags and bitmasks, too + const AString & ChunkData = a_Serializer.Serialize(cChunkDataSerializer::RELEASE_1_8_0, a_ChunkX, a_ChunkZ); + + cCSLock Lock(m_CSPacket); + SendData(ChunkData.data(), ChunkData.size()); +} + + + + + +void cProtocol180::SendCollectEntity(const cEntity & a_Entity, const cPlayer & a_Player) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x0d); // Collect Item packet + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteVarInt(a_Player.GetUniqueID()); +} + + + + + +void cProtocol180::SendDestroyEntity(const cEntity & a_Entity) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x13); // Destroy Entities packet + Pkt.WriteVarInt(1); + Pkt.WriteVarInt(a_Entity.GetUniqueID()); +} + + + + + +void cProtocol180::SendDisconnect(const AString & a_Reason) +{ + switch (m_State) + { + case 2: + { + // During login: + cPacketizer Pkt(*this, 0); + Pkt.WriteString(Printf("{\"text\":\"%s\"}", EscapeString(a_Reason).c_str())); + break; + } + case 3: + { + // In-game: + cPacketizer Pkt(*this, 0x40); + Pkt.WriteString(Printf("{\"text\":\"%s\"}", EscapeString(a_Reason).c_str())); + break; + } + } +} + + + + + +void cProtocol180::SendEditSign(int a_BlockX, int a_BlockY, int a_BlockZ) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x36); // Sign Editor Open packet + Pkt.WritePosition(a_BlockX, a_BlockY, a_BlockZ); +} + + + + + +void cProtocol180::SendEntityEffect(const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x1D); // Entity Effect packet + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteByte(a_EffectID); + Pkt.WriteByte(a_Amplifier); + Pkt.WriteVarInt((UInt32)a_Duration); + Pkt.WriteBool(false); // Hide particles +} + + + + + +void cProtocol180::SendEntityEquipment(const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x04); // Entity Equipment packet + Pkt.WriteVarInt((UInt32)a_Entity.GetUniqueID()); + Pkt.WriteShort(a_SlotNum); + Pkt.WriteItem(a_Item); +} + + + + + +void cProtocol180::SendEntityHeadLook(const cEntity & a_Entity) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x19); // Entity Head Look packet + Pkt.WriteVarInt((UInt32)a_Entity.GetUniqueID()); + Pkt.WriteByteAngle(a_Entity.GetHeadYaw()); +} + + + + + +void cProtocol180::SendEntityLook(const cEntity & a_Entity) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x16); // Entity Look packet + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteByteAngle(a_Entity.GetYaw()); + Pkt.WriteByteAngle(a_Entity.GetPitch()); + Pkt.WriteBool(true); // TODO: IsOnGround() on entities +} + + + + + +void cProtocol180::SendEntityMetadata(const cEntity & a_Entity) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x1c); // Entity Metadata packet + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteEntityMetadata(a_Entity); + Pkt.WriteByte(0x7f); // The termination byte +} + + + + + +void cProtocol180::SendEntityProperties(const cEntity & a_Entity) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x20); // Entity Properties packet + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteEntityProperties(a_Entity); +} + + + + + +void cProtocol180::SendEntityRelMove(const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x15); // Entity Relative Move packet + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteByte(a_RelX); + Pkt.WriteByte(a_RelY); + Pkt.WriteByte(a_RelZ); + Pkt.WriteBool(true); // TODO: IsOnGround() on entities +} + + + + + +void cProtocol180::SendEntityRelMoveLook(const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x17); // Entity Look And Relative Move packet + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteByte(a_RelX); + Pkt.WriteByte(a_RelY); + Pkt.WriteByte(a_RelZ); + Pkt.WriteByteAngle(a_Entity.GetYaw()); + Pkt.WriteByteAngle(a_Entity.GetPitch()); + Pkt.WriteBool(true); // TODO: IsOnGround() on entities +} + + + + + +void cProtocol180::SendEntityStatus(const cEntity & a_Entity, char a_Status) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x1a); // Entity Status packet + Pkt.WriteInt(a_Entity.GetUniqueID()); + Pkt.WriteChar(a_Status); +} + + + + + +void cProtocol180::SendEntityVelocity(const cEntity & a_Entity) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x12); // Entity Velocity packet + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + // 400 = 8000 / 20 ... Conversion from our speed in m/s to 8000 m/tick + Pkt.WriteShort((short)(a_Entity.GetSpeedX() * 400)); + Pkt.WriteShort((short)(a_Entity.GetSpeedY() * 400)); + Pkt.WriteShort((short)(a_Entity.GetSpeedZ() * 400)); +} + + + + + +void cProtocol180::SendExplosion(double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x27); // Explosion packet + Pkt.WriteFloat((float)a_BlockX); + Pkt.WriteFloat((float)a_BlockY); + Pkt.WriteFloat((float)a_BlockZ); + Pkt.WriteFloat((float)a_Radius); + Pkt.WriteInt((int)a_BlocksAffected.size()); + for (cVector3iArray::const_iterator itr = a_BlocksAffected.begin(), end = a_BlocksAffected.end(); itr != end; ++itr) + { + Pkt.WriteChar((char)itr->x); + Pkt.WriteChar((char)itr->y); + Pkt.WriteChar((char)itr->z); + } // for itr - a_BlockAffected[] + Pkt.WriteFloat((float)a_PlayerMotion.x); + Pkt.WriteFloat((float)a_PlayerMotion.y); + Pkt.WriteFloat((float)a_PlayerMotion.z); +} + + + + + +void cProtocol180::SendGameMode(eGameMode a_GameMode) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x2b); // Change Game State packet + Pkt.WriteByte(3); // Reason: Change game mode + Pkt.WriteFloat((float)a_GameMode); +} + + + + + +void cProtocol180::SendHealth(void) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x06); // Update Health packet + cPlayer * Player = m_Client->GetPlayer(); + Pkt.WriteFloat((float)Player->GetHealth()); + Pkt.WriteVarInt((UInt32)Player->GetFoodLevel()); + Pkt.WriteFloat((float)Player->GetFoodSaturationLevel()); +} + + + + + +void cProtocol180::SendInventorySlot(char a_WindowID, short a_SlotNum, const cItem & a_Item) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x2f); // Set Slot packet + Pkt.WriteChar(a_WindowID); + Pkt.WriteShort(a_SlotNum); + Pkt.WriteItem(a_Item); +} + + + + + +void cProtocol180::SendKeepAlive(int a_PingID) +{ + // Drop the packet if the protocol is not in the Game state yet (caused a client crash): + if (m_State != 3) + { + LOGWARNING("Trying to send a KeepAlive packet to a player who's not yet fully logged in (%d). The protocol class prevented the packet.", m_State); + return; + } + + cPacketizer Pkt(*this, 0x00); // Keep Alive packet + Pkt.WriteVarInt(a_PingID); +} + + + + + +void cProtocol180::SendLogin(const cPlayer & a_Player, const cWorld & a_World) +{ + // Send the Join Game packet: + { + cServer * Server = cRoot::Get()->GetServer(); + cPacketizer Pkt(*this, 0x01); // Join Game packet + Pkt.WriteInt(a_Player.GetUniqueID()); + Pkt.WriteByte((Byte)a_Player.GetEffectiveGameMode() | (Server->IsHardcore() ? 0x08 : 0)); // Hardcore flag bit 4 + Pkt.WriteChar((char)a_World.GetDimension()); + Pkt.WriteByte(2); // TODO: Difficulty (set to Normal) + Pkt.WriteByte(Server->GetMaxPlayers()); + Pkt.WriteString("default"); // Level type - wtf? + Pkt.WriteBool(false); // Reduced Debug Info - wtf? + } + m_LastSentDimension = a_World.GetDimension(); + + // Send the spawn position: + { + cPacketizer Pkt(*this, 0x05); // Spawn Position packet + Pkt.WritePosition((int)a_World.GetSpawnX(), (int)a_World.GetSpawnY(), (int)a_World.GetSpawnZ()); + } + + // Send the server difficulty: + { + cPacketizer Pkt(*this, 0x41); + Pkt.WriteChar(1); + } + + // Send player abilities: + SendPlayerAbilities(); +} + + + + +void cProtocol180::SendLoginSuccess(void) +{ + ASSERT(m_State == 2); // State: login? + + // Enable compression: + { + cPacketizer Pkt(*this, 0x03); // Set compression packet + Pkt.WriteVarInt(256); + } + + m_State = 3; // State = Game + + { + cPacketizer Pkt(*this, 0x02); // Login success packet + Pkt.WriteString(cMojangAPI::MakeUUIDDashed(m_Client->GetUUID())); + Pkt.WriteString(m_Client->GetUsername()); + } +} + + + + + +void cProtocol180::SendPaintingSpawn(const cPainting & a_Painting) +{ + ASSERT(m_State == 3); // In game mode? + double PosX = a_Painting.GetPosX(); + double PosY = a_Painting.GetPosY(); + double PosZ = a_Painting.GetPosZ(); + + switch (a_Painting.GetDirection()) + { + case 0: PosZ += 1; break; + case 1: PosX -= 1; break; + case 2: PosZ -= 1; break; + case 3: PosX += 1; break; + } + + cPacketizer Pkt(*this, 0x10); // Spawn Painting packet + Pkt.WriteVarInt(a_Painting.GetUniqueID()); + Pkt.WriteString(a_Painting.GetName().c_str()); + Pkt.WritePosition((int)PosX, (int)PosY, (int)PosZ); + Pkt.WriteChar(a_Painting.GetDirection()); +} + + + + + +void cProtocol180::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length, unsigned int m_Scale) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x34); + Pkt.WriteVarInt(a_ID); + Pkt.WriteByte(m_Scale); + + Pkt.WriteVarInt(0); + Pkt.WriteByte(1); + Pkt.WriteByte(a_Length); + Pkt.WriteByte(a_X); + Pkt.WriteByte(a_Y); + + Pkt.WriteVarInt(a_Length); + for (unsigned int i = 0; i < a_Length; ++i) + { + Pkt.WriteByte(a_Colors[i]); + } +} + + + + + +void cProtocol180::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decorators, unsigned int m_Scale) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x34); + Pkt.WriteVarInt(a_ID); + Pkt.WriteByte(m_Scale); + Pkt.WriteVarInt(a_Decorators.size()); + + for (cMapDecoratorList::const_iterator it = a_Decorators.begin(); it != a_Decorators.end(); ++it) + { + Pkt.WriteByte((it->GetType() << 4) | (it->GetRot() & 0xf)); + Pkt.WriteByte(it->GetPixelX()); + Pkt.WriteByte(it->GetPixelZ()); + } + + Pkt.WriteByte(0); +} + + + + + +void cProtocol180::SendMapInfo(int a_ID, unsigned int a_Scale) +{ + UNUSED(a_ID); + UNUSED(a_Scale); + + // This packet was removed in 1.8 +} + + + + + +void cProtocol180::SendPickupSpawn(const cPickup & a_Pickup) +{ + ASSERT(m_State == 3); // In game mode? + + { + cPacketizer Pkt(*this, 0x0e); // Spawn Object packet + Pkt.WriteVarInt(a_Pickup.GetUniqueID()); + Pkt.WriteByte(2); // Type = Pickup + Pkt.WriteFPInt(a_Pickup.GetPosX()); + Pkt.WriteFPInt(a_Pickup.GetPosY()); + Pkt.WriteFPInt(a_Pickup.GetPosZ()); + Pkt.WriteByteAngle(a_Pickup.GetYaw()); + Pkt.WriteByteAngle(a_Pickup.GetPitch()); + Pkt.WriteInt(0); // No object data + } + + { + cPacketizer Pkt(*this, 0x1c); // Entity Metadata packet + Pkt.WriteVarInt(a_Pickup.GetUniqueID()); + Pkt.WriteByte((0x05 << 5) | 10); // Slot type + index 10 + Pkt.WriteItem(a_Pickup.GetItem()); + Pkt.WriteByte(0x7f); // End of metadata + } +} + + + + + +void cProtocol180::SendPlayerAbilities(void) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x39); // Player Abilities packet + Byte Flags = 0; + cPlayer * Player = m_Client->GetPlayer(); + if (Player->IsGameModeCreative()) + { + Flags |= 0x01; + Flags |= 0x08; // Godmode, used for creative + } + if (Player->IsFlying()) + { + Flags |= 0x02; + } + if (Player->CanFly()) + { + Flags |= 0x04; + } + Pkt.WriteByte(Flags); + Pkt.WriteFloat((float)(0.05 * Player->GetFlyingMaxSpeed())); + Pkt.WriteFloat((float)(0.1 * Player->GetNormalMaxSpeed())); +} + + + + + +void cProtocol180::SendEntityAnimation(const cEntity & a_Entity, char a_Animation) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x0b); // Animation packet + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteChar(a_Animation); +} + + + + + +void cProtocol180::SendParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount) +{ + ASSERT(m_State == 3); // In game mode? + int ParticleID = GetParticleID(a_ParticleName); + + cPacketizer Pkt(*this, 0x2A); + Pkt.WriteInt(ParticleID); + Pkt.WriteBool(false); + Pkt.WriteFloat(a_SrcX); + Pkt.WriteFloat(a_SrcY); + Pkt.WriteFloat(a_SrcZ); + Pkt.WriteFloat(a_OffsetX); + Pkt.WriteFloat(a_OffsetY); + Pkt.WriteFloat(a_OffsetZ); + Pkt.WriteFloat(a_ParticleData); + Pkt.WriteInt(a_ParticleAmount); +} + + + + + +void cProtocol180::SendPlayerListAddPlayer(const cPlayer & a_Player) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x38); // Playerlist Item packet + Pkt.WriteVarInt(0); + Pkt.WriteVarInt(1); + Pkt.WriteUUID(a_Player.GetUUID()); + Pkt.WriteString(a_Player.GetPlayerListName()); + + const Json::Value & Properties = a_Player.GetClientHandle()->GetProperties(); + Pkt.WriteVarInt(Properties.size()); + for (Json::Value::iterator itr = Properties.begin(), end = Properties.end(); itr != end; ++itr) + { + Pkt.WriteString(((Json::Value)*itr).get("name", "").asString()); + Pkt.WriteString(((Json::Value)*itr).get("value", "").asString()); + AString Signature = ((Json::Value)*itr).get("signature", "").asString(); + if (Signature.empty()) + { + Pkt.WriteBool(false); + } + else + { + Pkt.WriteBool(true); + Pkt.WriteString(Signature); + } + } + + Pkt.WriteVarInt((UInt32)a_Player.GetGameMode()); + Pkt.WriteVarInt((UInt32)a_Player.GetClientHandle()->GetPing()); + Pkt.WriteBool(false); +} + + + + + +void cProtocol180::SendPlayerListRemovePlayer(const cPlayer & a_Player) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x38); // Playerlist Item packet + Pkt.WriteVarInt(4); + Pkt.WriteVarInt(1); + Pkt.WriteUUID(a_Player.GetUUID()); +} + + + + + +void cProtocol180::SendPlayerListUpdateGameMode(const cPlayer & a_Player) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x38); // Playerlist Item packet + Pkt.WriteVarInt(1); + Pkt.WriteVarInt(1); + Pkt.WriteUUID(a_Player.GetUUID()); + Pkt.WriteVarInt((UInt32)a_Player.GetGameMode()); +} + + + + + +void cProtocol180::SendPlayerListUpdatePing(const cPlayer & a_Player) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x38); // Playerlist Item packet + Pkt.WriteVarInt(2); + Pkt.WriteVarInt(1); + Pkt.WriteUUID(a_Player.GetUUID()); + Pkt.WriteVarInt((UInt32)a_Player.GetClientHandle()->GetPing()); +} + + + + + +void cProtocol180::SendPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x38); // Playerlist Item packet + Pkt.WriteVarInt(3); + Pkt.WriteVarInt(1); + Pkt.WriteUUID(a_Player.GetUUID()); + + if (a_CustomName.empty()) + { + Pkt.WriteBool(false); + } + else + { + Pkt.WriteBool(true); + Pkt.WriteString(Printf("{\"text\":\"%s\"}", a_CustomName.c_str())); + } +} + + + + + +void cProtocol180::SendPlayerMaxSpeed(void) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x20); // Entity Properties + cPlayer * Player = m_Client->GetPlayer(); + Pkt.WriteVarInt(Player->GetUniqueID()); + Pkt.WriteInt(1); // Count + Pkt.WriteString("generic.movementSpeed"); + // The default game speed is 0.1, multiply that value by the relative speed: + Pkt.WriteDouble(0.1 * Player->GetNormalMaxSpeed()); + if (Player->IsSprinting()) + { + Pkt.WriteVarInt(1); // Modifier count + Pkt.WriteInt64(0x662a6b8dda3e4c1c); + Pkt.WriteInt64(0x881396ea6097278d); // UUID of the modifier + Pkt.WriteDouble(Player->GetSprintingMaxSpeed() - Player->GetNormalMaxSpeed()); + Pkt.WriteByte(2); + } + else + { + Pkt.WriteVarInt(0); // Modifier count + } +} + + + + + +void cProtocol180::SendPlayerMoveLook(void) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x08); // Player Position And Look packet + cPlayer * Player = m_Client->GetPlayer(); + Pkt.WriteDouble(Player->GetPosX()); + + // The "+ 0.001" is there because otherwise the player falls through the block they were standing on. + Pkt.WriteDouble(Player->GetStance() + 0.001); + + Pkt.WriteDouble(Player->GetPosZ()); + Pkt.WriteFloat((float)Player->GetYaw()); + Pkt.WriteFloat((float)Player->GetPitch()); + Pkt.WriteByte(0); +} + + + + + +void cProtocol180::SendPlayerPosition(void) +{ + // There is no dedicated packet for this, send the whole thing: + SendPlayerMoveLook(); +} + + + + + +void cProtocol180::SendPlayerSpawn(const cPlayer & a_Player) +{ + // Called to spawn another player for the client + cPacketizer Pkt(*this, 0x0c); // Spawn Player packet + Pkt.WriteVarInt(a_Player.GetUniqueID()); + Pkt.WriteUUID(cMojangAPI::MakeUUIDShort(a_Player.GetUUID())); + Pkt.WriteFPInt(a_Player.GetPosX()); + Pkt.WriteFPInt(a_Player.GetPosY()); + Pkt.WriteFPInt(a_Player.GetPosZ()); + Pkt.WriteByteAngle(a_Player.GetYaw()); + Pkt.WriteByteAngle(a_Player.GetPitch()); + short ItemType = a_Player.GetEquippedItem().IsEmpty() ? 0 : a_Player.GetEquippedItem().m_ItemType; + Pkt.WriteShort(ItemType); + Pkt.WriteByte((3 << 5) | 6); // Metadata: float + index 6 + Pkt.WriteFloat((float)a_Player.GetHealth()); + Pkt.WriteByte((4 << 5 | (2 & 0x1F)) & 0xFF); + Pkt.WriteString(a_Player.GetName()); + Pkt.WriteByte(0x7f); // Metadata: end +} + + + + + +void cProtocol180::SendPluginMessage(const AString & a_Channel, const AString & a_Message) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x3f); + Pkt.WriteString(a_Channel); + Pkt.WriteBuf(a_Message.data(), a_Message.size()); +} + + + + + +void cProtocol180::SendRemoveEntityEffect(const cEntity & a_Entity, int a_EffectID) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x1e); + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteByte(a_EffectID); +} + + + + + +void cProtocol180::SendRespawn(eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) +{ + if ((m_LastSentDimension == a_Dimension) && !a_ShouldIgnoreDimensionChecks) + { + // Must not send a respawn for the world with the same dimension, the client goes cuckoo if we do (unless we are respawning from death) + return; + } + + cPacketizer Pkt(*this, 0x07); // Respawn packet + cPlayer * Player = m_Client->GetPlayer(); + Pkt.WriteInt((int)a_Dimension); + Pkt.WriteByte(2); // TODO: Difficulty (set to Normal) + Pkt.WriteByte((Byte)Player->GetEffectiveGameMode()); + Pkt.WriteString("default"); + m_LastSentDimension = a_Dimension; +} + + + + + +void cProtocol180::SendExperience(void) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x1f); // Experience Packet + cPlayer * Player = m_Client->GetPlayer(); + Pkt.WriteFloat(Player->GetXpPercentage()); + Pkt.WriteVarInt((UInt32)Player->GetXpLevel()); + Pkt.WriteVarInt((UInt32)Player->GetCurrentXp()); +} + + + + + +void cProtocol180::SendExperienceOrb(const cExpOrb & a_ExpOrb) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x11); + Pkt.WriteVarInt(a_ExpOrb.GetUniqueID()); + Pkt.WriteFPInt(a_ExpOrb.GetPosX()); + Pkt.WriteFPInt(a_ExpOrb.GetPosY()); + Pkt.WriteFPInt(a_ExpOrb.GetPosZ()); + Pkt.WriteShort(a_ExpOrb.GetReward()); +} + + + + + +void cProtocol180::SendScoreboardObjective(const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x3b); + Pkt.WriteString(a_Name); + Pkt.WriteByte(a_Mode); + if ((a_Mode == 0) || (a_Mode == 2)) + { + Pkt.WriteString(a_DisplayName); + Pkt.WriteString("integer"); + } +} + + + + + +void cProtocol180::SendScoreUpdate(const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x3c); + Pkt.WriteString(a_Player); + Pkt.WriteByte(a_Mode); + Pkt.WriteString(a_Objective); + + if (a_Mode != 1) + { + Pkt.WriteVarInt((UInt32) a_Score); + } +} + + + + + +void cProtocol180::SendDisplayObjective(const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x3d); + Pkt.WriteByte((int) a_Display); + Pkt.WriteString(a_Objective); +} + + + + + +void cProtocol180::SendSoundEffect(const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x29); // Sound Effect packet + Pkt.WriteString(a_SoundName); + Pkt.WriteInt((int)(a_X * 8.0)); + Pkt.WriteInt((int)(a_Y * 8.0)); + Pkt.WriteInt((int)(a_Z * 8.0)); + Pkt.WriteFloat(a_Volume); + Pkt.WriteByte((Byte)(a_Pitch * 63)); +} + + + + + +void cProtocol180::SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x28); // Effect packet + Pkt.WriteInt(a_EffectID); + Pkt.WritePosition(a_SrcX, a_SrcY, a_SrcZ); + Pkt.WriteInt(a_Data); + Pkt.WriteBool(false); +} + + + + + +void cProtocol180::SendSpawnFallingBlock(const cFallingBlock & a_FallingBlock) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x0e); // Spawn Object packet + Pkt.WriteVarInt(a_FallingBlock.GetUniqueID()); + Pkt.WriteByte(70); // Falling block + Pkt.WriteFPInt(a_FallingBlock.GetPosX()); + Pkt.WriteFPInt(a_FallingBlock.GetPosY()); + Pkt.WriteFPInt(a_FallingBlock.GetPosZ()); + Pkt.WriteByteAngle(a_FallingBlock.GetYaw()); + Pkt.WriteByteAngle(a_FallingBlock.GetPitch()); + Pkt.WriteInt(((int)a_FallingBlock.GetBlockType()) | (((int)a_FallingBlock.GetBlockMeta()) << 12)); + Pkt.WriteShort((short)(a_FallingBlock.GetSpeedX() * 400)); + Pkt.WriteShort((short)(a_FallingBlock.GetSpeedY() * 400)); + Pkt.WriteShort((short)(a_FallingBlock.GetSpeedZ() * 400)); +} + + + + + +void cProtocol180::SendSpawnMob(const cMonster & a_Mob) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x0f); // Spawn Mob packet + Pkt.WriteVarInt(a_Mob.GetUniqueID()); + Pkt.WriteByte((Byte)a_Mob.GetMobType()); + Pkt.WriteFPInt(a_Mob.GetPosX()); + Pkt.WriteFPInt(a_Mob.GetPosY()); + Pkt.WriteFPInt(a_Mob.GetPosZ()); + Pkt.WriteByteAngle(a_Mob.GetPitch()); + Pkt.WriteByteAngle(a_Mob.GetHeadYaw()); + Pkt.WriteByteAngle(a_Mob.GetYaw()); + Pkt.WriteShort((short)(a_Mob.GetSpeedX() * 400)); + Pkt.WriteShort((short)(a_Mob.GetSpeedY() * 400)); + Pkt.WriteShort((short)(a_Mob.GetSpeedZ() * 400)); + Pkt.WriteEntityMetadata(a_Mob); + Pkt.WriteByte(0x7f); // Metadata terminator +} + + + + + +void cProtocol180::SendSpawnObject(const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) +{ + ASSERT(m_State == 3); // In game mode? + double PosX = a_Entity.GetPosX(); + double PosZ = a_Entity.GetPosZ(); + double Yaw = a_Entity.GetYaw(); + if (a_ObjectType == 71) + { + FixItemFramePositions(a_ObjectData, PosX, PosZ, Yaw); + } + + cPacketizer Pkt(*this, 0xe); // Spawn Object packet + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteByte(a_ObjectType); + Pkt.WriteFPInt(PosX); + Pkt.WriteFPInt(a_Entity.GetPosY()); + Pkt.WriteFPInt(PosZ); + Pkt.WriteByteAngle(a_Entity.GetPitch()); + Pkt.WriteByteAngle(Yaw); + Pkt.WriteInt(a_ObjectData); + if (a_ObjectData != 0) + { + Pkt.WriteShort((short)(a_Entity.GetSpeedX() * 400)); + Pkt.WriteShort((short)(a_Entity.GetSpeedY() * 400)); + Pkt.WriteShort((short)(a_Entity.GetSpeedZ() * 400)); + } +} + + + + + +void cProtocol180::SendSpawnVehicle(const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0xe); // Spawn Object packet + Pkt.WriteVarInt(a_Vehicle.GetUniqueID()); + Pkt.WriteByte(a_VehicleType); + Pkt.WriteFPInt(a_Vehicle.GetPosX()); + Pkt.WriteFPInt(a_Vehicle.GetPosY()); + Pkt.WriteFPInt(a_Vehicle.GetPosZ()); + Pkt.WriteByteAngle(a_Vehicle.GetPitch()); + Pkt.WriteByteAngle(a_Vehicle.GetYaw()); + Pkt.WriteInt(a_VehicleSubType); + if (a_VehicleSubType != 0) + { + Pkt.WriteShort((short)(a_Vehicle.GetSpeedX() * 400)); + Pkt.WriteShort((short)(a_Vehicle.GetSpeedY() * 400)); + Pkt.WriteShort((short)(a_Vehicle.GetSpeedZ() * 400)); + } +} + + + + + +void cProtocol180::SendStatistics(const cStatManager & a_Manager) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x37); + Pkt.WriteVarInt(statCount); // TODO 2014-05-11 xdot: Optimization: Send "dirty" statistics only + + for (size_t i = 0; i < (size_t)statCount; ++i) + { + StatValue Value = a_Manager.GetValue((eStatistic) i); + const AString & StatName = cStatInfo::GetName((eStatistic) i); + + Pkt.WriteString(StatName); + Pkt.WriteVarInt(Value); + } +} + + + + + +void cProtocol180::SendTabCompletionResults(const AStringVector & a_Results) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x3a); // Tab-Complete packet + Pkt.WriteVarInt((int)a_Results.size()); + + for (AStringVector::const_iterator itr = a_Results.begin(), end = a_Results.end(); itr != end; ++itr) + { + Pkt.WriteString(*itr); + } +} + + + + + +void cProtocol180::SendTeleportEntity(const cEntity & a_Entity) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x18); + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WriteFPInt(a_Entity.GetPosX()); + Pkt.WriteFPInt(a_Entity.GetPosY()); + Pkt.WriteFPInt(a_Entity.GetPosZ()); + Pkt.WriteByteAngle(a_Entity.GetYaw()); + Pkt.WriteByteAngle(a_Entity.GetPitch()); + Pkt.WriteBool(true); // TODO: IsOnGrond() on entities +} + + + + + +void cProtocol180::SendThunderbolt(int a_BlockX, int a_BlockY, int a_BlockZ) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x2c); // Spawn Global Entity packet + Pkt.WriteVarInt(0); // EntityID = 0, always + Pkt.WriteByte(1); // Type = Thunderbolt + Pkt.WriteFPInt(a_BlockX); + Pkt.WriteFPInt(a_BlockY); + Pkt.WriteFPInt(a_BlockZ); +} + + + + + +void cProtocol180::SendTimeUpdate(Int64 a_WorldAge, Int64 a_TimeOfDay, bool a_DoDaylightCycle) +{ + ASSERT(m_State == 3); // In game mode? + if (!a_DoDaylightCycle) + { + // When writing a "-" before the number the client ignores it but it will stop the client-side time expiration. + a_TimeOfDay = std::min(-a_TimeOfDay, -1LL); + } + + cPacketizer Pkt(*this, 0x03); + Pkt.WriteInt64(a_WorldAge); + Pkt.WriteInt64(a_TimeOfDay); +} + + + + + +void cProtocol180::SendUnloadChunk(int a_ChunkX, int a_ChunkZ) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x21); // Chunk Data packet + Pkt.WriteInt(a_ChunkX); + Pkt.WriteInt(a_ChunkZ); + Pkt.WriteBool(true); + Pkt.WriteShort(0); // Primary bitmap + Pkt.WriteVarInt(0); // Data size +} + + + + +void cProtocol180::SendUpdateBlockEntity(cBlockEntity & a_BlockEntity) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x35); // Update tile entity packet + Pkt.WritePosition(a_BlockEntity.GetPosX(), a_BlockEntity.GetPosY(), a_BlockEntity.GetPosZ()); + + Byte Action = 0; + switch (a_BlockEntity.GetBlockType()) + { + case E_BLOCK_MOB_SPAWNER: Action = 1; break; // Update mob spawner spinny mob thing + case E_BLOCK_COMMAND_BLOCK: Action = 2; break; // Update command block text + case E_BLOCK_BEACON: Action = 3; break; // Update beacon entity + case E_BLOCK_HEAD: Action = 4; break; // Update Mobhead entity + case E_BLOCK_FLOWER_POT: Action = 5; break; // Update flower pot + default: ASSERT(!"Unhandled or unimplemented BlockEntity update request!"); break; + } + Pkt.WriteByte(Action); + + Pkt.WriteBlockEntity(a_BlockEntity); +} + + + + + +void cProtocol180::SendUpdateSign(int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x33); + Pkt.WritePosition(a_BlockX, a_BlockY, a_BlockZ); + + Json::StyledWriter JsonWriter; + AString Lines[] = { a_Line1, a_Line2, a_Line3, a_Line4 }; + for (size_t i = 0; i < ARRAYCOUNT(Lines); i++) + { + Json::Value RootValue; + RootValue["text"] = Lines[i]; + Pkt.WriteString(JsonWriter.write(RootValue).c_str()); + } +} + + + + + +void cProtocol180::SendUseBed(const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x0a); + Pkt.WriteVarInt(a_Entity.GetUniqueID()); + Pkt.WritePosition(a_BlockX, a_BlockY, a_BlockZ); +} + + + + + +void cProtocol180::SendWeather(eWeather a_Weather) +{ + ASSERT(m_State == 3); // In game mode? + + { + cPacketizer Pkt(*this, 0x2b); // Change Game State packet + Pkt.WriteByte((a_Weather == wSunny) ? 1 : 2); // End rain / begin rain + Pkt.WriteFloat(0); // Unused for weather + } + + // TODO: Fade effect, somehow +} + + + + + +void cProtocol180::SendWholeInventory(const cWindow & a_Window) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x30); // Window Items packet + Pkt.WriteChar(a_Window.GetWindowID()); + Pkt.WriteShort(a_Window.GetNumSlots()); + cItems Slots; + a_Window.GetSlots(*(m_Client->GetPlayer()), Slots); + for (cItems::const_iterator itr = Slots.begin(), end = Slots.end(); itr != end; ++itr) + { + Pkt.WriteItem(*itr); + } // for itr - Slots[] +} + + + + + +void cProtocol180::SendWindowClose(const cWindow & a_Window) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x2e); + Pkt.WriteChar(a_Window.GetWindowID()); +} + + + + + +void cProtocol180::SendWindowOpen(const cWindow & a_Window) +{ + ASSERT(m_State == 3); // In game mode? + + if (a_Window.GetWindowType() < 0) + { + // Do not send this packet for player inventory windows + return; + } + + cPacketizer Pkt(*this, 0x2d); + Pkt.WriteChar(a_Window.GetWindowID()); + Pkt.WriteString(a_Window.GetWindowTypeName()); + Pkt.WriteString(Printf("{\"text\":\"%s\"}", a_Window.GetWindowTitle().c_str())); + + switch (a_Window.GetWindowType()) + { + case cWindow::wtWorkbench: + case cWindow::wtEnchantment: + case cWindow::wtAnvil: + { + Pkt.WriteChar(0); + break; + } + default: + { + Pkt.WriteChar(a_Window.GetNumNonInventorySlots()); + break; + } + } + + if (a_Window.GetWindowType() == cWindow::wtAnimalChest) + { + Pkt.WriteInt(0); // TODO: The animal's EntityID + } +} + + + + + +void cProtocol180::SendWindowProperty(const cWindow & a_Window, int a_Property, int a_Value) +{ + ASSERT(m_State == 3); // In game mode? + + cPacketizer Pkt(*this, 0x31); // Window Property packet + Pkt.WriteChar(a_Window.GetWindowID()); + Pkt.WriteShort(a_Property); + Pkt.WriteShort(a_Value); +} + + + + + +bool cProtocol180::CompressPacket(const AString & a_Packet, AString & a_CompressedData) +{ + // Compress the data: + char CompressedData[MAX_COMPRESSED_PACKET_LEN]; + + uLongf CompressedSize = compressBound(a_Packet.size()); + if (CompressedSize >= MAX_COMPRESSED_PACKET_LEN) + { + ASSERT(!"Too high packet size."); + return false; + } + + int Status = compress2((Bytef*)CompressedData, &CompressedSize, (const Bytef*)a_Packet.data(), a_Packet.size(), Z_DEFAULT_COMPRESSION); + if (Status != Z_OK) + { + return false; + } + + AString LengthData; + cByteBuffer Buffer(20); + Buffer.WriteVarInt((UInt32)a_Packet.size()); + Buffer.ReadAll(LengthData); + Buffer.CommitRead(); + + Buffer.WriteVarInt(CompressedSize + LengthData.size()); + Buffer.WriteVarInt(a_Packet.size()); + Buffer.ReadAll(LengthData); + Buffer.CommitRead(); + + a_CompressedData.clear(); + a_CompressedData.reserve(LengthData.size() + CompressedSize); + a_CompressedData.append(LengthData.data(), LengthData.size()); + a_CompressedData.append(CompressedData, CompressedSize); + return true; +} + + + + + +int cProtocol180::GetParticleID(const AString & a_ParticleName) +{ + static bool IsInitialized = false; + static std::map<AString, int> ParticleMap; + if (!IsInitialized) + { + // Initialize the ParticleMap: + ParticleMap["explode"] = 0; + ParticleMap["largeexplode"] = 1; + ParticleMap["hugeexplosion"] = 2; + ParticleMap["fireworksspark"] = 3; + ParticleMap["bubble"] = 4; + ParticleMap["splash"] = 5; + ParticleMap["wake"] = 6; + ParticleMap["suspended"] = 7; + ParticleMap["depthsuspend"] = 8; + ParticleMap["crit"] = 9; + ParticleMap["magiccrit"] = 10; + ParticleMap["smoke"] = 11; + ParticleMap["largesmoke"] = 12; + ParticleMap["spell"] = 13; + ParticleMap["instantspell"] = 14; + ParticleMap["mobspell"] = 15; + ParticleMap["mobspellambient"] = 16; + ParticleMap["witchmagic"] = 17; + ParticleMap["dripwater"] = 18; + ParticleMap["driplava"] = 19; + ParticleMap["angryvillager"] = 20; + ParticleMap["happyVillager"] = 21; + ParticleMap["townaura"] = 22; + ParticleMap["note"] = 23; + ParticleMap["portal"] = 24; + ParticleMap["enchantmenttable"] = 25; + ParticleMap["flame"] = 26; + ParticleMap["lava"] = 27; + ParticleMap["footstep"] = 28; + ParticleMap["cloud"] = 29; + ParticleMap["reddust"] = 30; + ParticleMap["snowballpoof"] = 31; + ParticleMap["snowshovel"] = 32; + ParticleMap["slime"] = 33; + ParticleMap["heart"] = 34; + ParticleMap["barrier"] = 35; + ParticleMap["iconcrack"] = 36; + ParticleMap["blockcrack"] = 37; + ParticleMap["blockdust"] = 38; + ParticleMap["droplet"] = 39; + ParticleMap["take"] = 40; + ParticleMap["mobappearance"] = 41; + } + + AString ParticleName = StrToLower(a_ParticleName); + if (ParticleMap.find(ParticleName) == ParticleMap.end()) + { + LOGWARNING("Unknown particle: %s", a_ParticleName.c_str()); + ASSERT(!"Unknown particle"); + return 0; + } + + return ParticleMap[ParticleName]; +} + + + + + +void cProtocol180::FixItemFramePositions(int a_ObjectData, double & a_PosX, double & a_PosZ, double & a_Yaw) +{ + switch (a_ObjectData) + { + case 0: + { + a_PosZ += 1; + a_Yaw = 0; + break; + } + case 1: + { + a_PosX -= 1; + a_Yaw = 90; + break; + } + case 2: + { + a_PosZ -= 1; + a_Yaw = 180; + break; + } + case 3: + { + a_PosX += 1; + a_Yaw = 270; + break; + } + } +} + + + + + +void cProtocol180::AddReceivedData(const char * a_Data, size_t a_Size) +{ + // Write the incoming data into the comm log file: + if (g_ShouldLogCommIn) + { + if (m_ReceivedData.GetReadableSpace() > 0) + { + AString AllData; + size_t OldReadableSpace = m_ReceivedData.GetReadableSpace(); + m_ReceivedData.ReadAll(AllData); + m_ReceivedData.ResetRead(); + m_ReceivedData.SkipRead(m_ReceivedData.GetReadableSpace() - OldReadableSpace); + ASSERT(m_ReceivedData.GetReadableSpace() == OldReadableSpace); + AString Hex; + CreateHexDump(Hex, AllData.data(), AllData.size(), 16); + m_CommLogFile.Printf("Incoming data, " SIZE_T_FMT " (0x" SIZE_T_FMT_HEX ") unparsed bytes already present in buffer:\n%s\n", + AllData.size(), AllData.size(), Hex.c_str() + ); + } + AString Hex; + CreateHexDump(Hex, a_Data, a_Size, 16); + m_CommLogFile.Printf("Incoming data: %d (0x%x) bytes: \n%s\n", + (unsigned)a_Size, (unsigned)a_Size, Hex.c_str() + ); + m_CommLogFile.Flush(); + } + + if (!m_ReceivedData.Write(a_Data, a_Size)) + { + // Too much data in the incoming queue, report to caller: + m_Client->PacketBufferFull(); + return; + } + + // Handle all complete packets: + for (;;) + { + UInt32 PacketLen; + if (!m_ReceivedData.ReadVarInt(PacketLen)) + { + // Not enough data + m_ReceivedData.ResetRead(); + break; + } + if (!m_ReceivedData.CanReadBytes(PacketLen)) + { + // The full packet hasn't been received yet + m_ReceivedData.ResetRead(); + break; + } + + // Check packet for compression: + UInt32 CompressedSize = 0; + AString UncompressedData; + if (m_State == 3) + { + UInt32 NumBytesRead = m_ReceivedData.GetReadableSpace(); + m_ReceivedData.ReadVarInt(CompressedSize); + if (CompressedSize > PacketLen) + { + m_Client->Kick("Bad compression"); + return; + } + if (CompressedSize > 0) + { + // Decompress the data: + AString CompressedData; + m_ReceivedData.ReadString(CompressedData, CompressedSize); + InflateString(CompressedData.data(), CompressedSize, UncompressedData); + PacketLen = UncompressedData.size(); + } + else + { + NumBytesRead -= m_ReceivedData.GetReadableSpace(); // How many bytes has the CompressedSize taken up? + ASSERT(PacketLen > NumBytesRead); + PacketLen -= NumBytesRead; + } + } + + // Move the packet payload to a separate cByteBuffer, bb: + cByteBuffer bb(PacketLen + 1); + if (CompressedSize == 0) + { + // No compression was used, move directly + VERIFY(m_ReceivedData.ReadToByteBuffer(bb, (int)PacketLen)); + } + else + { + // Compression was used, move the uncompressed data: + VERIFY(bb.Write(UncompressedData.data(), UncompressedData.size())); + } + m_ReceivedData.CommitRead(); + + UInt32 PacketType; + if (!bb.ReadVarInt(PacketType)) + { + // Not enough data + break; + } + + // Write one NUL extra, so that we can detect over-reads + bb.Write("\0", 1); + + // Log the packet info into the comm log file: + if (g_ShouldLogCommIn) + { + AString PacketData; + bb.ReadAll(PacketData); + bb.ResetRead(); + bb.ReadVarInt(PacketType); + ASSERT(PacketData.size() > 0); // We have written an extra NUL, so there had to be at least one byte read + PacketData.resize(PacketData.size() - 1); + AString PacketDataHex; + CreateHexDump(PacketDataHex, PacketData.data(), PacketData.size(), 16); + m_CommLogFile.Printf("Next incoming packet is type %u (0x%x), length %u (0x%x) at state %d. Payload:\n%s\n", + PacketType, PacketType, PacketLen, PacketLen, m_State, PacketDataHex.c_str() + ); + } + + if (!HandlePacket(bb, PacketType)) + { + // Unknown packet, already been reported, but without the length. Log the length here: + LOGWARNING("Unhandled packet: type 0x%x, state %d, length %u", PacketType, m_State, PacketLen); + + #ifdef _DEBUG + // Dump the packet contents into the log: + bb.ResetRead(); + AString Packet; + bb.ReadAll(Packet); + Packet.resize(Packet.size() - 1); // Drop the final NUL pushed there for over-read detection + AString Out; + CreateHexDump(Out, Packet.data(), (int)Packet.size(), 24); + LOGD("Packet contents:\n%s", Out.c_str()); + #endif // _DEBUG + + // Put a message in the comm log: + if (g_ShouldLogCommIn) + { + m_CommLogFile.Printf("^^^^^^ Unhandled packet ^^^^^^\n\n\n"); + } + + return; + } + + // The packet should have 1 byte left in the buffer - the NUL we had added + if (bb.GetReadableSpace() != 1) + { + // Read more or less than packet length, report as error + LOGWARNING("Protocol 1.8: Wrong number of bytes read for packet 0x%x, state %d. Read " SIZE_T_FMT " bytes, packet contained %u bytes", + PacketType, m_State, bb.GetUsedSpace() - bb.GetReadableSpace(), PacketLen + ); + + // Put a message in the comm log: + if (g_ShouldLogCommIn) + { + m_CommLogFile.Printf("^^^^^^ Wrong number of bytes read for this packet (exp %d left, got " SIZE_T_FMT " left) ^^^^^^\n\n\n", + 1, bb.GetReadableSpace() + ); + m_CommLogFile.Flush(); + } + + ASSERT(!"Read wrong number of bytes!"); + m_Client->PacketError(PacketType); + } + } // for (ever) + + // Log any leftover bytes into the logfile: + if (g_ShouldLogCommIn && (m_ReceivedData.GetReadableSpace() > 0)) + { + AString AllData; + size_t OldReadableSpace = m_ReceivedData.GetReadableSpace(); + m_ReceivedData.ReadAll(AllData); + m_ReceivedData.ResetRead(); + m_ReceivedData.SkipRead(m_ReceivedData.GetReadableSpace() - OldReadableSpace); + ASSERT(m_ReceivedData.GetReadableSpace() == OldReadableSpace); + AString Hex; + CreateHexDump(Hex, AllData.data(), AllData.size(), 16); + m_CommLogFile.Printf("There are " SIZE_T_FMT " (0x" SIZE_T_FMT_HEX ") bytes of non-parse-able data left in the buffer:\n%s", + m_ReceivedData.GetReadableSpace(), m_ReceivedData.GetReadableSpace(), Hex.c_str() + ); + m_CommLogFile.Flush(); + } +} + + + + +bool cProtocol180::HandlePacket(cByteBuffer & a_ByteBuffer, UInt32 a_PacketType) +{ + switch (m_State) + { + case 1: + { + // Status + switch (a_PacketType) + { + case 0x00: HandlePacketStatusRequest(a_ByteBuffer); return true; + case 0x01: HandlePacketStatusPing (a_ByteBuffer); return true; + } + break; + } + + case 2: + { + // Login + switch (a_PacketType) + { + case 0x00: HandlePacketLoginStart (a_ByteBuffer); return true; + case 0x01: HandlePacketLoginEncryptionResponse(a_ByteBuffer); return true; + } + break; + } + + case 3: + { + // Game + switch (a_PacketType) + { + case 0x00: HandlePacketKeepAlive (a_ByteBuffer); return true; + case 0x01: HandlePacketChatMessage (a_ByteBuffer); return true; + case 0x02: HandlePacketUseEntity (a_ByteBuffer); return true; + case 0x03: HandlePacketPlayer (a_ByteBuffer); return true; + case 0x04: HandlePacketPlayerPos (a_ByteBuffer); return true; + case 0x05: HandlePacketPlayerLook (a_ByteBuffer); return true; + case 0x06: HandlePacketPlayerPosLook (a_ByteBuffer); return true; + case 0x07: HandlePacketBlockDig (a_ByteBuffer); return true; + case 0x08: HandlePacketBlockPlace (a_ByteBuffer); return true; + case 0x09: HandlePacketSlotSelect (a_ByteBuffer); return true; + case 0x0a: HandlePacketAnimation (a_ByteBuffer); return true; + case 0x0b: HandlePacketEntityAction (a_ByteBuffer); return true; + case 0x0c: HandlePacketSteerVehicle (a_ByteBuffer); return true; + case 0x0d: HandlePacketWindowClose (a_ByteBuffer); return true; + case 0x0e: HandlePacketWindowClick (a_ByteBuffer); return true; + case 0x0f: // Confirm transaction - not used in MCS + case 0x10: HandlePacketCreativeInventoryAction(a_ByteBuffer); return true; + case 0x11: HandlePacketEnchantItem (a_ByteBuffer); return true; + case 0x12: HandlePacketUpdateSign (a_ByteBuffer); return true; + case 0x13: HandlePacketPlayerAbilities (a_ByteBuffer); return true; + case 0x14: HandlePacketTabComplete (a_ByteBuffer); return true; + case 0x15: HandlePacketClientSettings (a_ByteBuffer); return true; + case 0x16: HandlePacketClientStatus (a_ByteBuffer); return true; + case 0x17: HandlePacketPluginMessage (a_ByteBuffer); return true; + } + break; + } + default: + { + // Received a packet in an unknown state, report: + LOGWARNING("Received a packet in an unknown protocol state %d. Ignoring further packets.", m_State); + + // Cannot kick the client - we don't know this state and thus the packet number for the kick packet + + // Switch to a state when all further packets are silently ignored: + m_State = 255; + return false; + } + case 255: + { + // This is the state used for "not processing packets anymore" when we receive a bad packet from a client. + // Do not output anything (the caller will do that for us), just return failure + return false; + } + } // switch (m_State) + + // Unknown packet type, report to the ClientHandle: + m_Client->PacketUnknown(a_PacketType); + return false; +} + + + + + +void cProtocol180::HandlePacketStatusPing(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadBEInt64, Int64, Timestamp); + + cPacketizer Pkt(*this, 0x01); // Ping packet + Pkt.WriteInt64(Timestamp); +} + + + + + +void cProtocol180::HandlePacketStatusRequest(cByteBuffer & a_ByteBuffer) +{ + cServer * Server = cRoot::Get()->GetServer(); + AString ServerDescription = Server->GetDescription(); + int NumPlayers = Server->GetNumPlayers(); + int MaxPlayers = Server->GetMaxPlayers(); + AString Favicon = Server->GetFaviconData(); + cRoot::Get()->GetPluginManager()->CallHookServerPing(*m_Client, ServerDescription, NumPlayers, MaxPlayers, Favicon); + + // Version: + Json::Value Version; + Version["name"] = "1.8"; + Version["protocol"] = 47; + + // Players: + Json::Value Players; + Players["online"] = NumPlayers; + Players["max"] = MaxPlayers; + // TODO: Add "sample" + + // Description: + Json::Value Description; + Description["text"] = ServerDescription.c_str(); + + // Create the response: + Json::Value ResponseValue; + ResponseValue["version"] = Version; + ResponseValue["players"] = Players; + ResponseValue["description"] = Description; + if (!Favicon.empty()) + { + ResponseValue["favicon"] = Printf("data:image/png;base64,%s", Favicon.c_str()); + } + + Json::StyledWriter Writer; + AString Response = Writer.write(ResponseValue); + + cPacketizer Pkt(*this, 0x00); // Response packet + Pkt.WriteString(Response); +} + + + + + +void cProtocol180::HandlePacketLoginEncryptionResponse(cByteBuffer & a_ByteBuffer) +{ + UInt32 EncKeyLength, EncNonceLength; + if (!a_ByteBuffer.ReadVarInt(EncKeyLength)) + { + return; + } + AString EncKey; + if (!a_ByteBuffer.ReadString(EncKey, EncKeyLength)) + { + return; + } + if (!a_ByteBuffer.ReadVarInt(EncNonceLength)) + { + return; + } + AString EncNonce; + if (!a_ByteBuffer.ReadString(EncNonce, EncNonceLength)) + { + return; + } + if ((EncKeyLength > MAX_ENC_LEN) || (EncNonceLength > MAX_ENC_LEN)) + { + LOGD("Too long encryption"); + m_Client->Kick("Hacked client"); + return; + } + + // Decrypt EncNonce using privkey + cRsaPrivateKey & rsaDecryptor = cRoot::Get()->GetServer()->GetPrivateKey(); + Int32 DecryptedNonce[MAX_ENC_LEN / sizeof(Int32)]; + int res = rsaDecryptor.Decrypt((const Byte *)EncNonce.data(), EncNonce.size(), (Byte *)DecryptedNonce, sizeof(DecryptedNonce)); + if (res != 4) + { + LOGD("Bad nonce length: got %d, exp %d", res, 4); + m_Client->Kick("Hacked client"); + return; + } + if (ntohl(DecryptedNonce[0]) != (unsigned)(uintptr_t)this) + { + LOGD("Bad nonce value"); + m_Client->Kick("Hacked client"); + return; + } + + // Decrypt the symmetric encryption key using privkey: + Byte DecryptedKey[MAX_ENC_LEN]; + res = rsaDecryptor.Decrypt((const Byte *)EncKey.data(), EncKey.size(), DecryptedKey, sizeof(DecryptedKey)); + if (res != 16) + { + LOGD("Bad key length"); + m_Client->Kick("Hacked client"); + return; + } + + StartEncryption(DecryptedKey); + m_Client->HandleLogin(4, m_Client->GetUsername()); +} + + + + + +void cProtocol180::HandlePacketLoginStart(cByteBuffer & a_ByteBuffer) +{ + AString Username; + if (!a_ByteBuffer.ReadVarUTF8String(Username)) + { + m_Client->Kick("Bad username"); + return; + } + + if (!m_Client->HandleHandshake(Username)) + { + // The client is not welcome here, they have been sent a Kick packet already + return; + } + + cServer * Server = cRoot::Get()->GetServer(); + // If auth is required, then send the encryption request: + if (Server->ShouldAuthenticate()) + { + cPacketizer Pkt(*this, 0x01); + Pkt.WriteString(Server->GetServerID()); + const AString & PubKeyDer = Server->GetPublicKeyDER(); + Pkt.WriteVarInt((short)PubKeyDer.size()); + Pkt.WriteBuf(PubKeyDer.data(), PubKeyDer.size()); + Pkt.WriteVarInt(4); + Pkt.WriteInt((int)(intptr_t)this); // Using 'this' as the cryptographic nonce, so that we don't have to generate one each time :) + m_Client->SetUsername(Username); + return; + } + + m_Client->HandleLogin(4, Username); +} + + + + + +void cProtocol180::HandlePacketAnimation(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, EntityID); + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, Animation); + m_Client->HandleAnimation(Animation); +} + + + + + +void cProtocol180::HandlePacketBlockDig(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, Status); + + int BlockX, BlockY, BlockZ; + if (!a_ByteBuffer.ReadPosition(BlockX, BlockY, BlockZ)) + { + return; + } + + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, Face); + m_Client->HandleLeftClick(BlockX, BlockY, BlockZ, static_cast<eBlockFace>(Face), Status); +} + + + + + +void cProtocol180::HandlePacketBlockPlace(cByteBuffer & a_ByteBuffer) +{ + int BlockX, BlockY, BlockZ; + if (!a_ByteBuffer.ReadPosition(BlockX, BlockY, BlockZ)) + { + return; + } + + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, Face); + if (Face == 255) + { + Face = 0; + } + + cItem Item; + ReadItem(a_ByteBuffer, Item, 3); + + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, CursorX); + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, CursorY); + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, CursorZ); + m_Client->HandleRightClick(BlockX, BlockY, BlockZ, static_cast<eBlockFace>(Face), CursorX, CursorY, CursorZ, m_Client->GetPlayer()->GetEquippedItem()); +} + + + + + +void cProtocol180::HandlePacketChatMessage(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadVarUTF8String, AString, Message); + m_Client->HandleChat(Message); +} + + + + + +void cProtocol180::HandlePacketClientSettings(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadVarUTF8String, AString, Locale); + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, ViewDistance); + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, ChatFlags); + HANDLE_READ(a_ByteBuffer, ReadBool, bool, ChatColors); + HANDLE_READ(a_ByteBuffer, ReadChar, char, SkinFlags); + + m_Client->SetLocale(Locale); + // TODO: Handle other values +} + + + + + +void cProtocol180::HandlePacketClientStatus(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadChar, char, ActionID); + switch (ActionID) + { + case 0: + { + // Respawn + m_Client->HandleRespawn(); + break; + } + case 1: + { + // Request stats + const cStatManager & Manager = m_Client->GetPlayer()->GetStatManager(); + SendStatistics(Manager); + + break; + } + case 2: + { + // Open Inventory achievement + m_Client->GetPlayer()->AwardAchievement(achOpenInv); + break; + } + } +} + + + + + +void cProtocol180::HandlePacketCreativeInventoryAction(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadBEShort, short, SlotNum); + cItem Item; + if (!ReadItem(a_ByteBuffer, Item)) + { + return; + } + m_Client->HandleCreativeInventory(SlotNum, Item); +} + + + + + +void cProtocol180::HandlePacketEntityAction(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadVarInt, UInt32, PlayerID); + HANDLE_READ(a_ByteBuffer, ReadChar, char, Action); + HANDLE_READ(a_ByteBuffer, ReadVarInt, UInt32, JumpBoost); + + switch (Action) + { + case 0: m_Client->HandleEntityCrouch(PlayerID, true); break; // Crouch + case 1: m_Client->HandleEntityCrouch(PlayerID, false); break; // Uncrouch + case 2: m_Client->HandleEntityLeaveBed(PlayerID); break; // Leave Bed + case 3: m_Client->HandleEntitySprinting(PlayerID, true); break; // Start sprinting + case 4: m_Client->HandleEntitySprinting(PlayerID, false); break; // Stop sprinting + } +} + + + + + +void cProtocol180::HandlePacketKeepAlive(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadVarInt, UInt32, KeepAliveID); + m_Client->HandleKeepAlive((int)KeepAliveID); +} + + + + + +void cProtocol180::HandlePacketPlayer(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadBool, bool, IsOnGround); + // TODO: m_Client->HandlePlayerOnGround(IsOnGround); +} + + + + + +void cProtocol180::HandlePacketPlayerAbilities(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, Flags); + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, FlyingSpeed); + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, WalkingSpeed); + + bool IsFlying = false, CanFly = false; + if ((Flags & 2) != 0) + { + IsFlying = true; + } + if ((Flags & 4) != 0) + { + CanFly = true; + } + + m_Client->HandlePlayerAbilities(CanFly, IsFlying, FlyingSpeed, WalkingSpeed); +} + + + + + +void cProtocol180::HandlePacketPlayerLook(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, Yaw); + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, Pitch); + HANDLE_READ(a_ByteBuffer, ReadBool, bool, IsOnGround); + m_Client->HandlePlayerLook(Yaw, Pitch, IsOnGround); +} + + + + + +void cProtocol180::HandlePacketPlayerPos(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadBEDouble, double, PosX); + HANDLE_READ(a_ByteBuffer, ReadBEDouble, double, PosY); + HANDLE_READ(a_ByteBuffer, ReadBEDouble, double, PosZ); + HANDLE_READ(a_ByteBuffer, ReadBool, bool, IsOnGround); + m_Client->HandlePlayerPos(PosX, PosY, PosZ, PosY + 1.62, IsOnGround); +} + + + + + +void cProtocol180::HandlePacketPlayerPosLook(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadBEDouble, double, PosX); + HANDLE_READ(a_ByteBuffer, ReadBEDouble, double, PosY); + HANDLE_READ(a_ByteBuffer, ReadBEDouble, double, PosZ); + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, Yaw); + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, Pitch); + HANDLE_READ(a_ByteBuffer, ReadBool, bool, IsOnGround); + m_Client->HandlePlayerMoveLook(PosX, PosY, PosZ, PosY + 1.62, Yaw, Pitch, IsOnGround); +} + + + + + +void cProtocol180::HandlePacketPluginMessage(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadVarUTF8String, AString, Channel); + + // If the plugin channel is recognized vanilla, handle it directly: + if (Channel.substr(0, 3) == "MC|") + { + HandleVanillaPluginMessage(a_ByteBuffer, Channel); + return; + } + + // Read the plugin message and relay to clienthandle: + AString Data; + VERIFY(a_ByteBuffer.ReadString(Data, a_ByteBuffer.GetReadableSpace() - 1)); // Always succeeds + m_Client->HandlePluginMessage(Channel, Data); +} + + + + + +void cProtocol180::HandlePacketSlotSelect(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadBEShort, short, SlotNum); + m_Client->HandleSlotSelected(SlotNum); +} + + + + + +void cProtocol180::HandlePacketSteerVehicle(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, Forward); + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, Sideways); + HANDLE_READ(a_ByteBuffer, ReadChar, char, Flags); + + if ((Flags & 0x2) != 0) + { + m_Client->HandleUnmount(); + } + else if ((Flags & 0x1) != 0) + { + m_Client->HandleSteerVehicle(Forward, Sideways); + } +} + + + + + +void cProtocol180::HandlePacketTabComplete(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadVarUTF8String, AString, Text); + HANDLE_READ(a_ByteBuffer, ReadBool, bool, HasPosition); + + if (HasPosition) + { + HANDLE_READ(a_ByteBuffer, ReadBEInt64, Int64, Position); + } + + m_Client->HandleTabCompletion(Text); +} + + + + + +void cProtocol180::HandlePacketUpdateSign(cByteBuffer & a_ByteBuffer) +{ + int BlockX, BlockY, BlockZ; + if (!a_ByteBuffer.ReadPosition(BlockX, BlockY, BlockZ)) + { + return; + } + + AString Lines[4]; + for (int i = 0; i < 4; i++) + { + HANDLE_READ(a_ByteBuffer, ReadVarUTF8String, AString, Line); + Lines[i] = Line.substr(1, Line.length() - 2); // Remove "" + } + + m_Client->HandleUpdateSign(BlockX, BlockY, BlockZ, Lines[0], Lines[1], Lines[2], Lines[3]); +} + + + + + +void cProtocol180::HandlePacketUseEntity(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadVarInt, UInt32, EntityID); + HANDLE_READ(a_ByteBuffer, ReadVarInt, UInt32, Type); + + switch (Type) + { + case 0: + { + m_Client->HandleUseEntity((int)EntityID, false); + break; + } + case 1: + { + m_Client->HandleUseEntity((int)EntityID, true); + break; + } + case 2: + { + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, TargetX); + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, TargetY); + HANDLE_READ(a_ByteBuffer, ReadBEFloat, float, TargetZ); + + // TODO: Do anything + break; + } + default: + { + ASSERT(!"Unhandled use entity type!"); + return; + } + } +} + + + + + +void cProtocol180::HandlePacketEnchantItem(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, WindowID); + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, Enchantment); + + m_Client->HandleEnchantItem(WindowID, Enchantment); +} + + + + + +void cProtocol180::HandlePacketWindowClick(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadChar, char, WindowID); + HANDLE_READ(a_ByteBuffer, ReadBEShort, short, SlotNum); + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, Button); + HANDLE_READ(a_ByteBuffer, ReadBEShort, short, TransactionID); + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, Mode); + cItem Item; + ReadItem(a_ByteBuffer, Item); + + // Convert Button, Mode, SlotNum and HeldItem into eClickAction: + eClickAction Action; + switch ((Mode << 8) | Button) + { + case 0x0000: Action = (SlotNum != -999) ? caLeftClick : caLeftClickOutside; break; + case 0x0001: Action = (SlotNum != -999) ? caRightClick : caRightClickOutside; break; + case 0x0100: Action = caShiftLeftClick; break; + case 0x0101: Action = caShiftRightClick; break; + case 0x0200: Action = caNumber1; break; + case 0x0201: Action = caNumber2; break; + case 0x0202: Action = caNumber3; break; + case 0x0203: Action = caNumber4; break; + case 0x0204: Action = caNumber5; break; + case 0x0205: Action = caNumber6; break; + case 0x0206: Action = caNumber7; break; + case 0x0207: Action = caNumber8; break; + case 0x0208: Action = caNumber9; break; + case 0x0300: Action = caMiddleClick; break; + case 0x0400: Action = (SlotNum == -999) ? caLeftClickOutsideHoldNothing : caDropKey; break; + case 0x0401: Action = (SlotNum == -999) ? caRightClickOutsideHoldNothing : caCtrlDropKey; break; + case 0x0500: Action = (SlotNum == -999) ? caLeftPaintBegin : caUnknown; break; + case 0x0501: Action = (SlotNum != -999) ? caLeftPaintProgress : caUnknown; break; + case 0x0502: Action = (SlotNum == -999) ? caLeftPaintEnd : caUnknown; break; + case 0x0504: Action = (SlotNum == -999) ? caRightPaintBegin : caUnknown; break; + case 0x0505: Action = (SlotNum != -999) ? caRightPaintProgress : caUnknown; break; + case 0x0506: Action = (SlotNum == -999) ? caRightPaintEnd : caUnknown; break; + case 0x0600: Action = caDblClick; break; + default: + { + LOGWARNING("Unhandled window click mode / button combination: %d (0x%x)", (Mode << 8) | Button, (Mode << 8) | Button); + Action = caUnknown; + break; + } + } + + m_Client->HandleWindowClick(WindowID, SlotNum, Action, Item); +} + + + + + +void cProtocol180::HandlePacketWindowClose(cByteBuffer & a_ByteBuffer) +{ + HANDLE_READ(a_ByteBuffer, ReadChar, char, WindowID); + m_Client->HandleWindowClose(WindowID); +} + + + + + +void cProtocol180::HandleVanillaPluginMessage(cByteBuffer & a_ByteBuffer, const AString & a_Channel) +{ + if (a_Channel == "MC|AdvCdm") + { + HANDLE_READ(a_ByteBuffer, ReadByte, Byte, Mode) + switch (Mode) + { + case 0x00: + { + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, BlockX); + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, BlockY); + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, BlockZ); + HANDLE_READ(a_ByteBuffer, ReadVarUTF8String, AString, Command); + m_Client->HandleCommandBlockBlockChange(BlockX, BlockY, BlockZ, Command); + break; + } + + default: + { + m_Client->SendChat(Printf("Failure setting command block command; unhandled mode %d", Mode), mtFailure); + LOG("Unhandled MC|AdvCdm packet mode."); + return; + } + } // switch (Mode) + return; + } + else if (a_Channel == "MC|Brand") + { + HANDLE_READ(a_ByteBuffer, ReadVarUTF8String, AString, Brand); + m_Client->SetClientBrand(Brand); + // Send back our brand, including the length: + SendPluginMessage("MC|Brand", "\x08MCServer"); + return; + } + else if (a_Channel == "MC|Beacon") + { + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, Effect1); + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, Effect2); + m_Client->HandleBeaconSelection(Effect1, Effect2); + return; + } + else if (a_Channel == "MC|ItemName") + { + HANDLE_READ(a_ByteBuffer, ReadVarUTF8String, AString, ItemName); + m_Client->HandleAnvilItemName(ItemName); + return; + } + else if (a_Channel == "MC|TrSel") + { + HANDLE_READ(a_ByteBuffer, ReadBEInt, int, SlotNum); + m_Client->HandleNPCTrade(SlotNum); + return; + } + LOG("Unhandled vanilla plugin channel: \"%s\".", a_Channel.c_str()); + + // Read the payload and send it through to the clienthandle: + AString Message; + VERIFY(a_ByteBuffer.ReadString(Message, a_ByteBuffer.GetReadableSpace() - 1)); + m_Client->HandlePluginMessage(a_Channel, Message); +} + + + + + +void cProtocol180::SendData(const char * a_Data, size_t a_Size) +{ + if (m_IsEncrypted) + { + Byte Encrypted[8192]; // Larger buffer, we may be sending lots of data (chunks) + while (a_Size > 0) + { + size_t NumBytes = (a_Size > sizeof(Encrypted)) ? sizeof(Encrypted) : a_Size; + m_Encryptor.ProcessData(Encrypted, (Byte *)a_Data, NumBytes); + m_Client->SendData((const char *)Encrypted, NumBytes); + a_Size -= NumBytes; + a_Data += NumBytes; + } + } + else + { + m_Client->SendData(a_Data, a_Size); + } +} + + + + + +bool cProtocol180::ReadItem(cByteBuffer & a_ByteBuffer, cItem & a_Item, size_t a_KeepRemainingBytes) +{ + HANDLE_PACKET_READ(a_ByteBuffer, ReadBEShort, short, ItemType); + if (ItemType == -1) + { + // The item is empty, no more data follows + a_Item.Empty(); + return true; + } + a_Item.m_ItemType = ItemType; + + HANDLE_PACKET_READ(a_ByteBuffer, ReadChar, char, ItemCount); + HANDLE_PACKET_READ(a_ByteBuffer, ReadBEShort, short, ItemDamage); + a_Item.m_ItemCount = ItemCount; + a_Item.m_ItemDamage = ItemDamage; + if (ItemCount <= 0) + { + a_Item.Empty(); + } + + AString Metadata; + if (!a_ByteBuffer.ReadString(Metadata, a_ByteBuffer.GetReadableSpace() - a_KeepRemainingBytes - 1) || (Metadata.size() == 0) || (Metadata[0] == 0)) + { + // No metadata + return true; + } + + ParseItemMetadata(a_Item, Metadata); + return true; +} + + + + + +void cProtocol180::ParseItemMetadata(cItem & a_Item, const AString & a_Metadata) +{ + // Parse into NBT: + cParsedNBT NBT(a_Metadata.data(), a_Metadata.size()); + if (!NBT.IsValid()) + { + AString HexDump; + CreateHexDump(HexDump, a_Metadata.data(), a_Metadata.size(), 16); + LOGWARNING("Cannot parse NBT item metadata: (" SIZE_T_FMT " bytes)\n%s", a_Metadata.size(), HexDump.c_str()); + return; + } + + // Load enchantments and custom display names from the NBT data: + for (int tag = NBT.GetFirstChild(NBT.GetRoot()); tag >= 0; tag = NBT.GetNextSibling(tag)) + { + AString TagName = NBT.GetName(tag); + switch (NBT.GetType(tag)) + { + case TAG_List: + { + if ((TagName == "ench") || (TagName == "StoredEnchantments")) // Enchantments tags + { + EnchantmentSerializer::ParseFromNBT(a_Item.m_Enchantments, NBT, tag); + } + break; + } + case TAG_Compound: + { + if (TagName == "display") // Custom name and lore tag + { + for (int displaytag = NBT.GetFirstChild(tag); displaytag >= 0; displaytag = NBT.GetNextSibling(displaytag)) + { + if ((NBT.GetType(displaytag) == TAG_String) && (NBT.GetName(displaytag) == "Name")) // Custon name tag + { + a_Item.m_CustomName = NBT.GetString(displaytag); + } + else if ((NBT.GetType(displaytag) == TAG_List) && (NBT.GetName(displaytag) == "Lore")) // Lore tag + { + AString Lore; + + for (int loretag = NBT.GetFirstChild(displaytag); loretag >= 0; loretag = NBT.GetNextSibling(loretag)) // Loop through array of strings + { + AppendPrintf(Lore, "%s`", NBT.GetString(loretag).c_str()); // Append the lore with a grave accent/backtick, used internally by MCS to display a new line in the client; don't forget to c_str ;) + } + + a_Item.m_Lore = Lore; + } + } + } + else if ((TagName == "Fireworks") || (TagName == "Explosion")) + { + cFireworkItem::ParseFromNBT(a_Item.m_FireworkItem, NBT, tag, (ENUM_ITEM_ID)a_Item.m_ItemType); + } + break; + } + case TAG_Int: + { + if (TagName == "RepairCost") + { + a_Item.m_RepairCost = NBT.GetInt(tag); + } + } + default: LOGD("Unimplemented NBT data when parsing!"); break; + } + } +} + + + + + +void cProtocol180::StartEncryption(const Byte * a_Key) +{ + m_Encryptor.Init(a_Key, a_Key); + m_Decryptor.Init(a_Key, a_Key); + m_IsEncrypted = true; + + // Prepare the m_AuthServerID: + cSha1Checksum Checksum; + cServer * Server = cRoot::Get()->GetServer(); + const AString & ServerID = Server->GetServerID(); + Checksum.Update((const Byte *)ServerID.c_str(), ServerID.length()); + Checksum.Update(a_Key, 16); + Checksum.Update((const Byte *)Server->GetPublicKeyDER().data(), Server->GetPublicKeyDER().size()); + Byte Digest[20]; + Checksum.Finalize(Digest); + cSha1Checksum::DigestToJava(Digest, m_AuthServerID); +} + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cProtocol180::cPacketizer: + +cProtocol180::cPacketizer::~cPacketizer() +{ + UInt32 PacketLen = (UInt32)m_Out.GetUsedSpace(); + AString PacketData, CompressedPacket; + m_Out.ReadAll(PacketData); + m_Out.CommitRead(); + + if ((m_Protocol.m_State == 3) && (PacketLen >= 256)) + { + if (!cProtocol180::CompressPacket(PacketData, CompressedPacket)) + { + return; + } + } + else if (m_Protocol.m_State == 3) + { + m_Protocol.m_OutPacketLenBuffer.WriteVarInt(PacketLen + 1); + m_Protocol.m_OutPacketLenBuffer.WriteVarInt(0); + + AString LengthData; + m_Protocol.m_OutPacketLenBuffer.ReadAll(LengthData); + m_Protocol.SendData(LengthData.data(), LengthData.size()); + } + else + { + m_Protocol.m_OutPacketLenBuffer.WriteVarInt(PacketLen); + + AString LengthData; + m_Protocol.m_OutPacketLenBuffer.ReadAll(LengthData); + m_Protocol.SendData(LengthData.data(), LengthData.size()); + } + + if (CompressedPacket.empty()) + { + m_Protocol.m_OutPacketLenBuffer.CommitRead(); + m_Protocol.SendData(PacketData.data(), PacketData.size()); + } + else + { + m_Protocol.SendData(CompressedPacket.data(), CompressedPacket.size()); + } + + // Log the comm into logfile: + if (g_ShouldLogCommOut) + { + AString Hex; + ASSERT(PacketData.size() > 0); + CreateHexDump(Hex, PacketData.data() + 1, PacketData.size() - 1, 16); + m_Protocol.m_CommLogFile.Printf("Outgoing packet: type %d (0x%x), length %u (0x%x), state %d. Payload:\n%s\n", + PacketData[0], PacketData[0], PacketLen, PacketLen, m_Protocol.m_State, Hex.c_str() + ); + } +} + + + + + +void cProtocol180::cPacketizer::WriteUUID(const AString & a_UUID) +{ + if (a_UUID.length() != 32) + { + LOGWARNING("Attempt to send a bad uuid (length isn't 32): %s", a_UUID.c_str()); + ASSERT(!"Wrong uuid length!"); + return; + } + AString UUID_1 = a_UUID.substr(0, 16); + AString UUID_2 = a_UUID.substr(16); + + Int64 Value_1, Value_2; + sscanf(UUID_1.c_str(), "%llx", &Value_1); + sscanf(UUID_2.c_str(), "%llx", &Value_2); + + WriteInt64(Value_1); + WriteInt64(Value_2); +} + + + + + +void cProtocol180::cPacketizer::WriteItem(const cItem & a_Item) +{ + short ItemType = a_Item.m_ItemType; + ASSERT(ItemType >= -1); // Check validity of packets in debug runtime + if (ItemType <= 0) + { + // Fix, to make sure no invalid values are sent. + ItemType = -1; + } + + if (a_Item.IsEmpty()) + { + WriteShort(-1); + return; + } + + WriteShort(ItemType); + WriteByte (a_Item.m_ItemCount); + WriteShort(a_Item.m_ItemDamage); + + if (a_Item.m_Enchantments.IsEmpty() && a_Item.IsBothNameAndLoreEmpty() && (a_Item.m_ItemType != E_ITEM_FIREWORK_ROCKET) && (a_Item.m_ItemType != E_ITEM_FIREWORK_STAR)) + { + WriteChar(0); + return; + } + + // Send the enchantments and custom names: + cFastNBTWriter Writer; + if (a_Item.m_RepairCost != 0) + { + Writer.AddInt("RepairCost", a_Item.m_RepairCost); + } + if (!a_Item.m_Enchantments.IsEmpty()) + { + const char * TagName = (a_Item.m_ItemType == E_ITEM_BOOK) ? "StoredEnchantments" : "ench"; + EnchantmentSerializer::WriteToNBTCompound(a_Item.m_Enchantments, Writer, TagName); + } + if (!a_Item.IsBothNameAndLoreEmpty()) + { + Writer.BeginCompound("display"); + if (!a_Item.IsCustomNameEmpty()) + { + Writer.AddString("Name", a_Item.m_CustomName.c_str()); + } + if (!a_Item.IsLoreEmpty()) + { + Writer.BeginList("Lore", TAG_String); + + AStringVector Decls = StringSplit(a_Item.m_Lore, "`"); + for (AStringVector::const_iterator itr = Decls.begin(), end = Decls.end(); itr != end; ++itr) + { + if (itr->empty()) + { + // The decl is empty (two `s), ignore + continue; + } + Writer.AddString("", itr->c_str()); + } + + Writer.EndList(); + } + Writer.EndCompound(); + } + if ((a_Item.m_ItemType == E_ITEM_FIREWORK_ROCKET) || (a_Item.m_ItemType == E_ITEM_FIREWORK_STAR)) + { + cFireworkItem::WriteToNBTCompound(a_Item.m_FireworkItem, Writer, (ENUM_ITEM_ID)a_Item.m_ItemType); + } + Writer.Finish(); + + AString Result = Writer.GetResult(); + if (Result.size() == 0) + { + WriteChar(0); + return; + } + WriteBuf(Result.data(), Result.size()); +} + + + + + +void cProtocol180::cPacketizer::WriteBlockEntity(const cBlockEntity & a_BlockEntity) +{ + cFastNBTWriter Writer; + + switch (a_BlockEntity.GetBlockType()) + { + case E_BLOCK_BEACON: + { + cBeaconEntity & BeaconEntity = (cBeaconEntity &)a_BlockEntity; + + Writer.AddInt("x", BeaconEntity.GetPosX()); + Writer.AddInt("y", BeaconEntity.GetPosY()); + Writer.AddInt("z", BeaconEntity.GetPosZ()); + Writer.AddInt("Primary", BeaconEntity.GetPrimaryEffect()); + Writer.AddInt("Secondary", BeaconEntity.GetSecondaryEffect()); + Writer.AddInt("Levels", BeaconEntity.GetBeaconLevel()); + Writer.AddString("id", "Beacon"); // "Tile Entity ID" - MC wiki; vanilla server always seems to send this though + break; + } + case E_BLOCK_COMMAND_BLOCK: + { + cCommandBlockEntity & CommandBlockEntity = (cCommandBlockEntity &)a_BlockEntity; + + Writer.AddByte("TrackOutput", 1); // Neither I nor the MC wiki has any idea about this + Writer.AddInt("SuccessCount", CommandBlockEntity.GetResult()); + Writer.AddInt("x", CommandBlockEntity.GetPosX()); + Writer.AddInt("y", CommandBlockEntity.GetPosY()); + Writer.AddInt("z", CommandBlockEntity.GetPosZ()); + Writer.AddString("Command", CommandBlockEntity.GetCommand().c_str()); + // You can set custom names for windows in Vanilla + // For a command block, this would be the 'name' prepended to anything it outputs into global chat + // MCS doesn't have this, so just leave it @ '@'. (geddit?) + Writer.AddString("CustomName", "@"); + Writer.AddString("id", "Control"); // "Tile Entity ID" - MC wiki; vanilla server always seems to send this though + + if (!CommandBlockEntity.GetLastOutput().empty()) + { + AString Output; + Printf(Output, "{\"text\":\"%s\"}", CommandBlockEntity.GetLastOutput().c_str()); + + Writer.AddString("LastOutput", Output.c_str()); + } + break; + } + case E_BLOCK_HEAD: + { + cMobHeadEntity & MobHeadEntity = (cMobHeadEntity &)a_BlockEntity; + + Writer.AddInt("x", MobHeadEntity.GetPosX()); + Writer.AddInt("y", MobHeadEntity.GetPosY()); + Writer.AddInt("z", MobHeadEntity.GetPosZ()); + Writer.AddByte("SkullType", MobHeadEntity.GetType() & 0xFF); + Writer.AddByte("Rot", MobHeadEntity.GetRotation() & 0xFF); + Writer.AddString("ExtraType", MobHeadEntity.GetOwner().c_str()); + Writer.AddString("id", "Skull"); // "Tile Entity ID" - MC wiki; vanilla server always seems to send this though + break; + } + case E_BLOCK_FLOWER_POT: + { + cFlowerPotEntity & FlowerPotEntity = (cFlowerPotEntity &)a_BlockEntity; + + Writer.AddInt("x", FlowerPotEntity.GetPosX()); + Writer.AddInt("y", FlowerPotEntity.GetPosY()); + Writer.AddInt("z", FlowerPotEntity.GetPosZ()); + Writer.AddInt("Item", (Int32) FlowerPotEntity.GetItem().m_ItemType); + Writer.AddInt("Data", (Int32) FlowerPotEntity.GetItem().m_ItemDamage); + Writer.AddString("id", "FlowerPot"); // "Tile Entity ID" - MC wiki; vanilla server always seems to send this though + break; + } + default: break; + } + + Writer.Finish(); + WriteBuf(Writer.GetResult().data(), Writer.GetResult().size()); +} + + + + + +void cProtocol180::cPacketizer::WriteByteAngle(double a_Angle) +{ + WriteByte((char)(255 * a_Angle / 360)); +} + + + + + +void cProtocol180::cPacketizer::WriteFPInt(double a_Value) +{ + int Value = (int)(a_Value * 32); + WriteInt(Value); +} + + + + + +void cProtocol180::cPacketizer::WriteEntityMetadata(const cEntity & a_Entity) +{ + // Common metadata: + Byte Flags = 0; + if (a_Entity.IsOnFire()) + { + Flags |= 0x01; + } + if (a_Entity.IsCrouched()) + { + Flags |= 0x02; + } + if (a_Entity.IsSprinting()) + { + Flags |= 0x08; + } + if (a_Entity.IsRclking()) + { + Flags |= 0x10; + } + if (a_Entity.IsInvisible()) + { + Flags |= 0x20; + } + WriteByte(0); // Byte(0) + index 0 + WriteByte(Flags); + + switch (a_Entity.GetEntityType()) + { + case cEntity::etPlayer: break; // TODO? + case cEntity::etPickup: + { + WriteByte((5 << 5) | 10); // Slot(5) + index 10 + WriteItem(((const cPickup &)a_Entity).GetItem()); + break; + } + case cEntity::etMinecart: + { + WriteByte(0x51); + + // The following expression makes Minecarts shake more with less health or higher damage taken + // It gets half the maximum health, and takes it away from the current health minus the half health: + /* + Health: 5 | 3 - (5 - 3) = 1 (shake power) + Health: 3 | 3 - (3 - 3) = 3 + Health: 1 | 3 - (1 - 3) = 5 + */ + WriteInt((((a_Entity.GetMaxHealth() / 2) - (a_Entity.GetHealth() - (a_Entity.GetMaxHealth() / 2))) * ((const cMinecart &)a_Entity).LastDamage()) * 4); + WriteByte(0x52); + WriteInt(1); // Shaking direction, doesn't seem to affect anything + WriteByte(0x73); + WriteFloat((float)(((const cMinecart &)a_Entity).LastDamage() + 10)); // Damage taken / shake effect multiplyer + + if (((cMinecart &)a_Entity).GetPayload() == cMinecart::mpNone) + { + cRideableMinecart & RideableMinecart = ((cRideableMinecart &)a_Entity); + const cItem & MinecartContent = RideableMinecart.GetContent(); + if (!MinecartContent.IsEmpty()) + { + WriteByte(0x54); + int Content = MinecartContent.m_ItemType; + Content |= MinecartContent.m_ItemDamage << 8; + WriteInt(Content); + WriteByte(0x55); + WriteInt(RideableMinecart.GetBlockHeight()); + WriteByte(0x56); + WriteByte(1); + } + } + else if (((cMinecart &)a_Entity).GetPayload() == cMinecart::mpFurnace) + { + WriteByte(0x10); + WriteByte(((const cMinecartWithFurnace &)a_Entity).IsFueled() ? 1 : 0); + } + break; + } + case cEntity::etProjectile: + { + cProjectileEntity & Projectile = (cProjectileEntity &)a_Entity; + switch (Projectile.GetProjectileKind()) + { + case cProjectileEntity::pkArrow: + { + WriteByte(0x10); + WriteByte(((const cArrowEntity &)a_Entity).IsCritical() ? 1 : 0); + break; + } + case cProjectileEntity::pkFirework: + { + WriteByte(0xA8); + WriteItem(((const cFireworkEntity &)a_Entity).GetItem()); + break; + } + default: break; + } + break; + } + case cEntity::etMonster: + { + WriteMobMetadata((const cMonster &)a_Entity); + break; + } + case cEntity::etItemFrame: + { + cItemFrame & Frame = (cItemFrame &)a_Entity; + WriteByte(0xA8); + WriteItem(Frame.GetItem()); + WriteByte(0x09); + WriteByte(Frame.GetRotation()); + break; + } + default: break; + } +} + + + + + +void cProtocol180::cPacketizer::WriteMobMetadata(const cMonster & a_Mob) +{ + switch (a_Mob.GetMobType()) + { + case mtCreeper: + { + WriteByte(0x10); + WriteByte(((const cCreeper &)a_Mob).IsBlowing() ? 1 : -1); + WriteByte(0x11); + WriteByte(((const cCreeper &)a_Mob).IsCharged() ? 1 : 0); + break; + } + + case mtBat: + { + WriteByte(0x10); + WriteByte(((const cBat &)a_Mob).IsHanging() ? 