diff options
73 files changed, 2271 insertions, 967 deletions
@@ -665,9 +665,7 @@ WARN_LOGFILE = # directories like "/usr/src/myproject". Separate the files or directories # with spaces. -INPUT = source \ - iniFile \ - WebServer +INPUT = src # This tag can be used to specify the character encoding of the source files # that doxygen parses. Internally doxygen uses the UTF-8 encoding, which is diff --git a/MCServer/Plugins/.gitignore b/MCServer/Plugins/.gitignore index 89eab800a..8553945b5 100644 --- a/MCServer/Plugins/.gitignore +++ b/MCServer/Plugins/.gitignore @@ -1,2 +1,3 @@ *.txt *.md +*/ diff --git a/MCServer/Plugins/APIDump/APIDesc.lua b/MCServer/Plugins/APIDump/APIDesc.lua index 241aa05ad..94cdd0063 100644 --- a/MCServer/Plugins/APIDump/APIDesc.lua +++ b/MCServer/Plugins/APIDump/APIDesc.lua @@ -290,6 +290,38 @@ g_APIDesc = }, -- AdditionalInfo }, -- cBlockArea + cBlockInfo = + { + Desc = [[ + This class is used to query and register block properties. + ]], + Functions = + { + FullyOccupiesVoxel = { Params = "Type", Return = "bool", Notes = "(STATIC) Returns whether the specified block fully occupies its voxel." }, + Get = { Params = "Type", Return = "{{cBlockInfo}}", Notes = "(STATIC) Returns the {{cBlockInfo}} structure for the specified type." }, + GetLightValue = { Params = "Type", Return = "number", Notes = "(STATIC) Returns how much light the specified block emits on its own." }, + GetSpreadLightFalloff = { Params = "Type", Return = "number", Notes = "(STATIC) Returns how much light the specified block consumes." }, + IsOneHitDig = { Params = "Type", Return = "bool", Notes = "(STATIC) Returns whether the specified block will be destroyed after a single hit." }, + IsPistonBreakable = { Params = "Type", Return = "bool", Notes = "(STATIC) Returns whether a piston can break the specified block." }, + IsSnowable = { Params = "Type", Return = "bool", Notes = "(STATIC) Returns whether the specified block can hold snow atop." }, + IsSolid = { Params = "Type", Return = "bool", Notes = "(STATIC) Returns whether the specified block is solid." }, + IsTransparent = { Params = "Type", Return = "bool", Notes = "(STATIC) Returns whether the specified block is transparent." }, + RequiresSpecialTool = { Params = "Type", Return = "bool", Notes = "(STATIC) Returns whether the specified block requires a special tool to drop." }, + }, + Variables = + { + m_FullyOccupiesVoxel = { Type = "bool", Notes = "Does this block fully occupy its voxel - is it a 'full' block?" }, + m_IsSnowable = { Type = "bool", Notes = "Can this block hold snow atop?" }, + m_IsSolid = { Type = "bool", Notes = "Is this block solid (player cannot walk through)?" }, + m_LightValue = { Type = "number", Notes = "How much light do the blocks emit on their own?" }, + m_OneHitDig = { Type = "bool", Notes = "Is a block destroyed after a single hit?" }, + m_PistonBreakable = { Type = "bool", Notes = "Can a piston break this block?" }, + m_RequiresSpecialTool = { Type = "bool", Notes = "Does this block require a tool to drop?" }, + m_SpreadLightFalloff = { Type = "number", Notes = "How much light do the blocks consume?" }, + m_Transparent = { Type = "bool", Notes = "Is a block completely transparent? (light doesn't get decreased(?))" }, + }, + }, -- cBlockInfo + cChatColor = { Desc = [[ @@ -451,6 +483,58 @@ end }, }, -- cClientHandle + cCompositeChat = + { + Desc = [[ + Encapsulates a chat message that can contain various formatting, URLs, commands executed on click + and commands suggested on click. The chat message can be sent by the regular chat-sending functions, + {{cPlayer}}:SendMessage(), {{cWorld}}:BroadcastChat() and {{cRoot}}:BroadcastChat().</p> + <p> + Note that most of the functions in this class are so-called modifiers - they modify the object and + then return the object itself, so that they can be chained one after another. + ]], + Functions = + { + constructor = + { + { Params = "", Return = "", Notes = "Creates an empty chat message" }, + { Params = "Text", Return = "", Notes = "Creates a chat message containing the specified text, parsed by the ParseText() function. This allows easy migration from old chat messages." }, + }, + AddRunCommandPart = { Params = "Text, Command, [Style]", Return = "self", Notes = "Adds a text which, when clicked, runs the specified command. Chaining." }, + AddSuggestCommandPart = { Params = "Text, Command, [Style]", Return = "self", Notes = "Adds a text which, when clicked, puts the specified command into the player's chat input area. Chaining." }, + AddTextPart = { Params = "Text, [Style]", Return = "self", Notes = "Adds a regular text. Chaining." }, + AddUrlPart = { Params = "Text, Url, [Style]", Return = "self", Notes = "Adds a text which, when clicked, opens up a browser at the specified URL. Chaining." }, + Clear = { Params = "", Return = "", Notes = "Removes all parts from this object" }, + GetMessageType = { Params = "", Return = "MessageType", Notes = "Returns the MessageType (mtXXX constant) that is associated with this message. When sent to a player, the message will be formatted according to this message type and the player's settings (adding \"[INFO]\" prefix etc.)" }, + ParseText = { Params = "Text", Return = "self", Notes = "Adds text, while recognizing http and https URLs and old-style formatting codes (\"@2\"). Chaining." }, + SetMessageType = { Params = "MessageType", Return = "self", Notes = "Sets the MessageType (mtXXX constant) that is associated with this message. When sent to a player, the message will be formatted according to this message type and the player's settings (adding \"[INFO]\" prefix etc.) Chaining." }, + UnderlineUrls = { Params = "", Return = "self", Notes = "Makes all URL parts contained in the message underlined. Doesn't affect parts added in the future. Chaining." }, + }, + + AdditionalInfo = + { + { + Header = "Chaining example", + Contents = [[ + Sending a chat message that is composed of multiple different parts has been made easy thanks to + chaining. Consider the following example that shows how a message containing all kinds of parts + is sent (adapted from the Debuggers plugin): +<pre class="prettyprint lang-lua"> +function OnPlayerJoined(a_Player) + -- Send an example composite chat message to the player: + a_Player:SendMessage(cCompositeChat() + :AddTextPart("Hello, ") + :AddUrlPart(a_Player:GetName(), "www.mc-server.org", "u@2") -- Colored underlined link + :AddSuggestCommandPart(", and welcome.", "/help", "u") -- Underlined suggest-command + :AddRunCommandPart(" SetDay", "/time set 0") -- Regular text that will execute command when clicked + :SetMessageType(mtJoin) -- It is a join-message + ) +end</pre> + ]], + }, + }, -- AdditionalInfo + }, -- cCompositeChat + cCraftingGrid = { Desc = [[ @@ -1115,6 +1199,42 @@ local Item5 = cItem(E_ITEM_DIAMOND_CHESTPLATE, 1, 0, "thorns=1;unbreaking=3"); }, }, -- cItem + cObjective = + { + Desc = [[ + This class represents a single scoreboard objective. + ]], + Functions = + { + AddScore = { Params = "string, number", Return = "Score", Notes = "Adds a value to the score of the specified player and returns the new value." }, + GetDisplayName = { Params = "", Return = "string", Notes = "Returns the display name of the objective. This name will be shown to the connected players." }, + GetName = { Params = "", Return = "string", Notes = "Returns the internal name of the objective." }, + GetScore = { Params = "string", Return = "Score", Notes = "Returns the score of the specified player." }, + GetType = { Params = "", Return = "eType", Notes = "Returns the type of the objective. (i.e what is being tracked)" }, + Reset = { Params = "", Return = "", Notes = "Resets the scores of the tracked players." }, + ResetScore = { Params = "string", Return = "", Notes = "Reset the score of the specified player." }, + SetDisplayName = { Params = "string", Return = "", Notes = "Sets the display name of the objective." }, + SetScore = { Params = "string, Score", Return = "", Notes = "Sets the score of the specified player." }, + SubScore = { Params = "string, number", Return = "Score", Notes = "Subtracts a value from the score of the specified player and returns the new value." }, + }, + Constants = + { + otAchievement = { Notes = "" }, + otDeathCount = { Notes = "" }, + otDummy = { Notes = "" }, + otHealth = { Notes = "" }, + otPlayerKillCount = { Notes = "" }, + otStat = { Notes = "" }, + otStatBlockMine = { Notes = "" }, + otStatEntityKill = { Notes = "" }, + otStatEntityKilledBy = { Notes = "" }, + otStatItemBreak = { Notes = "" }, + otStatItemCraft = { Notes = "" }, + otStatItemUse = { Notes = "" }, + otTotalKillCount = { Notes = "" }, + }, + }, -- cObjective + cPainting = { Desc = "This class represents a painting in the world. These paintings are special and different from Vanilla in that they can be critical-hit.", @@ -1822,6 +1942,36 @@ end }, }, -- cRoot + cScoreboard = + { + Desc = [[ + This class manages the objectives and teams of a single world. + ]], + Functions = + { + AddPlayerScore = { Params = "Name, Type, Value", Return = "", Notes = "Adds a value to all player scores of the specified objective type." }, + ForEachObjective = { Params = "CallBackFunction, [CallbackData]", Return = "bool", Notes = "Calls the specified callback for each objective in the scoreboard. Returns true if all objectives have been processed (including when there are zero objectives), or false if the callback function has aborted the enumeration by returning true. The callback function has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cObjective|Objective}}, [CallbackData])</pre> The callback should return false or no value to continue with the next objective, or true to abort the enumeration." }, + ForEachTeam = { Params = "CallBackFunction, [CallbackData]", Return = "bool", Notes = "Calls the specified callback for each team in the scoreboard. Returns true if all teams have been processed (including when there are zero teams), or false if the callback function has aborted the enumeration by returning true. The callback function has the following signature: <pre class=\"prettyprint lang-lua\">function Callback({{cObjective|Objective}}, [CallbackData])</pre> The callback should return false or no value to continue with the next team, or true to abort the