1 : 0); + break; + } + + case mtPig: + { + WriteByte(0x10); + WriteByte(((const cPig &)a_Mob).IsSaddled() ? 1 : 0); + break; + } + + case mtVillager: + { + WriteByte(0x50); + WriteInt(((const cVillager &)a_Mob).GetVilType()); + break; + } + + case mtZombie: + { + WriteByte(0x0c); + WriteByte(((const cZombie &)a_Mob).IsBaby() ? 1 : 0); + WriteByte(0x0d); + WriteByte(((const cZombie &)a_Mob).IsVillagerZombie() ? 1 : 0); + WriteByte(0x0e); + WriteByte(((const cZombie &)a_Mob).IsConverting() ? 1 : 0); + break; + } + + case mtGhast: + { + WriteByte(0x10); + WriteByte(((const cGhast &)a_Mob).IsCharging()); + break; + } + + case mtWolf: + { + const cWolf & Wolf = (const cWolf &)a_Mob; + Byte WolfStatus = 0; + if (Wolf.IsSitting()) + { + WolfStatus |= 0x1; + } + if (Wolf.IsAngry()) + { + WolfStatus |= 0x2; + } + if (Wolf.IsTame()) + { + WolfStatus |= 0x4; + } + WriteByte(0x10); + WriteByte(WolfStatus); + + WriteByte(0x72); + WriteFloat((float)(a_Mob.GetHealth())); + WriteByte(0x13); + WriteByte(Wolf.IsBegging() ? 1 : 0); + WriteByte(0x14); + WriteByte(Wolf.GetCollarColor()); + break; + } + + case mtSheep: + { + WriteByte(0x10); + Byte SheepMetadata = 0; + SheepMetadata = ((const cSheep &)a_Mob).GetFurColor(); + if (((const cSheep &)a_Mob).IsSheared()) + { + SheepMetadata |= 0x10; + } + WriteByte(SheepMetadata); + break; + } + + case mtEnderman: + { + WriteByte(0x30); + WriteShort((Byte)(((const cEnderman &)a_Mob).GetCarriedBlock())); + WriteByte(0x11); + WriteByte((Byte)(((const cEnderman &)a_Mob).GetCarriedMeta())); + WriteByte(0x12); + WriteByte(((const cEnderman &)a_Mob).IsScreaming() ? 1 : 0); + break; + } + + case mtSkeleton: + { + WriteByte(0x0d); + WriteByte(((const cSkeleton &)a_Mob).IsWither() ? 1 : 0); + break; + } + + case mtWitch: + { + WriteByte(0x15); + WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0); + break; + } + + case mtWither: + { + WriteByte(0x54); // Int at index 20 + WriteInt(((const cWither &)a_Mob).GetWitherInvulnerableTicks()); + WriteByte(0x66); // Float at index 6 + WriteFloat((float)(a_Mob.GetHealth())); + break; + } + + case mtSlime: + { + WriteByte(0x10); + WriteByte(((const cSlime &)a_Mob).GetSize()); + break; + } + + case mtMagmaCube: + { + WriteByte(0x10); + WriteByte(((const cMagmaCube &)a_Mob).GetSize()); + break; + } + + case mtHorse: + { + const cHorse & Horse = (const cHorse &)a_Mob; + int Flags = 0; + if (Horse.IsTame()) + { + Flags |= 0x02; + } + if (Horse.IsSaddled()) + { + Flags |= 0x04; + } + if (Horse.IsChested()) + { + Flags |= 0x08; + } + if (Horse.IsBaby()) + { + Flags |= 0x10; + } + if (Horse.IsEating()) + { + Flags |= 0x20; + } + if (Horse.IsRearing()) + { + Flags |= 0x40; + } + if (Horse.IsMthOpen()) + { + Flags |= 0x80; + } + WriteByte(0x50); // Int at index 16 + WriteInt(Flags); + WriteByte(0x13); // Byte at index 19 + WriteByte(Horse.GetHorseType()); + WriteByte(0x54); // Int at index 20 + int Appearance = 0; + Appearance = Horse.GetHorseColor(); + Appearance |= Horse.GetHorseStyle() << 8; + WriteInt(Appearance); + WriteByte(0x56); // Int at index 22 + WriteInt(Horse.GetHorseArmour()); + break; + } + } // switch (a_Mob.GetType()) +} + + + + + +void cProtocol180::cPacketizer::WriteEntityProperties(const cEntity & a_Entity) +{ + if (!a_Entity.IsMob()) + { + // No properties for anything else than mobs + WriteInt(0); + return; + } + + // const cMonster & Mob = (const cMonster &)a_Entity; + + // TODO: Send properties and modifiers based on the mob type + + WriteInt(0); // NumProperties +} + + + diff --git a/src/Protocol/Protocol18x.h b/src/Protocol/Protocol18x.h new file mode 100644 index 000000000..8c0b77a21 --- /dev/null +++ b/src/Protocol/Protocol18x.h @@ -0,0 +1,338 @@ + +// Protocol18x.h + +/* +Declares the 1.8.x protocol classes: + - cProtocol180 + - release 1.8.0 protocol (#47) +(others may be added later in the future for the 1.8 release series) +*/ + + + + + +#pragma once + +#include "Protocol.h" +#include "../ByteBuffer.h" + +#ifdef _MSC_VER + #pragma warning(push) + #pragma warning(disable:4127) + #pragma warning(disable:4244) + #pragma warning(disable:4231) + #pragma warning(disable:4189) + #pragma warning(disable:4702) +#endif + +#ifdef _MSC_VER + #pragma warning(pop) +#endif + +#include "PolarSSL++/AesCfb128Decryptor.h" +#include "PolarSSL++/AesCfb128Encryptor.h" + + + + + +// fwd: +namespace Json +{ + class Value; +} + + + + + +class cProtocol180 : + public cProtocol +{ + typedef cProtocol super; + +public: + + cProtocol180(cClientHandle * a_Client, const AString & a_ServerAddress, UInt16 a_ServerPort, UInt32 a_State); + + /** Called when client sends some data: */ + virtual void DataReceived(const char * a_Data, size_t a_Size) override; + + /** Sending stuff to clients (alphabetically sorted): */ + virtual void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle) override; + virtual void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) override; + virtual void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage) override; + virtual void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override; + virtual void SendBlockChanges (int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes) override; + virtual void SendChat (const AString & a_Message) override; + virtual void SendChat (const cCompositeChat & a_Message) override; + virtual void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) override; + virtual void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player) override; + virtual void SendDestroyEntity (const cEntity & a_Entity) override; + virtual void SendDisconnect (const AString & a_Reason) override; + virtual void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ) override; ///< Request the client to open up the sign editor for the sign (1.6+) + virtual void SendEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration) override; + virtual void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) override; + virtual void SendEntityHeadLook (const cEntity & a_Entity) override; + virtual void SendEntityLook (const cEntity & a_Entity) override; + virtual void SendEntityMetadata (const cEntity & a_Entity) override; + virtual void SendEntityProperties (const cEntity & a_Entity) override; + virtual void SendEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; + virtual void SendEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; + virtual void SendEntityStatus (const cEntity & a_Entity, char a_Status) override; + virtual void SendEntityVelocity (const cEntity & a_Entity) override; + virtual void SendExplosion (double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion) override; + virtual void SendGameMode (eGameMode a_GameMode) override; + virtual void SendHealth (void) override; + virtual void SendInventorySlot (char a_WindowID, short a_SlotNum, const cItem & a_Item) override; + virtual void SendKeepAlive (int a_PingID) override; + virtual void SendLogin (const cPlayer & a_Player, const cWorld & a_World) override; + virtual void SendLoginSuccess (void) override; + virtual void SendMapColumn (int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length, unsigned int m_Scale) override; + virtual void SendMapDecorators (int a_ID, const cMapDecoratorList & a_Decorators, unsigned int m_Scale) override; + virtual void SendMapInfo (int a_ID, unsigned int a_Scale) override; + virtual void SendPaintingSpawn (const cPainting & a_Painting) override; + virtual void SendPickupSpawn (const cPickup & a_Pickup) override; + virtual void SendPlayerAbilities (void) override; + virtual void SendEntityAnimation (const cEntity & a_Entity, char a_Animation) override; + virtual void SendParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount) override; + virtual void SendPlayerListAddPlayer (const cPlayer & a_Player) override; + virtual void SendPlayerListRemovePlayer (const cPlayer & a_Player) override; + virtual void SendPlayerListUpdateGameMode (const cPlayer & a_Player) override; + virtual void SendPlayerListUpdatePing (const cPlayer & a_Player) override; + virtual void SendPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName) override; + virtual void SendPlayerMaxSpeed (void) override; + virtual void SendPlayerMoveLook (void) override; + virtual void SendPlayerPosition (void) override; + virtual void SendPlayerSpawn (const cPlayer & a_Player) override; + virtual void SendPluginMessage (const AString & a_Channel, const AString & a_Message) override; + virtual void SendRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID) override; + virtual void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) override; + virtual void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) override; + virtual void SendExperience (void) override; + virtual void SendExperienceOrb (const cExpOrb & a_ExpOrb) override; + virtual void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) override; + virtual void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) override; + virtual void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) override; + virtual void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) override; + virtual void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock) override; + virtual void SendSpawnMob (const cMonster & a_Mob) override; + virtual void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) override; + virtual void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) override; + virtual void SendStatistics (const cStatManager & a_Manager) override; + virtual void SendTabCompletionResults (const AStringVector & a_Results) override; + virtual void SendTeleportEntity (const cEntity & a_Entity) override; + virtual void SendThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ) override; + virtual void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay, bool a_DoDaylightCycle) override; + virtual void SendUnloadChunk (int a_ChunkX, int a_ChunkZ) override; + virtual void SendUpdateBlockEntity (cBlockEntity & a_BlockEntity) override; + virtual void SendUpdateSign (int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4) override; + virtual void SendUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) override; + virtual void SendWeather (eWeather a_Weather) override; + virtual void SendWholeInventory (const cWindow & a_Window) override; + virtual void SendWindowClose (const cWindow & a_Window) override; + virtual void SendWindowOpen (const cWindow & a_Window) override; + virtual void SendWindowProperty (const cWindow & a_Window, int a_Property, int a_Value) override; + + virtual AString GetAuthServerID(void) override { return m_AuthServerID; } + + /** Compress the packet. a_Packet must be without packet length. + a_Compressed will be set to the compressed packet includes packet length and data length. + If compression fails, the function returns false. */ + static bool CompressPacket(const AString & a_Packet, AString & a_Compressed); + + /** The 1.8 protocol use a particle id instead of a string. This function converts the name to the id. If the name is incorrect, it returns 0. */ + static int GetParticleID(const AString & a_ParticleName); + + /** Minecraft 1.8 use other locations to spawn the item frame. This function converts the 1.7 positions to 1.8 positions. */ + static void FixItemFramePositions(int a_ObjectData, double & a_PosX, double & a_PosZ, double & a_Yaw); + +protected: + + /** Composes individual packets in the protocol's m_OutPacketBuffer; sends them upon being destructed */ + class cPacketizer + { + public: + cPacketizer(cProtocol180 & a_Protocol, UInt32 a_PacketType) : + m_Protocol(a_Protocol), + m_Out(a_Protocol.m_OutPacketBuffer), + m_Lock(a_Protocol.m_CSPacket) + { + m_Out.WriteVarInt(a_PacketType); + } + + ~cPacketizer(); + + void WriteBool(bool a_Value) + { + m_Out.WriteBool(a_Value); + } + + void WriteByte(Byte a_Value) + { + m_Out.WriteByte(a_Value); + } + + void WriteChar(char a_Value) + { + m_Out.WriteChar(a_Value); + } + + void WriteShort(short a_Value) + { + m_Out.WriteBEShort(a_Value); + } + + void WriteInt(int a_Value) + { + m_Out.WriteBEInt(a_Value); + } + + void WriteInt64(Int64 a_Value) + { + m_Out.WriteBEInt64(a_Value); + } + + void WriteFloat(float a_Value) + { + m_Out.WriteBEFloat(a_Value); + } + + void WriteDouble(double a_Value) + { + m_Out.WriteBEDouble(a_Value); + } + + void WriteVarInt(UInt32 a_Value) + { + m_Out.WriteVarInt(a_Value); + } + + void WriteString(const AString & a_Value) + { + m_Out.WriteVarUTF8String(a_Value); + } + + void WritePosition(int a_BlockX, int a_BlockY, int a_BlockZ) + { + m_Out.WritePosition(a_BlockX, a_BlockY, a_BlockZ); + } + + void WriteUUID(const AString & a_UUID); + + void WriteBuf(const char * a_Data, size_t a_Size) + { + m_Out.Write(a_Data, a_Size); + } + + void WriteItem(const cItem & a_Item); + void WriteByteAngle(double a_Angle); // Writes the specified angle using a single byte + void WriteFPInt(double a_Value); // Writes the double value as a 27:5 fixed-point integer + void WriteEntityMetadata(const cEntity & a_Entity); // Writes the metadata for the specified entity, not including the terminating 0x7f + void WriteMobMetadata(const cMonster & a_Mob); // Writes the mob-specific metadata for the specified mob + void WriteEntityProperties(const cEntity & a_Entity); // Writes the entity properties for the specified entity, including the Count field + void WriteBlockEntity(const cBlockEntity & a_BlockEntity); + + protected: + cProtocol180 & m_Protocol; + cByteBuffer & m_Out; + cCSLock m_Lock; + } ; + + AString m_ServerAddress; + + UInt16 m_ServerPort; + + AString m_AuthServerID; + + /** State of the protocol. 1 = status, 2 = login, 3 = game */ + UInt32 m_State; + + /** Buffer for the received data */ + cByteBuffer m_ReceivedData; + + /** Buffer for composing the outgoing packets, through cPacketizer */ + cByteBuffer m_OutPacketBuffer; + + /** Buffer for composing packet length (so that each cPacketizer instance doesn't allocate a new cPacketBuffer) */ + cByteBuffer m_OutPacketLenBuffer; + + bool m_IsEncrypted; + + cAesCfb128Decryptor m_Decryptor; + cAesCfb128Encryptor m_Encryptor; + + /** The logfile where the comm is logged, when g_ShouldLogComm is true */ + cFile m_CommLogFile; + + /** The dimension that was last sent to a player in a Respawn or Login packet. + Used to avoid Respawning into the same dimension, which confuses the client. */ + eDimension m_LastSentDimension; + + + /** Adds the received (unencrypted) data to m_ReceivedData, parses complete packets */ + void AddReceivedData(const char * a_Data, size_t a_Size); + + /** Reads and handles the packet. The packet length and type have already been read. + Returns true if the packet was understood, false if it was an unknown packet + */ + bool HandlePacket(cByteBuffer & a_ByteBuffer, UInt32 a_PacketType); + + // Packet handlers while in the Status state (m_State == 1): + void HandlePacketStatusPing(cByteBuffer & a_ByteBuffer); + void HandlePacketStatusRequest(cByteBuffer & a_ByteBuffer); + + // Packet handlers while in the Login state (m_State == 2): + void HandlePacketLoginEncryptionResponse(cByteBuffer & a_ByteBuffer); + void HandlePacketLoginStart(cByteBuffer & a_ByteBuffer); + + // Packet handlers while in the Game state (m_State == 3): + void HandlePacketAnimation (cByteBuffer & a_ByteBuffer); + void HandlePacketBlockDig (cByteBuffer & a_ByteBuffer); + void HandlePacketBlockPlace (cByteBuffer & a_ByteBuffer); + void HandlePacketChatMessage (cByteBuffer & a_ByteBuffer); + void HandlePacketClientSettings (cByteBuffer & a_ByteBuffer); + void HandlePacketClientStatus (cByteBuffer & a_ByteBuffer); + void HandlePacketCreativeInventoryAction(cByteBuffer & a_ByteBuffer); + void HandlePacketEntityAction (cByteBuffer & a_ByteBuffer); + void HandlePacketKeepAlive (cByteBuffer & a_ByteBuffer); + void HandlePacketPlayer (cByteBuffer & a_ByteBuffer); + void HandlePacketPlayerAbilities (cByteBuffer & a_ByteBuffer); + void HandlePacketPlayerLook (cByteBuffer & a_ByteBuffer); + void HandlePacketPlayerPos (cByteBuffer & a_ByteBuffer); + void HandlePacketPlayerPosLook (cByteBuffer & a_ByteBuffer); + void HandlePacketPluginMessage (cByteBuffer & a_ByteBuffer); + void HandlePacketSlotSelect (cByteBuffer & a_ByteBuffer); + void HandlePacketSteerVehicle (cByteBuffer & a_ByteBuffer); + void HandlePacketTabComplete (cByteBuffer & a_ByteBuffer); + void HandlePacketUpdateSign (cByteBuffer & a_ByteBuffer); + void HandlePacketUseEntity (cByteBuffer & a_ByteBuffer); + void HandlePacketEnchantItem (cByteBuffer & a_ByteBuffer); + void HandlePacketWindowClick (cByteBuffer & a_ByteBuffer); + void HandlePacketWindowClose (cByteBuffer & a_ByteBuffer); + + /** Parses Vanilla plugin messages into specific ClientHandle calls. + The message payload is still in the bytebuffer, the handler reads it specifically for each handled channel */ + void HandleVanillaPluginMessage(cByteBuffer & a_ByteBuffer, const AString & a_Channel); + + + /** Sends the data to the client, encrypting them if needed. */ + virtual void SendData(const char * a_Data, size_t a_Size) override; + + void SendCompass(const cWorld & a_World); + + /** Reads an item out of the received data, sets a_Item to the values read. + Returns false if not enough received data. + a_KeepRemainingBytes tells the function to keep that many bytes at the end of the buffer. */ + virtual bool ReadItem(cByteBuffer & a_ByteBuffer, cItem & a_Item, size_t a_KeepRemainingBytes = 0); + + /** Parses item metadata as read by ReadItem(), into the item enchantments. */ + void ParseItemMetadata(cItem & a_Item, const AString & a_Metadata); + + void StartEncryption(const Byte * a_Key); + +} ; + + + diff --git a/src/Protocol/ProtocolRecognizer.cpp b/src/Protocol/ProtocolRecognizer.cpp index a7fb7bcc2..15bcd03b1 100644 --- a/src/Protocol/ProtocolRecognizer.cpp +++ b/src/Protocol/ProtocolRecognizer.cpp @@ -7,17 +7,14 @@ #include "Globals.h" #include "ProtocolRecognizer.h" -#include "Protocol125.h" -#include "Protocol132.h" -#include "Protocol14x.h" -#include "Protocol15x.h" -#include "Protocol16x.h" #include "Protocol17x.h" +#include "Protocol18x.h" #include "../ClientHandle.h" #include "../Root.h" #include "../Server.h" #include "../World.h" #include "../ChatColor.h" +#include "Bindings/PluginManager.h" @@ -26,7 +23,7 @@ cProtocolRecognizer::cProtocolRecognizer(cClientHandle * a_Client) : super(a_Client), m_Protocol(NULL), - m_Buffer(512) + m_Buffer(8192) // We need a larger buffer to support BungeeCord - it sends one huge packet at the start { } @@ -48,19 +45,9 @@ AString cProtocolRecognizer::GetVersionTextFromInt(int a_ProtocolVersion) { switch (a_ProtocolVersion) { - case PROTO_VERSION_1_2_5: return "1.2.5"; - case PROTO_VERSION_1_3_2: return "1.3.2"; - case PROTO_VERSION_1_4_2: return "1.4.2"; - case PROTO_VERSION_1_4_4: return "1.4.4"; - case PROTO_VERSION_1_4_6: return "1.4.6"; - case PROTO_VERSION_1_5_0: return "1.5"; - case PROTO_VERSION_1_5_2: return "1.5.2"; - case PROTO_VERSION_1_6_1: return "1.6.1"; - case PROTO_VERSION_1_6_2: return "1.6.2"; - case PROTO_VERSION_1_6_3: return "1.6.3"; - case PROTO_VERSION_1_6_4: return "1.6.4"; case PROTO_VERSION_1_7_2: return "1.7.2"; case PROTO_VERSION_1_7_6: return "1.7.6"; + case PROTO_VERSION_1_8_0: return "1.8"; } ASSERT(!"Unknown protocol version"); return Printf("Unknown protocol (%d)", a_ProtocolVersion); @@ -210,8 +197,13 @@ void cProtocolRecognizer::SendDisconnect(const AString & a_Reason) else { // This is used when the client sends a server-ping, respond with the default packet: - WriteByte (0xff); // PACKET_DISCONNECT - WriteString(a_Reason); + static const int Packet = 0xff; // PACKET_DISCONNECT + SendData((const char *)&Packet, 1); // WriteByte() + + AString UTF16 = UTF8ToRawBEUTF16(a_Reason.c_str(), a_Reason.length()); + static const u_short Size = htons((u_short)(UTF16.size() / 2)); + SendData((const char *)&Size, 2); // WriteShort() + SendData(UTF16.data(), UTF16.size()); // WriteString() } } @@ -408,20 +400,20 @@ void cProtocolRecognizer::SendLoginSuccess(void) -void cProtocolRecognizer::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length) +void cProtocolRecognizer::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length, unsigned int m_Scale) { ASSERT(m_Protocol != NULL); - m_Protocol->SendMapColumn(a_ID, a_X, a_Y, a_Colors, a_Length); + m_Protocol->SendMapColumn(a_ID, a_X, a_Y, a_Colors, a_Length, m_Scale); } -void cProtocolRecognizer::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decorators) +void cProtocolRecognizer::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decorators, unsigned int m_Scale) { ASSERT(m_Protocol != NULL); - m_Protocol->SendMapDecorators(a_ID, a_Decorators); + m_Protocol->SendMapDecorators(a_ID, a_Decorators, m_Scale); } @@ -438,10 +430,10 @@ void cProtocolRecognizer::SendMapInfo(int a_ID, unsigned int a_Scale) -void cProtocolRecognizer::SendParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount) +void cProtocolRecognizer::SendParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount) { ASSERT(m_Protocol != NULL); - m_Protocol->SendParticleEffect(a_ParticleName, a_SrcX, a_SrcY, a_SrcZ, a_OffsetX, a_OffsetY, a_OffsetZ, a_ParticleData, a_ParticleAmmount); + m_Protocol->SendParticleEffect(a_ParticleName, a_SrcX, a_SrcY, a_SrcZ, a_OffsetX, a_OffsetY, a_OffsetZ, a_ParticleData, a_ParticleAmount); } @@ -486,10 +478,50 @@ void cProtocolRecognizer::SendEntityAnimation(const cEntity & a_Entity, char a_A -void cProtocolRecognizer::SendPlayerListItem(const cPlayer & a_Player, bool a_IsOnline) +void cProtocolRecognizer::SendPlayerListAddPlayer(const cPlayer & a_Player) +{ + ASSERT(m_Protocol != NULL); + m_Protocol->SendPlayerListAddPlayer(a_Player); +} + + + + + +void cProtocolRecognizer::SendPlayerListRemovePlayer(const cPlayer & a_Player) +{ + ASSERT(m_Protocol != NULL); + m_Protocol->SendPlayerListRemovePlayer(a_Player); +} + + + + + +void cProtocolRecognizer::SendPlayerListUpdateGameMode(const cPlayer & a_Player) +{ + ASSERT(m_Protocol != NULL); + m_Protocol->SendPlayerListUpdateGameMode(a_Player); +} + + + + + +void cProtocolRecognizer::SendPlayerListUpdatePing(const cPlayer & a_Player) +{ + ASSERT(m_Protocol != NULL); + m_Protocol->SendPlayerListUpdatePing(a_Player); +} + + + + + +void cProtocolRecognizer::SendPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName) { ASSERT(m_Protocol != NULL); - m_Protocol->SendPlayerListItem(a_Player, a_IsOnline); + m_Protocol->SendPlayerListUpdateDisplayName(a_Player, a_CustomName); } @@ -716,10 +748,10 @@ void cProtocolRecognizer::SendThunderbolt(int a_BlockX, int a_BlockY, int a_Bloc -void cProtocolRecognizer::SendTimeUpdate(Int64 a_WorldAge, Int64 a_TimeOfDay) +void cProtocolRecognizer::SendTimeUpdate(Int64 a_WorldAge, Int64 a_TimeOfDay, bool a_DoDaylightCycle) { ASSERT(m_Protocol != NULL); - m_Protocol->SendTimeUpdate(a_WorldAge, a_TimeOfDay); + m_Protocol->SendTimeUpdate(a_WorldAge, a_TimeOfDay, a_DoDaylightCycle); } @@ -830,51 +862,8 @@ bool cProtocolRecognizer::TryRecognizeProtocol(void) { // NOTE: If a new protocol is added or an old one is removed, adjust MCS_CLIENT_VERSIONS and // MCS_PROTOCOL_VERSIONS macros in the header file, as well as PROTO_VERSION_LATEST macro - - // The first packet should be a Handshake, 0x02: - unsigned char PacketType; - if (!m_Buffer.ReadByte(PacketType)) - { - return false; - } - switch (PacketType) - { - case 0x02: return TryRecognizeLengthlessProtocol(); // Handshake, continue recognizing - case 0xfe: - { - // This may be either a packet length or the length-less Ping packet - Byte NextByte; - if (!m_Buffer.ReadByte(NextByte)) - { - // Not enough data for either protocol - // This could actually happen with the 1.2 / 1.3 client, but their support is fading out anyway - return false; - } - if (NextByte != 0x01) - { - // This is definitely NOT a length-less Ping packet, handle as lengthed protocol: - break; - } - if (!m_Buffer.ReadByte(NextByte)) - { - // There is no more data. Although this *could* mean TCP fragmentation, it is highly unlikely - // and rather this is a 1.4 client sending a regular Ping packet (without the following Plugin message) - SendLengthlessServerPing(); - return false; - } - if (NextByte == 0xfa) - { - // Definitely a length-less Ping followed by a Plugin message - SendLengthlessServerPing(); - return false; - } - // Definitely a lengthed Initial handshake, handle below: - break; - } - } // switch (PacketType) - // This must be a lengthed protocol, try if it has the entire initial handshake packet: - m_Buffer.ResetRead(); + // Lengthed protocol, try if it has the entire initial handshake packet: UInt32 PacketLen; UInt32 ReadSoFar = (UInt32)m_Buffer.GetReadableSpace(); if (!m_Buffer.ReadVarInt(PacketLen)) @@ -895,61 +884,6 @@ bool cProtocolRecognizer::TryRecognizeProtocol(void) -bool cProtocolRecognizer::TryRecognizeLengthlessProtocol(void) -{ - // The comm started with 0x02, which is a Handshake packet in the length-less protocol family - // 1.3.2 starts with 0x02 0x39 <name-length-short> - // 1.2.5 starts with 0x02 <name-length-short> and name is expected to less than 0x3900 long :) - char ch; - if (!m_Buffer.ReadChar(ch)) - { - return false; - } - switch (ch) - { - case PROTO_VERSION_1_3_2: - { - m_Protocol = new cProtocol132(m_Client); - return true; - } - case PROTO_VERSION_1_4_2: - case PROTO_VERSION_1_4_4: - { - m_Protocol = new cProtocol142(m_Client); - return true; - } - case PROTO_VERSION_1_4_6: - { - m_Protocol = new cProtocol146(m_Client); - return true; - } - case PROTO_VERSION_1_5_0: - case PROTO_VERSION_1_5_2: - { - m_Protocol = new cProtocol150(m_Client); - return true; - } - case PROTO_VERSION_1_6_1: - { - m_Protocol = new cProtocol161(m_Client); - return true; - } - case PROTO_VERSION_1_6_2: - case PROTO_VERSION_1_6_3: - case PROTO_VERSION_1_6_4: - { - m_Protocol = new cProtocol162(m_Client); - return true; - } - } - m_Protocol = new cProtocol125(m_Client); - return true; -} - - - - - bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRemaining) { UInt32 PacketType; @@ -971,6 +905,7 @@ bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRema { return false; } + m_Client->SetProtocolVersion(ProtocolVersion); switch (ProtocolVersion) { case PROTO_VERSION_1_7_2: @@ -978,9 +913,18 @@ bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRema AString ServerAddress; short ServerPort; UInt32 NextState; - m_Buffer.ReadVarUTF8String(ServerAddress); - m_Buffer.ReadBEShort(ServerPort); - m_Buffer.ReadVarInt(NextState); + if (!m_Buffer.ReadVarUTF8String(ServerAddress)) + { + break; + } + if (!m_Buffer.ReadBEShort(ServerPort)) + { + break; + } + if (!m_Buffer.ReadVarInt(NextState)) + { + break; + } m_Buffer.CommitRead(); m_Protocol = new cProtocol172(m_Client, ServerAddress, (UInt16)ServerPort, NextState); return true; @@ -990,13 +934,43 @@ bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRema AString ServerAddress; short ServerPort; UInt32 NextState; - m_Buffer.ReadVarUTF8String(ServerAddress); - m_Buffer.ReadBEShort(ServerPort); - m_Buffer.ReadVarInt(NextState); + if (!m_Buffer.ReadVarUTF8String(ServerAddress)) + { + break; + } + if (!m_Buffer.ReadBEShort(ServerPort)) + { + break; + } + if (!m_Buffer.ReadVarInt(NextState)) + { + break; + } m_Buffer.CommitRead(); m_Protocol = new cProtocol176(m_Client, ServerAddress, (UInt16)ServerPort, NextState); return true; } + case PROTO_VERSION_1_8_0: + { + AString ServerAddress; + short ServerPort; + UInt32 NextState; + if (!m_Buffer.ReadVarUTF8String(ServerAddress)) + { + break; + } + if (!m_Buffer.ReadBEShort(ServerPort)) + { + break; + } + if (!m_Buffer.ReadVarInt(NextState)) + { + break; + } + m_Buffer.CommitRead(); + m_Protocol = new cProtocol180(m_Client, ServerAddress, (UInt16)ServerPort, NextState); + return true; + } } LOGINFO("Client \"%s\" uses an unsupported protocol (lengthed, version %u)", m_Client->GetIPString().c_str(), ProtocolVersion @@ -1008,79 +982,3 @@ bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRema - -void cProtocolRecognizer::SendLengthlessServerPing(void) -{ - AString Reply; - cServer * Server = cRoot::Get()->GetServer(); - switch (cRoot::Get()->GetPrimaryServerVersion()) - { - case PROTO_VERSION_1_2_5: - case PROTO_VERSION_1_3_2: - { - // http://wiki.vg/wiki/index.php?title=Protocol&oldid=3099#Server_List_Ping_.280xFE.29 - Printf(Reply, "%s%s%i%s%i", - Server->GetDescription().c_str(), - cChatColor::Delimiter, - Server->GetNumPlayers(), - cChatColor::Delimiter, - Server->GetMaxPlayers() - ); - break; - } - - case PROTO_VERSION_1_4_2: - case PROTO_VERSION_1_4_4: - case PROTO_VERSION_1_4_6: - case PROTO_VERSION_1_5_0: - case PROTO_VERSION_1_5_2: - case PROTO_VERSION_1_6_1: - case PROTO_VERSION_1_6_2: - case PROTO_VERSION_1_6_3: - case PROTO_VERSION_1_6_4: - { - // The server list ping now has 1 more byte of "magic". Mojang just loves to complicate stuff. - // http://wiki.vg/wiki/index.php?title=Protocol&oldid=3101#Server_List_Ping_.280xFE.29 - // _X 2012_10_31: I know that this needn't eat the byte, since it still may be in transit. - // Who cares? We're disconnecting anyway. - m_Buffer.ResetRead(); - if (m_Buffer.CanReadBytes(2)) - { - Byte val; - m_Buffer.ReadByte(val); // Packet type - Serverlist ping - m_Buffer.ReadByte(val); // 0x01 magic value - ASSERT(val == 0x01); - } - - // http://wiki.vg/wiki/index.php?title=Server_List_Ping&oldid=3100 - AString NumPlayers; - Printf(NumPlayers, "%d", Server->GetNumPlayers()); - AString MaxPlayers; - Printf(MaxPlayers, "%d", Server->GetMaxPlayers()); - - AString ProtocolVersionNum; - Printf(ProtocolVersionNum, "%d", cRoot::Get()->GetPrimaryServerVersion()); - AString ProtocolVersionTxt(GetVersionTextFromInt(cRoot::Get()->GetPrimaryServerVersion())); - - // Cannot use Printf() because of in-string NUL bytes. - Reply = cChatColor::Delimiter; - Reply.append("1"); - Reply.push_back(0); - Reply.append(ProtocolVersionNum); - Reply.push_back(0); - Reply.append(ProtocolVersionTxt); - Reply.push_back(0); - Reply.append(Server->GetDescription()); - Reply.push_back(0); - Reply.append(NumPlayers); - Reply.push_back(0); - Reply.append(MaxPlayers); - break; - } - } // switch (m_PrimaryServerVersion) - m_Client->Kick(Reply); -} - - - - diff --git a/src/Protocol/ProtocolRecognizer.h b/src/Protocol/ProtocolRecognizer.h index 65829ef73..b42cfdec2 100644 --- a/src/Protocol/ProtocolRecognizer.h +++ b/src/Protocol/ProtocolRecognizer.h @@ -18,8 +18,8 @@ // Adjust these if a new protocol is added or an old one is removed: -#define MCS_CLIENT_VERSIONS "1.2.4, 1.2.5, 1.3.1, 1.3.2, 1.4.2, 1.4.4, 1.4.5, 1.4.6, 1.4.7, 1.5, 1.5.1, 1.5.2, 1.6.1, 1.6.2, 1.6.3, 1.6.4, 1.7.2, 1.7.4, 1.7.5, 1.7.6, 1.7.7, 1.7.8, 1.7.9" -#define MCS_PROTOCOL_VERSIONS "29, 39, 47, 49, 51, 60, 61, 73, 74, 77, 78, 4, 5" +#define MCS_CLIENT_VERSIONS "1.7.x, 1.8" +#define MCS_PROTOCOL_VERSIONS "4, 5, 47" @@ -33,24 +33,9 @@ class cProtocolRecognizer : public: enum { - PROTO_VERSION_1_2_5 = 29, - PROTO_VERSION_1_3_2 = 39, - PROTO_VERSION_1_4_2 = 47, - PROTO_VERSION_1_4_4 = 49, - PROTO_VERSION_1_4_6 = 51, - PROTO_VERSION_1_5_0 = 60, - PROTO_VERSION_1_5_2 = 61, - PROTO_VERSION_1_6_1 = 73, - PROTO_VERSION_1_6_2 = 74, - PROTO_VERSION_1_6_3 = 77, - PROTO_VERSION_1_6_4 = 78, - - PROTO_VERSION_NEXT, - PROTO_VERSION_LATEST = PROTO_VERSION_NEXT - 1, ///< Automatically assigned to the last protocol version, this serves as the default for PrimaryServerVersion - - // These will be kept "under" the next / latest, because the next and latest are only needed for previous protocols PROTO_VERSION_1_7_2 = 4, PROTO_VERSION_1_7_6 = 5, + PROTO_VERSION_1_8_0 = 47, } ; cProtocolRecognizer(cClientHandle * a_Client); @@ -63,76 +48,80 @@ public: virtual void DataReceived(const char * a_Data, size_t a_Size) override; /// Sending stuff to clients (alphabetically sorted): - virtual void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle) override; - virtual void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) override; - virtual void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage) override; - virtual void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override; - virtual void SendBlockChanges (int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes) override; - virtual void SendChat (const AString & a_Message) override; - virtual void SendChat (const cCompositeChat & a_Message) override; - virtual void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) override; - virtual void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player) override; - virtual void SendDestroyEntity (const cEntity & a_Entity) override; - virtual void SendDisconnect (const AString & a_Reason) override; - virtual void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ) override; ///< Request the client to open up the sign editor for the sign (1.6+) - virtual void SendEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration) override; - virtual void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) override; - virtual void SendEntityHeadLook (const cEntity & a_Entity) override; - virtual void SendEntityLook (const cEntity & a_Entity) override; - virtual void SendEntityMetadata (const cEntity & a_Entity) override; - virtual void SendEntityProperties (const cEntity & a_Entity) override; - virtual void SendEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; - virtual void SendEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; - virtual void SendEntityStatus (const cEntity & a_Entity, char a_Status) override; - virtual void SendEntityVelocity (const cEntity & a_Entity) override; - virtual void SendExplosion (double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion) override; - virtual void SendGameMode (eGameMode a_GameMode) override; - virtual void SendHealth (void) override; - virtual void SendInventorySlot (char a_WindowID, short a_SlotNum, const cItem & a_Item) override; - virtual void SendKeepAlive (int a_PingID) override; - virtual void SendLogin (const cPlayer & a_Player, const cWorld & a_World) override; - virtual void SendLoginSuccess (void) override; - virtual void SendMapColumn (int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length) override; - virtual void SendMapDecorators (int a_ID, const cMapDecoratorList & a_Decorators) override; - virtual void SendMapInfo (int a_ID, unsigned int a_Scale) override; - virtual void SendParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount) override; - virtual void SendPaintingSpawn (const cPainting & a_Painting) override; - virtual void SendPickupSpawn (const cPickup & a_Pickup) override; - virtual void SendPlayerAbilities (void) override; - virtual void SendEntityAnimation (const cEntity & a_Entity, char a_Animation) override; - virtual void SendPlayerListItem (const cPlayer & a_Player, bool a_IsOnline) override; - virtual void SendPlayerMaxSpeed (void) override; - virtual void SendPlayerMoveLook (void) override; - virtual void SendPlayerPosition (void) override; - virtual void SendPlayerSpawn (const cPlayer & a_Player) override; - virtual void SendPluginMessage (const AString & a_Channel, const AString & a_Message) override; - virtual void SendRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID) override; - virtual void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) override; - virtual void SendExperience (void) override; - virtual void SendExperienceOrb (const cExpOrb & a_ExpOrb) override; - virtual void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) override; - virtual void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) override; - virtual void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) override; - virtual void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) override; - virtual void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) override; - virtual void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock) override; - virtual void SendSpawnMob (const cMonster & a_Mob) override; - virtual void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) override; - virtual void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) override; - virtual void SendStatistics (const cStatManager & a_Manager) override; - virtual void SendTabCompletionResults(const AStringVector & a_Results) override; - virtual void SendTeleportEntity (const cEntity & a_Entity) override; - virtual void SendThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ) override; - virtual void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay) override; - virtual void SendUnloadChunk (int a_ChunkX, int a_ChunkZ) override; - virtual void SendUpdateBlockEntity (cBlockEntity & a_BlockEntity) override; - virtual void SendUpdateSign (int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4) override; - virtual void SendUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) override; - virtual void SendWeather (eWeather a_Weather) override; - virtual void SendWholeInventory (const cWindow & a_Window) override; - virtual void SendWindowClose (const cWindow & a_Window) override; - virtual void SendWindowOpen (const cWindow & a_Window) override; - virtual void SendWindowProperty (const cWindow & a_Window, int a_Property, int a_Value) override; + virtual void SendAttachEntity (const cEntity & a_Entity, const cEntity * a_Vehicle) override; + virtual void SendBlockAction (int a_BlockX, int a_BlockY, int a_BlockZ, char a_Byte1, char a_Byte2, BLOCKTYPE a_BlockType) override; + virtual void SendBlockBreakAnim (int a_EntityID, int a_BlockX, int a_BlockY, int a_BlockZ, char a_Stage) override; + virtual void SendBlockChange (int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override; + virtual void SendBlockChanges (int a_ChunkX, int a_ChunkZ, const sSetBlockVector & a_Changes) override; + virtual void SendChat (const AString & a_Message) override; + virtual void SendChat (const cCompositeChat & a_Message) override; + virtual void SendChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer) override; + virtual void SendCollectEntity (const cEntity & a_Entity, const cPlayer & a_Player) override; + virtual void SendDestroyEntity (const cEntity & a_Entity) override; + virtual void SendDisconnect (const AString & a_Reason) override; + virtual void SendEditSign (int a_BlockX, int a_BlockY, int a_BlockZ) override; ///< Request the client to open up the sign editor for the sign (1.6+) + virtual void SendEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration) override; + virtual void SendEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item) override; + virtual void SendEntityHeadLook (const cEntity & a_Entity) override; + virtual void SendEntityLook (const cEntity & a_Entity) override; + virtual void SendEntityMetadata (const cEntity & a_Entity) override; + virtual void SendEntityProperties (const cEntity & a_Entity) override; + virtual void SendEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; + virtual void SendEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ) override; + virtual void SendEntityStatus (const cEntity & a_Entity, char a_Status) override; + virtual void SendEntityVelocity (const cEntity & a_Entity) override; + virtual void SendExplosion (double a_BlockX, double a_BlockY, double a_BlockZ, float a_Radius, const cVector3iArray & a_BlocksAffected, const Vector3d & a_PlayerMotion) override; + virtual void SendGameMode (eGameMode a_GameMode) override; + virtual void SendHealth (void) override; + virtual void SendInventorySlot (char a_WindowID, short a_SlotNum, const cItem & a_Item) override; + virtual void SendKeepAlive (int a_PingID) override; + virtual void SendLogin (const cPlayer & a_Player, const cWorld & a_World) override; + virtual void SendLoginSuccess (void) override; + virtual void SendMapColumn (int a_ID, int a_X, int a_Y, const Byte * a_Colors, unsigned int a_Length, unsigned int m_Scale) override; + virtual void SendMapDecorators (int a_ID, const cMapDecoratorList & a_Decorators, unsigned int m_Scale) override; + virtual void SendMapInfo (int a_ID, unsigned int a_Scale) override; + virtual void SendParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount) override; + virtual void SendPaintingSpawn (const cPainting & a_Painting) override; + virtual void SendPickupSpawn (const cPickup & a_Pickup) override; + virtual void SendPlayerAbilities (void) override; + virtual void SendEntityAnimation (const cEntity & a_Entity, char a_Animation) override; + virtual void SendPlayerListAddPlayer (const cPlayer & a_Player) override; + virtual void SendPlayerListRemovePlayer (const cPlayer & a_Player) override; + virtual void SendPlayerListUpdateGameMode (const cPlayer & a_Player) override; + virtual void SendPlayerListUpdatePing (const cPlayer & a_Player) override; + virtual void SendPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName) override; + virtual void SendPlayerMaxSpeed (void) override; + virtual void SendPlayerMoveLook (void) override; + virtual void SendPlayerPosition (void) override; + virtual void SendPlayerSpawn (const cPlayer & a_Player) override; + virtual void SendPluginMessage (const AString & a_Channel, const AString & a_Message) override; + virtual void SendRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID) override; + virtual void SendRespawn (eDimension a_Dimension, bool a_ShouldIgnoreDimensionChecks) override; + virtual void SendExperience (void) override; + virtual void SendExperienceOrb (const cExpOrb & a_ExpOrb) override; + virtual void SendScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode) override; + virtual void SendScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode) override; + virtual void SendDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display) override; + virtual void SendSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch) override; + virtual void SendSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data) override; + virtual void SendSpawnFallingBlock (const cFallingBlock & a_FallingBlock) override; + virtual void SendSpawnMob (const cMonster & a_Mob) override; + virtual void SendSpawnObject (const cEntity & a_Entity, char a_ObjectType, int a_ObjectData, Byte a_Yaw, Byte a_Pitch) override; + virtual void SendSpawnVehicle (const cEntity & a_Vehicle, char a_VehicleType, char a_VehicleSubType) override; + virtual void SendStatistics (const cStatManager & a_Manager) override; + virtual void SendTabCompletionResults (const AStringVector & a_Results) override; + virtual void SendTeleportEntity (const cEntity & a_Entity) override; + virtual void SendThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ) override; + virtual void SendTimeUpdate (Int64 a_WorldAge, Int64 a_TimeOfDay, bool a_DoDaylightCycle) override; + virtual void SendUnloadChunk (int a_ChunkX, int a_ChunkZ) override; + virtual void SendUpdateBlockEntity (cBlockEntity & a_BlockEntity) override; + virtual void SendUpdateSign (int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4) override; + virtual void SendUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) override; + virtual void SendWeather (eWeather a_Weather) override; + virtual void SendWholeInventory (const cWindow & a_Window) override; + virtual void SendWindowClose (const cWindow & a_Window) override; + virtual void SendWindowOpen (const cWindow & a_Window) override; + virtual void SendWindowProperty (const cWindow & a_Window, int a_Property, int a_Value) override; virtual AString GetAuthServerID(void) override; @@ -145,23 +134,11 @@ protected: /// Tries to recognize protocol based on m_Buffer contents; returns true if recognized bool TryRecognizeProtocol(void); - /** Tries to recognize a protocol in the length-less family, based on m_Buffer; returns true if recognized. - Handles protocols before release 1.7, that didn't include packet lengths, and started with a 0x02 handshake packet - Note that length-less server ping is handled directly in TryRecognizeProtocol(), this function is called only - when the 0x02 Handshake packet has been received - */ - bool TryRecognizeLengthlessProtocol(void); - - /** Tries to recognize a protocol in the leghted family (1.7+), based on m_Buffer; returns true if recognized. + /** Tries to recognize a protocol in the lengthed family (1.7+), based on m_Buffer; returns true if recognized. The packet length and type have already been read, type is 0 The number of bytes remaining in the packet is passed as a_PacketLengthRemaining **/ bool TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRemaining); - - /** Called when the recognizer gets a length-less protocol's server ping packet - Responds with server stats and destroys the client. - */ - void SendLengthlessServerPing(void); } ; diff --git a/src/RankManager.cpp b/src/RankManager.cpp new file mode 100644 index 000000000..f5342ed3d --- /dev/null +++ b/src/RankManager.cpp @@ -0,0 +1,1938 @@ + +// RankManager.cpp + +// Implements the cRankManager class that represents the rank manager responsible for assigning permissions and message visuals to players + +#include "Globals.h" +#include "RankManager.h" +#include "inifile/iniFile.h" +#include "Protocol/MojangAPI.h" +#include "ClientHandle.h" + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cRankManagerIniMigrator: + +/** Migrates from groups.ini and users.ini into the rankmanager DB */ +class cRankManagerIniMigrator +{ +public: + cRankManagerIniMigrator(cRankManager & a_RankManager, cMojangAPI & a_MojangAPI) : + m_RankManager(a_RankManager), + m_MojangAPI(a_MojangAPI) + { + } + + + + /** Performs the complete migration from INI files to DB. */ + bool Migrate(void) + { + cRankManager::cMassChangeLock Lock(m_RankManager); + + LOGD("Reading groups..."); + if (!ReadGroups()) + { + return false; + } + LOGD("Cleaning groups inheritance..."); + CleanGroupInheritance(); + LOGD("Creating groups..."); + CreateGroups(); + + LOGD("Reading users..."); + if (!ReadUsers()) + { + return false; + } + LOGD("Cleaning user groups..."); + CleanUserGroups(); + LOGD("Resolving user UUIDs..."); + ResolveUserUUIDs(); + + LOGD("Setting ranks..."); + SetRanks(); + + LOGD("Creating defaults..."); + CreateDefaults(); + + return true; + } + +protected: + + /** Container for a group read from an INI file. */ + struct sGroup + { + AString m_Name; + AString m_Color; + AStringVector m_Inherits; + AStringVector m_Permissions; + + sGroup(void) {} + + sGroup(const AString & a_Name, const AString & a_Color, const AStringVector & a_Inherits, const AStringVector & a_Permissions): + m_Name(a_Name), + m_Color(a_Color), + m_Inherits(a_Inherits), + m_Permissions(a_Permissions) + { + } + }; + typedef std::map<AString, sGroup> sGroupMap; + + + /** Container for a single user read from an INI file. */ + struct sUser + { + AString m_Name; + AStringVector m_Groups; + + /** Assigned by ResolveUserUUIDs(), contains the online (Mojang) UUID of the player. */ + AString m_UUID; + + /** Assigned by ResolveUserUUIDs(), contains the offline (generated) UUID of the player. */ + AString m_OfflineUUID; + + + sUser(void) {} + + sUser(const AString & a_Name, const AStringVector & a_Groups): + m_Name(a_Name), + m_Groups(a_Groups) + { + } + }; + typedef std::map<AString, sUser> sUserMap; + + typedef std::map<AString, AString> cStringMap; + + + /** The parent Rank manager where we will create the groups, ranks and players */ + cRankManager & m_RankManager; + + /** The player name to UUID resolver */ + cMojangAPI & m_MojangAPI; + + /** List of all groups read from the ini file */ + sGroupMap m_Groups; + + /** List of all players read from the ini file. */ + sUserMap m_Users; + + /** Maps lists of groups to rank names. + Each group list is either a simple "<Group>" if there's only one group, + or "<PrimaryGroup>, <FirstSecondaryGroup>, <SecondSecondaryGroup>...", where the secondary groups are + lowercased and alpha-sorted. This makes the group lists comparable for equivalence, simply by comparing + their string names. + The ranks are named "<Group>" for single-group players, and "AutoMigratedRank_N" for the composite ranks, + where N is a unique number. */ + cStringMap m_GroupsToRanks; + + + + /** Reads the groups from the "groups.ini" file into m_Groups */ + bool ReadGroups(void) + { + // Read the file: + cIniFile Groups; + if (!Groups.ReadFile("groups.ini")) + { + return false; + } + + // Read all the groups into a map: + int NumGroups = Groups.GetNumKeys(); + for (int i = 0; i < NumGroups; i++) + { + AString GroupName = Groups.GetKeyName(i); + AString lcGroupName = StrToLower(GroupName); + if (m_Groups.find(lcGroupName) != m_Groups.end()) + { + LOGINFO("groups.ini contains a duplicate definition of group %s, ignoring the latter.", GroupName.c_str()); + continue; + } + m_Groups[lcGroupName] = sGroup( + GroupName, + Groups.GetValue(GroupName, "Color", ""), + StringSplitAndTrim(Groups.GetValue(GroupName, "Inherits"), ","), + StringSplitAndTrim(Groups.GetValue(GroupName, "Permissions"), ",") + ); + } // for i - Groups' keys + return true; + } + + + + /** Removes non-existent groups from all the groups' inheritance */ + void CleanGroupInheritance(void) + { + for (sGroupMap::iterator itrG = m_Groups.begin(), endG = m_Groups.end(); itrG != endG; ++itrG) + { + AStringVector & Inherits = itrG->second.m_Inherits; + for (AStringVector::iterator itrI = Inherits.begin(); itrI != Inherits.end();) + { + AString lcInherits = StrToLower(*itrI); + if (m_Groups.find(lcInherits) != m_Groups.end()) + { + // Inherited group exists, continue checking the next one + ++itrI; + continue; + } + // Inherited group doesn't exist, remove it from the list: + LOGWARNING("RankMigrator: Group \"%s\" inherits from a non-existent group \"%s\", this inheritance will be ignored.", + itrG->second.m_Name.c_str(), itrI->c_str() + ); + AStringVector::iterator itrI2 = itrI; + ++itrI2; + Inherits.erase(itrI); + itrI = itrI2; + } // for itrI - Inherits[] + } // for itrG - m_Groups[] + } + + + + /** Reads the users from the "users.ini" file into m_Users */ + bool ReadUsers(void) + { + // Read the file: + cIniFile Users; + if (!Users.ReadFile("users.ini")) + { + return false; + } + + // Read all the users into a map: + int NumUsers = Users.GetNumKeys(); + for (int i = 0; i < NumUsers; i++) + { + AString UserName = Users.GetKeyName(i); + AString lcUserName = StrToLower(UserName); + if (m_Users.find(lcUserName) != m_Users.end()) + { + LOGINFO("users.ini contains a duplicate definition of user %s, ignoring the latter.", UserName.c_str()); + continue; + } + m_Users[lcUserName] = sUser( + UserName, + StringSplitAndTrim(Users.GetValue(UserName, "Groups", ""), ",") + ); + } // for i - Users' keys + return true; + } + + + + /** Removes non-existent groups from each user's definition. */ + void CleanUserGroups(void) + { + for (sUserMap::iterator itrU = m_Users.begin(), endU = m_Users.end(); itrU != endU; ++itrU) + { + AStringVector & Groups = itrU->second.m_Groups; + for (AStringVector::iterator itrG = Groups.begin(); itrG != Groups.end();) + { + AString lcGroup = StrToLower(*itrG); + if (m_Groups.find(lcGroup) != m_Groups.end()) + { + // Assigned group exists, continue checking the next one + ++itrG; + continue; + } + // Assigned group doesn't exist, remove it from the list: + LOGWARNING("RankMigrator: User \"%s\" is assigned a non-existent group \"%s\", this assignment will be ignored.", + itrU->second.m_Name.c_str(), itrG->c_str() + ); + AStringVector::iterator itrG2 = itrG; + ++itrG2; + Groups.erase(itrG); + itrG = itrG2; + } // for itrG - Groups[] + } // for itrU - m_Users[] + } + + + + /** Creates groups based on m_Groups. + Ignores group inheritance. */ + void CreateGroups(void) + { + // Create each group, with its permissions: + for (sGroupMap::const_iterator itr = m_Groups.begin(), end = m_Groups.end(); itr != end; ++itr) + { + m_RankManager.AddGroup(itr->second.m_Name); + m_RankManager.AddPermissionsToGroup(itr->second.m_Permissions, itr->second.m_Name); + } // for itr - m_Groups[] + } + + + /** Resolves the UUID of each user in m_Users. + If a user doesn't resolve, they are removed and logged in the console. */ + void ResolveUserUUIDs(void) + { + // Resolve all PlayerNames at once (the API doesn't like single-name queries): + AStringVector PlayerNames; + for (sUserMap::const_iterator itr = m_Users.begin(), end = m_Users.end(); itr != end; ++itr) + { + PlayerNames.push_back(itr->second.m_Name); + } + m_MojangAPI.GetUUIDsFromPlayerNames(PlayerNames); + + // Assign the UUIDs back to players, remove those not resolved: + for (sUserMap::iterator itr = m_Users.begin(); itr != m_Users.end(); ++itr) + { + AString UUID = m_MojangAPI.GetUUIDFromPlayerName(itr->second.m_Name); + if (UUID.empty()) + { + LOGWARNING("RankMigrator: Cannot resolve player %s to online UUID, player will be left unranked in online mode", itr->second.m_Name.c_str()); + } + itr->second.m_UUID = UUID; + itr->second.m_OfflineUUID = cClientHandle::GenerateOfflineUUID(itr->second.m_Name); + } + } + + + + /** Adds the specified groups to the specified ranks. Recurses on the groups' inheritance. */ + void AddGroupsToRank(const AStringVector & a_Groups, const AString & a_RankName) + { + for (AStringVector::const_iterator itr = a_Groups.begin(), end = a_Groups.end(); itr != end; ++itr) + { + // Normalize the group name: + sGroup & Group = m_Groups[StrToLower(*itr)]; + + // Avoid loops, check if the group is already added: + if (m_RankManager.IsGroupInRank(Group.m_Name, a_RankName)) + { + continue; + } + + // Add the group, and all the groups it inherits from recursively: + m_RankManager.AddGroupToRank(Group.m_Name, a_RankName); + AddGroupsToRank(Group.m_Inherits, a_RankName); + } // for itr - a_Groups[] + } + + + + /** Creates a rank for each player, based on the master groups they are assigned. */ + void SetRanks(void) + { + for (sUserMap::const_iterator itr = m_Users.begin(), end = m_Users.end(); itr != end; ++itr) + { + // Ignore users with no groups: + const AStringVector & Groups = itr->second.m_Groups; + if (Groups.empty()) + { + LOGWARNING("RankMigrator: Player %s has no groups assigned to them, skipping the player.", itr->second.m_Name.c_str()); + continue; + } + + // Compose the rank name out of group names: + AString RankName; + for (AStringVector::const_iterator itrG = Groups.begin(), endG = Groups.end(); itrG != endG; ++itrG) + { + AString GroupName = m_Groups[StrToLower(*itrG)].m_Name; // Normalize group name + if (!RankName.empty()) + { + RankName.push_back(','); + } + RankName.append(GroupName); + } // for itrG - Groups[] + + // Create the rank, with al its groups: + if (!m_RankManager.RankExists(RankName)) + { + m_RankManager.AddRank(RankName, "", "", m_Groups[StrToLower(Groups[0])].m_Color); + AddGroupsToRank(Groups, RankName); + } + + // Set the rank to the user, using both the online and offline UUIDs: + m_RankManager.SetPlayerRank(itr->second.m_UUID, itr->second.m_Name, RankName); + m_RankManager.SetPlayerRank(itr->second.m_OfflineUUID, itr->second.m_Name, RankName); + } // for itr - m_Users[] + } + + + + /** Creates the Default rank that contains the Default group, if it exists. + Sets the RankManager's default rank. */ + void CreateDefaults(void) + { + if (!m_RankManager.RankExists("Default")) + { + m_RankManager.AddRank("Default", "", "", ""); + if (!m_RankManager.IsGroupInRank("Default", "Default")) + { + m_RankManager.AddGroupToRank("Default", "Default"); + } + } + m_RankManager.SetDefaultRank("Default"); + } +}; + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cRankManager: + +cRankManager::cRankManager(void) : + m_DB("Ranks.sqlite", SQLITE_OPEN_READWRITE | SQLITE_OPEN_CREATE), + m_IsInitialized(false), + m_MojangAPI(NULL) +{ +} + + + + + +cRankManager::~cRankManager() +{ + if (m_MojangAPI != NULL) + { + m_MojangAPI->SetRankManager(NULL); + } +} + + + + + +void cRankManager::Initialize(cMojangAPI & a_MojangAPI) +{ + ASSERT(!m_IsInitialized); // Calling Initialize for the second time? + + // Create the DB tables, if they don't exist: + m_DB.exec("CREATE TABLE IF NOT EXISTS Rank (RankID INTEGER PRIMARY KEY, Name, MsgPrefix, MsgSuffix, MsgNameColorCode)"); + m_DB.exec("CREATE TABLE IF NOT EXISTS PlayerRank (PlayerUUID, PlayerName, RankID INTEGER)"); + m_DB.exec("CREATE TABLE IF NOT EXISTS PermGroup (PermGroupID INTEGER PRIMARY KEY, Name)"); + m_DB.exec("CREATE TABLE IF NOT EXISTS RankPermGroup (RankID INTEGER, PermGroupID INTEGER)"); + m_DB.exec("CREATE TABLE IF NOT EXISTS PermissionItem (PermGroupID INTEGER, Permission)"); + m_DB.exec("CREATE TABLE IF NOT EXISTS DefaultRank (RankID INTEGER)"); + + m_IsInitialized = true; + + a_MojangAPI.SetRankManager(this); + + // Check if tables empty, migrate from ini files then + if (AreDBTablesEmpty()) + { + LOGINFO("There are no ranks, migrating old-style INI files to new DB ranks..."); + LOGINFO("(This might take a while)"); + cRankManagerIniMigrator Migrator(*this, a_MojangAPI); + if (Migrator.Migrate()) + { + LOGINFO("Ranks migrated."); + // The default rank has been set by the migrator + return; + } + + // Migration failed. Add some defaults + LOGINFO("Rank migration failed, creating default ranks..."); + CreateDefaults(); + LOGINFO("Default ranks created."); + } + + // Load the default rank: + try + { + SQLite::Statement stmt(m_DB, + "SELECT Rank.Name FROM Rank " + "LEFT JOIN DefaultRank ON Rank.RankID = DefaultRank.RankID" + ); + if (stmt.executeStep()) + { + m_DefaultRank = stmt.getColumn(0).getText(); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Cannot load default rank: %s", __FUNCTION__, ex.what()); + return; + } + + // If the default rank cannot be loaded, use the first rank: + if (m_DefaultRank.empty()) + { + SetDefaultRank(GetAllRanks()[0]); + } +} + + + + + +AString cRankManager::GetPlayerRankName(const AString & a_PlayerUUID) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, "SELECT Rank.Name FROM Rank LEFT JOIN PlayerRank ON Rank.RankID = PlayerRank.RankID WHERE PlayerRank.PlayerUUID = ?"); + stmt.bind(1, a_PlayerUUID); + // executeStep returns false on no data + if (!stmt.executeStep()) + { + // No data returned from the DB + return AString(); + } + return stmt.getColumn(0).getText(); + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Cannot get player rank name: %s", __FUNCTION__, ex.what()); + } + return AString(); +} + + + + + +AString cRankManager::GetPlayerName(const AString & a_PlayerUUID) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Prepare the DB statement: + SQLite::Statement stmt(m_DB, "SELECT PlayerName FROM PlayerRank WHERE PlayerUUID = ?"); + stmt.bind(1, a_PlayerUUID); + + if (stmt.executeStep()) + { + return stmt.getColumn(0).getText(); + } + } + catch (SQLite::Exception & ex) + { + LOGWARNING("%s: Cannot get player name: %s", __FUNCTION__, ex.what()); + } + return AString(); +} + + + + + +AStringVector cRankManager::GetPlayerGroups(const AString & a_PlayerUUID) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + AStringVector res; + try + { + // Prepare the DB statement: + SQLite::Statement stmt(m_DB, + "SELECT PermGroup.Name FROM PermGroup " + "LEFT JOIN RankPermGroup ON PermGroup.PermGroupID = RankPermGroup.PermGroupID " + "LEFT JOIN PlayerRank ON PlayerRank.RankID = RankPermGroup.RankID " + "WHERE PlayerRank.PlayerUUID = ?" + ); + stmt.bind(1, a_PlayerUUID); + + // Execute and get results: + while (stmt.executeStep()) + { + res.push_back(stmt.getColumn(0).getText()); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Cannot get player groups: %s", __FUNCTION__, ex.what()); + } + return res; +} + + + + + +AStringVector cRankManager::GetPlayerPermissions(const AString & a_PlayerUUID) +{ + AString Rank = GetPlayerRankName(a_PlayerUUID); + if (Rank.empty()) + { + Rank = m_DefaultRank; + } + return GetRankPermissions(Rank); +} + + + + + +AStringVector cRankManager::GetRankGroups(const AString & a_RankName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + AStringVector res; + try + { + SQLite::Statement stmt(m_DB, + "SELECT PermGroup.Name FROM PermGroup " + "LEFT JOIN RankPermGroup ON RankPermGroup.PermGroupID = PermGroup.PermGroupID " + "LEFT JOIN Rank ON Rank.RankID = RankPermGroup.RankID " + "WHERE Rank.Name = ?" + ); + stmt.bind(1, a_RankName); + while (stmt.executeStep()) + { + res.push_back(stmt.getColumn(0).getText()); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to get rank groups from DB: %s", __FUNCTION__, ex.what()); + } + return res; +} + + + + + +AStringVector cRankManager::GetGroupPermissions(const AString & a_GroupName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + AStringVector res; + try + { + SQLite::Statement stmt(m_DB, + "SELECT PermissionItem.Permission FROM PermissionItem " + "LEFT JOIN PermGroup ON PermGroup.PermGroupID = PermissionItem.PermGroupID " + "WHERE PermGroup.Name = ?" + ); + stmt.bind(1, a_GroupName); + while (stmt.executeStep()) + { + res.push_back(stmt.getColumn(0).getText()); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to get group permissions from DB: %s", __FUNCTION__, ex.what()); + } + return res; +} + + + + + +AStringVector cRankManager::GetRankPermissions(const AString & a_RankName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + AStringVector res; + try + { + SQLite::Statement stmt(m_DB, + "SELECT PermissionItem.Permission FROM PermissionItem " + "LEFT JOIN RankPermGroup ON RankPermGroup.PermGroupID = PermissionItem.PermGroupID " + "LEFT JOIN Rank ON Rank.RankID = RankPermGroup.RankID " + "WHERE Rank.Name = ?" + ); + stmt.bind(1, a_RankName); + while (stmt.executeStep()) + { + res.push_back(stmt.getColumn(0).getText()); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to get rank permissions from DB: %s", __FUNCTION__, ex.what()); + } + return res; +} + + + + + +AStringVector cRankManager::GetAllPlayerUUIDs(void) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + AStringVector res; + try + { + SQLite::Statement stmt(m_DB, "SELECT PlayerUUID FROM PlayerRank ORDER BY PlayerName COLLATE NOCASE"); + while (stmt.executeStep()) + { + res.push_back(stmt.getColumn(0).getText()); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to get players from DB: %s", __FUNCTION__, ex.what()); + } + return res; +} + + + + + + +AStringVector cRankManager::GetAllRanks(void) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + AStringVector res; + try + { + SQLite::Statement stmt(m_DB, "SELECT Name FROM Rank"); + while (stmt.executeStep()) + { + res.push_back(stmt.getColumn(0).getText()); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to get ranks from DB: %s", __FUNCTION__, ex.what()); + } + return res; +} + + + + + +AStringVector cRankManager::GetAllGroups(void) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + AStringVector res; + try + { + SQLite::Statement stmt(m_DB, "SELECT Name FROM PermGroup"); + while (stmt.executeStep()) + { + res.push_back(stmt.getColumn(0).getText()); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to get groups from DB: %s", __FUNCTION__, ex.what()); + } + return res; +} + + + + + +AStringVector cRankManager::GetAllPermissions(void) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + AStringVector res; + try + { + SQLite::Statement stmt(m_DB, "SELECT DISTINCT(Permission) FROM PermissionItem"); + while (stmt.executeStep()) + { + res.push_back(stmt.getColumn(0).getText()); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to get permissions from DB: %s", __FUNCTION__, ex.what()); + } + return res; +} + + + + + +bool cRankManager::GetPlayerMsgVisuals( + const AString & a_PlayerUUID, + AString & a_MsgPrefix, + AString & a_MsgSuffix, + AString & a_MsgNameColorCode +) +{ + AString Rank = GetPlayerRankName(a_PlayerUUID); + if (Rank.empty()) + { + // Rank not found, return failure: + a_MsgPrefix.clear(); + a_MsgSuffix.clear(); + a_MsgNameColorCode.clear(); + return false; + } + return GetRankVisuals(Rank, a_MsgPrefix, a_MsgSuffix, a_MsgNameColorCode); +} + + + + + +void cRankManager::AddRank( + const AString & a_RankName, + const AString & a_MsgPrefix, + const AString & a_MsgSuffix, + const AString & a_MsgNameColorCode +) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Check if such a rank name is already used: + { + SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM Rank WHERE Name = ?"); + stmt.bind(1, a_RankName); + if (stmt.executeStep()) + { + if (stmt.getColumn(0).getInt() > 0) + { + // Rank already exists, do nothing: + return; + } + } + } + + // Insert a new rank: + SQLite::Statement stmt(m_DB, "INSERT INTO Rank (Name, MsgPrefix, MsgSuffix, MsgNameColorCode) VALUES (?, ?, ?, ?)"); + stmt.bind(1, a_RankName); + stmt.bind(2, a_MsgPrefix); + stmt.bind(3, a_MsgSuffix); + stmt.bind(4, a_MsgNameColorCode); + if (stmt.exec() <= 0) + { + LOGWARNING("%s: Failed to add a new rank \"%s\".", __FUNCTION__, a_RankName.c_str()); + return; + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to add a new rank \"%s\": %s", __FUNCTION__, a_RankName.c_str(), ex.what()); + } +} + + + + + +void cRankManager::AddGroup(const AString & a_GroupName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Check if such a group name is already used: + { + SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM PermGroup WHERE Name = ?"); + stmt.bind(1, a_GroupName); + if (stmt.executeStep()) + { + if (stmt.getColumn(0).getInt() > 0) + { + // Group already exists, do nothing: + return; + } + } + } + + // Insert a new group: + SQLite::Statement stmt(m_DB, "INSERT INTO PermGroup (Name) VALUES (?)"); + stmt.bind(1, a_GroupName); + if (stmt.exec() <= 0) + { + LOGWARNING("%s: Failed to add a new group \"%s\".", __FUNCTION__, a_GroupName.c_str()); + return; + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to add a new group \"%s\": %s", __FUNCTION__, a_GroupName.c_str(), ex.what()); + } +} + + + + + +void cRankManager::AddGroups(const AStringVector & a_GroupNames) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + for (AStringVector::const_iterator itr = a_GroupNames.begin(), end = a_GroupNames.end(); itr != end; ++itr) + { + // Check if such the group name is already used: + { + SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM PermGroup WHERE Name = ?"); + stmt.bind(1, *itr); + if (stmt.executeStep()) + { + if (stmt.getColumn(0).getInt() > 0) + { + // Group already exists, do nothing: + return; + } + } + } + + // Insert a new group: + SQLite::Statement stmt(m_DB, "INSERT INTO PermGroup (Name) VALUES (?)"); + stmt.bind(1, *itr); + if (stmt.exec() <= 0) + { + LOGWARNING("%s: Failed to add a new group \"%s\".", __FUNCTION__, itr->c_str()); + return; + } + } // for itr - a_GroupNames[] + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to add new groups: %s", __FUNCTION__, ex.what()); + } +} + + + + + +bool cRankManager::AddGroupToRank(const AString & a_GroupName, const AString & a_RankName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Get the group's ID: + int GroupID; + { + SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?"); + stmt.bind(1, a_GroupName); + if (!stmt.executeStep()) + { + LOGWARNING("%s: No such group (%s), aborting.", __FUNCTION__, a_GroupName.c_str()); + return false; + } + GroupID = stmt.getColumn(0); + } + + // Get the rank's ID: + int RankID; + { + SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?"); + stmt.bind(1, a_RankName); + if (!stmt.executeStep()) + { + LOGWARNING("%s: No such rank (%s), aborting.", __FUNCTION__, a_RankName.c_str()); + return false; + } + RankID = stmt.getColumn(0); + } + + // Check if the group is already there: + { + SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM RankPermGroup WHERE RankID = ? AND PermGroupID = ?"); + stmt.bind(1, RankID); + stmt.bind(2, GroupID); + if (!stmt.executeStep()) + { + LOGWARNING("%s: Failed to check binding between rank %s and group %s, aborting.", __FUNCTION__, a_RankName.c_str(), a_GroupName.c_str()); + return false; + } + if (stmt.getColumn(0).getInt() > 0) + { + LOGD("%s: Group %s already present in rank %s, skipping and returning success.", + __FUNCTION__, a_GroupName.c_str(), a_RankName.c_str() + ); + return true; + } + } + + // Add the group: + { + SQLite::Statement stmt(m_DB, "INSERT INTO RankPermGroup (RankID, PermGroupID) VALUES (?, ?)"); + stmt.bind(1, RankID); + stmt.bind(2, GroupID); + if (stmt.exec() <= 0) + { + LOGWARNING("%s: Failed to add group %s to rank %s, aborting.", __FUNCTION__, a_GroupName.c_str(), a_RankName.c_str()); + return false; + } + } + + // Adding succeeded: + return true; + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to add group %s to rank %s: %s", __FUNCTION__, a_GroupName.c_str(), a_RankName.c_str(), ex.what()); + } + return false; +} + + + + + +bool cRankManager::AddPermissionToGroup(const AString & a_Permission, const AString & a_GroupName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Get the group's ID: + int GroupID; + { + SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?"); + stmt.bind(1, a_GroupName); + if (!stmt.executeStep()) + { + LOGWARNING("%s: No such group (%s), aborting.", __FUNCTION__, a_GroupName.c_str()); + return false; + } + GroupID = stmt.getColumn(0).getInt(); + } + + // Check if the permission is already present: + { + SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM PermissionItem WHERE PermGroupID = ? AND Permission = ?"); + stmt.bind(1, GroupID); + stmt.bind(2, a_Permission); + if (!stmt.executeStep()) + { + LOGWARNING("%s: Failed to check binding between permission %s and group %s, aborting.", __FUNCTION__, a_Permission.c_str(), a_GroupName.c_str()); + return false; + } + if (stmt.getColumn(0).getInt() > 0) + { + LOGD("%s: Permission %s is already present in group %s, skipping and returning success.", + __FUNCTION__, a_Permission.c_str(), a_GroupName.c_str() + ); + return true; + } + } + + // Add the permission: + { + SQLite::Statement stmt(m_DB, "INSERT INTO PermissionItem (Permission, PermGroupID) VALUES (?, ?)"); + stmt.bind(1, a_Permission); + stmt.bind(2, GroupID); + if (stmt.exec() <= 0) + { + LOGWARNING("%s: Failed to add permission %s to group %s, aborting.", __FUNCTION__, a_Permission.c_str(), a_GroupName.c_str()); + return false; + } + } + + // Adding succeeded: + return true; + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to add permission %s to group %s: %s", + __FUNCTION__, a_Permission.c_str(), a_GroupName.c_str(), ex.what() + ); + } + return false; +} + + + + + +bool cRankManager::AddPermissionsToGroup(const AStringVector & a_Permissions, const AString & a_GroupName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Get the group's ID: + int GroupID; + { + SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?"); + stmt.bind(1, a_GroupName); + if (!stmt.executeStep()) + { + LOGWARNING("%s: No such group (%s), aborting.", __FUNCTION__, a_GroupName.c_str()); + return false; + } + GroupID = stmt.getColumn(0).getInt(); + } + + for (AStringVector::const_iterator itr = a_Permissions.begin(), end = a_Permissions.end(); itr != end; ++itr) + { + // Check if the permission is already present: + { + SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM PermissionItem WHERE PermGroupID = ? AND Permission = ?"); + stmt.bind(1, GroupID); + stmt.bind(2, *itr); + if (!stmt.executeStep()) + { + LOGWARNING("%s: Failed to check binding between permission %s and group %s, aborting.", __FUNCTION__, itr->c_str(), a_GroupName.c_str()); + return false; + } + if (stmt.getColumn(0).getInt() > 0) + { + LOGD("%s: Permission %s is already present in group %s, skipping and returning success.", + __FUNCTION__, itr->c_str(), a_GroupName.c_str() + ); + continue; + } + } + + // Add the permission: + { + SQLite::Statement stmt(m_DB, "INSERT INTO PermissionItem (Permission, PermGroupID) VALUES (?, ?)"); + stmt.bind(1, *itr); + stmt.bind(2, GroupID); + if (stmt.exec() <= 0) + { + LOGWARNING("%s: Failed to add permission %s to group %s, skipping.", __FUNCTION__, itr->c_str(), a_GroupName.c_str()); + continue; + } + } + } // for itr - a_Permissions[] + + // Adding succeeded: + return true; + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to add permissions to group %s: %s", + __FUNCTION__, a_GroupName.c_str(), ex.what() + ); + } + return false; +} + + + + + +void cRankManager::RemoveRank(const AString & a_RankName, const AString & a_ReplacementRankName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + // Check if the default rank is being removed with a proper replacement: + if ((a_RankName == m_DefaultRank) && !RankExists(a_ReplacementRankName)) + { + LOGWARNING("%s: Cannot remove rank %s, it is the default rank and the replacement rank doesn't exist.", __FUNCTION__, a_RankName.c_str()); + return; + } + + AStringVector res; + try + { + // Get the RankID for the rank being removed: + int RemoveRankID; + { + SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?"); + stmt.bind(1, a_RankName); + if (!stmt.executeStep()) + { + LOGINFO("%s: Rank %s was not found. Skipping.", __FUNCTION__, a_RankName.c_str()); + return; + } + RemoveRankID = stmt.getColumn(0).getInt(); + } + + // Get the RankID for the replacement rank: + int ReplacementRankID = -1; + { + SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?"); + stmt.bind(1, a_ReplacementRankName); + if (stmt.executeStep()) + { + ReplacementRankID = stmt.getColumn(0).getInt(); + } + } + + // Remove the rank's bindings to groups: + { + SQLite::Statement stmt(m_DB, "DELETE FROM RankPermGroup WHERE RankID = ?"); + stmt.bind(1, RemoveRankID); + stmt.exec(); + } + + // Adjust players: + if (ReplacementRankID == -1) + { + // No replacement, just delete all the players that have the rank: + SQLite::Statement stmt(m_DB, "DELETE FROM PlayerRank WHERE RankID = ?"); + stmt.bind(1, RemoveRankID); + stmt.exec(); + } + else + { + // Replacement available, change all the player records: + SQLite::Statement stmt(m_DB, "UPDATE PlayerRank SET RankID = ? WHERE RankID = ?"); + stmt.bind(1, ReplacementRankID); + stmt.bind(2, RemoveRankID); + stmt.exec(); + } + + // Remove the rank from the DB: + { + SQLite::Statement stmt(m_DB, "DELETE FROM Rank WHERE RankID = ?"); + stmt.bind(1, RemoveRankID); + stmt.exec(); + } + + // Update the default rank, if it was the one being removed: + if (a_RankName == m_DefaultRank) + { + m_DefaultRank = a_RankName; + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to remove rank from DB: %s", __FUNCTION__, ex.what()); + } +} + + + + + +void cRankManager::RemoveGroup(const AString & a_GroupName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Get the ID of the group: + int GroupID; + { + SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?"); + stmt.bind(1, a_GroupName); + if (!stmt.executeStep()) + { + LOGINFO("%s: Group %s was not found, skipping.", __FUNCTION__, a_GroupName.c_str()); + return; + } + GroupID = stmt.getColumn(0).getInt(); + } + + // Remove all permissions from the group: + { + SQLite::Statement stmt(m_DB, "DELETE FROM PermissionItem WHERE PermGroupID = ?"); + stmt.bind(1, GroupID); + stmt.exec(); + } + + // Remove the group from all ranks that contain it: + { + SQLite::Statement stmt(m_DB, "DELETE FROM RankPermGroup WHERE PermGroupID = ?"); + stmt.bind(1, GroupID); + stmt.exec(); + } + + // Remove the group itself: + { + SQLite::Statement stmt(m_DB, "DELETE FROM PermGroup WHERE PermGroupID = ?"); + stmt.bind(1, GroupID); + stmt.exec(); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to remove group %s from DB: %s", __FUNCTION__, a_GroupName.c_str(), ex.what()); + } +} + + + + + +void cRankManager::RemoveGroupFromRank(const AString & a_GroupName, const AString & a_RankName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Get the IDs of the group and the rank: + int GroupID, RankID; + { + SQLite::Statement stmt(m_DB, + "SELECT PermGroup.PermGroupID, Rank.RankID FROM PermGroup " + "LEFT JOIN RankPermGroup ON RankPermGroup.PermGroupID = PermGroup.PermGroupID " + "LEFT JOIN Rank ON Rank.RankID = RankPermGroup.RankID " + "WHERE PermGroup.Name = ? AND Rank.Name = ?" + ); + stmt.bind(1, a_GroupName); + stmt.bind(2, a_RankName); + if (!stmt.executeStep()) + { + LOGINFO("%s: Group %s was not found in rank %s, skipping.", __FUNCTION__, a_GroupName.c_str(), a_RankName.c_str()); + return; + } + GroupID = stmt.getColumn(0).getInt(); + RankID = stmt.getColumn(1).getInt(); + } + + // Remove the group from all ranks that contain it: + { + SQLite::Statement stmt(m_DB, "DELETE FROM RankPermGroup WHERE PermGroupID = ?"); + stmt.bind(1, GroupID); + stmt.exec(); + } + + // Remove the group-to-rank binding: + { + SQLite::Statement stmt(m_DB, "DELETE FROM RankPermGroup WHERE PermGroupID = ? AND RankID = ?"); + stmt.bind(1, GroupID); + stmt.bind(1, RankID); + stmt.exec(); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to remove group %s from rank %s in the DB: %s", __FUNCTION__, a_GroupName.c_str(), a_RankName.c_str(), ex.what()); + } +} + + + + + +void cRankManager::RemovePermissionFromGroup(const AString & a_Permission, const AString & a_GroupName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Get the ID of the group: + int GroupID; + { + SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?"); + stmt.bind(1, a_GroupName); + if (!stmt.executeStep()) + { + LOGINFO("%s: Group %s was not found, skipping.", __FUNCTION__, a_GroupName.c_str()); + return; + } + GroupID = stmt.getColumn(0).getInt(); + } + + // Remove the permission from the group: + { + SQLite::Statement stmt(m_DB, "DELETE FROM PermissionItem WHERE PermGroupID = ? AND Permission = ?"); + stmt.bind(1, GroupID); + stmt.bind(2, a_Permission); + stmt.exec(); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to remove permission %s from group %s in DB: %s", + __FUNCTION__, a_Permission.c_str(), a_GroupName.c_str(), ex.what() + ); + } +} + + + + + +bool cRankManager::RenameRank(const AString & a_OldName, const AString & a_NewName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Check that NewName doesn't exist: + { + SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?"); + stmt.bind(1, a_NewName); + if (stmt.executeStep()) + { + LOGINFO("%s: Rank %s is already present, cannot rename %s", __FUNCTION__, a_NewName.c_str(), a_OldName.c_str()); + return false; + } + } + + // Rename: + { + SQLite::Statement stmt(m_DB, "UPDATE Rank SET Name = ? WHERE Name = ?"); + stmt.bind(1, a_NewName); + stmt.bind(2, a_OldName); + if (stmt.exec() <= 0) + { + LOGINFO("%s: There is no rank %s, cannot rename to %s.", __FUNCTION__, a_OldName.c_str(), a_NewName.c_str()); + return false; + } + } + + // Update the default rank, if it was the one being renamed: + if (a_OldName == m_DefaultRank) + { + m_DefaultRank = a_NewName; + } + + return true; + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to rename rank %s to %s in DB: %s", + __FUNCTION__, a_OldName.c_str(), a_NewName.c_str(), ex.what()); + } + return false; +} + + + + + +bool cRankManager::RenameGroup(const AString & a_OldName, const AString & a_NewName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Check that NewName doesn't exist: + { + SQLite::Statement stmt(m_DB, "SELECT PermGroupID FROM PermGroup WHERE Name = ?"); + stmt.bind(1, a_NewName); + if (stmt.executeStep()) + { + LOGD("%s: Group %s is already present, cannot rename %s", __FUNCTION__, a_NewName.c_str(), a_OldName.c_str()); + return false; + } + } + + // Rename: + bool res; + { + SQLite::Statement stmt(m_DB, "UPDATE PermGroup SET Name = ? WHERE Name = ?"); + stmt.bind(1, a_NewName); + stmt.bind(2, a_OldName); + res = (stmt.exec() > 0); + } + + return res; + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to rename group %s to %s in DB: %s", + __FUNCTION__, a_OldName.c_str(), a_NewName.c_str(), ex.what()); + } + return false; +} + + + + + +void cRankManager::SetPlayerRank(const AString & a_PlayerUUID, const AString & a_PlayerName, const AString & a_RankName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Get the rank ID: + int RankID; + { + SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?"); + stmt.bind(1, a_RankName); + if (!stmt.executeStep()) + { + LOGWARNING("%s: There is no rank %s, aborting.", __FUNCTION__, a_RankName.c_str()); + return; + } + RankID = stmt.getColumn(0).getInt(); + } + + // Update the player's rank, if already in DB: + { + SQLite::Statement stmt(m_DB, "UPDATE PlayerRank SET RankID = ?, PlayerName = ? WHERE PlayerUUID = ?"); + stmt.bind(1, RankID); + stmt.bind(2, a_PlayerName); + stmt.bind(3, a_PlayerUUID); + if (stmt.exec() > 0) + { + // Successfully updated the player's rank + return; + } + } + + // The player is not yet in the DB, add them: + SQLite::Statement stmt(m_DB, "INSERT INTO PlayerRank (RankID, PlayerUUID, PlayerName) VALUES (?, ?, ?)"); + stmt.bind(1, RankID); + stmt.bind(2, a_PlayerUUID); + stmt.bind(3, a_PlayerName); + if (stmt.exec() > 0) + { + // Successfully added the player + return; + } + + LOGWARNING("%s: Failed to set player UUID %s to rank %s.", + __FUNCTION__, a_PlayerUUID.c_str(), a_RankName.c_str() + ); + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to set player UUID %s to rank %s: %s", + __FUNCTION__, a_PlayerUUID.c_str(), a_RankName.c_str(), ex.what() + ); + } +} + + + + + +void cRankManager::RemovePlayerRank(const AString & a_PlayerUUID) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, "DELETE FROM PlayerRank WHERE PlayerUUID = ?"); + stmt.bind(1, a_PlayerUUID); + stmt.exec(); + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to remove rank from player UUID %s: %s", + __FUNCTION__, a_PlayerUUID.c_str(), ex.what() + ); + } +} + + + + + +void cRankManager::SetRankVisuals( + const AString & a_RankName, + const AString & a_MsgPrefix, + const AString & a_MsgSuffix, + const AString & a_MsgNameColorCode +) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, "UPDATE Rank SET MsgPrefix = ?, MsgSuffix = ?, MsgNameColorCode = ? WHERE Name = ?"); + stmt.bind(1, a_MsgPrefix); + stmt.bind(2, a_MsgSuffix); + stmt.bind(3, a_MsgNameColorCode); + stmt.bind(4, a_RankName); + if (!stmt.executeStep()) + { + LOGINFO("%s: Rank %s not found, visuals not set.", __FUNCTION__, a_RankName.c_str()); + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to get ranks from DB: %s", __FUNCTION__, ex.what()); + } +} + + + + + +bool cRankManager::GetRankVisuals( + const AString & a_RankName, + AString & a_MsgPrefix, + AString & a_MsgSuffix, + AString & a_MsgNameColorCode +) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, "SELECT MsgPrefix, MsgSuffix, MsgNameColorCode FROM Rank WHERE Name = ?"); + stmt.bind(1, a_RankName); + if (!stmt.executeStep()) + { + // Rank not found + return false; + } + a_MsgPrefix = stmt.getColumn(0).getText(); + a_MsgSuffix = stmt.getColumn(1).getText(); + a_MsgNameColorCode = stmt.getColumn(2).getText(); + return true; + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to get ranks from DB: %s", __FUNCTION__, ex.what()); + } + return false; +} + + + + + +bool cRankManager::RankExists(const AString & a_RankName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, "SELECT * FROM Rank WHERE Name = ?"); + stmt.bind(1, a_RankName); + if (stmt.executeStep()) + { + // The rank was found + return true; + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to query DB for rank %s: %s", __FUNCTION__, a_RankName.c_str(), ex.what()); + } + return false; +} + + + + + +bool cRankManager::GroupExists(const AString & a_GroupName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, "SELECT * FROM PermGroup WHERE Name = ?"); + stmt.bind(1, a_GroupName); + if (stmt.executeStep()) + { + // The group was found + return true; + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to query DB for group %s: %s", __FUNCTION__, a_GroupName.c_str(), ex.what()); + } + return false; +} + + + + + +bool cRankManager::IsPlayerRankSet(const AString & a_PlayerUUID) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, "SELECT * FROM PlayerRank WHERE PlayerUUID = ?"); + stmt.bind(1, a_PlayerUUID); + if (stmt.executeStep()) + { + // The player UUID was found, they have a rank + return true; + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to query DB for player UUID %s: %s", __FUNCTION__, a_PlayerUUID.c_str(), ex.what()); + } + return false; +} + + + + + +bool cRankManager::IsGroupInRank(const AString & a_GroupName, const AString & a_RankName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, + "SELECT * FROM Rank " + "LEFT JOIN RankPermGroup ON Rank.RankID = RankPermGroup.RankID " + "LEFT JOIN PermGroup ON PermGroup.PermGroupID = RankPermGroup.PermGroupID " + "WHERE Rank.Name = ? AND PermGroup.Name = ?" + ); + stmt.bind(1, a_RankName); + stmt.bind(2, a_GroupName); + if (stmt.executeStep()) + { + // The group is in the rank + return true; + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to query DB: %s", __FUNCTION__, ex.what()); + } + return false; +} + + + + + +bool cRankManager::IsPermissionInGroup(const AString & a_Permission, const AString & a_GroupName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, + "SELECT * FROM PermissionItem " + "LEFT JOIN PermGroup ON PermGroup.PermGroupID = PermissionItem.PermGroupID " + "WHERE PermissionItem.Permission = ? AND PermGroup.Name = ?" + ); + stmt.bind(1, a_Permission); + stmt.bind(2, a_GroupName); + if (stmt.executeStep()) + { + // The permission is in the group + return true; + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to query DB: %s", __FUNCTION__, ex.what()); + } + return false; +} + + + + + +void cRankManager::NotifyNameUUID(const AString & a_PlayerName, const AString & a_UUID) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, "UPDATE PlayerRank SET PlayerName = ? WHERE PlayerUUID = ?"); + stmt.bind(1, a_PlayerName); + stmt.bind(2, a_UUID); + stmt.exec(); + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to update DB: %s", __FUNCTION__, ex.what()); + } +} + + + + + +bool cRankManager::SetDefaultRank(const AString & a_RankName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + // Find the rank's ID: + int RankID = 0; + { + SQLite::Statement stmt(m_DB, "SELECT RankID FROM Rank WHERE Name = ?"); + stmt.bind(1, a_RankName); + if (!stmt.executeStep()) + { + LOGINFO("%s: Cannot set rank %s as the default, it does not exist.", __FUNCTION__, a_RankName.c_str()); + return false; + } + } + + // Set the rank as the default: + { + SQLite::Statement stmt(m_DB, "UPDATE DefaultRank SET RankID = ?"); + stmt.bind(1, RankID); + if (stmt.exec() < 1) + { + // Failed to update, there might be none in the DB, try inserting: + SQLite::Statement stmt2(m_DB, "INSERT INTO DefaultRank (RankID) VALUES (?)"); + stmt2.bind(1, RankID); + if (stmt2.exec() < 1) + { + LOGINFO("%s: Cannot update the default rank in the DB to %s.", __FUNCTION__, a_RankName.c_str()); + return false; + } + } + } + + // Set the internal cache: + m_DefaultRank = a_RankName; + return true; + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to update DB: %s", __FUNCTION__, ex.what()); + return false; + } +} + + + + + +void cRankManager::ClearPlayerRanks(void) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, "DELETE FROM PlayerRank"); + stmt.exec(); + } + catch (SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to remove/clear all players: %s", __FUNCTION__, ex.what()); + } +} + + + + + +bool cRankManager::UpdatePlayerName(const AString & a_PlayerUUID, const AString & a_NewPlayerName) +{ + ASSERT(m_IsInitialized); + cCSLock Lock(m_CS); + + try + { + SQLite::Statement stmt(m_DB, "UPDATE PlayerRank SET PlayerName = ? WHERE PlayerUUID = ?"); + stmt.bind(1, a_NewPlayerName); + stmt.bind(2, a_PlayerUUID); + if (stmt.exec() > 0) + { + // The player name was changed, returns true + return true; + } + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to update player name from UUID %s: %s", __FUNCTION__, a_PlayerUUID.c_str(), ex.what()); + } + return false; +} + + + + + + +bool cRankManager::AreDBTablesEmpty(void) +{ + return ( + IsDBTableEmpty("Rank") && + IsDBTableEmpty("PlayerRank") && + IsDBTableEmpty("PermGroup") && + IsDBTableEmpty("RankPermGroup") && + IsDBTableEmpty("PermissionItem") && + IsDBTableEmpty("DefaultRank") + ); +} + + + + + +bool cRankManager::IsDBTableEmpty(const AString & a_TableName) +{ + try + { + SQLite::Statement stmt(m_DB, "SELECT COUNT(*) FROM " + a_TableName); + return (stmt.executeStep() && (stmt.getColumn(0).getInt() == 0)); + } + catch (const SQLite::Exception & ex) + { + LOGWARNING("%s: Failed to query DB: %s", __FUNCTION__, ex.what()); + } + return false; +} + + + + + +void cRankManager::CreateDefaults(void) +{ + // Wrap everything in a big transaction to speed things up: + cMassChangeLock Lock(*this); + + // Create ranks: + AddRank("Default", "", "", ""); + AddRank("VIP", "", "", ""); + AddRank("Operator", "", "", ""); + AddRank("Admin", "", "", ""); + + // Create groups: + AddGroup("Default"); + AddGroup("Kick"); + AddGroup("Teleport"); + AddGroup("Everything"); + + // Add groups to ranks: + AddGroupToRank("Default", "Default"); + AddGroupToRank("Teleport", "VIP"); + AddGroupToRank("Teleport", "Operator"); + AddGroupToRank("Kick", "Operator"); + AddGroupToRank("Everything", "Admin"); + + // Add permissions to groups: + AddPermissionToGroup("core.build", "Default"); + AddPermissionToGroup("core.tp", "Teleport"); + AddPermissionToGroup("core.kick", "Kick"); + AddPermissionToGroup("*", "Everything"); + + // Set the default rank: + SetDefaultRank("Default"); +} + + + + diff --git a/src/RankManager.h b/src/RankManager.h new file mode 100644 index 000000000..61c52fda6 --- /dev/null +++ b/src/RankManager.h @@ -0,0 +1,260 @@ + +// RankManager.h + +// Declares the cRankManager class that represents the rank manager responsible for assigning permissions and message visuals to players + + + + +#pragma once + +#include "SQLiteCpp/Database.h" +#include "SQLiteCpp/Transaction.h" + + + + + +class cMojangAPI; + + + + + +class cRankManager +{ +public: + /** Acquire this lock to perform mass changes. + Improves performance by wrapping everything into a transaction. + Makes sure that no other thread is accessing the DB. */ + class cMassChangeLock + { + public: + cMassChangeLock(cRankManager & a_RankManager) : + m_Lock(a_RankManager.m_CS), + m_Transaction(a_RankManager.m_DB) + { + } + + ~cMassChangeLock() + { + m_Transaction.commit(); + } + + protected: + cCSLock m_Lock; + SQLite::Transaction m_Transaction; + }; + + + /** Creates the rank manager. Needs to be initialized before other use. */ + cRankManager(void); + + ~cRankManager(); + + /** Initializes the rank manager. Performs migration and default-setting if no data is found in the DB. + The a_MojangAPI param is used when migrating from old ini files, to look up player UUIDs. */ + void Initialize(cMojangAPI & a_MojangAPI); + + /** Returns the name of the rank that the specified player has assigned to them. + If the player has no rank assigned, returns an empty string (NOT the default rank). */ + AString GetPlayerRankName(const AString & a_PlayerUUID); + + /** Returns the last name that the specified player has. + An empty string is returned if the player isn't in the database. */ + AString GetPlayerName(const AString & a_PlayerUUID); + + /** Returns the names of Groups that the specified player has assigned to them. */ + AStringVector GetPlayerGroups(const AString & a_PlayerUUID); + + /** Returns the permissions that the specified player has assigned to them. + If the player has no rank assigned to them, returns the default rank's permissions. */ + AStringVector GetPlayerPermissions(const AString & a_PlayerUUID); + + /** Returns the names of groups that the specified rank has assigned to it. + Returns an empty vector if the rank doesn't exist. */ + AStringVector GetRankGroups(const AString & a_RankName); + + /** Returns the permissions that the specified group has assigned to it. + Returns an empty vector if the group doesn't exist. */ + AStringVector GetGroupPermissions(const AString & a_GroupName); + + /** Returns all permissions that the specified rank has assigned to it, through all its groups. + Returns an empty vector if the rank doesn't exist. Any non-existent groups are ignored. */ + AStringVector GetRankPermissions(const AString & a_RankName); + + /** Returns the short uuids of all defined players. The returned players are ordered by their name (NOT their UUIDs). */ + AStringVector GetAllPlayerUUIDs(void); + + /** Returns the names of all defined ranks. */ + AStringVector GetAllRanks(void); + + /** Returns the names of all permission groups. */ + AStringVector GetAllGroups(void); + + /** Returns all the distinct permissions that are stored in the DB. */ + AStringVector GetAllPermissions(void); + + /** Returns the message visuals (prefix, postfix, color) for the specified player. + Returns true if the visuals were read from the DB, false if not (player not found etc). */ + bool GetPlayerMsgVisuals( + const AString & a_PlayerUUID, + AString & a_MsgPrefix, + AString & a_MsgSuffix, + AString & a_MsgNameColorCode + ); + + /** Adds a new rank. No action if the rank already exists. */ + void AddRank( + const AString & a_RankName, + const AString & a_MsgPrefix, + const AString & a_MsgSuffix, + const AString & a_MsgNameColorCode + ); + + /** Adds a new permission group. No action if such a group already exists. */ + void AddGroup(const AString & a_GroupName); + + /** Bulk-adds groups. Group names that already exist are silently skipped. */ + void AddGroups(const AStringVector & a_GroupNames); + + /** Adds the specified permission group to the specified rank. + Fails if the rank or group names are not found. + Returns true if successful, false on error. */ + bool AddGroupToRank(const AString & a_GroupName, const AString & a_RankName); + + /** Adds the specified permission to the specified permission group. + Fails if the permission group name is not found. + Returns true if successful, false on error. */ + bool AddPermissionToGroup(const AString & a_Permission, const AString & a_GroupName); + + /** Adds the specified permissions to the specified permission group. + Fails if the permission group name is not found. + Returns true if successful, false on error. */ + bool AddPermissionsToGroup(const AStringVector & a_Permissions, const AString & a_GroupName); + + /** Removes the specified rank. + All players assigned to that rank will be re-assigned to a_ReplacementRankName. + If a_ReplacementRankName is empty or not a valid rank, the player will be removed from the DB, + which means they will receive the default rank the next time they are queried. + If the rank being removed is the default rank, the default will be changed to the replacement + rank; the operation fails if there's no replacement. */ + void RemoveRank(const AString & a_RankName, const AString & a_ReplacementRankName); + + /** Removes the specified group completely. + The group will first be removed from all ranks using it, and then removed itself. */ + void RemoveGroup(const AString & a_GroupName); + + /** Removes the specified group from the specified rank. + The group will stay defined, even if no rank is using it. */ + void RemoveGroupFromRank(const AString & a_GroupName, const AString & a_RankName); + + /** Removes the specified permission from the specified group. */ + void RemovePermissionFromGroup(const AString & a_Permission, const AString & a_GroupName); + + /** Renames the specified rank. No action if the rank name is not found. + Fails if the new name is already used. + Updates the cached m_DefaultRank if the default rank is being renamed. + Returns true on success, false on failure. */ + bool RenameRank(const AString & a_OldName, const AString & a_NewName); + + /** Renames the specified group. No action if the rank name is not found. + Fails if the new name is already used. + Returns true on success, false on failure. */ + bool RenameGroup(const AString & a_OldName, const AString & a_NewName); + + /** Sets the specified player's rank. + If the player already had rank assigned to them, it is overwritten with the new rank and name. + Note that this doesn't change the cPlayer if the player is already connected, you need to update all the + cPlayer instances manually. + The PlayerName is provided for reference, so that GetRankPlayerNames() can work. */ + void SetPlayerRank(const AString & a_PlayerUUID, const AString & a_PlayerName, const AString & a_RankName); + + /** Removes the player's rank assignment. The player is left without a rank. + Note that this doesn't change the cPlayer instances for the already connected players, you need to update + all the instances manually. + No action if the player has no rank assigned to them already. */ + void RemovePlayerRank(const AString & a_PlayerUUID); + + /** Sets the message visuals of an existing rank. No action if the rank name is not found. */ + void SetRankVisuals( + const AString & a_RankName, + const AString & a_MsgPrefix, + const AString & a_MsgSuffix, + const AString & a_MsgNameColorCode + ); + + /** Returns the message visuals of an existing rank. + Returns true if successful, false on error (rank doesn't exist). */ + bool GetRankVisuals( + const AString & a_RankName, + AString & a_MsgPrefix, + AString & a_MsgSuffix, + AString & a_MsgNameColorCode + ); + + /** Returns true iff the specified rank exists in the DB. */ + bool RankExists(const AString & a_RankName); + + /** Returns true iff the specified group exists in the DB. */ + bool GroupExists(const AString & a_GroupName); + + /** Returns true iff the specified player has a rank assigned to them in the DB. */ + bool IsPlayerRankSet(const AString & a_PlayerUUID); + + /** Returns true iff the specified rank contains the specified group. */ + bool IsGroupInRank(const AString & a_GroupName, const AString & a_RankName); + + /** Returns true iff the specified group contains the specified permission. */ + bool IsPermissionInGroup(const AString & a_Permission, const AString & a_GroupName); + + /** Called by cMojangAPI whenever the playername-uuid pairing is discovered. Updates the DB. */ + void NotifyNameUUID(const AString & a_PlayerName, const AString & a_UUID); + + /** Sets the specified rank as the default rank. + Returns true on success, false on failure (rank not found). */ + bool SetDefaultRank(const AString & a_RankName); + + /** Returns the name of the default rank. */ + const AString & GetDefaultRank(void) const { return m_DefaultRank; } + + /** Removes all player ranks from the database. Note that this doesn't change the cPlayer instances + for the already connected players, you need to update all the instances manually. */ + void ClearPlayerRanks(void); + + /** Updates the playername that is saved with this uuid. Returns false if a error occurred */ + bool UpdatePlayerName(const AString & a_PlayerUUID, const AString & a_NewPlayerName); + +protected: + + /** The database storage for all the data. Protected by m_CS. */ + SQLite::Database m_DB; + + /** The name of the default rank. Kept as a cache so that queries for it don't need to go through the DB. */ + AString m_DefaultRank; + + /** The mutex protecting m_DB and m_DefaultRank against multi-threaded access. */ + cCriticalSection m_CS; + + /** Set to true once the manager is initialized. */ + bool m_IsInitialized; + + /** The MojangAPI instance that is used for translating playernames to UUIDs. + Set in Initialize(), may be NULL. */ + cMojangAPI * m_MojangAPI; + + + /** Returns true if all the DB tables are empty, indicating a fresh new install. */ + bool AreDBTablesEmpty(void); + + /** Returns true iff the specified DB table is empty. + If there's an error while querying, returns false. */ + bool IsDBTableEmpty(const AString & a_TableName); + + /** Creates a default set of ranks / groups / permissions. */ + void CreateDefaults(void); +} ; + + + + diff --git a/src/Root.cpp b/src/Root.cpp index b65e9b067..aa3d43cba 100644 --- a/src/Root.cpp +++ b/src/Root.cpp @@ -6,7 +6,6 @@ #include "World.h" #include "WebAdmin.h" #include "FurnaceRecipe.h" -#include "GroupManager.h" #include "CraftingRecipes.h" #include "Bindings/PluginManager.h" #include "MonsterConfig.h" @@ -18,6 +17,8 @@ #include "CommandOutput.h" #include "DeadlockDetect.h" #include "OSSupport/Timer.h" +#include "LoggerListeners.h" +#include "BuildInfo.h" #include "inifile/iniFile.h" @@ -41,17 +42,14 @@ cRoot* cRoot::s_Root = NULL; cRoot::cRoot(void) : - m_PrimaryServerVersion(cProtocolRecognizer::PROTO_VERSION_LATEST), m_pDefaultWorld(NULL), m_InputThread(NULL), m_Server(NULL), m_MonsterConfig(NULL), - m_GroupManager(NULL), m_CraftingRecipes(NULL), m_FurnaceRecipe(NULL), m_WebAdmin(NULL), m_PluginManager(NULL), - m_Log(NULL), m_bStop(false), m_bRestart(false) { @@ -105,10 +103,20 @@ void cRoot::Start(void) HMENU hmenu = GetSystemMenu(hwnd, FALSE); EnableMenuItem(hmenu, SC_CLOSE, MF_GRAYED); // Disable close button when starting up; it causes problems with our CTRL-CLOSE handling #endif + + cLogger::cListener * consoleLogListener = MakeConsoleListener(); + cLogger::cListener * fileLogListener = new cFileListener(); + cLogger::GetInstance().AttachListener(consoleLogListener); + cLogger::GetInstance().AttachListener(fileLogListener); + + LOG("--- Started Log ---\n"); + + #ifdef BUILD_ID + LOG("MCServer " BUILD_SERIES_NAME " build id: " BUILD_ID); + LOG("from commit id: " BUILD_COMMIT_ID " built at: " BUILD_DATETIME); + #endif cDeadlockDetect dd; - delete m_Log; - m_Log = new cMCLogger(); m_bStop = false; while (!m_bStop) @@ -133,20 +141,11 @@ void cRoot::Start(void) IniFile.AddHeaderComment(" See: http://wiki.mc-server.org/doku.php?id=configure:settings.ini for further configuration help"); } - m_PrimaryServerVersion = IniFile.GetValueI("Server", "PrimaryServerVersion", 0); - if (m_PrimaryServerVersion == 0) - { - m_PrimaryServerVersion = cProtocolRecognizer::PROTO_VERSION_LATEST; - } - else - { - // Make a note in the log that the primary server version is explicitly set in the ini file - LOGINFO("Primary server version set explicitly to %d.", m_PrimaryServerVersion); - } - LOG("Starting server..."); + m_MojangAPI.Start(IniFile); // Mojang API needs to be started before plugins, so that plugins may use it for DB upgrades on server init if (!m_Server->InitServer(IniFile)) { + IniFile.WriteFile("settings.ini"); LOGERROR("Failure starting server, aborting..."); return; } @@ -155,7 +154,7 @@ void cRoot::Start(void) m_WebAdmin->Init(); LOGD("Loading settings..."); - m_GroupManager = new cGroupManager(); + m_RankManager.Initialize(m_MojangAPI); m_CraftingRecipes = new cCraftingRecipes; m_FurnaceRecipe = new cFurnaceRecipe(); @@ -234,8 +233,6 @@ void cRoot::Start(void) LOGD("Unloading recipes..."); delete m_FurnaceRecipe; m_FurnaceRecipe = NULL; delete m_CraftingRecipes; m_CraftingRecipes = NULL; - LOGD("Forgetting groups..."); - delete m_GroupManager; m_GroupManager = NULL; LOGD("Unloading worlds..."); UnloadWorlds(); @@ -248,8 +245,13 @@ void cRoot::Start(void) delete m_Server; m_Server = NULL; LOG("Shutdown successful!"); } - - delete m_Log; m_Log = NULL; + + LOG("--- Stopped Log ---"); + + cLogger::GetInstance().DetachListener(consoleLogListener); + delete consoleLogListener; + cLogger::GetInstance().DetachListener(fileLogListener); + delete fileLogListener; } @@ -269,19 +271,19 @@ void cRoot::LoadWorlds(cIniFile & IniFile) { // First get the default world AString DefaultWorldName = IniFile.GetValueSet("Worlds", "DefaultWorld", "world"); - m_pDefaultWorld = new cWorld( DefaultWorldName.c_str()); + m_pDefaultWorld = new cWorld(DefaultWorldName.c_str()); m_WorldsByName[ DefaultWorldName ] = m_pDefaultWorld; // Then load the other worlds - unsigned int KeyNum = IniFile.FindKey("Worlds"); - unsigned int NumWorlds = IniFile.GetNumValues( KeyNum); + int KeyNum = IniFile.FindKey("Worlds"); + int NumWorlds = IniFile.GetNumValues(KeyNum); if (NumWorlds <= 0) { return; } bool FoundAdditionalWorlds = false; - for (unsigned int i = 0; i < NumWorlds; i++) + for (int i = 0; i < NumWorlds; i++) { AString ValueName = IniFile.GetValueName(KeyNum, i); if (ValueName.compare("World") != 0) @@ -461,16 +463,6 @@ void cRoot::QueueExecuteConsoleCommand(const AString & a_Cmd, cCommandOutputCall void cRoot::QueueExecuteConsoleCommand(const AString & a_Cmd) { - // Some commands are built-in: - if (a_Cmd == "stop") - { - m_bStop = true; - } - else if (a_Cmd == "restart") - { - m_bRestart = true; - } - // Put the command into a queue (Alleviates FS #363): cCSLock Lock(m_CSPendingCommands); m_PendingCommands.push_back(cCommand(a_Cmd, new cLogCommandDeleteSelfOutputCallback)); @@ -482,14 +474,16 @@ void cRoot::QueueExecuteConsoleCommand(const AString & a_Cmd) void cRoot::ExecuteConsoleCommand(const AString & a_Cmd, cCommandOutputCallback & a_Output) { - // Some commands are built-in: + // cRoot handles stopping and restarting due to our access to controlling variables if (a_Cmd == "stop") { m_bStop = true; + return; } else if (a_Cmd == "restart") { m_bRestart = true; + return; } LOG("Executing console command: \"%s\"", a_Cmd.c_str()); @@ -544,17 +538,6 @@ void cRoot::SaveAllChunks(void) -void cRoot::ReloadGroups(void) -{ - LOG("Reload groups ..."); - m_GroupManager->LoadGroups(); - m_GroupManager->CheckUsers(); -} - - - - - void cRoot::BroadcastChat(const AString & a_Message, eMessageType a_ChatPrefix) { for (WorldMap::iterator itr = m_WorldsByName.begin(), end = m_WorldsByName.end(); itr != end; ++itr) diff --git a/src/Root.h b/src/Root.h index 93117389e..84c6a98ec 100644 --- a/src/Root.h +++ b/src/Root.h @@ -2,8 +2,10 @@ #pragma once #include "Protocol/Authenticator.h" +#include "Protocol/MojangAPI.h" #include "HTTPServer/HTTPServer.h" #include "Defines.h" +#include "RankManager.h" @@ -12,7 +14,6 @@ // fwd: class cThread; class cMonsterConfig; -class cGroupManager; class cCraftingRecipes; class cFurnaceRecipe; class cWebAdmin; @@ -40,11 +41,12 @@ namespace Json class cRoot { public: - static bool m_TerminateEventRaised; - static cRoot * Get() { return s_Root; } // tolua_end + static bool m_TerminateEventRaised; + + cRoot(void); ~cRoot(); @@ -72,12 +74,8 @@ public: /// Writes chunkstats, for each world and totals, to the output callback void LogChunkStats(cCommandOutputCallback & a_Output); - int GetPrimaryServerVersion(void) const { return m_PrimaryServerVersion; } // tolua_export - void SetPrimaryServerVersion(int a_Version) { m_PrimaryServerVersion = a_Version; } // tolua_export - cMonsterConfig * GetMonsterConfig(void) { return m_MonsterConfig; } - cGroupManager * GetGroupManager (void) { return m_GroupManager; } // tolua_export cCraftingRecipes * GetCraftingRecipes(void) { return m_CraftingRecipes; } // tolua_export cFurnaceRecipe * GetFurnaceRecipe (void) { return m_FurnaceRecipe; } // Exported in ManualBindings.cpp with quite a different signature @@ -87,6 +85,8 @@ public: cWebAdmin * GetWebAdmin (void) { return m_WebAdmin; } // tolua_export cPluginManager * GetPluginManager (void) { return m_PluginManager; } // tolua_export cAuthenticator & GetAuthenticator (void) { return m_Authenticator; } + cMojangAPI & GetMojangAPI (void) { return m_MojangAPI; } + cRankManager & GetRankManager (void) { return m_RankManager; } /** Queues a console command for execution through the cServer class. The command will be executed in the tick thread @@ -120,9 +120,6 @@ public: /// Saves all chunks in all worlds void SaveAllChunks(void); // tolua_export - /// Reloads all the groups - void ReloadGroups(void); // tolua_export - /// Calls the callback for each player in all worlds bool ForEachPlayer(cPlayerListCallback & a_Callback); // >> EXPORTED IN MANUALBINDINGS << @@ -133,15 +130,15 @@ public: /// Sends a chat message to all connected clients (in all worlds) void BroadcastChat (const AString & a_Message, eMessageType a_ChatPrefix = mtCustom); - void BroadcastChatInfo (const AString & a_Message) { BroadcastChat(a_Message, mtInformation); } + void BroadcastChat (const cCompositeChat & a_Message); + void BroadcastChatDeath (const AString & a_Message) { BroadcastChat(a_Message, mtDeath); } void BroadcastChatFailure(const AString & a_Message) { BroadcastChat(a_Message, mtFailure); } - void BroadcastChatSuccess(const AString & a_Message) { BroadcastChat(a_Message, mtSuccess); } - void BroadcastChatWarning(const AString & a_Message) { BroadcastChat(a_Message, mtWarning); } void BroadcastChatFatal (const AString & a_Message) { BroadcastChat(a_Message, mtFailure); } + void BroadcastChatInfo (const AString & a_Message) { BroadcastChat(a_Message, mtInformation); } void BroadcastChatJoin (const AString & a_Message) { BroadcastChat(a_Message, mtJoin); } void BroadcastChatLeave (const AString & a_Message) { BroadcastChat(a_Message, mtLeave); } - void BroadcastChatDeath (const AString & a_Message) { BroadcastChat(a_Message, mtDeath); } - void BroadcastChat (const cCompositeChat & a_Message); + void BroadcastChatSuccess(const AString & a_Message) { BroadcastChat(a_Message, mtSuccess); } + void BroadcastChatWarning(const AString & a_Message) { BroadcastChat(a_Message, mtWarning); } /// Returns the textual description of the protocol version: 49 -> "1.4.4". Provided specifically for Lua API static AString GetProtocolVersionTextFromInt(int a_ProtocolVersionNum); @@ -170,9 +167,6 @@ private: typedef std::map<AString, cWorld *> WorldMap; typedef std::vector<cCommand> cCommandQueue; - - /// The version of the protocol that is primary for the server (reported in the server list). All versions are still supported. - int m_PrimaryServerVersion; cWorld * m_pDefaultWorld; WorldMap m_WorldsByName; @@ -185,16 +179,15 @@ private: cServer * m_Server; cMonsterConfig * m_MonsterConfig; - cGroupManager * m_GroupManager; cCraftingRecipes * m_CraftingRecipes; cFurnaceRecipe * m_FurnaceRecipe; cWebAdmin * m_WebAdmin; cPluginManager * m_PluginManager; cAuthenticator m_Authenticator; + cMojangAPI m_MojangAPI; + cRankManager m_RankManager; cHTTPServer m_HTTPServer; - cMCLogger * m_Log; - bool m_bStop; bool m_bRestart; diff --git a/src/Server.cpp b/src/Server.cpp index 42ad133f1..969ffd693 100644 --- a/src/Server.cpp +++ b/src/Server.cpp @@ -11,7 +11,6 @@ #include "World.h" #include "ChunkDef.h" #include "Bindings/PluginManager.h" -#include "GroupManager.h" #include "ChatColor.h" #include "Entities/Player.h" #include "Inventory.h" @@ -117,7 +116,9 @@ cServer::cServer(void) : m_MaxPlayers(0), m_bIsHardcore(false), m_TickThread(*this), - m_ShouldAuthenticate(false) + m_ShouldAuthenticate(false), + m_ShouldLoadOfflinePlayerData(false), + m_ShouldLoadNamedPlayerData(true) { } @@ -258,6 +259,13 @@ bool cServer::InitServer(cIniFile & a_SettingsIni) m_ServerID = sid.str(); m_ServerID.resize(16, '0'); } + + // Check if both BungeeCord and online mode are on, if so, warn the admin: + m_ShouldAllowBungeeCord = a_SettingsIni.GetValueSetB("Authentication", "AllowBungeeCord", false); + if (m_ShouldAllowBungeeCord && m_ShouldAuthenticate) + { + LOGWARNING("WARNING: BungeeCord is allowed and server set to online mode. This is unsafe and will not work properly. Disable either authentication or BungeeCord in settings.ini."); + } m_ShouldLoadOfflinePlayerData = a_SettingsIni.GetValueSetB("PlayerData", "LoadOfflinePlayerData", false); m_ShouldLoadNamedPlayerData = a_SettingsIni.GetValueSetB("PlayerData", "LoadNamedPlayerData", true); @@ -457,83 +465,98 @@ void cServer::ExecuteConsoleCommand(const AString & a_Cmd, cCommandOutputCallbac return; } - // Special handling: "stop" and "restart" are built in - if ((split[0].compare("stop") == 0) || (split[0].compare("restart") == 0)) - { - return; - } + // "stop" and "restart" are handled in cRoot::ExecuteConsoleCommand, our caller, due to its access to controlling variables // "help" and "reload" are to be handled by MCS, so that they work no matter what if (split[0] == "help") { PrintHelp(split, a_Output); + a_Output.Finished(); return; } - if (split[0] == "reload") + else if (split[0] == "reload") { cPluginManager::Get()->ReloadPlugins(); - cRoot::Get()->ReloadGroups(); + a_Output.Finished(); return; } - if (split[0] == "reloadplugins") + else if (split[0] == "reloadplugins") { cPluginManager::Get()->ReloadPlugins(); - return; - } - if (split[0] == "reloadgroups") - { - cRoot::Get()->ReloadGroups(); - a_Output.Out("Groups reloaded!"); + a_Output.Out("Plugins reloaded"); a_Output.Finished(); return; } - if (split[0] == "load") + else if (split[0] == "load") { if (split.size() > 1) { - cPluginManager::Get()->LoadPlugin(split[1]); - - return; + a_Output.Out(cPluginManager::Get()->LoadPlugin(split[1]) ? "Plugin loaded" : "Error occurred loading plugin"); } else { - a_Output.Out("No plugin given! Command: load <pluginname>"); - a_Output.Finished(); - return; + a_Output.Out("Usage: load <pluginname>"); } + a_Output.Finished(); + return; } - - if (split[0] == "unload") + else if (split[0] == "unload") { if (split.size() > 1) { cPluginManager::Get()->RemovePlugin(cPluginManager::Get()->GetPlugin(split[1])); - return; + a_Output.Out("Plugin unloaded"); } else { - a_Output.Out("No plugin given! Command: unload <pluginname>"); - a_Output.Finished(); - return; + a_Output.Out("Usage: unload <pluginname>"); } + a_Output.Finished(); + return; + } + if (split[0] == "destroyentities") + { + class WorldCallback : public cWorldListCallback + { + virtual bool Item(cWorld * a_World) override + { + class EntityCallback : public cEntityCallback + { + virtual bool Item(cEntity * a_Entity) override + { + if (!a_Entity->IsPlayer()) + { + a_Entity->Destroy(); + } + return false; + } + } EC; + a_World->ForEachEntity(EC); + return false; + } + } WC; + cRoot::Get()->ForEachWorld(WC); + a_Output.Out("Destroyed all entities"); + a_Output.Finished(); + return; } // There is currently no way a plugin can do these (and probably won't ever be): - if (split[0].compare("chunkstats") == 0) + else if (split[0].compare("chunkstats") == 0) { cRoot::Get()->LogChunkStats(a_Output); a_Output.Finished(); return; } #if defined(_MSC_VER) && defined(_DEBUG) && defined(ENABLE_LEAK_FINDER) - if (split[0].compare("dumpmem") == 0) + else if (split[0].compare("dumpmem") == 0) { LeakFinderXmlOutput Output("memdump.xml"); DumpUsedMemory(&Output); return; } - if (split[0].compare("killmem") == 0) + else if (split[0].compare("killmem") == 0) { for (;;) { @@ -542,7 +565,7 @@ void cServer::ExecuteConsoleCommand(const AString & a_Cmd, cCommandOutputCallbac } #endif - if (cPluginManager::Get()->ExecuteConsoleCommand(split, a_Output)) + else if (cPluginManager::Get()->ExecuteConsoleCommand(split, a_Output)) { a_Output.Finished(); return; @@ -610,6 +633,7 @@ void cServer::BindBuiltInConsoleCommands(void) PlgMgr->BindConsoleCommand("chunkstats", NULL, " - Displays detailed chunk memory statistics"); PlgMgr->BindConsoleCommand("load <pluginname>", NULL, " - Adds and enables the specified plugin"); PlgMgr->BindConsoleCommand("unload <pluginname>", NULL, " - Disables the specified plugin"); + PlgMgr->BindConsoleCommand("destroyentities", NULL, " - Destroys all entities in all worlds"); #if defined(_MSC_VER) && defined(_DEBUG) && defined(ENABLE_LEAK_FINDER) PlgMgr->BindConsoleCommand("dumpmem", NULL, " - Dumps all used memory blocks together with their callstacks into memdump.xml"); diff --git a/src/Server.h b/src/Server.h index b03359f03..6d659fa40 100644 --- a/src/Server.h +++ b/src/Server.h @@ -63,12 +63,12 @@ public: // tolua_export const AString & GetDescription(void) const {return m_Description; } // Player counts: - int GetMaxPlayers(void) const {return m_MaxPlayers; } + int GetMaxPlayers(void) const { return m_MaxPlayers; } int GetNumPlayers(void) const; void SetMaxPlayers(int a_MaxPlayers) { m_MaxPlayers = a_MaxPlayers; } // Hardcore mode or not: - bool IsHardcore(void) const {return m_bIsHardcore; } + bool IsHardcore(void) const { return m_bIsHardcore; } // tolua_end @@ -120,7 +120,7 @@ public: // tolua_export const AString & GetPublicKeyDER(void) const { return m_PublicKeyDER; } /** Returns true if authentication has been turned on in server settings. */ - bool ShouldAuthenticate(void) const { return m_ShouldAuthenticate; } + bool ShouldAuthenticate(void) const { return m_ShouldAuthenticate; } // tolua_export /** Returns true if offline UUIDs should be used to load data for players whose normal UUIDs cannot be found. Loaded from the settings.ini [PlayerData].LoadOfflinePlayerData setting. */ @@ -131,6 +131,11 @@ public: // tolua_export Loaded from the settings.ini [PlayerData].LoadNamedPlayerData setting. */ bool ShouldLoadNamedPlayerData(void) const { return m_ShouldLoadNamedPlayerData; } + /** Returns true if BungeeCord logins (that specify the player's UUID) are allowed. + Read from settings, admins should set this to true only when they chain to BungeeCord, + it makes the server vulnerable to identity theft through direct connections. */ + bool ShouldAllowBungeeCord(void) const { return m_ShouldAllowBungeeCord; } + private: friend class cRoot; // so cRoot can create and destroy cServer @@ -230,6 +235,9 @@ private: This allows a seamless transition from name-based to UUID-based player storage. Loaded from the settings.ini [PlayerData].LoadNamedPlayerData setting. */ bool m_ShouldLoadNamedPlayerData; + + /** True if BungeeCord handshake packets (with player UUID) should be accepted. */ + bool m_ShouldAllowBungeeCord; cServer(void); diff --git a/src/SetChunkData.cpp b/src/SetChunkData.cpp index 6e0c2733e..707dfb9e8 100644 --- a/src/SetChunkData.cpp +++ b/src/SetChunkData.cpp @@ -5,6 +5,7 @@ #include "Globals.h" #include "SetChunkData.h" +#include "BlockEntities/BlockEntity.h" @@ -13,6 +14,9 @@ cSetChunkData::cSetChunkData(int a_ChunkX, int a_ChunkZ, bool a_ShouldMarkDirty) : m_ChunkX(a_ChunkX), m_ChunkZ(a_ChunkZ), + m_IsLightValid(false), + m_IsHeightMapValid(false), + m_AreBiomesValid(false), m_ShouldMarkDirty(a_ShouldMarkDirty) { } @@ -40,7 +44,6 @@ cSetChunkData::cSetChunkData( // Check the params' validity: ASSERT(a_BlockTypes != NULL); ASSERT(a_BlockMetas != NULL); - ASSERT(a_Biomes != NULL); // Copy block types and metas: memcpy(m_BlockTypes, a_BlockTypes, sizeof(cChunkDef::BlockTypes)); @@ -113,3 +116,35 @@ void cSetChunkData::CalculateHeightMap(void) + +void cSetChunkData::RemoveInvalidBlockEntities(void) +{ + for (cBlockEntityList::iterator itr = m_BlockEntities.begin(); itr != m_BlockEntities.end();) + { + BLOCKTYPE EntityBlockType = (*itr)->GetBlockType(); + BLOCKTYPE WorldBlockType = cChunkDef::GetBlock(m_BlockTypes, (*itr)->GetRelX(), (*itr)->GetPosY(), (*itr)->GetRelZ()); + if (EntityBlockType != WorldBlockType) + { + // Bad blocktype, remove the block entity: + LOGD("Block entity blocktype mismatch at {%d, %d, %d}: entity for blocktype %s(%d) in block %s(%d). Deleting the block entity.", + (*itr)->GetPosX(), (*itr)->GetPosY(), (*itr)->GetPosZ(), + ItemTypeToString(EntityBlockType).c_str(), EntityBlockType, + ItemTypeToString(WorldBlockType).c_str(), WorldBlockType + ); + cBlockEntityList::iterator itr2 = itr; + itr2++; + delete *itr; + m_BlockEntities.erase(itr); + itr = itr2; + } + else + { + // Good blocktype, keep the block entity: + ++itr; + } + } // for itr - m_BlockEntities[] +} + + + + diff --git a/src/SetChunkData.h b/src/SetChunkData.h index a2f776f6b..03e9ef4d9 100644 --- a/src/SetChunkData.h +++ b/src/SetChunkData.h @@ -92,6 +92,9 @@ public: /** Calculates the heightmap based on the contained blocktypes and marks it valid. */ void CalculateHeightMap(void); + /** Removes the block entities that don't have a proper blocktype at their corresponding coords. */ + void RemoveInvalidBlockEntities(void); + protected: int m_ChunkX; int m_ChunkZ; diff --git a/src/Simulator/CMakeLists.txt b/src/Simulator/CMakeLists.txt index 521b145b6..5aa406717 100644 --- a/src/Simulator/CMakeLists.txt +++ b/src/Simulator/CMakeLists.txt @@ -10,7 +10,6 @@ SET (SRCS FloodyFluidSimulator.cpp FluidSimulator.cpp IncrementalRedstoneSimulator.cpp - RedstoneSimulator.cpp SandSimulator.cpp Simulator.cpp SimulatorManager.cpp diff --git a/src/Simulator/FireSimulator.cpp b/src/Simulator/FireSimulator.cpp index 69dc7164e..7ae84af7b 100644 --- a/src/Simulator/FireSimulator.cpp +++ b/src/Simulator/FireSimulator.cpp @@ -179,6 +179,17 @@ bool cFireSimulator::IsFuel(BLOCKTYPE a_BlockType) case E_BLOCK_WOOL: case E_BLOCK_BOOKCASE: case E_BLOCK_FENCE: + case E_BLOCK_SPRUCE_FENCE: + case E_BLOCK_BIRCH_FENCE: + case E_BLOCK_JUNGLE_FENCE: + case E_BLOCK_DARK_OAK_FENCE: + case E_BLOCK_ACACIA_FENCE: + case E_BLOCK_FENCE_GATE: + case E_BLOCK_SPRUCE_FENCE_GATE: + case E_BLOCK_BIRCH_FENCE_GATE: + case E_BLOCK_JUNGLE_FENCE_GATE: + case E_BLOCK_DARK_OAK_FENCE_GATE: + case E_BLOCK_ACACIA_FENCE_GATE: case E_BLOCK_TNT: case E_BLOCK_VINES: case E_BLOCK_HAY_BALE: @@ -359,18 +370,26 @@ void cFireSimulator::RemoveFuelNeighbors(cChunk * a_Chunk, int a_RelX, int a_Rel continue; } + int AbsX = (Neighbour->GetPosX() * cChunkDef::Width) + X; + int Y = a_RelY + gNeighborCoords[i].y; + int AbsZ = (Neighbour->GetPosZ() * cChunkDef::Width) + Z; + if (BlockType == E_BLOCK_TNT) { - int AbsX = X + Neighbour->GetPosX() * cChunkDef::Width; - int AbsZ = Z + Neighbour->GetPosZ() * cChunkDef::Width; - - m_World.SpawnPrimedTNT(AbsX, a_RelY + gNeighborCoords[i].y, AbsZ, 0); - Neighbour->SetBlock(X, a_RelY + gNeighborCoords[i].y, Z, E_BLOCK_AIR, 0); + m_World.SpawnPrimedTNT(AbsX, Y, AbsZ, 0); + Neighbour->SetBlock(X, a_RelY + Y, Z, E_BLOCK_AIR, 0); return; } bool ShouldReplaceFuel = (m_World.GetTickRandomNumber(MAX_CHANCE_REPLACE_FUEL) < m_ReplaceFuelChance); - Neighbour->SetBlock(X, a_RelY + gNeighborCoords[i].y, Z, ShouldReplaceFuel ? E_BLOCK_FIRE : E_BLOCK_AIR, 0); + if (ShouldReplaceFuel && !cRoot::Get()->GetPluginManager()->CallHookBlockSpread(&m_World, AbsX, Y, AbsZ, ssFireSpread)) + { + Neighbour->SetBlock(X, Y, Z, E_BLOCK_FIRE, 0); + } + else + { + Neighbour->SetBlock(X, Y, Z, E_BLOCK_AIR, 0); + } } // for i - Coords[] } diff --git a/src/Simulator/FireSimulator.h b/src/Simulator/FireSimulator.h index 9ccc3ef4f..f76dbe342 100644 --- a/src/Simulator/FireSimulator.h +++ b/src/Simulator/FireSimulator.h @@ -16,7 +16,7 @@ it progresses to the next step (blockmeta++). This value is updated if a neighbo The simulator reads its parameters from the ini file given to the constructor. */ class cFireSimulator : - public cSimulator + public cSimulator<cChunk, cWorld> { public: cFireSimulator(cWorld & a_World, cIniFile & a_IniFile); diff --git a/src/Simulator/FloodyFluidSimulator.cpp b/src/Simulator/FloodyFluidSimulator.cpp index 2c5c4b658..b839aa746 100644 --- a/src/Simulator/FloodyFluidSimulator.cpp +++ b/src/Simulator/FloodyFluidSimulator.cpp @@ -12,6 +12,7 @@ #include "../BlockArea.h" #include "../Blocks/BlockHandler.h" #include "../BlockInServerPluginInterface.h" +#include "../Blocks/ChunkInterface.h" diff --git a/src/Simulator/FluidSimulator.h b/src/Simulator/FluidSimulator.h index 672b740a2..0877a7bf1 100644 --- a/src/Simulator/FluidSimulator.h +++ b/src/Simulator/FluidSimulator.h @@ -4,7 +4,8 @@ #include "Simulator.h" - +class cChunk; +class cWorld; enum Direction @@ -36,9 +37,9 @@ public: class cFluidSimulator : - public cSimulator + public cSimulator<cChunk, cWorld> { - typedef cSimulator super; + typedef cSimulator<cChunk, cWorld> super; public: cFluidSimulator(cWorld & a_World, BLOCKTYPE a_Fluid, BLOCKTYPE a_StationaryFluid); diff --git a/src/Simulator/IncrementalRedstoneSimulator.cpp b/src/Simulator/IncrementalRedstoneSimulator.cpp index ada8de4b8..df05a9fee 100644 --- a/src/Simulator/IncrementalRedstoneSimulator.cpp +++ b/src/Simulator/IncrementalRedstoneSimulator.cpp @@ -1,2222 +1,24 @@ -#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules +#include "Globals.h" -#include "IncrementalRedstoneSimulator.h" -#include "BoundingBox.h" -#include "../BlockEntities/DropSpenserEntity.h" -#include "../BlockEntities/NoteEntity.h" -#include "../BlockEntities/ChestEntity.h" -#include "../BlockEntities/CommandBlockEntity.h" -#include "../Entities/TNTEntity.h" -#include "../Entities/Pickup.h" -#include "../Blocks/BlockTorch.h" -#include "../Blocks/BlockDoor.h" -#include "../Blocks/BlockButton.h" -#include "../Blocks/BlockLever.h" -#include "../Blocks/BlockPiston.h" -#include "../Blocks/BlockTripwireHook.h" +#include "BlockEntities/ChestEntity.h" +typedef cItemCallback<cChestEntity> cChestCallback; +#include "IncrementalRedstoneSimulator.inc" +#include "Chunk.h" +#include "World.h" +#include "Blocks/GetHandlerCompileTimeTemplate.h" +#include "Blocks/BlockTorch.h" +#include "Blocks/BlockLever.h" +#include "Blocks/BlockButton.h" +#include "Blocks/BlockTripwireHook.h" +#include "Blocks/BlockDoor.h" +#include "Blocks/BlockPiston.h" - -cIncrementalRedstoneSimulator::cIncrementalRedstoneSimulator(cWorld & a_World) : - super(a_World), - m_RedstoneSimulatorChunkData(), - m_PoweredBlocks(), - m_LinkedPoweredBlocks(), - m_SimulatedPlayerToggleableBlocks(), - m_RepeatersDelayList(), - m_Chunk() -{ -} - - - - - -cIncrementalRedstoneSimulator::~cIncrementalRedstoneSimulator() -{ -} - - - - - -void cIncrementalRedstoneSimulator::RedstoneAddBlock(int a_BlockX, int a_BlockY, int a_BlockZ, cChunk * a_Chunk, cChunk * a_OtherChunk) -{ - if ((a_Chunk == NULL) || !a_Chunk->IsValid()) - { - return; - } - else if ((a_BlockY < 0) || (a_BlockY > cChunkDef::Height)) - { - return; - } - - // We may be called with coordinates in a chunk that is not the first chunk parameter - // In that case, the actual chunk (which the coordinates are in), will be passed as the second parameter - // Use that Chunk pointer to get a relative position - - int RelX = 0; - int RelZ = 0; - BLOCKTYPE Block; - NIBBLETYPE Meta; - - if (a_OtherChunk != NULL) - { - RelX = a_BlockX - a_OtherChunk->GetPosX() * cChunkDef::Width; - RelZ = a_BlockZ - a_OtherChunk->GetPosZ() * cChunkDef::Width; - a_OtherChunk->GetBlockTypeMeta(RelX, a_BlockY, RelZ, Block, Meta); - - // If a_OtherChunk is passed (not NULL), it is the chunk that had a block change, and a_Chunk will be the neighbouring chunk of that block - // Because said neighbouring chunk does not know of this change but still needs to update its redstone, we set it to dirty - a_Chunk->SetIsRedstoneDirty(true); - } - else - { - RelX = a_BlockX - a_Chunk->GetPosX() * cChunkDef::Width; - RelZ = a_BlockZ - a_Chunk->GetPosZ() * cChunkDef::Width; - a_Chunk->GetBlockTypeMeta(RelX, a_BlockY, RelZ, Block, Meta); - } - - // Every time a block is changed (AddBlock called), we want to go through all lists and check to see if the coordiantes stored within are still valid - // Checking only when a block is changed, as opposed to every tick, also improves performance - - PoweredBlocksList * PoweredBlocks = a_Chunk->GetRedstoneSimulatorPoweredBlocksList(); - for (PoweredBlocksList::iterator itr = PoweredBlocks->begin(); itr != PoweredBlocks->end();) - { - if (!itr->a_SourcePos.Equals(Vector3i(a_BlockX, a_BlockY, a_BlockZ))) - { - ++itr; - continue; - } - - if (!IsPotentialSource(Block)) - { - LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from powered blocks list as it no longer connected to a source", itr->a_BlockPos.x, itr->a_BlockPos.y, itr->a_BlockPos.z); - itr = PoweredBlocks->erase(itr); - continue; - } - else if ( - // Changeable sources - ((Block == E_BLOCK_REDSTONE_WIRE) && (Meta == 0)) || - ((Block == E_BLOCK_LEVER) && !IsLeverOn(Meta)) || - ((Block == E_BLOCK_DETECTOR_RAIL) && ((Meta & 0x08) == 0)) || - (((Block == E_BLOCK_STONE_BUTTON) || (Block == E_BLOCK_WOODEN_BUTTON)) && (!IsButtonOn(Meta))) || - ((Block == E_BLOCK_TRIPWIRE_HOOK) && ((Meta & 0x08) == 0)) - ) - { - LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from powered blocks list due to present/past metadata mismatch", itr->a_BlockPos.x, itr->a_BlockPos.y, itr->a_BlockPos.z); - itr = PoweredBlocks->erase(itr); - continue; - } - ++itr; - } - - LinkedBlocksList * LinkedPoweredBlocks = a_Chunk->GetRedstoneSimulatorLinkedBlocksList(); - // We loop through all values (insteading of breaking out at the first) to make sure everything is gone, as there can be multiple SourceBlock entries for one AddBlock coordinate - for (LinkedBlocksList::iterator itr = LinkedPoweredBlocks->begin(); itr != LinkedPoweredBlocks->end();) - { - if (itr->a_SourcePos.Equals(Vector3i(a_BlockX, a_BlockY, a_BlockZ))) - { - if (!IsPotentialSource(Block)) - { - LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from linked powered blocks list as it is no longer connected to a source", itr->a_BlockPos.x, itr->a_BlockPos.y, itr->a_BlockPos.z); - itr = LinkedPoweredBlocks->erase(itr); - continue; - } - else if ( - // Things that can send power through a block but which depends on meta - ((Block == E_BLOCK_REDSTONE_WIRE) && (Meta == 0)) || - ((Block == E_BLOCK_LEVER) && !IsLeverOn(Meta)) || - (((Block == E_BLOCK_STONE_BUTTON) || (Block == E_BLOCK_WOODEN_BUTTON)) && (!IsButtonOn(Meta))) - ) - { - LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from linked powered blocks list due to present/past metadata mismatch", itr->a_BlockPos.x, itr->a_BlockPos.y, itr->a_BlockPos.z); - itr = LinkedPoweredBlocks->erase(itr); - continue; - } - } - else if (itr->a_MiddlePos.Equals(Vector3i(a_BlockX, a_BlockY, a_BlockZ))) - { - if (!IsViableMiddleBlock(Block)) - { - LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from linked powered blocks list as it is no longer powered through a valid middle block", itr->a_BlockPos.x, itr->a_BlockPos.y, itr->a_BlockPos.z); - itr = LinkedPoweredBlocks->erase(itr); - continue; - } - } - ++itr; - } - - SimulatedPlayerToggleableList * SimulatedPlayerToggleableBlocks = a_Chunk->GetRedstoneSimulatorSimulatedPlayerToggleableList(); - for (SimulatedPlayerToggleableList::iterator itr = SimulatedPlayerToggleableBlocks->begin(); itr != SimulatedPlayerToggleableBlocks->end(); ++itr) - { - if (!itr->a_RelBlockPos.Equals(Vector3i(RelX, a_BlockY, RelZ))) - { - continue; - } - - if (!IsAllowedBlock(Block)) - { - LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from toggleable simulated list as it is no longer redstone", itr->a_RelBlockPos.x, itr->a_RelBlockPos.y, itr->a_RelBlockPos.z); - SimulatedPlayerToggleableBlocks->erase(itr); - break; - } - } - - RepeatersDelayList * RepeatersDelayList = a_Chunk->GetRedstoneSimulatorRepeatersDelayList(); - for (RepeatersDelayList::iterator itr = RepeatersDelayList->begin(); itr != RepeatersDelayList->end(); ++itr) - { - if (!itr->a_RelBlockPos.Equals(Vector3i(RelX, a_BlockY, RelZ))) - { - continue; - } - - if ((Block != E_BLOCK_REDSTONE_REPEATER_ON) && (Block != E_BLOCK_REDSTONE_REPEATER_OFF)) - { - RepeatersDelayList->erase(itr); - break; - } - } - - if (a_OtherChunk != NULL) - { - // DO NOT touch our chunk's data structure if we are being called with coordinates from another chunk - this one caused me massive grief :P - return; - } - - cRedstoneSimulatorChunkData * RedstoneSimulatorChunkData = a_Chunk->GetRedstoneSimulatorData(); - for (cRedstoneSimulatorChunkData::iterator itr = RedstoneSimulatorChunkData->begin(); itr != RedstoneSimulatorChunkData->end(); ++itr) - { - if ((itr->x == RelX) && (itr->y == a_BlockY) && (itr->z == RelZ)) // We are at an entry matching the current (changed) block - { - if (!IsAllowedBlock(Block)) - { - itr->DataTwo = true; // The new blocktype is not redstone; it must be queued to be removed from this list - } - else - { - itr->DataTwo = false; - itr->Data = Block; // Update block information - } - return; - } - } - - if (!IsAllowedBlock(Block)) - { - return; - } - - for (cRedstoneSimulatorChunkData::iterator itr = a_Chunk->GetRedstoneSimulatorQueuedData()->begin(); itr != a_Chunk->GetRedstoneSimulatorQueuedData()->end(); ++itr) - { - if ((itr->x == RelX) && (itr->y == a_BlockY) && (itr->z == RelZ)) - { - // Can't have duplicates in here either, in case something adds the block again before the structure can written to the main chunk data - return; - } - } - a_Chunk->GetRedstoneSimulatorQueuedData()->push_back(cCoordWithBlockAndBool(RelX, a_BlockY, RelZ, Block, false)); -} - - - - - -void cIncrementalRedstoneSimulator::SimulateChunk(float a_Dt, int a_ChunkX, int a_ChunkZ, cChunk * a_Chunk) -{ - m_RedstoneSimulatorChunkData = a_Chunk->GetRedstoneSimulatorData(); - if (m_RedstoneSimulatorChunkData->empty() && a_Chunk->GetRedstoneSimulatorQueuedData()->empty()) - { - return; - } - - m_RedstoneSimulatorChunkData->insert(m_RedstoneSimulatorChunkData->end(), a_Chunk->GetRedstoneSimulatorQueuedData()->begin(), a_Chunk->GetRedstoneSimulatorQueuedData()->end()); - a_Chunk->GetRedstoneSimulatorQueuedData()->clear(); - - m_PoweredBlocks = a_Chunk->GetRedstoneSimulatorPoweredBlocksList(); - m_RepeatersDelayList = a_Chunk->GetRedstoneSimulatorRepeatersDelayList(); - m_SimulatedPlayerToggleableBlocks = a_Chunk->GetRedstoneSimulatorSimulatedPlayerToggleableList(); - m_LinkedPoweredBlocks = a_Chunk->GetRedstoneSimulatorLinkedBlocksList(); - m_Chunk = a_Chunk; - bool ShouldUpdateSimulateOnceBlocks = false; - - if (a_Chunk->IsRedstoneDirty()) - { - // Simulate the majority of devices only if something (blockwise or power-wise) has changed - // Make sure to allow the chunk to resimulate after the initial run if there was a power change (ShouldUpdateSimulateOnceBlocks helps to do this) - a_Chunk->SetIsRedstoneDirty(false); - ShouldUpdateSimulateOnceBlocks = true; - } - - HandleRedstoneRepeaterDelays(); - - for (cRedstoneSimulatorChunkData::iterator dataitr = m_RedstoneSimulatorChunkData->begin(); dataitr != m_RedstoneSimulatorChunkData->end();) - { - if (dataitr->DataTwo) - { - dataitr = m_RedstoneSimulatorChunkData->erase(dataitr); - continue; - } - - switch (dataitr->Data) - { - case E_BLOCK_DAYLIGHT_SENSOR: HandleDaylightSensor(dataitr->x, dataitr->y, dataitr->z); break; - case E_BLOCK_TRIPWIRE: HandleTripwire(dataitr->x, dataitr->y, dataitr->z); break; - case E_BLOCK_TRIPWIRE_HOOK: HandleTripwireHook(dataitr->x, dataitr->y, dataitr->z); break; - - case E_BLOCK_WOODEN_PRESSURE_PLATE: - case E_BLOCK_STONE_PRESSURE_PLATE: - case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: - case E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE: - { - HandlePressurePlate(dataitr->x, dataitr->y, dataitr->z, dataitr->Data); - break; - } - default: break; - } - - if (ShouldUpdateSimulateOnceBlocks) - { - switch (dataitr->Data) - { - case E_BLOCK_REDSTONE_WIRE: HandleRedstoneWire(dataitr->x, dataitr->y, dataitr->z); break; - case E_BLOCK_COMMAND_BLOCK: HandleCommandBlock(dataitr->x, dataitr->y, dataitr->z); break; - case E_BLOCK_NOTE_BLOCK: HandleNoteBlock(dataitr->x, dataitr->y, dataitr->z); break; - case E_BLOCK_BLOCK_OF_REDSTONE: HandleRedstoneBlock(dataitr->x, dataitr->y, dataitr->z); break; - case E_BLOCK_LEVER: HandleRedstoneLever(dataitr->x, dataitr->y, dataitr->z); break; - case E_BLOCK_FENCE_GATE: HandleFenceGate(dataitr->x, dataitr->y, dataitr->z); break; - case E_BLOCK_TNT: HandleTNT(dataitr->x, dataitr->y, dataitr->z); break; - case E_BLOCK_TRAPDOOR: HandleTrapdoor(dataitr->x, dataitr->y, dataitr->z); break; - case E_BLOCK_TRAPPED_CHEST: HandleTrappedChest(dataitr->x, dataitr->y, dataitr->z); break; - - case E_BLOCK_ACTIVATOR_RAIL: - case E_BLOCK_DETECTOR_RAIL: - case E_BLOCK_POWERED_RAIL: - { - HandleRail(dataitr->x, dataitr->y, dataitr->z, dataitr->Data); - break; - } - case E_BLOCK_WOODEN_DOOR: - case E_BLOCK_IRON_DOOR: - { - HandleDoor(dataitr->x, dataitr->y, dataitr->z); - break; - } - case E_BLOCK_REDSTONE_LAMP_OFF: - case E_BLOCK_REDSTONE_LAMP_ON: - { - HandleRedstoneLamp(dataitr->x, dataitr->y, dataitr->z, dataitr->Data); - break; - } - case E_BLOCK_DISPENSER: - case E_BLOCK_DROPPER: - { - HandleDropSpenser(dataitr->x, dataitr->y, dataitr->z); - break; - } - case E_BLOCK_PISTON: - case E_BLOCK_STICKY_PISTON: - { - HandlePiston(dataitr->x, dataitr->y, dataitr->z); - break; - } - case E_BLOCK_REDSTONE_REPEATER_OFF: - case E_BLOCK_REDSTONE_REPEATER_ON: - { - HandleRedstoneRepeater(dataitr->x, dataitr->y, dataitr->z, dataitr->Data); - break; - } - case E_BLOCK_REDSTONE_TORCH_OFF: - case E_BLOCK_REDSTONE_TORCH_ON: - { - HandleRedstoneTorch(dataitr->x, dataitr->y, dataitr->z, dataitr->Data); - break; - } - case E_BLOCK_STONE_BUTTON: - case E_BLOCK_WOODEN_BUTTON: - { - HandleRedstoneButton(dataitr->x, dataitr->y, dataitr->z); - break; - } - default: break; - } - } - ++dataitr; - } -} - - - - -void cIncrementalRedstoneSimulator::WakeUp(int a_BlockX, int a_BlockY, int a_BlockZ, cChunk * a_Chunk) -{ - if (AreCoordsOnChunkBoundary(a_BlockX, a_BlockY, a_BlockZ)) - { - // On a chunk boundary, alert all four sides (i.e. at least one neighbouring chunk) - AddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk); - - // Pass the original coordinates, because when adding things to our simulator lists, we get the chunk that they are in, and therefore any updates need to preseve their position - // RedstoneAddBlock to pass both the neighbouring chunk and the chunk which the coordinates are in and +- 2 in GetNeighbour() to accomodate for LinkedPowered blocks being 2 away from chunk boundaries - RedstoneAddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX - 2, a_BlockZ), a_Chunk); - RedstoneAddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX + 2, a_BlockZ), a_Chunk); - RedstoneAddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX, a_BlockZ - 2), a_Chunk); - RedstoneAddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX, a_BlockZ + 2), a_Chunk); - - return; - } - - // Not on boundary, just alert this chunk for speed - AddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk); -} - - - - - -void cIncrementalRedstoneSimulator::HandleRedstoneTorch(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState) -{ - static const struct // Define which directions the torch can power - { - int x, y, z; - } gCrossCoords[] = - { - { 1, 0, 0}, - {-1, 0, 0}, - { 0, 0, 1}, - { 0, 0, -1}, - { 0, 1, 0}, - } ; - - if (a_MyState == E_BLOCK_REDSTONE_TORCH_ON) - { - // Check if the block the torch is on is powered - int X = a_RelBlockX; int Y = a_RelBlockY; int Z = a_RelBlockZ; - AddFaceDirection(X, Y, Z, cBlockTorchHandler::MetaDataToDirection(m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ)), true); // Inverse true to get the block torch is on - - cChunk * Neighbour = m_Chunk->GetRelNeighborChunk(X, Z); - if ((Neighbour == NULL) || !Neighbour->IsValid()) - { - return; - } - - if (AreCoordsDirectlyPowered(X, Y, Z, Neighbour)) - { - // There was a match, torch goes off - m_Chunk->SetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_BLOCK_REDSTONE_TORCH_OFF, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ)); - return; - } - - // Torch still on, make all 4(X, Z) + 1(Y) sides powered - for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++) - { - BLOCKTYPE Type = 0; - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, Type)) - { - continue; - } - if (i + 1 < ARRAYCOUNT(gCrossCoords)) // Sides of torch, not top (top is last) - { - if ( - IsMechanism(Type) && // Is it a mechanism? Not block/other torch etc. - (!Vector3i(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z).Equals(Vector3i(X, Y, Z))) // CAN'T power block is that it is on - ) - { - SetBlockPowered(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, a_RelBlockX, a_RelBlockY, a_RelBlockZ); - } - } - else - { - // Top side, power whatever is there, including blocks - SetBlockPowered(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, a_RelBlockX, a_RelBlockY, a_RelBlockZ); - // Power all blocks surrounding block above torch - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YP); - } - } - - if (m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) != 0x5) // Is torch standing on ground? If NOT (i.e. on wall), power block beneath - { - BLOCKTYPE Type = m_Chunk->GetBlock(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ); - - if (IsMechanism(Type)) // Still can't make a normal block powered though! - { - SetBlockPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ); - } - } - } - else - { - // Check if the block the torch is on is powered - int X = a_RelBlockX; int Y = a_RelBlockY; int Z = a_RelBlockZ; - AddFaceDirection(X, Y, Z, cBlockTorchHandler::MetaDataToDirection(m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ)), true); // Inverse true to get the block torch is on - - cChunk * Neighbour = m_Chunk->GetRelNeighborChunk(X, Z); - if ((Neighbour == NULL) || !Neighbour->IsValid()) - { - return; - } - - // See if off state torch can be turned on again - if (AreCoordsDirectlyPowered(X, Y, Z, Neighbour)) - { - return; // Something matches, torch still powered - } - - // Block torch on not powered, can be turned on again! - m_Chunk->SetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_BLOCK_REDSTONE_TORCH_ON, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ)); - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleRedstoneBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - SetBlockPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ); // Set self as powered -} - - - - - -void cIncrementalRedstoneSimulator::HandleRedstoneLever(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - NIBBLETYPE Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - if (IsLeverOn(Meta)) - { - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - - eBlockFace Dir = cBlockLeverHandler::BlockMetaDataToBlockFace(Meta); - - Dir = ReverseBlockFace(Dir); - - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, Dir); - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleFenceGate(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - NIBBLETYPE MetaData = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - - if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) - { - if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true)) - { - if ((MetaData & 0x4) == 0) - { - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, MetaData | 0x4); - m_Chunk->BroadcastSoundParticleEffect(1003, BlockX, a_RelBlockY, BlockZ, 0); - } - SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true); - } - } - else - { - if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false)) - { - if ((MetaData & 0x4) != 0) - { - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, MetaData & ~0x04); - m_Chunk->BroadcastSoundParticleEffect(1003, BlockX, a_RelBlockY, BlockZ, 0); - } - SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false); - } - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleRedstoneButton(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - NIBBLETYPE Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - if (IsButtonOn(Meta)) - { - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - - eBlockFace Dir = cBlockButtonHandler::BlockMetaDataToBlockFace(Meta); - Dir = ReverseBlockFace(Dir); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, Dir); - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleRedstoneWire(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - static const struct // Define which directions the wire can receive power from - { - int x, y, z; - } gCrossCoords[] = - { - { 1, 0, 0}, /* Wires on same level start */ - {-1, 0, 0}, - { 0, 0, 1}, - { 0, 0, -1}, /* Wires on same level stop */ - { 1, 1, 0}, /* Wires one higher, surrounding self start */ - {-1, 1, 0}, - { 0, 1, 1}, - { 0, 1, -1}, /* Wires one higher, surrounding self stop */ - { 1, -1, 0}, /* Wires one lower, surrounding self start */ - {-1, -1, 0}, - { 0, -1, 1}, - { 0, -1, -1}, /* Wires one lower, surrounding self stop */ - } ; - - static const struct // Define which directions the wire will check for repeater prescence - { - int x, y, z; - } gSideCoords[] = - { - { 1, 0, 0 }, - {-1, 0, 0 }, - { 0, 0, 1 }, - { 0, 0, -1 }, - { 0, 1, 0 }, - }; - - // Check to see if directly beside a power source - unsigned char MyPower; - if (!IsWirePowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower)) - { - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, 0); - m_World.WakeUpSimulators(BlockX, a_RelBlockY, BlockZ); - return; - } - - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - - if (MyPower < 1) - { - return; - } - - MyPower--; - - for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++) // Loop through all directions to transfer or receive power - { - if ((i >= 4) && (i <= 7)) // If we are currently checking for wire surrounding ourself one block above... - { - BLOCKTYPE Type = 0; - if (a_RelBlockY + 1 >= cChunkDef::Height) - { - continue; - } - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, Type)) - { - continue; - } - if (cBlockInfo::IsSolid(Type)) // If there is something solid above us (wire cut off)... - { - continue; // We don't receive power from that wire - } - } - else if ((i >= 8) && (i <= 11)) // See above, but this is for wire below us - { - BLOCKTYPE Type = 0; - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY, a_RelBlockZ + gCrossCoords[i].z, Type)) - { - continue; - } - if (cBlockInfo::IsSolid(Type)) - { - continue; - } - } - - BLOCKTYPE Type = 0; - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, Type)) - { - continue; - } - if (Type == E_BLOCK_REDSTONE_WIRE) - { - SetBlockPowered(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - } - } - - for (size_t i = 0; i < ARRAYCOUNT(gSideCoords); i++) // Look for repeaters immediately surrounding self and try to power them - { - BLOCKTYPE Type = 0; - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + gSideCoords[i].x, a_RelBlockY + gSideCoords[i].y, a_RelBlockZ + gSideCoords[i].z, Type)) - { - continue; - } - if (Type == E_BLOCK_REDSTONE_REPEATER_OFF) - { - SetBlockPowered(a_RelBlockX + gSideCoords[i].x, a_RelBlockY + gSideCoords[i].y, a_RelBlockZ + gSideCoords[i].z, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - } - } - - // Wire still powered, power blocks beneath - SetBlockPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YM, MyPower); - - switch (GetWireDirection(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) - { - case REDSTONE_NONE: - { - SetBlockPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - SetBlockPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - SetBlockPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - SetBlockPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_XM, MyPower); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_XP, MyPower); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_ZM, MyPower); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_ZP, MyPower); - break; - } - case REDSTONE_X_POS: - { - SetBlockPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_XP, MyPower); - break; - } - case REDSTONE_X_NEG: - { - SetBlockPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_XM, MyPower); - break; - } - case REDSTONE_Z_POS: - { - SetBlockPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_ZP, MyPower); - break; - } - case REDSTONE_Z_NEG: - { - SetBlockPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_ZM, MyPower); - break; - } - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleRedstoneRepeater(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState) +cRedstoneSimulator<cChunk, cWorld> * MakeIncrementalRedstoneSimulator(cWorld & a_World) { - /* Repeater Orientation Mini Guide: - =================================== - - | - | Z Axis - V - - X Axis ----> - - Repeater directions, values from a cWorld::GetBlockMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) lookup: - - East (Right) (X+): 0x1 - West (Left) (X-): 0x3 - North (Up) (Z-): 0x2 - South (Down) (Z+): 0x0 - // TODO: Add E_META_XXX enum entries for all meta values and update project with them - - Sun rises from East (X+) - - */ - - // Create a variable holding my meta to avoid multiple lookups. - NIBBLETYPE a_Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - bool IsOn = (a_MyState == E_BLOCK_REDSTONE_REPEATER_ON); - - if (!IsRepeaterLocked(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_Meta)) // If we're locked, change nothing. Otherwise: - { - bool IsSelfPowered = IsRepeaterPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_Meta); - if (IsSelfPowered && !IsOn) // Queue a power change if powered, but not on and not locked. - { - QueueRepeaterPowerChange(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_Meta, true); - } - else if (!IsSelfPowered && IsOn) // Queue a power change if unpowered, on, and not locked. - { - QueueRepeaterPowerChange(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_Meta, false); - } - } -} - -void cIncrementalRedstoneSimulator::HandleRedstoneRepeaterDelays() -{ - for (RepeatersDelayList::iterator itr = m_RepeatersDelayList->begin(); itr != m_RepeatersDelayList->end();) - { - if (itr->a_ElapsedTicks >= itr->a_DelayTicks) // Has the elapsed ticks reached the target ticks? - { - int RelBlockX = itr->a_RelBlockPos.x; - int RelBlockY = itr->a_RelBlockPos.y; - int RelBlockZ = itr->a_RelBlockPos.z; - BLOCKTYPE Block; - NIBBLETYPE Meta; - m_Chunk->GetBlockTypeMeta(RelBlockX, RelBlockY, RelBlockZ, Block, Meta); - if (itr->ShouldPowerOn) - { - if (Block != E_BLOCK_REDSTONE_REPEATER_ON) // For performance - { - m_Chunk->SetBlock(itr->a_RelBlockPos, E_BLOCK_REDSTONE_REPEATER_ON, Meta); - } - - switch (Meta & 0x3) // We only want the direction (bottom) bits - { - case 0x0: - { - SetBlockPowered(RelBlockX, RelBlockY, RelBlockZ - 1, RelBlockX, RelBlockY, RelBlockZ); - SetDirectionLinkedPowered(RelBlockX, RelBlockY, RelBlockZ, BLOCK_FACE_ZM); - break; - } - case 0x1: - { - SetBlockPowered(RelBlockX + 1, RelBlockY, RelBlockZ, RelBlockX, RelBlockY, RelBlockZ); - SetDirectionLinkedPowered(RelBlockX, RelBlockY, RelBlockZ, BLOCK_FACE_XP); - break; - } - case 0x2: - { - SetBlockPowered(RelBlockX, RelBlockY, RelBlockZ + 1, RelBlockX, RelBlockY, RelBlockZ); - SetDirectionLinkedPowered(RelBlockX, RelBlockY, RelBlockZ, BLOCK_FACE_ZP); - break; - } - case 0x3: - { - SetBlockPowered(RelBlockX - 1, RelBlockY, RelBlockZ, RelBlockX, RelBlockY, RelBlockZ); - SetDirectionLinkedPowered(RelBlockX, RelBlockY, RelBlockZ, BLOCK_FACE_XM); - break; - } - } - } - else if (Block != E_BLOCK_REDSTONE_REPEATER_OFF) - { - m_Chunk->SetBlock(RelBlockX, RelBlockY, RelBlockZ, E_BLOCK_REDSTONE_REPEATER_OFF, Meta); - } - itr = m_RepeatersDelayList->erase(itr); - } - else - { - LOGD("Incremented a repeater @ {%i %i %i} | Elapsed ticks: %i | Target delay: %i", itr->a_RelBlockPos.x, itr->a_RelBlockPos.y, itr->a_RelBlockPos.z, itr->a_ElapsedTicks, itr->a_DelayTicks); - itr->a_ElapsedTicks++; - itr++; - } - } + return new cIncrementalRedstoneSimulator<cChunk, cWorld, GetHandlerCompileTime, cChestEntity>(a_World); } - - - - -void cIncrementalRedstoneSimulator::HandlePiston(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - - if (IsPistonPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x7)) // We only want the bottom three bits (4th controls extended-ness) - { - cBlockPistonHandler::ExtendPiston(BlockX, a_RelBlockY, BlockZ, &m_World); - } - else - { - cBlockPistonHandler::RetractPiston(BlockX, a_RelBlockY, BlockZ, &m_World); - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleDropSpenser(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - class cSetPowerToDropSpenser : - public cDropSpenserCallback - { - bool m_IsPowered; - public: - cSetPowerToDropSpenser(bool a_IsPowered) : m_IsPowered(a_IsPowered) {} - - virtual bool Item(cDropSpenserEntity * a_DropSpenser) override - { - a_DropSpenser->SetRedstonePower(m_IsPowered); - return false; - } - } DrSpSP (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)); - - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - m_Chunk->DoWithDropSpenserAt(BlockX, a_RelBlockY, BlockZ, DrSpSP); -} - - - - - -void cIncrementalRedstoneSimulator::HandleRedstoneLamp(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState) -{ - if (a_MyState == E_BLOCK_REDSTONE_LAMP_OFF) - { - if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) - { - m_Chunk->SetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_BLOCK_REDSTONE_LAMP_ON, 0); - } - } - else - { - if (!AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) - { - m_Chunk->SetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_BLOCK_REDSTONE_LAMP_OFF, 0); - } - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleTNT(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - - if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) - { - m_Chunk->BroadcastSoundEffect("game.tnt.primed", (double)BlockX, (double)a_RelBlockY, (double)BlockZ, 0.5f, 0.6f); - m_Chunk->SetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_BLOCK_AIR, 0); - m_World.SpawnPrimedTNT(BlockX + 0.5, a_RelBlockY + 0.5, BlockZ + 0.5); // 80 ticks to boom - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleDoor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - - if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) - { - if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true)) - { - cChunkInterface ChunkInterface(m_World.GetChunkMap()); - if (!cBlockDoorHandler::IsOpen(ChunkInterface, BlockX, a_RelBlockY, BlockZ)) - { - cBlockDoorHandler::SetOpen(ChunkInterface, BlockX, a_RelBlockY, BlockZ, true); - m_Chunk->BroadcastSoundParticleEffect(1003, BlockX, a_RelBlockY, BlockZ, 0); - } - SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true); - } - } - else - { - if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false)) - { - cChunkInterface ChunkInterface(m_World.GetChunkMap()); - if (cBlockDoorHandler::IsOpen(ChunkInterface, BlockX, a_RelBlockY, BlockZ)) - { - cBlockDoorHandler::SetOpen(ChunkInterface, BlockX, a_RelBlockY, BlockZ, false); - m_Chunk->BroadcastSoundParticleEffect(1003, BlockX, a_RelBlockY, BlockZ, 0); - } - SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false); - } - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleCommandBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - class cSetPowerToCommandBlock : - public cCommandBlockCallback - { - bool m_IsPowered; - public: - cSetPowerToCommandBlock(bool a_IsPowered) : m_IsPowered(a_IsPowered) {} - - virtual bool Item(cCommandBlockEntity * a_CommandBlock) override - { - a_CommandBlock->SetRedstonePower(m_IsPowered); - return false; - } - } CmdBlockSP (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)); - - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - m_Chunk->DoWithCommandBlockAt(BlockX, a_RelBlockY, BlockZ, CmdBlockSP); -} - - - - - -void cIncrementalRedstoneSimulator::HandleRail(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyType) -{ - switch (a_MyType) - { - case E_BLOCK_DETECTOR_RAIL: - { - if ((m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x08) == 0x08) - { - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_MyType); - } - break; - } - case E_BLOCK_ACTIVATOR_RAIL: - case E_BLOCK_POWERED_RAIL: - { - if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) - { - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) | 0x08); - } - else - { - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x07); - } - break; - } - default: LOGD("Unhandled type of rail in %s", __FUNCTION__); - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleTrapdoor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - - if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) - { - if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true)) - { - m_World.SetTrapdoorOpen(BlockX, a_RelBlockY, BlockZ, true); - SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true); - } - } - else - { - if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false)) - { - m_World.SetTrapdoorOpen(BlockX, a_RelBlockY, BlockZ, false); - SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false); - } - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleNoteBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - bool m_bAreCoordsPowered = AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - - if (m_bAreCoordsPowered) - { - if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true)) - { - class cSetPowerToNoteBlock : - public cNoteBlockCallback - { - bool m_IsPowered; - public: - cSetPowerToNoteBlock(bool a_IsPowered) : m_IsPowered(a_IsPowered) {} - - virtual bool Item(cNoteEntity * a_NoteBlock) override - { - if (m_IsPowered) - { - a_NoteBlock->MakeSound(); - } - return false; - } - } NoteBlockSP(m_bAreCoordsPowered); - - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - m_Chunk->DoWithNoteBlockAt(BlockX, a_RelBlockY, BlockZ, NoteBlockSP); - SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true); - } - } - else - { - if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false)) - { - SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false); - } - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleDaylightSensor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX, BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - int ChunkX, ChunkZ; - cChunkDef::BlockToChunk(BlockX, BlockZ, ChunkX, ChunkZ); - - if (!m_World.IsChunkLighted(ChunkX, ChunkZ)) - { - m_World.QueueLightChunk(ChunkX, ChunkZ); - } - else - { - if (m_Chunk->GetTimeAlteredLight(m_World.GetBlockSkyLight(BlockX, a_RelBlockY + 1, BlockZ)) > 8) - { - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - } - else - { - WakeUp(BlockX, a_RelBlockY, BlockZ, m_Chunk); - } - } -} - - - - - -void cIncrementalRedstoneSimulator::HandlePressurePlate(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyType) -{ - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - - switch (a_MyType) - { - case E_BLOCK_STONE_PRESSURE_PLATE: - { - // MCS feature - stone pressure plates can only be triggered by players :D - cPlayer * a_Player = m_World.FindClosestPlayer(Vector3f(BlockX + 0.5f, (float)a_RelBlockY, BlockZ + 0.5f), 0.5f, false); - - if (a_Player != NULL) - { - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, 0x1); - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YM, a_MyType); - } - else - { - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, 0x0); - SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); - } - break; - } - case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: - { - class cPressurePlateCallback : - public cEntityCallback - { - public: - cPressurePlateCallback(int a_BlockX, int a_BlockY, int a_BlockZ) : - m_NumberOfEntities(0), - m_X(a_BlockX), - m_Y(a_BlockY), - m_Z(a_BlockZ) - { - } - - virtual bool Item(cEntity * a_Entity) override - { - Vector3f EntityPos = a_Entity->GetPosition(); - Vector3f BlockPos(m_X + 0.5f, (float)m_Y, m_Z + 0.5f); - double Distance = (EntityPos - BlockPos).Length(); - - if (Distance <= 0.5) - { - m_NumberOfEntities++; - } - return false; - } - - bool GetPowerLevel(unsigned char & a_PowerLevel) const - { - a_PowerLevel = std::min(m_NumberOfEntities, MAX_POWER_LEVEL); - return (a_PowerLevel > 0); - } - - protected: - int m_NumberOfEntities; - - int m_X; - int m_Y; - int m_Z; - }; - - cPressurePlateCallback PressurePlateCallback(BlockX, a_RelBlockY, BlockZ); - m_World.ForEachEntityInChunk(m_Chunk->GetPosX(), m_Chunk->GetPosZ(), PressurePlateCallback); - - unsigned char Power; - NIBBLETYPE Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - if (PressurePlateCallback.GetPowerLevel(Power)) - { - if (Meta == E_META_PRESSURE_PLATE_RAISED) - { - m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.5F); - } - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_DEPRESSED); - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, Power); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YM, a_MyType); - } - else - { - if (Meta == E_META_PRESSURE_PLATE_DEPRESSED) - { - m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.6F); - } - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_RAISED); - SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); - } - - break; - } - case E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE: - { - class cPressurePlateCallback : - public cEntityCallback - { - public: - cPressurePlateCallback(int a_BlockX, int a_BlockY, int a_BlockZ) : - m_NumberOfEntities(0), - m_X(a_BlockX), - m_Y(a_BlockY), - m_Z(a_BlockZ) - { - } - - virtual bool Item(cEntity * a_Entity) override - { - Vector3f EntityPos = a_Entity->GetPosition(); - Vector3f BlockPos(m_X + 0.5f, (float)m_Y, m_Z + 0.5f); - double Distance = (EntityPos - BlockPos).Length(); - - if (Distance <= 0.5) - { - m_NumberOfEntities++; - } - return false; - } - - bool GetPowerLevel(unsigned char & a_PowerLevel) const - { - a_PowerLevel = std::min((int)ceil(m_NumberOfEntities / 10.f), MAX_POWER_LEVEL); - return (a_PowerLevel > 0); - } - - protected: - int m_NumberOfEntities; - - int m_X; - int m_Y; - int m_Z; - }; - - cPressurePlateCallback PressurePlateCallback(BlockX, a_RelBlockY, BlockZ); - m_World.ForEachEntityInChunk(m_Chunk->GetPosX(), m_Chunk->GetPosZ(), PressurePlateCallback); - - unsigned char Power; - NIBBLETYPE Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - if (PressurePlateCallback.GetPowerLevel(Power)) - { - if (Meta == E_META_PRESSURE_PLATE_RAISED) - { - m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.5F); - } - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_DEPRESSED); - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, Power); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YM, a_MyType); - } - else - { - if (Meta == E_META_PRESSURE_PLATE_DEPRESSED) - { - m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.6F); - } - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_RAISED); - SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); - } - - break; - } - case E_BLOCK_WOODEN_PRESSURE_PLATE: - { - class cPressurePlateCallback : - public cEntityCallback - { - public: - cPressurePlateCallback(int a_BlockX, int a_BlockY, int a_BlockZ) : - m_FoundEntity(false), - m_X(a_BlockX), - m_Y(a_BlockY), - m_Z(a_BlockZ) - { - } - - virtual bool Item(cEntity * a_Entity) override - { - Vector3f EntityPos = a_Entity->GetPosition(); - Vector3f BlockPos(m_X + 0.5f, (float)m_Y, m_Z + 0.5f); - double Distance = (EntityPos - BlockPos).Length(); - - if (Distance <= 0.5) - { - m_FoundEntity = true; - return true; // Break out, we only need to know for plates that at least one entity is on top - } - return false; - } - - bool FoundEntity(void) const - { - return m_FoundEntity; - } - - protected: - bool m_FoundEntity; - - int m_X; - int m_Y; - int m_Z; - } ; - - cPressurePlateCallback PressurePlateCallback(BlockX, a_RelBlockY, BlockZ); - m_World.ForEachEntityInChunk(m_Chunk->GetPosX(), m_Chunk->GetPosZ(), PressurePlateCallback); - - NIBBLETYPE Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - if (PressurePlateCallback.FoundEntity()) - { - if (Meta == E_META_PRESSURE_PLATE_RAISED) - { - m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.5F); - } - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_DEPRESSED); - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YM, a_MyType); - } - else - { - if (Meta == E_META_PRESSURE_PLATE_DEPRESSED) - { - m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.6F); - } - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_RAISED); - SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); - } - break; - } - default: - { - LOGD("Unimplemented pressure plate type %s in cRedstoneSimulator", ItemToFullString(a_MyType).c_str()); - break; - } - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleTripwireHook(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - int BlockX = m_Chunk->GetPosX() * cChunkDef::Width + a_RelBlockX; - int BlockZ = m_Chunk->GetPosZ() * cChunkDef::Width + a_RelBlockZ; - int RelX = a_RelBlockX, RelZ = a_RelBlockZ; - bool FoundActivated = false; - eBlockFace FaceToGoTowards = cBlockTripwireHookHandler::MetadataToDirection(m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ)); - - for (int i = 0; i < 40; ++i) // Tripwires can be connected up to 40 blocks - { - BLOCKTYPE Type; - NIBBLETYPE Meta; - - AddFaceDirection(RelX, a_RelBlockY, RelZ, FaceToGoTowards); - m_Chunk->UnboundedRelGetBlock(RelX, a_RelBlockY, RelZ, Type, Meta); - - if (Type == E_BLOCK_TRIPWIRE) - { - if (Meta == 0x1) - { - FoundActivated = true; - } - } - else if (Type == E_BLOCK_TRIPWIRE_HOOK) - { - if (ReverseBlockFace(cBlockTripwireHookHandler::MetadataToDirection(Meta)) == FaceToGoTowards) - { - // Other hook facing in opposite direction - circuit completed! - break; - } - else - { - // Tripwire hook not connected at all, AND away all the power state bits - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x3); - SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); - return; - } - } - else - { - // Tripwire hook not connected at all, AND away all the power state bits - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x3); - SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); - return; - } - } - - if (FoundActivated) - { - // Connected and activated, set the 3rd and 4th highest bits - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) | 0xC); - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - } - else - { - // Connected but not activated, AND away the highest bit - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, (m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x7) | 0x4); - SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleTrappedChest(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - class cGetTrappedChestPlayers : - public cChestCallback - { - public: - cGetTrappedChestPlayers(void) : - m_NumberOfPlayers(0) - { - } - - virtual bool Item(cChestEntity * a_Chest) override - { - ASSERT(a_Chest->GetBlockType() == E_BLOCK_TRAPPED_CHEST); - m_NumberOfPlayers = a_Chest->GetNumberOfPlayers(); - return (m_NumberOfPlayers <= 0); - } - - unsigned char GetPowerLevel(void) const - { - return std::min(m_NumberOfPlayers, MAX_POWER_LEVEL); - } - - private: - int m_NumberOfPlayers; - - } GTCP; - - int BlockX = m_Chunk->GetPosX() * cChunkDef::Width + a_RelBlockX; - int BlockZ = m_Chunk->GetPosZ() * cChunkDef::Width + a_RelBlockZ; - if (m_Chunk->DoWithChestAt(BlockX, a_RelBlockY, BlockZ, GTCP)) - { - SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, GTCP.GetPowerLevel()); - } - else - { - SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); - } -} - - - - - -void cIncrementalRedstoneSimulator::HandleTripwire(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - int BlockX = m_Chunk->GetPosX() * cChunkDef::Width + a_RelBlockX; - int BlockZ = m_Chunk->GetPosZ() * cChunkDef::Width + a_RelBlockZ; - - class cTripwireCallback : - public cEntityCallback - { - public: - cTripwireCallback(int a_BlockX, int a_BlockY, int a_BlockZ) : - m_FoundEntity(false), - m_X(a_BlockX), - m_Y(a_BlockY), - m_Z(a_BlockZ) - { - } - - virtual bool Item(cEntity * a_Entity) override - { - cBoundingBox bbWire(m_X, m_X + 1, m_Y, m_Y + 0.1, m_Z, m_Z + 1); - cBoundingBox bbEntity(a_Entity->GetPosition(), a_Entity->GetWidth() / 2, a_Entity->GetHeight()); - - if (bbEntity.DoesIntersect(bbWire)) - { - m_FoundEntity = true; - return true; // One entity is sufficient to trigger the wire - } - return false; - } - - bool FoundEntity(void) const - { - return m_FoundEntity; - } - - protected: - bool m_FoundEntity; - - int m_X; - int m_Y; - int m_Z; - }; - - cTripwireCallback TripwireCallback(BlockX, a_RelBlockY, BlockZ); - m_World.ForEachEntityInChunk(m_Chunk->GetPosX(), m_Chunk->GetPosZ(), TripwireCallback); - - if (TripwireCallback.FoundEntity()) - { - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, 0x1); - } - else - { - m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, 0x0); - } -} - - - - - -bool cIncrementalRedstoneSimulator::AreCoordsDirectlyPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, cChunk * a_Chunk) -{ - // Torches want to access neighbour's data when on a wall, hence the extra chunk parameter - - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - - for (PoweredBlocksList::const_iterator itr = a_Chunk->GetRedstoneSimulatorPoweredBlocksList()->begin(); itr != a_Chunk->GetRedstoneSimulatorPoweredBlocksList()->end(); ++itr) // Check powered list - { - if (itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) - { - return true; - } - } - return false; -} - - - - - -bool cIncrementalRedstoneSimulator::AreCoordsLinkedPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - - for (LinkedBlocksList::const_iterator itr = m_LinkedPoweredBlocks->begin(); itr != m_LinkedPoweredBlocks->end(); ++itr) // Check linked powered list - { - if (itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) - { - return true; - } - } - return false; -} - - - - - -bool cIncrementalRedstoneSimulator::IsRepeaterPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta) -{ - // Repeaters cannot be powered by any face except their back; verify that this is true for a source - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - - for (PoweredBlocksList::const_iterator itr = m_PoweredBlocks->begin(); itr != m_PoweredBlocks->end(); ++itr) - { - if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) { continue; } - - switch (a_Meta & 0x3) - { - case 0x0: - { - // Flip the coords to check the back of the repeater - if (itr->a_SourcePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ + 1))) { return true; } - break; - } - case 0x1: - { - if (itr->a_SourcePos.Equals(Vector3i(BlockX - 1, a_RelBlockY, BlockZ))) { return true; } - break; - } - case 0x2: - { - if (itr->a_SourcePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ - 1))) { return true; } - break; - } - case 0x3: - { - if (itr->a_SourcePos.Equals(Vector3i(BlockX + 1, a_RelBlockY, BlockZ))) { return true; } - break; - } - } - } - - for (LinkedBlocksList::const_iterator itr = m_LinkedPoweredBlocks->begin(); itr != m_LinkedPoweredBlocks->end(); ++itr) - { - if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) { continue; } - - switch (a_Meta & 0x3) - { - case 0x0: - { - if (itr->a_MiddlePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ + 1))) { return true; } - break; - } - case 0x1: - { - if (itr->a_MiddlePos.Equals(Vector3i(BlockX - 1, a_RelBlockY, BlockZ))) { return true; } - break; - } - case 0x2: - { - if (itr->a_MiddlePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ - 1))) { return true; } - break; - } - case 0x3: - { - if (itr->a_MiddlePos.Equals(Vector3i(BlockX + 1, a_RelBlockY, BlockZ))) { return true; } - break; - } - } - } - return false; // Couldn't find power source behind repeater -} - - - - - -bool cIncrementalRedstoneSimulator::IsRepeaterLocked(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta) -{ - switch (a_Meta & 0x3) // We only want the 'direction' part of our metadata - { - // If the repeater is looking up or down (If parallel to the Z axis) - case 0x0: - case 0x2: - { - // Check if eastern(right) neighbor is a powered on repeater who is facing us - BLOCKTYPE Block = 0; - if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, Block) && (Block == E_BLOCK_REDSTONE_REPEATER_ON)) // Is right neighbor a powered repeater? - { - NIBBLETYPE OtherRepeaterDir = m_Chunk->GetMeta(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ) & 0x3; - if (OtherRepeaterDir == 0x3) { return true; } // If so, I am latched/locked - } - - // Check if western(left) neighbor is a powered on repeater who is facing us - if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, Block) && (Block == E_BLOCK_REDSTONE_REPEATER_ON)) - { - NIBBLETYPE OtherRepeaterDir = m_Chunk->GetMeta(a_RelBlockX -1, a_RelBlockY, a_RelBlockZ) & 0x3; - if (OtherRepeaterDir == 0x1) { return true; } // If so, I am latched/locked - } - - break; - } - - // If the repeater is looking left or right (If parallel to the x axis) - case 0x1: - case 0x3: - { - // Check if southern(down) neighbor is a powered on repeater who is facing us - BLOCKTYPE Block = 0; - if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, Block) && (Block == E_BLOCK_REDSTONE_REPEATER_ON)) - { - NIBBLETYPE OtherRepeaterDir = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1) & 0x3; - if (OtherRepeaterDir == 0x0) { return true; } // If so, am latched/locked - } - - // Check if northern(up) neighbor is a powered on repeater who is facing us - if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, Block) && (Block == E_BLOCK_REDSTONE_REPEATER_ON)) - { - NIBBLETYPE OtherRepeaterDir = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1) & 0x3; - if (OtherRepeaterDir == 0x2) { return true; } // If so, I am latched/locked - } - - break; - } - } - - return false; // None of the checks succeeded, I am not a locked repeater -} - - - - -bool cIncrementalRedstoneSimulator::IsPistonPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta) -{ - // Pistons cannot be powered through their front face; this function verifies that a source meets this requirement - - eBlockFace Face = cBlockPistonHandler::MetaDataToDirection(a_Meta); - int BlockX = m_Chunk->GetPosX() * cChunkDef::Width + a_RelBlockX; - int BlockZ = m_Chunk->GetPosZ() * cChunkDef::Width + a_RelBlockZ; - - for (PoweredBlocksList::const_iterator itr = m_PoweredBlocks->begin(); itr != m_PoweredBlocks->end(); ++itr) - { - if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) { continue; } - - AddFaceDirection(BlockX, a_RelBlockY, BlockZ, Face); - - if (!itr->a_SourcePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) - { - return true; - } - - AddFaceDirection(BlockX, a_RelBlockY, BlockZ, Face, true); - } - - for (LinkedBlocksList::const_iterator itr = m_LinkedPoweredBlocks->begin(); itr != m_LinkedPoweredBlocks->end(); ++itr) - { - if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) { continue; } - - AddFaceDirection(BlockX, a_RelBlockY, BlockZ, Face); - - if (!itr->a_MiddlePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) - { - return true; - } - - AddFaceDirection(BlockX, a_RelBlockY, BlockZ, Face, true); - } - return false; // Source was in front of the piston's front face -} - - - - -bool cIncrementalRedstoneSimulator::IsWirePowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, unsigned char & a_PowerLevel) -{ - a_PowerLevel = 0; - int BlockX = m_Chunk->GetPosX() * cChunkDef::Width + a_RelBlockX; - int BlockZ = m_Chunk->GetPosZ() * cChunkDef::Width + a_RelBlockZ; - - for (PoweredBlocksList::const_iterator itr = m_PoweredBlocks->begin(); itr != m_PoweredBlocks->end(); ++itr) // Check powered list - { - if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) - { - continue; - } - a_PowerLevel = std::max(itr->a_PowerLevel, a_PowerLevel); // Get the highest power level (a_PowerLevel is initialised already and there CAN be multiple levels for one block) - } - - for (LinkedBlocksList::const_iterator itr = m_LinkedPoweredBlocks->begin(); itr != m_LinkedPoweredBlocks->end(); ++itr) // Check linked powered list - { - if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) - { - continue; - } - - BLOCKTYPE Type = E_BLOCK_AIR; - int RelSourceX = itr->a_SourcePos.x - m_Chunk->GetPosX() * cChunkDef::Width; - int RelSourceZ = itr->a_SourcePos.z - m_Chunk->GetPosZ() * cChunkDef::Width; - if (!m_Chunk->UnboundedRelGetBlockType(RelSourceX, itr->a_SourcePos.y, RelSourceZ, Type) || (Type == E_BLOCK_REDSTONE_WIRE)) - { - continue; - } - a_PowerLevel = std::max(itr->a_PowerLevel, a_PowerLevel); - } - - return (a_PowerLevel != 0); // Answer the inital question: is the wire powered? -} - - - - - -bool cIncrementalRedstoneSimulator::AreCoordsSimulated(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, bool IsCurrentStatePowered) -{ - for (SimulatedPlayerToggleableList::const_iterator itr = m_SimulatedPlayerToggleableBlocks->begin(); itr != m_SimulatedPlayerToggleableBlocks->end(); ++itr) - { - if (itr->a_RelBlockPos.Equals(Vector3i(a_RelBlockX, a_RelBlockY, a_RelBlockZ))) - { - if (itr->WasLastStatePowered != IsCurrentStatePowered) // Was the last power state different to the current? - { - return false; // It was, coordinates are no longer simulated - } - else - { - return true; // It wasn't, don't resimulate block, and allow players to toggle - } - } - } - return false; // Block wasn't even in the list, not simulated -} - - - - - -void cIncrementalRedstoneSimulator::SetDirectionLinkedPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, char a_Direction, unsigned char a_PowerLevel) -{ - BLOCKTYPE MiddleBlock = 0; - switch (a_Direction) - { - case BLOCK_FACE_XM: - { - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, MiddleBlock)) - { - return; - } - - SetBlockLinkedPowered(a_RelBlockX - 2, a_RelBlockY, a_RelBlockZ, a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - - break; - } - case BLOCK_FACE_XP: - { - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, MiddleBlock)) - { - return; - } - - SetBlockLinkedPowered(a_RelBlockX + 2, a_RelBlockY, a_RelBlockZ, a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - - break; - } - case BLOCK_FACE_YM: - { - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, MiddleBlock)) - { - return; - } - - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY - 2, a_RelBlockZ, a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - - break; - } - case BLOCK_FACE_YP: - { - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, MiddleBlock)) - { - return; - } - - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY + 2, a_RelBlockZ, a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - - break; - } - case BLOCK_FACE_ZM: - { - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, MiddleBlock)) - { - return; - } - - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 2, a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - - break; - } - case BLOCK_FACE_ZP: - { - if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, MiddleBlock)) - { - return; - } - - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 2, a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); - - break; - } - default: - { - ASSERT(!"Unhandled face direction when attempting to set blocks as linked powered!"); // Zombies, that wasn't supposed to happen... - break; - } - } -} - - - - - -void cIncrementalRedstoneSimulator::SetAllDirsAsPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, unsigned char a_PowerLevel) -{ - static const struct - { - int x, y, z; - } gCrossCoords[] = - { - { 1, 0, 0 }, - { -1, 0, 0 }, - { 0, 0, 1 }, - { 0, 0, -1 }, - { 0, 1, 0 }, - { 0, -1, 0 } - }; - - for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++) // Loop through struct to power all directions - { - SetBlockPowered(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_PowerLevel); - } -} - - - - - -void cIncrementalRedstoneSimulator::SetBlockPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, int a_RelSourceX, int a_RelSourceY, int a_RelSourceZ, unsigned char a_PowerLevel) -{ - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - int SourceX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelSourceX; - int SourceZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelSourceZ; - - cChunk * Neighbour = m_Chunk->GetRelNeighborChunkAdjustCoords(a_RelBlockX, a_RelBlockZ); // Adjust coordinates for the later call using these values - if ((Neighbour == NULL) || !Neighbour->IsValid()) - { - return; - } - - PoweredBlocksList * Powered = Neighbour->GetRedstoneSimulatorPoweredBlocksList(); // We need to insert the value into the chunk who owns the block position - for (PoweredBlocksList::iterator itr = Powered->begin(); itr != Powered->end(); ++itr) - { - if ( - itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ)) && - itr->a_SourcePos.Equals(Vector3i(SourceX, a_RelSourceY, SourceZ)) - ) - { - // Check for duplicates, update power level, don't add a new listing - itr->a_PowerLevel = a_PowerLevel; - return; - } - } - - // No need to get neighbouring chunk as we can guarantee that when something is powering us, the entry will be in our chunk - // TODO: on C++11 support, change this to a llama function pased to a std::remove_if - for (PoweredBlocksList::iterator itr = m_PoweredBlocks->begin(); itr != m_PoweredBlocks->end(); ++itr) - { - if ( - itr->a_BlockPos.Equals(Vector3i(SourceX, a_RelSourceY, SourceZ)) && - itr->a_SourcePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ)) && - (m_Chunk->GetBlock(a_RelSourceX, a_RelSourceY, a_RelSourceZ) == E_BLOCK_REDSTONE_WIRE) - ) - { - BLOCKTYPE Block; - NIBBLETYPE Meta; - Neighbour->GetBlockTypeMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, Block, Meta); - - if (Block == E_BLOCK_REDSTONE_WIRE) - { - if (Meta < a_PowerLevel) - { - m_PoweredBlocks->erase(itr); // Powering source with higher power level, allow it - break; - } - else - { - // Powered wires try to power their source - don't let them! - return; - } - } - } - } - - sPoweredBlocks RC; - RC.a_BlockPos = Vector3i(BlockX, a_RelBlockY, BlockZ); - RC.a_SourcePos = Vector3i(SourceX, a_RelSourceY, SourceZ); - RC.a_PowerLevel = a_PowerLevel; - Powered->push_back(RC); - Neighbour->SetIsRedstoneDirty(true); - m_Chunk->SetIsRedstoneDirty(true); -} - - - - - -void cIncrementalRedstoneSimulator::SetBlockLinkedPowered( - int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, - int a_RelMiddleX, int a_RelMiddleY, int a_RelMiddleZ, - int a_RelSourceX, int a_RelSourceY, int a_RelSourceZ, - BLOCKTYPE a_MiddleBlock, unsigned char a_PowerLevel - ) -{ - int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; - int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; - int MiddleX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelMiddleX; - int MiddleZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelMiddleZ; - int SourceX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelSourceX; - int SourceZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelSourceZ; - - if (!IsViableMiddleBlock(a_MiddleBlock)) - { - return; - } - - cChunk * Neighbour = m_Chunk->GetNeighborChunk(BlockX, BlockZ); - if ((Neighbour == NULL) || !Neighbour->IsValid()) - { - return; - } - - LinkedBlocksList * Linked = Neighbour->GetRedstoneSimulatorLinkedBlocksList(); - for (LinkedBlocksList::iterator itr = Linked->begin(); itr != Linked->end(); ++itr) // Check linked powered list - { - if ( - itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ)) && - itr->a_MiddlePos.Equals(Vector3i(MiddleX, a_RelMiddleY, MiddleZ)) && - itr->a_SourcePos.Equals(Vector3i(SourceX, a_RelSourceY, SourceZ)) - ) - { - // Check for duplicates, update power level, don't add a new listing - itr->a_PowerLevel = a_PowerLevel; - return; - } - } - - sLinkedPoweredBlocks RC; - RC.a_BlockPos = Vector3i(BlockX, a_RelBlockY, BlockZ); - RC.a_MiddlePos = Vector3i(MiddleX, a_RelMiddleY, MiddleZ); - RC.a_SourcePos = Vector3i(SourceX, a_RelSourceY, SourceZ); - RC.a_PowerLevel = a_PowerLevel; - Linked->push_back(RC); - Neighbour->SetIsRedstoneDirty(true); - m_Chunk->SetIsRedstoneDirty(true); -} - - - - - -void cIncrementalRedstoneSimulator::SetPlayerToggleableBlockAsSimulated(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, bool WasLastStatePowered) -{ - for (SimulatedPlayerToggleableList::iterator itr = m_SimulatedPlayerToggleableBlocks->begin(); itr != m_SimulatedPlayerToggleableBlocks->end(); ++itr) - { - if (!itr->a_RelBlockPos.Equals(Vector3i(a_RelBlockX, a_RelBlockY, a_RelBlockZ))) - { - continue; - } - - if (itr->WasLastStatePowered != WasLastStatePowered) - { - // If power states different, update listing - itr->WasLastStatePowered = WasLastStatePowered; - return; - } - else - { - // If states the same, just ignore - return; - } - } - - // We have arrive here; no block must be in list - add one - sSimulatedPlayerToggleableList RC; - RC.a_RelBlockPos = Vector3i(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - RC.WasLastStatePowered = WasLastStatePowered; - m_SimulatedPlayerToggleableBlocks->push_back(RC); -} - - - - - -bool cIncrementalRedstoneSimulator::QueueRepeaterPowerChange(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta, bool ShouldPowerOn) -{ - for (RepeatersDelayList::iterator itr = m_RepeatersDelayList->begin(); itr != m_RepeatersDelayList->end(); ++itr) - { - if (itr->a_RelBlockPos.Equals(Vector3i(a_RelBlockX, a_RelBlockY, a_RelBlockZ))) - { - if (ShouldPowerOn == itr->ShouldPowerOn) // We are queued already for the same thing, don't replace entry - { - return false; - } - - // Already in here (normal to allow repeater to continue on powering and updating blocks in front) - just update info and quit - itr->a_DelayTicks = (((a_Meta & 0xC) >> 0x2) + 1) * 2; // See below for description - itr->a_ElapsedTicks = 0; - itr->ShouldPowerOn = ShouldPowerOn; - return false; - } - } - - // Self not in list, add self to list - sRepeatersDelayList RC; - RC.a_RelBlockPos = Vector3i(a_RelBlockX, a_RelBlockY, a_RelBlockZ); - - // Gets the top two bits (delay time), shifts them into the lower two bits, and adds one (meta 0 = 1 tick; 1 = 2 etc.) - // Multiply by 2 because in MCS, 1 redstone tick = 1 world tick, but in Vanilla, 1 redstone tick = 2 world ticks, and we need to maintain compatibility - RC.a_DelayTicks = (((a_Meta & 0xC) >> 0x2) + 1) * 2; - - RC.a_ElapsedTicks = 0; - RC.ShouldPowerOn = ShouldPowerOn; - m_RepeatersDelayList->push_back(RC); - return true; -} - - - - - -void cIncrementalRedstoneSimulator::SetSourceUnpowered(int a_SourceX, int a_SourceY, int a_SourceZ, cChunk * a_Chunk, bool a_IsFirstCall) -{ - if (!a_IsFirstCall) // The neighbouring chunks passed when this parameter is false may be invalid - { - if ((a_Chunk == NULL) || !a_Chunk->IsValid()) - { - return; - } - } - // TODO: on C++11 support, change both of these to llama functions pased to a std::remove_if - - for (PoweredBlocksList::iterator itr = a_Chunk->GetRedstoneSimulatorPoweredBlocksList()->begin(); itr != a_Chunk->GetRedstoneSimulatorPoweredBlocksList()->end();) - { - if (itr->a_SourcePos.Equals(Vector3i(a_SourceX, a_SourceY, a_SourceZ))) - { - itr = a_Chunk->GetRedstoneSimulatorPoweredBlocksList()->erase(itr); - a_Chunk->SetIsRedstoneDirty(true); - continue; - } - ++itr; - } - for (LinkedBlocksList::iterator itr = a_Chunk->GetRedstoneSimulatorLinkedBlocksList()->begin(); itr != a_Chunk->GetRedstoneSimulatorLinkedBlocksList()->end();) - { - if (itr->a_SourcePos.Equals(Vector3i(a_SourceX, a_SourceY, a_SourceZ))) - { - itr = a_Chunk->GetRedstoneSimulatorLinkedBlocksList()->erase(itr); - a_Chunk->SetIsRedstoneDirty(true); - continue; - } - ++itr; - } - - if (a_IsFirstCall && AreCoordsOnChunkBoundary(a_SourceX, a_SourceY, a_SourceZ)) - { - // +- 2 to accomodate linked powered blocks - SetSourceUnpowered(a_SourceX, a_SourceY, a_SourceZ, a_Chunk->GetNeighborChunk(a_SourceX - 2, a_SourceZ), false); - SetSourceUnpowered(a_SourceX, a_SourceY, a_SourceZ, a_Chunk->GetNeighborChunk(a_SourceX + 2, a_SourceZ), false); - SetSourceUnpowered(a_SourceX, a_SourceY, a_SourceZ, a_Chunk->GetNeighborChunk(a_SourceX, a_SourceZ - 2), false); - SetSourceUnpowered(a_SourceX, a_SourceY, a_SourceZ, a_Chunk->GetNeighborChunk(a_SourceX, a_SourceZ + 2), false); - } -} - - - - - -cIncrementalRedstoneSimulator::eRedstoneDirection cIncrementalRedstoneSimulator::GetWireDirection(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) -{ - int Dir = REDSTONE_NONE; - - BLOCKTYPE NegX = 0; - if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, NegX)) - { - if (IsPotentialSource(NegX)) - { - Dir |= (REDSTONE_X_POS); - } - } - - BLOCKTYPE PosX = 0; - if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, PosX)) - { - if (IsPotentialSource(PosX)) - { - Dir |= (REDSTONE_X_NEG); - } - } - - BLOCKTYPE NegZ = 0; - if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, NegZ)) - { - if (IsPotentialSource(NegZ)) - { - if ((Dir & REDSTONE_X_POS) && !(Dir & REDSTONE_X_NEG)) // corner - { - Dir ^= REDSTONE_X_POS; - Dir |= REDSTONE_X_NEG; - } - if ((Dir & REDSTONE_X_NEG) && !(Dir & REDSTONE_X_POS)) // corner - { - Dir ^= REDSTONE_X_NEG; - Dir |= REDSTONE_X_POS; - } - Dir |= REDSTONE_Z_POS; - } - } - - BLOCKTYPE PosZ = 0; - if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, PosZ)) - { - if (IsPotentialSource(PosZ)) - { - if ((Dir & REDSTONE_X_POS) && !(Dir & REDSTONE_X_NEG)) // corner - { - Dir ^= REDSTONE_X_POS; - Dir |= REDSTONE_X_NEG; - } - if ((Dir & REDSTONE_X_NEG) && !(Dir & REDSTONE_X_POS)) // corner - { - Dir ^= REDSTONE_X_NEG; - Dir |= REDSTONE_X_POS; - } - Dir |= REDSTONE_Z_NEG; - } - } - return (eRedstoneDirection)Dir; -} - - - - - -bool cIncrementalRedstoneSimulator::IsLeverOn(NIBBLETYPE a_BlockMeta) -{ - // Extract the ON bit from metadata and return if true if it is set: - return ((a_BlockMeta & 0x8) == 0x8); -} - - - - diff --git a/src/Simulator/IncrementalRedstoneSimulator.h b/src/Simulator/IncrementalRedstoneSimulator.h index 79740a8f6..5bd1ad95d 100644 --- a/src/Simulator/IncrementalRedstoneSimulator.h +++ b/src/Simulator/IncrementalRedstoneSimulator.h @@ -3,314 +3,7 @@ #include "RedstoneSimulator.h" -/// Per-chunk data for the simulator, specified individual chunks to simulate -typedef cCoordWithBlockAndBoolVector cRedstoneSimulatorChunkData; - - - - - -class cIncrementalRedstoneSimulator : - public cRedstoneSimulator -{ - typedef cRedstoneSimulator super; -public: - - cIncrementalRedstoneSimulator(cWorld & a_World); - ~cIncrementalRedstoneSimulator(); - - virtual void Simulate(float a_Dt) override { UNUSED(a_Dt);} // not used - virtual void SimulateChunk(float a_Dt, int a_ChunkX, int a_ChunkZ, cChunk * a_Chunk) override; - virtual bool IsAllowedBlock(BLOCKTYPE a_BlockType) override { return IsRedstone(a_BlockType); } - virtual void WakeUp(int a_BlockX, int a_BlockY, int a_BlockZ, cChunk * a_Chunk) override; - - enum eRedstoneDirection - { - REDSTONE_NONE = 0, - REDSTONE_X_POS = 0x1, - REDSTONE_X_NEG = 0x2, - REDSTONE_Z_POS = 0x4, - REDSTONE_Z_NEG = 0x8, - }; - eRedstoneDirection GetWireDirection(int a_BlockX, int a_BlockY, int a_BlockZ); - -private: - - #define MAX_POWER_LEVEL 15 - - struct sPoweredBlocks // Define structure of the directly powered blocks list - { - Vector3i a_BlockPos; // Position of powered block - Vector3i a_SourcePos; // Position of source powering the block at a_BlockPos - unsigned char a_PowerLevel; - }; - - struct sLinkedPoweredBlocks // Define structure of the indirectly powered blocks list (i.e. repeaters powering through a block to the block at the other side) - { - Vector3i a_BlockPos; - Vector3i a_MiddlePos; // Position of block that is betwixt a source and the destination - Vector3i a_SourcePos; - unsigned char a_PowerLevel; - }; - - struct sSimulatedPlayerToggleableList // Define structure of the list containing simulate-on-update blocks (such as trapdoors that respond once to a block update, and can be toggled by a player) - { - Vector3i a_RelBlockPos; - bool WasLastStatePowered; // Was the last state powered or not? Determines whether a source update has happened and if I should resimulate - }; - - struct sRepeatersDelayList // Define structure of list containing repeaters' delay states - { - Vector3i a_RelBlockPos; - unsigned char a_DelayTicks; // For how many ticks should the repeater delay - unsigned char a_ElapsedTicks; // How much of the previous has been elapsed? - bool ShouldPowerOn; // What happens when the delay time is fulfilled? - }; - -public: - - typedef std::vector <sPoweredBlocks> PoweredBlocksList; - typedef std::vector <sLinkedPoweredBlocks> LinkedBlocksList; - typedef std::vector <sSimulatedPlayerToggleableList> SimulatedPlayerToggleableList; - typedef std::vector <sRepeatersDelayList> RepeatersDelayList; - -private: - - cRedstoneSimulatorChunkData * m_RedstoneSimulatorChunkData; - PoweredBlocksList * m_PoweredBlocks; - LinkedBlocksList * m_LinkedPoweredBlocks; - SimulatedPlayerToggleableList * m_SimulatedPlayerToggleableBlocks; - RepeatersDelayList * m_RepeatersDelayList; - - virtual void AddBlock(int a_BlockX, int a_BlockY, int a_BlockZ, cChunk * a_Chunk) override { RedstoneAddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk); } - void RedstoneAddBlock(int a_BlockX, int a_BlockY, int a_BlockZ, cChunk * a_Chunk, cChunk * a_OtherChunk = NULL); - cChunk * m_Chunk; - - // We want a_MyState for devices needing a full FastSetBlock (as opposed to meta) because with our simulation model, we cannot keep setting the block if it is already set correctly - // In addition to being non-performant, it would stop the player from actually breaking said device - - /* ====== SOURCES ====== */ - /** Handles the redstone torch */ - void HandleRedstoneTorch(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState); - /** Handles the redstone block */ - void HandleRedstoneBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles levers */ - void HandleRedstoneLever(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles buttons */ - void HandleRedstoneButton(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles daylight sensors */ - void HandleDaylightSensor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles pressure plates */ - void HandlePressurePlate(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyType); - /** Handles tripwire hooks - Performs correct meta and power setting for self by going in the direction it faces and looking for a continous line of tripwire bounded by another oppositely facing hook - If this line is complete, it verifies that at least on wire reports an entity is on top (via its meta), and performs its task - */ - void HandleTripwireHook(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles trapped chests */ - void HandleTrappedChest(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /* ==================== */ - - /* ====== CARRIERS ====== */ - /** Handles redstone wire */ - void HandleRedstoneWire(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles repeaters */ - void HandleRedstoneRepeater(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState); - /* ====================== */ - - /* ====== DEVICES ====== */ - /** Handles pistons */ - void HandlePiston(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles dispensers and droppers */ - void HandleDropSpenser(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles TNT (exploding) */ - void HandleTNT(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles redstone lamps */ - void HandleRedstoneLamp(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState); - /** Handles doords */ - void HandleDoor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles command blocks */ - void HandleCommandBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles activator, detector, and powered rails */ - void HandleRail(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyType); - /** Handles trapdoors */ - void HandleTrapdoor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles fence gates */ - void HandleFenceGate(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles noteblocks */ - void HandleNoteBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Handles tripwires */ - void HandleTripwire(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /* ===================== */ - - /* ====== Helper functions ====== */ - /** Marks a block as powered */ - void SetBlockPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, int a_RelSourceX, int a_RelSourceY, int a_RelSourceZ, unsigned char a_PowerLevel = MAX_POWER_LEVEL); - /** Marks a block as being powered through another block */ - void SetBlockLinkedPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, int a_RelMiddleX, int a_RelMiddleY, int a_RelMiddleZ, int a_RelSourceX, int a_RelSourceY, int a_RelSourceZ, BLOCKTYPE a_MiddeBlock, unsigned char a_PowerLevel = MAX_POWER_LEVEL); - /** Marks a block as simulated, who should not be simulated further unless their power state changes, to accomodate a player manually toggling the block without triggering the simulator toggling it back */ - void SetPlayerToggleableBlockAsSimulated(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, bool WasLastStatePowered); - /** Marks the second block in a direction as linked powered */ - void SetDirectionLinkedPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, char a_Direction, unsigned char a_PowerLevel = MAX_POWER_LEVEL); - /** Marks all blocks immediately surrounding a coordinate as powered */ - void SetAllDirsAsPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, unsigned char a_PowerLevel = MAX_POWER_LEVEL); - /** Queues a repeater to be powered or unpowered and returns if the m_RepeatersDelayList iterators were invalidated */ - bool QueueRepeaterPowerChange(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta, bool ShouldPowerOn); - /** Removes a block from the Powered and LinkedPowered lists - Used for variable sources such as tripwire hooks, daylight sensors, and trapped chests - */ - void SetSourceUnpowered(int a_RelSourceX, int a_RelSourceY, int a_RelSourceZ, cChunk * a_Chunk, bool a_IsFirstCall = true); - - /** Returns if a coordinate is powered or linked powered */ - bool AreCoordsPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) { return AreCoordsDirectlyPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk) || AreCoordsLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); } - /** Returns if a coordinate is in the directly powered blocks list */ - bool AreCoordsDirectlyPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, cChunk * a_Chunk); - /** Returns if a coordinate is in the indirectly powered blocks list */ - bool AreCoordsLinkedPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); - /** Returns if a coordinate was marked as simulated (for blocks toggleable by players) */ - bool AreCoordsSimulated(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, bool IsCurrentStatePowered); - /** Returns if a repeater is powered by testing for power sources behind the repeater */ - bool IsRepeaterPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta); - /** Returns if a repeater is locked */ - bool IsRepeaterLocked(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta); - /** Returns if a piston is powered */ - bool IsPistonPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta); - /** Returns if a wire is powered - The only diffence between this and a normal AreCoordsPowered is that this function checks for a wire powering another wire */ - bool IsWirePowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, unsigned char & a_PowerLevel); - /** Handles delayed updates to repeaters **/ - void HandleRedstoneRepeaterDelays(void); - - /** Returns if lever metadata marks it as emitting power */ - bool IsLeverOn(NIBBLETYPE a_BlockMeta); - /** Returns if button metadata marks it as emitting power */ - bool IsButtonOn(NIBBLETYPE a_BlockMeta) { return IsLeverOn(a_BlockMeta); } - /* ============================== */ - - /* ====== Misc Functions ====== */ - /** Returns if a block is viable to be the MiddleBlock of a SetLinkedPowered operation */ - inline static bool IsViableMiddleBlock(BLOCKTYPE Block) { return cBlockInfo::FullyOccupiesVoxel(Block); } - - /** Returns if a block is a mechanism (something that accepts power and does something) - Used by torches to determine if they power a block whilst not standing on the ground - */ - inline static bool IsMechanism(BLOCKTYPE Block) - { - switch (Block) - { - case E_BLOCK_ACTIVATOR_RAIL: - case E_BLOCK_COMMAND_BLOCK: - case E_BLOCK_PISTON: - case E_BLOCK_STICKY_PISTON: - case E_BLOCK_DISPENSER: - case E_BLOCK_DROPPER: - case E_BLOCK_FENCE_GATE: - case E_BLOCK_HOPPER: - case E_BLOCK_NOTE_BLOCK: - case E_BLOCK_TNT: - case E_BLOCK_TRAPDOOR: - case E_BLOCK_REDSTONE_LAMP_OFF: - case E_BLOCK_REDSTONE_LAMP_ON: - case E_BLOCK_WOODEN_DOOR: - case E_BLOCK_IRON_DOOR: - case E_BLOCK_REDSTONE_REPEATER_OFF: - case E_BLOCK_REDSTONE_REPEATER_ON: - case E_BLOCK_POWERED_RAIL: - case E_BLOCK_REDSTONE_WIRE: - { - return true; - } - default: return false; - } - } - - /** Returns if a block has the potential to output power */ - inline static bool IsPotentialSource(BLOCKTYPE Block) - { - switch (Block) - { - case E_BLOCK_DETECTOR_RAIL: - case E_BLOCK_DAYLIGHT_SENSOR: - case E_BLOCK_WOODEN_BUTTON: - case E_BLOCK_STONE_BUTTON: - case E_BLOCK_REDSTONE_WIRE: - case E_BLOCK_REDSTONE_TORCH_ON: - case E_BLOCK_LEVER: - case E_BLOCK_REDSTONE_REPEATER_ON: - case E_BLOCK_BLOCK_OF_REDSTONE: - case E_BLOCK_ACTIVE_COMPARATOR: - case E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE: - case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: - case E_BLOCK_STONE_PRESSURE_PLATE: - case E_BLOCK_WOODEN_PRESSURE_PLATE: - case E_BLOCK_TRAPPED_CHEST: - { - return true; - } - default: return false; - } - } - - /** Returns if a block is any sort of redstone device */ - inline static bool IsRedstone(BLOCKTYPE Block) - { - switch (Block) - { - // All redstone devices, please alpha sort - case E_BLOCK_ACTIVATOR_RAIL: - case E_BLOCK_ACTIVE_COMPARATOR: - case E_BLOCK_BLOCK_OF_REDSTONE: - case E_BLOCK_COMMAND_BLOCK: - case E_BLOCK_DETECTOR_RAIL: - case E_BLOCK_DISPENSER: - case E_BLOCK_DAYLIGHT_SENSOR: - case E_BLOCK_DROPPER: - case E_BLOCK_FENCE_GATE: - case E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE: - case E_BLOCK_HOPPER: - case E_BLOCK_INACTIVE_COMPARATOR: - case E_BLOCK_IRON_DOOR: - case E_BLOCK_LEVER: - case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: - case E_BLOCK_NOTE_BLOCK: - case E_BLOCK_POWERED_RAIL: - case E_BLOCK_REDSTONE_LAMP_OFF: - case E_BLOCK_REDSTONE_LAMP_ON: - case E_BLOCK_REDSTONE_REPEATER_OFF: - case E_BLOCK_REDSTONE_REPEATER_ON: - case E_BLOCK_REDSTONE_TORCH_OFF: - case E_BLOCK_REDSTONE_TORCH_ON: - case E_BLOCK_REDSTONE_WIRE: - case E_BLOCK_STICKY_PISTON: - case E_BLOCK_STONE_BUTTON: - case E_BLOCK_STONE_PRESSURE_PLATE: - case E_BLOCK_TNT: - case E_BLOCK_TRAPDOOR: - case E_BLOCK_TRAPPED_CHEST: - case E_BLOCK_TRIPWIRE_HOOK: - case E_BLOCK_TRIPWIRE: - case E_BLOCK_WOODEN_BUTTON: - case E_BLOCK_WOODEN_DOOR: - case E_BLOCK_WOODEN_PRESSURE_PLATE: - case E_BLOCK_PISTON: - { - return true; - } - default: return false; - } - } - - inline static bool AreCoordsOnChunkBoundary(int a_BlockX, int a_BlockY, int a_BlockZ) - { - return ( // Are we on a chunk boundary? +- 2 because of LinkedPowered blocks - ((a_BlockX % cChunkDef::Width) <= 1) || - ((a_BlockX % cChunkDef::Width) >= 14) || - ((a_BlockZ % cChunkDef::Width) <= 1) || - ((a_BlockZ % cChunkDef::Width) >= 14) - ); - } -}; - - - +class cWorld; +class cChunk; +cRedstoneSimulator<cChunk, cWorld> * MakeIncrementalRedstoneSimulator(cWorld & a_World); diff --git a/src/Simulator/IncrementalRedstoneSimulator.inc b/src/Simulator/IncrementalRedstoneSimulator.inc new file mode 100644 index 000000000..200fc0971 --- /dev/null +++ b/src/Simulator/IncrementalRedstoneSimulator.inc @@ -0,0 +1,2598 @@ + +#include "IncrementalRedstoneSimulator.h" +#include "BoundingBox.h" +#include "BlockEntities/RedstonePoweredEntity.h" +#include "Blocks/ChunkInterface.h" +#include "RedstoneSimulator.h" + + +typedef cItemCallback<cEntity> cEntityCallback; + + + + + +typedef cItemCallback<cRedstonePoweredEntity> cRedstonePoweredCallback; + + +template<class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +class cIncrementalRedstoneSimulator : + public cRedstoneSimulator<ChunkType, WorldType> +{ + typedef cRedstoneSimulator<ChunkType, WorldType> super; +public: + + cIncrementalRedstoneSimulator(WorldType & a_World) + : cRedstoneSimulator<ChunkType, WorldType>(a_World) + { + } + ~cIncrementalRedstoneSimulator(); + + virtual cRedstoneSimulatorChunkData * CreateChunkData() override + { + return new cIncrementalRedstoneSimulatorChunkData; + } + + virtual void Simulate(float a_Dt) override { UNUSED(a_Dt);} // not used + virtual void SimulateChunk(float a_Dt, int a_ChunkX, int a_ChunkZ, ChunkType * a_Chunk) override; + virtual bool IsAllowedBlock(BLOCKTYPE a_BlockType) override { return IsRedstone(a_BlockType); } + virtual void WakeUp(int a_BlockX, int a_BlockY, int a_BlockZ, ChunkType * a_Chunk) override; + + enum eRedstoneDirection + { + REDSTONE_NONE = 0, + REDSTONE_X_POS = 0x1, + REDSTONE_X_NEG = 0x2, + REDSTONE_Z_POS = 0x4, + REDSTONE_Z_NEG = 0x8, + }; + eRedstoneDirection GetWireDirection(int a_BlockX, int a_BlockY, int a_BlockZ); + +private: + + #define MAX_POWER_LEVEL 15 + + struct sPoweredBlocks // Define structure of the directly powered blocks list + { + Vector3i a_BlockPos; // Position of powered block + Vector3i a_SourcePos; // Position of source powering the block at a_BlockPos + unsigned char a_PowerLevel; + }; + + struct sLinkedPoweredBlocks // Define structure of the indirectly powered blocks list (i.e. repeaters powering through a block to the block at the other side) + { + Vector3i a_BlockPos; + Vector3i a_MiddlePos; // Position of block that is betwixt a source and the destination + Vector3i a_SourcePos; + unsigned char a_PowerLevel; + }; + + struct sSimulatedPlayerToggleableList // Define structure of the list containing simulate-on-update blocks (such as trapdoors that respond once to a block update, and can be toggled by a player) + { + Vector3i a_RelBlockPos; + bool WasLastStatePowered; // Was the last state powered or not? Determines whether a source update has happened and if I should resimulate + }; + + struct sRepeatersDelayList // Define structure of list containing repeaters' delay states + { + Vector3i a_RelBlockPos; + unsigned char a_DelayTicks; // For how many ticks should the repeater delay + unsigned char a_ElapsedTicks; // How much of the previous has been elapsed? + bool ShouldPowerOn; // What happens when the delay time is fulfilled? + }; + + class cIncrementalRedstoneSimulatorChunkData : + public cRedstoneSimulatorChunkData + { + public: + /// Per-chunk data for the simulator, specified individual chunks to simulate + cCoordWithBlockAndBoolVector m_ChunkData; + cCoordWithBlockAndBoolVector m_QueuedChunkData; + std::vector<sPoweredBlocks> m_PoweredBlocks; + std::vector<sLinkedPoweredBlocks> m_LinkedBlocks; + std::vector<sSimulatedPlayerToggleableList> m_SimulatedPlayerToggleableBlocks; + std::vector<sRepeatersDelayList> m_RepeatersDelayList; + }; + +public: + + typedef std::vector <sPoweredBlocks> PoweredBlocksList; + typedef std::vector <sLinkedPoweredBlocks> LinkedBlocksList; + typedef std::vector <sSimulatedPlayerToggleableList> SimulatedPlayerToggleableList; + typedef std::vector <sRepeatersDelayList> RepeatersDelayList; + +private: + + cIncrementalRedstoneSimulatorChunkData * m_RedstoneSimulatorChunkData; + PoweredBlocksList * m_PoweredBlocks; + LinkedBlocksList * m_LinkedPoweredBlocks; + SimulatedPlayerToggleableList * m_SimulatedPlayerToggleableBlocks; + RepeatersDelayList * m_RepeatersDelayList; + + virtual void AddBlock(int a_BlockX, int a_BlockY, int a_BlockZ, ChunkType * a_Chunk) override { RedstoneAddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk); } + void RedstoneAddBlock(int a_BlockX, int a_BlockY, int a_BlockZ, ChunkType * a_Chunk, ChunkType * a_OtherChunk = NULL); + ChunkType * m_Chunk; + + // We want a_MyState for devices needing a full FastSetBlock (as opposed to meta) because with our simulation model, we cannot keep setting the block if it is already set correctly + // In addition to being non-performant, it would stop the player from actually breaking said device + + /* ====== SOURCES ====== */ + /** Handles the redstone torch */ + void HandleRedstoneTorch(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState); + /** Handles the redstone block */ + void HandleRedstoneBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles levers */ + void HandleRedstoneLever(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles buttons */ + void HandleRedstoneButton(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles daylight sensors */ + void HandleDaylightSensor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles pressure plates */ + void HandlePressurePlate(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyType); + /** Handles tripwire hooks + Performs correct meta and power setting for self by going in the direction it faces and looking for a continous line of tripwire bounded by another oppositely facing hook + If this line is complete, it verifies that at least on wire reports an entity is on top (via its meta), and performs its task + */ + void HandleTripwireHook(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles trapped chests */ + void HandleTrappedChest(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /* ==================== */ + + /* ====== CARRIERS ====== */ + /** Handles redstone wire */ + void HandleRedstoneWire(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles repeaters */ + void HandleRedstoneRepeater(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState); + /* ====================== */ + + /* ====== DEVICES ====== */ + /** Handles pistons */ + void HandlePiston(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles dispensers and droppers */ + void HandleDropSpenser(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles TNT (exploding) */ + void HandleTNT(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles redstone lamps */ + void HandleRedstoneLamp(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState); + /** Handles doords */ + void HandleDoor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles command blocks */ + void HandleCommandBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles activator, detector, and powered rails */ + void HandleRail(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyType); + /** Handles trapdoors */ + void HandleTrapdoor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles fence gates */ + void HandleFenceGate(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles noteblocks */ + void HandleNoteBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Handles tripwires */ + void HandleTripwire(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /* ===================== */ + + /* ====== Helper functions ====== */ + /** Marks a block as powered */ + void SetBlockPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, int a_RelSourceX, int a_RelSourceY, int a_RelSourceZ, unsigned char a_PowerLevel = MAX_POWER_LEVEL); + /** Marks a block as being powered through another block */ + void SetBlockLinkedPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, int a_RelMiddleX, int a_RelMiddleY, int a_RelMiddleZ, int a_RelSourceX, int a_RelSourceY, int a_RelSourceZ, BLOCKTYPE a_MiddeBlock, unsigned char a_PowerLevel = MAX_POWER_LEVEL); + /** Marks a block as simulated, who should not be simulated further unless their power state changes, to accomodate a player manually toggling the block without triggering the simulator toggling it back */ + void SetPlayerToggleableBlockAsSimulated(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, bool WasLastStatePowered); + /** Marks the second block in a direction as linked powered */ + void SetDirectionLinkedPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, char a_Direction, unsigned char a_PowerLevel = MAX_POWER_LEVEL); + /** Marks all blocks immediately surrounding a coordinate as powered */ + void SetAllDirsAsPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, unsigned char a_PowerLevel = MAX_POWER_LEVEL); + /** Queues a repeater to be powered or unpowered and returns if the m_RepeatersDelayList iterators were invalidated */ + bool QueueRepeaterPowerChange(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta, bool ShouldPowerOn); + /** Removes a block from the Powered and LinkedPowered lists + Used for variable sources such as tripwire hooks, daylight sensors, and trapped chests + */ + void SetSourceUnpowered(int a_RelSourceX, int a_RelSourceY, int a_RelSourceZ, ChunkType * a_Chunk, bool a_IsFirstCall = true); + + /** Returns if a coordinate is powered or linked powered */ + bool AreCoordsPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) { return AreCoordsDirectlyPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk) || AreCoordsLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); } + /** Returns if a coordinate is in the directly powered blocks list */ + bool AreCoordsDirectlyPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, ChunkType * a_Chunk); + /** Returns if a coordinate is in the indirectly powered blocks list */ + bool AreCoordsLinkedPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ); + /** Returns if a coordinate was marked as simulated (for blocks toggleable by players) */ + bool AreCoordsSimulated(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, bool IsCurrentStatePowered); + /** Returns if a repeater is powered by testing for power sources behind the repeater */ + bool IsRepeaterPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta); + /** Returns if a repeater is locked */ + bool IsRepeaterLocked(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta); + /** Returns if a piston is powered */ + bool IsPistonPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta); + /** Returns if a wire is powered + The only diffence between this and a normal AreCoordsPowered is that this function checks for a wire powering another wire */ + bool IsWirePowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, unsigned char & a_PowerLevel); + /** Handles delayed updates to repeaters **/ + void HandleRedstoneRepeaterDelays(void); + + /** Returns if lever metadata marks it as emitting power */ + bool IsLeverOn(NIBBLETYPE a_BlockMeta); + /** Returns if button metadata marks it as emitting power */ + bool IsButtonOn(NIBBLETYPE a_BlockMeta) { return IsLeverOn(a_BlockMeta); } + /* ============================== */ + + /* ====== Misc Functions ====== */ + /** Returns if a block is viable to be the MiddleBlock of a SetLinkedPowered operation */ + inline static bool IsViableMiddleBlock(BLOCKTYPE Block) { return cBlockInfo::FullyOccupiesVoxel(Block); } + + /** Returns if a block is a mechanism (something that accepts power and does something) + Used by torches to determine if they power a block whilst not standing on the ground + */ + inline static bool IsMechanism(BLOCKTYPE Block) + { + switch (Block) + { + case E_BLOCK_ACACIA_DOOR: + case E_BLOCK_ACACIA_FENCE_GATE: + case E_BLOCK_ACTIVATOR_RAIL: + case E_BLOCK_BIRCH_DOOR: + case E_BLOCK_BIRCH_FENCE_GATE: + case E_BLOCK_COMMAND_BLOCK: + case E_BLOCK_DARK_OAK_DOOR: + case E_BLOCK_DARK_OAK_FENCE_GATE: + case E_BLOCK_DISPENSER: + case E_BLOCK_DROPPER: + case E_BLOCK_FENCE_GATE: + case E_BLOCK_HOPPER: + case E_BLOCK_IRON_DOOR: + case E_BLOCK_IRON_TRAPDOOR: + case E_BLOCK_JUNGLE_DOOR: + case E_BLOCK_JUNGLE_FENCE_GATE: + case E_BLOCK_NOTE_BLOCK: + case E_BLOCK_PISTON: + case E_BLOCK_POWERED_RAIL: + case E_BLOCK_REDSTONE_LAMP_OFF: + case E_BLOCK_REDSTONE_LAMP_ON: + case E_BLOCK_REDSTONE_REPEATER_OFF: + case E_BLOCK_REDSTONE_REPEATER_ON: + case E_BLOCK_REDSTONE_WIRE: + case E_BLOCK_SPRUCE_DOOR: + case E_BLOCK_SPRUCE_FENCE_GATE: + case E_BLOCK_STICKY_PISTON: + case E_BLOCK_TNT: + case E_BLOCK_TRAPDOOR: + case E_BLOCK_WOODEN_DOOR: + { + return true; + } + default: return false; + } + } + + /** Returns if a block has the potential to output power */ + inline static bool IsPotentialSource(BLOCKTYPE Block) + { + switch (Block) + { + case E_BLOCK_DETECTOR_RAIL: + case E_BLOCK_DAYLIGHT_SENSOR: + case E_BLOCK_WOODEN_BUTTON: + case E_BLOCK_STONE_BUTTON: + case E_BLOCK_REDSTONE_WIRE: + case E_BLOCK_REDSTONE_TORCH_ON: + case E_BLOCK_LEVER: + case E_BLOCK_REDSTONE_REPEATER_ON: + case E_BLOCK_BLOCK_OF_REDSTONE: + case E_BLOCK_ACTIVE_COMPARATOR: + case E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE: + case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: + case E_BLOCK_STONE_PRESSURE_PLATE: + case E_BLOCK_WOODEN_PRESSURE_PLATE: + case E_BLOCK_TRAPPED_CHEST: + { + return true; + } + default: return false; + } + } + + /** Returns if a block is any sort of redstone device */ + inline static bool IsRedstone(BLOCKTYPE Block) + { + switch (Block) + { + // All redstone devices, please alpha sort + case E_BLOCK_ACACIA_DOOR: + case E_BLOCK_ACACIA_FENCE_GATE: + case E_BLOCK_ACTIVATOR_RAIL: + case E_BLOCK_ACTIVE_COMPARATOR: + case E_BLOCK_BIRCH_DOOR: + case E_BLOCK_BIRCH_FENCE_GATE: + case E_BLOCK_BLOCK_OF_REDSTONE: + case E_BLOCK_COMMAND_BLOCK: + case E_BLOCK_DARK_OAK_DOOR: + case E_BLOCK_DARK_OAK_FENCE_GATE: + case E_BLOCK_DAYLIGHT_SENSOR: + case E_BLOCK_DETECTOR_RAIL: + case E_BLOCK_DISPENSER: + case E_BLOCK_DROPPER: + case E_BLOCK_FENCE_GATE: + case E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE: + case E_BLOCK_HOPPER: + case E_BLOCK_INACTIVE_COMPARATOR: + case E_BLOCK_IRON_DOOR: + case E_BLOCK_IRON_TRAPDOOR: + case E_BLOCK_JUNGLE_DOOR: + case E_BLOCK_JUNGLE_FENCE_GATE: + case E_BLOCK_LEVER: + case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: + case E_BLOCK_NOTE_BLOCK: + case E_BLOCK_POWERED_RAIL: + case E_BLOCK_REDSTONE_LAMP_OFF: + case E_BLOCK_REDSTONE_LAMP_ON: + case E_BLOCK_REDSTONE_REPEATER_OFF: + case E_BLOCK_REDSTONE_REPEATER_ON: + case E_BLOCK_REDSTONE_TORCH_OFF: + case E_BLOCK_REDSTONE_TORCH_ON: + case E_BLOCK_REDSTONE_WIRE: + case E_BLOCK_SPRUCE_DOOR: + case E_BLOCK_SPRUCE_FENCE_GATE: + case E_BLOCK_STICKY_PISTON: + case E_BLOCK_STONE_BUTTON: + case E_BLOCK_STONE_PRESSURE_PLATE: + case E_BLOCK_TNT: + case E_BLOCK_TRAPDOOR: + case E_BLOCK_TRAPPED_CHEST: + case E_BLOCK_TRIPWIRE_HOOK: + case E_BLOCK_TRIPWIRE: + case E_BLOCK_WOODEN_BUTTON: + case E_BLOCK_WOODEN_DOOR: + case E_BLOCK_WOODEN_PRESSURE_PLATE: + case E_BLOCK_PISTON: + { + return true; + } + default: return false; + } + } + + inline static bool AreCoordsOnChunkBoundary(int a_BlockX, int a_BlockY, int a_BlockZ) + { + return ( // Are we on a chunk boundary? +- 2 because of LinkedPowered blocks + ((a_BlockX % cChunkDef::Width) <= 1) || + ((a_BlockX % cChunkDef::Width) >= 14) || + ((a_BlockZ % cChunkDef::Width) <= 1) || + ((a_BlockZ % cChunkDef::Width) >= 14) + ); + } +}; + + + + + +template<class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::~cIncrementalRedstoneSimulator() +{ +} + + + + +template<class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::RedstoneAddBlock(int a_BlockX, int a_BlockY, int a_BlockZ, ChunkType * a_Chunk, ChunkType * a_OtherChunk) +{ + if ((a_Chunk == NULL) || !a_Chunk->IsValid()) + { + return; + } + else if ((a_BlockY < 0) || (a_BlockY > cChunkDef::Height)) + { + return; + } + + // We may be called with coordinates in a chunk that is not the first chunk parameter + // In that case, the actual chunk (which the coordinates are in), will be passed as the second parameter + // Use that Chunk pointer to get a relative position + + int RelX = 0; + int RelZ = 0; + BLOCKTYPE Block; + NIBBLETYPE Meta; + + if (a_OtherChunk != NULL) + { + RelX = a_BlockX - a_OtherChunk->GetPosX() * cChunkDef::Width; + RelZ = a_BlockZ - a_OtherChunk->GetPosZ() * cChunkDef::Width; + a_OtherChunk->GetBlockTypeMeta(RelX, a_BlockY, RelZ, Block, Meta); + + // If a_OtherChunk is passed (not NULL), it is the chunk that had a block change, and a_Chunk will be the neighbouring chunk of that block + // Because said neighbouring chunk does not know of this change but still needs to update its redstone, we set it to dirty + a_Chunk->SetIsRedstoneDirty(true); + } + else + { + RelX = a_BlockX - a_Chunk->GetPosX() * cChunkDef::Width; + RelZ = a_BlockZ - a_Chunk->GetPosZ() * cChunkDef::Width; + a_Chunk->GetBlockTypeMeta(RelX, a_BlockY, RelZ, Block, Meta); + } + + // Every time a block is changed (AddBlock called), we want to go through all lists and check to see if the coordiantes stored within are still valid + // Checking only when a block is changed, as opposed to every tick, also improves performance + + cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData * SimulatorChunkData = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData()); + if (SimulatorChunkData == NULL) + { + return; + } + PoweredBlocksList & PoweredBlocks = SimulatorChunkData->m_PoweredBlocks; + for (typename PoweredBlocksList::iterator itr = PoweredBlocks.begin(); itr != PoweredBlocks.end();) + { + if (!itr->a_SourcePos.Equals(Vector3i(a_BlockX, a_BlockY, a_BlockZ))) + { + ++itr; + continue; + } + + if (!IsPotentialSource(Block)) + { + LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from powered blocks list as it no longer connected to a source", itr->a_BlockPos.x, itr->a_BlockPos.y, itr->a_BlockPos.z); + itr = PoweredBlocks.erase(itr); + continue; + } + else if ( + // Changeable sources + ((Block == E_BLOCK_REDSTONE_WIRE) && (Meta == 0)) || + ((Block == E_BLOCK_LEVER) && !IsLeverOn(Meta)) || + ((Block == E_BLOCK_DETECTOR_RAIL) && ((Meta & 0x08) == 0)) || + (((Block == E_BLOCK_STONE_BUTTON) || (Block == E_BLOCK_WOODEN_BUTTON)) && (!IsButtonOn(Meta))) || + ((Block == E_BLOCK_TRIPWIRE_HOOK) && ((Meta & 0x08) == 0)) + ) + { + LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from powered blocks list due to present/past metadata mismatch", itr->a_BlockPos.x, itr->a_BlockPos.y, itr->a_BlockPos.z); + itr = PoweredBlocks.erase(itr); + continue; + } + ++itr; + } + + LinkedBlocksList & LinkedPoweredBlocks = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_LinkedBlocks; + // We loop through all values (insteading of breaking out at the first) to make sure everything is gone, as there can be multiple SourceBlock entries for one AddBlock coordinate + for (typename LinkedBlocksList::iterator itr = LinkedPoweredBlocks.begin(); itr != LinkedPoweredBlocks.end();) + { + if (itr->a_SourcePos.Equals(Vector3i(a_BlockX, a_BlockY, a_BlockZ))) + { + if (!IsPotentialSource(Block)) + { + LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from linked powered blocks list as it is no longer connected to a source", itr->a_BlockPos.x, itr->a_BlockPos.y, itr->a_BlockPos.z); + itr = LinkedPoweredBlocks.erase(itr); + continue; + } + else if ( + // Things that can send power through a block but which depends on meta + ((Block == E_BLOCK_REDSTONE_WIRE) && (Meta == 0)) || + ((Block == E_BLOCK_LEVER) && !IsLeverOn(Meta)) || + (((Block == E_BLOCK_STONE_BUTTON) || (Block == E_BLOCK_WOODEN_BUTTON)) && (!IsButtonOn(Meta))) + ) + { + LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from linked powered blocks list due to present/past metadata mismatch", itr->a_BlockPos.x, itr->a_BlockPos.y, itr->a_BlockPos.z); + itr = LinkedPoweredBlocks.erase(itr); + continue; + } + } + else if (itr->a_MiddlePos.Equals(Vector3i(a_BlockX, a_BlockY, a_BlockZ))) + { + if (!IsViableMiddleBlock(Block)) + { + LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from linked powered blocks list as it is no longer powered through a valid middle block", itr->a_BlockPos.x, itr->a_BlockPos.y, itr->a_BlockPos.z); + itr = LinkedPoweredBlocks.erase(itr); + continue; + } + } + ++itr; + } + + SimulatedPlayerToggleableList & SimulatedPlayerToggleableBlocks = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_SimulatedPlayerToggleableBlocks; + for (typename SimulatedPlayerToggleableList::iterator itr = SimulatedPlayerToggleableBlocks.begin(); itr != SimulatedPlayerToggleableBlocks.end(); ++itr) + { + if (!itr->a_RelBlockPos.Equals(Vector3i(RelX, a_BlockY, RelZ))) + { + continue; + } + + if (!IsAllowedBlock(Block)) + { + LOGD("cIncrementalRedstoneSimulator: Erased block @ {%i, %i, %i} from toggleable simulated list as it is no longer redstone", itr->a_RelBlockPos.x, itr->a_RelBlockPos.y, itr->a_RelBlockPos.z); + SimulatedPlayerToggleableBlocks.erase(itr); + break; + } + } + + RepeatersDelayList & RepeatersDelayList = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_RepeatersDelayList; + for (typename RepeatersDelayList::iterator itr = RepeatersDelayList.begin(); itr != RepeatersDelayList.end(); ++itr) + { + if (!itr->a_RelBlockPos.Equals(Vector3i(RelX, a_BlockY, RelZ))) + { + continue; + } + + if ((Block != E_BLOCK_REDSTONE_REPEATER_ON) && (Block != E_BLOCK_REDSTONE_REPEATER_OFF)) + { + RepeatersDelayList.erase(itr); + break; + } + } + + if (a_OtherChunk != NULL) + { + // DO NOT touch our chunk's data structure if we are being called with coordinates from another chunk - this one caused me massive grief :P + return; + } + + cCoordWithBlockAndBoolVector & RedstoneSimulatorChunkData = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_ChunkData; + for (cCoordWithBlockAndBoolVector::iterator itr = RedstoneSimulatorChunkData.begin(); itr != RedstoneSimulatorChunkData.end(); ++itr) + { + if ((itr->x == RelX) && (itr->y == a_BlockY) && (itr->z == RelZ)) // We are at an entry matching the current (changed) block + { + if (!IsAllowedBlock(Block)) + { + itr->DataTwo = true; // The new blocktype is not redstone; it must be queued to be removed from this list + } + else + { + itr->DataTwo = false; + itr->Data = Block; // Update block information + } + return; + } + } + + if (!IsAllowedBlock(Block)) + { + return; + } + + cCoordWithBlockAndBoolVector & QueuedData = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_QueuedChunkData; + for (cCoordWithBlockAndBoolVector::iterator itr = QueuedData.begin(); itr != QueuedData.end(); ++itr) + { + if ((itr->x == RelX) && (itr->y == a_BlockY) && (itr->z == RelZ)) + { + // Can't have duplicates in here either, in case something adds the block again before the structure can written to the main chunk data + return; + } + } + QueuedData.push_back(cCoordWithBlockAndBool(RelX, a_BlockY, RelZ, Block, false)); +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::SimulateChunk(float a_Dt, int a_ChunkX, int a_ChunkZ, ChunkType * a_Chunk) +{ + m_RedstoneSimulatorChunkData = (cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData(); + if (m_RedstoneSimulatorChunkData == NULL) + { + m_RedstoneSimulatorChunkData = new cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData(); + a_Chunk->SetRedstoneSimulatorData(m_RedstoneSimulatorChunkData); + } + if (m_RedstoneSimulatorChunkData->m_ChunkData.empty() && ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_QueuedChunkData.empty()) + { + return; + } + + m_RedstoneSimulatorChunkData->m_ChunkData.insert( + m_RedstoneSimulatorChunkData->m_ChunkData.end(), + m_RedstoneSimulatorChunkData ->m_QueuedChunkData.begin(), + m_RedstoneSimulatorChunkData ->m_QueuedChunkData.end()); + + m_RedstoneSimulatorChunkData->m_QueuedChunkData.clear(); + + m_PoweredBlocks = &m_RedstoneSimulatorChunkData->m_PoweredBlocks; + m_RepeatersDelayList = &m_RedstoneSimulatorChunkData->m_RepeatersDelayList; + m_SimulatedPlayerToggleableBlocks = &m_RedstoneSimulatorChunkData->m_SimulatedPlayerToggleableBlocks; + m_LinkedPoweredBlocks = &m_RedstoneSimulatorChunkData->m_LinkedBlocks; + m_Chunk = a_Chunk; + bool ShouldUpdateSimulateOnceBlocks = false; + + if (a_Chunk->IsRedstoneDirty()) + { + // Simulate the majority of devices only if something (blockwise or power-wise) has changed + // Make sure to allow the chunk to resimulate after the initial run if there was a power change (ShouldUpdateSimulateOnceBlocks helps to do this) + a_Chunk->SetIsRedstoneDirty(false); + ShouldUpdateSimulateOnceBlocks = true; + } + + HandleRedstoneRepeaterDelays(); + + for (cCoordWithBlockAndBoolVector::iterator dataitr = m_RedstoneSimulatorChunkData->m_ChunkData.begin(); dataitr != m_RedstoneSimulatorChunkData->m_ChunkData.end();) + { + if (dataitr->DataTwo) + { + dataitr = m_RedstoneSimulatorChunkData->m_ChunkData.erase(dataitr); + continue; + } + + switch (dataitr->Data) + { + case E_BLOCK_DAYLIGHT_SENSOR: HandleDaylightSensor(dataitr->x, dataitr->y, dataitr->z); break; + case E_BLOCK_TRIPWIRE: HandleTripwire(dataitr->x, dataitr->y, dataitr->z); break; + case E_BLOCK_TRIPWIRE_HOOK: HandleTripwireHook(dataitr->x, dataitr->y, dataitr->z); break; + + case E_BLOCK_WOODEN_PRESSURE_PLATE: + case E_BLOCK_STONE_PRESSURE_PLATE: + case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: + case E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE: + { + HandlePressurePlate(dataitr->x, dataitr->y, dataitr->z, dataitr->Data); + break; + } + default: break; + } + + if (ShouldUpdateSimulateOnceBlocks) + { + switch (dataitr->Data) + { + case E_BLOCK_REDSTONE_WIRE: HandleRedstoneWire(dataitr->x, dataitr->y, dataitr->z); break; + case E_BLOCK_COMMAND_BLOCK: HandleCommandBlock(dataitr->x, dataitr->y, dataitr->z); break; + case E_BLOCK_NOTE_BLOCK: HandleNoteBlock(dataitr->x, dataitr->y, dataitr->z); break; + case E_BLOCK_BLOCK_OF_REDSTONE: HandleRedstoneBlock(dataitr->x, dataitr->y, dataitr->z); break; + case E_BLOCK_LEVER: HandleRedstoneLever(dataitr->x, dataitr->y, dataitr->z); break; + case E_BLOCK_TNT: HandleTNT(dataitr->x, dataitr->y, dataitr->z); break; + case E_BLOCK_IRON_TRAPDOOR: HandleTrapdoor(dataitr->x, dataitr->y, dataitr->z); break; + case E_BLOCK_TRAPDOOR: HandleTrapdoor(dataitr->x, dataitr->y, dataitr->z); break; + case E_BLOCK_TRAPPED_CHEST: HandleTrappedChest(dataitr->x, dataitr->y, dataitr->z); break; + + case E_BLOCK_ACTIVATOR_RAIL: + case E_BLOCK_DETECTOR_RAIL: + case E_BLOCK_POWERED_RAIL: + { + HandleRail(dataitr->x, dataitr->y, dataitr->z, dataitr->Data); + break; + } + case E_BLOCK_ACACIA_DOOR: + case E_BLOCK_BIRCH_DOOR: + case E_BLOCK_DARK_OAK_DOOR: + case E_BLOCK_JUNGLE_DOOR: + case E_BLOCK_SPRUCE_DOOR: + case E_BLOCK_WOODEN_DOOR: + case E_BLOCK_IRON_DOOR: + { + HandleDoor(dataitr->x, dataitr->y, dataitr->z); + break; + } + case E_BLOCK_ACACIA_FENCE_GATE: + case E_BLOCK_BIRCH_FENCE_GATE: + case E_BLOCK_DARK_OAK_FENCE_GATE: + case E_BLOCK_FENCE_GATE: + case E_BLOCK_JUNGLE_FENCE_GATE: + case E_BLOCK_SPRUCE_FENCE_GATE: + { + HandleFenceGate(dataitr->x, dataitr->y, dataitr->z); + break; + } + case E_BLOCK_REDSTONE_LAMP_OFF: + case E_BLOCK_REDSTONE_LAMP_ON: + { + HandleRedstoneLamp(dataitr->x, dataitr->y, dataitr->z, dataitr->Data); + break; + } + case E_BLOCK_DISPENSER: + case E_BLOCK_DROPPER: + { + HandleDropSpenser(dataitr->x, dataitr->y, dataitr->z); + break; + } + case E_BLOCK_PISTON: + case E_BLOCK_STICKY_PISTON: + { + HandlePiston(dataitr->x, dataitr->y, dataitr->z); + break; + } + case E_BLOCK_REDSTONE_REPEATER_OFF: + case E_BLOCK_REDSTONE_REPEATER_ON: + { + HandleRedstoneRepeater(dataitr->x, dataitr->y, dataitr->z, dataitr->Data); + break; + } + case E_BLOCK_REDSTONE_TORCH_OFF: + case E_BLOCK_REDSTONE_TORCH_ON: + { + HandleRedstoneTorch(dataitr->x, dataitr->y, dataitr->z, dataitr->Data); + break; + } + case E_BLOCK_STONE_BUTTON: + case E_BLOCK_WOODEN_BUTTON: + { + HandleRedstoneButton(dataitr->x, dataitr->y, dataitr->z); + break; + } + default: break; + } + } + ++dataitr; + } +} + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::WakeUp(int a_BlockX, int a_BlockY, int a_BlockZ, ChunkType * a_Chunk) +{ + if (AreCoordsOnChunkBoundary(a_BlockX, a_BlockY, a_BlockZ)) + { + // On a chunk boundary, alert all four sides (i.e. at least one neighbouring chunk) + AddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk); + + // Pass the original coordinates, because when adding things to our simulator lists, we get the chunk that they are in, and therefore any updates need to preseve their position + // RedstoneAddBlock to pass both the neighbouring chunk and the chunk which the coordinates are in and +- 2 in GetNeighbour() to accomodate for LinkedPowered blocks being 2 away from chunk boundaries + RedstoneAddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX - 2, a_BlockZ), a_Chunk); + RedstoneAddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX + 2, a_BlockZ), a_Chunk); + RedstoneAddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX, a_BlockZ - 2), a_Chunk); + RedstoneAddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX, a_BlockZ + 2), a_Chunk); + + return; + } + + // Not on boundary, just alert this chunk for speed + AddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk); +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleRedstoneTorch(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState) +{ + static const struct // Define which directions the torch can power + { + int x, y, z; + } gCrossCoords[] = + { + { 1, 0, 0}, + {-1, 0, 0}, + { 0, 0, 1}, + { 0, 0, -1}, + { 0, 1, 0}, + } ; + + if (a_MyState == E_BLOCK_REDSTONE_TORCH_ON) + { + // Check if the block the torch is on is powered + int X = a_RelBlockX; int Y = a_RelBlockY; int Z = a_RelBlockZ; + AddFaceDirection(X, Y, Z, GetHandlerCompileTime<E_BLOCK_TORCH>::type::MetaDataToDirection(m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ)), true); // Inverse true to get the block torch is on + + ChunkType * Neighbour = m_Chunk->GetRelNeighborChunk(X, Z); + if ((Neighbour == NULL) || !Neighbour->IsValid()) + { + return; + } + + if (AreCoordsDirectlyPowered(X, Y, Z, Neighbour)) + { + // There was a match, torch goes off + m_Chunk->SetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_BLOCK_REDSTONE_TORCH_OFF, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ)); + return; + } + + // Torch still on, make all 4(X, Z) + 1(Y) sides powered + for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++) + { + BLOCKTYPE Type = 0; + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, Type)) + { + continue; + } + if (i + 1 < ARRAYCOUNT(gCrossCoords)) // Sides of torch, not top (top is last) + { + if ( + IsMechanism(Type) && // Is it a mechanism? Not block/other torch etc. + (!Vector3i(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z).Equals(Vector3i(X, Y, Z))) // CAN'T power block is that it is on + ) + { + SetBlockPowered(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, a_RelBlockX, a_RelBlockY, a_RelBlockZ); + } + } + else + { + // Top side, power whatever is there, including blocks + SetBlockPowered(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, a_RelBlockX, a_RelBlockY, a_RelBlockZ); + // Power all blocks surrounding block above torch + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YP); + } + } + + if (m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) != 0x5) // Is torch standing on ground? If NOT (i.e. on wall), power block beneath + { + BLOCKTYPE Type = m_Chunk->GetBlock(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ); + + if (IsMechanism(Type)) // Still can't make a normal block powered though! + { + SetBlockPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ); + } + } + } + else + { + // Check if the block the torch is on is powered + int X = a_RelBlockX; int Y = a_RelBlockY; int Z = a_RelBlockZ; + AddFaceDirection(X, Y, Z, GetHandlerCompileTime<E_BLOCK_TORCH>::type::MetaDataToDirection(m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ)), true); // Inverse true to get the block torch is on + + ChunkType * Neighbour = m_Chunk->GetRelNeighborChunk(X, Z); + if ((Neighbour == NULL) || !Neighbour->IsValid()) + { + return; + } + + // See if off state torch can be turned on again + if (AreCoordsDirectlyPowered(X, Y, Z, Neighbour)) + { + return; // Something matches, torch still powered + } + + // Block torch on not powered, can be turned on again! + m_Chunk->SetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_BLOCK_REDSTONE_TORCH_ON, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ)); + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleRedstoneBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + SetBlockPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ); // Set self as powered +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleRedstoneLever(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + NIBBLETYPE Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + if (IsLeverOn(Meta)) + { + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + + eBlockFace Dir = GetHandlerCompileTime<E_BLOCK_LEVER>::type::BlockMetaDataToBlockFace(Meta); + + Dir = ReverseBlockFace(Dir); + + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, Dir); + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleFenceGate(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + NIBBLETYPE MetaData = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + + if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) + { + if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true)) + { + if ((MetaData & 0x4) == 0) + { + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, MetaData | 0x4); + m_Chunk->BroadcastSoundParticleEffect(1003, BlockX, a_RelBlockY, BlockZ, 0); + } + SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true); + } + } + else + { + if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false)) + { + if ((MetaData & 0x4) != 0) + { + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, MetaData & ~0x04); + m_Chunk->BroadcastSoundParticleEffect(1003, BlockX, a_RelBlockY, BlockZ, 0); + } + SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false); + } + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleRedstoneButton(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + NIBBLETYPE Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + if (IsButtonOn(Meta)) + { + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + + eBlockFace Dir = GetHandlerCompileTime<E_BLOCK_STONE_BUTTON>::type::BlockMetaDataToBlockFace(Meta); + Dir = ReverseBlockFace(Dir); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, Dir); + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleRedstoneWire(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + static const struct // Define which directions the wire can receive power from + { + int x, y, z; + } gCrossCoords[] = + { + { 1, 0, 0}, /* Wires on same level start */ + {-1, 0, 0}, + { 0, 0, 1}, + { 0, 0, -1}, /* Wires on same level stop */ + { 1, 1, 0}, /* Wires one higher, surrounding self start */ + {-1, 1, 0}, + { 0, 1, 1}, + { 0, 1, -1}, /* Wires one higher, surrounding self stop */ + { 1, -1, 0}, /* Wires one lower, surrounding self start */ + {-1, -1, 0}, + { 0, -1, 1}, + { 0, -1, -1}, /* Wires one lower, surrounding self stop */ + } ; + + static const struct // Define which directions the wire will check for repeater prescence + { + int x, y, z; + } gSideCoords[] = + { + { 1, 0, 0 }, + {-1, 0, 0 }, + { 0, 0, 1 }, + { 0, 0, -1 }, + { 0, 1, 0 }, + }; + + // Check to see if directly beside a power source + unsigned char MyPower; + if (!IsWirePowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower)) + { + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, 0); + this->m_World.WakeUpSimulators(BlockX, a_RelBlockY, BlockZ); + return; + } + + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + + if (MyPower < 1) + { + return; + } + + MyPower--; + + for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++) // Loop through all directions to transfer or receive power + { + if ((i >= 4) && (i <= 7)) // If we are currently checking for wire surrounding ourself one block above... + { + BLOCKTYPE Type = 0; + if (a_RelBlockY + 1 >= cChunkDef::Height) + { + continue; + } + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, Type)) + { + continue; + } + if (cBlockInfo::IsSolid(Type)) // If there is something solid above us (wire cut off)... + { + continue; // We don't receive power from that wire + } + } + else if ((i >= 8) && (i <= 11)) // See above, but this is for wire below us + { + BLOCKTYPE Type = 0; + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY, a_RelBlockZ + gCrossCoords[i].z, Type)) + { + continue; + } + if (cBlockInfo::IsSolid(Type)) + { + continue; + } + } + + BLOCKTYPE Type = 0; + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, Type)) + { + continue; + } + if (Type == E_BLOCK_REDSTONE_WIRE) + { + SetBlockPowered(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + } + } + + for (size_t i = 0; i < ARRAYCOUNT(gSideCoords); i++) // Look for repeaters immediately surrounding self and try to power them + { + BLOCKTYPE Type = 0; + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + gSideCoords[i].x, a_RelBlockY + gSideCoords[i].y, a_RelBlockZ + gSideCoords[i].z, Type)) + { + continue; + } + if (Type == E_BLOCK_REDSTONE_REPEATER_OFF) + { + SetBlockPowered(a_RelBlockX + gSideCoords[i].x, a_RelBlockY + gSideCoords[i].y, a_RelBlockZ + gSideCoords[i].z, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + } + } + + // Wire still powered, power blocks beneath + SetBlockPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YM, MyPower); + + switch (GetWireDirection(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) + { + case REDSTONE_NONE: + { + SetBlockPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + SetBlockPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + SetBlockPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + SetBlockPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_XM, MyPower); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_XP, MyPower); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_ZM, MyPower); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_ZP, MyPower); + break; + } + case REDSTONE_X_POS: + { + SetBlockPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_XP, MyPower); + break; + } + case REDSTONE_X_NEG: + { + SetBlockPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_XM, MyPower); + break; + } + case REDSTONE_Z_POS: + { + SetBlockPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_ZP, MyPower); + break; + } + case REDSTONE_Z_NEG: + { + SetBlockPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MyPower); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_ZM, MyPower); + break; + } + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleRedstoneRepeater(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState) +{ + /* Repeater Orientation Mini Guide: + =================================== + + | + | Z Axis + V + + X Axis ----> + + Repeater directions, values from a WorldType::GetBlockMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) lookup: + + East (Right) (X+): 0x1 + West (Left) (X-): 0x3 + North (Up) (Z-): 0x2 + South (Down) (Z+): 0x0 + // TODO: Add E_META_XXX enum entries for all meta values and update project with them + + Sun rises from East (X+) + + */ + + // Create a variable holding my meta to avoid multiple lookups. + NIBBLETYPE a_Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + bool IsOn = (a_MyState == E_BLOCK_REDSTONE_REPEATER_ON); + + if (!IsRepeaterLocked(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_Meta)) // If we're locked, change nothing. Otherwise: + { + bool IsSelfPowered = IsRepeaterPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_Meta); + if (IsSelfPowered && !IsOn) // Queue a power change if powered, but not on and not locked. + { + QueueRepeaterPowerChange(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_Meta, true); + } + else if (!IsSelfPowered && IsOn) // Queue a power change if unpowered, on, and not locked. + { + QueueRepeaterPowerChange(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_Meta, false); + } + } +} + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleRedstoneRepeaterDelays() +{ + for (typename RepeatersDelayList::iterator itr = m_RepeatersDelayList->begin(); itr != m_RepeatersDelayList->end();) + { + if (itr->a_ElapsedTicks >= itr->a_DelayTicks) // Has the elapsed ticks reached the target ticks? + { + int RelBlockX = itr->a_RelBlockPos.x; + int RelBlockY = itr->a_RelBlockPos.y; + int RelBlockZ = itr->a_RelBlockPos.z; + BLOCKTYPE Block; + NIBBLETYPE Meta; + m_Chunk->GetBlockTypeMeta(RelBlockX, RelBlockY, RelBlockZ, Block, Meta); + if (itr->ShouldPowerOn) + { + if (Block != E_BLOCK_REDSTONE_REPEATER_ON) // For performance + { + m_Chunk->SetBlock(itr->a_RelBlockPos, E_BLOCK_REDSTONE_REPEATER_ON, Meta); + } + + switch (Meta & 0x3) // We only want the direction (bottom) bits + { + case 0x0: + { + SetBlockPowered(RelBlockX, RelBlockY, RelBlockZ - 1, RelBlockX, RelBlockY, RelBlockZ); + SetDirectionLinkedPowered(RelBlockX, RelBlockY, RelBlockZ, BLOCK_FACE_ZM); + break; + } + case 0x1: + { + SetBlockPowered(RelBlockX + 1, RelBlockY, RelBlockZ, RelBlockX, RelBlockY, RelBlockZ); + SetDirectionLinkedPowered(RelBlockX, RelBlockY, RelBlockZ, BLOCK_FACE_XP); + break; + } + case 0x2: + { + SetBlockPowered(RelBlockX, RelBlockY, RelBlockZ + 1, RelBlockX, RelBlockY, RelBlockZ); + SetDirectionLinkedPowered(RelBlockX, RelBlockY, RelBlockZ, BLOCK_FACE_ZP); + break; + } + case 0x3: + { + SetBlockPowered(RelBlockX - 1, RelBlockY, RelBlockZ, RelBlockX, RelBlockY, RelBlockZ); + SetDirectionLinkedPowered(RelBlockX, RelBlockY, RelBlockZ, BLOCK_FACE_XM); + break; + } + } + } + else if (Block != E_BLOCK_REDSTONE_REPEATER_OFF) + { + m_Chunk->SetBlock(RelBlockX, RelBlockY, RelBlockZ, E_BLOCK_REDSTONE_REPEATER_OFF, Meta); + } + itr = m_RepeatersDelayList->erase(itr); + } + else + { + LOGD("Incremented a repeater @ {%i %i %i} | Elapsed ticks: %i | Target delay: %i", itr->a_RelBlockPos.x, itr->a_RelBlockPos.y, itr->a_RelBlockPos.z, itr->a_ElapsedTicks, itr->a_DelayTicks); + itr->a_ElapsedTicks++; + itr++; + } + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandlePiston(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + + if (IsPistonPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x7)) // We only want the bottom three bits (4th controls extended-ness) + { + GetHandlerCompileTime<E_BLOCK_PISTON>::type::ExtendPiston(BlockX, a_RelBlockY, BlockZ, &this->m_World); + } + else + { + GetHandlerCompileTime<E_BLOCK_PISTON>::type::RetractPiston(BlockX, a_RelBlockY, BlockZ, &this->m_World); + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleDropSpenser(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + class cSetPowerToDropSpenser : + public cRedstonePoweredCallback + { + bool m_IsPowered; + public: + cSetPowerToDropSpenser(bool a_IsPowered) : m_IsPowered(a_IsPowered) {} + + virtual bool Item(cRedstonePoweredEntity * a_DropSpenser) override + { + a_DropSpenser->SetRedstonePower(m_IsPowered); + return false; + } + } DrSpSP (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)); + + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + m_Chunk->DoWithRedstonePoweredEntityAt(BlockX, a_RelBlockY, BlockZ, DrSpSP); +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleRedstoneLamp(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyState) +{ + if (a_MyState == E_BLOCK_REDSTONE_LAMP_OFF) + { + if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) + { + m_Chunk->SetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_BLOCK_REDSTONE_LAMP_ON, 0); + } + } + else + { + if (!AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) + { + m_Chunk->SetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_BLOCK_REDSTONE_LAMP_OFF, 0); + } + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleTNT(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + + if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) + { + m_Chunk->BroadcastSoundEffect("game.tnt.primed", (double)BlockX, (double)a_RelBlockY, (double)BlockZ, 0.5f, 0.6f); + m_Chunk->SetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_BLOCK_AIR, 0); + this->m_World.SpawnPrimedTNT(BlockX + 0.5, a_RelBlockY + 0.5, BlockZ + 0.5); // 80 ticks to boom + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleDoor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + + typedef typename GetHandlerCompileTime<E_BLOCK_WOODEN_DOOR>::type DoorHandler; + + if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) + { + if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true)) + { + cChunkInterface ChunkInterface(this->m_World.GetChunkMap()); + if (!DoorHandler::IsOpen(ChunkInterface, BlockX, a_RelBlockY, BlockZ)) + { + DoorHandler::SetOpen(ChunkInterface, BlockX, a_RelBlockY, BlockZ, true); + m_Chunk->BroadcastSoundParticleEffect(1003, BlockX, a_RelBlockY, BlockZ, 0); + } + SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true); + } + } + else + { + if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false)) + { + cChunkInterface ChunkInterface(this->m_World.GetChunkMap()); + if (DoorHandler::IsOpen(ChunkInterface, BlockX, a_RelBlockY, BlockZ)) + { + DoorHandler::SetOpen(ChunkInterface, BlockX, a_RelBlockY, BlockZ, false); + m_Chunk->BroadcastSoundParticleEffect(1003, BlockX, a_RelBlockY, BlockZ, 0); + } + SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false); + } + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleCommandBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + class cSetPowerToCommandBlock : + public cRedstonePoweredCallback + { + bool m_IsPowered; + public: + cSetPowerToCommandBlock(bool a_IsPowered) : m_IsPowered(a_IsPowered) {} + + virtual bool Item(cRedstonePoweredEntity * a_CommandBlock) override + { + a_CommandBlock->SetRedstonePower(m_IsPowered); + return false; + } + } CmdBlockSP (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)); + + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + m_Chunk->DoWithRedstonePoweredEntityAt(BlockX, a_RelBlockY, BlockZ, CmdBlockSP); +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleRail(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyType) +{ + switch (a_MyType) + { + case E_BLOCK_DETECTOR_RAIL: + { + if ((m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x08) == 0x08) + { + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_MyType); + } + break; + } + case E_BLOCK_ACTIVATOR_RAIL: + case E_BLOCK_POWERED_RAIL: + { + if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) + { + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) | 0x08); + } + else + { + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x07); + } + break; + } + default: LOGD("Unhandled type of rail in %s", __FUNCTION__); + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleTrapdoor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + + if (AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ)) + { + if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true)) + { + this->m_World.SetTrapdoorOpen(BlockX, a_RelBlockY, BlockZ, true); + SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true); + } + } + else + { + if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false)) + { + this->m_World.SetTrapdoorOpen(BlockX, a_RelBlockY, BlockZ, false); + SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false); + } + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleNoteBlock(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + bool m_bAreCoordsPowered = AreCoordsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + + if (m_bAreCoordsPowered) + { + if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true)) + { + class cSetPowerToNoteBlock : + public cRedstonePoweredCallback + { + public: + cSetPowerToNoteBlock() {} + + virtual bool Item(cRedstonePoweredEntity * a_NoteBlock) override + { + a_NoteBlock->SetRedstonePower(true); + return false; + } + } NoteBlockSP; + + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + m_Chunk->DoWithRedstonePoweredEntityAt(BlockX, a_RelBlockY, BlockZ, NoteBlockSP); + SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, true); + } + } + else + { + if (!AreCoordsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false)) + { + SetPlayerToggleableBlockAsSimulated(a_RelBlockX, a_RelBlockY, a_RelBlockZ, false); + } + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleDaylightSensor(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX, BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + int ChunkX, ChunkZ; + cChunkDef::BlockToChunk(BlockX, BlockZ, ChunkX, ChunkZ); + + if (!this->m_World.IsChunkLighted(ChunkX, ChunkZ)) + { + this->m_World.QueueLightChunk(ChunkX, ChunkZ); + } + else + { + if (m_Chunk->GetTimeAlteredLight(this->m_World.GetBlockSkyLight(BlockX, a_RelBlockY + 1, BlockZ)) > 8) + { + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + } + else + { + WakeUp(BlockX, a_RelBlockY, BlockZ, m_Chunk); + } + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandlePressurePlate(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, BLOCKTYPE a_MyType) +{ + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + + switch (a_MyType) + { + case E_BLOCK_STONE_PRESSURE_PLATE: + { + // MCS feature - stone pressure plates can only be triggered by players :D + cPlayer * a_Player = this->m_World.FindClosestPlayer(Vector3f(BlockX + 0.5f, (float)a_RelBlockY, BlockZ + 0.5f), 0.5f, false); + + if (a_Player != NULL) + { + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, 0x1); + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YM, a_MyType); + } + else + { + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, 0x0); + SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); + } + break; + } + case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: + { + class cPressurePlateCallback : + public cEntityCallback + { + public: + cPressurePlateCallback(int a_BlockX, int a_BlockY, int a_BlockZ) : + m_NumberOfEntities(0), + m_X(a_BlockX), + m_Y(a_BlockY), + m_Z(a_BlockZ) + { + } + + virtual bool Item(cEntity * a_Entity) override + { + Vector3f EntityPos = a_Entity->GetPosition(); + Vector3f BlockPos(m_X + 0.5f, (float)m_Y, m_Z + 0.5f); + double Distance = (EntityPos - BlockPos).Length(); + + if (Distance <= 0.5) + { + m_NumberOfEntities++; + } + return false; + } + + bool GetPowerLevel(unsigned char & a_PowerLevel) const + { + a_PowerLevel = std::min(m_NumberOfEntities, MAX_POWER_LEVEL); + return (a_PowerLevel > 0); + } + + protected: + int m_NumberOfEntities; + + int m_X; + int m_Y; + int m_Z; + }; + + cPressurePlateCallback PressurePlateCallback(BlockX, a_RelBlockY, BlockZ); + this->m_World.ForEachEntityInChunk(m_Chunk->GetPosX(), m_Chunk->GetPosZ(), PressurePlateCallback); + + unsigned char Power; + NIBBLETYPE Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + if (PressurePlateCallback.GetPowerLevel(Power)) + { + if (Meta == E_META_PRESSURE_PLATE_RAISED) + { + m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.5F); + } + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_DEPRESSED); + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, Power); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YM, a_MyType); + } + else + { + if (Meta == E_META_PRESSURE_PLATE_DEPRESSED) + { + m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.6F); + } + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_RAISED); + SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); + } + + break; + } + case E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE: + { + class cPressurePlateCallback : + public cEntityCallback + { + public: + cPressurePlateCallback(int a_BlockX, int a_BlockY, int a_BlockZ) : + m_NumberOfEntities(0), + m_X(a_BlockX), + m_Y(a_BlockY), + m_Z(a_BlockZ) + { + } + + virtual bool Item(cEntity * a_Entity) override + { + Vector3f EntityPos = a_Entity->GetPosition(); + Vector3f BlockPos(m_X + 0.5f, (float)m_Y, m_Z + 0.5f); + double Distance = (EntityPos - BlockPos).Length(); + + if (Distance <= 0.5) + { + m_NumberOfEntities++; + } + return false; + } + + bool GetPowerLevel(unsigned char & a_PowerLevel) const + { + a_PowerLevel = std::min((int)ceil(m_NumberOfEntities / 10.f), MAX_POWER_LEVEL); + return (a_PowerLevel > 0); + } + + protected: + int m_NumberOfEntities; + + int m_X; + int m_Y; + int m_Z; + }; + + cPressurePlateCallback PressurePlateCallback(BlockX, a_RelBlockY, BlockZ); + this->m_World.ForEachEntityInChunk(m_Chunk->GetPosX(), m_Chunk->GetPosZ(), PressurePlateCallback); + + unsigned char Power; + NIBBLETYPE Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + if (PressurePlateCallback.GetPowerLevel(Power)) + { + if (Meta == E_META_PRESSURE_PLATE_RAISED) + { + m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.5F); + } + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_DEPRESSED); + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, Power); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YM, a_MyType); + } + else + { + if (Meta == E_META_PRESSURE_PLATE_DEPRESSED) + { + m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.6F); + } + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_RAISED); + SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); + } + + break; + } + case E_BLOCK_WOODEN_PRESSURE_PLATE: + { + class cPressurePlateCallback : + public cEntityCallback + { + public: + cPressurePlateCallback(int a_BlockX, int a_BlockY, int a_BlockZ) : + m_FoundEntity(false), + m_X(a_BlockX), + m_Y(a_BlockY), + m_Z(a_BlockZ) + { + } + + virtual bool Item(cEntity * a_Entity) override + { + Vector3f EntityPos = a_Entity->GetPosition(); + Vector3f BlockPos(m_X + 0.5f, (float)m_Y, m_Z + 0.5f); + double Distance = (EntityPos - BlockPos).Length(); + + if (Distance <= 0.5) + { + m_FoundEntity = true; + return true; // Break out, we only need to know for plates that at least one entity is on top + } + return false; + } + + bool FoundEntity(void) const + { + return m_FoundEntity; + } + + protected: + bool m_FoundEntity; + + int m_X; + int m_Y; + int m_Z; + } ; + + cPressurePlateCallback PressurePlateCallback(BlockX, a_RelBlockY, BlockZ); + this->m_World.ForEachEntityInChunk(m_Chunk->GetPosX(), m_Chunk->GetPosZ(), PressurePlateCallback); + + NIBBLETYPE Meta = m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + if (PressurePlateCallback.FoundEntity()) + { + if (Meta == E_META_PRESSURE_PLATE_RAISED) + { + m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.5F); + } + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_DEPRESSED); + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + SetDirectionLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, BLOCK_FACE_YM, a_MyType); + } + else + { + if (Meta == E_META_PRESSURE_PLATE_DEPRESSED) + { + m_Chunk->BroadcastSoundEffect("random.click", (double)BlockX + 0.5, (double)a_RelBlockY + 0.1, (double)BlockZ + 0.5, 0.3F, 0.6F); + } + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, E_META_PRESSURE_PLATE_RAISED); + SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); + } + break; + } + default: + { + LOGD("Unimplemented pressure plate type %s in cRedstoneSimulator", ItemToFullString(cItem(a_MyType)).c_str()); + break; + } + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleTripwireHook(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + int BlockX = m_Chunk->GetPosX() * cChunkDef::Width + a_RelBlockX; + int BlockZ = m_Chunk->GetPosZ() * cChunkDef::Width + a_RelBlockZ; + int RelX = a_RelBlockX, RelZ = a_RelBlockZ; + bool FoundActivated = false; + eBlockFace FaceToGoTowards = GetHandlerCompileTime<E_BLOCK_TRIPWIRE_HOOK>::type::MetadataToDirection(m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ)); + + for (int i = 0; i < 40; ++i) // Tripwires can be connected up to 40 blocks + { + BLOCKTYPE Type; + NIBBLETYPE Meta; + + AddFaceDirection(RelX, a_RelBlockY, RelZ, FaceToGoTowards); + m_Chunk->UnboundedRelGetBlock(RelX, a_RelBlockY, RelZ, Type, Meta); + + if (Type == E_BLOCK_TRIPWIRE) + { + if (Meta == 0x1) + { + FoundActivated = true; + } + } + else if (Type == E_BLOCK_TRIPWIRE_HOOK) + { + if (ReverseBlockFace( GetHandlerCompileTime<E_BLOCK_TRIPWIRE_HOOK>::type::MetadataToDirection(Meta)) == FaceToGoTowards) + { + // Other hook facing in opposite direction - circuit completed! + break; + } + else + { + // Tripwire hook not connected at all, AND away all the power state bits + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x3); + SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); + return; + } + } + else + { + // Tripwire hook not connected at all, AND away all the power state bits + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x3); + SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); + return; + } + } + + if (FoundActivated) + { + // Connected and activated, set the 3rd and 4th highest bits + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) | 0xC); + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + } + else + { + // Connected but not activated, AND away the highest bit + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, (m_Chunk->GetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ) & 0x7) | 0x4); + SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); + } +} + +template <class ChestType> +class cGetTrappedChestPlayers : + public cItemCallback<ChestType> +{ +public: + cGetTrappedChestPlayers(void) : + m_NumberOfPlayers(0) + { + } + + virtual ~cGetTrappedChestPlayers() + { + } + + virtual bool Item(ChestType * a_Chest) override + { + ASSERT(a_Chest->GetBlockType() == E_BLOCK_TRAPPED_CHEST); + m_NumberOfPlayers = a_Chest->GetNumberOfPlayers(); + return (m_NumberOfPlayers <= 0); + } + + unsigned char GetPowerLevel(void) const + { + return std::min(m_NumberOfPlayers, MAX_POWER_LEVEL); + } + +private: + int m_NumberOfPlayers; + +}; + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleTrappedChest(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + cGetTrappedChestPlayers<ChestType> GTCP; + + int BlockX = m_Chunk->GetPosX() * cChunkDef::Width + a_RelBlockX; + int BlockZ = m_Chunk->GetPosZ() * cChunkDef::Width + a_RelBlockZ; + if (m_Chunk->DoWithChestAt(BlockX, a_RelBlockY, BlockZ, GTCP)) + { + SetAllDirsAsPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ, GTCP.GetPowerLevel()); + } + else + { + SetSourceUnpowered(BlockX, a_RelBlockY, BlockZ, m_Chunk); + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::HandleTripwire(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + int BlockX = m_Chunk->GetPosX() * cChunkDef::Width + a_RelBlockX; + int BlockZ = m_Chunk->GetPosZ() * cChunkDef::Width + a_RelBlockZ; + + class cTripwireCallback : + public cEntityCallback + { + public: + cTripwireCallback(int a_BlockX, int a_BlockY, int a_BlockZ) : + m_FoundEntity(false), + m_X(a_BlockX), + m_Y(a_BlockY), + m_Z(a_BlockZ) + { + } + + virtual bool Item(cEntity * a_Entity) override + { + cBoundingBox bbWire(m_X, m_X + 1, m_Y, m_Y + 0.1, m_Z, m_Z + 1); + cBoundingBox bbEntity(a_Entity->GetPosition(), a_Entity->GetWidth() / 2, a_Entity->GetHeight()); + + if (bbEntity.DoesIntersect(bbWire)) + { + m_FoundEntity = true; + return true; // One entity is sufficient to trigger the wire + } + return false; + } + + bool FoundEntity(void) const + { + return m_FoundEntity; + } + + protected: + bool m_FoundEntity; + + int m_X; + int m_Y; + int m_Z; + }; + + cTripwireCallback TripwireCallback(BlockX, a_RelBlockY, BlockZ); + this->m_World.ForEachEntityInChunk(m_Chunk->GetPosX(), m_Chunk->GetPosZ(), TripwireCallback); + + if (TripwireCallback.FoundEntity()) + { + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, 0x1); + } + else + { + m_Chunk->SetMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, 0x0); + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +bool cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::AreCoordsDirectlyPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, ChunkType * a_Chunk) +{ + // Torches want to access neighbour's data when on a wall, hence the extra chunk parameter + + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + + for (typename PoweredBlocksList::const_iterator itr = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_PoweredBlocks.begin(); itr != ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_PoweredBlocks.end(); ++itr) // Check powered list + { + if (itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) + { + return true; + } + } + return false; +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +bool cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::AreCoordsLinkedPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + + for (typename LinkedBlocksList::const_iterator itr = m_LinkedPoweredBlocks->begin(); itr != m_LinkedPoweredBlocks->end(); ++itr) // Check linked powered list + { + if (itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) + { + return true; + } + } + return false; +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +bool cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::IsRepeaterPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta) +{ + // Repeaters cannot be powered by any face except their back; verify that this is true for a source + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + + for (typename PoweredBlocksList::const_iterator itr = m_PoweredBlocks->begin(); itr != m_PoweredBlocks->end(); ++itr) + { + if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) { continue; } + + switch (a_Meta & 0x3) + { + case 0x0: + { + // Flip the coords to check the back of the repeater + if (itr->a_SourcePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ + 1))) { return true; } + break; + } + case 0x1: + { + if (itr->a_SourcePos.Equals(Vector3i(BlockX - 1, a_RelBlockY, BlockZ))) { return true; } + break; + } + case 0x2: + { + if (itr->a_SourcePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ - 1))) { return true; } + break; + } + case 0x3: + { + if (itr->a_SourcePos.Equals(Vector3i(BlockX + 1, a_RelBlockY, BlockZ))) { return true; } + break; + } + } + } + + for (typename LinkedBlocksList::const_iterator itr = m_LinkedPoweredBlocks->begin(); itr != m_LinkedPoweredBlocks->end(); ++itr) + { + if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) { continue; } + + switch (a_Meta & 0x3) + { + case 0x0: + { + if (itr->a_MiddlePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ + 1))) { return true; } + break; + } + case 0x1: + { + if (itr->a_MiddlePos.Equals(Vector3i(BlockX - 1, a_RelBlockY, BlockZ))) { return true; } + break; + } + case 0x2: + { + if (itr->a_MiddlePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ - 1))) { return true; } + break; + } + case 0x3: + { + if (itr->a_MiddlePos.Equals(Vector3i(BlockX + 1, a_RelBlockY, BlockZ))) { return true; } + break; + } + } + } + return false; // Couldn't find power source behind repeater +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +bool cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::IsRepeaterLocked(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta) +{ + switch (a_Meta & 0x3) // We only want the 'direction' part of our metadata + { + // If the repeater is looking up or down (If parallel to the Z axis) + case 0x0: + case 0x2: + { + // Check if eastern(right) neighbor is a powered on repeater who is facing us + BLOCKTYPE Block = 0; + NIBBLETYPE OtherRepeaterDir = 0; + if (m_Chunk->UnboundedRelGetBlock(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, Block, OtherRepeaterDir) && (Block == E_BLOCK_REDSTONE_REPEATER_ON)) // Is right neighbor a powered repeater? + { + if ((OtherRepeaterDir & 0x03) == 0x3) + { + return true; + } // If so, I am latched/locked + } + + // Check if western(left) neighbor is a powered on repeater who is facing us + if (m_Chunk->UnboundedRelGetBlock(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, Block, OtherRepeaterDir) && (Block == E_BLOCK_REDSTONE_REPEATER_ON)) + { + NIBBLETYPE OtherRepeaterDir = m_Chunk->GetMeta(a_RelBlockX -1, a_RelBlockY, a_RelBlockZ) & 0x3; + if ((OtherRepeaterDir & 0x03) == 0x1) + { + return true; + } // If so, I am latched/locked + } + + break; + } + + // If the repeater is looking left or right (If parallel to the x axis) + case 0x1: + case 0x3: + { + // Check if southern(down) neighbor is a powered on repeater who is facing us + BLOCKTYPE Block = 0; + NIBBLETYPE OtherRepeaterDir = 0; + + if (m_Chunk->UnboundedRelGetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, Block, OtherRepeaterDir) && (Block == E_BLOCK_REDSTONE_REPEATER_ON)) + { + if ((OtherRepeaterDir & 0x30 ) == 0x00) + { + return true; + } // If so, am latched/locked + } + + // Check if northern(up) neighbor is a powered on repeater who is facing us + if (m_Chunk->UnboundedRelGetBlock(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, Block, OtherRepeaterDir) && (Block == E_BLOCK_REDSTONE_REPEATER_ON)) + { + if ((OtherRepeaterDir & 0x03) == 0x02) + { + return true; + } // If so, I am latched/locked + } + + break; + } + } + + return false; // None of the checks succeeded, I am not a locked repeater +} + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +bool cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::IsPistonPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta) +{ + // Pistons cannot be powered through their front face; this function verifies that a source meets this requirement + + eBlockFace Face = GetHandlerCompileTime<E_BLOCK_PISTON>::type::MetaDataToDirection(a_Meta); + int BlockX = m_Chunk->GetPosX() * cChunkDef::Width + a_RelBlockX; + int BlockZ = m_Chunk->GetPosZ() * cChunkDef::Width + a_RelBlockZ; + + for (typename PoweredBlocksList::const_iterator itr = m_PoweredBlocks->begin(); itr != m_PoweredBlocks->end(); ++itr) + { + if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) { continue; } + + AddFaceDirection(BlockX, a_RelBlockY, BlockZ, Face); + + if (!itr->a_SourcePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) + { + return true; + } + + AddFaceDirection(BlockX, a_RelBlockY, BlockZ, Face, true); + } + + for (typename LinkedBlocksList::const_iterator itr = m_LinkedPoweredBlocks->begin(); itr != m_LinkedPoweredBlocks->end(); ++itr) + { + if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) { continue; } + + AddFaceDirection(BlockX, a_RelBlockY, BlockZ, Face); + + if (!itr->a_MiddlePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) + { + return true; + } + + AddFaceDirection(BlockX, a_RelBlockY, BlockZ, Face, true); + } + return false; // Source was in front of the piston's front face +} + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +bool cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::IsWirePowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, unsigned char & a_PowerLevel) +{ + a_PowerLevel = 0; + int BlockX = m_Chunk->GetPosX() * cChunkDef::Width + a_RelBlockX; + int BlockZ = m_Chunk->GetPosZ() * cChunkDef::Width + a_RelBlockZ; + + for (typename PoweredBlocksList::const_iterator itr = m_PoweredBlocks->begin(); itr != m_PoweredBlocks->end(); ++itr) // Check powered list + { + if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) + { + continue; + } + a_PowerLevel = std::max(itr->a_PowerLevel, a_PowerLevel); // Get the highest power level (a_PowerLevel is initialised already and there CAN be multiple levels for one block) + } + + for (typename LinkedBlocksList::const_iterator itr = m_LinkedPoweredBlocks->begin(); itr != m_LinkedPoweredBlocks->end(); ++itr) // Check linked powered list + { + if (!itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ))) + { + continue; + } + + BLOCKTYPE Type = E_BLOCK_AIR; + int RelSourceX = itr->a_SourcePos.x - m_Chunk->GetPosX() * cChunkDef::Width; + int RelSourceZ = itr->a_SourcePos.z - m_Chunk->GetPosZ() * cChunkDef::Width; + if (!m_Chunk->UnboundedRelGetBlockType(RelSourceX, itr->a_SourcePos.y, RelSourceZ, Type) || (Type == E_BLOCK_REDSTONE_WIRE)) + { + continue; + } + a_PowerLevel = std::max(itr->a_PowerLevel, a_PowerLevel); + } + + return (a_PowerLevel != 0); // Answer the inital question: is the wire powered? +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +bool cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::AreCoordsSimulated(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, bool IsCurrentStatePowered) +{ + for (typename SimulatedPlayerToggleableList::const_iterator itr = m_SimulatedPlayerToggleableBlocks->begin(); itr != m_SimulatedPlayerToggleableBlocks->end(); ++itr) + { + if (itr->a_RelBlockPos.Equals(Vector3i(a_RelBlockX, a_RelBlockY, a_RelBlockZ))) + { + if (itr->WasLastStatePowered != IsCurrentStatePowered) // Was the last power state different to the current? + { + return false; // It was, coordinates are no longer simulated + } + else + { + return true; // It wasn't, don't resimulate block, and allow players to toggle + } + } + } + return false; // Block wasn't even in the list, not simulated +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::SetDirectionLinkedPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, char a_Direction, unsigned char a_PowerLevel) +{ + BLOCKTYPE MiddleBlock = 0; + switch (a_Direction) + { + case BLOCK_FACE_XM: + { + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, MiddleBlock)) + { + return; + } + + SetBlockLinkedPowered(a_RelBlockX - 2, a_RelBlockY, a_RelBlockZ, a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + + break; + } + case BLOCK_FACE_XP: + { + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, MiddleBlock)) + { + return; + } + + SetBlockLinkedPowered(a_RelBlockX + 2, a_RelBlockY, a_RelBlockZ, a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + + break; + } + case BLOCK_FACE_YM: + { + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, MiddleBlock)) + { + return; + } + + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY - 2, a_RelBlockZ, a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + + break; + } + case BLOCK_FACE_YP: + { + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, MiddleBlock)) + { + return; + } + + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY + 2, a_RelBlockZ, a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + + break; + } + case BLOCK_FACE_ZM: + { + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, MiddleBlock)) + { + return; + } + + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 2, a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + + break; + } + case BLOCK_FACE_ZP: + { + if (!m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, MiddleBlock)) + { + return; + } + + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 2, a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY + 1, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + SetBlockLinkedPowered(a_RelBlockX, a_RelBlockY - 1, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, a_RelBlockX, a_RelBlockY, a_RelBlockZ, MiddleBlock, a_PowerLevel); + + break; + } + default: + { + ASSERT(!"Unhandled face direction when attempting to set blocks as linked powered!"); // Zombies, that wasn't supposed to happen... + break; + } + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::SetAllDirsAsPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, unsigned char a_PowerLevel) +{ + static const struct + { + int x, y, z; + } gCrossCoords[] = + { + { 1, 0, 0 }, + { -1, 0, 0 }, + { 0, 0, 1 }, + { 0, 0, -1 }, + { 0, 1, 0 }, + { 0, -1, 0 } + }; + + for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++) // Loop through struct to power all directions + { + SetBlockPowered(a_RelBlockX + gCrossCoords[i].x, a_RelBlockY + gCrossCoords[i].y, a_RelBlockZ + gCrossCoords[i].z, a_RelBlockX, a_RelBlockY, a_RelBlockZ, a_PowerLevel); + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::SetBlockPowered(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, int a_RelSourceX, int a_RelSourceY, int a_RelSourceZ, unsigned char a_PowerLevel) +{ + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + int SourceX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelSourceX; + int SourceZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelSourceZ; + + ChunkType * Neighbour = m_Chunk->GetRelNeighborChunkAdjustCoords(a_RelBlockX, a_RelBlockZ); // Adjust coordinates for the later call using these values + if ((Neighbour == NULL) || !Neighbour->IsValid()) + { + return; + } + + PoweredBlocksList & Powered = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)Neighbour->GetRedstoneSimulatorData())->m_PoweredBlocks; // We need to insert the value into the chunk who owns the block position + for (typename PoweredBlocksList::iterator itr = Powered.begin(); itr != Powered.end(); ++itr) + { + if ( + itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ)) && + itr->a_SourcePos.Equals(Vector3i(SourceX, a_RelSourceY, SourceZ)) + ) + { + // Check for duplicates, update power level, don't add a new listing + itr->a_PowerLevel = a_PowerLevel; + return; + } + } + + // No need to get neighbouring chunk as we can guarantee that when something is powering us, the entry will be in our chunk + // TODO: on C++11 support, change this to a llama function pased to a std::remove_if + for (typename PoweredBlocksList::iterator itr = m_PoweredBlocks->begin(); itr != m_PoweredBlocks->end(); ++itr) + { + if ( + itr->a_BlockPos.Equals(Vector3i(SourceX, a_RelSourceY, SourceZ)) && + itr->a_SourcePos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ)) && + (m_Chunk->GetBlock(a_RelSourceX, a_RelSourceY, a_RelSourceZ) == E_BLOCK_REDSTONE_WIRE) + ) + { + BLOCKTYPE Block; + NIBBLETYPE Meta; + Neighbour->GetBlockTypeMeta(a_RelBlockX, a_RelBlockY, a_RelBlockZ, Block, Meta); + + if (Block == E_BLOCK_REDSTONE_WIRE) + { + if (Meta < a_PowerLevel) + { + m_PoweredBlocks->erase(itr); // Powering source with higher power level, allow it + break; + } + else + { + // Powered wires try to power their source - don't let them! + return; + } + } + } + } + + sPoweredBlocks RC; + RC.a_BlockPos = Vector3i(BlockX, a_RelBlockY, BlockZ); + RC.a_SourcePos = Vector3i(SourceX, a_RelSourceY, SourceZ); + RC.a_PowerLevel = a_PowerLevel; + Powered.push_back(RC); + Neighbour->SetIsRedstoneDirty(true); + m_Chunk->SetIsRedstoneDirty(true); +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::SetBlockLinkedPowered( + int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, + int a_RelMiddleX, int a_RelMiddleY, int a_RelMiddleZ, + int a_RelSourceX, int a_RelSourceY, int a_RelSourceZ, + BLOCKTYPE a_MiddleBlock, unsigned char a_PowerLevel + ) +{ + int BlockX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelBlockX; + int BlockZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelBlockZ; + int MiddleX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelMiddleX; + int MiddleZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelMiddleZ; + int SourceX = (m_Chunk->GetPosX() * cChunkDef::Width) + a_RelSourceX; + int SourceZ = (m_Chunk->GetPosZ() * cChunkDef::Width) + a_RelSourceZ; + + if (!IsViableMiddleBlock(a_MiddleBlock)) + { + return; + } + + ChunkType * Neighbour = m_Chunk->GetNeighborChunk(BlockX, BlockZ); + if ((Neighbour == NULL) || !Neighbour->IsValid()) + { + return; + } + + LinkedBlocksList & Linked = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)Neighbour->GetRedstoneSimulatorData())->m_LinkedBlocks; + for (typename LinkedBlocksList::iterator itr = Linked.begin(); itr != Linked.end(); ++itr) // Check linked powered list + { + if ( + itr->a_BlockPos.Equals(Vector3i(BlockX, a_RelBlockY, BlockZ)) && + itr->a_MiddlePos.Equals(Vector3i(MiddleX, a_RelMiddleY, MiddleZ)) && + itr->a_SourcePos.Equals(Vector3i(SourceX, a_RelSourceY, SourceZ)) + ) + { + // Check for duplicates, update power level, don't add a new listing + itr->a_PowerLevel = a_PowerLevel; + return; + } + } + + sLinkedPoweredBlocks RC; + RC.a_BlockPos = Vector3i(BlockX, a_RelBlockY, BlockZ); + RC.a_MiddlePos = Vector3i(MiddleX, a_RelMiddleY, MiddleZ); + RC.a_SourcePos = Vector3i(SourceX, a_RelSourceY, SourceZ); + RC.a_PowerLevel = a_PowerLevel; + Linked.push_back(RC); + Neighbour->SetIsRedstoneDirty(true); + m_Chunk->SetIsRedstoneDirty(true); +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::SetPlayerToggleableBlockAsSimulated(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, bool WasLastStatePowered) +{ + for (typename SimulatedPlayerToggleableList::iterator itr = m_SimulatedPlayerToggleableBlocks->begin(); itr != m_SimulatedPlayerToggleableBlocks->end(); ++itr) + { + if (!itr->a_RelBlockPos.Equals(Vector3i(a_RelBlockX, a_RelBlockY, a_RelBlockZ))) + { + continue; + } + + if (itr->WasLastStatePowered != WasLastStatePowered) + { + // If power states different, update listing + itr->WasLastStatePowered = WasLastStatePowered; + return; + } + else + { + // If states the same, just ignore + return; + } + } + + // We have arrive here; no block must be in list - add one + sSimulatedPlayerToggleableList RC; + RC.a_RelBlockPos = Vector3i(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + RC.WasLastStatePowered = WasLastStatePowered; + m_SimulatedPlayerToggleableBlocks->push_back(RC); +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +bool cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::QueueRepeaterPowerChange(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ, NIBBLETYPE a_Meta, bool ShouldPowerOn) +{ + for (typename RepeatersDelayList::iterator itr = m_RepeatersDelayList->begin(); itr != m_RepeatersDelayList->end(); ++itr) + { + if (itr->a_RelBlockPos.Equals(Vector3i(a_RelBlockX, a_RelBlockY, a_RelBlockZ))) + { + if (ShouldPowerOn == itr->ShouldPowerOn) // We are queued already for the same thing, don't replace entry + { + return false; + } + + // Already in here (normal to allow repeater to continue on powering and updating blocks in front) - just update info and quit + itr->a_DelayTicks = (((a_Meta & 0xC) >> 0x2) + 1) * 2; // See below for description + itr->a_ElapsedTicks = 0; + itr->ShouldPowerOn = ShouldPowerOn; + return false; + } + } + + // Self not in list, add self to list + sRepeatersDelayList RC; + RC.a_RelBlockPos = Vector3i(a_RelBlockX, a_RelBlockY, a_RelBlockZ); + + // Gets the top two bits (delay time), shifts them into the lower two bits, and adds one (meta 0 = 1 tick; 1 = 2 etc.) + // Multiply by 2 because in MCS, 1 redstone tick = 1 world tick, but in Vanilla, 1 redstone tick = 2 world ticks, and we need to maintain compatibility + RC.a_DelayTicks = (((a_Meta & 0xC) >> 0x2) + 1) * 2; + + RC.a_ElapsedTicks = 0; + RC.ShouldPowerOn = ShouldPowerOn; + m_RepeatersDelayList->push_back(RC); + return true; +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +void cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::SetSourceUnpowered(int a_SourceX, int a_SourceY, int a_SourceZ, ChunkType * a_Chunk, bool a_IsFirstCall) +{ + if (!a_IsFirstCall) // The neighbouring chunks passed when this parameter is false may be invalid + { + if ((a_Chunk == NULL) || !a_Chunk->IsValid()) + { + return; + } + } + // TODO: on C++11 support, change both of these to llama functions pased to a std::remove_if + + for (typename PoweredBlocksList::iterator itr = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_PoweredBlocks.begin(); itr != ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_PoweredBlocks.end();) + { + if (itr->a_SourcePos.Equals(Vector3i(a_SourceX, a_SourceY, a_SourceZ))) + { + itr = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_PoweredBlocks.erase(itr); + a_Chunk->SetIsRedstoneDirty(true); + continue; + } + ++itr; + } + for (typename LinkedBlocksList::iterator itr = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_LinkedBlocks.begin(); itr != ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_LinkedBlocks.end();) + { + if (itr->a_SourcePos.Equals(Vector3i(a_SourceX, a_SourceY, a_SourceZ))) + { + itr = ((cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::cIncrementalRedstoneSimulatorChunkData *)a_Chunk->GetRedstoneSimulatorData())->m_LinkedBlocks.erase(itr); + a_Chunk->SetIsRedstoneDirty(true); + continue; + } + ++itr; + } + + if (a_IsFirstCall && AreCoordsOnChunkBoundary(a_SourceX, a_SourceY, a_SourceZ)) + { + // +- 2 to accomodate linked powered blocks + SetSourceUnpowered(a_SourceX, a_SourceY, a_SourceZ, a_Chunk->GetNeighborChunk(a_SourceX - 2, a_SourceZ), false); + SetSourceUnpowered(a_SourceX, a_SourceY, a_SourceZ, a_Chunk->GetNeighborChunk(a_SourceX + 2, a_SourceZ), false); + SetSourceUnpowered(a_SourceX, a_SourceY, a_SourceZ, a_Chunk->GetNeighborChunk(a_SourceX, a_SourceZ - 2), false); + SetSourceUnpowered(a_SourceX, a_SourceY, a_SourceZ, a_Chunk->GetNeighborChunk(a_SourceX, a_SourceZ + 2), false); + } +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +typename cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::eRedstoneDirection cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::GetWireDirection(int a_RelBlockX, int a_RelBlockY, int a_RelBlockZ) +{ + int Dir = REDSTONE_NONE; + + BLOCKTYPE NegX = 0; + if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX - 1, a_RelBlockY, a_RelBlockZ, NegX)) + { + if (IsPotentialSource(NegX)) + { + Dir |= (REDSTONE_X_POS); + } + } + + BLOCKTYPE PosX = 0; + if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX + 1, a_RelBlockY, a_RelBlockZ, PosX)) + { + if (IsPotentialSource(PosX)) + { + Dir |= (REDSTONE_X_NEG); + } + } + + BLOCKTYPE NegZ = 0; + if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY, a_RelBlockZ - 1, NegZ)) + { + if (IsPotentialSource(NegZ)) + { + if ((Dir & REDSTONE_X_POS) && !(Dir & REDSTONE_X_NEG)) // corner + { + Dir ^= REDSTONE_X_POS; + Dir |= REDSTONE_X_NEG; + } + if ((Dir & REDSTONE_X_NEG) && !(Dir & REDSTONE_X_POS)) // corner + { + Dir ^= REDSTONE_X_NEG; + Dir |= REDSTONE_X_POS; + } + Dir |= REDSTONE_Z_POS; + } + } + + BLOCKTYPE PosZ = 0; + if (m_Chunk->UnboundedRelGetBlockType(a_RelBlockX, a_RelBlockY, a_RelBlockZ + 1, PosZ)) + { + if (IsPotentialSource(PosZ)) + { + if ((Dir & REDSTONE_X_POS) && !(Dir & REDSTONE_X_NEG)) // corner + { + Dir ^= REDSTONE_X_POS; + Dir |= REDSTONE_X_NEG; + } + if ((Dir & REDSTONE_X_NEG) && !