enumeration." }, + GetNumObjectives = { Params = "", Return = "number", Notes = "Returns the nuber of registered objectives." }, + GetNumTeams = { Params = "", Return = "number", Notes = "Returns the number of registered teams." }, + GetObjective = { Params = "string", Return = "{{cObjective}}", Notes = "Returns the objective with the specified name." }, + GetObjectiveIn = { Params = "DisplaySlot", Return = "{{cObjective}}", Notes = "Returns the objective in the specified display slot. Can be nil." }, + GetTeam = { Params = "string", Return = "{{cTeam}}", Notes = "Returns the team with the specified name." }, + RegisterObjective = { Params = "Name, DisplayName, Type", Return = "{{cObjective}}", Notes = "Registers a new scoreboard objective. Returns the {{cObjective}} instance, nil on error." }, + RegisterTeam = { Params = "Name, DisplayName, Prefix, Suffix", Return = "{{cTeam}}", Notes = "Registers a new team. Returns the {{cTeam}} instance, nil on error." }, + RemoveObjective = { Params = "string", Return = "bool", Notes = "Removes the objective with the specified name. Returns true if operation was successful." }, + RemoveTeam = { Params = "string", Return = "bool", Notes = "Removes the team with the specified name. Returns true if operation was successful." }, + SetDisplay = { Params = "Name, DisplaySlot", Return = "", Notes = "Updates the currently displayed objective." }, + }, + Constants = + { + dsCount = { Notes = "" }, + dsList = { Notes = "" }, + dsName = { Notes = "" }, + dsSidebar = { Notes = "" }, + }, + }, -- cScoreboard + cServer = { Desc = [[ @@ -1842,6 +1992,32 @@ end }, }, -- cServer + cTeam = + { + Desc = [[ + This class manages a single player team. + ]], + Functions = + { + AddPlayer = { Params = "string", Returns = "bool", Notes = "Adds a player to this team. Returns true if the operation was successful." }, + AllowsFriendlyFire = { Params = "", Return = "bool", Notes = "Returns whether team friendly fire is allowed." }, + CanSeeFriendlyInvisible = { Params = "", Return = "bool", Notes = "Returns whether players can see invisible teammates." }, + HasPlayer = { Params = "string", Returns = "bool", Notes = "Returns whether the specified player is a member of this team." }, + GetDisplayName = { Params = "", Return = "string", Notes = "Returns the display name of the team." }, + GetName = { Params = "", Return = "string", Notes = "Returns the internal name of the team." }, + GetNumPlayers = { Params = "", Return = "number", Notes = "Returns the number of registered players." }, + GetPrefix = { Params = "", Return = "string", Notes = "Returns the prefix prepended to the names of the members of this team." }, + RemovePlayer = { Params = "string", Returns = "bool", Notes = "Removes the player with the specified name from this team. Returns true if the operation was successful." }, + Reset = { Params = "", Returns = "", Notes = "Removes all players from this team." }, + GetSuffix = { Params = "", Return = "string", Notes = "Returns the suffix appended to the names of the members of this team." }, + SetCanSeeFriendlyInvisible = { Params = "bool", Return = "", Notes = "Set whether players can see invisible teammates." }, + SetDisplayName = { Params = "string", Return = "", Notes = "Sets the display name of this team. (i.e. what will be shown to the players)" }, + SetFriendlyFire = { Params = "bool", Return = "", Notes = "Sets whether team friendly fire is allowed." }, + SetPrefix = { Params = "string", Return = "", Notes = "Sets the prefix prepended to the names of the members of this team." }, + SetSuffix = { Params = "string", Return = "", Notes = "Sets the suffix appended to the names of the members of this team." }, + }, + }, -- cTeam + cTNTEntity = { Desc = "This class manages a TNT entity.", @@ -2577,16 +2753,16 @@ end IgnoreClasses = { - "coroutine", - "debug", - "io", - "math", - "package", - "os", - "string", - "table", - "g_Stats", - "g_TrackedPages", + "^coroutine$", + "^debug$", + "^io$", + "^math$", + "^package$", + "^os$", + "^string$", + "^table$", + "^g_Stats$", + "^g_TrackedPages$", }, IgnoreFunctions = diff --git a/MCServer/Plugins/Debuggers/Debuggers.lua b/MCServer/Plugins/Debuggers/Debuggers.lua index 66894d835..329a652cd 100644 --- a/MCServer/Plugins/Debuggers/Debuggers.lua +++ b/MCServer/Plugins/Debuggers/Debuggers.lua @@ -30,6 +30,7 @@ function Initialize(Plugin) PM:AddHook(cPluginManager.HOOK_CHUNK_GENERATED, OnChunkGenerated); PM:AddHook(cPluginManager.HOOK_PLUGINS_LOADED, OnPluginsLoaded); PM:AddHook(cPluginManager.HOOK_PLUGIN_MESSAGE, OnPluginMessage); + PM:AddHook(cPluginManager.HOOK_PLAYER_JOINED, OnPlayerJoined) PM:BindCommand("/le", "debuggers", HandleListEntitiesCmd, "- Shows a list of all the loaded entities"); PM:BindCommand("/ke", "debuggers", HandleKillEntitiesCmd, "- Kills all the loaded entities"); @@ -1258,3 +1259,17 @@ end + +function OnPlayerJoined(a_Player) + -- Test composite chat chaining: + a_Player:SendMessage(cCompositeChat() + :AddTextPart("Hello, ") + :AddUrlPart(a_Player:GetName(), "www.mc-server.org", "u@2") + :AddSuggestCommandPart(", and welcome.", "/help", "u") + :AddRunCommandPart(" SetDay", "/time set 0") + ) +end + + + + diff --git a/src/Bindings/AllToLua.pkg b/src/Bindings/AllToLua.pkg index 6537437cd..6b067b1e5 100644 --- a/src/Bindings/AllToLua.pkg +++ b/src/Bindings/AllToLua.pkg @@ -26,6 +26,7 @@ $cfile "WebPlugin.h" $cfile "LuaWindow.h" $cfile "../BlockID.h" +$cfile "../BlockInfo.h" $cfile "../StringUtils.h" $cfile "../Defines.h" $cfile "../ChatColor.h" @@ -75,6 +76,7 @@ $cfile "../Mobs/Monster.h" $cfile "../CompositeChat.h" $cfile "../Map.h" $cfile "../MapManager.h" +$cfile "../Scoreboard.h" diff --git a/src/Bindings/DeprecatedBindings.cpp b/src/Bindings/DeprecatedBindings.cpp new file mode 100644 index 000000000..408b1b84a --- /dev/null +++ b/src/Bindings/DeprecatedBindings.cpp @@ -0,0 +1,506 @@ + +#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules + +#include "DeprecatedBindings.h" +#include "tolua++/include/tolua++.h" + +#include "Plugin.h" +#include "PluginLua.h" +#include "PluginManager.h" +#include "LuaWindow.h" +#include "LuaChunkStay.h" + +#include "../BlockInfo.h" + + + + + +/* get function: g_BlockLightValue */ +#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockLightValue +static int tolua_get_AllToLua_g_BlockLightValue(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetLightValue(tolua_index)); + return 1; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* set function: g_BlockLightValue */ +#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockLightValue +static int tolua_set_AllToLua_g_BlockLightValue(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + cBlockInfo::Get(tolua_index).m_LightValue = ((unsigned char) tolua_tonumber(tolua_S,3,0)); + return 0; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* get function: g_BlockSpreadLightFalloff */ +#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockSpreadLightFalloff +static int tolua_get_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetSpreadLightFalloff(tolua_index)); + return 1; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* set function: g_BlockSpreadLightFalloff */ +#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockSpreadLightFalloff +static int tolua_set_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + cBlockInfo::Get(tolua_index).m_SpreadLightFalloff = ((unsigned char) tolua_tonumber(tolua_S,3,0)); + return 0; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* get function: g_BlockTransparent */ +#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockTransparent +static int tolua_get_AllToLua_g_BlockTransparent(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + tolua_pushboolean(tolua_S, cBlockInfo::IsTransparent(tolua_index)); + return 1; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* set function: g_BlockTransparent */ +#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockTransparent +static int tolua_set_AllToLua_g_BlockTransparent(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + cBlockInfo::Get(tolua_index).m_Transparent = (tolua_toboolean(tolua_S,3,0) != 0); + return 0; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* get function: g_BlockOneHitDig */ +#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockOneHitDig +static int tolua_get_AllToLua_g_BlockOneHitDig(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsOneHitDig(tolua_index)); + return 1; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* set function: g_BlockOneHitDig */ +#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockOneHitDig +static int tolua_set_AllToLua_g_BlockOneHitDig(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + cBlockInfo::Get(tolua_index).m_OneHitDig = (tolua_toboolean(tolua_S,3,0) != 0); + return 0; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* get function: g_BlockPistonBreakable */ +#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockPistonBreakable +static int tolua_get_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0 || tolua_index>=256) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsPistonBreakable(tolua_index)); + return 1; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* set function: g_BlockPistonBreakable */ +#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockPistonBreakable +static int tolua_set_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0 || tolua_index>=256) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + cBlockInfo::Get(tolua_index).m_PistonBreakable = (tolua_toboolean(tolua_S,3,0) != 0); + return 0; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* get function: g_BlockIsSnowable */ +#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockIsSnowable +static int tolua_get_AllToLua_g_BlockIsSnowable(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0 || tolua_index>=256) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsSnowable(tolua_index)); + return 1; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* set function: g_BlockIsSnowable */ +#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockIsSnowable +static int tolua_set_AllToLua_g_BlockIsSnowable(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0 || tolua_index>=256) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + cBlockInfo::Get(tolua_index).m_IsSnowable = (tolua_toboolean(tolua_S,3,0) != 0); + return 0; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* get function: g_BlockRequiresSpecialTool */ +#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockRequiresSpecialTool +static int tolua_get_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0 || tolua_index>=256) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + tolua_pushboolean(tolua_S,(bool)cBlockInfo::RequiresSpecialTool(tolua_index)); + return 1; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* set function: g_BlockRequiresSpecialTool */ +#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockRequiresSpecialTool +static int tolua_set_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0 || tolua_index>=256) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + cBlockInfo::Get(tolua_index).m_RequiresSpecialTool = (tolua_toboolean(tolua_S,3,0) != 0); + return 0; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* get function: g_BlockIsSolid */ +#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockIsSolid +static int tolua_get_AllToLua_g_BlockIsSolid(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0 || tolua_index>=256) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsSolid(tolua_index)); + return 1; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* set function: g_BlockIsSolid */ +#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockIsSolid +static int tolua_set_AllToLua_g_BlockIsSolid(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0 || tolua_index>=256) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + cBlockInfo::Get(tolua_index).m_IsSolid = (tolua_toboolean(tolua_S,3,0) != 0); + return 0; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* get function: g_BlockFullyOccupiesVoxel */ +#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockFullyOccupiesVoxel +static int tolua_get_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0 || tolua_index>=256) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + tolua_pushboolean(tolua_S,(bool)cBlockInfo::FullyOccupiesVoxel(tolua_index)); + return 1; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +/* set function: g_BlockFullyOccupiesVoxel */ +#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockFullyOccupiesVoxel +static int tolua_set_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S) +{ + int tolua_index; + #ifndef TOLUA_RELEASE + { + tolua_Error tolua_err; + if (!tolua_isnumber(tolua_S,2,0,&tolua_err)) + tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err); + } + #endif + tolua_index = (int)tolua_tonumber(tolua_S,2,0); + #ifndef TOLUA_RELEASE + if (tolua_index<0 || tolua_index>=256) + tolua_error(tolua_S,"array indexing out of range.",NULL); + #endif + cBlockInfo::Get(tolua_index).m_FullyOccupiesVoxel = (tolua_toboolean(tolua_S,3,0) != 0); + return 0; +} +#endif //#ifndef TOLUA_DISABLE + + + + + +void DeprecatedBindings::Bind(lua_State * tolua_S) +{ + tolua_beginmodule(tolua_S, NULL); + + tolua_array(tolua_S, "g_BlockLightValue", tolua_get_AllToLua_g_BlockLightValue, tolua_set_AllToLua_g_BlockLightValue); + tolua_array(tolua_S, "g_BlockSpreadLightFalloff", tolua_get_AllToLua_g_BlockSpreadLightFalloff, tolua_set_AllToLua_g_BlockSpreadLightFalloff); + tolua_array(tolua_S, "g_BlockTransparent", tolua_get_AllToLua_g_BlockTransparent, tolua_set_AllToLua_g_BlockTransparent); + tolua_array(tolua_S, "g_BlockOneHitDig", tolua_get_AllToLua_g_BlockOneHitDig, tolua_set_AllToLua_g_BlockOneHitDig); + tolua_array(tolua_S, "g_BlockPistonBreakable", tolua_get_AllToLua_g_BlockPistonBreakable, tolua_set_AllToLua_g_BlockPistonBreakable); + tolua_array(tolua_S, "g_BlockIsSnowable", tolua_get_AllToLua_g_BlockIsSnowable, tolua_set_AllToLua_g_BlockIsSnowable); + tolua_array(tolua_S, "g_BlockRequiresSpecialTool", tolua_get_AllToLua_g_BlockRequiresSpecialTool, tolua_set_AllToLua_g_BlockRequiresSpecialTool); + tolua_array(tolua_S, "g_BlockIsSolid", tolua_get_AllToLua_g_BlockIsSolid, tolua_set_AllToLua_g_BlockIsSolid); + tolua_array(tolua_S, "g_BlockFullyOccupiesVoxel", tolua_get_AllToLua_g_BlockFullyOccupiesVoxel, tolua_set_AllToLua_g_BlockFullyOccupiesVoxel); + + tolua_endmodule(tolua_S); +} + + + + diff --git a/src/Bindings/DeprecatedBindings.h b/src/Bindings/DeprecatedBindings.h new file mode 100644 index 000000000..5fc3cfa80 --- /dev/null +++ b/src/Bindings/DeprecatedBindings.h @@ -0,0 +1,8 @@ +#pragma once + +struct lua_State; +class DeprecatedBindings +{ +public: + static void Bind( lua_State* tolua_S ); +}; diff --git a/src/Bindings/LuaState.cpp b/src/Bindings/LuaState.cpp index 45a066efe..1890dcfe5 100644 --- a/src/Bindings/LuaState.cpp +++ b/src/Bindings/LuaState.cpp @@ -14,6 +14,7 @@ extern "C" #include "tolua++/include/tolua++.h" #include "Bindings.h" #include "ManualBindings.h" +#include "DeprecatedBindings.h" // fwd: SQLite/lsqlite3.c extern "C" @@ -95,6 +96,7 @@ void cLuaState::Create(void) luaL_openlibs(m_LuaState); tolua_AllToLua_open(m_LuaState); ManualBindings::Bind(m_LuaState); + DeprecatedBindings::Bind(m_LuaState); luaopen_lsqlite3(m_LuaState); luaopen_lxp(m_LuaState); m_IsOwned = true; @@ -714,7 +716,7 @@ void cLuaState::Push(cBlockEntity * a_BlockEntity) -void cLuaState::GetReturn(int a_StackPos, bool & a_ReturnedVal) +void cLuaState::GetStackValue(int a_StackPos, bool & a_ReturnedVal) { a_ReturnedVal = (tolua_toboolean(m_LuaState, a_StackPos, a_ReturnedVal ? 1 : 0) > 0); } @@ -723,11 +725,17 @@ void cLuaState::GetReturn(int a_StackPos, bool & a_ReturnedVal) -void cLuaState::GetReturn(int a_StackPos, AString & a_ReturnedVal) +void cLuaState::GetStackValue(int a_StackPos, AString & a_Value) { - if (lua_isstring(m_LuaState, a_StackPos)) + size_t len = 0; + const char * data = lua_tolstring(m_LuaState, a_StackPos, &len); + if (data != NULL) + { + a_Value.assign(data, len); + } + else { - a_ReturnedVal = tolua_tocppstring(m_LuaState, a_StackPos, a_ReturnedVal.c_str()); + a_Value.clear(); } } @@ -735,7 +743,7 @@ void cLuaState::GetReturn(int a_StackPos, AString & a_ReturnedVal) -void cLuaState::GetReturn(int a_StackPos, int & a_ReturnedVal) +void cLuaState::GetStackValue(int a_StackPos, int & a_ReturnedVal) { if (lua_isnumber(m_LuaState, a_StackPos)) { @@ -747,7 +755,7 @@ void cLuaState::GetReturn(int a_StackPos, int & a_ReturnedVal) -void cLuaState::GetReturn(int a_StackPos, double & a_ReturnedVal) +void cLuaState::GetStackValue(int a_StackPos, double & a_ReturnedVal) { if (lua_isnumber(m_LuaState, a_StackPos)) { diff --git a/src/Bindings/LuaState.h b/src/Bindings/LuaState.h index dcb660c3f..4a7a6fadb 100644 --- a/src/Bindings/LuaState.h +++ b/src/Bindings/LuaState.h @@ -197,6 +197,19 @@ public: void Push(void * a_Ptr); void Push(cHopperEntity * a_Hopper); void Push(cBlockEntity * a_BlockEntity); + + /** Retrieve value at a_StackPos, if it is a valid bool. If not, a_Value is unchanged */ + void GetStackValue(int a_StackPos, bool & a_Value); + + /** Retrieve value at a_StackPos, if it is a valid string. If not, a_Value is unchanged */ + void GetStackValue(int a_StackPos, AString & a_Value); + + /** Retrieve value at a_StackPos, if it is a valid number. If not, a_Value is unchanged */ + void GetStackValue(int a_StackPos, int & a_Value); + + /** Retrieve value at a_StackPos, if it is a valid number. If not, a_Value is unchanged */ + void GetStackValue(int a_StackPos, double & a_Value); + /** Call any 0-param 0-return Lua function in a single line: */ template <typename FnT> @@ -270,7 +283,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); return true; } @@ -292,7 +305,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); ASSERT(InitialTop == lua_gettop(m_LuaState)); return true; @@ -315,7 +328,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); return true; } @@ -338,7 +351,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); return true; } @@ -362,7 +375,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); return true; } @@ -387,7 +400,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); return true; } @@ -414,7 +427,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); return true; } @@ -442,7 +455,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); return true; } @@ -471,7 +484,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); return true; } @@ -501,7 +514,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); return true; } @@ -532,7 +545,7 @@ public: { return false; } - GetReturn(-1, a_Ret1); + GetStackValue(-1, a_Ret1); lua_pop(m_LuaState, 1); return true; } @@ -553,8 +566,8 @@ public: { return false; } - GetReturn(-2, a_Ret1); - GetReturn(-1, a_Ret2); + GetStackValue(-2, a_Ret1); + GetStackValue(-1, a_Ret2); lua_pop(m_LuaState, 2); return true; } @@ -576,8 +589,8 @@ public: { return false; } - GetReturn(-2, a_Ret1); - GetReturn(-1, a_Ret2); + GetStackValue(-2, a_Ret1); + GetStackValue(-1, a_Ret2); lua_pop(m_LuaState, 2); return true; } @@ -601,8 +614,8 @@ public: { return false; } - GetReturn(-2, a_Ret1); - GetReturn(-1, a_Ret2); + GetStackValue(-2, a_Ret1); + GetStackValue(-1, a_Ret2); lua_pop(m_LuaState, 2); return true; } @@ -627,8 +640,8 @@ public: { return false; } - GetReturn(-2, a_Ret1); - GetReturn(-1, a_Ret2); + GetStackValue(-2, a_Ret1); + GetStackValue(-1, a_Ret2); lua_pop(m_LuaState, 2); return true; } @@ -654,8 +667,8 @@ public: { return false; } - GetReturn(-2, a_Ret1); - GetReturn(-1, a_Ret2); + GetStackValue(-2, a_Ret1); + GetStackValue(-1, a_Ret2); lua_pop(m_LuaState, 2); return true; } @@ -683,8 +696,8 @@ public: { return false; } - GetReturn(-2, a_Ret1); - GetReturn(-1, a_Ret2); + GetStackValue(-2, a_Ret1); + GetStackValue(-1, a_Ret2); lua_pop(m_LuaState, 2); return true; } @@ -713,8 +726,8 @@ public: { return false; } - GetReturn(-2, a_Ret1); - GetReturn(-1, a_Ret2); + GetStackValue(-2, a_Ret1); + GetStackValue(-1, a_Ret2); lua_pop(m_LuaState, 2); return true; } @@ -743,9 +756,9 @@ public: { return false; } - GetReturn(-3, a_Ret1); - GetReturn(-2, a_Ret2); - GetReturn(-1, a_Ret3); + GetStackValue(-3, a_Ret1); + GetStackValue(-2, a_Ret2); + GetStackValue(-1, a_Ret3); lua_pop(m_LuaState, 3); return true; } @@ -775,9 +788,9 @@ public: { return false; } - GetReturn(-3, a_Ret1); - GetReturn(-2, a_Ret2); - GetReturn(-1, a_Ret3); + GetStackValue(-3, a_Ret1); + GetStackValue(-2, a_Ret2); + GetStackValue(-1, a_Ret3); lua_pop(m_LuaState, 3); return true; } @@ -808,11 +821,11 @@ public: { return false; } - GetReturn(-5, a_Ret1); - GetReturn(-4, a_Ret2); - GetReturn(-3, a_Ret3); - GetReturn(-2, a_Ret4); - GetReturn(-1, a_Ret5); + GetStackValue(-5, a_Ret1); + GetStackValue(-4, a_Ret2); + GetStackValue(-3, a_Ret3); + GetStackValue(-2, a_Ret4); + GetStackValue(-1, a_Ret5); lua_pop(m_LuaState, 5); return true; } @@ -918,18 +931,6 @@ protected: /** Pushes a usertype of the specified class type onto the stack */ void PushUserType(void * a_Object, const char * a_Type); - /** Retrieve value returned at a_StackPos, if it is a valid bool. If not, a_ReturnedVal is unchanged */ - void GetReturn(int a_StackPos, bool & a_ReturnedVal); - - /** Retrieve value returned at a_StackPos, if it is a valid string. If not, a_ReturnedVal is unchanged */ - void GetReturn(int a_StackPos, AString & a_ReturnedVal); - - /** Retrieve value returned at a_StackPos, if it is a valid number. If not, a_ReturnedVal is unchanged */ - void GetReturn(int a_StackPos, int & a_ReturnedVal); - - /** Retrieve value returned at a_StackPos, if it is a valid number. If not, a_ReturnedVal is unchanged */ - void GetReturn(int a_StackPos, double & a_ReturnedVal); - /** Calls the function that has been pushed onto the stack by PushFunction(), with arguments pushed by PushXXX(). diff --git a/src/Bindings/ManualBindings.cpp b/src/Bindings/ManualBindings.cpp index 461186d3b..9fbc2e842 100644 --- a/src/Bindings/ManualBindings.cpp +++ b/src/Bindings/ManualBindings.cpp @@ -26,6 +26,7 @@ #include "md5/md5.h" #include "../LineBlockTracer.h" #include "../WorldStorage/SchematicFileSerializer.h" +#include "../CompositeChat.h" @@ -2511,6 +2512,253 @@ static int tolua_cBlockArea_SaveToSchematicFile(lua_State * tolua_S) +static int tolua_cCompositeChat_AddRunCommandPart(lua_State * tolua_S) +{ + // function cCompositeChat:AddRunCommandPart(Message, Command, [Style]) + // Exported manually to support call-chaining (return *this) + + // Check params: + cLuaState L(tolua_S); + if ( + !L.CheckParamUserType(1, "cCompositeChat") || + !L.CheckParamString(2, 3) + ) + { + return 0; + } + cCompositeChat * self = (cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL); + if (self == NULL) + { + tolua_error(tolua_S, "invalid 'self' in function 'cCompositeChat:AddRunCommandPart'", NULL); + return 0; + } + + // Add the part: + AString Text, Command, Style; + L.GetStackValue(2, Text); + L.GetStackValue(3, Command); + L.GetStackValue(4, Style); + self->AddRunCommandPart(Text, Command, Style); + + // Cut away everything from the stack except for the cCompositeChat instance; return that: + lua_settop(L, 1); + return 1; +} + + + + + +static int tolua_cCompositeChat_AddSuggestCommandPart(lua_State * tolua_S) +{ + // function cCompositeChat:AddSuggestCommandPart(Message, Command, [Style]) + // Exported manually to support call-chaining (return *this) + + // Check params: + cLuaState L(tolua_S); + if ( + !L.CheckParamUserType(1, "cCompositeChat") || + !L.CheckParamString(2, 3) + ) + { + return 0; + } + cCompositeChat * self = (cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL); + if (self == NULL) + { + tolua_error(tolua_S, "invalid 'self' in function 'cCompositeChat:AddSuggestCommandPart'", NULL); + return 0; + } + + // Add the part: + AString Text, Command, Style; + L.GetStackValue(2, Text); + L.GetStackValue(3, Command); + L.GetStackValue(4, Style); + self->AddSuggestCommandPart(Text, Command, Style); + + // Cut away everything from the stack except for the cCompositeChat instance; return that: + lua_settop(L, 1); + return 1; +} + + + + + +static int tolua_cCompositeChat_AddTextPart(lua_State * tolua_S) +{ + // function cCompositeChat:AddTextPart(Message, [Style]) + // Exported manually to support call-chaining (return *this) + + // Check params: + cLuaState L(tolua_S); + if ( + !L.CheckParamUserType(1, "cCompositeChat") || + !L.CheckParamString(2) + ) + { + return 0; + } + cCompositeChat * self = (cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL); + if (self == NULL) + { + tolua_error(tolua_S, "invalid 'self' in function 'cCompositeChat:AddTextPart'", NULL); + return 0; + } + + // Add the part: + AString Text, Style; + L.GetStackValue(2, Text); + L.GetStackValue(3, Style); + self->AddTextPart(Text, Style); + + // Cut away everything from the stack except for the cCompositeChat instance; return that: + lua_settop(L, 1); + return 1; +} + + + + + +static int tolua_cCompositeChat_AddUrlPart(lua_State * tolua_S) +{ + // function cCompositeChat:AddTextPart(Message, Url, [Style]) + // Exported manually to support call-chaining (return *this) + + // Check params: + cLuaState L(tolua_S); + if ( + !L.CheckParamUserType(1, "cCompositeChat") || + !L.CheckParamString(2, 3) + ) + { + return 0; + } + cCompositeChat * self = (cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL); + if (self == NULL) + { + tolua_error(tolua_S, "invalid 'self' in function 'cCompositeChat:AddUrlPart'", NULL); + return 0; + } + + // Add the part: + AString Text, Url, Style; + L.GetStackValue(2, Text); + L.GetStackValue(3, Url); + L.GetStackValue(4, Style); + self->AddUrlPart(Text, Url, Style); + + // Cut away everything from the stack except for the cCompositeChat instance; return that: + lua_settop(L, 1); + return 1; +} + + + + + +static int tolua_cCompositeChat_ParseText(lua_State * tolua_S) +{ + // function cCompositeChat:ParseText(TextMessage) + // Exported manually to support call-chaining (return *this) + + // Check params: + cLuaState L(tolua_S); + if ( + !L.CheckParamUserType(1, "cCompositeChat") || + !L.CheckParamString(2) + ) + { + return 0; + } + cCompositeChat * self = (cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL); + if (self == NULL) + { + tolua_error(tolua_S, "invalid 'self' in function 'cCompositeChat:ParseText'", NULL); + return 0; + } + + // Parse the text: + AString Text; + L.GetStackValue(2, Text); + self->ParseText(Text); + + // Cut away everything from the stack except for the cCompositeChat instance; return that: + lua_settop(L, 1); + return 1; +} + + + + + +static int tolua_cCompositeChat_SetMessageType(lua_State * tolua_S) +{ + // function cCompositeChat:SetMessageType(MessageType) + // Exported manually to support call-chaining (return *this) + + // Check params: + cLuaState L(tolua_S); + if ( + !L.CheckParamUserType(1, "cCompositeChat") || + !L.CheckParamNumber(2) + ) + { + return 0; + } + cCompositeChat * self = (cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL); + if (self == NULL) + { + tolua_error(tolua_S, "invalid 'self' in function 'cCompositeChat:SetMessageType'", NULL); + return 0; + } + + // Set the type: + int MessageType; + L.GetStackValue(1, MessageType); + self->SetMessageType((eMessageType)MessageType); + + // Cut away everything from the stack except for the cCompositeChat instance; return that: + lua_settop(L, 1); + return 1; +} + + + + + +static int tolua_cCompositeChat_UnderlineUrls(lua_State * tolua_S) +{ + // function cCompositeChat:UnderlineUrls() + // Exported manually to support call-chaining (return *this) + + // Check params: + cLuaState L(tolua_S); + if (!L.CheckParamUserType(1, "cCompositeChat")) + { + return 0; + } + cCompositeChat * self = (cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL); + if (self == NULL) + { + tolua_error(tolua_S, "invalid 'self' in function 'cCompositeChat:UnderlineUrls'", NULL); + return 0; + } + + // Call the processing + self->UnderlineUrls(); + + // Cut away everything from the stack except for the cCompositeChat instance; return that: + lua_settop(L, 1); + return 1; +} + + + + + void ManualBindings::Bind(lua_State * tolua_S) { tolua_beginmodule(tolua_S, NULL); @@ -2535,6 +2783,16 @@ void ManualBindings::Bind(lua_State * tolua_S) tolua_function(tolua_S, "SaveToSchematicFile", tolua_cBlockArea_SaveToSchematicFile); tolua_endmodule(tolua_S); + tolua_beginmodule(tolua_S, "cCompositeChat"); + tolua_function(tolua_S, "AddRunCommandPart", tolua_cCompositeChat_AddRunCommandPart); + tolua_function(tolua_S, "AddSuggestCommandPart", tolua_cCompositeChat_AddSuggestCommandPart); + tolua_function(tolua_S, "AddTextPart", tolua_cCompositeChat_AddTextPart); + tolua_function(tolua_S, "AddUrlPart", tolua_cCompositeChat_AddUrlPart); + tolua_function(tolua_S, "ParseText", tolua_cCompositeChat_ParseText); + tolua_function(tolua_S, "SetMessageType", tolua_cCompositeChat_SetMessageType); + tolua_function(tolua_S, "UnderlineUrls", tolua_cCompositeChat_UnderlineUrls); + tolua_endmodule(tolua_S); + tolua_beginmodule(tolua_S, "cHopperEntity"); tolua_function(tolua_S, "GetOutputBlockPos", tolua_cHopperEntity_GetOutputBlockPos); tolua_endmodule(tolua_S); @@ -2583,6 +2841,11 @@ void ManualBindings::Bind(lua_State * tolua_S) tolua_beginmodule(tolua_S, "cMapManager"); tolua_function(tolua_S, "DoWithMap", tolua_DoWithID<cMapManager, cMap, &cMapManager::DoWithMap>); tolua_endmodule(tolua_S); + + tolua_beginmodule(tolua_S, "cScoreboard"); + tolua_function(tolua_S, "ForEachObjective", tolua_ForEach<cScoreboard, cObjective, &cScoreboard::ForEachObjective>); + tolua_function(tolua_S, "ForEachTeam", tolua_ForEach<cScoreboard, cTeam, &cScoreboard::ForEachTeam>); + tolua_endmodule(tolua_S); tolua_beginmodule(tolua_S, "cPlugin"); tolua_function(tolua_S, "Call", tolua_cPlugin_Call); diff --git a/src/BlockID.cpp b/src/BlockID.cpp index ff1c54e3f..79e122032 100644 --- a/src/BlockID.cpp +++ b/src/BlockID.cpp @@ -12,20 +12,6 @@ -NIBBLETYPE g_BlockLightValue[256]; -NIBBLETYPE g_BlockSpreadLightFalloff[256]; -bool g_BlockTransparent[256]; -bool g_BlockOneHitDig[256]; -bool g_BlockPistonBreakable[256]; -bool g_BlockIsSnowable[256]; -bool g_BlockRequiresSpecialTool[256]; -bool g_BlockIsSolid[256]; -bool g_BlockFullyOccupiesVoxel[256]; - - - - - class cBlockIDMap { // Making the map case-insensitive: @@ -481,389 +467,4 @@ cItem GetIniItemSet(cIniFile & a_IniFile, const char * a_Section, const char * a -// This is actually just some code that needs to run at program startup, so it is wrapped into a global var's constructor: -class cBlockPropertiesInitializer -{ -public: - cBlockPropertiesInitializer(void) - { - memset(g_BlockLightValue, 0x00, sizeof(g_BlockLightValue)); - memset(g_BlockSpreadLightFalloff, 0x0f, sizeof(g_BlockSpreadLightFalloff)); // 0x0f means total falloff - memset(g_BlockTransparent, 