(Dir & REDSTONE_X_POS)) // corner + { + Dir ^= REDSTONE_X_NEG; + Dir |= REDSTONE_X_POS; + } + Dir |= REDSTONE_Z_NEG; + } + } + return (eRedstoneDirection)Dir; +} + + + + +template <class ChunkType, class WorldType, template <BLOCKTYPE block> class GetHandlerCompileTime, class ChestType> +bool cIncrementalRedstoneSimulator<ChunkType, WorldType, GetHandlerCompileTime, ChestType>::IsLeverOn(NIBBLETYPE a_BlockMeta) +{ + // Extract the ON bit from metadata and return if true if it is set: + return ((a_BlockMeta & 0x8) == 0x8); +} + + + + diff --git a/src/Simulator/NoopRedstoneSimulator.h b/src/Simulator/NoopRedstoneSimulator.h index f9ed47982..7c961f32b 100644 --- a/src/Simulator/NoopRedstoneSimulator.h +++ b/src/Simulator/NoopRedstoneSimulator.h @@ -8,9 +8,9 @@ class cRedstoneNoopSimulator : - public cRedstoneSimulator + public cRedstoneSimulator<cChunk, cWorld> { - typedef cRedstoneSimulator super; + typedef cRedstoneSimulator<cChunk, cWorld> super; public: cRedstoneNoopSimulator(cWorld & a_World) : @@ -36,5 +36,10 @@ public: UNUSED(a_BlockZ); UNUSED(a_Chunk); } + + virtual cRedstoneSimulatorChunkData * CreateChunkData() override + { + return NULL; + } } ; diff --git a/src/Simulator/RedstoneSimulator.cpp b/src/Simulator/RedstoneSimulator.cpp deleted file mode 100644 index a83f21106..000000000 --- a/src/Simulator/RedstoneSimulator.cpp +++ /dev/null @@ -1,19 +0,0 @@ - -#include "Globals.h" - -#include "RedstoneSimulator.h" -#include "../World.h" - - - - - -cRedstoneSimulator::cRedstoneSimulator(cWorld & a_World) : - super(a_World) -{ -} - - - - - diff --git a/src/Simulator/RedstoneSimulator.h b/src/Simulator/RedstoneSimulator.h index b3e20c9a5..6104d39b4 100644 --- a/src/Simulator/RedstoneSimulator.h +++ b/src/Simulator/RedstoneSimulator.h @@ -4,14 +4,27 @@ #include "Simulator.h" +class cRedstoneSimulatorChunkData +{ +public: + virtual ~cRedstoneSimulatorChunkData() = 0; +} ; +inline cRedstoneSimulatorChunkData::~cRedstoneSimulatorChunkData() {} + +template <class ChunkType, class WorldType> class cRedstoneSimulator : - public cSimulator + public cSimulator<ChunkType, WorldType> { - typedef cSimulator super; + typedef cSimulator<ChunkType, WorldType> super; public: - cRedstoneSimulator(cWorld & a_World); + cRedstoneSimulator(WorldType & a_World) : + super(a_World) + { + } + + virtual cRedstoneSimulatorChunkData * CreateChunkData() = 0; } ; diff --git a/src/Simulator/SandSimulator.cpp b/src/Simulator/SandSimulator.cpp index 1380f8841..aad41e463 100644 --- a/src/Simulator/SandSimulator.cpp +++ b/src/Simulator/SandSimulator.cpp @@ -7,6 +7,7 @@ #include "../Defines.h" #include "../Entities/FallingBlock.h" #include "../Chunk.h" +#include "inifile/iniFile.h" @@ -159,6 +160,7 @@ bool cSandSimulator::CanContinueFallThrough(BLOCKTYPE a_BlockType) case E_BLOCK_FIRE: case E_BLOCK_FLOWER_POT: case E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE: + case E_BLOCK_IRON_TRAPDOOR: case E_BLOCK_LAVA: case E_BLOCK_LEVER: case E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE: diff --git a/src/Simulator/SandSimulator.h b/src/Simulator/SandSimulator.h index 1262f2792..feb82b4d5 100644 --- a/src/Simulator/SandSimulator.h +++ b/src/Simulator/SandSimulator.h @@ -3,13 +3,15 @@ #include "Simulator.h" +/// Per-chunk data for the simulator, specified individual chunks to simulate; Data is not used +typedef cCoordWithIntList cSandSimulatorChunkData; - +#include "Chunk.h" /// Despite the class name, this simulator takes care of all blocks that fall when suspended in the air. class cSandSimulator : - public cSimulator + public cSimulator<cChunk, cWorld> { public: cSandSimulator(cWorld & a_World, cIniFile & a_IniFile); @@ -55,8 +57,7 @@ protected: -/// Per-chunk data for the simulator, specified individual chunks to simulate; Data is not used -typedef cCoordWithIntList cSandSimulatorChunkData; + diff --git a/src/Simulator/Simulator.cpp b/src/Simulator/Simulator.cpp index 0739f0187..29a1132ad 100644 --- a/src/Simulator/Simulator.cpp +++ b/src/Simulator/Simulator.cpp @@ -1,50 +1,18 @@ -#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules +#include "Globals.h" -#include "Simulator.h" #include "../World.h" #include "../BlockID.h" #include "../Defines.h" #include "../Chunk.h" +#include "Simulator.inc" +#ifdef __clang__ + #pragma clang diagnostic ignored "-Wweak-template-vtables" +#endif // __clang__ - - -cSimulator::cSimulator(cWorld & a_World) - : m_World(a_World) -{ -} - - - - - -cSimulator::~cSimulator() -{ -} - - - - - -void cSimulator::WakeUp(int a_BlockX, int a_BlockY, int a_BlockZ, cChunk * a_Chunk) -{ - AddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk); - AddBlock(a_BlockX - 1, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX - 1, a_BlockZ)); - AddBlock(a_BlockX + 1, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX + 1, a_BlockZ)); - AddBlock(a_BlockX, a_BlockY, a_BlockZ - 1, a_Chunk->GetNeighborChunk(a_BlockX, a_BlockZ - 1)); - AddBlock(a_BlockX, a_BlockY, a_BlockZ + 1, a_Chunk->GetNeighborChunk(a_BlockX, a_BlockZ + 1)); - if (a_BlockY > 0) - { - AddBlock(a_BlockX, a_BlockY - 1, a_BlockZ, a_Chunk); - } - if (a_BlockY < cChunkDef::Height - 1) - { - AddBlock(a_BlockX, a_BlockY + 1, a_BlockZ, a_Chunk); - } -} - +template class cSimulator<cChunk, cWorld>; diff --git a/src/Simulator/Simulator.h b/src/Simulator/Simulator.h index 4d9a18867..7cc2f1344 100644 --- a/src/Simulator/Simulator.h +++ b/src/Simulator/Simulator.h @@ -2,23 +2,17 @@ #pragma once #include "../Vector3.h" -#include "inifile/iniFile.h" -class cWorld; -class cChunk; - - - - +template <class ChunkType, class WorldType> class cSimulator { public: - cSimulator(cWorld & a_World); + cSimulator(WorldType & a_World); virtual ~cSimulator(); /// Called in each tick, a_Dt is the time passed since the last tick, in msec @@ -26,7 +20,7 @@ public: /// Called in each tick for each chunk, a_Dt is the time passed since the last tick, in msec; direct access to chunk data available virtual void SimulateChunk(float a_Dt, int a_ChunkX, - int a_ChunkZ, cChunk * a_Chunk) + int a_ChunkZ, ChunkType * a_Chunk) { UNUSED(a_Dt); UNUSED(a_ChunkX); @@ -35,7 +29,7 @@ public: } /// Called when a block changes - virtual void WakeUp(int a_BlockX, int a_BlockY, int a_BlockZ, cChunk * a_Chunk); + virtual void WakeUp(int a_BlockX, int a_BlockY, int a_BlockZ, ChunkType * a_Chunk); virtual bool IsAllowedBlock(BLOCKTYPE a_BlockType) = 0; @@ -43,9 +37,9 @@ protected: friend class cChunk; // Calls AddBlock() in its WakeUpSimulators() function, to speed things up /// Called to simulate a new block - virtual void AddBlock(int a_BlockX, int a_BlockY, int a_BlockZ, cChunk * a_Chunk) = 0; + virtual void AddBlock(int a_BlockX, int a_BlockY, int a_BlockZ, ChunkType * a_Chunk) = 0; - cWorld & m_World; + WorldType & m_World; } ; diff --git a/src/Simulator/Simulator.inc b/src/Simulator/Simulator.inc new file mode 100644 index 000000000..511a6b4c2 --- /dev/null +++ b/src/Simulator/Simulator.inc @@ -0,0 +1,45 @@ + + +#include "Simulator.h" + + + + +template <class ChunkType, class WorldType> +cSimulator<ChunkType, WorldType>::cSimulator(WorldType & a_World) + : m_World(a_World) +{ +} + + + + +template <class ChunkType, class WorldType> +cSimulator<ChunkType, WorldType>::~cSimulator() +{ +} + + + + +template <class ChunkType, class WorldType> +void cSimulator<ChunkType, WorldType>::WakeUp(int a_BlockX, int a_BlockY, int a_BlockZ, ChunkType * a_Chunk) +{ + AddBlock(a_BlockX, a_BlockY, a_BlockZ, a_Chunk); + AddBlock(a_BlockX - 1, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX - 1, a_BlockZ)); + AddBlock(a_BlockX + 1, a_BlockY, a_BlockZ, a_Chunk->GetNeighborChunk(a_BlockX + 1, a_BlockZ)); + AddBlock(a_BlockX, a_BlockY, a_BlockZ - 1, a_Chunk->GetNeighborChunk(a_BlockX, a_BlockZ - 1)); + AddBlock(a_BlockX, a_BlockY, a_BlockZ + 1, a_Chunk->GetNeighborChunk(a_BlockX, a_BlockZ + 1)); + if (a_BlockY > 0) + { + AddBlock(a_BlockX, a_BlockY - 1, a_BlockZ, a_Chunk); + } + if (a_BlockY < cChunkDef::Height - 1) + { + AddBlock(a_BlockX, a_BlockY + 1, a_BlockZ, a_Chunk); + } +} + + + + diff --git a/src/Simulator/SimulatorManager.cpp b/src/Simulator/SimulatorManager.cpp index 918bac7a1..dafdcd239 100644 --- a/src/Simulator/SimulatorManager.cpp +++ b/src/Simulator/SimulatorManager.cpp @@ -70,7 +70,7 @@ void cSimulatorManager::WakeUp(int a_BlockX, int a_BlockY, int a_BlockZ, cChunk -void cSimulatorManager::RegisterSimulator(cSimulator * a_Simulator, int a_Rate) +void cSimulatorManager::RegisterSimulator(cSimulator<cChunk, cWorld> * a_Simulator, int a_Rate) { m_Simulators.push_back(std::make_pair(a_Simulator, a_Rate)); } diff --git a/src/Simulator/SimulatorManager.h b/src/Simulator/SimulatorManager.h index 31a709316..185141764 100644 --- a/src/Simulator/SimulatorManager.h +++ b/src/Simulator/SimulatorManager.h @@ -37,10 +37,10 @@ public: void WakeUp(int a_BlockX, int a_BlockY, int a_BlockZ, cChunk * a_Chunk); - void RegisterSimulator(cSimulator * a_Simulator, int a_Rate); // Takes ownership of the simulator object! + void RegisterSimulator(cSimulator<cChunk, cWorld> * a_Simulator, int a_Rate); // Takes ownership of the simulator object! protected: - typedef std::vector <std::pair<cSimulator *, int> > cSimulators; + typedef std::vector <std::pair<cSimulator<cChunk, cWorld> *, int> > cSimulators; cWorld & m_World; cSimulators m_Simulators; diff --git a/src/Simulator/VanillaFluidSimulator.cpp b/src/Simulator/VanillaFluidSimulator.cpp index 18d9b07e1..6df75eebb 100644 --- a/src/Simulator/VanillaFluidSimulator.cpp +++ b/src/Simulator/VanillaFluidSimulator.cpp @@ -98,7 +98,7 @@ int cVanillaFluidSimulator::CalculateFlowCost(cChunk * a_Chunk, int a_RelX, int } // Check if block below is passable - if (!a_Chunk->UnboundedRelGetBlock(a_RelX, a_RelY - 1, a_RelZ, BlockType, BlockMeta)) + if ((a_RelY > 0) && !a_Chunk->UnboundedRelGetBlock(a_RelX, a_RelY - 1, a_RelZ, BlockType, BlockMeta)) { return Cost; } diff --git a/src/StringCompression.cpp b/src/StringCompression.cpp index 71d64e71e..af9f1687f 100644 --- a/src/StringCompression.cpp +++ b/src/StringCompression.cpp @@ -180,3 +180,65 @@ extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & + +extern int InflateString(const char * a_Data, size_t a_Length, AString & a_Uncompressed) +{ + a_Uncompressed.reserve(a_Length); + + char Buffer[64 KiB]; + z_stream strm; + memset(&strm, 0, sizeof(strm)); + strm.next_in = (Bytef *)a_Data; + strm.avail_in = (uInt)a_Length; + strm.next_out = (Bytef *)Buffer; + strm.avail_out = sizeof(Buffer); + + int res = inflateInit(&strm); // Force GZIP decoding + if (res != Z_OK) + { + LOG("%s: inflation initialization failed: %d (\"%s\").", __FUNCTION__, res, strm.msg); + return res; + } + + for (;;) + { + res = inflate(&strm, Z_NO_FLUSH); + switch (res) + { + case Z_OK: + { + // Some data has been uncompressed. Consume the buffer and continue uncompressing + a_Uncompressed.append(Buffer, sizeof(Buffer) - strm.avail_out); + strm.next_out = (Bytef *)Buffer; + strm.avail_out = sizeof(Buffer); + if (strm.avail_in == 0) + { + // All data has been uncompressed + inflateEnd(&strm); + return Z_OK; + } + break; + } + + case Z_STREAM_END: + { + // Finished uncompressing. Consume the rest of the buffer and return + a_Uncompressed.append(Buffer, sizeof(Buffer) - strm.avail_out); + inflateEnd(&strm); + return Z_OK; + } + + default: + { + // An error has occurred, log it and return the error value + LOG("%s: inflation failed: %d (\"%s\").", __FUNCTION__, res, strm.msg); + inflateEnd(&strm); + return res; + } + } // switch (res) + } // while (true) +} + + + + diff --git a/src/StringCompression.h b/src/StringCompression.h index 038240797..dde17ce30 100644 --- a/src/StringCompression.h +++ b/src/StringCompression.h @@ -21,5 +21,7 @@ extern int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_ /// Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed); +/** Uncompresses a_Data into a_Uncompressed using Inflate; returns Z_OK for success or Z_XXX error constants same as zlib */ +extern int InflateString(const char * a_Data, size_t a_Length, AString & a_Uncompressed); diff --git a/src/StringUtils.cpp b/src/StringUtils.cpp index b0e5a4ffe..21962f832 100644 --- a/src/StringUtils.cpp +++ b/src/StringUtils.cpp @@ -196,16 +196,19 @@ AString TrimString(const AString & str) -AString & StrToUpper(AString & s) +AString & InPlaceLowercase(AString & s) { - AString::iterator i = s.begin(); - AString::iterator end = s.end(); + std::transform(s.begin(), s.end(), s.begin(), ::tolower); + return s; +} - while (i != end) - { - *i = (char)toupper(*i); - ++i; - } + + + + +AString & InPlaceUppercase(AString & s) +{ + std::transform(s.begin(), s.end(), s.begin(), ::toupper); return s; } @@ -213,17 +216,22 @@ AString & StrToUpper(AString & s) -AString & StrToLower(AString & s) +AString StrToLower(const AString & s) { - AString::iterator i = s.begin(); - AString::iterator end = s.end(); + AString res(s); + std::transform(res.begin(), res.end(), res.begin(), ::tolower); + return res; +} - while (i != end) - { - *i = (char)tolower(*i); - ++i; - } - return s; + + + + +AString StrToUpper(const AString & s) +{ + AString res(s); + std::transform(res.begin(), res.end(), res.begin(), ::toupper); + return res; } @@ -236,10 +244,8 @@ int NoCaseCompare(const AString & s1, const AString & s2) // MSVC has stricmp that compares case-insensitive: return _stricmp(s1.c_str(), s2.c_str()); #else - // Do it the hard way: - AString s1Copy(s1); - AString s2Copy(s2); - return StrToUpper(s1Copy).compare(StrToUpper(s2Copy)); + // Do it the hard way - convert both strings to lowercase: + return StrToLower(s1).compare(StrToLower(s2)); #endif // else _MSC_VER } @@ -435,10 +441,10 @@ static bool isLegalUTF8(const unsigned char * source, int length) -AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a_UTF16) +AString UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length) { - a_UTF16.clear(); - a_UTF16.reserve(a_UTF8Length * 3); + AString UTF16; + UTF16.reserve(a_UTF8Length * 3); const unsigned char * source = (const unsigned char*)a_UTF8; const unsigned char * sourceEnd = source + a_UTF8Length; @@ -452,12 +458,12 @@ AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a unsigned short extraBytesToRead = trailingBytesForUTF8[*source]; if (source + extraBytesToRead >= sourceEnd) { - return a_UTF16; + return UTF16; } // Do this check whether lenient or strict if (!isLegalUTF8(source, extraBytesToRead + 1)) { - return a_UTF16; + return UTF16; } // The cases all fall through. See "Note A" below. @@ -481,13 +487,13 @@ AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a ch = ' '; } unsigned short v = htons((unsigned short)ch); - a_UTF16.append((const char *)&v, 2); + UTF16.append((const char *)&v, 2); } else if (ch > UNI_MAX_UTF16) { // Invalid value, replace with a space unsigned short v = htons(' '); - a_UTF16.append((const char *)&v, 2); + UTF16.append((const char *)&v, 2); } else { @@ -495,11 +501,11 @@ AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a ch -= halfBase; unsigned short v1 = htons((ch >> halfShift) + UNI_SUR_HIGH_START); unsigned short v2 = htons((ch & halfMask) + UNI_SUR_LOW_START); - a_UTF16.append((const char *)&v1, 2); - a_UTF16.append((const char *)&v2, 2); + UTF16.append((const char *)&v1, 2); + UTF16.append((const char *)&v2, 2); } } - return a_UTF16; + return UTF16; } /* @@ -863,3 +869,31 @@ void SetBEInt(char * a_Mem, Int32 a_Value) + +bool SplitZeroTerminatedStrings(const AString & a_Strings, AStringVector & a_Output) +{ + a_Output.clear(); + size_t size = a_Strings.size(); + size_t start = 0; + bool res = false; + for (size_t i = 0; i < size; i++) + { + if (a_Strings[i] == 0) + { + a_Output.push_back(a_Strings.substr(start, i - start)); + start = i + 1; + res = true; + } + } + if (start < size) + { + a_Output.push_back(a_Strings.substr(start, size - start)); + res = true; + } + + return res; +} + + + + diff --git a/src/StringUtils.h b/src/StringUtils.h index 30b9904d1..159e8ecac 100644 --- a/src/StringUtils.h +++ b/src/StringUtils.h @@ -9,7 +9,7 @@ #pragma once #include <string> - +#include <limits> @@ -43,10 +43,16 @@ extern AStringVector StringSplitAndTrim(const AString & str, const AString & del extern AString TrimString(const AString & str); // tolua_export /// In-place string conversion to uppercase; returns the same string -extern AString & StrToUpper(AString & s); +extern AString & InPlaceUppercase(AString & s); /// In-place string conversion to lowercase; returns the same string -extern AString & StrToLower(AString & s); +extern AString & InPlaceLowercase(AString & s); + +/** Returns an upper-cased copy of the string */ +extern AString StrToUpper(const AString & s); + +/** Returns a lower-cased copy of the string */ +extern AString StrToLower(const AString & s); /// Case-insensitive string comparison; returns 0 if the strings are the same extern int NoCaseCompare(const AString & s1, const AString & s2); // tolua_export @@ -60,8 +66,8 @@ extern void ReplaceString(AString & iHayStack, const AString & iNeedle, const AS /// Converts a stream of BE shorts into UTF-8 string; returns a ref to a_UTF8 extern AString & RawBEToUTF8(const char * a_RawData, size_t a_NumShorts, AString & a_UTF8); -/// Converts a UTF-8 string into a UTF-16 BE string, packing that back into AString; return a ref to a_UTF16 -extern AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a_UTF16); +/// Converts a UTF-8 string into a UTF-16 BE string; returns a ref to a_UTF16 +extern AString UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length); /// Creates a nicely formatted HEX dump of the given memory block. Max a_BytesPerLine is 120 extern AString & CreateHexDump(AString & a_Out, const void * a_Data, size_t a_Size, size_t a_BytesPerLine); @@ -93,6 +99,73 @@ extern int GetBEInt(const char * a_Mem); /// Writes four bytes to the specified memory location so that they interpret as BigEndian int extern void SetBEInt(char * a_Mem, Int32 a_Value); +/** Splits a string that has embedded \0 characters, on those characters. +a_Output is first cleared and then each separate string is pushed back into a_Output. +Returns true if there are at least two strings in a_Output (there was at least one \0 separator). */ +extern bool SplitZeroTerminatedStrings(const AString & a_Strings, AStringVector & a_Output); + +/// Parses any integer type. Checks bounds and returns errors out of band. +template <class T> +bool StringToInteger(const AString & a_str, T & a_Num) +{ + size_t i = 0; + bool positive = true; + T result = 0; + if (a_str[0] == '+') + { + i++; + } + else if (a_str[0] == '-') + { + i++; + positive = false; + } + if (positive) + { + for (size_t size = a_str.size(); i < size; i++) + { + if ((a_str[i] < '0') || (a_str[i] > '9')) + { + return false; + } + if (std::numeric_limits<T>::max() / 10 < result) + { + return false; + } + result *= 10; + T digit = a_str[i] - '0'; + if (std::numeric_limits<T>::max() - digit < result) + { + return false; + } + result += digit; + } + } + else + { + for (size_t size = a_str.size(); i < size; i++) + { + if ((a_str[i] < '0') || (a_str[i] > '9')) + { + return false; + } + if (std::numeric_limits<T>::min() / 10 > result) + { + return false; + } + result *= 10; + T digit = a_str[i] - '0'; + if (std::numeric_limits<T>::min() + digit > result) + { + return false; + } + result -= digit; + } + } + a_Num = result; + return true; +} + // If you have any other string helper functions, declare them here diff --git a/src/Tracer.cpp b/src/Tracer.cpp index 756147a7b..e125c6aa4 100644 --- a/src/Tracer.cpp +++ b/src/Tracer.cpp @@ -250,7 +250,7 @@ int LinesCross(float x0, float y0, float x1, float y1, float x2, float y2, float // float linx, liny; float d=(x1-x0)*(y3-y2)-(y1-y0)*(x3-x2); - if (abs(d)<0.001) {return 0;} + if (std::abs(d)<0.001) {return 0;} float AB=((y0-y2)*(x3-x2)-(x0-x2)*(y3-y2))/d; if (AB>=0.0 && AB<=1.0) { @@ -283,7 +283,7 @@ int cTracer::intersect3D_SegmentPlane( const Vector3f & a_Origin, const Vector3f if (fabs(D) < EPSILON) { // segment is parallel to plane - if (N == 0) + if (N == 0.0) { // segment lies in plane return 2; diff --git a/src/UI/SlotArea.cpp b/src/UI/SlotArea.cpp index b5f84c24c..999bed989 100644 --- a/src/UI/SlotArea.cpp +++ b/src/UI/SlotArea.cpp @@ -5,10 +5,12 @@ #include "Globals.h" #include "SlotArea.h" #include "../Entities/Player.h" +#include "../BlockEntities/BeaconEntity.h" #include "../BlockEntities/ChestEntity.h" #include "../BlockEntities/DropSpenserEntity.h" #include "../BlockEntities/EnderChestEntity.h" #include "../BlockEntities/FurnaceEntity.h" +#include "../Entities/Minecart.h" #include "../Items/ItemHandler.h" #include "Window.h" #include "../CraftingRecipes.h" @@ -206,7 +208,7 @@ void cSlotArea::ShiftClicked(cPlayer & a_Player, int a_SlotNum, const cItem & a_ m_ParentWindow.DistributeStack(Slot, a_Player, this, true); if (Slot.IsEmpty()) { - // Empty the slot completely, the cilent doesn't like left-over ItemType with zero count + // Empty the slot completely, the client doesn't like left-over ItemType with zero count Slot.Empty(); } SetSlot(a_SlotNum, a_Player, Slot); @@ -1190,21 +1192,48 @@ void cSlotAreaAnvil::UpdateResult(cPlayer & a_Player) - //////////////////////////////////////////////////////////////////////////////// -// cSlotAreaEnchanting: +// cSlotAreaBeacon: -cSlotAreaEnchanting::cSlotAreaEnchanting(cEnchantingWindow & a_ParentWindow) : - cSlotAreaTemporary(1, a_ParentWindow) +cSlotAreaBeacon::cSlotAreaBeacon(cBeaconEntity * a_Beacon, cWindow & a_ParentWindow) : + cSlotArea(1, a_ParentWindow), + m_Beacon(a_Beacon) { - a_ParentWindow.m_SlotArea = this; + m_Beacon->GetContents().AddListener(*this); } -void cSlotAreaEnchanting::Clicked(cPlayer & a_Player, int a_SlotNum, eClickAction a_ClickAction, const cItem & a_ClickedItem) +cSlotAreaBeacon::~cSlotAreaBeacon() +{ + m_Beacon->GetContents().RemoveListener(*this); +} + + + + +bool cSlotAreaBeacon::IsPlaceableItem(short a_ItemType) +{ + switch (a_ItemType) + { + case E_ITEM_EMERALD: + case E_ITEM_DIAMOND: + case E_ITEM_GOLD: + case E_ITEM_IRON: + { + return true; + } + } + return false; +} + + + + + +void cSlotAreaBeacon::Clicked(cPlayer & a_Player, int a_SlotNum, eClickAction a_ClickAction, const cItem & a_ClickedItem) { ASSERT((a_SlotNum >= 0) && (a_SlotNum < GetNumSlots())); @@ -1214,7 +1243,7 @@ void cSlotAreaEnchanting::Clicked(cPlayer & a_Player, int a_SlotNum, eClickActio LOGWARNING("GetSlot(%d) returned NULL! Ignoring click", a_SlotNum); return; } - + switch (a_ClickAction) { case caShiftLeftClick: @@ -1223,14 +1252,28 @@ void cSlotAreaEnchanting::Clicked(cPlayer & a_Player, int a_SlotNum, eClickActio ShiftClicked(a_Player, a_SlotNum, a_ClickedItem); return; } - case caDblClick: + case caMiddleClick: { - DblClicked(a_Player, a_SlotNum); + MiddleClicked(a_Player, a_SlotNum); return; } - case caMiddleClick: + case caDropKey: + case caCtrlDropKey: { - MiddleClicked(a_Player, a_SlotNum); + DropClicked(a_Player, a_SlotNum, false); + return; + } + case caNumber1: + case caNumber2: + case caNumber3: + case caNumber4: + case caNumber5: + case caNumber6: + case caNumber7: + case caNumber8: + case caNumber9: + { + NumberClicked(a_Player, a_SlotNum, a_ClickAction); return; } default: @@ -1238,7 +1281,7 @@ void cSlotAreaEnchanting::Clicked(cPlayer & a_Player, int a_SlotNum, eClickActio break; } } - + cItem Slot(*GetSlot(a_SlotNum, a_Player)); if (!Slot.IsSameType(a_ClickedItem)) { @@ -1248,106 +1291,211 @@ void cSlotAreaEnchanting::Clicked(cPlayer & a_Player, int a_SlotNum, eClickActio bAsync = true; } cItem & DraggingItem = a_Player.GetDraggingItem(); - switch (a_ClickAction) + + if (DraggingItem.IsEmpty()) { - case caRightClick: + DraggingItem = Slot; + Slot.Empty(); + } + else if (Slot.IsEmpty()) + { + if (!IsPlaceableItem(DraggingItem.m_ItemType)) { - // Right-clicked - if (DraggingItem.IsEmpty()) - { - DraggingItem = Slot.CopyOne(); - Slot.Empty(); - break; - } - - if (Slot.IsEmpty()) - { - Slot = DraggingItem.CopyOne(); - DraggingItem.m_ItemCount -= 1; - if (DraggingItem.m_ItemCount <= 0) - { - DraggingItem.Empty(); - } - } - else if ((!DraggingItem.IsEqual(Slot)) && (DraggingItem.m_ItemCount == 1)) - { - // Swap contents - cItem tmp(DraggingItem); - DraggingItem = Slot; - Slot = tmp; - } - break; + return; } - case caLeftClick: + Slot = DraggingItem.CopyOne(); + DraggingItem.m_ItemCount -= 1; + if (DraggingItem.m_ItemCount <= 0) { - // Left-clicked - if (DraggingItem.IsEmpty()) - { - DraggingItem = Slot.CopyOne(); - Slot.Empty(); - break; - } - - if (DraggingItem.IsEqual(Slot)) - { - // Do nothing - break; - } - - if (!Slot.IsEmpty()) - { - if (DraggingItem.m_ItemCount == 1) - { - // Swap contents - cItem tmp(DraggingItem); - DraggingItem = Slot; - Slot = tmp; - } - } - else - { - Slot = DraggingItem.CopyOne(); - DraggingItem.m_ItemCount -= 1; - if (DraggingItem.m_ItemCount <= 0) - { - DraggingItem.Empty(); - } - } - break; + DraggingItem.Empty(); } - default: + } + else if (DraggingItem.m_ItemCount == 1) + { + if (!IsPlaceableItem(DraggingItem.m_ItemCount)) { - LOGWARNING("SlotArea: Unhandled click action: %d (%s)", a_ClickAction, ClickActionToString(a_ClickAction)); - m_ParentWindow.BroadcastWholeWindow(); return; } - } // switch (a_ClickAction - + + // Switch contents + cItem tmp(DraggingItem); + DraggingItem = Slot; + Slot = tmp; + } + SetSlot(a_SlotNum, a_Player, Slot); if (bAsync) { m_ParentWindow.BroadcastWholeWindow(); } - UpdateResult(a_Player); } -void cSlotAreaEnchanting::DblClicked(cPlayer & a_Player, int a_SlotNum) +void cSlotAreaBeacon::DistributeStack(cItem & a_ItemStack, cPlayer & a_Player, bool a_ShouldApply, bool a_KeepEmptySlots) { - cItem & Dragging = a_Player.GetDraggingItem(); - if ((!Dragging.IsEmpty()) || (a_SlotNum != 0)) + const cItem * Slot = GetSlot(0, a_Player); + if (!Slot->IsEmpty() || !IsPlaceableItem(a_ItemStack.m_ItemType) || (a_ItemStack.m_ItemCount != 1)) + { + return; + } + + if (a_ShouldApply) + { + SetSlot(0, a_Player, a_ItemStack.CopyOne()); + } + a_ItemStack.Empty(); +} + + + + + +const cItem * cSlotAreaBeacon::GetSlot(int a_SlotNum, cPlayer & a_Player) const +{ + UNUSED(a_Player); + return &(m_Beacon->GetSlot(a_SlotNum)); +} + + + + + +void cSlotAreaBeacon::SetSlot(int a_SlotNum, cPlayer & a_Player, const cItem & a_Item) +{ + UNUSED(a_Player); + m_Beacon->SetSlot(a_SlotNum, a_Item); +} + + + + + +void cSlotAreaBeacon::OnSlotChanged(cItemGrid * a_ItemGrid, int a_SlotNum) +{ + UNUSED(a_SlotNum); + // Something has changed in the window, broadcast the entire window to all clients + ASSERT(a_ItemGrid == &(m_Beacon->GetContents())); + + m_ParentWindow.BroadcastWholeWindow(); +} + + + + + +//////////////////////////////////////////////////////////////////////////////// +// cSlotAreaEnchanting: + +cSlotAreaEnchanting::cSlotAreaEnchanting(cEnchantingWindow & a_ParentWindow, int a_BlockX, int a_BlockY, int a_BlockZ) : + cSlotAreaTemporary(1, a_ParentWindow), + m_BlockX(a_BlockX), + m_BlockY(a_BlockY), + m_BlockZ(a_BlockZ) +{ + a_ParentWindow.m_SlotArea = this; +} + + + + + +void cSlotAreaEnchanting::Clicked(cPlayer & a_Player, int a_SlotNum, eClickAction a_ClickAction, const cItem & a_ClickedItem) +{ + ASSERT((a_SlotNum >= 0) && (a_SlotNum < GetNumSlots())); + + bool bAsync = false; + if (GetSlot(a_SlotNum, a_Player) == NULL) { + LOGWARNING("GetSlot(%d) returned NULL! Ignoring click", a_SlotNum); return; } + + switch (a_ClickAction) + { + case caShiftLeftClick: + case caShiftRightClick: + { + ShiftClicked(a_Player, a_SlotNum, a_ClickedItem); + return; + } + case caDblClick: + { + DblClicked(a_Player, a_SlotNum); + return; + } + case caMiddleClick: + { + MiddleClicked(a_Player, a_SlotNum); + return; + } + case caDropKey: + case caCtrlDropKey: + { + DropClicked(a_Player, a_SlotNum, false); + return; + } + case caNumber1: + case caNumber2: + case caNumber3: + case caNumber4: + case caNumber5: + case caNumber6: + case caNumber7: + case caNumber8: + case caNumber9: + { + NumberClicked(a_Player, a_SlotNum, a_ClickAction); + return; + } + default: + { + break; + } + } - cItem Item = *GetSlot(0, a_Player); - if (!m_ParentWindow.CollectItemsToHand(Item, *this, a_Player, false)) + cItem Slot(*GetSlot(a_SlotNum, a_Player)); + if (!Slot.IsSameType(a_ClickedItem)) + { + LOGWARNING("*** Window lost sync at item %d in SlotArea with %d items ***", a_SlotNum, m_NumSlots); + LOGWARNING("My item: %s", ItemToFullString(Slot).c_str()); + LOGWARNING("Their item: %s", ItemToFullString(a_ClickedItem).c_str()); + bAsync = true; + } + cItem & DraggingItem = a_Player.GetDraggingItem(); + + if (DraggingItem.IsEmpty()) + { + // DraggingItem is empty -> Switch draggingitem and slot + if (!Slot.IsEmpty()) + { + std::swap(DraggingItem, Slot); + } + } + else if (Slot.IsEmpty()) + { + // DraggingItem isn't empty and slot is empty -> Set one dragging item in the slot + Slot = DraggingItem.CopyOne(); + DraggingItem.m_ItemCount -= 1; + + if (DraggingItem.m_ItemCount <= 0) + { + DraggingItem.Empty(); + } + } + else if ((DraggingItem.m_ItemCount == 1) && !DraggingItem.IsEqual(Slot)) + { + // DraggingItem and slot aren't empty -> Switch items + std::swap(DraggingItem, Slot); + } + + SetSlot(a_SlotNum, a_Player, Slot); + if (bAsync) { - m_ParentWindow.CollectItemsToHand(Item, *this, a_Player, true); + m_ParentWindow.BroadcastWholeWindow(); } } @@ -1372,7 +1520,15 @@ void cSlotAreaEnchanting::DistributeStack(cItem & a_ItemStack, cPlayer & a_Playe { a_ItemStack.Empty(); } +} + + + + +void cSlotAreaEnchanting::OnPlayerAdded(cPlayer & a_Player) +{ + super::OnPlayerAdded(a_Player); UpdateResult(a_Player); } @@ -1392,29 +1548,33 @@ void cSlotAreaEnchanting::OnPlayerRemoved(cPlayer & a_Player) +void cSlotAreaEnchanting::SetSlot(int a_SlotNum, cPlayer & a_Player, const cItem & a_Item) +{ + super::SetSlot(a_SlotNum, a_Player, a_Item); + UpdateResult(a_Player); +} + + + + + void cSlotAreaEnchanting::UpdateResult(cPlayer & a_Player) { cItem Item = *GetSlot(0, a_Player); - if (Item.IsEmpty() || !Item.m_Enchantments.IsEmpty()) - { - m_ParentWindow.SetProperty(0, 0, a_Player); - m_ParentWindow.SetProperty(1, 0, a_Player); - m_ParentWindow.SetProperty(2, 0, a_Player); - } - else if (cItem::IsEnchantable(Item.m_ItemType) || Item.m_ItemType == E_ITEM_BOOK) + if (cItem::IsEnchantable(Item.m_ItemType) && Item.m_Enchantments.IsEmpty()) { int Bookshelves = std::min(GetBookshelvesCount(a_Player.GetWorld()), 15); cFastRandom Random; - int base = (Random.GenerateRandomInteger(1, 8) + (int)floor((float)Bookshelves / 2) + Random.GenerateRandomInteger(0, Bookshelves)); - int topSlot = std::max(base / 3, 1); - int middleSlot = (base * 2) / 3 + 1; - int bottomSlot = std::max(base, Bookshelves * 2); + int Base = (Random.GenerateRandomInteger(1, 8) + (int)floor((float)Bookshelves / 2) + Random.GenerateRandomInteger(0, Bookshelves)); + int TopSlot = std::max(Base / 3, 1); + int MiddleSlot = (Base * 2) / 3 + 1; + int BottomSlot = std::max(Base, Bookshelves * 2); - m_ParentWindow.SetProperty(0, topSlot, a_Player); - m_ParentWindow.SetProperty(1, middleSlot, a_Player); - m_ParentWindow.SetProperty(2, bottomSlot, a_Player); + m_ParentWindow.SetProperty(0, TopSlot, a_Player); + m_ParentWindow.SetProperty(1, MiddleSlot, a_Player); + m_ParentWindow.SetProperty(2, BottomSlot, a_Player); } else { @@ -1430,12 +1590,9 @@ void cSlotAreaEnchanting::UpdateResult(cPlayer & a_Player) int cSlotAreaEnchanting::GetBookshelvesCount(cWorld * a_World) { - int PosX, PosY, PosZ; - ((cEnchantingWindow*)&m_ParentWindow)->GetBlockPos(PosX, PosY, PosZ); - int Bookshelves = 0; cBlockArea Area; - Area.Read(a_World, PosX - 2, PosX + 2, PosY, PosY + 1, PosZ - 2, PosZ + 2); + Area.Read(a_World, m_BlockX - 2, m_BlockX + 2, m_BlockY, m_BlockY + 1, m_BlockZ - 2, m_BlockZ + 2); static const struct { @@ -1483,7 +1640,7 @@ int cSlotAreaEnchanting::GetBookshelvesCount(cWorld * a_World) if ( (Area.GetRelBlockType(CheckCoords[i].m_AirX, CheckCoords[i].m_AirY, CheckCoords[i].m_AirZ) == E_BLOCK_AIR) && // There's air in the checkspot (Area.GetRelBlockType(CheckCoords[i].m_BookX, CheckCoords[i].m_BookY, CheckCoords[i].m_BookZ) == E_BLOCK_BOOKCASE) // There's bookcase in the wanted place - ) + ) { Bookshelves++; } @@ -1764,6 +1921,40 @@ void cSlotAreaFurnace::HandleSmeltItem(const cItem & a_Result, cPlayer & a_Playe //////////////////////////////////////////////////////////////////////////////// +// cSlotAreaMinecartWithChest: + +cSlotAreaMinecartWithChest::cSlotAreaMinecartWithChest(cMinecartWithChest * a_Chest, cWindow & a_ParentWindow) : + cSlotArea(27, a_ParentWindow), + m_Chest(a_Chest) +{ +} + + + + + +const cItem * cSlotAreaMinecartWithChest::GetSlot(int a_SlotNum, cPlayer & a_Player) const +{ + // a_SlotNum ranges from 0 to 26, use that to index the minecart chest entity's inventory directly: + UNUSED(a_Player); + return &(m_Chest->GetSlot(a_SlotNum)); +} + + + + + +void cSlotAreaMinecartWithChest::SetSlot(int a_SlotNum, cPlayer & a_Player, const cItem & a_Item) +{ + UNUSED(a_Player); + m_Chest->SetSlot(a_SlotNum, a_Item); +} + + + + + +//////////////////////////////////////////////////////////////////////////////// // cSlotAreaInventoryBase: cSlotAreaInventoryBase::cSlotAreaInventoryBase(int a_NumSlots, int a_SlotOffset, cWindow & a_ParentWindow) : diff --git a/src/UI/SlotArea.h b/src/UI/SlotArea.h index fa842bb81..1eeeb9836 100644 --- a/src/UI/SlotArea.h +++ b/src/UI/SlotArea.h @@ -15,10 +15,12 @@ class cWindow; class cPlayer; +class cBeaconEntity; class cChestEntity; class cDropSpenserEntity; class cEnderChestEntity; class cFurnaceEntity; +class cMinecartWithChest; class cCraftingRecipe; class cEnchantingWindow; class cWorld; @@ -314,20 +316,49 @@ protected: +class cSlotAreaBeacon : + public cSlotArea, + public cItemGrid::cListener +{ + typedef cSlotArea super; + +public: + cSlotAreaBeacon(cBeaconEntity * a_Beacon, cWindow & a_ParentWindow); + virtual ~cSlotAreaBeacon(); + + bool IsPlaceableItem(short a_ItemType); + + virtual void Clicked(cPlayer & a_Player, int a_SlotNum, eClickAction a_ClickAction, const cItem & a_ClickedItem) override; + virtual void DistributeStack(cItem & a_ItemStack, cPlayer & a_Player, bool a_ShouldApply, bool a_KeepEmptySlots) override; + virtual const cItem * GetSlot(int a_SlotNum, cPlayer & a_Player) const override; + virtual void SetSlot(int a_SlotNum, cPlayer & a_Player, const cItem & a_Item) override; + +protected: + cBeaconEntity * m_Beacon; + + // cItemGrid::cListener overrides: + virtual void OnSlotChanged(cItemGrid * a_ItemGrid, int a_SlotNum) override; +} ; + + + + + class cSlotAreaEnchanting : public cSlotAreaTemporary { typedef cSlotAreaTemporary super; public: - cSlotAreaEnchanting(cEnchantingWindow & a_ParentWindow); + cSlotAreaEnchanting(cEnchantingWindow & a_ParentWindow, int a_BlockX, int a_BlockY, int a_BlockZ); // cSlotArea overrides: virtual void Clicked(cPlayer & a_Player, int a_SlotNum, eClickAction a_ClickAction, const cItem & a_ClickedItem) override; - virtual void DblClicked(cPlayer & a_Player, int a_SlotNum) override; virtual void DistributeStack(cItem & a_ItemStack, cPlayer & a_Player, bool a_ShouldApply, bool a_KeepEmptySlots) override; + virtual void SetSlot(int a_SlotNum, cPlayer & a_Player, const cItem & a_Item) override; // cSlotAreaTemporary overrides: + virtual void OnPlayerAdded (cPlayer & a_Player) override; virtual void OnPlayerRemoved(cPlayer & a_Player) override; /* Get the count of bookshelves who stand in the near of the enchanting table */ @@ -336,6 +367,8 @@ public: protected: /** Handles a click in the item slot. */ void UpdateResult(cPlayer & a_Player); + + int m_BlockX, m_BlockY, m_BlockZ; }; @@ -416,10 +449,27 @@ protected: // cItemGrid::cListener overrides: virtual void OnSlotChanged(cItemGrid * a_ItemGrid, int a_SlotNum) override; - /// Called after an item has been smelted to handle statistics e.t.c. + /// Called after an item has been smelted to handle statistics etc. void HandleSmeltItem(const cItem & a_Result, cPlayer & a_Player); } ; + +class cSlotAreaMinecartWithChest : + public cSlotArea +{ +public: + cSlotAreaMinecartWithChest(cMinecartWithChest * a_ChestCart, cWindow & a_ParentWindow); + + virtual const cItem * GetSlot(int a_SlotNum, cPlayer & a_Player) const override; + virtual void SetSlot(int a_SlotNum, cPlayer & a_Player, const cItem & a_Item) override; + +protected: + cMinecartWithChest * m_Chest; +}; + + + + diff --git a/src/UI/Window.cpp b/src/UI/Window.cpp index 4731f282b..d83336f75 100644 --- a/src/UI/Window.cpp +++ b/src/UI/Window.cpp @@ -9,10 +9,12 @@ #include "../Entities/Pickup.h" #include "../Inventory.h" #include "../Items/ItemHandler.h" +#include "../BlockEntities/BeaconEntity.h" #include "../BlockEntities/ChestEntity.h" #include "../BlockEntities/DropSpenserEntity.h" #include "../BlockEntities/EnderChestEntity.h" #include "../BlockEntities/HopperEntity.h" +#include "../Entities/Minecart.h" #include "../Root.h" #include "../Bindings/PluginManager.h" @@ -56,6 +58,34 @@ cWindow::~cWindow() +const AString cWindow::GetWindowTypeName(void) const +{ + switch (m_WindowType) + { + case wtChest: return "minecraft:chest"; + case wtWorkbench: return "minecraft:crafting_table"; + case wtFurnace: return "minecraft:furnace"; + case wtDropSpenser: return "minecraft:dispenser"; + case wtEnchantment: return "minecraft:enchanting_table"; + case wtBrewery: return "minecraft:brewing_stand"; + case wtNPCTrade: return "minecraft:villager"; + case wtBeacon: return "minecraft:beacon"; + case wtAnvil: return "minecraft:anvil"; + case wtHopper: return "minecraft:hopper"; + case wtDropper: return "minecraft:dropper"; + case wtAnimalChest: return "EntityHorse"; + default: + { + ASSERT(!"Unknown inventory type!"); + return ""; + } + } +} + + + + + int cWindow::GetNumSlots(void) const { int res = 0; @@ -841,6 +871,36 @@ void cAnvilWindow::GetBlockPos(int & a_PosX, int & a_PosY, int & a_PosZ) //////////////////////////////////////////////////////////////////////////////// +// cBeaconWindow: + +cBeaconWindow::cBeaconWindow(int a_BlockX, int a_BlockY, int a_BlockZ, cBeaconEntity * a_Beacon) : + cWindow(wtBeacon, "Beacon"), + m_Beacon(a_Beacon) +{ + m_ShouldDistributeToHotbarFirst = true; + m_SlotAreas.push_back(new cSlotAreaBeacon(m_Beacon, *this)); + m_SlotAreas.push_back(new cSlotAreaInventory(*this)); + m_SlotAreas.push_back(new cSlotAreaHotBar(*this)); +} + + + + + +void cBeaconWindow::OpenedByPlayer(cPlayer & a_Player) +{ + super::OpenedByPlayer(a_Player); + + a_Player.GetClientHandle()->SendWindowProperty(*this, 0, m_Beacon->GetBeaconLevel()); + a_Player.GetClientHandle()->SendWindowProperty(*this, 1, m_Beacon->GetPrimaryEffect()); + a_Player.GetClientHandle()->SendWindowProperty(*this, 2, m_Beacon->GetSecondaryEffect()); +} + + + + + +//////////////////////////////////////////////////////////////////////////////// // cEnchantingWindow: cEnchantingWindow::cEnchantingWindow(int a_BlockX, int a_BlockY, int a_BlockZ) : @@ -850,7 +910,7 @@ cEnchantingWindow::cEnchantingWindow(int a_BlockX, int a_BlockY, int a_BlockZ) : m_BlockY(a_BlockY), m_BlockZ(a_BlockZ) { - m_SlotAreas.push_back(new cSlotAreaEnchanting(*this)); + m_SlotAreas.push_back(new cSlotAreaEnchanting(*this, m_BlockX, m_BlockY, m_BlockZ)); m_SlotAreas.push_back(new cSlotAreaInventory(*this)); m_SlotAreas.push_back(new cSlotAreaHotBar(*this)); } @@ -861,8 +921,13 @@ cEnchantingWindow::cEnchantingWindow(int a_BlockX, int a_BlockY, int a_BlockZ) : void cEnchantingWindow::SetProperty(int a_Property, int a_Value) { - m_PropertyValue[a_Property] = a_Value; + if ((a_Property < 0) || ((size_t)a_Property >= ARRAYCOUNT(m_PropertyValue))) + { + ASSERT(!"a_Property is invalid"); + return; + } + m_PropertyValue[a_Property] = a_Value; super::SetProperty(a_Property, a_Value); } @@ -872,8 +937,13 @@ void cEnchantingWindow::SetProperty(int a_Property, int a_Value) void cEnchantingWindow::SetProperty(int a_Property, int a_Value, cPlayer & a_Player) { - m_PropertyValue[a_Property] = a_Value; + if ((a_Property < 0) || ((size_t)a_Property >= ARRAYCOUNT(m_PropertyValue))) + { + ASSERT(!"a_Property is invalid"); + return; + } + m_PropertyValue[a_Property] = a_Value; super::SetProperty(a_Property, a_Value, a_Player); } @@ -883,18 +953,13 @@ void cEnchantingWindow::SetProperty(int a_Property, int a_Value, cPlayer & a_Pla int cEnchantingWindow::GetPropertyValue(int a_Property) { - return m_PropertyValue[a_Property]; -} - - - - + if ((a_Property < 0) || ((size_t)a_Property >= ARRAYCOUNT(m_PropertyValue))) + { + ASSERT(!"a_Property is invalid"); + return 0; + } -void cEnchantingWindow::GetBlockPos(int & a_PosX, int & a_PosY, int & a_PosZ) -{ - a_PosX = m_BlockX; - a_PosY = m_BlockY; - a_PosZ = m_BlockZ; + return m_PropertyValue[a_Property]; } @@ -1012,6 +1077,34 @@ cChestWindow::~cChestWindow() //////////////////////////////////////////////////////////////////////////////// +// cMinecartWithChestWindow: + +cMinecartWithChestWindow::cMinecartWithChestWindow(cMinecartWithChest * a_ChestCart) : + cWindow(wtChest, "Minecart with Chest"), + m_ChestCart(a_ChestCart) +{ + m_ShouldDistributeToHotbarFirst = false; + m_SlotAreas.push_back(new cSlotAreaMinecartWithChest(a_ChestCart, *this)); + m_SlotAreas.push_back(new cSlotAreaInventory(*this)); + m_SlotAreas.push_back(new cSlotAreaHotBar(*this)); + + a_ChestCart->GetWorld()->BroadcastSoundEffect("random.chestopen", a_ChestCart->GetPosX(), a_ChestCart->GetPosY(), a_ChestCart->GetPosZ(), 1, 1); +} + + + + + +cMinecartWithChestWindow::~cMinecartWithChestWindow() +{ + m_ChestCart->GetWorld()->BroadcastSoundEffect("random.chestclosed", m_ChestCart->GetPosX(), m_ChestCart->GetPosY(), m_ChestCart->GetPosZ(), 1, 1); +} + + + + + +//////////////////////////////////////////////////////////////////////////////// // cDropSpenserWindow: cDropSpenserWindow::cDropSpenserWindow(int a_BlockX, int a_BlockY, int a_BlockZ, cDropSpenserEntity * a_DropSpenser) : @@ -1037,6 +1130,7 @@ cEnderChestWindow::cEnderChestWindow(cEnderChestEntity * a_EnderChest) : m_BlockY(a_EnderChest->GetPosY()), m_BlockZ(a_EnderChest->GetPosZ()) { + m_ShouldDistributeToHotbarFirst = false; m_SlotAreas.push_back(new cSlotAreaEnderChest(a_EnderChest, *this)); m_SlotAreas.push_back(new cSlotAreaInventory(*this)); m_SlotAreas.push_back(new cSlotAreaHotBar(*this)); diff --git a/src/UI/Window.h b/src/UI/Window.h index 97db0ca88..6b6dce346 100644 --- a/src/UI/Window.h +++ b/src/UI/Window.h @@ -23,6 +23,8 @@ class cDropSpenserEntity; class cEnderChestEntity; class cFurnaceEntity; class cHopperEntity; +class cMinecartWithChest; +class cBeaconEntity; class cSlotArea; class cSlotAreaAnvil; class cWorld; @@ -62,7 +64,7 @@ public: wtBeacon = 7, wtAnvil = 8, wtHopper = 9, - // Unknown: 10 + wtDropper = 10, wtAnimalChest = 11, }; @@ -75,6 +77,7 @@ public: char GetWindowID(void) const { return m_WindowID; } // tolua_export int GetWindowType(void) const { return m_WindowType; } // tolua_export + const AString GetWindowTypeName(void) const; // tolua_export cWindowOwner * GetOwner(void) { return m_Owner; } void SetOwner( cWindowOwner * a_Owner) { m_Owner = a_Owner; } @@ -258,6 +261,26 @@ protected: +class cBeaconWindow : + public cWindow +{ + typedef cWindow super; +public: + cBeaconWindow(int a_BlockX, int a_BlockY, int a_BlockZ, cBeaconEntity * a_Beacon); + + cBeaconEntity * GetBeaconEntity(void) const { return m_Beacon; } + + // cWindow Overrides: + virtual void OpenedByPlayer(cPlayer & a_Player) override; + +protected: + cBeaconEntity * m_Beacon; +} ; + + + + + class cEnchantingWindow : public cWindow { @@ -270,9 +293,6 @@ public: /** Return the Value of a Property */ int GetPropertyValue(int a_Property); - /** Get the Position from the Enchantment Table */ - void GetBlockPos(int & a_PosX, int & a_PosY, int & a_PosZ); - cSlotArea * m_SlotArea; protected: @@ -342,6 +362,20 @@ protected: +class cMinecartWithChestWindow : + public cWindow +{ +public: + cMinecartWithChestWindow(cMinecartWithChest * a_ChestCart); + ~cMinecartWithChestWindow(); +private: + cMinecartWithChest * m_ChestCart; +}; + + + + + class cEnderChestWindow : public cWindow { diff --git a/src/UI/WindowOwner.h b/src/UI/WindowOwner.h index 7a7941e37..6845a161b 100644 --- a/src/UI/WindowOwner.h +++ b/src/UI/WindowOwner.h @@ -1,4 +1,3 @@ - #pragma once #include "../BlockEntities/BlockEntity.h" @@ -16,12 +15,6 @@ for entities / players in motion to close their windows when they get too far aw -// class cWindow; - - - - - /** Base class for the window owning */ @@ -32,16 +25,16 @@ public: m_Window(NULL) { } - + virtual ~cWindowOwner() { } - + void CloseWindow(void) { m_Window = NULL; } - + void OpenWindow(cWindow * a_Window) { m_Window = a_Window; @@ -54,11 +47,11 @@ public: } /// Returns the block position at which the element owning the window is - virtual void GetBlockPos(int & a_BlockX, int & a_BlockY, int & a_BlockZ) = 0; - + virtual Vector3i GetBlockPos(void) = 0; + private: cWindow * m_Window; -} ; +}; @@ -71,26 +64,19 @@ class cBlockEntityWindowOwner : public cWindowOwner { public: - cBlockEntityWindowOwner(void) : - m_BlockEntity(NULL) - { - } - - void SetBlockEntity(cBlockEntity * a_BlockEntity) + cBlockEntityWindowOwner(cBlockEntity * a_BlockEntity) : + m_BlockEntity(a_BlockEntity) { - m_BlockEntity = a_BlockEntity; } - - virtual void GetBlockPos(int & a_BlockX, int & a_BlockY, int & a_BlockZ) override + + virtual Vector3i GetBlockPos(void) override { - a_BlockX = m_BlockEntity->GetPosX(); - a_BlockY = m_BlockEntity->GetPosY(); - a_BlockZ = m_BlockEntity->GetPosZ(); + return Vector3i(m_BlockEntity->GetPosX(), m_BlockEntity->GetPosY(), m_BlockEntity->GetPosZ()); } - + private: cBlockEntity * m_BlockEntity; -} ; +}; @@ -103,26 +89,19 @@ class cEntityWindowOwner : public cWindowOwner { public: - cEntityWindowOwner(void) : - m_Entity(NULL) - { - } - - void SetEntity(cEntity * a_Entity) + cEntityWindowOwner(cEntity * a_Entity) : + m_Entity(a_Entity) { - m_Entity = a_Entity; } - virtual void GetBlockPos(int & a_BlockX, int & a_BlockY, int & a_BlockZ) override + virtual Vector3i GetBlockPos(void) override { - a_BlockX = (int)floor(m_Entity->GetPosX() + 0.5); - a_BlockY = (int)floor(m_Entity->GetPosY() + 0.5); - a_BlockZ = (int)floor(m_Entity->GetPosZ() + 0.5); + return m_Entity->GetPosition().Floor(); } - + private: cEntity * m_Entity; -} ; +}; diff --git a/src/Vector3.h b/src/Vector3.h index 1dcb38f64..1854e42e3 100644 --- a/src/Vector3.h +++ b/src/Vector3.h @@ -3,8 +3,6 @@ -#define _USE_MATH_DEFINES // Enable non-standard math defines (MSVC) -#include <math.h> #include <list> #include <vector> @@ -29,9 +27,9 @@ public: // Hardcoded copy constructors (tolua++ does not support function templates .. yet) - Vector3(const Vector3<float> & a_Rhs) : x((T) a_Rhs.x), y((T) a_Rhs.y), z((T) a_Rhs.z) {} - Vector3(const Vector3<double> & a_Rhs) : x((T) a_Rhs.x), y((T) a_Rhs.y), z((T) a_Rhs.z) {} - Vector3(const Vector3<int> & a_Rhs) : x((T) a_Rhs.x), y((T) a_Rhs.y), z((T) a_Rhs.z) {} + Vector3(const Vector3<float> & a_Rhs) : x(static_cast<T>(a_Rhs.x)), y(static_cast<T>(a_Rhs.y)), z(static_cast<T>(a_Rhs.z)) {} + Vector3(const Vector3<double> & a_Rhs) : x(static_cast<T>(a_Rhs.x)), y(static_cast<T>(a_Rhs.y)), z(static_cast<T>(a_Rhs.z)) {} + Vector3(const Vector3<int> & a_Rhs) : x(static_cast<T>(a_Rhs.x)), y(static_cast<T>(a_Rhs.y)), z(static_cast<T>(a_Rhs.z)) {} // tolua_end @@ -53,9 +51,9 @@ public: { double Len = 1.0 / Length(); - x = (T)(x * Len); - y = (T)(y * Len); - z = (T)(z * Len); + x = static_cast<T>(x * Len); + y = static_cast<T>(y * Len); + z = static_cast<T>(z * Len); } inline Vector3<T> NormalizeCopy(void) const @@ -63,9 +61,9 @@ public: double Len = 1.0 / Length(); return Vector3<T>( - (T)(x * Len), - (T)(y * Len), - (T)(z * Len) + static_cast<T>(x * Len), + static_cast<T>(y * Len), + static_cast<T>(z * Len) ); } @@ -74,15 +72,15 @@ public: double Len = 1.0 / Length(); a_Rhs.Set( - (T)(x * Len), - (T)(y * Len), - (T)(z * Len) + static_cast<T>(x * Len), + static_cast<T>(y * Len), + static_cast<T>(z * Len) ); } inline double Length(void) const { - return sqrt((double)(x * x + y * y + z * z)); + return sqrt(static_cast<double>(x * x + y * y + z * z)); } inline double SqrLength(void) const @@ -138,9 +136,9 @@ public: inline Vector3<int> Floor(void) const { return Vector3<int>( - (int)floor(x), - (int)floor(y), - (int)floor(z) + FloorC(x), + FloorC(y), + FloorC(z) ); } diff --git a/src/VoronoiMap.cpp b/src/VoronoiMap.cpp index 5efd09c01..5ad634fe4 100644 --- a/src/VoronoiMap.cpp +++ b/src/VoronoiMap.cpp @@ -10,11 +10,13 @@ -cVoronoiMap::cVoronoiMap(int a_Seed, int a_CellSize) : +cVoronoiMap::cVoronoiMap(int a_Seed, int a_CellSize, int a_JitterSize) : m_Noise1(a_Seed + 1), m_Noise2(a_Seed + 2), m_Noise3(a_Seed + 3), - m_CellSize(a_CellSize), + m_CellSize(std::max(a_CellSize, 2)), + m_JitterSize(Clamp(a_JitterSize, 1, a_CellSize)), + m_OddRowOffset(0), m_CurrentCellX(9999999), // Cell coords that are definitely out of the range for normal generator, so that the first query will overwrite them m_CurrentCellZ(9999999) { @@ -26,7 +28,29 @@ cVoronoiMap::cVoronoiMap(int a_Seed, int a_CellSize) : void cVoronoiMap::SetCellSize(int a_CellSize) { + a_CellSize = std::max(a_CellSize, 2); // Cell size must be at least 2 m_CellSize = a_CellSize; + + // For compatibility with previous version, which didn't have the jitter, we set jitter here as well. + m_JitterSize = a_CellSize; +} + + + + + +void cVoronoiMap::SetJitterSize(int a_JitterSize) +{ + m_JitterSize = Clamp(a_JitterSize, 1, m_CellSize); +} + + + + + +void cVoronoiMap::SetOddRowOffset(int a_OddRowOffset) +{ + m_OddRowOffset = Clamp(a_OddRowOffset, -m_CellSize, m_CellSize); } @@ -35,8 +59,8 @@ void cVoronoiMap::SetCellSize(int a_CellSize) int cVoronoiMap::GetValueAt(int a_X, int a_Y) { - int MinDist1, MinDist2; - return GetValueAt(a_X, a_Y, MinDist1, MinDist2); + int SeedX, SeedY, MinDist2; + return GetValueAt(a_X, a_Y, SeedX, SeedY, MinDist2); } @@ -45,41 +69,47 @@ int cVoronoiMap::GetValueAt(int a_X, int a_Y) int cVoronoiMap::GetValueAt(int a_X, int a_Y, int & a_MinDist) { - int MinDist2; - return GetValueAt(a_X, a_Y, a_MinDist, MinDist2); + int SeedX, SeedY, MinDist2; + int res = GetValueAt(a_X, a_Y, SeedX, SeedY, MinDist2); + a_MinDist = (a_X - SeedX) * (a_X - SeedX) + (a_Y - SeedY) * (a_Y - SeedY); + return res; } -int cVoronoiMap::GetValueAt(int a_X, int a_Y, int & a_MinDist1, int & a_MinDist2) +int cVoronoiMap::GetValueAt( + int a_X, int a_Y, // Coords to query + int & a_NearestSeedX, int & a_NearestSeedY, // Coords of the closest cell + int & a_MinDist2 // Distance to the second closest cell +) { - // Note that due to historical reasons, the algorithm uses XZ coords, while the input uses XY coords. - // This is because the algorithm was first implemented directly in the biome generators which use MC coords. - int CellX = a_X / m_CellSize; - int CellZ = a_Y / m_CellSize; + int CellY = a_Y / m_CellSize; - UpdateCell(CellX, CellZ); + UpdateCell(CellX, CellY); // Get 5x5 neighboring cell seeds, compare distance to each. Return the value in the minumim-distance cell + int NearestSeedX = 0, NearestSeedY = 0; int MinDist = m_CellSize * m_CellSize * 16; // There has to be a cell closer than this int MinDist2 = MinDist; int res = 0; // Will be overriden for (int x = 0; x < 5; x++) { - for (int z = 0; z < 5; z++) + for (int y = 0; y < 5; y++) { - int SeedX = m_SeedX[x][z]; - int SeedZ = m_SeedZ[x][z]; + int SeedX = m_SeedX[x][y]; + int SeedY = m_SeedZ[x][y]; - int Dist = (SeedX - a_X) * (SeedX - a_X) + (SeedZ - a_Y) * (SeedZ - a_Y); + int Dist = (SeedX - a_X) * (SeedX - a_X) + (SeedY - a_Y) * (SeedY - a_Y); if (Dist < MinDist) { + NearestSeedX = SeedX; + NearestSeedY = SeedY; MinDist2 = MinDist; MinDist = Dist; - res = m_Noise3.IntNoise2DInt(x + CellX - 2, z + CellZ - 2); + res = m_Noise3.IntNoise2DInt(x + CellX - 2, y + CellY - 2); } else if (Dist < MinDist2) { @@ -88,7 +118,8 @@ int cVoronoiMap::GetValueAt(int a_X, int a_Y, int & a_MinDist1, int & a_MinDist2 } // for z } // for x - a_MinDist1 = MinDist; + a_NearestSeedX = NearestSeedX; + a_NearestSeedY = NearestSeedY; a_MinDist2 = MinDist2; return res; } @@ -97,6 +128,58 @@ int cVoronoiMap::GetValueAt(int a_X, int a_Y, int & a_MinDist1, int & a_MinDist2 +void cVoronoiMap::FindNearestSeeds( + int a_X, int a_Y, + int & a_NearestSeedX, int & a_NearestSeedY, + int & a_SecondNearestSeedX, int & a_SecondNearestSeedY +) +{ + int CellX = a_X / m_CellSize; + int CellY = a_Y / m_CellSize; + + UpdateCell(CellX, CellY); + + // Get 5x5 neighboring cell seeds, compare distance to each. Return the value in the minumim-distance cell + int NearestSeedX = 0, NearestSeedY = 0; + int SecondNearestSeedX = 0, SecondNearestSeedY = 0; + int MinDist = m_CellSize * m_CellSize * 16; // There has to be a cell closer than this + int MinDist2 = MinDist; + for (int x = 0; x < 5; x++) + { + for (int y = 0; y < 5; y++) + { + int SeedX = m_SeedX[x][y]; + int SeedY = m_SeedZ[x][y]; + + int Dist = (SeedX - a_X) * (SeedX - a_X) + (SeedY - a_Y) * (SeedY - a_Y); + if (Dist < MinDist) + { + SecondNearestSeedX = NearestSeedX; + SecondNearestSeedY = NearestSeedY; + MinDist2 = MinDist; + NearestSeedX = SeedX; + NearestSeedY = SeedY; + MinDist = Dist; + } + else if (Dist < MinDist2) + { + SecondNearestSeedX = SeedX; + SecondNearestSeedY = SeedY; + MinDist2 = Dist; + } + } // for z + } // for x + + a_NearestSeedX = NearestSeedX; + a_NearestSeedY = NearestSeedY; + a_SecondNearestSeedX = SecondNearestSeedX; + a_SecondNearestSeedY = SecondNearestSeedY; +} + + + + + void cVoronoiMap::UpdateCell(int a_CellX, int a_CellZ) { // If the specified cell is currently cached, bail out: @@ -111,12 +194,13 @@ void cVoronoiMap::UpdateCell(int a_CellX, int a_CellZ) for (int x = 0; x < 5; x++) { int BaseX = (NoiseBaseX + x) * m_CellSize; + int OddRowOffset = ((NoiseBaseX + x) & 0x01) * m_OddRowOffset; for (int z = 0; z < 5; z++) { - int OffsetX = (m_Noise1.IntNoise2DInt(NoiseBaseX + x, NoiseBaseZ + z) / 8) % m_CellSize; - int OffsetZ = (m_Noise2.IntNoise2DInt(NoiseBaseX + x, NoiseBaseZ + z) / 8) % m_CellSize; + int OffsetX = (m_Noise1.IntNoise2DInt(NoiseBaseX + x, NoiseBaseZ + z) / 8) % m_JitterSize; + int OffsetZ = (m_Noise2.IntNoise2DInt(NoiseBaseX + x, NoiseBaseZ + z) / 8) % m_JitterSize; m_SeedX[x][z] = BaseX + OffsetX; - m_SeedZ[x][z] = (NoiseBaseZ + z) * m_CellSize + OffsetZ; + m_SeedZ[x][z] = (NoiseBaseZ + z) * m_CellSize + OddRowOffset + OffsetZ; } // for z } // for x m_CurrentCellX = a_CellX; diff --git a/src/VoronoiMap.h b/src/VoronoiMap.h index 84cf206e9..dfb11e9ce 100644 --- a/src/VoronoiMap.h +++ b/src/VoronoiMap.h @@ -18,19 +18,40 @@ class cVoronoiMap { public: - cVoronoiMap(int a_Seed, int a_CellSize = 128); + cVoronoiMap(int a_Seed, int a_CellSize = 128, int a_JitterSize = 128); - /// Sets the cell size used for generating the Voronoi seeds + /** Sets both the cell size and jitter size used for generating the Voronoi seeds. */ void SetCellSize(int a_CellSize); + + /** Sets the jitter size. Clamps it to current cell size. */ + void SetJitterSize(int a_JitterSize); + + /** Sets the offset that is added to each odd row of cells. + This offset makes the voronoi cells align to a non-grid. + Clamps the value to [-m_CellSize, +m_CellSize]. */ + void SetOddRowOffset(int a_OddRowOffset); - /// Returns the value in the cell into which the specified point lies + /** Returns the value in the cell into which the specified point lies. */ int GetValueAt(int a_X, int a_Y); - /// Returns the value in the cell into which the specified point lies, and the distance to the nearest Voronoi seed + /** Returns the value in the cell into which the specified point lies, + and the distance to the nearest Voronoi seed. */ int GetValueAt(int a_X, int a_Y, int & a_MinDistance); - /// Returns the value in the cell into which the specified point lies, and the distances to the 2 nearest Voronoi seeds. Uses a cache - int GetValueAt(int a_X, int a_Y, int & a_MinDistance1, int & a_MinDistance2); + /** Returns the value in the cell into which the specified point lies, + and the distances to the 2 nearest Voronoi seeds. Uses a cache. */ + int GetValueAt( + int a_X, int a_Y, // Coords to query + int & a_NearestSeedX, int & a_NearestSeedY, // Coords of the closest cell's seed + int & a_MinDist2 // Distance to the second closest cell's seed + ); + + /** Finds the nearest and second nearest seeds, returns their coords. */ + void FindNearestSeeds( + int a_X, int a_Y, + int & a_NearestSeedX, int & a_NearestSeedY, + int & a_SecondNearestSeedX, int & a_SecondNearestSeedY + ); protected: /// The noise used for generating Voronoi seeds @@ -38,8 +59,17 @@ protected: cNoise m_Noise2; cNoise m_Noise3; - /// Size of the Voronoi cells (avg X/Y distance between the seeds) + /** Size of the Voronoi cells (avg X/Y distance between the seeds). Expected to be at least 2. */ int m_CellSize; + + /** The amount that the cell seeds may be offset from the grid. + Expected to be at least 1 and less than m_CellSize. */ + int m_JitterSize; + + /** The constant amount that the cell seeds of every odd row will be offset from the grid. + This allows us to have non-rectangular grids. + Expected to be between -m_CellSize and +m_CellSize. */ + int m_OddRowOffset; /** The X coordinate of the currently cached cell neighborhood */ int m_CurrentCellX; diff --git a/src/WebAdmin.cpp b/src/WebAdmin.cpp index f5dc6fde7..db2ace386 100644 --- a/src/WebAdmin.cpp +++ b/src/WebAdmin.cpp @@ -43,6 +43,8 @@ public: cWebAdmin::cWebAdmin(void) : m_IsInitialized(false), m_IsRunning(false), + m_PortsIPv4("8080"), + m_PortsIPv6(""), m_TemplateScript("<webadmin_template>") { } @@ -89,6 +91,8 @@ bool cWebAdmin::Init(void) m_IniFile.AddHeaderComment(" Password format: Password=*password*; for example:"); m_IniFile.AddHeaderComment(" [User:admin]"); m_IniFile.AddHeaderComment(" Password=admin"); + m_IniFile.SetValue("WebAdmin", "Port", m_PortsIPv4); + m_IniFile.SetValue("WebAdmin", "PortsIPv6", m_PortsIPv6); m_IniFile.WriteFile("webadmin.ini"); } @@ -100,8 +104,8 @@ bool cWebAdmin::Init(void) LOGD("Initialising WebAdmin..."); - m_PortsIPv4 = m_IniFile.GetValueSet("WebAdmin", "Port", "8080"); - m_PortsIPv6 = m_IniFile.GetValueSet("WebAdmin", "PortsIPv6", ""); + m_PortsIPv4 = m_IniFile.GetValueSet("WebAdmin", "Port", m_PortsIPv4); + m_PortsIPv6 = m_IniFile.GetValueSet("WebAdmin", "PortsIPv6", m_PortsIPv6); if (!m_HTTPServer.Initialize(m_PortsIPv4, m_PortsIPv6)) { @@ -131,8 +135,24 @@ bool cWebAdmin::Start(void) m_TemplateScript.RegisterAPILibs(); if (!m_TemplateScript.LoadFile(FILE_IO_PREFIX "webadmin/template.lua")) { - LOGWARN("Could not load WebAdmin template \"%s\", using default template.", FILE_IO_PREFIX "webadmin/template.lua"); + LOGWARN("Could not load WebAdmin template \"%s\". WebAdmin disabled!", FILE_IO_PREFIX "webadmin/template.lua"); m_TemplateScript.Close(); + m_HTTPServer.Stop(); + return false; + } + + if (!LoadLoginTemplate()) + { + LOGWARN("Could not load WebAdmin login template \"%s\", using fallback template.", FILE_IO_PREFIX "webadmin/login_template.html"); + + // Sets the fallback template: + m_LoginTemplate = \ + "<h1>MCServer WebAdmin</h1>" \ + "<center>" \ + "<form method='get' action='webadmin/'>" \ + "<input type='submit' value='Log in'>" \ + "</form>" \ + "</center>"; } m_IsRunning = m_HTTPServer.Start(*this); @@ -159,22 +179,22 @@ void cWebAdmin::Stop(void) -AString cWebAdmin::GetTemplate() +bool cWebAdmin::LoadLoginTemplate(void) { - AString retVal = ""; - - char SourceFile[] = "webadmin/template.html"; - - cFile f; - if (!f.Open(SourceFile, cFile::fmRead)) + cFile File(FILE_IO_PREFIX "webadmin/login_template.html", cFile::fmRead); + if (!File.IsOpen()) { - return ""; + return false; } - // copy the file into the buffer: - f.ReadRestOfFile(retVal); + AString TemplateContent; + if (File.ReadRestOfFile(TemplateContent) == -1) + { + return false; + } - return retVal; + m_LoginTemplate = TemplateContent; + return true; } @@ -198,9 +218,9 @@ void cWebAdmin::HandleWebadminRequest(cHTTPConnection & a_Connection, cHTTPReque } // Check if the contents should be wrapped in the template: - AString URL = a_Request.GetBareURL(); - ASSERT(URL.length() > 0); - bool ShouldWrapInTemplate = ((URL.length() > 1) && (URL[1] != '~')); + AString BareURL = a_Request.GetBareURL(); + ASSERT(BareURL.length() > 0); + bool ShouldWrapInTemplate = ((BareURL.length() > 1) && (BareURL[1] != '~')); // Retrieve the request data: cWebadminRequestData * Data = (cWebadminRequestData *)(a_Request.GetUserData()); @@ -215,7 +235,7 @@ void cWebAdmin::HandleWebadminRequest(cHTTPConnection & a_Connection, cHTTPReque HTTPTemplateRequest TemplateRequest; TemplateRequest.Request.Username = a_Request.GetAuthUsername(); TemplateRequest.Request.Method = a_Request.GetMethod(); - TemplateRequest.Request.Path = URL.substr(1); + TemplateRequest.Request.Path = BareURL.substr(1); if (Data->m_Form.Finish()) { @@ -258,7 +278,7 @@ void cWebAdmin::HandleWebadminRequest(cHTTPConnection & a_Connection, cHTTPReque return; } - AString BaseURL = GetBaseURL(URL); + AString BaseURL = GetBaseURL(BareURL); AString Menu; Template = "{CONTENT}"; AString FoundPlugin; @@ -320,17 +340,64 @@ void cWebAdmin::HandleWebadminRequest(cHTTPConnection & a_Connection, cHTTPReque void cWebAdmin::HandleRootRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) { UNUSED(a_Request); - static const char LoginForm[] = \ - "<h1>MCServer WebAdmin</h1>" \ - "<center>" \ - "<form method='get' action='webadmin/'>" \ - "<input type='submit' value='Log in'>" \ - "</form>" \ - "</center>"; + cHTTPResponse Resp; Resp.SetContentType("text/html"); a_Connection.Send(Resp); - a_Connection.Send(LoginForm, sizeof(LoginForm) - 1); + a_Connection.Send(m_LoginTemplate); + a_Connection.FinishResponse(); +} + + + + + +void cWebAdmin::HandleFileRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) +{ + AString FileURL = a_Request.GetURL(); + std::replace(FileURL.begin(), FileURL.end(), '\\', '/'); + + // Remove all leading backslashes: + if (FileURL[0] == '/') + { + size_t FirstCharToRead = FileURL.find_first_not_of('/'); + if (FirstCharToRead != AString::npos) + { + FileURL = FileURL.substr(FirstCharToRead); + } + } + + // Remove all "../" strings: + ReplaceString(FileURL, "../", ""); + + bool LoadedSuccessfull = false; + AString Content = "<h2>404 Not Found</h2>"; + AString Path = Printf(FILE_IO_PREFIX "webadmin/files/%s", FileURL.c_str()); + if (cFile::IsFile(Path)) + { + cFile File(Path, cFile::fmRead); + AString FileContent; + if (File.IsOpen() && (File.ReadRestOfFile(FileContent) != -1)) + { + LoadedSuccessfull = true; + Content = FileContent; + } + } + + // Find content type (The currently method is very bad. We should change it later) + AString ContentType = "text/html"; + size_t LastPointPosition = Path.find_last_of('.'); + if (LoadedSuccessfull && (LastPointPosition != AString::npos) && (LastPointPosition < Path.length())) + { + AString FileExtension = Path.substr(LastPointPosition + 1); + ContentType = GetContentTypeFromFileExt(FileExtension); + } + + // Send the response: + cHTTPResponse Resp; + Resp.SetContentType(ContentType); + a_Connection.Send(Resp); + a_Connection.Send(Content); a_Connection.FinishResponse(); } @@ -338,6 +405,41 @@ void cWebAdmin::HandleRootRequest(cHTTPConnection & a_Connection, cHTTPRequest & +AString cWebAdmin::GetContentTypeFromFileExt(const AString & a_FileExtension) +{ + static bool IsInitialized = false; + static std::map<AString, AString> ContentTypeMap; + if (!IsInitialized) + { + // Initialize the ContentTypeMap: + ContentTypeMap["png"] = "image/png"; + ContentTypeMap["fif"] = "image/fif"; + ContentTypeMap["gif"] = "image/gif"; + ContentTypeMap["jpeg"] = "image/jpeg"; + ContentTypeMap["jpg"] = "image/jpeg"; + ContentTypeMap["jpe"] = "image/jpeg"; + ContentTypeMap["tiff"] = "image/tiff"; + ContentTypeMap["ico"] = "image/ico"; + ContentTypeMap["csv"] = "image/comma-separated-values"; + ContentTypeMap["css"] = "text/css"; + ContentTypeMap["js"] = "text/javascript"; + ContentTypeMap["txt"] = "text/plain"; + ContentTypeMap["rtx"] = "text/richtext"; + ContentTypeMap["xml"] = "text/xml"; + } + + AString FileExtension = StrToLower(a_FileExtension); + if (ContentTypeMap.find(a_FileExtension) == ContentTypeMap.end()) + { + return "text/html"; + } + return ContentTypeMap[FileExtension]; +} + + + + + sWebAdminPage cWebAdmin::GetPage(const HTTPRequest & a_Request) { sWebAdminPage Page; @@ -404,6 +506,7 @@ AString cWebAdmin::GetDefaultPage(void) + AString cWebAdmin::GetBaseURL( const AString& a_URL) { return GetBaseURL(StringSplit(a_URL, "/")); @@ -444,6 +547,38 @@ AString cWebAdmin::GetHTMLEscapedString(const AString & a_Input) +AString cWebAdmin::GetURLEncodedString(const AString & a_Input) +{ + // Translation table from nibble to hex: + static const char Hex[] = "0123456789abcdef"; + + // Preallocate the output to match input: + AString dst; + size_t len = a_Input.length(); + dst.reserve(len); + + // Loop over input and substitute whatever is needed: + for (size_t i = 0; i < len; i++) + { + char ch = a_Input[i]; + if (isalnum(ch) || (ch == '-') || (ch == '_') || (ch == '.') || (ch == '~')) + { + dst.push_back(ch); + } + else + { + dst.push_back('%'); + dst.push_back(Hex[(ch >> 4) & 0x0f]); + dst.push_back(Hex[ch & 0x0f]); + } + } // for i - a_Input[] + return dst; +} + + + + + AString cWebAdmin::GetBaseURL(const AStringVector & a_URLSplit) { AString BaseURL = "./"; @@ -518,7 +653,7 @@ void cWebAdmin::OnRequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & } else { - // TODO: Handle other requests + HandleFileRequest(a_Connection, a_Request); } // Delete any request data assigned to the request: @@ -541,4 +676,3 @@ void cWebAdmin::cWebadminRequestData::OnBody(const char * a_Data, size_t a_Size) - diff --git a/src/WebAdmin.h b/src/WebAdmin.h index d679a097c..94b95dbcf 100644 --- a/src/WebAdmin.h +++ b/src/WebAdmin.h @@ -116,6 +116,9 @@ public: /** Stops the HTTP server, if it was started. */ void Stop(void); + /** Loads the login template. Returns true if the loading succeeds, false if not. */ + bool LoadLoginTemplate(void); + void AddPlugin(cWebPlugin * a_Plugin); void RemovePlugin(cWebPlugin * a_Plugin); @@ -132,16 +135,22 @@ public: /** Returns the prefix needed for making a link point to the webadmin root from the given URL ("../../../webadmin"-style) */ AString GetBaseURL(const AString & a_URL); - /** Escapes text passed into it, so it can be embedded into html. */ - static AString GetHTMLEscapedString(const AString & a_Input); - AString GetIPv4Ports(void) const { return m_PortsIPv4; } AString GetIPv6Ports(void) const { return m_PortsIPv6; } // tolua_end + /** Escapes text passed into it, so it can be embedded into html. */ + static AString GetHTMLEscapedString(const AString & a_Input); + + /** Escapes the string for use in an URL */ + static AString GetURLEncodedString(const AString & a_Input); + /** Returns the prefix needed for making a link point to the webadmin root from the given URL ("../../../webadmin"-style) */ - AString GetBaseURL(const AStringVector& a_URLSplit); + static AString GetBaseURL(const AStringVector & a_URLSplit); + + /** Returns the content type from the file extension. If the extension isn't in the list, the function returns "text/html" */ + static AString GetContentTypeFromFileExt(const AString & a_FileExtension); protected: /** Common base class for request body data handlers */ @@ -202,18 +211,21 @@ protected: /** The Lua template script to provide templates: */ cLuaState m_TemplateScript; + /** The template that provides the login site: */ + AString m_LoginTemplate; + /** The HTTP server which provides the underlying HTTP parsing, serialization and events */ cHTTPServer m_HTTPServer; - - AString GetTemplate(void); - /** Handles requests coming to the "/webadmin" or "/~webadmin" URLs */ void HandleWebadminRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Request); /** Handles requests for the root page */ void HandleRootRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Request); + /** Handles requests for a file */ + void HandleFileRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Request); + // cHTTPServer::cCallbacks overrides: virtual void OnRequestBegun (cHTTPConnection & a_Connection, cHTTPRequest & a_Request) override; virtual void OnRequestBody (cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) override; diff --git a/src/World.cpp b/src/World.cpp index 84c0f2b93..a3c804b44 100644 --- a/src/World.cpp +++ b/src/World.cpp @@ -1,3 +1,4 @@ + #include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules #include "BlockID.h" @@ -25,6 +26,7 @@ #include "Entities/TNTEntity.h" #include "BlockEntities/CommandBlockEntity.h" +#include "BlockEntities/BeaconEntity.h" // Simulators: #include "Simulator/SimulatorManager.h" @@ -242,14 +244,45 @@ cWorld::cWorld(const AString & a_WorldName, eDimension a_Dimension, const AStrin #endif m_Dimension(a_Dimension), m_IsSpawnExplicitlySet(false), + m_IsDaylightCycleEnabled(true), m_WorldAgeSecs(0), m_TimeOfDaySecs(0), m_WorldAge(0), m_TimeOfDay(0), m_LastTimeUpdate(0), m_SkyDarkness(0), + m_GameMode(gmNotSet), + m_bEnabledPVP(false), + m_IsDeepSnowEnabled(false), + m_ShouldLavaSpawnFire(true), + m_VillagersShouldHarvestCrops(true), + m_SimulatorManager(NULL), + m_SandSimulator(NULL), + m_WaterSimulator(NULL), + m_LavaSimulator(NULL), + m_FireSimulator(NULL), + m_RedstoneSimulator(NULL), + m_MaxPlayers(10), + m_ChunkMap(NULL), + m_bAnimals(true), m_Weather(eWeather_Sunny), m_WeatherInterval(24000), // Guaranteed 1 day of sunshine at server start :) + m_MaxCactusHeight(3), + m_MaxSugarcaneHeight(4), + m_IsCactusBonemealable(false), + m_IsCarrotsBonemealable(true), + m_IsCropsBonemealable(true), + m_IsGrassBonemealable(true), + m_IsMelonStemBonemealable(true), + m_IsMelonBonemealable(true), + m_IsPotatoesBonemealable(true), + m_IsPumpkinStemBonemealable(true), + m_IsPumpkinBonemealable(true), + m_IsSaplingBonemealable(true), + m_IsSugarcaneBonemealable(false), + m_bCommandBlocksEnabled(true), + m_bUseChatPrefixes(false), + m_TNTShrapnelLevel(slNone), m_Scoreboard(this), m_MapManager(this), m_GeneratorCallbacks(*this), @@ -404,12 +437,12 @@ void cWorld::InitializeSpawn(void) int ViewDist = IniFile.GetValueSetI("SpawnPosition", "PregenerateDistance", DefaultViewDist); IniFile.WriteFile(m_IniFileName); - LOG("Preparing spawn area in world \"%s\"...", m_WorldName.c_str()); + LOG("Preparing spawn area in world \"%s\", %d x %d chunks, total %d chunks...", m_WorldName.c_str(), ViewDist, ViewDist, ViewDist * ViewDist); for (int x = 0; x < ViewDist; x++) { for (int z = 0; z < ViewDist; z++) { - m_ChunkMap->TouchChunk(x + ChunkX-(ViewDist - 1) / 2, ZERO_CHUNK_Y, z + ChunkZ-(ViewDist - 1) / 2); // Queue the chunk in the generator / loader + m_ChunkMap->TouchChunk(x + ChunkX-(ViewDist - 1) / 2, z + ChunkZ-(ViewDist - 1) / 2); // Queue the chunk in the generator / loader } } @@ -530,6 +563,9 @@ void cWorld::Start(void) // If no configuration value is found, GetDimension() is written to file and the variable is written to again to ensure that cosmic rays haven't sneakily changed its value m_Dimension = StringToDimension(IniFile.GetValueSet("General", "Dimension", DimensionToString(GetDimension()))); + m_BroadcastDeathMessages = IniFile.GetValueSetB("Broadcasting", "BroadcastDeathMessages", true); + m_BroadcastAchievementMessages = IniFile.GetValueSetB("Broadcasting", "BroadcastAchievementMessages", true); + // Try to find the "SpawnPosition" key and coord values in the world configuration, set the flag if found int KeyNum = IniFile.FindKey("SpawnPosition"); m_IsSpawnExplicitlySet = @@ -572,10 +608,10 @@ void cWorld::Start(void) m_bEnabledPVP = IniFile.GetValueSetB("Mechanics", "PVPEnabled", true); m_bUseChatPrefixes = IniFile.GetValueSetB("Mechanics", "UseChatPrefixes", true); m_VillagersShouldHarvestCrops = IniFile.GetValueSetB("Monsters", "VillagersShouldHarvestCrops", true); + m_IsDaylightCycleEnabled = IniFile.GetValueSetB("General", "IsDaylightCycleEnabled", true); int GameMode = IniFile.GetValueSetI("General", "Gamemode", (int)m_GameMode); int Weather = IniFile.GetValueSetI("General", "Weather", (int)m_Weather); - m_TimeOfDay = IniFile.GetValueSetI("General", "TimeInTicks", m_TimeOfDay); - + if (GetDimension() == dimOverworld) { m_NetherWorldName = IniFile.GetValueSet("LinkedWorlds", "NetherWorldName", GetName() + "_nether"); @@ -593,6 +629,7 @@ void cWorld::Start(void) InitialiseGeneratorDefaults(IniFile); InitialiseAndLoadMobSpawningValues(IniFile); + SetTimeOfDay(IniFile.GetValueSetI("General", "TimeInTicks", m_TimeOfDay)); m_ChunkMap = new cChunkMap(this); @@ -644,8 +681,19 @@ void cWorld::GenerateRandomSpawn(void) { LOGD("Generating random spawnpoint..."); - while (IsBlockWaterOrIce(GetBlock((int)m_SpawnX, GetHeight((int)m_SpawnX, (int)m_SpawnZ), (int)m_SpawnZ))) + // Look for a spawn point at most 100 chunks away from map center: + for (int i = 0; i < 100; i++) { + EMCSBiome biome = GetBiomeAt((int)m_SpawnX, (int)m_SpawnZ); + if ( + (biome != biOcean) && (biome != biFrozenOcean) && // The biome is acceptable (don't want a small ocean island) + !IsBlockWaterOrIce(GetBlock((int)m_SpawnX, GetHeight((int)m_SpawnX, (int)m_SpawnZ), (int)m_SpawnZ)) // The terrain is acceptable (don't want to spawn inside a lake / river) + ) + { + // A good spawnpoint was found + break; + } + // Try a neighboring chunk: if ((GetTickRandomNumber(4) % 2) == 0) // Randomise whether to increment X or Z coords { m_SpawnX += cChunkDef::Width; @@ -654,11 +702,11 @@ void cWorld::GenerateRandomSpawn(void) { m_SpawnZ += cChunkDef::Width; } - } + } // for i - 100* m_SpawnY = (double)GetHeight((int)m_SpawnX, (int)m_SpawnZ) + 1.6f; // 1.6f to accomodate player height - LOGD("Generated random spawnpoint %i %i %i", (int)m_SpawnX, (int)m_SpawnY, (int)m_SpawnZ); + LOGINFO("Generated random spawnpoint position {%i, %i, %i}", (int)m_SpawnX, (int)m_SpawnY, (int)m_SpawnZ); } @@ -720,6 +768,11 @@ void cWorld::InitialiseGeneratorDefaults(cIniFile & a_IniFile) a_IniFile.GetValueSet("Generator", "BottomLavaHeight", "30"); break; } + case dimNotSet: + { + ASSERT(!"Dimension not set"); + break; + } } } @@ -735,6 +788,7 @@ void cWorld::InitialiseAndLoadMobSpawningValues(cIniFile & a_IniFile) case dimOverworld: DefaultMonsters = "bat, cavespider, chicken, cow, creeper, enderman, horse, mooshroom, ocelot, pig, sheep, silverfish, skeleton, slime, spider, squid, wolf, zombie"; break; case dimNether: DefaultMonsters = "blaze, ghast, magmacube, skeleton, zombie, zombiepigman"; break; case dimEnd: DefaultMonsters = "enderman"; break; + case dimNotSet: ASSERT(!"Dimension not set"); break; } m_bAnimals = a_IniFile.GetValueSetB("Monsters", "AnimalsOn", true); @@ -748,8 +802,8 @@ void cWorld::InitialiseAndLoadMobSpawningValues(cIniFile & a_IniFile) AStringVector SplitList = StringSplitAndTrim(AllMonsters, ","); for (AStringVector::const_iterator itr = SplitList.begin(), end = SplitList.end(); itr != end; ++itr) { - cMonster::eType ToAdd = cMonster::StringToMobType(*itr); - if (ToAdd != cMonster::mtInvalidType) + eMonsterType ToAdd = cMonster::StringToMobType(*itr); + if (ToAdd != mtInvalidType) { m_AllowedMobs.insert(ToAdd); LOGD("Allowed mob: %s", itr->c_str()); @@ -793,6 +847,7 @@ void cWorld::Stop(void) IniFile.SetValueI("Physics", "TNTShrapnelLevel", (int)m_TNTShrapnelLevel); IniFile.SetValueB("Mechanics", "CommandBlocksEnabled", m_bCommandBlocksEnabled); IniFile.SetValueB("Mechanics", "UseChatPrefixes", m_bUseChatPrefixes); + IniFile.SetValueB("General", "IsDaylightCycleEnabled", m_IsDaylightCycleEnabled); IniFile.SetValueI("General", "Weather", (int)m_Weather); IniFile.SetValueI("General", "TimeInTicks", m_TimeOfDay); IniFile.WriteFile(m_IniFileName); @@ -823,28 +878,32 @@ void cWorld::Tick(float a_Dt, int a_LastTickDurationMSec) { SetChunkData(**itr); } // for itr - SetChunkDataQueue[] - - // We need sub-tick precision here, that's why we store the time in seconds and calculate ticks off of it + m_WorldAgeSecs += (double)a_Dt / 1000.0; - m_TimeOfDaySecs += (double)a_Dt / 1000.0; + m_WorldAge = (Int64)(m_WorldAgeSecs * 20.0); - // Wrap time of day each 20 minutes (1200 seconds) - if (m_TimeOfDaySecs > 1200.0) + if (m_IsDaylightCycleEnabled) { - m_TimeOfDaySecs -= 1200.0; - } + // We need sub-tick precision here, that's why we store the time in seconds and calculate ticks off of it + m_TimeOfDaySecs += (double)a_Dt / 1000.0; - m_WorldAge = (Int64)(m_WorldAgeSecs * 20.0); - m_TimeOfDay = (Int64)(m_TimeOfDaySecs * 20.0); + // Wrap time of day each 20 minutes (1200 seconds) + if (m_TimeOfDaySecs > 1200.0) + { + m_TimeOfDaySecs -= 1200.0; + } - // Updates the sky darkness based on current time of day - UpdateSkyDarkness(); + m_TimeOfDay = static_cast<int>(m_TimeOfDaySecs * 20.0); - // Broadcast time update every 40 ticks (2 seconds) - if (m_LastTimeUpdate < m_WorldAge - 40) - { - BroadcastTimeUpdate(); - m_LastTimeUpdate = m_WorldAge; + // Updates the sky darkness based on current time of day + UpdateSkyDarkness(); + + // Broadcast time update every 40 ticks (2 seconds) + if (m_LastTimeUpdate < m_WorldAge - 40) + { + BroadcastTimeUpdate(); + m_LastTimeUpdate = m_WorldAge; + } } // Add entities waiting in the queue to be added: @@ -1088,7 +1147,7 @@ void cWorld::UpdateSkyDarkness(void) } else if (TempTime <= TIME_NIGHT_START) { - m_SkyDarkness = (TIME_NIGHT_START - TempTime) / TIME_SPAWN_DIVISOR; + m_SkyDarkness = static_cast<NIBBLETYPE>((TIME_NIGHT_START - TempTime) / TIME_SPAWN_DIVISOR); } else if (TempTime <= TIME_NIGHT_END) { @@ -1096,7 +1155,7 @@ void cWorld::UpdateSkyDarkness(void) } else { - m_SkyDarkness = (TIME_SUNRISE - TempTime) / TIME_SPAWN_DIVISOR; + m_SkyDarkness = static_cast<NIBBLETYPE>((TIME_SUNRISE - TempTime) / TIME_SPAWN_DIVISOR); } } @@ -1184,24 +1243,26 @@ void cWorld::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_Blo return; } - // TODO: Add damage to entities and implement block hardiness + // TODO: Implement block hardiness Vector3d explosion_pos = Vector3d(a_BlockX, a_BlockY, a_BlockZ); cVector3iArray BlocksAffected; m_ChunkMap->DoExplosionAt(a_ExplosionSize, a_BlockX, a_BlockY, a_BlockZ, BlocksAffected); BroadcastSoundEffect("random.explode", (double)a_BlockX, (double)a_BlockY, (double)a_BlockZ, 1.0f, 0.6f); + { cCSLock Lock(m_CSPlayers); for (cPlayerList::iterator itr = m_Players.begin(); itr != m_Players.end(); ++itr) { cClientHandle * ch = (*itr)->GetClientHandle(); - if ((ch == NULL) || !ch->IsLoggedIn() || ch->IsDestroyed()) + if (ch == NULL) { continue; } + Vector3d distance_explosion = (*itr)->GetPosition() - explosion_pos; if (distance_explosion.SqrLength() < 4096.0) { - double real_distance = std::max(0.004, sqrt(distance_explosion.SqrLength())); + double real_distance = std::max(0.004, distance_explosion.Length()); double power = a_ExplosionSize / real_distance; if (power <= 1) { @@ -1213,6 +1274,7 @@ void cWorld::DoExplosionAt(double a_ExplosionSize, double a_BlockX, double a_Blo } } } + cPluginManager::Get()->CallHookExploded(*this, a_ExplosionSize, a_CanCauseFire, a_BlockX, a_BlockY, a_BlockZ, a_Source, a_SourceData); } @@ -1229,6 +1291,15 @@ bool cWorld::DoWithBlockEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBloc +bool cWorld::DoWithBeaconAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBeaconCallback& a_Callback) +{ + return m_ChunkMap->DoWithBeaconAt(a_BlockX, a_BlockY, a_BlockZ, a_Callback); +} + + + + + bool cWorld::DoWithChestAt(int a_BlockX, int a_BlockY, int a_BlockZ, cChestCallback & a_Callback) { return m_ChunkMap->DoWithChestAt(a_BlockX, a_BlockY, a_BlockZ, a_Callback); @@ -1538,9 +1609,9 @@ bool cWorld::GrowRipePlant(int a_BlockX, int a_BlockY, int a_BlockZ, bool a_IsBy MTRand r1; for (int i = 0; i < 60; i++) { - int OfsX = (r1.randInt(3) + r1.randInt(3) + r1.randInt(3) + r1.randInt(3)) / 2 - 3; - int OfsY = r1.randInt(3) + r1.randInt(3) - 3; - int OfsZ = (r1.randInt(3) + r1.randInt(3) + r1.randInt(3) + r1.randInt(3)) / 2 - 3; + int OfsX = static_cast<int>(r1.randInt(3) + r1.randInt(3) + r1.randInt(3) + r1.randInt(3)) / 2 - 3; + int OfsY = static_cast<int>(r1.randInt(3) + r1.randInt(3)) - 3; + int OfsZ = static_cast<int>(r1.randInt(3) + r1.randInt(3) + r1.randInt(3) + r1.randInt(3)) / 2 - 3; BLOCKTYPE Ground = GetBlock(a_BlockX + OfsX, a_BlockY + OfsY, a_BlockZ + OfsZ); if (Ground != E_BLOCK_GRASS) { @@ -1667,7 +1738,7 @@ bool cWorld::SetAreaBiome(const cCuboid & a_Area, EMCSBiome a_Biome) void cWorld::SetBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, bool a_SendToClients) { - m_ChunkMap->SetBlock(*this, a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta, a_SendToClients); + m_ChunkMap->SetBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta, a_SendToClients); } @@ -2084,16 +2155,34 @@ void cWorld::BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation -void cWorld::BroadcastParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude) +void cWorld::BroadcastParticleEffect(const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount, cClientHandle * a_Exclude) +{ + m_ChunkMap->BroadcastParticleEffect(a_ParticleName, a_SrcX, a_SrcY, a_SrcZ, a_OffsetX, a_OffsetY, a_OffsetZ, a_ParticleData, a_ParticleAmount, a_Exclude); +} + + + + + +void cWorld::BroadcastPlayerListAddPlayer(const cPlayer & a_Player, const cClientHandle * a_Exclude) { - m_ChunkMap->BroadcastParticleEffect(a_ParticleName, a_SrcX, a_SrcY, a_SrcZ, a_OffsetX, a_OffsetY, a_OffsetZ, a_ParticleData, a_ParticleAmmount, a_Exclude); + cCSLock Lock(m_CSPlayers); + for (cPlayerList::iterator itr = m_Players.begin(); itr != m_Players.end(); ++itr) + { + cClientHandle * ch = (*itr)->GetClientHandle(); + if ((ch == a_Exclude) || (ch == NULL) || !ch->IsLoggedIn() || ch->IsDestroyed()) + { + continue; + } + ch->SendPlayerListAddPlayer(a_Player); + } } -void cWorld::BroadcastPlayerListItem (const cPlayer & a_Player, bool a_IsOnline, const cClientHandle * a_Exclude) +void cWorld::BroadcastPlayerListRemovePlayer(const cPlayer & a_Player, const cClientHandle * a_Exclude) { cCSLock Lock(m_CSPlayers); for (cPlayerList::iterator itr = m_Players.begin(); itr != m_Players.end(); ++itr) @@ -2103,7 +2192,61 @@ void cWorld::BroadcastPlayerListItem (const cPlayer & a_Player, bool a_IsOnline, { continue; } - ch->SendPlayerListItem(a_Player, a_IsOnline); + ch->SendPlayerListRemovePlayer(a_Player); + } +} + + + + + +void cWorld::BroadcastPlayerListUpdateGameMode(const cPlayer & a_Player, const cClientHandle * a_Exclude) +{ + cCSLock Lock(m_CSPlayers); + for (cPlayerList::iterator itr = m_Players.begin(); itr != m_Players.end(); ++itr) + { + cClientHandle * ch = (*itr)->GetClientHandle(); + if ((ch == a_Exclude) || (ch == NULL) || !ch->IsLoggedIn() || ch->IsDestroyed()) + { + continue; + } + ch->SendPlayerListUpdateGameMode(a_Player); + } +} + + + + + +void cWorld::BroadcastPlayerListUpdatePing(const cPlayer & a_Player, const cClientHandle * a_Exclude) +{ + cCSLock Lock(m_CSPlayers); + for (cPlayerList::iterator itr = m_Players.begin(); itr != m_Players.end(); ++itr) + { + cClientHandle * ch = (*itr)->GetClientHandle(); + if ((ch == a_Exclude) || (ch == NULL) || !ch->IsLoggedIn() || ch->IsDestroyed()) + { + continue; + } + ch->SendPlayerListUpdatePing(a_Player); + } +} + + + + + +void cWorld::BroadcastPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName, const cClientHandle * a_Exclude) +{ + cCSLock Lock(m_CSPlayers); + for (cPlayerList::iterator itr = m_Players.begin(); itr != m_Players.end(); ++itr) + { + cClientHandle * ch = (*itr)->GetClientHandle(); + if ((ch == a_Exclude) || (ch == NULL) || !ch->IsLoggedIn() || ch->IsDestroyed()) + { + continue; + } + ch->SendPlayerListUpdateDisplayName(a_Player, a_CustomName); } } @@ -2238,7 +2381,7 @@ void cWorld::BroadcastTimeUpdate(const cClientHandle * a_Exclude) { continue; } - ch->SendTimeUpdate(m_WorldAge, m_TimeOfDay); + ch->SendTimeUpdate(m_WorldAge, m_TimeOfDay, m_IsDaylightCycleEnabled); } } @@ -2320,6 +2463,8 @@ void cWorld::MarkChunkSaved (int a_ChunkX, int a_ChunkZ) void cWorld::QueueSetChunkData(const cSetChunkDataPtr & a_SetChunkData) { + ASSERT(IsChunkQueued(a_SetChunkData->GetChunkX(), a_SetChunkData->GetChunkZ())); + // Validate biomes, if needed: if (!a_SetChunkData->AreBiomesValid()) { @@ -2370,7 +2515,7 @@ void cWorld::SetChunkData(cSetChunkData & a_SetChunkData) // Save the chunk right after generating, so that we don't have to generate it again on next run if (a_SetChunkData.ShouldMarkDirty()) { - m_Storage.QueueSaveChunk(ChunkX, 0, ChunkZ); + m_Storage.QueueSaveChunk(ChunkX, ChunkZ); } } @@ -2409,6 +2554,15 @@ bool cWorld::GetChunkBlockTypes(int a_ChunkX, int a_ChunkZ, BLOCKTYPE * a_BlockT +bool cWorld::IsChunkQueued(int a_ChunkX, int a_ChunkZ) const +{ + return m_ChunkMap->IsChunkQueued(a_ChunkX, a_ChunkZ); +} + + + + + bool cWorld::IsChunkValid(int a_ChunkX, int a_ChunkZ) const { return m_ChunkMap->IsChunkValid(a_ChunkX, a_ChunkZ); @@ -2615,7 +2769,7 @@ void cWorld::SendPlayerList(cPlayer * a_DestPlayer) cClientHandle * ch = (*itr)->GetClientHandle(); if ((ch != NULL) && !ch->IsDestroyed()) { - a_DestPlayer->GetClientHandle()->SendPlayerListItem(*(*itr), true); + a_DestPlayer->GetClientHandle()->SendPlayerListAddPlayer(*(*itr)); } } } @@ -2642,6 +2796,15 @@ bool cWorld::ForEachEntityInChunk(int a_ChunkX, int a_ChunkZ, cEntityCallback & +bool cWorld::ForEachEntityInBox(const cBoundingBox & a_Box, cEntityCallback & a_Callback) +{ + return m_ChunkMap->ForEachEntityInBox(a_Box, a_Callback); +} + + + + + bool cWorld::DoWithEntityByID(int a_UniqueID, cEntityCallback & a_Callback) { return m_ChunkMap->DoWithEntityByID(a_UniqueID, a_Callback); @@ -2715,36 +2878,18 @@ void cWorld::RemoveClientFromChunkSender(cClientHandle * a_Client) -void cWorld::TouchChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +void cWorld::TouchChunk(int a_ChunkX, int a_ChunkZ) { - m_ChunkMap->TouchChunk(a_ChunkX, a_ChunkY, a_ChunkZ); + m_ChunkMap->TouchChunk(a_ChunkX, a_ChunkZ); } -bool cWorld::LoadChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +void cWorld::ChunkLoadFailed(int a_ChunkX, int a_ChunkZ) { - return m_ChunkMap->LoadChunk(a_ChunkX, a_ChunkY, a_ChunkZ); -} - - - - - -void cWorld::LoadChunks(const cChunkCoordsList & a_Chunks) -{ - m_ChunkMap->LoadChunks(a_Chunks); -} - - - - - -void cWorld::ChunkLoadFailed(int a_ChunkX, int a_ChunkY, int a_ChunkZ) -{ - m_ChunkMap->ChunkLoadFailed(a_ChunkX, a_ChunkY, a_ChunkZ); + m_ChunkMap->ChunkLoadFailed(a_ChunkX, a_ChunkZ); } @@ -2788,7 +2933,7 @@ bool cWorld::SetCommandBlockCommand(int a_BlockX, int a_BlockY, int a_BlockZ, co { AString m_Command; public: - cUpdateCommandBlock(const AString & a_Command) : m_Command(a_Command) {} + cUpdateCommandBlock(const AString & a_CallbackCommand) : m_Command(a_CallbackCommand) {} virtual bool Item(cCommandBlockEntity * a_CommandBlock) override { @@ -2809,7 +2954,7 @@ bool cWorld::IsTrapdoorOpen(int a_BlockX, int a_BlockY, int a_BlockZ) BLOCKTYPE Block; NIBBLETYPE Meta; GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, Block, Meta); - if (Block != E_BLOCK_TRAPDOOR) + if ((Block != E_BLOCK_TRAPDOOR) && (Block != E_BLOCK_IRON_TRAPDOOR)) { return false; } @@ -2826,7 +2971,7 @@ bool cWorld::SetTrapdoorOpen(int a_BlockX, int a_BlockY, int a_BlockZ, bool a_Op BLOCKTYPE Block; NIBBLETYPE Meta; GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, Block, Meta); - if (Block != E_BLOCK_TRAPDOOR) + if ((Block != E_BLOCK_TRAPDOOR) && (Block != E_BLOCK_IRON_TRAPDOOR)) { return false; } @@ -2849,8 +2994,7 @@ void cWorld::RegenerateChunk(int a_ChunkX, int a_ChunkZ) { m_ChunkMap->MarkChunkRegenerating(a_ChunkX, a_ChunkZ); - // Trick: use Y=1 to force the chunk generation even though the chunk data is already present - m_Generator.QueueGenerateChunk(a_ChunkX, 1, a_ChunkZ); + m_Generator.QueueGenerateChunk(a_ChunkX, a_ChunkZ, true); } @@ -2859,7 +3003,7 @@ void cWorld::RegenerateChunk(int a_ChunkX, int a_ChunkZ) void cWorld::GenerateChunk(int a_ChunkX, int a_ChunkZ) { - m_Generator.QueueGenerateChunk(a_ChunkX, ZERO_CHUNK_Y, a_ChunkZ); + m_ChunkMap->TouchChunk(a_ChunkX, a_ChunkZ); } @@ -3065,7 +3209,7 @@ bool cWorld::IsBlockDirectlyWatered(int a_BlockX, int a_BlockY, int a_BlockZ) -int cWorld::SpawnMob(double a_PosX, double a_PosY, double a_PosZ, cMonster::eType a_MonsterType) +int cWorld::SpawnMob(double a_PosX, double a_PosY, double a_PosZ, eMonsterType a_MonsterType) { cMonster * Monster = NULL; @@ -3140,21 +3284,51 @@ int cWorld::CreateProjectile(double a_PosX, double a_PosY, double a_PosZ, cProje void cWorld::TabCompleteUserName(const AString & a_Text, AStringVector & a_Results) { + typedef std::pair<AString::size_type, AString> pair_t; + size_t LastSpace = a_Text.find_last_of(" "); // Find the position of the last space + AString LastWord = a_Text.substr(LastSpace + 1, a_Text.length()); // Find the last word + + if (LastWord.empty()) + { + return; + } + + std::vector<pair_t> UsernamesByWeight; + cCSLock Lock(m_CSPlayers); for (cPlayerList::iterator itr = m_Players.begin(), end = m_Players.end(); itr != end; ++itr) { - size_t LastSpace = a_Text.find_last_of(" "); // Find the position of the last space - - AString LastWord = a_Text.substr(LastSpace + 1, a_Text.length()); // Find the last word AString PlayerName ((*itr)->GetName()); - size_t Found = PlayerName.find(LastWord); // Try to find last word in playername - + if ((*itr)->HasCustomName()) + { + PlayerName = (*itr)->GetCustomName(); + } + + AString::size_type Found = PlayerName.find(LastWord); // Try to find last word in playername if (Found == AString::npos) { continue; // No match } - - a_Results.push_back(PlayerName); // Match! + + UsernamesByWeight.push_back(std::make_pair(Found, PlayerName)); // Match! Store it with the position of the match as a weight + } + Lock.Unlock(); + + std::sort(UsernamesByWeight.begin(), UsernamesByWeight.end()); // Sort lexicographically (by the first value, then second), so higher weights (usernames with match closer to start) come first (#1274) + + /* TODO: Uncomment once migrated to C++11 + std::transform( + UsernamesByWeight.begin(), + UsernamesByWeight.end(), + std::back_inserter(a_Results), + [](const pair_t & p) { return p.first; } + ); + */ + + a_Results.reserve(UsernamesByWeight.size()); + for (std::vector<pair_t>::const_iterator itr = UsernamesByWeight.begin(); itr != UsernamesByWeight.end(); ++itr) + { + a_Results.push_back(itr->second); } } @@ -3171,21 +3345,21 @@ void cWorld::SetChunkAlwaysTicked(int a_ChunkX, int a_ChunkZ, bool a_AlwaysTicke -cRedstoneSimulator * cWorld::InitializeRedstoneSimulator(cIniFile & a_IniFile) +cRedstoneSimulator<cChunk, cWorld> * cWorld::InitializeRedstoneSimulator(cIniFile & a_IniFile) { - AString SimulatorName = a_IniFile.GetValueSet("Physics", "RedstoneSimulator", ""); + AString SimulatorName = a_IniFile.GetValueSet("Physics", "RedstoneSimulator", "Incremental"); if (SimulatorName.empty()) { - LOGWARNING("[Physics] RedstoneSimulator not present or empty in %s, using the default of \"incremental\".", GetIniFileName().c_str()); - SimulatorName = "incremental"; + LOGWARNING("[Physics] RedstoneSimulator not present or empty in %s, using the default of \"Incremental\".", GetIniFileName().c_str()); + SimulatorName = "Incremental"; } - cRedstoneSimulator * res = NULL; + cRedstoneSimulator<cChunk, cWorld> * res = NULL; - if (NoCaseCompare(SimulatorName, "incremental") == 0) + if (NoCaseCompare(SimulatorName, "Incremental") == 0) { - res = new cIncrementalRedstoneSimulator(*this); + res = MakeIncrementalRedstoneSimulator(*this); } else if (NoCaseCompare(SimulatorName, "noop") == 0) { @@ -3207,7 +3381,7 @@ cFluidSimulator * cWorld::InitializeFluidSimulator(cIniFile & a_IniFile, const c Printf(SimulatorNameKey, "%sSimulator", a_FluidName); AString SimulatorSectionName; Printf(SimulatorSectionName, "%sSimulator", a_FluidName); - AString SimulatorName = a_IniFile.GetValueSet("Physics", SimulatorNameKey, ""); + AString SimulatorName = a_IniFile.GetValueSet("Physics", SimulatorNameKey, "Vanilla"); if (SimulatorName.empty()) { LOGWARNING("[Physics] %s not present or empty in %s, using the default of \"Vanilla\".", SimulatorNameKey.c_str(), GetIniFileName().c_str()); @@ -3238,20 +3412,26 @@ cFluidSimulator * cWorld::InitializeFluidSimulator(cIniFile & a_IniFile, const c int Falloff = a_IniFile.GetValueSetI(SimulatorSectionName, "Falloff", IsWater ? 1 : 2); int TickDelay = a_IniFile.GetValueSetI(SimulatorSectionName, "TickDelay", IsWater ? 5 : 30); int NumNeighborsForSource = a_IniFile.GetValueSetI(SimulatorSectionName, "NumNeighborsForSource", IsWater ? 2 : -1); + + if ((Falloff > 15) || (Falloff < 0)) + { + LOGWARNING("Falloff for %s simulator is out of range, assuming default of %d", a_FluidName, IsWater ? 1 : 2); + Falloff = IsWater ? 1 : 2; + } if (NoCaseCompare(SimulatorName, "floody") == 0) { - res = new cFloodyFluidSimulator(*this, a_SimulateBlock, a_StationaryBlock, Falloff, TickDelay, NumNeighborsForSource); + res = new cFloodyFluidSimulator(*this, a_SimulateBlock, a_StationaryBlock, static_cast<NIBBLETYPE>(Falloff), TickDelay, NumNeighborsForSource); } else if (NoCaseCompare(SimulatorName, "vanilla") == 0) { - res = new cVanillaFluidSimulator(*this, a_SimulateBlock, a_StationaryBlock, Falloff, TickDelay, NumNeighborsForSource); + res = new cVanillaFluidSimulator(*this, a_SimulateBlock, a_StationaryBlock, static_cast<NIBBLETYPE>(Falloff), TickDelay, NumNeighborsForSource); } else { // The simulator name doesn't match anything we have, issue a warning: LOGWARNING("%s [Physics]:%s specifies an unknown simulator, using the default \"Vanilla\".", GetIniFileName().c_str(), SimulatorNameKey.c_str()); - res = new cVanillaFluidSimulator(*this, a_SimulateBlock, a_StationaryBlock, Falloff, TickDelay, NumNeighborsForSource); + res = new cVanillaFluidSimulator(*this, a_SimulateBlock, a_StationaryBlock, static_cast<NIBBLETYPE>(Falloff), TickDelay, NumNeighborsForSource); } } @@ -3281,7 +3461,7 @@ void cWorld::AddQueuedPlayers(void) cCSLock Lock(m_CSPlayers); for (cPlayerList::iterator itr = PlayersToAdd.begin(), end = PlayersToAdd.end(); itr != end; ++itr) { - ASSERT(std::find(m_Players.begin(), m_Players.end(), *itr) == m_Players.end()); // Is it already in the list? HOW? + ASSERT(std::find(m_Players.begin(), m_Players.end(), *itr) == m_Players.end()); // Is it already in the list? HOW? LOGD("Adding player %s to world \"%s\".", (*itr)->GetName().c_str(), m_WorldName.c_str()); m_Players.push_back(*itr); @@ -3361,9 +3541,9 @@ void cWorld::cTaskSendBlockToAllPlayers::Run(cWorld & a_World) public cPlayerListCallback { public: - cPlayerCallback(std::vector<Vector3i> & a_SendQueue, cWorld & a_World) : + cPlayerCallback(std::vector<Vector3i> & a_SendQueue, cWorld & a_CallbackWorld) : m_SendQueue(a_SendQueue), - m_World(a_World) + m_World(a_CallbackWorld) { } @@ -3407,14 +3587,16 @@ void cWorld::cChunkGeneratorCallbacks::OnChunkGenerated(cChunkDesc & a_ChunkDesc cChunkDef::BlockNibbles BlockMetas; a_ChunkDesc.CompressBlockMetas(BlockMetas); - m_World->QueueSetChunkData(cSetChunkDataPtr(new cSetChunkData( + cSetChunkDataPtr SetChunkData(new cSetChunkData( a_ChunkDesc.GetChunkX(), a_ChunkDesc.GetChunkZ(), a_ChunkDesc.GetBlockTypes(), BlockMetas, NULL, NULL, // We don't have lighting, chunk will be lighted when needed &a_ChunkDesc.GetHeightMap(), &a_ChunkDesc.GetBiomeMap(), a_ChunkDesc.GetEntities(), a_ChunkDesc.GetBlockEntities(), true - ))); + )); + SetChunkData->RemoveInvalidBlockEntities(); + m_World->QueueSetChunkData(SetChunkData); } @@ -3430,6 +3612,15 @@ bool cWorld::cChunkGeneratorCallbacks::IsChunkValid(int a_ChunkX, int a_ChunkZ) +bool cWorld::cChunkGeneratorCallbacks::IsChunkQueued(int a_ChunkX, int a_ChunkZ) +{ + return m_World->IsChunkQueued(a_ChunkX, a_ChunkZ); +} + + + + + bool cWorld::cChunkGeneratorCallbacks::HasChunkAnyClients(int a_ChunkX, int a_ChunkZ) { return m_World->HasChunkAnyClients(a_ChunkX, a_ChunkZ); diff --git a/src/World.h b/src/World.h index 6649c4163..90dada259 100644 --- a/src/World.h +++ b/src/World.h @@ -33,6 +33,7 @@ class cFireSimulator; class cFluidSimulator; class cSandSimulator; +template <class ChunkType, class WorldType> class cRedstoneSimulator; class cItem; class cPlayer; @@ -41,6 +42,7 @@ class cEntity; class cBlockEntity; class cWorldGenerator; // The generator that actually generates the chunks for a single world class cChunkGenerator; // The thread responsible for generating chunks +class cBeaconEntity; class cChestEntity; class cDispenserEntity; class cFlowerPotEntity; @@ -59,6 +61,7 @@ typedef std::vector<cSetChunkDataPtr> cSetChunkDataPtrs; typedef cItemCallback<cPlayer> cPlayerListCallback; typedef cItemCallback<cEntity> cEntityCallback; +typedef cItemCallback<cBeaconEntity> cBeaconCallback; typedef cItemCallback<cChestEntity> cChestCallback; typedef cItemCallback<cDispenserEntity> cDispenserCallback; typedef cItemCallback<cFurnaceEntity> cFurnaceCallback; @@ -143,19 +146,30 @@ public: // tolua_begin int GetTicksUntilWeatherChange(void) const { return m_WeatherInterval; } - + + /** Is the daylight cyclus enabled? */ + virtual bool IsDaylightCycleEnabled(void) const { return m_IsDaylightCycleEnabled; } + + /** Sets the daylight cyclus to true/false. */ + virtual void SetDaylightCycleEnabled(bool a_IsDaylightCycleEnabled) + { + m_IsDaylightCycleEnabled = a_IsDaylightCycleEnabled; + BroadcastTimeUpdate(); + } + virtual Int64 GetWorldAge (void) const override { return m_WorldAge; } - virtual Int64 GetTimeOfDay(void) const override { return m_TimeOfDay; } + virtual int GetTimeOfDay(void) const override { return m_TimeOfDay; } void SetTicksUntilWeatherChange(int a_WeatherInterval) { m_WeatherInterval = a_WeatherInterval; } - virtual void SetTimeOfDay(Int64 a_TimeOfDay) override + virtual void SetTimeOfDay(int a_TimeOfDay) override { m_TimeOfDay = a_TimeOfDay; m_TimeOfDaySecs = (double)a_TimeOfDay / 20.0; + UpdateSkyDarkness(); BroadcastTimeUpdate(); } @@ -175,6 +189,9 @@ public: /** Returns true if the world is in Adventure mode */ bool IsGameModeAdventure(void) const { return (m_GameMode == gmAdventure); } + /** Returns true if the world is in Spectator mode */ + bool IsGameModeSpectator(void) const { return (m_GameMode == gmSpectator); } + bool IsPVPEnabled(void) const { return m_bEnabledPVP; } bool IsDeepSnowEnabled(void) const { return m_IsDeepSnowEnabled; } @@ -210,33 +227,37 @@ public: void BroadcastChat (const cCompositeChat & a_Message, const cClientHandle * a_Exclude = NULL); // tolua_end - void BroadcastChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude = NULL); - void BroadcastCollectEntity (const cEntity & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL); - void BroadcastDestroyEntity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); - void BroadcastEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude = NULL); - void BroadcastEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item, const cClientHandle * a_Exclude = NULL); - void BroadcastEntityHeadLook (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); - void BroadcastEntityLook (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); - void BroadcastEntityMetadata (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); - void BroadcastEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL); - void BroadcastEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL); - void BroadcastEntityStatus (const cEntity & a_Entity, char a_Status, const cClientHandle * a_Exclude = NULL); - void BroadcastEntityVelocity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); - virtual void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) override; // tolua_export - void BroadcastParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmmount, cClientHandle * a_Exclude = NULL); // tolua_export - void BroadcastPlayerListItem (const cPlayer & a_Player, bool a_IsOnline, const cClientHandle * a_Exclude = NULL); - void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL); - void BroadcastScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode); - void BroadcastScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode); - void BroadcastDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display); - void BroadcastSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL); // tolua_export - void BroadcastSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL); // tolua_export - void BroadcastSpawnEntity (cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); - void BroadcastTeleportEntity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); - void BroadcastThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL); - void BroadcastTimeUpdate (const cClientHandle * a_Exclude = NULL); - virtual void BroadcastUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) override; - void BroadcastWeather (eWeather a_Weather, const cClientHandle * a_Exclude = NULL); + void BroadcastChunkData (int a_ChunkX, int a_ChunkZ, cChunkDataSerializer & a_Serializer, const cClientHandle * a_Exclude = NULL); + void BroadcastCollectEntity (const cEntity & a_Pickup, const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL); + void BroadcastDestroyEntity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); + void BroadcastEntityEffect (const cEntity & a_Entity, int a_EffectID, int a_Amplifier, short a_Duration, const cClientHandle * a_Exclude = NULL); + void BroadcastEntityEquipment (const cEntity & a_Entity, short a_SlotNum, const cItem & a_Item, const cClientHandle * a_Exclude = NULL); + void BroadcastEntityHeadLook (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); + void BroadcastEntityLook (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); + void BroadcastEntityMetadata (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); + void BroadcastEntityRelMove (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL); + void BroadcastEntityRelMoveLook (const cEntity & a_Entity, char a_RelX, char a_RelY, char a_RelZ, const cClientHandle * a_Exclude = NULL); + void BroadcastEntityStatus (const cEntity & a_Entity, char a_Status, const cClientHandle * a_Exclude = NULL); + void BroadcastEntityVelocity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); + virtual void BroadcastEntityAnimation (const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) override; // tolua_export + void BroadcastParticleEffect (const AString & a_ParticleName, float a_SrcX, float a_SrcY, float a_SrcZ, float a_OffsetX, float a_OffsetY, float a_OffsetZ, float a_ParticleData, int a_ParticleAmount, cClientHandle * a_Exclude = NULL); // tolua_export + void BroadcastPlayerListAddPlayer (const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL); + void BroadcastPlayerListRemovePlayer (const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL); + void BroadcastPlayerListUpdateGameMode (const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL); + void BroadcastPlayerListUpdatePing (const cPlayer & a_Player, const cClientHandle * a_Exclude = NULL); + void BroadcastPlayerListUpdateDisplayName(const cPlayer & a_Player, const AString & a_CustomName, const cClientHandle * a_Exclude = NULL); + void BroadcastRemoveEntityEffect (const cEntity & a_Entity, int a_EffectID, const cClientHandle * a_Exclude = NULL); + void BroadcastScoreboardObjective (const AString & a_Name, const AString & a_DisplayName, Byte a_Mode); + void BroadcastScoreUpdate (const AString & a_Objective, const AString & a_Player, cObjective::Score a_Score, Byte a_Mode); + void BroadcastDisplayObjective (const AString & a_Objective, cScoreboard::eDisplaySlot a_Display); + void BroadcastSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL); // tolua_export + void BroadcastSoundParticleEffect (int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL); // tolua_export + void BroadcastSpawnEntity (cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); + void BroadcastTeleportEntity (const cEntity & a_Entity, const cClientHandle * a_Exclude = NULL); + void BroadcastThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ, const cClientHandle * a_Exclude = NULL); + void BroadcastTimeUpdate (const cClientHandle * a_Exclude = NULL); + virtual void BroadcastUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ) override; + void BroadcastWeather (eWeather a_Weather, const cClientHandle * a_Exclude = NULL); virtual cBroadcastInterface & GetBroadcastManager(void) override { @@ -266,7 +287,12 @@ public: /** Gets the chunk's blocks, only the block types */ bool GetChunkBlockTypes(int a_ChunkX, int a_ChunkZ, BLOCKTYPE * a_BlockTypes); - bool IsChunkValid (int a_ChunkX, int a_ChunkZ) const; + /** Returns true iff the chunk is in the loader / generator queue. */ + bool IsChunkQueued(int a_ChunkX, int a_ChunkZ) const; + + /** Returns true iff the chunk is present and valid. */ + bool IsChunkValid(int a_ChunkX, int a_ChunkZ) const; + bool HasChunkAnyClients(int a_ChunkX, int a_ChunkZ) const; /** Queues a task to unload unused chunks onto the tick thread. The prefferred way of unloading*/ @@ -311,6 +337,11 @@ public: /** Calls the callback for each entity in the specified chunk; returns true if all entities processed, false if the callback aborted by returning true */ bool ForEachEntityInChunk(int a_ChunkX, int a_ChunkZ, cEntityCallback & a_Callback); // Exported in ManualBindings.cpp + /** Calls the callback for each entity that has a nonempty intersection with the specified boundingbox. + Returns true if all entities processed, false if the callback aborted by returning true. + If any chunk in the box is missing, ignores the entities in that chunk silently. */ + bool ForEachEntityInBox(const cBoundingBox & a_Box, cEntityCallback & a_Callback); // Exported in ManualBindings.cpp + /** Calls the callback if the entity with the specified ID is found, with the entity object as the callback param. Returns true if entity found and callback returned false. */ bool DoWithEntityByID(int a_UniqueID, cEntityCallback & a_Callback); // Exported in ManualBindings.cpp @@ -338,16 +369,10 @@ public: void RemoveClientFromChunkSender(cClientHandle * a_Client); /** Touches the chunk, causing it to be loaded or generated */ - void TouchChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ); - - /** Loads the chunk, if not already loaded. Doesn't generate. Returns true if chunk valid (even if already loaded before) */ - bool LoadChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ); - - /** Loads the chunks specified. Doesn't report failure, other than chunks being !IsValid() */ - void LoadChunks(const cChunkCoordsList & a_Chunks); + void TouchChunk(int a_ChunkX, int a_ChunkZ); /** Marks the chunk as failed-to-load: */ - void ChunkLoadFailed(int a_ChunkX, int a_ChunkY, int a_ChunkZ); + void ChunkLoadFailed(int a_ChunkX, int a_ChunkZ); /** Sets the sign text, asking plugins for permission first. a_Player is the player who this change belongs to, may be NULL. Returns true if sign text changed. Same as UpdateSign() */ bool SetSignLines(int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Line1, const AString & a_Line2, const AString & a_Line3, const AString & a_Line4, cPlayer * a_Player = NULL); // Exported in ManualBindings.cpp @@ -367,7 +392,7 @@ public: /** Regenerate the given chunk: */ void RegenerateChunk(int a_ChunkX, int a_ChunkZ); // tolua_export - /** Generates the given chunk, if not already generated */ + /** Generates the given chunk */ void GenerateChunk(int a_ChunkX, int a_ChunkZ); // tolua_export /** Queues a chunk for lighting; a_Callback is called after the chunk is lighted */ @@ -452,7 +477,7 @@ public: int SpawnMinecart(double a_X, double a_Y, double a_Z, int a_MinecartType, const cItem & a_Content = cItem(), int a_BlockHeight = 1); /** Spawns an experience orb at the given location with the given reward. It returns the UniqueID of the spawned experience orb. */ - int SpawnExperienceOrb(double a_X, double a_Y, double a_Z, int a_Reward); + virtual int SpawnExperienceOrb(double a_X, double a_Y, double a_Z, int a_Reward) override; /** Spawns a new primed TNT entity at the specified block coords and specified fuse duration. Initial velocity is given based on the relative coefficient provided */ void SpawnPrimedTNT(double a_X, double a_Y, double a_Z, int a_FuseTimeInSec = 80, double a_InitialVelocityCoeff = 1); @@ -485,7 +510,7 @@ public: inline cFluidSimulator * GetWaterSimulator(void) { return m_WaterSimulator; } inline cFluidSimulator * GetLavaSimulator (void) { return m_LavaSimulator; } - inline cRedstoneSimulator * GetRedstoneSimulator(void) { return m_RedstoneSimulator; } + inline cRedstoneSimulator<cChunk, cWorld> * GetRedstoneSimulator(void) { return m_RedstoneSimulator; } /** Calls the callback for each block entity in the specified chunk; returns true if all block entities processed, false if the callback aborted by returning true */ bool ForEachBlockEntityInChunk(int a_ChunkX, int a_ChunkZ, cBlockEntityCallback & a_Callback); // Exported in ManualBindings.cpp @@ -523,6 +548,9 @@ public: /** Calls the callback for the block entity at the specified coords; returns false if there's no block entity at those coords, true if found */ virtual bool DoWithBlockEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBlockEntityCallback & a_Callback) override; // Exported in ManualBindings.cpp + /** Calls the callback for the beacon at the specified coords; returns false if there's no beacon at those coords, true if found */ + bool DoWithBeaconAt(int a_BlockX, int a_BlockY, int a_BlockZ, cBeaconCallback & a_Callback); // Exported in ManualBindings.cpp + /** Calls the callback for the chest at the specified coords; returns false if there's no chest at those coords, true if found */ bool DoWithChestAt(int a_BlockX, int a_BlockY, int a_BlockZ, cChestCallback & a_Callback); // Exported in ManualBindings.cpp @@ -621,6 +649,10 @@ public: bool ShouldUseChatPrefixes(void) const { return m_bUseChatPrefixes; } void SetShouldUseChatPrefixes(bool a_Flag) { m_bUseChatPrefixes = a_Flag; } + bool ShouldBroadcastDeathMessages(void) const { return m_BroadcastDeathMessages; } + bool ShouldBroadcastAchievementMessages(void) const { return m_BroadcastAchievementMessages; } + + AString GetNetherWorldName(void) const { return m_NetherWorldName; } void SetNetherWorldName(const AString & a_Name) { m_NetherWorldName = a_Name; } @@ -743,7 +775,7 @@ public: bool IsBlockDirectlyWatered(int a_BlockX, int a_BlockY, int a_BlockZ); // tolua_export /** Spawns a mob of the specified type. Returns the mob's EntityID if recognized and spawned, <0 otherwise */ - virtual int SpawnMob(double a_PosX, double a_PosY, double a_PosZ, cMonster::eType a_MonsterType) override; // tolua_export + virtual int SpawnMob(double a_PosX, double a_PosY, double a_PosZ, eMonsterType a_MonsterType) override; // tolua_export int SpawnMobFinalize(cMonster* a_Monster); /** Creates a projectile of the specified type. Returns the projectile's EntityID if successful, <0 otherwise @@ -797,6 +829,7 @@ private: virtual void OnChunkGenerated (cChunkDesc & a_ChunkDesc) override; virtual bool IsChunkValid (int a_ChunkX, int a_ChunkZ) override; virtual bool HasChunkAnyClients(int a_ChunkX, int a_ChunkZ) override; + virtual bool IsChunkQueued (int a_ChunkX, int a_ChunkZ) override; // cPluginInterface overrides: virtual void CallHookChunkGenerating(cChunkDesc & a_ChunkDesc) override; @@ -856,10 +889,14 @@ private: double m_SpawnY; double m_SpawnZ; + bool m_BroadcastDeathMessages; + bool m_BroadcastAchievementMessages; + + bool m_IsDaylightCycleEnabled; double m_WorldAgeSecs; // World age, in seconds. Is only incremented, cannot be set by plugins. double m_TimeOfDaySecs; // Time of day in seconds. Can be adjusted. Is wrapped to zero each day. Int64 m_WorldAge; // World age in ticks, calculated off of m_WorldAgeSecs - Int64 m_TimeOfDay; // Time in ticks, calculated off of m_TimeOfDaySecs + int m_TimeOfDay; // Time in ticks, calculated off of m_TimeOfDaySecs Int64 m_LastTimeUpdate; // The tick in which the last time update has been sent. Int64 m_LastUnload; // The last WorldAge (in ticks) in which unloading was triggerred Int64 m_LastSave; // The last WorldAge (in ticks) in which save-all was triggerred @@ -881,7 +918,7 @@ private: cFluidSimulator * m_WaterSimulator; cFluidSimulator * m_LavaSimulator; cFireSimulator * m_FireSimulator; - cRedstoneSimulator * m_RedstoneSimulator; + cRedstoneSimulator<cChunk, cWorld> * m_RedstoneSimulator; cCriticalSection m_CSPlayers; cPlayerList m_Players; @@ -893,7 +930,7 @@ private: cChunkMap * m_ChunkMap; bool m_bAnimals; - std::set<cMonster::eType> m_AllowedMobs; + std::set<eMonsterType> m_AllowedMobs; eWeather m_Weather; int m_WeatherInterval; @@ -1022,7 +1059,7 @@ private: cFluidSimulator * InitializeFluidSimulator(cIniFile & a_IniFile, const char * a_FluidName, BLOCKTYPE a_SimulateBlock, BLOCKTYPE a_StationaryBlock); /** Creates a new redstone simulator.*/ - cRedstoneSimulator * InitializeRedstoneSimulator(cIniFile & a_IniFile); + cRedstoneSimulator<cChunk, cWorld> * InitializeRedstoneSimulator(cIniFile & a_IniFile); /** Adds the players queued in the m_PlayersToAdd queue into the m_Players list. Assumes it is called from the Tick thread. */ diff --git a/src/WorldStorage/CMakeLists.txt b/src/WorldStorage/CMakeLists.txt index a00ff3b2f..59193db2a 100644 --- a/src/WorldStorage/CMakeLists.txt +++ b/src/WorldStorage/CMakeLists.txt @@ -14,7 +14,6 @@ SET (SRCS ScoreboardSerializer.cpp StatSerializer.cpp WSSAnvil.cpp - WSSCompact.cpp WorldStorage.cpp) SET (HDRS @@ -27,7 +26,6 @@ SET (HDRS ScoreboardSerializer.h StatSerializer.h WSSAnvil.h - WSSCompact.h WorldStorage.h) if(NOT MSVC) diff --git a/src/WorldStorage/FastNBT.cpp b/src/WorldStorage/FastNBT.cpp index c6294b99c..ed8e8bb14 100644 --- a/src/WorldStorage/FastNBT.cpp +++ b/src/WorldStorage/FastNBT.cpp @@ -310,7 +310,7 @@ int cParsedNBT::FindTagByPath(int a_Tag, const AString & a_Path) const { continue; } - Tag = FindChildByName(Tag, a_Path.c_str() + Begin, i - Begin - 1); + Tag = FindChildByName(Tag, a_Path.c_str() + Begin, i - Begin); if (Tag < 0) { return -1; diff --git a/src/WorldStorage/FastNBT.h b/src/WorldStorage/FastNBT.h index 4ef72e379..c6225eacf 100644 --- a/src/WorldStorage/FastNBT.h +++ b/src/WorldStorage/FastNBT.h @@ -76,7 +76,9 @@ public: cFastNBTTag(eTagType a_Type, int a_Parent) : m_Type(a_Type), + m_NameStart(0), m_NameLength(0), + m_DataStart(0), m_DataLength(0), m_Parent(a_Parent), m_PrevSibling(-1), @@ -88,7 +90,9 @@ public: cFastNBTTag(eTagType a_Type, int a_Parent, int a_PrevSibling) : m_Type(a_Type), + m_NameStart(0), m_NameLength(0), + m_DataStart(0), m_DataLength(0), m_Parent(a_Parent), m_PrevSibling(a_PrevSibling), @@ -209,8 +213,8 @@ public: // If your platform produces a compiler error here, you'll need to add code that manually decodes 32-bit floats char Check1[5 - sizeof(float)]; // Fails if sizeof(float) > 4 char Check2[sizeof(float) - 3]; // Fails if sizeof(float) < 4 - UNUSED(Check1); - UNUSED(Check2); + UNUSED_VAR(Check1); + UNUSED_VAR(Check2); Int32 i = GetBEInt(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); float f; @@ -225,8 +229,8 @@ public: // If your platform produces a compiler error here, you'll need to add code that manually decodes 64-bit doubles char Check1[9 - sizeof(double)]; // Fails if sizeof(double) > 8 char Check2[sizeof(double) - 7]; // Fails if sizeof(double) < 8 - UNUSED(Check1); - UNUSED(Check2); + UNUSED_VAR(Check1); + UNUSED_VAR(Check2); ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Double); return NetworkToHostDouble8(m_Data + m_Tags[(size_t)a_Tag].m_DataStart); diff --git a/src/WorldStorage/MapSerializer.cpp b/src/WorldStorage/MapSerializer.cpp index 012fc52f3..4a913c81a 100644 --- a/src/WorldStorage/MapSerializer.cpp +++ b/src/WorldStorage/MapSerializer.cpp @@ -130,14 +130,14 @@ bool cMapSerializer::LoadMapFromNBT(const cParsedNBT & a_NBT) } int CurrLine = a_NBT.FindChildByName(Data, "scale"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_Byte)) { - unsigned int Scale = a_NBT.GetByte(CurrLine); + unsigned int Scale = (unsigned int)a_NBT.GetByte(CurrLine); m_Map->SetScale(Scale); } CurrLine = a_NBT.FindChildByName(Data, "dimension"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_Byte)) { eDimension Dimension = (eDimension) a_NBT.GetByte(CurrLine); @@ -149,9 +149,9 @@ bool cMapSerializer::LoadMapFromNBT(const cParsedNBT & a_NBT) } CurrLine = a_NBT.FindChildByName(Data, "width"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_Short)) { - unsigned int Width = a_NBT.GetShort(CurrLine); + unsigned int Width = (unsigned int)a_NBT.GetShort(CurrLine); if (Width != 128) { return false; @@ -160,9 +160,9 @@ bool cMapSerializer::LoadMapFromNBT(const cParsedNBT & a_NBT) } CurrLine = a_NBT.FindChildByName(Data, "height"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_Short)) { - unsigned int Height = a_NBT.GetShort(CurrLine); + unsigned int Height = (unsigned int)a_NBT.GetShort(CurrLine); if (Height >= 256) { return false; @@ -171,14 +171,14 @@ bool cMapSerializer::LoadMapFromNBT(const cParsedNBT & a_NBT) } CurrLine = a_NBT.FindChildByName(Data, "xCenter"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_Int)) { int CenterX = a_NBT.GetInt(CurrLine); m_Map->m_CenterX = CenterX; } CurrLine = a_NBT.FindChildByName(Data, "zCenter"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_Int)) { int CenterZ = a_NBT.GetInt(CurrLine); m_Map->m_CenterZ = CenterZ; diff --git a/src/WorldStorage/MapSerializer.h b/src/WorldStorage/MapSerializer.h index 4fa40f6f9..e13a75c8f 100644 --- a/src/WorldStorage/MapSerializer.h +++ b/src/WorldStorage/MapSerializer.h @@ -28,10 +28,10 @@ public: cMapSerializer(const AString& a_WorldName, cMap * a_Map); - /** Try to load the scoreboard */ + /** Try to load the map */ bool Load(void); - /** Try to save the scoreboard */ + /** Try to save the map */ bool Save(void); diff --git a/src/WorldStorage/NBTChunkSerializer.cpp b/src/WorldStorage/NBTChunkSerializer.cpp index 4857da1b6..28b9dd042 100644 --- a/src/WorldStorage/NBTChunkSerializer.cpp +++ b/src/WorldStorage/NBTChunkSerializer.cpp @@ -10,6 +10,7 @@ #include "../StringCompression.h" #include "FastNBT.h" +#include "../BlockEntities/BeaconEntity.h" #include "../BlockEntities/ChestEntity.h" #include "../BlockEntities/CommandBlockEntity.h" #include "../BlockEntities/DispenserEntity.h" @@ -80,6 +81,18 @@ void cNBTChunkSerializer::Finish(void) memset(m_BlockLight, 0, sizeof(m_BlockLight)); memset(m_BlockSkyLight, 0, sizeof(m_BlockSkyLight)); } + + // Check if "Entity" and "TileEntities" lists exists. MCEdit requires this. + if (!m_HasHadEntity) + { + m_Writer.BeginList("Entities", TAG_Compound); + m_Writer.EndList(); + } + if (!m_HasHadBlockEntity) + { + m_Writer.BeginList("TileEntities", TAG_Compound); + m_Writer.EndList(); + } } @@ -176,6 +189,23 @@ void cNBTChunkSerializer::AddBasicTileEntity(cBlockEntity * a_Entity, const char +void cNBTChunkSerializer::AddBeaconEntity(cBeaconEntity * a_Entity) +{ + m_Writer.BeginCompound(""); + AddBasicTileEntity(a_Entity, "Beacon"); + m_Writer.AddInt("Levels", a_Entity->GetBeaconLevel()); + m_Writer.AddInt("Primary", (int)a_Entity->GetPrimaryEffect()); + m_Writer.AddInt("Secondary", (int)a_Entity->GetSecondaryEffect()); + m_Writer.BeginList("Items", TAG_Compound); + AddItemGrid(a_Entity->GetContents()); + m_Writer.EndList(); + m_Writer.EndCompound(); +} + + + + + void cNBTChunkSerializer::AddChestEntity(cChestEntity * a_Entity, BLOCKTYPE a_ChestType) { m_Writer.BeginCompound(""); @@ -440,35 +470,35 @@ void cNBTChunkSerializer::AddMonsterEntity(cMonster * a_Monster) const char * EntityClass = NULL; switch (a_Monster->GetMobType()) { - case cMonster::mtBat: EntityClass = "Bat"; break; - case cMonster::mtBlaze: EntityClass = "Blaze"; break; - case cMonster::mtCaveSpider: EntityClass = "CaveSpider"; break; - case cMonster::mtChicken: EntityClass = "Chicken"; break; - case cMonster::mtCow: EntityClass = "Cow"; break; - case cMonster::mtCreeper: EntityClass = "Creeper"; break; - case cMonster::mtEnderDragon: EntityClass = "EnderDragon"; break; - case cMonster::mtEnderman: EntityClass = "Enderman"; break; - case cMonster::mtGhast: EntityClass = "Ghast"; break; - case cMonster::mtGiant: EntityClass = "Giant"; break; - case cMonster::mtHorse: EntityClass = "Horse"; break; - case cMonster::mtIronGolem: EntityClass = "VillagerGolem"; break; - case cMonster::mtMagmaCube: EntityClass = "LavaSlime"; break; - case cMonster::mtMooshroom: EntityClass = "MushroomCow"; break; - case cMonster::mtOcelot: EntityClass = "Ozelot"; break; - case cMonster::mtPig: EntityClass = "Pig"; break; - case cMonster::mtSheep: EntityClass = "Sheep"; break; - case cMonster::mtSilverfish: EntityClass = "Silverfish"; break; - case cMonster::mtSkeleton: EntityClass = "Skeleton"; break; - case cMonster::mtSlime: EntityClass = "Slime"; break; - case cMonster::mtSnowGolem: EntityClass = "SnowMan"; break; - case cMonster::mtSpider: EntityClass = "Spider"; break; - case cMonster::mtSquid: EntityClass = "Squid"; break; - case cMonster::mtVillager: EntityClass = "Villager"; break; - case cMonster::mtWitch: EntityClass = "Witch"; break; - case cMonster::mtWither: EntityClass = "WitherBoss"; break; - case cMonster::mtWolf: EntityClass = "Wolf"; break; - case cMonster::mtZombie: EntityClass = "Zombie"; break; - case cMonster::mtZombiePigman: EntityClass = "PigZombie"; break; + case mtBat: EntityClass = "Bat"; break; + case mtBlaze: EntityClass = "Blaze"; break; + case mtCaveSpider: EntityClass = "CaveSpider"; break; + case mtChicken: EntityClass = "Chicken"; break; + case mtCow: EntityClass = "Cow"; break; + case mtCreeper: EntityClass = "Creeper"; break; + case mtEnderDragon: EntityClass = "EnderDragon"; break; + case mtEnderman: EntityClass = "Enderman"; break; + case mtGhast: EntityClass = "Ghast"; break; + case mtGiant: EntityClass = "Giant"; break; + case mtHorse: EntityClass = "Horse"; break; + case mtIronGolem: EntityClass = "VillagerGolem"; break; + case mtMagmaCube: EntityClass = "LavaSlime"; break; + case mtMooshroom: EntityClass = "MushroomCow"; break; + case mtOcelot: EntityClass = "Ozelot"; break; + case mtPig: EntityClass = "Pig"; break; + case mtSheep: EntityClass = "Sheep"; break; + case mtSilverfish: EntityClass = "Silverfish"; break; + case mtSkeleton: EntityClass = "Skeleton"; break; + case mtSlime: EntityClass = "Slime"; break; + case mtSnowGolem: EntityClass = "SnowMan"; break; + case mtSpider: EntityClass = "Spider"; break; + case mtSquid: EntityClass = "Squid"; break; + case mtVillager: EntityClass = "Villager"; break; + case mtWitch: EntityClass = "Witch"; break; + case mtWither: EntityClass = "WitherBoss"; break; + case mtWolf: EntityClass = "Wolf"; break; + case mtZombie: EntityClass = "Zombie"; break; + case mtZombiePigman: EntityClass = "PigZombie"; break; default: { ASSERT(!"Unhandled monster type"); @@ -486,26 +516,28 @@ void cNBTChunkSerializer::AddMonsterEntity(cMonster * a_Monster) m_Writer.AddFloat("", a_Monster->GetDropChanceBoots()); m_Writer.EndList(); m_Writer.AddByte("CanPickUpLoot", (char)a_Monster->CanPickUpLoot()); + m_Writer.AddString("CustomName", a_Monster->GetCustomName()); + m_Writer.AddByte("CustomNameVisible", (char)a_Monster->IsCustomNameAlwaysVisible()); switch (a_Monster->GetMobType()) { - case cMonster::mtBat: + case mtBat: { m_Writer.AddByte("BatFlags", ((const cBat *)a_Monster)->IsHanging()); break; } - case cMonster::mtCreeper: + case mtCreeper: { m_Writer.AddByte("powered", ((const cCreeper *)a_Monster)->IsCharged()); m_Writer.AddByte("ignited", ((const cCreeper *)a_Monster)->IsBlowing()); break; } - case cMonster::mtEnderman: + case mtEnderman: { m_Writer.AddShort("carried", (Int16)((const cEnderman *)a_Monster)->GetCarriedBlock()); m_Writer.AddShort("carriedData", (Int16)((const cEnderman *)a_Monster)->GetCarriedMeta()); break; } - case cMonster::mtHorse: + case mtHorse: { const cHorse & Horse = *((const cHorse *)a_Monster); m_Writer.AddByte("ChestedHorse", Horse.IsChested()); @@ -518,46 +550,54 @@ void cNBTChunkSerializer::AddMonsterEntity(cMonster * a_Monster) m_Writer.AddByte("Saddle", Horse.IsSaddled()); break; } - case cMonster::mtMagmaCube: + case mtMagmaCube: { m_Writer.AddInt("Size", ((const cMagmaCube *)a_Monster)->GetSize()); break; } - case cMonster::mtSheep: + case mtSheep: { m_Writer.AddByte("Sheared", ((const cSheep *)a_Monster)->IsSheared()); m_Writer.AddByte("Color", ((const cSheep *)a_Monster)->GetFurColor()); break; } - case cMonster::mtSlime: + case mtSlime: { m_Writer.AddInt("Size", ((const cSlime *)a_Monster)->GetSize()); break; } - case cMonster::mtSkeleton: + case mtSkeleton: { m_Writer.AddByte("SkeletonType", (((const cSkeleton *)a_Monster)->IsWither() ? 1 : 0)); break; } - case cMonster::mtVillager: + case mtVillager: { m_Writer.AddInt("Profession", ((const cVillager *)a_Monster)->GetVilType()); break; } - case cMonster::mtWither: + case mtWither: { m_Writer.AddInt("Invul", ((const cWither *)a_Monster)->GetWitherInvulnerableTicks()); break; } - case cMonster::mtWolf: + case mtWolf: { - m_Writer.AddString("Owner", ((const cWolf *)a_Monster)->GetOwner()); - m_Writer.AddByte("Sitting", (((const cWolf *)a_Monster)->IsSitting() ? 1 : 0)); - m_Writer.AddByte("Angry", (((const cWolf *)a_Monster)->IsAngry() ? 1 : 0)); - m_Writer.AddInt("CollarColor", ((const cWolf *)a_Monster)->GetCollarColor()); + const cWolf & Wolf = *((cWolf *)a_Monster); + if (!Wolf.GetOwnerName().empty()) + { + m_Writer.AddString("Owner", Wolf.GetOwnerName()); + } + if (!Wolf.GetOwnerUUID().empty()) + { + m_Writer.AddString("OwnerUUID", Wolf.GetOwnerUUID()); + } + m_Writer.AddByte("Sitting", Wolf.IsSitting() ? 1 : 0); + m_Writer.AddByte("Angry", Wolf.IsAngry() ? 1 : 0); + m_Writer.AddByte("CollarColor", (unsigned char)Wolf.GetCollarColor()); break; } - case cMonster::mtZombie: + case mtZombie: { m_Writer.AddByte("IsVillager", (((const cZombie *)a_Monster)->IsVillagerZombie() ? 1 : 0)); m_Writer.AddByte("IsBaby", (((const cZombie *)a_Monster)->IsBaby() ? 1 : 0)); @@ -589,7 +629,6 @@ void cNBTChunkSerializer::AddProjectileEntity(cProjectileEntity * a_Projectile) { m_Writer.BeginCompound(""); AddBasicEntity(a_Projectile, a_Projectile->GetMCAClassName()); - Vector3d Pos = a_Projectile->GetPosition(); m_Writer.AddByte("inGround", a_Projectile->IsInGround() ? 1 : 0); switch (a_Projectile->GetProjectileKind()) @@ -598,9 +637,9 @@ void cNBTChunkSerializer::AddProjectileEntity(cProjectileEntity * a_Projectile) { cArrowEntity * Arrow = (cArrowEntity *)a_Projectile; - m_Writer.AddInt("xTile", (Int16)Arrow->GetBlockHit().x); - m_Writer.AddInt("yTile", (Int16)Arrow->GetBlockHit().y); - m_Writer.AddInt("zTile", (Int16)Arrow->GetBlockHit().z); + m_Writer.AddShort("xTile", (Int16)Arrow->GetBlockHit().x); + m_Writer.AddShort("yTile", (Int16)Arrow->GetBlockHit().y); + m_Writer.AddShort("zTile", (Int16)Arrow->GetBlockHit().z); m_Writer.AddByte("pickup", Arrow->GetPickupState()); m_Writer.AddDouble("damage", Arrow->GetDamageCoeff()); break; @@ -713,7 +752,7 @@ void cNBTChunkSerializer::AddItemFrameEntity(cItemFrame * a_ItemFrame) void cNBTChunkSerializer::AddMinecartChestContents(cMinecartWithChest * a_Minecart) { m_Writer.BeginList("Items", TAG_Compound); - for (int i = 0; i < cMinecartWithChest::NumSlots; i++) + for (int i = 0; i < cMinecartWithChest::ContentsHeight * cMinecartWithChest::ContentsWidth; i++) { const cItem & Item = a_Minecart->GetSlot(i); if (Item.IsEmpty()) @@ -738,6 +777,22 @@ void cNBTChunkSerializer::LightIsValid(bool a_IsLightValid) +void cNBTChunkSerializer::HeightMap(const cChunkDef::HeightMap * a_HeightMap) +{ + for (int RelX = 0; RelX < cChunkDef::Width; RelX++) + { + for (int RelZ = 0; RelZ < cChunkDef::Width; RelZ++) + { + int Height = cChunkDef::GetHeight(*a_HeightMap, RelX, RelZ); + m_VanillaHeightMap[(RelZ << 4) | RelX] = Height; + } + } +} + + + + + void cNBTChunkSerializer::BiomeData(const cChunkDef::BiomeMap * a_BiomeMap) { memcpy(m_Biomes, a_BiomeMap, sizeof(m_Biomes)); @@ -825,6 +880,7 @@ void cNBTChunkSerializer::BlockEntity(cBlockEntity * a_Entity) // Add tile-entity into NBT: switch (a_Entity->GetBlockType()) { + case E_BLOCK_BEACON: AddBeaconEntity ((cBeaconEntity *) a_Entity); break; case E_BLOCK_CHEST: AddChestEntity ((cChestEntity *) a_Entity, a_Entity->GetBlockType()); break; case E_BLOCK_COMMAND_BLOCK: AddCommandBlockEntity((cCommandBlockEntity *)a_Entity); break; case E_BLOCK_DISPENSER: AddDispenserEntity ((cDispenserEntity *) a_Entity); break; diff --git a/src/WorldStorage/NBTChunkSerializer.h b/src/WorldStorage/NBTChunkSerializer.h index 710a06a70..5ffab8cc5 100644 --- a/src/WorldStorage/NBTChunkSerializer.h +++ b/src/WorldStorage/NBTChunkSerializer.h @@ -20,6 +20,7 @@ class cFastNBTWriter; class cEntity; class cBlockEntity; class cBoat; +class cBeaconEntity; class cChestEntity; class cCommandBlockEntity; class cDispenserEntity; @@ -58,6 +59,7 @@ class cNBTChunkSerializer : public: cChunkDef::BiomeMap m_Biomes; unsigned char m_VanillaBiomes[cChunkDef::Width * cChunkDef::Width]; + int m_VanillaHeightMap[cChunkDef::Width * cChunkDef::Width]; bool m_BiomesAreValid; @@ -93,6 +95,7 @@ protected: // Block entities: void AddBasicTileEntity(cBlockEntity * a_Entity, const char * a_EntityTypeID); + void AddBeaconEntity (cBeaconEntity * a_Entity); void AddChestEntity (cChestEntity * a_Entity, BLOCKTYPE a_ChestType); void AddDispenserEntity(cDispenserEntity * a_Entity); void AddDropperEntity (cDropperEntity * a_Entity); @@ -123,6 +126,7 @@ protected: // cChunkDataSeparateCollector overrides: virtual void LightIsValid(bool a_IsLightValid) override; + virtual void HeightMap(const cChunkDef::HeightMap * a_HeightMap) override; virtual void BiomeData(const cChunkDef::BiomeMap * a_BiomeMap) override; virtual void Entity(cEntity * a_Entity) override; virtual void BlockEntity(cBlockEntity * a_Entity) override; diff --git a/src/WorldStorage/ScoreboardSerializer.cpp b/src/WorldStorage/ScoreboardSerializer.cpp index da8236e0d..e30eecf67 100644 --- a/src/WorldStorage/ScoreboardSerializer.cpp +++ b/src/WorldStorage/ScoreboardSerializer.cpp @@ -283,37 +283,37 @@ bool cScoreboardSerializer::LoadScoreboardFromNBT(const cParsedNBT & a_NBT) bool AllowsFriendlyFire = true, CanSeeFriendlyInvisible = false; int CurrLine = a_NBT.FindChildByName(Child, "Name"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_String)) { - Name = a_NBT.GetInt(CurrLine); + Name = a_NBT.GetString(CurrLine); } CurrLine = a_NBT.FindChildByName(Child, "DisplayName"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_String)) { - DisplayName = a_NBT.GetInt(CurrLine); + DisplayName = a_NBT.GetString(CurrLine); } CurrLine = a_NBT.FindChildByName(Child, "Prefix"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_String)) { - Prefix = a_NBT.GetInt(CurrLine); + Prefix = a_NBT.GetString(CurrLine); } CurrLine = a_NBT.FindChildByName(Child, "Suffix"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_String)) { - Suffix = a_NBT.GetInt(CurrLine); + Suffix = a_NBT.GetString(CurrLine); } CurrLine = a_NBT.FindChildByName(Child, "AllowFriendlyFire"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_Int)) { AllowsFriendlyFire = (a_NBT.GetInt(CurrLine) != 0); } CurrLine = a_NBT.FindChildByName(Child, "SeeFriendlyInvisibles"); - if (CurrLine >= 0) + if ((CurrLine >= 0) && (a_NBT.GetType(CurrLine) == TAG_Int)) { CanSeeFriendlyInvisible = (a_NBT.GetInt(CurrLine) != 0); } diff --git a/src/WorldStorage/WSSAnvil.cpp b/src/WorldStorage/WSSAnvil.cpp index 71ff3ef99..092b9514c 100644 --- a/src/WorldStorage/WSSAnvil.cpp +++ b/src/WorldStorage/WSSAnvil.cpp @@ -15,7 +15,9 @@ #include "../ItemGrid.h" #include "../StringCompression.h" #include "../SetChunkData.h" +#include "../Root.h" +#include "../BlockEntities/BeaconEntity.h" #include "../BlockEntities/ChestEntity.h" #include "../BlockEntities/CommandBlockEntity.h" #include "../BlockEntities/DispenserEntity.h" @@ -48,6 +50,9 @@ #include "../Entities/HangingEntity.h" #include "../Entities/ItemFrame.h" +#include "../Protocol/MojangAPI.h" +#include "Server.h" + @@ -62,8 +67,17 @@ Since only the header is actually in the memory, this number can be high, but st */ #define MAX_MCA_FILES 32 -/// The maximum size of an inflated chunk; raw chunk data is 192 KiB, allow 64 KiB more of entities -#define CHUNK_INFLATE_MAX 256 KiB +#define LOAD_FAILED(CHX, CHZ) \ + { \ + const int RegionX = FAST_FLOOR_DIV(CHX, 32); \ + const int RegionZ = FAST_FLOOR_DIV(CHZ, 32); \ + LOGERROR("%s (%d): Loading chunk [%d, %d] from file r.%d.%d.mca failed. " \ + "The server will now abort in order to avoid further data loss. " \ + "Please add the reported file and this message to the issue report.", \ + __FUNCTION__, __LINE__, CHX, CHZ, RegionX, RegionZ \ + ); \ + *((volatile int *)0) = 0; /* Crash intentionally */ \ + } @@ -83,10 +97,26 @@ cWSSAnvil::cWSSAnvil(cWorld * a_World, int a_CompressionFactor) : if (!cFile::Exists(fnam)) { cFastNBTWriter Writer; - Writer.BeginCompound(""); - Writer.AddInt("SpawnX", (int)(a_World->GetSpawnX())); - Writer.AddInt("SpawnY", (int)(a_World->GetSpawnY())); - Writer.AddInt("SpawnZ", (int)(a_World->GetSpawnZ())); + Writer.BeginCompound("Data"); + Writer.AddByte("allowCommands", 1); + Writer.AddByte("Difficulty", 2); + Writer.AddByte("hardcore", cRoot::Get()->GetServer()->IsHardcore() ? 1 : 0); + Writer.AddByte("initialized", 1); + Writer.AddByte("MapFeatures", 1); + Writer.AddByte("raining", a_World->IsWeatherRain() ? 1 : 0); + Writer.AddByte("thundering", a_World->IsWeatherStorm() ? 1 : 0); + Writer.AddInt("GameType", (int)a_World->GetGameMode()); + Writer.AddInt("generatorVersion", 1); + Writer.AddInt("SpawnX", (int)a_World->GetSpawnX()); + Writer.AddInt("SpawnY", (int)a_World->GetSpawnY()); + Writer.AddInt("SpawnZ", (int)a_World->GetSpawnZ()); + Writer.AddInt("version", 19133); + Writer.AddLong("DayTime", (Int64)a_World->GetTimeOfDay()); + Writer.AddLong("Time", a_World->GetWorldAge()); + Writer.AddLong("SizeOnDisk", 0); + Writer.AddString("generatorName", "default"); + Writer.AddString("generatorOptions", ""); + Writer.AddString("LevelName", a_World->GetName()); Writer.EndCompound(); Writer.Finish(); @@ -244,29 +274,22 @@ cWSSAnvil::cMCAFile * cWSSAnvil::LoadMCAFile(const cChunkCoords & a_Chunk) bool cWSSAnvil::LoadChunkFromData(const cChunkCoords & a_Chunk, const AString & a_Data) { - // Decompress the data: - char Uncompressed[CHUNK_INFLATE_MAX]; - z_stream strm; - strm.zalloc = (alloc_func)NULL; - strm.zfree = (free_func)NULL; - strm.opaque = NULL; - inflateInit(&strm); - strm.next_out = (Bytef *)Uncompressed; - strm.avail_out = sizeof(Uncompressed); - strm.next_in = (Bytef *)a_Data.data(); - strm.avail_in = (uInt)a_Data.size(); - int res = inflate(&strm, Z_FINISH); - inflateEnd(&strm); - if (res != Z_STREAM_END) + // Uncompress the data: + AString Uncompressed; + int res = InflateString(a_Data.data(), a_Data.size(), Uncompressed); + if (res != Z_OK) { + LOGWARNING("Uncompressing chunk [%d, %d] failed: %d", a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ, res); + LOAD_FAILED(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ); return false; } // Parse the NBT data: - cParsedNBT NBT(Uncompressed, strm.total_out); + cParsedNBT NBT(Uncompressed.data(), Uncompressed.size()); if (!NBT.IsValid()) { // NBT Parsing failed + LOAD_FAILED(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ); return false; } @@ -313,11 +336,19 @@ bool cWSSAnvil::LoadChunkFromNBT(const cChunkCoords & a_Chunk, const cParsedNBT int Level = a_NBT.FindChildByName(0, "Level"); if (Level < 0) { + LOAD_FAILED(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ); return false; } int Sections = a_NBT.FindChildByName(Level, "Sections"); - if ((Sections < 0) || (a_NBT.GetType(Sections) != TAG_List) || (a_NBT.GetChildrenType(Sections) != TAG_Compound)) + if ((Sections < 0) || (a_NBT.GetType(Sections) != TAG_List)) + { + LOAD_FAILED(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ); + return false; + } + eTagType SectionsType = a_NBT.GetChildrenType(Sections); + if ((SectionsType != TAG_Compound) && (SectionsType != TAG_End)) { + LOAD_FAILED(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ); return false; } for (int Child = a_NBT.GetFirstChild(Sections); Child >= 0; Child = a_NBT.GetNextSibling(Child)) @@ -392,7 +423,7 @@ bool cWSSAnvil::LoadChunkFromNBT(const cChunkCoords & a_Chunk, const cParsedNBT } // for y //*/ - m_World->QueueSetChunkData(cSetChunkDataPtr(new cSetChunkData( + cSetChunkDataPtr SetChunkData(new cSetChunkData( a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ, BlockTypes, MetaData, IsLightValid ? BlockLight : NULL, @@ -400,7 +431,8 @@ bool cWSSAnvil::LoadChunkFromNBT(const cChunkCoords & a_Chunk, const cParsedNBT NULL, Biomes, Entities, BlockEntities, false - ))); + )); + m_World->QueueSetChunkData(SetChunkData); return true; } @@ -425,6 +457,7 @@ bool cWSSAnvil::SaveChunkToNBT(const cChunkCoords & a_Chunk, cFastNBTWriter & a_ a_Writer.BeginCompound("Level"); a_Writer.AddInt("xPos", a_Chunk.m_ChunkX); a_Writer.AddInt("zPos", a_Chunk.m_ChunkZ); + cNBTChunkSerializer Serializer(a_Writer); if (!m_World->GetChunkData(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ, Serializer)) { @@ -439,7 +472,10 @@ bool cWSSAnvil::SaveChunkToNBT(const cChunkCoords & a_Chunk, cFastNBTWriter & a_ a_Writer.AddByteArray("Biomes", (const char *)(Serializer.m_VanillaBiomes), ARRAYCOUNT(Serializer.m_VanillaBiomes)); a_Writer.AddIntArray ("MCSBiomes", (const int *)(Serializer.m_Biomes), ARRAYCOUNT(Serializer.m_Biomes)); } - + + // Save heightmap (Vanilla require this): + a_Writer.AddIntArray("HeightMap", (const int *)Serializer.m_VanillaHeightMap, ARRAYCOUNT(Serializer.m_VanillaHeightMap)); + // Save blockdata: a_Writer.BeginList("Sections", TAG_Compound); size_t SliceSizeBlock = cChunkDef::Width * cChunkDef::Width * 16; @@ -470,6 +506,9 @@ bool cWSSAnvil::SaveChunkToNBT(const cChunkCoords & a_Chunk, cFastNBTWriter & a_ { a_Writer.AddByte("MCSIsLightValid", 1); } + + // Save the world age to the chunk data. Required by vanilla and mcedit. + a_Writer.AddLong("LastUpdate", m_World->GetWorldAge()); // Store the flag that the chunk has all the ores, trees, dungeons etc. MCS chunks are always complete. a_Writer.AddByte("TerrainPopulated", 1); @@ -577,60 +616,28 @@ void cWSSAnvil::LoadBlockEntitiesFromNBT(cBlockEntityList & a_BlockEntities, con { continue; } - int sID = a_NBT.FindChildByName(Child, "id"); - if (sID < 0) + + // Get the BlockEntity's position + int x, y, z; + if (!GetBlockEntityNBTPos(a_NBT, Child, x, y, z) || (y < 0) || (y >= cChunkDef::Height)) { + LOGWARNING("Bad block entity, missing the coords. Will be ignored."); continue; } - if (strncmp(a_NBT.GetData(sID), "Chest", a_NBT.GetDataLength(sID)) == 0) - { - LoadChestFromNBT(a_BlockEntities, a_NBT, Child, E_BLOCK_CHEST); - } - else if (strncmp(a_NBT.GetData(sID), "Control", a_NBT.GetDataLength(sID)) == 0) - { - LoadCommandBlockFromNBT(a_BlockEntities, a_NBT, Child); - } - else if (strncmp(a_NBT.GetData(sID), "Dropper", a_NBT.GetDataLength(sID)) == 0) - { - LoadDropperFromNBT(a_BlockEntities, a_NBT, Child); - } - else if (strncmp(a_NBT.GetData(sID), "FlowerPot", a_NBT.GetDataLength(sID)) == 0) + int RelX = x, RelY = y, RelZ = z, ChunkX, ChunkZ; + cChunkDef::AbsoluteToRelative(RelX, RelY, RelZ, ChunkX, ChunkZ); + + // Load the proper BlockEntity type based on the block type: + BLOCKTYPE BlockType = cChunkDef::GetBlock(a_BlockTypes, RelX, RelY, RelZ); + NIBBLETYPE BlockMeta = cChunkDef::GetNibble(a_BlockMetas, RelX, RelY, RelZ); + std::auto_ptr<cBlockEntity> be(LoadBlockEntityFromNBT(a_NBT, Child, x, y, z, BlockType, BlockMeta)); + if (be.get() == NULL) { - LoadFlowerPotFromNBT(a_BlockEntities, a_NBT, Child); - } - else if (strncmp(a_NBT.GetData(sID), "Furnace", a_NBT.GetDataLength(sID)) == 0) - { - LoadFurnaceFromNBT(a_BlockEntities, a_NBT, Child, a_BlockTypes, a_BlockMetas); - } - else if (strncmp(a_NBT.GetData(sID), "Hopper", a_NBT.GetDataLength(sID)) == 0) - { - LoadHopperFromNBT(a_BlockEntities, a_NBT, Child); - } - else if (strncmp(a_NBT.GetData(sID), "Music", a_NBT.GetDataLength(sID)) == 0) - { - LoadNoteFromNBT(a_BlockEntities, a_NBT, Child); - } - else if (strncmp(a_NBT.GetData(sID), "RecordPlayer", a_NBT.GetDataLength(sID)) == 0) - { - LoadJukeboxFromNBT(a_BlockEntities, a_NBT, Child); - } - else if (strncmp(a_NBT.GetData(sID), "Sign", a_NBT.GetDataLength(sID)) == 0) - { - LoadSignFromNBT(a_BlockEntities, a_NBT, Child); - } - else if (strncmp(a_NBT.GetData(sID), "Skull", a_NBT.GetDataLength(sID)) == 0) - { - LoadMobHeadFromNBT(a_BlockEntities, a_NBT, Child); - } - else if (strncmp(a_NBT.GetData(sID), "Trap", a_NBT.GetDataLength(sID)) == 0) - { - LoadDispenserFromNBT(a_BlockEntities, a_NBT, Child); - } - else if (strncmp(a_NBT.GetData(sID), "TrappedChest", a_NBT.GetDataLength(sID)) == 0) - { - LoadChestFromNBT(a_BlockEntities, a_NBT, Child, E_BLOCK_TRAPPED_CHEST); + continue; } - // TODO: Other block entities + + // Add the BlockEntity to the loaded data: + a_BlockEntities.push_back(be.release()); } // for Child - tag children } @@ -638,6 +645,54 @@ void cWSSAnvil::LoadBlockEntitiesFromNBT(cBlockEntityList & a_BlockEntities, con +cBlockEntity * cWSSAnvil::LoadBlockEntityFromNBT(const cParsedNBT & a_NBT, int a_Tag, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) +{ + ASSERT((a_BlockY >= 0) && (a_BlockY < cChunkDef::Height)); + + // Load the specific BlockEntity type: + switch (a_BlockType) + { + // Specific entity loaders: + case E_BLOCK_BEACON: return LoadBeaconFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ); + case E_BLOCK_CHEST: return LoadChestFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_CHEST); + case E_BLOCK_COMMAND_BLOCK: return LoadCommandBlockFromNBT(a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ); + case E_BLOCK_DISPENSER: return LoadDispenserFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ); + case E_BLOCK_DROPPER: return LoadDropperFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ); + case E_BLOCK_FLOWER_POT: return LoadFlowerPotFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ); + case E_BLOCK_FURNACE: return LoadFurnaceFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_FURNACE, a_BlockMeta); + case E_BLOCK_HEAD: return LoadMobHeadFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ); + case E_BLOCK_HOPPER: return LoadHopperFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ); + case E_BLOCK_JUKEBOX: return LoadJukeboxFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ); + case E_BLOCK_LIT_FURNACE: return LoadFurnaceFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_LIT_FURNACE, a_BlockMeta); + case E_BLOCK_NOTE_BLOCK: return LoadNoteBlockFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ); + case E_BLOCK_SIGN_POST: return LoadSignFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_SIGN_POST); + case E_BLOCK_TRAPPED_CHEST: return LoadChestFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_TRAPPED_CHEST); + case E_BLOCK_WALLSIGN: return LoadSignFromNBT (a_NBT, a_Tag, a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_WALLSIGN); + + // Blocktypes that have block entities but don't load their contents from disk: + case E_BLOCK_ENDER_CHEST: return NULL; + } + + // All the other blocktypes should have no entities assigned to them. Report an error: + // Get the "id" tag: + int TagID = a_NBT.FindChildByName(a_Tag, "id"); + AString TypeName("<unknown>"); + if (TagID >= 0) + { + TypeName.assign(a_NBT.GetData(TagID), (size_t)a_NBT.GetDataLength(TagID)); + } + LOGINFO("WorldLoader(%s): Block entity mismatch: block type %s (%d), type \"%s\", at {%d, %d, %d}; the entity will be lost.", + m_World->GetName().c_str(), + ItemTypeToString(a_BlockType).c_str(), a_BlockType, TypeName.c_str(), + a_BlockX, a_BlockY, a_BlockZ + ); + return NULL; +} + + + + + bool cWSSAnvil::LoadItemFromNBT(cItem & a_Item, const cParsedNBT & a_NBT, int a_TagIdx) { int Type = a_NBT.FindChildByName(a_TagIdx, "id"); @@ -648,7 +703,6 @@ bool cWSSAnvil::LoadItemFromNBT(cItem & a_Item, const cParsedNBT & a_NBT, int a_ a_Item.m_ItemType = a_NBT.GetShort(Type); if (a_Item.m_ItemType < 0) { - LOGD("Encountered an item with negative type (%d). Replacing with an empty item.", a_NBT.GetShort(Type)); a_Item.Empty(); return true; } @@ -746,81 +800,194 @@ void cWSSAnvil::LoadItemGridFromNBT(cItemGrid & a_ItemGrid, const cParsedNBT & a -void cWSSAnvil::LoadChestFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx, BLOCKTYPE a_ChestType) +bool cWSSAnvil::CheckBlockEntityType(const cParsedNBT & a_NBT, int a_TagIdx, const char * a_ExpectedType) { - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) + // Check if the given tag is a compound: + if (a_NBT.GetType(a_TagIdx) != TAG_Compound) { - return; + return false; } + + // Get the "id" tag: + int TagID = a_NBT.FindChildByName(a_TagIdx, "id"); + if (TagID < 0) + { + return false; + } + + // Compare the value: + if (strncmp(a_NBT.GetData(TagID), a_ExpectedType, (size_t)a_NBT.GetDataLength(TagID)) == 0) + { + return true; + } + LOGWARNING("Block entity type mismatch: exp \"%s\", got \"%s\".", + a_ExpectedType, + AString(a_NBT.GetData(TagID), (size_t)a_NBT.GetDataLength(TagID)).c_str() + ); + return false; +} + + + + + +cBlockEntity * cWSSAnvil::LoadBeaconFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ) +{ + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Beacon")) + { + return NULL; + } + + std::auto_ptr<cBeaconEntity> Beacon(new cBeaconEntity(a_BlockX, a_BlockY, a_BlockZ, m_World)); + + int CurrentLine = a_NBT.FindChildByName(a_TagIdx, "Levels"); + if (CurrentLine >= 0) + { + Beacon->SetBeaconLevel((char)a_NBT.GetInt(CurrentLine)); + } + + CurrentLine = a_NBT.FindChildByName(a_TagIdx, "Primary"); + if (CurrentLine >= 0) + { + Beacon->SetPrimaryEffect((cEntityEffect::eType)a_NBT.GetInt(CurrentLine)); + } + + CurrentLine = a_NBT.FindChildByName(a_TagIdx, "Secondary"); + if (CurrentLine >= 0) + { + Beacon->SetSecondaryEffect((cEntityEffect::eType)a_NBT.GetInt(CurrentLine)); + } + + // We are better than mojang, we load/save the beacon inventory! + int Items = a_NBT.FindChildByName(a_TagIdx, "Items"); + if ((Items >= 0) && (a_NBT.GetType(Items) == TAG_List)) + { + LoadItemGridFromNBT(Beacon->GetContents(), a_NBT, Items); + } + + return Beacon.release(); +} + + + + + +cBlockEntity * cWSSAnvil::LoadChestFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_ChestBlockType) +{ + // Check if the data has a proper type: + // TODO: Does vanilla use "TrappedChest" or not? MCWiki says no, but previous code says yes + // Ref.: http://minecraft.gamepedia.com/Trapped_Chest + // https://github.com/mc-server/MCServer/blob/d0551e2e0a98a28f31a88d489d17b408e4a7d38d/src/WorldStorage/WSSAnvil.cpp#L637 + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Chest") && !CheckBlockEntityType(a_NBT, a_TagIdx, "TrappedChest")) + { + return NULL; + } + int Items = a_NBT.FindChildByName(a_TagIdx, "Items"); if ((Items < 0) || (a_NBT.GetType(Items) != TAG_List)) { - return; // Make it an empty chest - the chunk loader will provide an empty cChestEntity for this + return NULL; // Make it an empty chest - the chunk loader will provide an empty cChestEntity for this } - std::auto_ptr<cChestEntity> Chest(new cChestEntity(x, y, z, m_World, a_ChestType)); + std::auto_ptr<cChestEntity> Chest(new cChestEntity(a_BlockX, a_BlockY, a_BlockZ, m_World, a_ChestBlockType)); LoadItemGridFromNBT(Chest->GetContents(), a_NBT, Items); - a_BlockEntities.push_back(Chest.release()); + return Chest.release(); } -void cWSSAnvil::LoadDispenserFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx) +cBlockEntity * cWSSAnvil::LoadCommandBlockFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ) { - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Control")) { - return; + return NULL; + } + + std::auto_ptr<cCommandBlockEntity> CmdBlock(new cCommandBlockEntity(a_BlockX, a_BlockY, a_BlockZ, m_World)); + + int currentLine = a_NBT.FindChildByName(a_TagIdx, "Command"); + if (currentLine >= 0) + { + CmdBlock->SetCommand(a_NBT.GetString(currentLine)); } + + currentLine = a_NBT.FindChildByName(a_TagIdx, "SuccessCount"); + if (currentLine >= 0) + { + CmdBlock->SetResult(a_NBT.GetInt(currentLine)); + } + + currentLine = a_NBT.FindChildByName(a_TagIdx, "LastOutput"); + if (currentLine >= 0) + { + CmdBlock->SetLastOutput(a_NBT.GetString(currentLine)); + } + + // TODO 2014-01-18 xdot: Figure out what TrackOutput is and parse it. + + return CmdBlock.release(); +} + + + + + +cBlockEntity * cWSSAnvil::LoadDispenserFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ) +{ + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Trap")) + { + return NULL; + } + int Items = a_NBT.FindChildByName(a_TagIdx, "Items"); if ((Items < 0) || (a_NBT.GetType(Items) != TAG_List)) { - return; // Make it an empty dispenser - the chunk loader will provide an empty cDispenserEntity for this + return NULL; // Make it an empty dispenser - the chunk loader will provide an empty cDispenserEntity for this } - std::auto_ptr<cDispenserEntity> Dispenser(new cDispenserEntity(x, y, z, m_World)); + std::auto_ptr<cDispenserEntity> Dispenser(new cDispenserEntity(a_BlockX, a_BlockY, a_BlockZ, m_World)); LoadItemGridFromNBT(Dispenser->GetContents(), a_NBT, Items); - a_BlockEntities.push_back(Dispenser.release()); + return Dispenser.release(); } -void cWSSAnvil::LoadDropperFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx) +cBlockEntity * cWSSAnvil::LoadDropperFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ) { - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Dropper")) { - return; + return NULL; } + int Items = a_NBT.FindChildByName(a_TagIdx, "Items"); if ((Items < 0) || (a_NBT.GetType(Items) != TAG_List)) { - return; // Make it an empty dropper - the chunk loader will provide an empty cDropperEntity for this + return NULL; // Make it an empty dropper - the chunk loader will provide an empty cDropperEntity for this } - std::auto_ptr<cDropperEntity> Dropper(new cDropperEntity(x, y, z, m_World)); + std::auto_ptr<cDropperEntity> Dropper(new cDropperEntity(a_BlockX, a_BlockY, a_BlockZ, m_World)); LoadItemGridFromNBT(Dropper->GetContents(), a_NBT, Items); - a_BlockEntities.push_back(Dropper.release()); + return Dropper.release(); } -void cWSSAnvil::LoadFlowerPotFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx) +cBlockEntity * cWSSAnvil::LoadFlowerPotFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ) { - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "FlowerPot")) { - return; + return NULL; } - std::auto_ptr<cFlowerPotEntity> FlowerPot(new cFlowerPotEntity(x, y, z, m_World)); + + std::auto_ptr<cFlowerPotEntity> FlowerPot(new cFlowerPotEntity(a_BlockX, a_BlockY, a_BlockZ, m_World)); short ItemType = 0, ItemData = 0; int currentLine = a_NBT.FindChildByName(a_TagIdx, "Item"); @@ -836,37 +1003,28 @@ void cWSSAnvil::LoadFlowerPotFromNBT(cBlockEntityList & a_BlockEntities, const c } FlowerPot->SetItem(cItem(ItemType, 1, ItemData)); - a_BlockEntities.push_back(FlowerPot.release()); + return FlowerPot.release(); } -void cWSSAnvil::LoadFurnaceFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx, BLOCKTYPE * a_BlockTypes, NIBBLETYPE * a_BlockMetas) +cBlockEntity * cWSSAnvil::LoadFurnaceFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) { - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Furnace")) { - return; + return NULL; } + int Items = a_NBT.FindChildByName(a_TagIdx, "Items"); if ((Items < 0) || (a_NBT.GetType(Items) != TAG_List)) { - return; // Make it an empty furnace - the chunk loader will provide an empty cFurnaceEntity for this + return NULL; // Make it an empty furnace - the chunk loader will provide an empty cFurnaceEntity for this } - // Convert coords to relative: - int RelX = x; - int RelZ = z; - int ChunkX, ChunkZ; - cChunkDef::AbsoluteToRelative(RelX, y, RelZ, ChunkX, ChunkZ); - - // Create the furnace entity, with proper BlockType and BlockMeta info: - BLOCKTYPE BlockType = cChunkDef::GetBlock(a_BlockTypes, RelX, y, RelZ); - NIBBLETYPE BlockMeta = cChunkDef::GetNibble(a_BlockMetas, RelX, y, RelZ); - std::auto_ptr<cFurnaceEntity> Furnace(new cFurnaceEntity(x, y, z, BlockType, BlockMeta, m_World)); + std::auto_ptr<cFurnaceEntity> Furnace(new cFurnaceEntity(a_BlockX, a_BlockY, a_BlockZ, a_BlockType, a_BlockMeta, m_World)); // Load slots: for (int Child = a_NBT.GetFirstChild(Items); Child != -1; Child = a_NBT.GetNextSibling(Child)) @@ -903,184 +1061,147 @@ void cWSSAnvil::LoadFurnaceFromNBT(cBlockEntityList & a_BlockEntities, const cPa // Restart cooking: Furnace->ContinueCooking(); - a_BlockEntities.push_back(Furnace.release()); + return Furnace.release(); } -void cWSSAnvil::LoadHopperFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx) +cBlockEntity * cWSSAnvil::LoadHopperFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ) { - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Hopper")) { - return; + return NULL; } + int Items = a_NBT.FindChildByName(a_TagIdx, "Items"); if ((Items < 0) || (a_NBT.GetType(Items) != TAG_List)) { - return; // Make it an empty hopper - the chunk loader will provide an empty cHopperEntity for this + return NULL; // Make it an empty hopper - the chunk loader will provide an empty cHopperEntity for this } - std::auto_ptr<cHopperEntity> Hopper(new cHopperEntity(x, y, z, m_World)); + std::auto_ptr<cHopperEntity> Hopper(new cHopperEntity(a_BlockX, a_BlockY, a_BlockZ, m_World)); LoadItemGridFromNBT(Hopper->GetContents(), a_NBT, Items); - a_BlockEntities.push_back(Hopper.release()); + return Hopper.release(); } -void cWSSAnvil::LoadJukeboxFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx) +cBlockEntity * cWSSAnvil::LoadJukeboxFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ) { - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "RecordPlayer")) { - return; + return NULL; } - std::auto_ptr<cJukeboxEntity> Jukebox(new cJukeboxEntity(x, y, z, m_World)); + + std::auto_ptr<cJukeboxEntity> Jukebox(new cJukeboxEntity(a_BlockX, a_BlockY, a_BlockZ, m_World)); int Record = a_NBT.FindChildByName(a_TagIdx, "Record"); if (Record >= 0) { Jukebox->SetRecord(a_NBT.GetInt(Record)); } - a_BlockEntities.push_back(Jukebox.release()); + return Jukebox.release(); } -void cWSSAnvil::LoadNoteFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx) +cBlockEntity * cWSSAnvil::LoadMobHeadFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ) { - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) - { - return; - } - std::auto_ptr<cNoteEntity> Note(new cNoteEntity(x, y, z, m_World)); - int note = a_NBT.FindChildByName(a_TagIdx, "note"); - if (note >= 0) + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Skull")) { - Note->SetPitch(a_NBT.GetByte(note)); + return NULL; } - a_BlockEntities.push_back(Note.release()); -} - + std::auto_ptr<cMobHeadEntity> MobHead(new cMobHeadEntity(a_BlockX, a_BlockY, a_BlockZ, m_World)); - - -void cWSSAnvil::LoadSignFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx) -{ - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) - { - return; - } - std::auto_ptr<cSignEntity> Sign(new cSignEntity(E_BLOCK_SIGN_POST, x, y, z, m_World)); - - int currentLine = a_NBT.FindChildByName(a_TagIdx, "Text1"); - if (currentLine >= 0) - { - Sign->SetLine(0, a_NBT.GetString(currentLine)); - } - - currentLine = a_NBT.FindChildByName(a_TagIdx, "Text2"); + int currentLine = a_NBT.FindChildByName(a_TagIdx, "SkullType"); if (currentLine >= 0) { - Sign->SetLine(1, a_NBT.GetString(currentLine)); + MobHead->SetType(static_cast<eMobHeadType>(a_NBT.GetByte(currentLine))); } - currentLine = a_NBT.FindChildByName(a_TagIdx, "Text3"); + currentLine = a_NBT.FindChildByName(a_TagIdx, "Rot"); if (currentLine >= 0) { - Sign->SetLine(2, a_NBT.GetString(currentLine)); + MobHead->SetRotation(static_cast<eMobHeadRotation>(a_NBT.GetByte(currentLine))); } - currentLine = a_NBT.FindChildByName(a_TagIdx, "Text4"); + currentLine = a_NBT.FindChildByName(a_TagIdx, "ExtraType"); if (currentLine >= 0) { - Sign->SetLine(3, a_NBT.GetString(currentLine)); + MobHead->SetOwner(a_NBT.GetString(currentLine)); } - a_BlockEntities.push_back(Sign.release()); + return MobHead.release(); } -void cWSSAnvil::LoadMobHeadFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx) +cBlockEntity * cWSSAnvil::LoadNoteBlockFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ) { - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Music")) { - return; - } - std::auto_ptr<cMobHeadEntity> MobHead(new cMobHeadEntity(x, y, z, m_World)); - - int currentLine = a_NBT.FindChildByName(a_TagIdx, "SkullType"); - if (currentLine >= 0) - { - MobHead->SetType(static_cast<eMobHeadType>(a_NBT.GetByte(currentLine))); - } - - currentLine = a_NBT.FindChildByName(a_TagIdx, "Rot"); - if (currentLine >= 0) - { - MobHead->SetRotation(static_cast<eMobHeadRotation>(a_NBT.GetByte(currentLine))); + return NULL; } - currentLine = a_NBT.FindChildByName(a_TagIdx, "ExtraType"); - if (currentLine >= 0) + std::auto_ptr<cNoteEntity> NoteBlock(new cNoteEntity(a_BlockX, a_BlockY, a_BlockZ, m_World)); + int note = a_NBT.FindChildByName(a_TagIdx, "note"); + if (note >= 0) { - MobHead->SetOwner(a_NBT.GetString(currentLine)); + NoteBlock->SetPitch(a_NBT.GetByte(note)); } - - a_BlockEntities.push_back(MobHead.release()); + return NoteBlock.release(); } -void cWSSAnvil::LoadCommandBlockFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx) +cBlockEntity * cWSSAnvil::LoadSignFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType) { - ASSERT(a_NBT.GetType(a_TagIdx) == TAG_Compound); - int x, y, z; - if (!GetBlockEntityNBTPos(a_NBT, a_TagIdx, x, y, z)) + // Check if the data has a proper type: + if (!CheckBlockEntityType(a_NBT, a_TagIdx, "Sign")) { - return; + return NULL; } - std::auto_ptr<cCommandBlockEntity> CmdBlock(new cCommandBlockEntity(x, y, z, m_World)); - int currentLine = a_NBT.FindChildByName(a_TagIdx, "Command"); + std::auto_ptr<cSignEntity> Sign(new cSignEntity(a_BlockType, a_BlockX, a_BlockY, a_BlockZ, m_World)); + + int currentLine = a_NBT.FindChildByName(a_TagIdx, "Text1"); if (currentLine >= 0) { - CmdBlock->SetCommand(a_NBT.GetString(currentLine)); + Sign->SetLine(0, a_NBT.GetString(currentLine)); } - currentLine = a_NBT.FindChildByName(a_TagIdx, "SuccessCount"); + currentLine = a_NBT.FindChildByName(a_TagIdx, "Text2"); if (currentLine >= 0) { - CmdBlock->SetResult(a_NBT.GetInt(currentLine)); + Sign->SetLine(1, a_NBT.GetString(currentLine)); } - currentLine = a_NBT.FindChildByName(a_TagIdx, "LastOutput"); + currentLine = a_NBT.FindChildByName(a_TagIdx, "Text3"); if (currentLine >= 0) { - CmdBlock->SetLastOutput(a_NBT.GetString(currentLine)); + Sign->SetLine(2, a_NBT.GetString(currentLine)); } - // TODO 2014-01-18 xdot: Figure out what TrackOutput is and parse it. + currentLine = a_NBT.FindChildByName(a_TagIdx, "Text4"); + if (currentLine >= 0) + { + Sign->SetLine(3, a_NBT.GetString(currentLine)); + } - a_BlockEntities.push_back(CmdBlock.release()); + return Sign.release(); } @@ -1543,7 +1664,7 @@ void cWSSAnvil::LoadHangingFromNBT(cHangingEntity & a_Hanging, const cParsedNBT if (Direction > 0) { Direction = (int)a_NBT.GetByte(Direction); - if ((Direction < 0) || (Direction > 5)) + if ((Direction < 2) || (Direction > 5)) { a_Hanging.SetDirection(BLOCK_FACE_NORTH); } @@ -1631,7 +1752,7 @@ void cWSSAnvil::LoadArrowFromNBT(cEntityList & a_Entities, const cParsedNBT & a_ // Load pickup state: int PickupIdx = a_NBT.FindChildByName(a_TagIdx, "pickup"); - if (PickupIdx > 0) + if ((PickupIdx > 0) && (a_NBT.GetType(PickupIdx) == TAG_Byte)) { Arrow->SetPickupState((cArrowEntity::ePickupState)a_NBT.GetByte(PickupIdx)); } @@ -1639,7 +1760,7 @@ void cWSSAnvil::LoadArrowFromNBT(cEntityList & a_Entities, const cParsedNBT & a_ { // Try the older "player" tag: int PlayerIdx = a_NBT.FindChildByName(a_TagIdx, "player"); - if (PlayerIdx > 0) + if ((PlayerIdx > 0) && (a_NBT.GetType(PlayerIdx) == TAG_Byte)) { Arrow->SetPickupState((a_NBT.GetByte(PlayerIdx) == 0) ? cArrowEntity::psNoPickup : cArrowEntity::psInSurvivalOrCreative); } @@ -1647,7 +1768,7 @@ void cWSSAnvil::LoadArrowFromNBT(cEntityList & a_Entities, const cParsedNBT & a_ // Load damage: int DamageIdx = a_NBT.FindChildByName(a_TagIdx, "damage"); - if (DamageIdx > 0) + if ((DamageIdx > 0) && (a_NBT.GetType(DamageIdx) == TAG_Double)) { Arrow->SetDamageCoeff(a_NBT.GetDouble(DamageIdx)); } @@ -1658,7 +1779,24 @@ void cWSSAnvil::LoadArrowFromNBT(cEntityList & a_Entities, const cParsedNBT & a_ int InBlockZIdx = a_NBT.FindChildByName(a_TagIdx, "zTile"); if ((InBlockXIdx > 0) && (InBlockYIdx > 0) && (InBlockZIdx > 0)) { - Arrow->SetBlockHit(Vector3i(a_NBT.GetInt(InBlockXIdx), a_NBT.GetInt(InBlockYIdx), a_NBT.GetInt(InBlockZIdx))); + if (a_NBT.GetType(InBlockXIdx) == a_NBT.GetType(InBlockYIdx) == a_NBT.GetType(InBlockZIdx)) + { + switch (a_NBT.GetType(InBlockXIdx)) + { + case TAG_Int: + { + // Old MCS code used this, keep reading it for compatibility reasons: + Arrow->SetBlockHit(Vector3i(a_NBT.GetInt(InBlockXIdx), a_NBT.GetInt(InBlockYIdx), a_NBT.GetInt(InBlockZIdx))); + break; + } + case TAG_Short: + { + // Vanilla uses this + Arrow->SetBlockHit(Vector3i((int)a_NBT.GetShort(InBlockXIdx), (int)a_NBT.GetShort(InBlockYIdx), (int)a_NBT.GetShort(InBlockZIdx))); + break; + } + } + } } // Store the new arrow in the entities list: @@ -2363,24 +2501,17 @@ void cWSSAnvil::LoadWolfFromNBT(cEntityList & a_Entities, const cParsedNBT & a_N { return; } - int OwnerIdx = a_NBT.FindChildByName(a_TagIdx, "Owner"); - if (OwnerIdx > 0) - { - AString OwnerName = a_NBT.GetString(OwnerIdx); - if (OwnerName != "") - { - Monster->SetOwner(OwnerName); - Monster->SetIsTame(true); - } - } + + LoadWolfOwner(*Monster.get(), a_NBT, a_TagIdx); + int SittingIdx = a_NBT.FindChildByName(a_TagIdx, "Sitting"); - if (SittingIdx > 0) + if ((SittingIdx > 0) && (a_NBT.GetType(SittingIdx) == TAG_Byte)) { bool Sitting = ((a_NBT.GetByte(SittingIdx) == 1) ? true : false); Monster->SetIsSitting(Sitting); } int AngryIdx = a_NBT.FindChildByName(a_TagIdx, "Angry"); - if (AngryIdx > 0) + if ((AngryIdx > 0) && (a_NBT.GetType(AngryIdx) == TAG_Byte)) { bool Angry = ((a_NBT.GetByte(AngryIdx) == 1) ? true : false); Monster->SetIsAngry(Angry); @@ -2388,8 +2519,22 @@ void cWSSAnvil::LoadWolfFromNBT(cEntityList & a_Entities, const cParsedNBT & a_N int CollarColorIdx = a_NBT.FindChildByName(a_TagIdx, "CollarColor"); if (CollarColorIdx > 0) { - int CollarColor = a_NBT.GetInt(CollarColorIdx); - Monster->SetCollarColor(CollarColor); + switch (a_NBT.GetType(CollarColorIdx)) + { + case TAG_Byte: + { + // Vanilla uses this + unsigned char CollarColor = a_NBT.GetByte(CollarColorIdx); + Monster->SetCollarColor(CollarColor); + break; + } + case TAG_Int: + { + // Old MCS code used this, keep reading it for compatibility reasons: + Monster->SetCollarColor(a_NBT.GetInt(CollarColorIdx)); + break; + } + } } a_Entities.push_back(Monster.release()); } @@ -2444,6 +2589,64 @@ void cWSSAnvil::LoadPigZombieFromNBT(cEntityList & a_Entities, const cParsedNBT +void cWSSAnvil::LoadWolfOwner(cWolf & a_Wolf, const cParsedNBT & a_NBT, int a_TagIdx) +{ + // Load the owner information. OwnerUUID or Owner may be specified, possibly both: + AString OwnerUUID, OwnerName; + int OwnerUUIDIdx = a_NBT.FindChildByName(a_TagIdx, "OwnerUUID"); + if (OwnerUUIDIdx > 0) + { + OwnerUUID = a_NBT.GetString(OwnerUUIDIdx); + } + int OwnerIdx = a_NBT.FindChildByName(a_TagIdx, "Owner"); + if (OwnerIdx > 0) + { + OwnerName = a_NBT.GetString(OwnerIdx); + } + if (OwnerName.empty() && OwnerUUID.empty()) + { + // There is no owner, bail out: + return; + } + + // Convert name to UUID, if needed: + if (OwnerUUID.empty()) + { + // This wolf has only playername stored (pre-1.7.6), look up the UUID + // The lookup is blocking, but we're running in a separate thread, so it's ok + OwnerUUID = cRoot::Get()->GetMojangAPI().GetUUIDFromPlayerName(OwnerName); + if (OwnerUUID.empty()) + { + // Not a known player, un-tame the wolf by bailing out + return; + } + } + else + { + // Normalize the UUID: + OwnerUUID = cMojangAPI::MakeUUIDShort(OwnerUUID); + } + + // Convert UUID to name, if needed: + if (OwnerName.empty()) + { + // The lookup is blocking, but we're running in a separate thread, so it's ok + OwnerName = cRoot::Get()->GetMojangAPI().GetPlayerNameFromUUID(OwnerUUID); + if (OwnerName.empty()) + { + // Not a known player, un-tame the wolf by bailing out + return; + } + } + + a_Wolf.SetOwner(OwnerName, OwnerUUID); + a_Wolf.SetIsTame(true); +} + + + + + bool cWSSAnvil::LoadEntityBaseFromNBT(cEntity & a_Entity, const cParsedNBT & a_NBT, int a_TagIdx) { double Pos[3]; @@ -2504,6 +2707,19 @@ bool cWSSAnvil::LoadMonsterBaseFromNBT(cMonster & a_Monster, const cParsedNBT & a_Monster.SetCanPickUpLoot(CanPickUpLoot); } + int CustomNameTag = a_NBT.FindChildByName(a_TagIdx, "CustomName"); + if ((CustomNameTag > 0) && (a_NBT.GetType(CustomNameTag) == TAG_String)) + { + a_Monster.SetCustomName(a_NBT.GetString(CustomNameTag)); + } + + int CustomNameVisibleTag = a_NBT.FindChildByName(a_TagIdx, "CustomNameVisible"); + if ((CustomNameVisibleTag > 0) && (a_NBT.GetType(CustomNameVisibleTag) == TAG_Byte)) + { + bool CustomNameVisible = (a_NBT.GetByte(CustomNameVisibleTag) == 1); + a_Monster.SetCustomNameAlwaysVisible(CustomNameVisible); + } + return true; } @@ -2675,30 +2891,42 @@ bool cWSSAnvil::cMCAFile::GetChunkData(const cChunkCoords & a_Chunk, AString & a } unsigned ChunkLocation = ntohl(m_Header[LocalX + 32 * LocalZ]); unsigned ChunkOffset = ChunkLocation >> 8; + if (ChunkOffset < 2) + { + return false; + } m_File.Seek((int)ChunkOffset * 4096); int ChunkSize = 0; if (m_File.Read(&ChunkSize, 4) != 4) { + LOAD_FAILED(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ); return false; } ChunkSize = ntohl((u_long)ChunkSize); char CompressionType = 0; if (m_File.Read(&CompressionType, 1) != 1) { + LOAD_FAILED(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ); return false; } if (CompressionType != 2) { // Chunk is in an unknown compression + LOAD_FAILED(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ); return false; } ChunkSize--; // HACK: This depends on the internal knowledge that AString's data() function returns the internal buffer directly a_Data.assign(ChunkSize, '\0'); - return (m_File.Read((void *)a_Data.data(), ChunkSize) == ChunkSize); + if (m_File.Read((void *)a_Data.data(), ChunkSize) == ChunkSize) + { + return true; + } + LOAD_FAILED(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ); + return false; } @@ -2753,7 +2981,13 @@ bool cWSSAnvil::cMCAFile::SetChunkData(const cChunkCoords & a_Chunk, const AStri // Store the header: ChunkSize = ((u_long)a_Data.size() + MCA_CHUNK_HEADER_LENGTH + 4095) / 4096; // Round data size *up* to nearest 4KB sector, make it a sector number - ASSERT(ChunkSize < 256); + if (ChunkSize > 255) + { + LOGWARNING("Cannot save chunk [%d, %d], the data is too large (%u KiB, maximum is 1024 KiB). Remove some entities and retry.", + a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ, (unsigned)(ChunkSize * 4) + ); + return false; + } m_Header[LocalX + 32 * LocalZ] = htonl((ChunkSector << 8) | ChunkSize); if (m_File.Seek(0) < 0) { diff --git a/src/WorldStorage/WSSAnvil.h b/src/WorldStorage/WSSAnvil.h index 9f8714404..591ec6757 100644 --- a/src/WorldStorage/WSSAnvil.h +++ b/src/WorldStorage/WSSAnvil.h @@ -21,6 +21,7 @@ class cItemGrid; class cProjectileEntity; class cHangingEntity; +class cWolf; @@ -124,6 +125,10 @@ protected: /// Loads the chunk's BlockEntities from NBT data (a_Tag is the Level\\TileEntities list tag; may be -1) void LoadBlockEntitiesFromNBT(cBlockEntityList & a_BlockEntitites, const cParsedNBT & a_NBT, int a_Tag, BLOCKTYPE * a_BlockTypes, NIBBLETYPE * a_BlockMetas); + /** Loads the data for a block entity from the specified NBT tag. + Returns the loaded block entity, or NULL upon failure. */ + cBlockEntity * LoadBlockEntityFromNBT(const cParsedNBT & a_NBT, int a_Tag, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta); + /// Loads a cItem contents from the specified NBT tag; returns true if successful. Doesn't load the Slot tag bool LoadItemFromNBT(cItem & a_Item, const cParsedNBT & a_NBT, int a_TagIdx); @@ -133,17 +138,21 @@ protected: */ void LoadItemGridFromNBT(cItemGrid & a_ItemGrid, const cParsedNBT & a_NBT, int a_ItemsTagIdx, int s_SlotOffset = 0); - void LoadChestFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx, BLOCKTYPE a_ChestType); - void LoadDispenserFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx); - void LoadDropperFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx); - void LoadFlowerPotFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx); - void LoadFurnaceFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx, BLOCKTYPE * a_BlockTypes, NIBBLETYPE * a_BlockMetas); - void LoadHopperFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx); - void LoadJukeboxFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx); - void LoadNoteFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx); - void LoadSignFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx); - void LoadMobHeadFromNBT (cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx); - void LoadCommandBlockFromNBT(cBlockEntityList & a_BlockEntities, const cParsedNBT & a_NBT, int a_TagIdx); + /** Returns true iff the "id" child tag inside the specified tag equals the specified expected type. */ + bool CheckBlockEntityType(const cParsedNBT & a_NBT, int a_TagIdx, const char * a_ExpectedType); + + cBlockEntity * LoadBeaconFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ); + cBlockEntity * LoadChestFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_ChestBlockType); + cBlockEntity * LoadCommandBlockFromNBT(const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ); + cBlockEntity * LoadDispenserFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ); + cBlockEntity * LoadDropperFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ); + cBlockEntity * LoadFlowerPotFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ); + cBlockEntity * LoadFurnaceFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta); + cBlockEntity * LoadHopperFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ); + cBlockEntity * LoadJukeboxFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ); + cBlockEntity * LoadMobHeadFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ); + cBlockEntity * LoadNoteBlockFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ); + cBlockEntity * LoadSignFromNBT (const cParsedNBT & a_NBT, int a_TagIdx, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_SignBlockType); void LoadEntityFromNBT(cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_EntityTagIdx, const char * a_IDTag, size_t a_IDTagLength); @@ -200,6 +209,9 @@ protected: void LoadZombieFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx); void LoadPigZombieFromNBT (cEntityList & a_Entities, const cParsedNBT & a_NBT, int a_TagIdx); + /** Loads the wolf's owner information from the NBT into the specified wolf entity. */ + void LoadWolfOwner(cWolf & a_Wolf, const cParsedNBT & a_NBT, int a_TagIdx); + /// Loads entity common data from the NBT compound; returns true if successful bool LoadEntityBaseFromNBT(cEntity & a_Entity, const cParsedNBT & a_NBT, int a_TagIdx); diff --git a/src/WorldStorage/WSSCompact.cpp b/src/WorldStorage/WSSCompact.cpp deleted file mode 100644 index ee47047a0..000000000 --- a/src/WorldStorage/WSSCompact.cpp +++ /dev/null @@ -1,1046 +0,0 @@ - -// WSSCompact.cpp - -// Interfaces to the cWSSCompact class representing the "compact" storage schema (PAK-files) - -#include "Globals.h" -#include "WSSCompact.h" -#include "../World.h" -#include "zlib/zlib.h" -#include "json/json.h" -#include "../StringCompression.h" -#include "../BlockEntities/ChestEntity.h" -#include "../BlockEntities/CommandBlockEntity.h" -#include "../BlockEntities/DispenserEntity.h" -#include "../BlockEntities/FlowerPotEntity.h" -#include "../BlockEntities/FurnaceEntity.h" -#include "../BlockEntities/JukeboxEntity.h" -#include "../BlockEntities/MobHeadEntity.h" -#include "../BlockEntities/NoteEntity.h" -#include "../BlockEntities/SignEntity.h" -#include "../SetChunkData.h" - - - - - -#pragma pack(push, 1) -/// The chunk header, as stored in the file: -struct cWSSCompact::sChunkHeader -{ - int m_ChunkX; - int m_ChunkZ; - int m_CompressedSize; - int m_UncompressedSize; -} ; -#pragma pack(pop) - - - - - -/// The maximum number of PAK files that are cached -const size_t MAX_PAK_FILES = 16; - -/// The maximum number of unsaved chunks before the cPAKFile saves them to disk -const int MAX_DIRTY_CHUNKS = 16; - - - - - -//////////////////////////////////////////////////////////////////////////////// -// cJsonChunkSerializer: - -cJsonChunkSerializer::cJsonChunkSerializer(void) : - m_HasJsonData(false) -{ -} - - - - - -void cJsonChunkSerializer::Entity(cEntity * a_Entity) -{ - // TODO: a_Entity->SaveToJson(m_Root); -} - - - - - -void cJsonChunkSerializer::BlockEntity(cBlockEntity * a_BlockEntity) -{ - const char * SaveInto = NULL; - switch (a_BlockEntity->GetBlockType()) - { - case E_BLOCK_CHEST: SaveInto = "Chests"; break; - case E_BLOCK_DISPENSER: SaveInto = "Dispensers"; break; - case E_BLOCK_DROPPER: SaveInto = "Droppers"; break; - case E_BLOCK_FLOWER_POT: SaveInto = "FlowerPots"; break; - case E_BLOCK_FURNACE: SaveInto = "Furnaces"; break; - case E_BLOCK_SIGN_POST: SaveInto = "Signs"; break; - case E_BLOCK_WALLSIGN: SaveInto = "Signs"; break; - case E_BLOCK_NOTE_BLOCK: SaveInto = "Notes"; break; - case E_BLOCK_JUKEBOX: SaveInto = "Jukeboxes"; break; - case E_BLOCK_COMMAND_BLOCK: SaveInto = "CommandBlocks"; break; - case E_BLOCK_HEAD: SaveInto = "MobHeads"; break; - - default: - { - ASSERT(!"Unhandled blocktype in BlockEntities list while saving to JSON"); - break; - } - } // switch (BlockEntity->GetBlockType()) - if (SaveInto == NULL) - { - return; - } - - Json::Value val; - a_BlockEntity->SaveToJson(val); - m_Root[SaveInto].append(val); - m_HasJsonData = true; -} - - - - - -void cJsonChunkSerializer::LightIsValid(bool a_IsLightValid) -{ - if (a_IsLightValid) - { - m_Root["IsLightValid"] = true; - m_HasJsonData = true; - } -} - - - - - -//////////////////////////////////////////////////////////////////////////////// -// cWSSCompact: - -cWSSCompact::~cWSSCompact() -{ - for (cPAKFiles::iterator itr = m_PAKFiles.begin(); itr != m_PAKFiles.end(); ++itr) - { - delete *itr; - } -} - - - - - -bool cWSSCompact::LoadChunk(const cChunkCoords & a_Chunk) -{ - AString ChunkData; - int UncompressedSize = 0; - if (!GetChunkData(a_Chunk, UncompressedSize, ChunkData)) - { - // The reason for failure is already printed in GetChunkData() - return false; - } - - return LoadChunkFromData(a_Chunk, UncompressedSize, ChunkData, m_World); -} - - - - - -bool cWSSCompact::SaveChunk(const cChunkCoords & a_Chunk) -{ - cCSLock Lock(m_CS); - - cPAKFile * f = LoadPAKFile(a_Chunk); - if (f == NULL) - { - // For some reason we couldn't locate the file - LOG("Cannot locate a proper PAK file for chunk [%d, %d]", a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ); - return false; - } - return f->SaveChunk(a_Chunk, m_World); -} - - - - - -cWSSCompact::cPAKFile * cWSSCompact::LoadPAKFile(const cChunkCoords & a_Chunk) -{ - // ASSUMES that m_CS has been locked - - // We need to retain this weird conversion code, because some edge chunks are in the wrong PAK file - const int LayerX = FAST_FLOOR_DIV(a_Chunk.m_ChunkX, 32); - const int LayerZ = FAST_FLOOR_DIV(a_Chunk.m_ChunkZ, 32); - - // Is it already cached? - for (cPAKFiles::iterator itr = m_PAKFiles.begin(); itr != m_PAKFiles.end(); ++itr) - { - if (((*itr) != NULL) && ((*itr)->GetLayerX() == LayerX) && ((*itr)->GetLayerZ() == LayerZ)) - { - // Move the file to front and return it: - cPAKFile * f = *itr; - if (itr != m_PAKFiles.begin()) - { - m_PAKFiles.erase(itr); - m_PAKFiles.push_front(f); - } - return f; - } - } - - // Load it anew: - AString FileName; - Printf(FileName, "%s/X%i_Z%i.pak", m_World->GetName().c_str(), LayerX, LayerZ); - cPAKFile * f = new cPAKFile(FileName, LayerX, LayerZ, m_CompressionFactor); - if (f == NULL) - { - return NULL; - } - m_PAKFiles.push_front(f); - - // If there are too many PAK files cached, delete the last one used: - if (m_PAKFiles.size() > MAX_PAK_FILES) - { - delete m_PAKFiles.back(); - m_PAKFiles.pop_back(); - } - return f; -} - - - - - -bool cWSSCompact::GetChunkData(const cChunkCoords & a_Chunk, int & a_UncompressedSize, AString & a_Data) -{ - cCSLock Lock(m_CS); - cPAKFile * f = LoadPAKFile(a_Chunk); - if (f == NULL) - { - return false; - } - return f->GetChunkData(a_Chunk, a_UncompressedSize, a_Data); -} - - - - - -/* -// TODO: Rewrite saving to use the same principles as loading -bool cWSSCompact::SetChunkData(const cChunkCoords & a_Chunk, int a_UncompressedSize, const AString & a_Data) -{ - cCSLock Lock(m_CS); - cPAKFile * f = LoadPAKFile(a_Chunk); - if (f == NULL) - { - return false; - } - return f->SetChunkData(a_Chunk, a_UncompressedSize, a_Data); -} -*/ - - - - - -bool cWSSCompact::EraseChunkData(const cChunkCoords & a_Chunk) -{ - cCSLock Lock(m_CS); - cPAKFile * f = LoadPAKFile(a_Chunk); - if (f == NULL) - { - return false; - } - return f->EraseChunkData(a_Chunk); -} - - - - - -void cWSSCompact::LoadEntitiesFromJson(Json::Value & a_Value, cEntityList & a_Entities, cBlockEntityList & a_BlockEntities, cWorld * a_World) -{ - // Load chests: - Json::Value AllChests = a_Value.get("Chests", Json::nullValue); - if (!AllChests.empty()) - { - for (Json::Value::iterator itr = AllChests.begin(); itr != AllChests.end(); ++itr) - { - std::auto_ptr<cChestEntity> ChestEntity(new cChestEntity(0, 0, 0, a_World, E_BLOCK_CHEST)); - if (!ChestEntity->LoadFromJson(*itr)) - { - LOGWARNING("ERROR READING CHEST FROM JSON!"); - } - else - { - a_BlockEntities.push_back(ChestEntity.release()); - } - } // for itr - AllChests[] - } - - // Load dispensers: - Json::Value AllDispensers = a_Value.get("Dispensers", Json::nullValue); - for (Json::Value::iterator itr = AllDispensers.begin(); itr != AllDispensers.end(); ++itr) - { - std::auto_ptr<cDispenserEntity> DispenserEntity(new cDispenserEntity(0, 0, 0, a_World)); - if (!DispenserEntity->LoadFromJson(*itr)) - { - LOGWARNING("ERROR READING DISPENSER FROM JSON!"); - } - else - { - a_BlockEntities.push_back(DispenserEntity.release()); - } - } // for itr - AllDispensers[] - - // Load Flowerpots: - Json::Value AllFlowerPots = a_Value.get("FlowerPots", Json::nullValue); - for (Json::Value::iterator itr = AllFlowerPots.begin(); itr != AllFlowerPots.end(); ++itr) - { - std::auto_ptr<cFlowerPotEntity> FlowerPotEntity(new cFlowerPotEntity(0, 0, 0, a_World)); - if (!FlowerPotEntity->LoadFromJson(*itr)) - { - LOGWARNING("ERROR READING FLOWERPOT FROM JSON!"); - } - else - { - a_BlockEntities.push_back(FlowerPotEntity.release()); - } - } // for itr - AllFlowerPots[] - - // Load furnaces: - Json::Value AllFurnaces = a_Value.get("Furnaces", Json::nullValue); - for (Json::Value::iterator itr = AllFurnaces.begin(); itr != AllFurnaces.end(); ++itr) - { - // TODO: The block type and meta aren't correct, there's no way to get them here - std::auto_ptr<cFurnaceEntity> FurnaceEntity(new cFurnaceEntity(0, 0, 0, E_BLOCK_FURNACE, 0, a_World)); - if (!FurnaceEntity->LoadFromJson(*itr)) - { - LOGWARNING("ERROR READING FURNACE FROM JSON!"); - } - else - { - a_BlockEntities.push_back(FurnaceEntity.release()); - } - } // for itr - AllFurnaces[] - - // Load signs: - Json::Value AllSigns = a_Value.get("Signs", Json::nullValue); - for (Json::Value::iterator itr = AllSigns.begin(); itr != AllSigns.end(); ++itr) - { - std::auto_ptr<cSignEntity> SignEntity(new cSignEntity(E_BLOCK_SIGN_POST, 0, 0, 0, a_World)); - if (!SignEntity->LoadFromJson(*itr)) - { - LOGWARNING("ERROR READING SIGN FROM JSON!"); - } - else - { - a_BlockEntities.push_back(SignEntity.release()); - } - } // for itr - AllSigns[] - - // Load note blocks: - Json::Value AllNotes = a_Value.get("Notes", Json::nullValue); - for (Json::Value::iterator itr = AllNotes.begin(); itr != AllNotes.end(); ++itr) - { - std::auto_ptr<cNoteEntity> NoteEntity(new cNoteEntity(0, 0, 0, a_World)); - if (!NoteEntity->LoadFromJson(*itr)) - { - LOGWARNING("ERROR READING NOTE BLOCK FROM JSON!"); - } - else - { - a_BlockEntities.push_back(NoteEntity.release()); - } - } // for itr - AllNotes[] - - // Load jukeboxes: - Json::Value AllJukeboxes = a_Value.get("Jukeboxes", Json::nullValue); - for (Json::Value::iterator itr = AllJukeboxes.begin(); itr != AllJukeboxes.end(); ++itr) - { - std::auto_ptr<cJukeboxEntity> JukeboxEntity(new cJukeboxEntity(0, 0, 0, a_World)); - if (!JukeboxEntity->LoadFromJson(*itr)) - { - LOGWARNING("ERROR READING JUKEBOX FROM JSON!"); - } - else - { - a_BlockEntities.push_back(JukeboxEntity.release()); - } - } // for itr - AllJukeboxes[] - - // Load command blocks: - Json::Value AllCommandBlocks = a_Value.get("CommandBlocks", Json::nullValue); - for (Json::Value::iterator itr = AllCommandBlocks.begin(); itr != AllCommandBlocks.end(); ++itr) - { - std::auto_ptr<cCommandBlockEntity> CommandBlockEntity(new cCommandBlockEntity(0, 0, 0, a_World)); - if (!CommandBlockEntity->LoadFromJson(*itr)) - { - LOGWARNING("ERROR READING COMMAND BLOCK FROM JSON!"); - } - else - { - a_BlockEntities.push_back(CommandBlockEntity.release()); - } - } // for itr - AllCommandBlocks[] - - // Load mob heads: - Json::Value AllMobHeads = a_Value.get("MobHeads", Json::nullValue); - for (Json::Value::iterator itr = AllMobHeads.begin(); itr != AllMobHeads.end(); ++itr) - { - std::auto_ptr<cMobHeadEntity> MobHeadEntity(new cMobHeadEntity(0, 0, 0, a_World)); - if (!MobHeadEntity->LoadFromJson(*itr)) - { - LOGWARNING("ERROR READING MOB HEAD FROM JSON!"); - } - else - { - a_BlockEntities.push_back(MobHeadEntity.release()); - } - } // for itr - AllMobHeads[] -} - - - - - -//////////////////////////////////////////////////////////////////////////////// -// cWSSCompact::cPAKFile - -#define READ(Var) \ - if (f.Read(&Var, sizeof(Var)) != sizeof(Var)) \ - { \ - LOGERROR("ERROR READING %s FROM FILE %s (line %d); file offset %d", #Var, m_FileName.c_str(), __LINE__, f.Tell()); \ - return; \ - } - -cWSSCompact::cPAKFile::cPAKFile(const AString & a_FileName, int a_LayerX, int a_LayerZ, int a_CompressionFactor) : - m_FileName(a_FileName), - m_CompressionFactor(a_CompressionFactor), - m_LayerX(a_LayerX), - m_LayerZ(a_LayerZ), - m_NumDirty(0), - m_ChunkVersion( CHUNK_VERSION), // Init with latest version - m_PakVersion( PAK_VERSION) -{ - cFile f; - if (!f.Open(m_FileName, cFile::fmRead)) - { - return; - } - - // Read headers: - READ(m_PakVersion); - if (m_PakVersion != 1) - { - LOGERROR("File \"%s\" is in an unknown pak format (%d)", m_FileName.c_str(), m_PakVersion); - return; - } - - READ(m_ChunkVersion); - switch (m_ChunkVersion) - { - case 1: - { - m_ChunkSize.Set(16, 128, 16); - break; - } - case 2: - case 3: - { - m_ChunkSize.Set(16, 256, 16); - break; - } - default: - { - LOGERROR("File \"%s\" is in an unknown chunk format (%d)", m_FileName.c_str(), m_ChunkVersion); - return; - } - }; - - short NumChunks = 0; - READ(NumChunks); - - // Read chunk headers: - for (int i = 0; i < NumChunks; i++) - { - sChunkHeader * Header = new sChunkHeader; - - // Here we do not use the READ macro, as it does not free the resources - // allocated with new in case of error. - if (f.Read(Header, sizeof(*Header)) != sizeof(*Header)) - { - LOGERROR("ERROR READING %s FROM FILE %s (line %d); file offset %d", "Header", m_FileName.c_str(), __LINE__, f.Tell()); - delete Header; - Header = NULL; - return; - } - m_ChunkHeaders.push_back(Header); - } // for i - chunk headers - - // Read chunk data: - if (f.ReadRestOfFile(m_DataContents) == -1) - { - LOGERROR("Cannot read file \"%s\" contents", m_FileName.c_str()); - return; - } - - if (m_ChunkVersion == 1) // Convert chunks to version 2 - { - UpdateChunk1To2(); - } -#if AXIS_ORDER == AXIS_ORDER_XZY - if (m_ChunkVersion == 2) // Convert chunks to version 3 - { - UpdateChunk2To3(); - } -#endif -} - - - - - -cWSSCompact::cPAKFile::~cPAKFile() -{ - if (m_NumDirty > 0) - { - SynchronizeFile(); - } - for (sChunkHeaders::iterator itr = m_ChunkHeaders.begin(); itr != m_ChunkHeaders.end(); ++itr) - { - delete *itr; - } -} - - - - - -bool cWSSCompact::cPAKFile::GetChunkData(const cChunkCoords & a_Chunk, int & a_UncompressedSize, AString & a_Data) -{ - int ChunkX = a_Chunk.m_ChunkX; - int ChunkZ = a_Chunk.m_ChunkZ; - sChunkHeader * Header = NULL; - int Offset = 0; - for (sChunkHeaders::iterator itr = m_ChunkHeaders.begin(); itr != m_ChunkHeaders.end(); ++itr) - { - if (((*itr)->m_ChunkX == ChunkX) && ((*itr)->m_ChunkZ == ChunkZ)) - { - Header = *itr; - break; - } - Offset += (*itr)->m_CompressedSize; - } - if ((Header == NULL) || (Offset + Header->m_CompressedSize > (int)m_DataContents.size())) - { - // Chunk not found / data invalid - return false; - } - - a_UncompressedSize = Header->m_UncompressedSize; - a_Data.assign(m_DataContents, Offset, Header->m_CompressedSize); - return true; -} - - - - - -bool cWSSCompact::cPAKFile::SaveChunk(const cChunkCoords & a_Chunk, cWorld * a_World) -{ - if (!SaveChunkToData(a_Chunk, a_World)) - { - return false; - } - if (m_NumDirty > MAX_DIRTY_CHUNKS) - { - SynchronizeFile(); - } - return true; -} - - - - - -void cWSSCompact::cPAKFile::UpdateChunk1To2() -{ - int Offset = 0; - AString NewDataContents; - int ChunksConverted = 0; - for (sChunkHeaders::iterator itr = m_ChunkHeaders.begin(); itr != m_ChunkHeaders.end(); ++itr) - { - sChunkHeader * Header = *itr; - - if (ChunksConverted % 32 == 0) - { - LOGINFO("Updating \"%s\" version 1 to version 2: " SIZE_T_FMT " %%", m_FileName.c_str(), (ChunksConverted * 100) / m_ChunkHeaders.size()); - } - ChunksConverted++; - - AString Data; - int UncompressedSize = Header->m_UncompressedSize; - Data.assign(m_DataContents, Offset, Header->m_CompressedSize); - Offset += Header->m_CompressedSize; - - // Crude data integrity check: - int ExpectedSize = (16*128*16)*2 + (16*128*16)/2; // For version 1 - if (UncompressedSize < ExpectedSize) - { - LOGWARNING("Chunk [%d, %d] has too short decompressed data (%d bytes out of %d needed), erasing", - Header->m_ChunkX, Header->m_ChunkZ, - UncompressedSize, ExpectedSize - ); - Offset += Header->m_CompressedSize; - continue; - } - - // Decompress the data: - AString UncompressedData; - { - int errorcode = UncompressString(Data.data(), Data.size(), UncompressedData, (size_t)UncompressedSize); - if (errorcode != Z_OK) - { - LOGERROR("Error %d decompressing data for chunk [%d, %d]", - errorcode, - Header->m_ChunkX, Header->m_ChunkZ - ); - Offset += Header->m_CompressedSize; - continue; - } - } - - if (UncompressedSize != (int)UncompressedData.size()) - { - LOGWARNING("Uncompressed data size differs (exp %d bytes, got " SIZE_T_FMT ") for chunk [%d, %d]", - UncompressedSize, UncompressedData.size(), - Header->m_ChunkX, Header->m_ChunkZ - ); - Offset += Header->m_CompressedSize; - continue; - } - - - // Old version is 128 blocks high with YZX axis order - char ConvertedData[cChunkDef::BlockDataSize]; - int Index = 0; - unsigned int InChunkOffset = 0; - for (int x = 0; x < 16; ++x) for (int z = 0; z < 16; ++z) - { - for (int y = 0; y < 128; ++y) - { - ConvertedData[Index++] = UncompressedData[y + z * 128 + x * 128 * 16 + InChunkOffset]; - } - // Add 128 empty blocks after an old y column - memset(ConvertedData + Index, E_BLOCK_AIR, 128); - Index += 128; - } - InChunkOffset += (16 * 128 * 16); - for (int x = 0; x < 16; ++x) for (int z = 0; z < 16; ++z) // Metadata - { - for (int y = 0; y < 64; ++y) - { - ConvertedData[Index++] = UncompressedData[y + z * 64 + x * 64 * 16 + InChunkOffset]; - } - memset(ConvertedData + Index, 0, 64); - Index += 64; - } - InChunkOffset += (16 * 128 * 16) / 2; - for (int x = 0; x < 16; ++x) for (int z = 0; z < 16; ++z) // Block light - { - for (int y = 0; y < 64; ++y) - { - ConvertedData[Index++] = UncompressedData[y + z * 64 + x * 64 * 16 + InChunkOffset]; - } - memset(ConvertedData + Index, 0, 64); - Index += 64; - } - InChunkOffset += (16*128*16)/2; - for (int x = 0; x < 16; ++x) for (int z = 0; z < 16; ++z) // Sky light - { - for (int y = 0; y < 64; ++y) - { - ConvertedData[Index++] = UncompressedData[y + z * 64 + x * 64 * 16 + InChunkOffset]; - } - memset(ConvertedData + Index, 0, 64); - Index += 64; - } - InChunkOffset += (16 * 128 * 16) / 2; - - AString Converted(ConvertedData, ARRAYCOUNT(ConvertedData)); - - // Add JSON data afterwards - if (UncompressedData.size() > InChunkOffset) - { - Converted.append( UncompressedData.begin() + InChunkOffset, UncompressedData.end()); - } - - // Re-compress data - AString CompressedData; - { - int errorcode = CompressString(Converted.data(), Converted.size(), CompressedData, m_CompressionFactor); - if (errorcode != Z_OK) - { - LOGERROR("Error %d compressing data for chunk [%d, %d]", - errorcode, - Header->m_ChunkX, Header->m_ChunkZ - ); - continue; - } - } - - // Save into file's cache - Header->m_UncompressedSize = (int)Converted.size(); - Header->m_CompressedSize = (int)CompressedData.size(); - NewDataContents.append(CompressedData); - } - - // Done converting - m_DataContents = NewDataContents; - m_ChunkVersion = 2; - SynchronizeFile(); - - LOGINFO("Updated \"%s\" version 1 to version 2", m_FileName.c_str()); -} - - - - - -void cWSSCompact::cPAKFile::UpdateChunk2To3() -{ - int Offset = 0; - AString NewDataContents; - int ChunksConverted = 0; - for (sChunkHeaders::iterator itr = m_ChunkHeaders.begin(); itr != m_ChunkHeaders.end(); ++itr) - { - sChunkHeader * Header = *itr; - - if (ChunksConverted % 32 == 0) - { - LOGINFO("Updating \"%s\" version 2 to version 3: " SIZE_T_FMT " %%", m_FileName.c_str(), (ChunksConverted * 100) / m_ChunkHeaders.size()); - } - ChunksConverted++; - - AString Data; - int UncompressedSize = Header->m_UncompressedSize; - Data.assign(m_DataContents, Offset, Header->m_CompressedSize); - Offset += Header->m_CompressedSize; - - // Crude data integrity check: - const int ExpectedSize = (16 * 256 * 16) * 2 + (16 * 256 * 16) / 2; // For version 2 - if (UncompressedSize < ExpectedSize) - { - LOGWARNING("Chunk [%d, %d] has too short decompressed data (%d bytes out of %d needed), erasing", - Header->m_ChunkX, Header->m_ChunkZ, - UncompressedSize, ExpectedSize - ); - Offset += Header->m_CompressedSize; - continue; - } - - // Decompress the data: - AString UncompressedData; - { - int errorcode = UncompressString(Data.data(), Data.size(), UncompressedData, (size_t)UncompressedSize); - if (errorcode != Z_OK) - { - LOGERROR("Error %d decompressing data for chunk [%d, %d]", - errorcode, - Header->m_ChunkX, Header->m_ChunkZ - ); - Offset += Header->m_CompressedSize; - continue; - } - } - - if (UncompressedSize != (int)UncompressedData.size()) - { - LOGWARNING("Uncompressed data size differs (exp %d bytes, got " SIZE_T_FMT ") for chunk [%d, %d]", - UncompressedSize, UncompressedData.size(), - Header->m_ChunkX, Header->m_ChunkZ - ); - Offset += Header->m_CompressedSize; - continue; - } - - char ConvertedData[ExpectedSize]; - memset(ConvertedData, 0, ExpectedSize); - - // Cannot use cChunk::MakeIndex because it might change again????????? - // For compatibility, use what we know is current - #define MAKE_3_INDEX( x, y, z) ( x + (z * 16) + (y * 16 * 16)) - - unsigned int InChunkOffset = 0; - for (int x = 0; x < 16; ++x) for (int z = 0; z < 16; ++z) for (int y = 0; y < 256; ++y) // YZX Loop order is important, in 1.1 Y was first then Z then X - { - ConvertedData[ MAKE_3_INDEX(x, y, z) ] = UncompressedData[InChunkOffset]; - ++InChunkOffset; - } // for y, z, x - - - unsigned int index2 = 0; - for (int x = 0; x < 16; ++x) for (int z = 0; z < 16; ++z) for (int y = 0; y < 256; ++y) - { - ConvertedData[ InChunkOffset + MAKE_3_INDEX(x, y, z)/2 ] |= ( (UncompressedData[ InChunkOffset + index2/2 ] >> ((index2&1)*4)) & 0x0f) << ((x&1)*4); - ++index2; - } - InChunkOffset += index2 / 2; - index2 = 0; - - for (int x = 0; x < 16; ++x) for (int z = 0; z < 16; ++z) for (int y = 0; y < 256; ++y) - { - ConvertedData[ InChunkOffset + MAKE_3_INDEX(x, y, z)/2 ] |= ( (UncompressedData[ InChunkOffset + index2/2 ] >> ((index2&1)*4)) & 0x0f) << ((x&1)*4); - ++index2; - } - InChunkOffset += index2 / 2; - index2 = 0; - - for (int x = 0; x < 16; ++x) for (int z = 0; z < 16; ++z) for (int y = 0; y < 256; ++y) - { - ConvertedData[ InChunkOffset + MAKE_3_INDEX(x, y, z)/2 ] |= ( (UncompressedData[ InChunkOffset + index2/2 ] >> ((index2&1)*4)) & 0x0f) << ((x&1)*4); - ++index2; - } - InChunkOffset += index2 / 2; - - AString Converted(ConvertedData, ExpectedSize); - - // Add JSON data afterwards - if (UncompressedData.size() > InChunkOffset) - { - Converted.append( UncompressedData.begin() + InChunkOffset, UncompressedData.end()); - } - - // Re-compress data - AString CompressedData; - { - int errorcode = CompressString(Converted.data(), Converted.size(), CompressedData, m_CompressionFactor); - if (errorcode != Z_OK) - { - LOGERROR("Error %d compressing data for chunk [%d, %d]", - errorcode, - Header->m_ChunkX, Header->m_ChunkZ - ); - continue; - } - } - - // Save into file's cache - Header->m_UncompressedSize = (int)Converted.size(); - Header->m_CompressedSize = (int)CompressedData.size(); - NewDataContents.append(CompressedData); - } - - // Done converting - m_DataContents = NewDataContents; - m_ChunkVersion = 3; - SynchronizeFile(); - - LOGINFO("Updated \"%s\" version 2 to version 3", m_FileName.c_str()); -} - - - - - -bool cWSSCompact::LoadChunkFromData(const cChunkCoords & a_Chunk, int a_UncompressedSize, const AString & a_Data, cWorld * a_World) -{ - // Crude data integrity check: - if (a_UncompressedSize < cChunkDef::BlockDataSize) - { - LOGWARNING("Chunk [%d, %d] has too short decompressed data (%d bytes out of %d needed), erasing", - a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ, - a_UncompressedSize, cChunkDef::BlockDataSize - ); - EraseChunkData(a_Chunk); - return false; - } - - // Decompress the data: - AString UncompressedData; - int errorcode = UncompressString(a_Data.data(), a_Data.size(), UncompressedData, (size_t)a_UncompressedSize); - if (errorcode != Z_OK) - { - LOGERROR("Error %d decompressing data for chunk [%d, %d]", - errorcode, - a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ - ); - return false; - } - - if (a_UncompressedSize != (int)UncompressedData.size()) - { - LOGWARNING("Uncompressed data size differs (exp %d bytes, got " SIZE_T_FMT ") for chunk [%d, %d]", - a_UncompressedSize, UncompressedData.size(), - a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ - ); - return false; - } - - cEntityList Entities; - cBlockEntityList BlockEntities; - bool IsLightValid = false; - - if (a_UncompressedSize > cChunkDef::BlockDataSize) - { - Json::Value root; // will contain the root value after parsing. - Json::Reader reader; - if (!reader.parse( UncompressedData.data() + cChunkDef::BlockDataSize, root, false)) - { - LOGERROR("Failed to parse trailing JSON in chunk [%d, %d]!", - a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ - ); - } - else - { - LoadEntitiesFromJson(root, Entities, BlockEntities, a_World); - IsLightValid = root.get("IsLightValid", false).asBool(); - } - } - - BLOCKTYPE * BlockData = (BLOCKTYPE *)UncompressedData.data(); - NIBBLETYPE * MetaData = (NIBBLETYPE *)(BlockData + MetaOffset); - NIBBLETYPE * BlockLight = (NIBBLETYPE *)(BlockData + LightOffset); - NIBBLETYPE * SkyLight = (NIBBLETYPE *)(BlockData + SkyLightOffset); - - a_World->QueueSetChunkData(cSetChunkDataPtr(new cSetChunkData( - a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ, - BlockData, MetaData, - IsLightValid ? BlockLight : NULL, - IsLightValid ? SkyLight : NULL, - NULL, NULL, - Entities, BlockEntities, - false - ))); - - return true; -} - - - - - -bool cWSSCompact::cPAKFile::EraseChunkData(const cChunkCoords & a_Chunk) -{ - int ChunkX = a_Chunk.m_ChunkX; - int ChunkZ = a_Chunk.m_ChunkZ; - int Offset = 0; - for (sChunkHeaders::iterator itr = m_ChunkHeaders.begin(); itr != m_ChunkHeaders.end(); ++itr) - { - if (((*itr)->m_ChunkX == ChunkX) && ((*itr)->m_ChunkZ == ChunkZ)) - { - m_DataContents.erase(Offset, (*itr)->m_CompressedSize); - delete *itr; - itr = m_ChunkHeaders.erase(itr); - return true; - } - Offset += (*itr)->m_CompressedSize; - } - - return false; -} - - - - - -bool cWSSCompact::cPAKFile::SaveChunkToData(const cChunkCoords & a_Chunk, cWorld * a_World) -{ - // Serialize the chunk: - cJsonChunkSerializer Serializer; - if (!a_World->GetChunkData(a_Chunk.m_ChunkX, a_Chunk.m_ChunkZ, Serializer)) - { - // Chunk not valid - LOG("cWSSCompact: Trying to save chunk [%d, %d, %d] that has no data, ignoring request.", a_Chunk.m_ChunkX, a_Chunk.m_ChunkY, a_Chunk.m_ChunkZ); - return false; - } - - AString Data; - Data.assign((const char *)Serializer.GetBlockData(), cChunkDef::BlockDataSize); - if (Serializer.HasJsonData()) - { - AString JsonData; - Json::StyledWriter writer; - JsonData = writer.write(Serializer.GetRoot()); - Data.append(JsonData); - } - - // Compress the data: - AString CompressedData; - int errorcode = CompressString(Data.data(), Data.size(), CompressedData, m_CompressionFactor); - if (errorcode != Z_OK) - { - LOGERROR("Error %i compressing data for chunk [%d, %d, %d]", errorcode, a_Chunk.m_ChunkX, a_Chunk.m_ChunkY, a_Chunk.m_ChunkZ); - return false; - } - - // Erase any existing data for the chunk: - EraseChunkData(a_Chunk); - - // Save the header: - sChunkHeader * Header = new sChunkHeader; - if (Header == NULL) - { - LOGWARNING("Cannot create a new chunk header to save chunk [%d, %d, %d]", a_Chunk.m_ChunkX, a_Chunk.m_ChunkY, a_Chunk.m_ChunkZ); - return false; - } - Header->m_CompressedSize = (int)CompressedData.size(); - Header->m_ChunkX = a_Chunk.m_ChunkX; - Header->m_ChunkZ = a_Chunk.m_ChunkZ; - Header->m_UncompressedSize = (int)Data.size(); - m_ChunkHeaders.push_back(Header); - - m_DataContents.append(CompressedData.data(), CompressedData.size()); - - m_NumDirty++; - return true; -} - - - - - -#define WRITE(Var) \ - if (f.Write(&Var, sizeof(Var)) != sizeof(Var)) \ - { \ - LOGERROR("cWSSCompact: ERROR writing %s to file \"%s\" (line %d); file offset %d", #Var, m_FileName.c_str(), __LINE__, f.Tell()); \ - return; \ - } - -void cWSSCompact::cPAKFile::SynchronizeFile(void) -{ - cFile f; - if (!f.Open(m_FileName, cFile::fmWrite)) - { - LOGERROR("Cannot open PAK file \"%s\" for writing", m_FileName.c_str()); - return; - } - - WRITE(m_PakVersion); - WRITE(m_ChunkVersion); - short NumChunks = (short)m_ChunkHeaders.size(); - WRITE(NumChunks); - for (sChunkHeaders::iterator itr = m_ChunkHeaders.begin(); itr != m_ChunkHeaders.end(); ++itr) - { - WRITE(**itr); - } - if (f.Write(m_DataContents.data(), m_DataContents.size()) != (int)m_DataContents.size()) - { - LOGERROR("cWSSCompact: ERROR writing chunk contents to file \"%s\" (line %d); file offset %d", m_FileName.c_str(), __LINE__, f.Tell()); - return; - } - m_NumDirty = 0; -} - - - - diff --git a/src/WorldStorage/WSSCompact.h b/src/WorldStorage/WSSCompact.h deleted file mode 100644 index 83e9cb49f..000000000 --- a/src/WorldStorage/WSSCompact.h +++ /dev/null @@ -1,157 +0,0 @@ - -// WSSCompact.h - -// Interfaces to the cWSSCompact class representing the "Compact" storage schema (PAK-files) - - - - - -#pragma once -#ifndef WSSCOMPACT_H_INCLUDED -#define WSSCOMPACT_H_INCLUDED - -#include "WorldStorage.h" -#include "../Vector3.h" -#include "json/json.h" -#include "ChunkDataCallback.h" - - - - - -/// Helper class for serializing a chunk into Json -class cJsonChunkSerializer : - public cChunkDataArrayCollector -{ -public: - - cJsonChunkSerializer(void); - - Json::Value & GetRoot (void) {return m_Root; } - BLOCKTYPE * GetBlockData(void) {return (BLOCKTYPE *)m_BlockData; } - bool HasJsonData (void) const {return m_HasJsonData; } - -protected: - - // NOTE: block data is serialized into inherited cChunkDataCollector's m_BlockData[] array - - // Entities and BlockEntities are serialized to Json - Json::Value m_Root; - bool m_HasJsonData; - - // cChunkDataCollector overrides: - virtual void Entity (cEntity * a_Entity) override; - virtual void BlockEntity (cBlockEntity * a_Entity) override; - virtual void LightIsValid (bool a_IsLightValid) override; -} ; - - - - - -class cWSSCompact : - public cWSSchema -{ -public: - cWSSCompact(cWorld * a_World, int a_CompressionFactor) : cWSSchema(a_World), m_CompressionFactor(a_CompressionFactor) {} - virtual ~cWSSCompact(); - -protected: - - enum - { - // Offsets to individual components in the joined blockdata array - MetaOffset = cChunkDef::NumBlocks, - LightOffset = MetaOffset + cChunkDef::NumBlocks / 2, - SkyLightOffset = LightOffset + cChunkDef::NumBlocks / 2, - } ; - - struct sChunkHeader; - typedef std::vector<sChunkHeader *> sChunkHeaders; - - /// Implements a cache for a single PAK file; implements lazy-write in order to be able to write multiple chunks fast - class cPAKFile - { - public: - - cPAKFile(const AString & a_FileName, int a_LayerX, int a_LayerZ, int a_CompressionFactor); - ~cPAKFile(); - - bool GetChunkData(const cChunkCoords & a_Chunk, int & a_UncompressedSize, AString & a_Data); - bool SetChunkData(const cChunkCoords & a_Chunk, int a_UncompressedSize, const AString & a_Data); - bool EraseChunkData(const cChunkCoords & a_Chunk); - - bool SaveChunk(const cChunkCoords & a_Chunk, cWorld * a_World); - - int GetLayerX(void) const {return m_LayerX; } - int GetLayerZ(void) const {return m_LayerZ; } - - static const int PAK_VERSION = 1; -#if AXIS_ORDER == AXIS_ORDER_XZY - static const int CHUNK_VERSION = 3; -#elif AXIS_ORDER == AXIS_ORDER_YZX - static const int CHUNK_VERSION = 2; -#endif - protected: - - AString m_FileName; - int m_CompressionFactor; - int m_LayerX; - int m_LayerZ; - - sChunkHeaders m_ChunkHeaders; - AString m_DataContents; // Data contents of the file, cached - - int m_NumDirty; // Number of chunks that were written into m_DataContents but not into the file - - Vector3i m_ChunkSize; // Is related to m_ChunkVersion - char m_ChunkVersion; - char m_PakVersion; - - bool SaveChunkToData(const cChunkCoords & a_Chunk, cWorld * a_World); // Saves the chunk to m_DataContents, updates headers and m_NumDirty - void SynchronizeFile(void); // Writes m_DataContents along with the headers to file, resets m_NumDirty - - void UpdateChunk1To2(void); // Height from 128 to 256 - void UpdateChunk2To3(void); // Axis order from YZX to XZY - } ; - - typedef std::list<cPAKFile *> cPAKFiles; - - cCriticalSection m_CS; - cPAKFiles m_PAKFiles; // A MRU cache of PAK files - - int m_CompressionFactor; - - /// Loads the correct PAK file either from cache or from disk, manages the m_PAKFiles cache - cPAKFile * LoadPAKFile(const cChunkCoords & a_Chunk); - - /// Gets chunk data from the correct file; locks CS as needed - bool GetChunkData(const cChunkCoords & a_Chunk, int & a_UncompressedSize, AString & a_Data); - - /// Sets chunk data to the correct file; locks CS as needed - bool SetChunkData(const cChunkCoords & a_Chunk, int a_UncompressedSize, const AString & a_Data); - - /// Erases chunk data from the correct file; locks CS as needed - bool EraseChunkData(const cChunkCoords & a_Chunk); - - /// Loads the chunk from the data (no locking needed) - bool LoadChunkFromData(const cChunkCoords & a_Chunk, int a_UncompressedSize, const AString & a_Data, cWorld * a_World); - - void LoadEntitiesFromJson(Json::Value & a_Value, cEntityList & a_Entities, cBlockEntityList & a_BlockEntities, cWorld * a_World); - - // cWSSchema overrides: - virtual bool LoadChunk(const cChunkCoords & a_Chunk) override; - virtual bool SaveChunk(const cChunkCoords & a_Chunk) override; - virtual const AString GetName(void) const override {return "compact"; } -} ; - - - - - -#endif // WSSCOMPACT_H_INCLUDED - - - - diff --git a/src/WorldStorage/WorldStorage.cpp b/src/WorldStorage/WorldStorage.cpp index 707e8f929..c611bfd90 100644 --- a/src/WorldStorage/WorldStorage.cpp +++ b/src/WorldStorage/WorldStorage.cpp @@ -7,7 +7,6 @@ #include "Globals.h" #include "WorldStorage.h" -#include "WSSCompact.h" #include "WSSAnvil.h" #include "../World.h" #include "../Generating/ChunkGenerator.h" @@ -141,9 +140,11 @@ size_t cWorldStorage::GetSaveQueueLength(void) -void cWorldStorage::QueueLoadChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ, bool a_Generate) +void cWorldStorage::QueueLoadChunk(int a_ChunkX, int a_ChunkZ) { - m_LoadQueue.EnqueueItem(sChunkLoad(a_ChunkX, a_ChunkY, a_ChunkZ, a_Generate)); + ASSERT(m_World->IsChunkQueued(a_ChunkX, a_ChunkZ)); + + m_LoadQueue.EnqueueItem(cChunkCoords(a_ChunkX, a_ChunkZ)); m_Event.Set(); } @@ -151,9 +152,11 @@ void cWorldStorage::QueueLoadChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ, boo -void cWorldStorage::QueueSaveChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +void cWorldStorage::QueueSaveChunk(int a_ChunkX, int a_ChunkZ) { - m_SaveQueue.EnqueueItemIfNotPresent(cChunkCoords(a_ChunkX, a_ChunkY, a_ChunkZ)); + ASSERT(m_World->IsChunkValid(a_ChunkX, a_ChunkZ)); + + m_SaveQueue.EnqueueItemIfNotPresent(cChunkCoords(a_ChunkX, a_ChunkZ)); m_Event.Set(); } @@ -161,9 +164,9 @@ void cWorldStorage::QueueSaveChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) -void cWorldStorage::UnqueueLoad(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +void cWorldStorage::UnqueueLoad(int a_ChunkX, int a_ChunkZ) { - m_LoadQueue.Remove(sChunkLoad(a_ChunkX, a_ChunkY, a_ChunkZ, true)); + m_LoadQueue.Remove(cChunkCoords(a_ChunkX, a_ChunkZ)); } @@ -183,7 +186,6 @@ void cWorldStorage::InitSchemas(int a_StorageCompressionFactor) { // The first schema added is considered the default m_Schemas.push_back(new cWSSAnvil (m_World, a_StorageCompressionFactor)); - m_Schemas.push_back(new cWSSCompact (m_World, a_StorageCompressionFactor)); m_Schemas.push_back(new cWSSForgetful(m_World)); // Add new schemas here @@ -242,22 +244,14 @@ void cWorldStorage::Execute(void) bool cWorldStorage::LoadOneChunk(void) { - sChunkLoad ToLoad(0, 0, 0, false); + cChunkCoords ToLoad(0, 0); bool ShouldLoad = m_LoadQueue.TryDequeueItem(ToLoad); - if (ShouldLoad && !LoadChunk(ToLoad.m_ChunkX, ToLoad.m_ChunkY, ToLoad.m_ChunkZ)) + + if (ShouldLoad) { - if (ToLoad.m_Generate) - { - // The chunk couldn't be loaded, generate it: - m_World->GetGenerator().QueueGenerateChunk(ToLoad.m_ChunkX, ToLoad.m_ChunkY, ToLoad.m_ChunkZ); - } - else - { - // TODO: Notify the world that the load has failed: - // m_World->ChunkLoadFailed(ToLoad.m_ChunkX, ToLoad.m_ChunkY, ToLoad.m_ChunkZ); - } + return LoadChunk(ToLoad.m_ChunkX, ToLoad.m_ChunkZ); } - return ShouldLoad; + return false; } @@ -266,7 +260,7 @@ bool cWorldStorage::LoadOneChunk(void) bool cWorldStorage::SaveOneChunk(void) { - cChunkCoords ToSave(0, 0, 0); + cChunkCoords ToSave(0, 0); bool ShouldSave = m_SaveQueue.TryDequeueItem(ToSave); if (ShouldSave && m_World->IsChunkValid(ToSave.m_ChunkX, ToSave.m_ChunkZ)) { @@ -283,15 +277,11 @@ bool cWorldStorage::SaveOneChunk(void) -bool cWorldStorage::LoadChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) +bool cWorldStorage::LoadChunk(int a_ChunkX, int a_ChunkZ) { - if (m_World->IsChunkValid(a_ChunkX, a_ChunkZ)) - { - // Already loaded (can happen, since the queue is async) - return true; - } + ASSERT(m_World->IsChunkQueued(a_ChunkX, a_ChunkZ)); - cChunkCoords Coords(a_ChunkX, a_ChunkY, a_ChunkZ); + cChunkCoords Coords(a_ChunkX, a_ChunkZ); // First try the schema that is used for saving if (m_SaveSchema->LoadChunk(Coords)) @@ -309,7 +299,7 @@ bool cWorldStorage::LoadChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ) } // Notify the chunk owner that the chunk failed to load (sets cChunk::m_HasLoadFailed to true): - m_World->ChunkLoadFailed(a_ChunkX, a_ChunkY, a_ChunkZ); + m_World->ChunkLoadFailed(a_ChunkX, a_ChunkZ); return false; } diff --git a/src/WorldStorage/WorldStorage.h b/src/WorldStorage/WorldStorage.h index 978a5b5d1..fc7e9f84c 100644 --- a/src/WorldStorage/WorldStorage.h +++ b/src/WorldStorage/WorldStorage.h @@ -64,13 +64,10 @@ public: cWorldStorage(void); ~cWorldStorage(); - void QueueLoadChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ, bool a_Generate); // Queues the chunk for loading; if not loaded, the chunk will be generated if a_Generate is true - void QueueSaveChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ); + void QueueLoadChunk(int a_ChunkX, int a_ChunkZ); + void QueueSaveChunk(int a_ChunkX, int a_ChunkZ); - /// Loads the chunk specified; returns true on success, false on failure - bool LoadChunk(int a_ChunkX, int a_ChunkY, int a_ChunkZ); - - void UnqueueLoad(int a_ChunkX, int a_ChunkY, int a_ChunkZ); + void UnqueueLoad(int a_ChunkX, int a_ChunkZ); void UnqueueSave(const cChunkCoords & a_Chunk); bool Start(cWorld * a_World, const AString & a_StorageSchemaName, int a_StorageCompressionFactor); // Hide the cIsThread's Start() method, we need to provide args @@ -84,38 +81,10 @@ public: protected: - struct sChunkLoad - { - int m_ChunkX; - int m_ChunkY; - int m_ChunkZ; - bool m_Generate; // If true, the chunk will be generated if it cannot be loaded - - sChunkLoad(int a_ChunkX, int a_ChunkY, int a_ChunkZ, bool a_Generate) : m_ChunkX(a_ChunkX), m_ChunkY(a_ChunkY), m_ChunkZ(a_ChunkZ), m_Generate(a_Generate) {} - - bool operator==(const sChunkLoad other) const - { - return this->m_ChunkX == other.m_ChunkX && - this->m_ChunkY == other.m_ChunkY && - this->m_ChunkZ == other.m_ChunkZ; - } - } ; - - struct FuncTable - { - static void Delete(sChunkLoad) {} - static void Combine(sChunkLoad & a_orig, const sChunkLoad a_new) - { - a_orig.m_Generate |= a_new.m_Generate; - } - }; - - typedef cQueue<sChunkLoad, FuncTable> sChunkLoadQueue; - cWorld * m_World; AString m_StorageSchemaName; - sChunkLoadQueue m_LoadQueue; + cChunkCoordsQueue m_LoadQueue; cChunkCoordsQueue m_SaveQueue; /// All the storage schemas (all used for loading) @@ -123,7 +92,11 @@ protected: /// The one storage schema used for saving cWSSchema * m_SaveSchema; + + /// Loads the chunk specified; returns true on success, false on failure + bool LoadChunk(int a_ChunkX, int a_ChunkZ); + void InitSchemas(int a_StorageCompressionFactor); virtual void Execute(void) override; diff --git a/src/main.cpp b/src/main.cpp index 106233342..86ecd4000 100644 --- a/src/main.cpp +++ b/src/main.cpp @@ -273,6 +273,8 @@ int main( int argc, char **argv) } } // for i - argv[] + cLogger::InitiateMultithreading(); + #if !defined(ANDROID_NDK) try #endif diff --git a/tests/CMakeLists.txt b/tests/CMakeLists.txt index 1fbd88f04..7e21ff94f 100644 --- a/tests/CMakeLists.txt +++ b/tests/CMakeLists.txt @@ -5,3 +5,4 @@ enable_testing() include_directories(${CMAKE_CURRENT_SOURCE_DIR}) add_subdirectory(ChunkData) +add_subdirectory(Redstone) diff --git a/tests/ChunkData/CopyBlocks.cpp b/tests/ChunkData/CopyBlocks.cpp index ec9451099..99f416e94 100644 --- a/tests/ChunkData/CopyBlocks.cpp +++ b/tests/ChunkData/CopyBlocks.cpp @@ -45,7 +45,7 @@ int main(int argc, char ** argv) BLOCKTYPE * WritePosition = &TestBuffer[WritePosIdx]; memset(TestBuffer, 0x03, sizeof(TestBuffer)); size_t LastReportedStep = 1; - for (size_t idx = 0; idx < 5000; idx += 7) + for (size_t idx = 0; idx < 5000; idx += 73) { if (idx / 500 != LastReportedStep) { @@ -53,7 +53,7 @@ int main(int argc, char ** argv) LastReportedStep = idx / 500; } - for (size_t len = 3; len < 1000; len += 13) + for (size_t len = 3; len < 700; len += 13) { Data.CopyBlockTypes(WritePosition, idx, len); diff --git a/tests/Redstone/CMakeLists.txt b/tests/Redstone/CMakeLists.txt new file mode 100644 index 000000000..ee4a7a64f --- /dev/null +++ b/tests/Redstone/CMakeLists.txt @@ -0,0 +1,10 @@ +cmake_minimum_required (VERSION 2.6) + +enable_testing() + +include_directories(${CMAKE_SOURCE_DIR}/src/) + +add_definitions(-DTEST_GLOBALS=1) + +add_executable(Redstone-creatable-exe creatable.cpp ../../src/BoundingBox.cpp) +add_test(NAME creatable-test COMMAND Redstone-creatable-exe) diff --git a/tests/Redstone/creatable.cpp b/tests/Redstone/creatable.cpp new file mode 100644 index 000000000..02c622788 --- /dev/null +++ b/tests/Redstone/creatable.cpp @@ -0,0 +1,164 @@ + +#include "Globals.h" + +class MockChest; +typedef cItemCallback<MockChest> cChestCallback; + +AString ItemToFullString(const cItem & a_Item) +{ +return ""; +} + +class cEntity +{ +public: + const Vector3d & GetPosition (void) const { return m_pos;} + double GetWidth (void) const { return 0; } + double GetHeight (void) const { return 0; } + static const Vector3d m_pos; +}; + +const Vector3d cEntity::m_pos = Vector3d(0,0,0); + +class cItem +{ +public: + cItem(BLOCKTYPE val) {} +}; + +void cBlockInfo::Initialize(cBlockInfoArray & a_Info) {} +cBlockInfo::~cBlockInfo () {} + +#include "Blocks/ChunkInterface.h" + +bool cChunkInterface::ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) +{ + return false; +} + +bool cChunkInterface::WriteBlockArea(cBlockArea & a_Area, int a_MinBlockX, int a_MinBlockY, int a_MinBlockZ, int a_DataTypes) +{ + return false; +} + +#include "Simulator/Simulator.inc" + +#include "Simulator/IncrementalRedstoneSimulator.inc" + +class MockWorld; + + +class MockHandler +{ +public: + static eBlockFace MetadataToDirection(NIBBLETYPE a_MetaData) { return BLOCK_FACE_NONE; } + static eBlockFace MetaDataToDirection(NIBBLETYPE a_MetaData) { return BLOCK_FACE_NONE; } + static eBlockFace BlockMetaDataToBlockFace(NIBBLETYPE a_MetaData) { return BLOCK_FACE_NONE; } + static NIBBLETYPE IsOpen(cChunkInterface & a_ChunkInterface, int a_BlockX, int a_BlockY, int a_BlockZ) { return 0; } + static void ExtendPiston(int a_BlockX, int a_BlockY, int a_BlockZ, MockWorld * a_World) {} + static void RetractPiston(int a_BlockX, int a_BlockY, int a_BlockZ, MockWorld * a_World) {} + static void SetOpen(cChunkInterface & a_ChunkInterface, int a_BlockX, int a_BlockY, int a_BlockZ, bool a_Open) {} + +}; + +template<unsigned char val> +class MockHandlerFetcher +{ +public: + typedef MockHandler type; +}; + +class MockWorld +{ +public: + bool IsChunkLighted(int a_ChunkX, int a_ChunkZ) { return false; } + bool ForEachEntityInChunk(int a_ChunkX, int a_ChunkZ, cEntityCallback & a_Callback) { return false; } + + void QueueLightChunk(int a_ChunkX, int a_ChunkZ, cChunkCoordCallback * a_Callback = NULL) {} + + + NIBBLETYPE GetBlockSkyLight (int a_BlockX, int a_BlockY, int a_BlockZ) { return 0; } + + cPlayer * FindClosestPlayer(const Vector3d & a_Pos, float a_SightLimit, bool a_CheckLineOfSight = true) { return NULL; } + + + void WakeUpSimulators(int a_BlockX, int a_BlockY, int a_BlockZ) {} + + void SpawnPrimedTNT(double a_X, double a_Y, double a_Z, int a_FuseTimeInSec = 80, double a_InitialVelocityCoeff = 1) {} + + + bool SetTrapdoorOpen(int a_BlockX, int a_BlockY, int a_BlockZ, bool a_Open) {return false; } + + + cChunkMap * GetChunkMap (void) { return NULL; } + +}; + + +class MockChunk +{ +public: + cRedstoneSimulatorChunkData * GetRedstoneSimulatorData() { return NULL; } + void SetRedstoneSimulatorData(cRedstoneSimulatorChunkData * a_Data) {} + bool IsRedstoneDirty() { return true; } + void SetIsRedstoneDirty(bool a_Param) {} + + void GetBlockTypeMeta(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) {} + + void SetBlock(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, bool a_SendToClients = true) {} + void SetBlock( const Vector3i & a_RelBlockPos, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) {} + + int GetPosX(void) const { return 0; } + int GetPosZ(void) const { return 0; } + + MockChunk * GetRelNeighborChunkAdjustCoords(int & a_RelX, int & a_RelZ) const { return NULL; } + + + BLOCKTYPE GetBlock(int a_RelX, int a_RelY, int a_RelZ) const { return 0; } + BLOCKTYPE GetBlock(const Vector3i & a_RelCoords) const { return 0; } + + NIBBLETYPE GetMeta(int a_RelX, int a_RelY, int a_RelZ) const { return 0; } + void SetMeta(int a_RelX, int a_RelY, int a_RelZ, NIBBLETYPE a_Meta) {} + + + bool UnboundedRelGetBlock(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta) const { return false; } + + bool UnboundedRelGetBlockType(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE & a_BlockType) const { return false; } + + MockChunk * GetNeighborChunk(int a_BlockX, int a_BlockZ) { return NULL; } + + MockChunk * GetRelNeighborChunk(int a_RelX, int a_RelZ) { return NULL; } + + bool IsValid(void) const { return false; } + + NIBBLETYPE GetTimeAlteredLight(NIBBLETYPE a_Skylight) const { return 0; } + + void BroadcastSoundParticleEffect(int a_EffectID, int a_SrcX, int a_SrcY, int a_SrcZ, int a_Data, const cClientHandle * a_Exclude = NULL) {} + void BroadcastSoundEffect (const AString & a_SoundName, double a_X, double a_Y, double a_Z, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL) {} + + bool DoWithRedstonePoweredEntityAt(int a_BlockX, int a_BlockY, int a_BlockZ, cRedstonePoweredCallback & a_Callback) { return false; } + + template <class T> + bool DoWithChestAt(int a_BlockX, int a_BlockY, int a_BlockZ, T & a_Callback) + { + return false; + } + +}; +class MockChest +{ +public: + BLOCKTYPE GetBlockType(void) const { return 0; } + int GetNumberOfPlayers(void) const { return 0; } +}; + +int main(int argc, char** argv) +{ + + + + MockWorld World; + + cIncrementalRedstoneSimulator<MockChunk, MockWorld, MockHandlerFetcher, MockChest> Simulator(World); + return 0; +} |