0x00, sizeof(g_BlockTransparent)); - memset(g_BlockOneHitDig, 0x00, sizeof(g_BlockOneHitDig)); - memset(g_BlockPistonBreakable, 0x00, sizeof(g_BlockPistonBreakable)); - memset(g_BlockFullyOccupiesVoxel, 0x00, sizeof(g_BlockFullyOccupiesVoxel)); - - // Setting bools to true must be done manually, see http://forum.mc-server.org/showthread.php?tid=629&pid=5415#pid5415 - for (size_t i = 0; i < ARRAYCOUNT(g_BlockIsSnowable); i++) - { - g_BlockIsSnowable[i] = true; - } - memset(g_BlockRequiresSpecialTool, 0x00, sizeof(g_BlockRequiresSpecialTool)); // Set all blocks to false - - // Setting bools to true must be done manually, see http://forum.mc-server.org/showthread.php?tid=629&pid=5415#pid5415 - for (size_t i = 0; i < ARRAYCOUNT(g_BlockIsSolid); i++) - { - g_BlockIsSolid[i] = true; - } - - // Emissive blocks - g_BlockLightValue[E_BLOCK_FIRE] = 15; - g_BlockLightValue[E_BLOCK_GLOWSTONE] = 15; - g_BlockLightValue[E_BLOCK_JACK_O_LANTERN] = 15; - g_BlockLightValue[E_BLOCK_LAVA] = 15; - g_BlockLightValue[E_BLOCK_STATIONARY_LAVA] = 15; - g_BlockLightValue[E_BLOCK_END_PORTAL] = 15; - g_BlockLightValue[E_BLOCK_REDSTONE_LAMP_ON] = 15; - g_BlockLightValue[E_BLOCK_TORCH] = 14; - g_BlockLightValue[E_BLOCK_BURNING_FURNACE] = 13; - g_BlockLightValue[E_BLOCK_NETHER_PORTAL] = 11; - g_BlockLightValue[E_BLOCK_REDSTONE_ORE_GLOWING] = 9; - g_BlockLightValue[E_BLOCK_REDSTONE_REPEATER_ON] = 9; - g_BlockLightValue[E_BLOCK_REDSTONE_TORCH_ON] = 7; - g_BlockLightValue[E_BLOCK_BREWING_STAND] = 1; - g_BlockLightValue[E_BLOCK_BROWN_MUSHROOM] = 1; - g_BlockLightValue[E_BLOCK_DRAGON_EGG] = 1; - - // Spread blocks - g_BlockSpreadLightFalloff[E_BLOCK_AIR] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_CAKE] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_CHEST] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_COBWEB] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_CROPS] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_FENCE] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_FENCE_GATE] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_FIRE] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_GLASS] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_GLASS_PANE] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_GLOWSTONE] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_IRON_BARS] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_IRON_DOOR] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_LEAVES] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_SIGN_POST] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_TORCH] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_VINES] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_WALLSIGN] = 1; - g_BlockSpreadLightFalloff[E_BLOCK_WOODEN_DOOR] = 1; - - // Light in water and lava dissapears faster: - g_BlockSpreadLightFalloff[E_BLOCK_LAVA] = 3; - g_BlockSpreadLightFalloff[E_BLOCK_STATIONARY_LAVA] = 3; - g_BlockSpreadLightFalloff[E_BLOCK_STATIONARY_WATER] = 3; - g_BlockSpreadLightFalloff[E_BLOCK_WATER] = 3; - - // Transparent blocks - g_BlockTransparent[E_BLOCK_ACTIVATOR_RAIL] = true; - g_BlockTransparent[E_BLOCK_AIR] = true; - g_BlockTransparent[E_BLOCK_BIG_FLOWER] = true; - g_BlockTransparent[E_BLOCK_BROWN_MUSHROOM] = true; - g_BlockTransparent[E_BLOCK_CARROTS] = true; - g_BlockTransparent[E_BLOCK_CHEST] = true; - g_BlockTransparent[E_BLOCK_COBWEB] = true; - g_BlockTransparent[E_BLOCK_CROPS] = true; - g_BlockTransparent[E_BLOCK_DANDELION] = true; - g_BlockTransparent[E_BLOCK_DETECTOR_RAIL] = true; - g_BlockTransparent[E_BLOCK_ENDER_CHEST] = true; - g_BlockTransparent[E_BLOCK_FENCE] = true; - g_BlockTransparent[E_BLOCK_FENCE_GATE] = true; - g_BlockTransparent[E_BLOCK_FIRE] = true; - g_BlockTransparent[E_BLOCK_FLOWER] = true; - g_BlockTransparent[E_BLOCK_FLOWER_POT] = true; - g_BlockTransparent[E_BLOCK_GLASS] = true; - g_BlockTransparent[E_BLOCK_GLASS_PANE] = true; - g_BlockTransparent[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE] = true; - g_BlockTransparent[E_BLOCK_ICE] = true; - g_BlockTransparent[E_BLOCK_IRON_DOOR] = true; - g_BlockTransparent[E_BLOCK_LAVA] = true; - g_BlockTransparent[E_BLOCK_LEAVES] = true; - g_BlockTransparent[E_BLOCK_LEVER] = true; - g_BlockTransparent[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE] = true; - g_BlockTransparent[E_BLOCK_MELON_STEM] = true; - g_BlockTransparent[E_BLOCK_NETHER_BRICK_FENCE] = true; - g_BlockTransparent[E_BLOCK_NEW_LEAVES] = true; - g_BlockTransparent[E_BLOCK_POTATOES] = true; - g_BlockTransparent[E_BLOCK_POWERED_RAIL] = true; - g_BlockTransparent[E_BLOCK_PISTON_EXTENSION] = true; - g_BlockTransparent[E_BLOCK_PUMPKIN_STEM] = true; - g_BlockTransparent[E_BLOCK_RAIL] = true; - g_BlockTransparent[E_BLOCK_RED_MUSHROOM] = true; - g_BlockTransparent[E_BLOCK_SIGN_POST] = true; - g_BlockTransparent[E_BLOCK_SNOW] = true; - g_BlockTransparent[E_BLOCK_STAINED_GLASS] = true; - g_BlockTransparent[E_BLOCK_STAINED_GLASS_PANE] = true; - g_BlockTransparent[E_BLOCK_STATIONARY_LAVA] = true; - g_BlockTransparent[E_BLOCK_STATIONARY_WATER] = true; - g_BlockTransparent[E_BLOCK_STONE_BUTTON] = true; - g_BlockTransparent[E_BLOCK_STONE_PRESSURE_PLATE] = true; - g_BlockTransparent[E_BLOCK_TALL_GRASS] = true; - g_BlockTransparent[E_BLOCK_TORCH] = true; - g_BlockTransparent[E_BLOCK_VINES] = true; - g_BlockTransparent[E_BLOCK_WALLSIGN] = true; - g_BlockTransparent[E_BLOCK_WATER] = true; - g_BlockTransparent[E_BLOCK_WOODEN_BUTTON] = true; - g_BlockTransparent[E_BLOCK_WOODEN_DOOR] = true; - g_BlockTransparent[E_BLOCK_WOODEN_PRESSURE_PLATE] = true; - - // TODO: Any other transparent blocks? - - // One hit break blocks: - g_BlockOneHitDig[E_BLOCK_ACTIVE_COMPARATOR] = true; - g_BlockOneHitDig[E_BLOCK_BIG_FLOWER] = true; - g_BlockOneHitDig[E_BLOCK_BROWN_MUSHROOM] = true; - g_BlockOneHitDig[E_BLOCK_CARROTS] = true; - g_BlockOneHitDig[E_BLOCK_CROPS] = true; - g_BlockOneHitDig[E_BLOCK_DANDELION] = true; - g_BlockOneHitDig[E_BLOCK_FIRE] = true; - g_BlockOneHitDig[E_BLOCK_FLOWER] = true; - g_BlockOneHitDig[E_BLOCK_FLOWER_POT] = true; - g_BlockOneHitDig[E_BLOCK_INACTIVE_COMPARATOR] = true; - g_BlockOneHitDig[E_BLOCK_MELON_STEM] = true; - g_BlockOneHitDig[E_BLOCK_POTATOES] = true; - g_BlockOneHitDig[E_BLOCK_PUMPKIN_STEM] = true; - g_BlockOneHitDig[E_BLOCK_REDSTONE_REPEATER_OFF] = true; - g_BlockOneHitDig[E_BLOCK_REDSTONE_REPEATER_ON] = true; - g_BlockOneHitDig[E_BLOCK_REDSTONE_TORCH_OFF] = true; - g_BlockOneHitDig[E_BLOCK_REDSTONE_TORCH_ON] = true; - g_BlockOneHitDig[E_BLOCK_REDSTONE_WIRE] = true; - g_BlockOneHitDig[E_BLOCK_RED_MUSHROOM] = true; - g_BlockOneHitDig[E_BLOCK_REEDS] = true; - g_BlockOneHitDig[E_BLOCK_SAPLING] = true; - g_BlockOneHitDig[E_BLOCK_TNT] = true; - g_BlockOneHitDig[E_BLOCK_TALL_GRASS] = true; - g_BlockOneHitDig[E_BLOCK_TORCH] = true; - - // Blocks that break when pushed by piston: - g_BlockPistonBreakable[E_BLOCK_ACTIVE_COMPARATOR] = true; - g_BlockPistonBreakable[E_BLOCK_AIR] = true; - g_BlockPistonBreakable[E_BLOCK_BED] = true; - g_BlockPistonBreakable[E_BLOCK_BIG_FLOWER] = true; - g_BlockPistonBreakable[E_BLOCK_BROWN_MUSHROOM] = true; - g_BlockPistonBreakable[E_BLOCK_COBWEB] = true; - g_BlockPistonBreakable[E_BLOCK_CROPS] = true; - g_BlockPistonBreakable[E_BLOCK_DANDELION] = true; - g_BlockPistonBreakable[E_BLOCK_DEAD_BUSH] = true; - g_BlockPistonBreakable[E_BLOCK_FIRE] = true; - g_BlockPistonBreakable[E_BLOCK_FLOWER] = true; - g_BlockPistonBreakable[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE] = true; - g_BlockPistonBreakable[E_BLOCK_INACTIVE_COMPARATOR] = true; - g_BlockPistonBreakable[E_BLOCK_IRON_DOOR] = true; - g_BlockPistonBreakable[E_BLOCK_JACK_O_LANTERN] = true; - g_BlockPistonBreakable[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE] = true; - g_BlockPistonBreakable[E_BLOCK_LADDER] = true; - g_BlockPistonBreakable[E_BLOCK_LAVA] = true; - g_BlockPistonBreakable[E_BLOCK_LEVER] = true; - g_BlockPistonBreakable[E_BLOCK_MELON] = true; - g_BlockPistonBreakable[E_BLOCK_MELON_STEM] = true; - g_BlockPistonBreakable[E_BLOCK_PUMPKIN] = true; - g_BlockPistonBreakable[E_BLOCK_PUMPKIN_STEM] = true; - g_BlockPistonBreakable[E_BLOCK_REDSTONE_REPEATER_OFF] = true; - g_BlockPistonBreakable[E_BLOCK_REDSTONE_REPEATER_ON] = true; - g_BlockPistonBreakable[E_BLOCK_REDSTONE_TORCH_OFF] = true; - g_BlockPistonBreakable[E_BLOCK_REDSTONE_TORCH_ON] = true; - g_BlockPistonBreakable[E_BLOCK_REDSTONE_WIRE] = true; - g_BlockPistonBreakable[E_BLOCK_RED_MUSHROOM] = true; - g_BlockPistonBreakable[E_BLOCK_REEDS] = true; - g_BlockPistonBreakable[E_BLOCK_SNOW] = true; - g_BlockPistonBreakable[E_BLOCK_STATIONARY_LAVA] = true; - g_BlockPistonBreakable[E_BLOCK_STATIONARY_WATER] = true; - g_BlockPistonBreakable[E_BLOCK_STONE_BUTTON] = true; - g_BlockPistonBreakable[E_BLOCK_STONE_PRESSURE_PLATE] = true; - g_BlockPistonBreakable[E_BLOCK_TALL_GRASS] = true; - g_BlockPistonBreakable[E_BLOCK_TORCH] = true; - g_BlockPistonBreakable[E_BLOCK_VINES] = true; - g_BlockPistonBreakable[E_BLOCK_WATER] = true; - g_BlockPistonBreakable[E_BLOCK_WOODEN_BUTTON] = true; - g_BlockPistonBreakable[E_BLOCK_WOODEN_DOOR] = true; - g_BlockPistonBreakable[E_BLOCK_WOODEN_PRESSURE_PLATE] = true; - - - // Blocks that cannot be snowed over: - g_BlockIsSnowable[E_BLOCK_ACTIVE_COMPARATOR] = false; - g_BlockIsSnowable[E_BLOCK_AIR] = false; - g_BlockIsSnowable[E_BLOCK_BIG_FLOWER] = false; - g_BlockIsSnowable[E_BLOCK_BROWN_MUSHROOM] = false; - g_BlockIsSnowable[E_BLOCK_CACTUS] = false; - g_BlockIsSnowable[E_BLOCK_CHEST] = false; - g_BlockIsSnowable[E_BLOCK_CROPS] = false; - g_BlockIsSnowable[E_BLOCK_DANDELION] = false; - g_BlockIsSnowable[E_BLOCK_FIRE] = false; - g_BlockIsSnowable[E_BLOCK_FLOWER] = false; - g_BlockIsSnowable[E_BLOCK_GLASS] = false; - g_BlockIsSnowable[E_BLOCK_ICE] = false; - g_BlockIsSnowable[E_BLOCK_INACTIVE_COMPARATOR] = false; - g_BlockIsSnowable[E_BLOCK_LAVA] = false; - g_BlockIsSnowable[E_BLOCK_LILY_PAD] = false; - g_BlockIsSnowable[E_BLOCK_REDSTONE_REPEATER_OFF] = false; - g_BlockIsSnowable[E_BLOCK_REDSTONE_REPEATER_ON] = false; - g_BlockIsSnowable[E_BLOCK_REDSTONE_TORCH_OFF] = false; - g_BlockIsSnowable[E_BLOCK_REDSTONE_TORCH_ON] = false; - g_BlockIsSnowable[E_BLOCK_REDSTONE_WIRE] = false; - g_BlockIsSnowable[E_BLOCK_RED_MUSHROOM] = false; - g_BlockIsSnowable[E_BLOCK_REEDS] = false; - g_BlockIsSnowable[E_BLOCK_SAPLING] = false; - g_BlockIsSnowable[E_BLOCK_SIGN_POST] = false; - g_BlockIsSnowable[E_BLOCK_SNOW] = false; - g_BlockIsSnowable[E_BLOCK_STAINED_GLASS] = false; - g_BlockIsSnowable[E_BLOCK_STAINED_GLASS_PANE] = false; - g_BlockIsSnowable[E_BLOCK_STATIONARY_LAVA] = false; - g_BlockIsSnowable[E_BLOCK_STATIONARY_WATER] = false; - g_BlockIsSnowable[E_BLOCK_TALL_GRASS] = false; - g_BlockIsSnowable[E_BLOCK_TNT] = false; - g_BlockIsSnowable[E_BLOCK_TORCH] = false; - g_BlockIsSnowable[E_BLOCK_VINES] = false; - g_BlockIsSnowable[E_BLOCK_WALLSIGN] = false; - g_BlockIsSnowable[E_BLOCK_WATER] = false; - - - // Blocks that don't drop without a special tool: - g_BlockRequiresSpecialTool[E_BLOCK_BRICK] = true; - g_BlockRequiresSpecialTool[E_BLOCK_CAULDRON] = true; - g_BlockRequiresSpecialTool[E_BLOCK_COAL_ORE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_COBBLESTONE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_COBBLESTONE_STAIRS] = true; - g_BlockRequiresSpecialTool[E_BLOCK_COBWEB] = true; - g_BlockRequiresSpecialTool[E_BLOCK_DIAMOND_BLOCK] = true; - g_BlockRequiresSpecialTool[E_BLOCK_DIAMOND_ORE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_DOUBLE_STONE_SLAB] = true; - g_BlockRequiresSpecialTool[E_BLOCK_EMERALD_ORE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_END_STONE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_GOLD_BLOCK] = true; - g_BlockRequiresSpecialTool[E_BLOCK_GOLD_ORE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_IRON_BLOCK] = true; - g_BlockRequiresSpecialTool[E_BLOCK_IRON_ORE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_LAPIS_BLOCK] = true; - g_BlockRequiresSpecialTool[E_BLOCK_LAPIS_ORE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_MOSSY_COBBLESTONE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_NETHERRACK] = true; - g_BlockRequiresSpecialTool[E_BLOCK_NETHER_BRICK] = true; - g_BlockRequiresSpecialTool[E_BLOCK_NETHER_BRICK_STAIRS] = true; - g_BlockRequiresSpecialTool[E_BLOCK_OBSIDIAN] = true; - g_BlockRequiresSpecialTool[E_BLOCK_REDSTONE_ORE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_REDSTONE_ORE_GLOWING] = true; - g_BlockRequiresSpecialTool[E_BLOCK_SANDSTONE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_SANDSTONE_STAIRS] = true; - g_BlockRequiresSpecialTool[E_BLOCK_SNOW] = true; - g_BlockRequiresSpecialTool[E_BLOCK_STONE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_STONE_BRICKS] = true; - g_BlockRequiresSpecialTool[E_BLOCK_STONE_BRICK_STAIRS] = true; - g_BlockRequiresSpecialTool[E_BLOCK_STONE_PRESSURE_PLATE] = true; - g_BlockRequiresSpecialTool[E_BLOCK_STONE_SLAB] = true; - g_BlockRequiresSpecialTool[E_BLOCK_VINES] = true; - - // Nonsolid blocks: - g_BlockIsSolid[E_BLOCK_ACTIVATOR_RAIL] = false; - g_BlockIsSolid[E_BLOCK_AIR] = false; - g_BlockIsSolid[E_BLOCK_BIG_FLOWER] = false; - g_BlockIsSolid[E_BLOCK_BROWN_MUSHROOM] = false; - g_BlockIsSolid[E_BLOCK_CARROTS] = false; - g_BlockIsSolid[E_BLOCK_COBWEB] = false; - g_BlockIsSolid[E_BLOCK_CROPS] = false; - g_BlockIsSolid[E_BLOCK_DANDELION] = false; - g_BlockIsSolid[E_BLOCK_DETECTOR_RAIL] = false; - g_BlockIsSolid[E_BLOCK_END_PORTAL] = false; - g_BlockIsSolid[E_BLOCK_FIRE] = false; - g_BlockIsSolid[E_BLOCK_FLOWER] = false; - g_BlockIsSolid[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE] = false; - g_BlockIsSolid[E_BLOCK_LAVA] = false; - g_BlockIsSolid[E_BLOCK_LEVER] = false; - g_BlockIsSolid[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE] = false; - g_BlockIsSolid[E_BLOCK_MELON_STEM] = false; - g_BlockIsSolid[E_BLOCK_NETHER_PORTAL] = false; - g_BlockIsSolid[E_BLOCK_PISTON_EXTENSION] = false; - g_BlockIsSolid[E_BLOCK_POTATOES] = false; - g_BlockIsSolid[E_BLOCK_POWERED_RAIL] = false; - g_BlockIsSolid[E_BLOCK_RAIL] = false; - g_BlockIsSolid[E_BLOCK_REDSTONE_TORCH_OFF] = false; - g_BlockIsSolid[E_BLOCK_REDSTONE_TORCH_ON] = false; - g_BlockIsSolid[E_BLOCK_REDSTONE_WIRE] = false; - g_BlockIsSolid[E_BLOCK_RED_MUSHROOM] = false; - g_BlockIsSolid[E_BLOCK_REEDS] = false; - g_BlockIsSolid[E_BLOCK_SAPLING] = false; - g_BlockIsSolid[E_BLOCK_SIGN_POST] = false; - g_BlockIsSolid[E_BLOCK_SNOW] = false; - g_BlockIsSolid[E_BLOCK_STATIONARY_LAVA] = false; - g_BlockIsSolid[E_BLOCK_STATIONARY_WATER] = false; - g_BlockIsSolid[E_BLOCK_STONE_BUTTON] = false; - g_BlockIsSolid[E_BLOCK_STONE_PRESSURE_PLATE] = false; - g_BlockIsSolid[E_BLOCK_TALL_GRASS] = false; - g_BlockIsSolid[E_BLOCK_TORCH] = false; - g_BlockIsSolid[E_BLOCK_TRIPWIRE] = false; - g_BlockIsSolid[E_BLOCK_VINES] = false; - g_BlockIsSolid[E_BLOCK_WALLSIGN] = false; - g_BlockIsSolid[E_BLOCK_WATER] = false; - g_BlockIsSolid[E_BLOCK_WOODEN_BUTTON] = false; - g_BlockIsSolid[E_BLOCK_WOODEN_PRESSURE_PLATE] = false; - g_BlockIsSolid[E_BLOCK_WOODEN_SLAB] = false; - - // Torch placeable blocks: - g_BlockFullyOccupiesVoxel[E_BLOCK_NEW_LOG] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_BEDROCK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_BLOCK_OF_COAL] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_BLOCK_OF_REDSTONE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_BOOKCASE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_BRICK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_CLAY] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_COAL_ORE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_COBBLESTONE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_COMMAND_BLOCK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_CRAFTING_TABLE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_DIAMOND_BLOCK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_DIAMOND_ORE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_DIRT] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_DISPENSER] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_DOUBLE_STONE_SLAB] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_DOUBLE_WOODEN_SLAB] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_DROPPER] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_EMERALD_BLOCK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_EMERALD_ORE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_END_STONE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_FURNACE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_GLOWSTONE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_GOLD_BLOCK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_GOLD_ORE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_GRASS] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_GRAVEL] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_HARDENED_CLAY] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_HAY_BALE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_HUGE_BROWN_MUSHROOM] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_HUGE_RED_MUSHROOM] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_IRON_BLOCK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_IRON_ORE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_JACK_O_LANTERN] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_JUKEBOX] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_LAPIS_BLOCK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_LAPIS_ORE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_LOG] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_MELON] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_MOSSY_COBBLESTONE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_MYCELIUM] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_NETHERRACK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_NETHER_BRICK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_NETHER_QUARTZ_ORE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_NOTE_BLOCK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_OBSIDIAN] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_PACKED_ICE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_PLANKS] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_PUMPKIN] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_QUARTZ_BLOCK] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_REDSTONE_LAMP_OFF] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_REDSTONE_LAMP_ON] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_REDSTONE_ORE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_REDSTONE_ORE_GLOWING] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_SANDSTONE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_SAND] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_SILVERFISH_EGG] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_SPONGE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_STAINED_CLAY] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_WOOL] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_STONE] = true; - g_BlockFullyOccupiesVoxel[E_BLOCK_STONE_BRICKS] = true; - } -} BlockPropertiesInitializer; - - - - diff --git a/src/BlockID.h b/src/BlockID.h index 861bb8dae..1c454cd23 100644 --- a/src/BlockID.h +++ b/src/BlockID.h @@ -909,17 +909,3 @@ extern cItem GetIniItemSet(cIniFile & a_IniFile, const char * a_Section, const c -// Block properties: -extern NIBBLETYPE g_BlockLightValue[256]; -extern NIBBLETYPE g_BlockSpreadLightFalloff[256]; -extern bool g_BlockTransparent[256]; -extern bool g_BlockOneHitDig[256]; -extern bool g_BlockPistonBreakable[256]; -extern bool g_BlockIsSnowable[256]; -extern bool g_BlockRequiresSpecialTool[256]; -extern bool g_BlockIsSolid[256]; -extern bool g_BlockFullyOccupiesVoxel[256]; - - - - diff --git a/src/BlockInfo.cpp b/src/BlockInfo.cpp new file mode 100644 index 000000000..399efcd9b --- /dev/null +++ b/src/BlockInfo.cpp @@ -0,0 +1,442 @@ + +#include "Globals.h" + +#include "BlockInfo.h" +#include "Blocks/BlockHandler.h" + + + + + +cBlockInfo cBlockInfo::ms_Info[256]; + + + + + +cBlockInfo::cBlockInfo() + : m_LightValue(0x00) + , m_SpreadLightFalloff(0x0f) + , m_Transparent(false) + , m_OneHitDig(false) + , m_PistonBreakable(false) + , m_IsSnowable(true) + , m_RequiresSpecialTool(false) + , m_IsSolid(true) + , m_FullyOccupiesVoxel(false) + , m_Handler(NULL) +{} + + + + + +cBlockInfo::~cBlockInfo() +{ + delete m_Handler; +} + + + + + +cBlockInfo & cBlockInfo::Get(BLOCKTYPE a_Type) +{ + ASSERT(a_Type < 256); + + return ms_Info[a_Type]; +} + + + + + +void cBlockInfo::Initialize(void) +{ + for (unsigned int i = 0; i < 256; ++i) + { + if (ms_Info[i].m_Handler == NULL) + { + ms_Info[i].m_Handler = cBlockHandler::CreateBlockHandler((BLOCKTYPE) i); + } + } + + // Emissive blocks + ms_Info[E_BLOCK_FIRE ].m_LightValue = 15; + ms_Info[E_BLOCK_GLOWSTONE ].m_LightValue = 15; + ms_Info[E_BLOCK_JACK_O_LANTERN ].m_LightValue = 15; + ms_Info[E_BLOCK_LAVA ].m_LightValue = 15; + ms_Info[E_BLOCK_STATIONARY_LAVA ].m_LightValue = 15; + ms_Info[E_BLOCK_END_PORTAL ].m_LightValue = 15; + ms_Info[E_BLOCK_REDSTONE_LAMP_ON ].m_LightValue = 15; + ms_Info[E_BLOCK_TORCH ].m_LightValue = 14; + ms_Info[E_BLOCK_BURNING_FURNACE ].m_LightValue = 13; + ms_Info[E_BLOCK_NETHER_PORTAL ].m_LightValue = 11; + ms_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_LightValue = 9; + ms_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_LightValue = 9; + ms_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_LightValue = 7; + ms_Info[E_BLOCK_BREWING_STAND ].m_LightValue = 1; + ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_LightValue = 1; + ms_Info[E_BLOCK_DRAGON_EGG ].m_LightValue = 1; + + + // Spread blocks + ms_Info[E_BLOCK_AIR ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_CAKE ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_CHEST ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_COBWEB ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_CROPS ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_FENCE ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_FENCE_GATE ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_FIRE ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_GLASS ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_GLASS_PANE ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_GLOWSTONE ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_IRON_BARS ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_IRON_DOOR ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_LEAVES ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_SIGN_POST ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_TORCH ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_VINES ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_WALLSIGN ].m_SpreadLightFalloff = 1; + ms_Info[E_BLOCK_WOODEN_DOOR ].m_SpreadLightFalloff = 1; + + // Light in water and lava dissapears faster: + ms_Info[E_BLOCK_LAVA ].m_SpreadLightFalloff = 3; + ms_Info[E_BLOCK_STATIONARY_LAVA ].m_SpreadLightFalloff = 3; + ms_Info[E_BLOCK_STATIONARY_WATER ].m_SpreadLightFalloff = 3; + ms_Info[E_BLOCK_WATER ].m_SpreadLightFalloff = 3; + + + // Transparent blocks + ms_Info[E_BLOCK_ACTIVATOR_RAIL ].m_Transparent = true; + ms_Info[E_BLOCK_AIR ].m_Transparent = true; + ms_Info[E_BLOCK_BIG_FLOWER ].m_Transparent = true; + ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_Transparent = true; + ms_Info[E_BLOCK_CARROTS ].m_Transparent = true; + ms_Info[E_BLOCK_CHEST ].m_Transparent = true; + ms_Info[E_BLOCK_COBWEB ].m_Transparent = true; + ms_Info[E_BLOCK_CROPS ].m_Transparent = true; + ms_Info[E_BLOCK_DANDELION ].m_Transparent = true; + ms_Info[E_BLOCK_DETECTOR_RAIL ].m_Transparent = true; + ms_Info[E_BLOCK_ENDER_CHEST ].m_Transparent = true; + ms_Info[E_BLOCK_FENCE ].m_Transparent = true; + ms_Info[E_BLOCK_FENCE_GATE ].m_Transparent = true; + ms_Info[E_BLOCK_FIRE ].m_Transparent = true; + ms_Info[E_BLOCK_FLOWER ].m_Transparent = true; + ms_Info[E_BLOCK_FLOWER_POT ].m_Transparent = true; + ms_Info[E_BLOCK_GLASS ].m_Transparent = true; + ms_Info[E_BLOCK_GLASS_PANE ].m_Transparent = true; + ms_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_Transparent = true; + ms_Info[E_BLOCK_ICE ].m_Transparent = true; + ms_Info[E_BLOCK_IRON_DOOR ].m_Transparent = true; + ms_Info[E_BLOCK_LAVA ].m_Transparent = true; + ms_Info[E_BLOCK_LEAVES ].m_Transparent = true; + ms_Info[E_BLOCK_LEVER ].m_Transparent = true; + ms_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_Transparent = true; + ms_Info[E_BLOCK_MELON_STEM ].m_Transparent = true; + ms_Info[E_BLOCK_NETHER_BRICK_FENCE ].m_Transparent = true; + ms_Info[E_BLOCK_NEW_LEAVES ].m_Transparent = true; + ms_Info[E_BLOCK_POTATOES ].m_Transparent = true; + ms_Info[E_BLOCK_POWERED_RAIL ].m_Transparent = true; + ms_Info[E_BLOCK_PISTON_EXTENSION ].m_Transparent = true; + ms_Info[E_BLOCK_PUMPKIN_STEM ].m_Transparent = true; + ms_Info[E_BLOCK_RAIL ].m_Transparent = true; + ms_Info[E_BLOCK_RED_MUSHROOM ].m_Transparent = true; + ms_Info[E_BLOCK_SIGN_POST ].m_Transparent = true; + ms_Info[E_BLOCK_SNOW ].m_Transparent = true; + ms_Info[E_BLOCK_STAINED_GLASS ].m_Transparent = true; + ms_Info[E_BLOCK_STAINED_GLASS_PANE ].m_Transparent = true; + ms_Info[E_BLOCK_STATIONARY_LAVA ].m_Transparent = true; + ms_Info[E_BLOCK_STATIONARY_WATER ].m_Transparent = true; + ms_Info[E_BLOCK_STONE_BUTTON ].m_Transparent = true; + ms_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_Transparent = true; + ms_Info[E_BLOCK_TALL_GRASS ].m_Transparent = true; + ms_Info[E_BLOCK_TORCH ].m_Transparent = true; + ms_Info[E_BLOCK_VINES ].m_Transparent = true; + ms_Info[E_BLOCK_WALLSIGN ].m_Transparent = true; + ms_Info[E_BLOCK_WATER ].m_Transparent = true; + ms_Info[E_BLOCK_WOODEN_BUTTON ].m_Transparent = true; + ms_Info[E_BLOCK_WOODEN_DOOR ].m_Transparent = true; + ms_Info[E_BLOCK_WOODEN_PRESSURE_PLATE].m_Transparent = true; + + // TODO: Any other transparent blocks? + + + // One hit break blocks: + ms_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_OneHitDig = true; + ms_Info[E_BLOCK_BIG_FLOWER ].m_OneHitDig = true; + ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_OneHitDig = true; + ms_Info[E_BLOCK_CARROTS ].m_OneHitDig = true; + ms_Info[E_BLOCK_CROPS ].m_OneHitDig = true; + ms_Info[E_BLOCK_DANDELION ].m_OneHitDig = true; + ms_Info[E_BLOCK_FIRE ].m_OneHitDig = true; + ms_Info[E_BLOCK_FLOWER ].m_OneHitDig = true; + ms_Info[E_BLOCK_FLOWER_POT ].m_OneHitDig = true; + ms_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_OneHitDig = true; + ms_Info[E_BLOCK_MELON_STEM ].m_OneHitDig = true; + ms_Info[E_BLOCK_POTATOES ].m_OneHitDig = true; + ms_Info[E_BLOCK_PUMPKIN_STEM ].m_OneHitDig = true; + ms_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_OneHitDig = true; + ms_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_OneHitDig = true; + ms_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_OneHitDig = true; + ms_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_OneHitDig = true; + ms_Info[E_BLOCK_REDSTONE_WIRE ].m_OneHitDig = true; + ms_Info[E_BLOCK_RED_MUSHROOM ].m_OneHitDig = true; + ms_Info[E_BLOCK_REEDS ].m_OneHitDig = true; + ms_Info[E_BLOCK_SAPLING ].m_OneHitDig = true; + ms_Info[E_BLOCK_TNT ].m_OneHitDig = true; + ms_Info[E_BLOCK_TALL_GRASS ].m_OneHitDig = true; + ms_Info[E_BLOCK_TORCH ].m_OneHitDig = true; + + + // Blocks that break when pushed by piston: + ms_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_PistonBreakable = true; + ms_Info[E_BLOCK_AIR ].m_PistonBreakable = true; + ms_Info[E_BLOCK_BED ].m_PistonBreakable = true; + ms_Info[E_BLOCK_BIG_FLOWER ].m_PistonBreakable = true; + ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_PistonBreakable = true; + ms_Info[E_BLOCK_COBWEB ].m_PistonBreakable = true; + ms_Info[E_BLOCK_CROPS ].m_PistonBreakable = true; + ms_Info[E_BLOCK_DANDELION ].m_PistonBreakable = true; + ms_Info[E_BLOCK_DEAD_BUSH ].m_PistonBreakable = true; + ms_Info[E_BLOCK_FIRE ].m_PistonBreakable = true; + ms_Info[E_BLOCK_FLOWER ].m_PistonBreakable = true; + ms_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_PistonBreakable = true; + ms_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_PistonBreakable = true; + ms_Info[E_BLOCK_IRON_DOOR ].m_PistonBreakable = true; + ms_Info[E_BLOCK_JACK_O_LANTERN ].m_PistonBreakable = true; + ms_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_PistonBreakable = true; + ms_Info[E_BLOCK_LADDER ].m_PistonBreakable = true; + ms_Info[E_BLOCK_LAVA ].m_PistonBreakable = true; + ms_Info[E_BLOCK_LEVER ].m_PistonBreakable = true; + ms_Info[E_BLOCK_MELON ].m_PistonBreakable = true; + ms_Info[E_BLOCK_MELON_STEM ].m_PistonBreakable = true; + ms_Info[E_BLOCK_PUMPKIN ].m_PistonBreakable = true; + ms_Info[E_BLOCK_PUMPKIN_STEM ].m_PistonBreakable = true; + ms_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_PistonBreakable = true; + ms_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_PistonBreakable = true; + ms_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_PistonBreakable = true; + ms_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_PistonBreakable = true; + ms_Info[E_BLOCK_REDSTONE_WIRE ].m_PistonBreakable = true; + ms_Info[E_BLOCK_RED_MUSHROOM ].m_PistonBreakable = true; + ms_Info[E_BLOCK_REEDS ].m_PistonBreakable = true; + ms_Info[E_BLOCK_SNOW ].m_PistonBreakable = true; + ms_Info[E_BLOCK_STATIONARY_LAVA ].m_PistonBreakable = true; + ms_Info[E_BLOCK_STATIONARY_WATER ].m_PistonBreakable = true; + ms_Info[E_BLOCK_STONE_BUTTON ].m_PistonBreakable = true; + ms_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_PistonBreakable = true; + ms_Info[E_BLOCK_TALL_GRASS ].m_PistonBreakable = true; + ms_Info[E_BLOCK_TORCH ].m_PistonBreakable = true; + ms_Info[E_BLOCK_VINES ].m_PistonBreakable = true; + ms_Info[E_BLOCK_WATER ].m_PistonBreakable = true; + ms_Info[E_BLOCK_WOODEN_BUTTON ].m_PistonBreakable = true; + ms_Info[E_BLOCK_WOODEN_DOOR ].m_PistonBreakable = true; + ms_Info[E_BLOCK_WOODEN_PRESSURE_PLATE].m_PistonBreakable = true; + + + // Blocks that cannot be snowed over: + ms_Info[E_BLOCK_ACTIVE_COMPARATOR ].m_IsSnowable = false; + ms_Info[E_BLOCK_AIR ].m_IsSnowable = false; + ms_Info[E_BLOCK_BIG_FLOWER ].m_IsSnowable = false; + ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_IsSnowable = false; + ms_Info[E_BLOCK_CACTUS ].m_IsSnowable = false; + ms_Info[E_BLOCK_CHEST ].m_IsSnowable = false; + ms_Info[E_BLOCK_CROPS ].m_IsSnowable = false; + ms_Info[E_BLOCK_DANDELION ].m_IsSnowable = false; + ms_Info[E_BLOCK_FIRE ].m_IsSnowable = false; + ms_Info[E_BLOCK_FLOWER ].m_IsSnowable = false; + ms_Info[E_BLOCK_GLASS ].m_IsSnowable = false; + ms_Info[E_BLOCK_ICE ].m_IsSnowable = false; + ms_Info[E_BLOCK_INACTIVE_COMPARATOR ].m_IsSnowable = false; + ms_Info[E_BLOCK_LAVA ].m_IsSnowable = false; + ms_Info[E_BLOCK_LILY_PAD ].m_IsSnowable = false; + ms_Info[E_BLOCK_REDSTONE_REPEATER_OFF].m_IsSnowable = false; + ms_Info[E_BLOCK_REDSTONE_REPEATER_ON].m_IsSnowable = false; + ms_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_IsSnowable = false; + ms_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_IsSnowable = false; + ms_Info[E_BLOCK_REDSTONE_WIRE ].m_IsSnowable = false; + ms_Info[E_BLOCK_RED_MUSHROOM ].m_IsSnowable = false; + ms_Info[E_BLOCK_REEDS ].m_IsSnowable = false; + ms_Info[E_BLOCK_SAPLING ].m_IsSnowable = false; + ms_Info[E_BLOCK_SIGN_POST ].m_IsSnowable = false; + ms_Info[E_BLOCK_SNOW ].m_IsSnowable = false; + ms_Info[E_BLOCK_STAINED_GLASS ].m_IsSnowable = false; + ms_Info[E_BLOCK_STAINED_GLASS_PANE ].m_IsSnowable = false; + ms_Info[E_BLOCK_STATIONARY_LAVA ].m_IsSnowable = false; + ms_Info[E_BLOCK_STATIONARY_WATER ].m_IsSnowable = false; + ms_Info[E_BLOCK_TALL_GRASS ].m_IsSnowable = false; + ms_Info[E_BLOCK_TNT ].m_IsSnowable = false; + ms_Info[E_BLOCK_TORCH ].m_IsSnowable = false; + ms_Info[E_BLOCK_VINES ].m_IsSnowable = false; + ms_Info[E_BLOCK_WALLSIGN ].m_IsSnowable = false; + ms_Info[E_BLOCK_WATER ].m_IsSnowable = false; + + + // Blocks that don't drop without a special tool: + ms_Info[E_BLOCK_BRICK ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_CAULDRON ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_COAL_ORE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_COBBLESTONE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_COBBLESTONE_STAIRS ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_COBWEB ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_DIAMOND_BLOCK ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_DIAMOND_ORE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_DOUBLE_STONE_SLAB ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_EMERALD_ORE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_END_STONE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_GOLD_BLOCK ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_GOLD_ORE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_IRON_BLOCK ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_IRON_ORE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_LAPIS_BLOCK ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_LAPIS_ORE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_MOSSY_COBBLESTONE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_NETHERRACK ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_NETHER_BRICK ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_NETHER_BRICK_STAIRS ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_OBSIDIAN ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_REDSTONE_ORE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_SANDSTONE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_SANDSTONE_STAIRS ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_SNOW ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_STONE ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_STONE_BRICKS ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_STONE_BRICK_STAIRS ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_STONE_SLAB ].m_RequiresSpecialTool = true; + ms_Info[E_BLOCK_VINES ].m_RequiresSpecialTool = true; + + + // Nonsolid blocks: + ms_Info[E_BLOCK_ACTIVATOR_RAIL ].m_IsSolid = false; + ms_Info[E_BLOCK_AIR ].m_IsSolid = false; + ms_Info[E_BLOCK_BIG_FLOWER ].m_IsSolid = false; + ms_Info[E_BLOCK_BROWN_MUSHROOM ].m_IsSolid = false; + ms_Info[E_BLOCK_CARROTS ].m_IsSolid = false; + ms_Info[E_BLOCK_COBWEB ].m_IsSolid = false; + ms_Info[E_BLOCK_CROPS ].m_IsSolid = false; + ms_Info[E_BLOCK_DANDELION ].m_IsSolid = false; + ms_Info[E_BLOCK_DETECTOR_RAIL ].m_IsSolid = false; + ms_Info[E_BLOCK_END_PORTAL ].m_IsSolid = false; + ms_Info[E_BLOCK_FIRE ].m_IsSolid = false; + ms_Info[E_BLOCK_FLOWER ].m_IsSolid = false; + ms_Info[E_BLOCK_HEAVY_WEIGHTED_PRESSURE_PLATE].m_IsSolid = false; + ms_Info[E_BLOCK_LAVA ].m_IsSolid = false; + ms_Info[E_BLOCK_LEVER ].m_IsSolid = false; + ms_Info[E_BLOCK_LIGHT_WEIGHTED_PRESSURE_PLATE].m_IsSolid = false; + ms_Info[E_BLOCK_MELON_STEM ].m_IsSolid = false; + ms_Info[E_BLOCK_NETHER_PORTAL ].m_IsSolid = false; + ms_Info[E_BLOCK_PISTON_EXTENSION ].m_IsSolid = false; + ms_Info[E_BLOCK_POTATOES ].m_IsSolid = false; + ms_Info[E_BLOCK_POWERED_RAIL ].m_IsSolid = false; + ms_Info[E_BLOCK_RAIL ].m_IsSolid = false; + ms_Info[E_BLOCK_REDSTONE_TORCH_OFF ].m_IsSolid = false; + ms_Info[E_BLOCK_REDSTONE_TORCH_ON ].m_IsSolid = false; + ms_Info[E_BLOCK_REDSTONE_WIRE ].m_IsSolid = false; + ms_Info[E_BLOCK_RED_MUSHROOM ].m_IsSolid = false; + ms_Info[E_BLOCK_REEDS ].m_IsSolid = false; + ms_Info[E_BLOCK_SAPLING ].m_IsSolid = false; + ms_Info[E_BLOCK_SIGN_POST ].m_IsSolid = false; + ms_Info[E_BLOCK_SNOW ].m_IsSolid = false; + ms_Info[E_BLOCK_STATIONARY_LAVA ].m_IsSolid = false; + ms_Info[E_BLOCK_STATIONARY_WATER ].m_IsSolid = false; + ms_Info[E_BLOCK_STONE_BUTTON ].m_IsSolid = false; + ms_Info[E_BLOCK_STONE_PRESSURE_PLATE].m_IsSolid = false; + ms_Info[E_BLOCK_TALL_GRASS ].m_IsSolid = false; + ms_Info[E_BLOCK_TORCH ].m_IsSolid = false; + ms_Info[E_BLOCK_TRIPWIRE ].m_IsSolid = false; + ms_Info[E_BLOCK_VINES ].m_IsSolid = false; + ms_Info[E_BLOCK_WALLSIGN ].m_IsSolid = false; + ms_Info[E_BLOCK_WATER ].m_IsSolid = false; + ms_Info[E_BLOCK_WOODEN_BUTTON ].m_IsSolid = false; + ms_Info[E_BLOCK_WOODEN_PRESSURE_PLATE].m_IsSolid = false; + ms_Info[E_BLOCK_WOODEN_SLAB ].m_IsSolid = false; + + + // Torch placeable blocks: + ms_Info[E_BLOCK_NEW_LOG ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_BEDROCK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_BLOCK_OF_COAL ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_BLOCK_OF_REDSTONE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_BOOKCASE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_BRICK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_CLAY ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_COAL_ORE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_COBBLESTONE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_COMMAND_BLOCK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_CRAFTING_TABLE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_DIAMOND_BLOCK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_DIAMOND_ORE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_DIRT ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_DISPENSER ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_DOUBLE_STONE_SLAB ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_DOUBLE_WOODEN_SLAB ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_DROPPER ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_EMERALD_BLOCK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_EMERALD_ORE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_END_STONE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_FURNACE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_GLOWSTONE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_GOLD_BLOCK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_GOLD_ORE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_GRASS ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_GRAVEL ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_HARDENED_CLAY ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_HAY_BALE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_HUGE_BROWN_MUSHROOM ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_HUGE_RED_MUSHROOM ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_IRON_BLOCK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_IRON_ORE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_JACK_O_LANTERN ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_JUKEBOX ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_LAPIS_BLOCK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_LAPIS_ORE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_LOG ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_MELON ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_MOSSY_COBBLESTONE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_MYCELIUM ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_NETHERRACK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_NETHER_BRICK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_NETHER_QUARTZ_ORE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_NOTE_BLOCK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_OBSIDIAN ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_PACKED_ICE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_PLANKS ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_PUMPKIN ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_QUARTZ_BLOCK ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_REDSTONE_LAMP_OFF ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_REDSTONE_LAMP_ON ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_REDSTONE_ORE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_REDSTONE_ORE_GLOWING].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_SANDSTONE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_SAND ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_SILVERFISH_EGG ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_SPONGE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_STAINED_CLAY ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_WOOL ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_STONE ].m_FullyOccupiesVoxel = true; + ms_Info[E_BLOCK_STONE_BRICKS ].m_FullyOccupiesVoxel = true; +} + + + + + +// This is actually just some code that needs to run at program startup, so it is wrapped into a global var's constructor: +class cBlockInfoInitializer +{ +public: + cBlockInfoInitializer(void) + { + cBlockInfo::Initialize(); + } +} BlockInfoInitializer; + + + + + diff --git a/src/BlockInfo.h b/src/BlockInfo.h new file mode 100644 index 000000000..40c1db867 --- /dev/null +++ b/src/BlockInfo.h @@ -0,0 +1,103 @@ + +#pragma once + + + + + +// fwd: +class cBlockHandler; + + + + + +// tolua_begin +class cBlockInfo +{ +public: + // tolua_end + + cBlockInfo(); + + ~cBlockInfo(); + + /** (Re-)Initializes the internal BlockInfo structures. */ + static void Initialize(void); + + // tolua_begin + + /** Returns the associated BlockInfo structure. */ + static cBlockInfo & Get(BLOCKTYPE a_Type); + + + /** How much light do the blocks emit on their own? */ + NIBBLETYPE m_LightValue; + + /** How much light do the blocks consume? */ + NIBBLETYPE m_SpreadLightFalloff; + + /** Is a block completely transparent? (light doesn't get decreased(?)) */ + bool m_Transparent; + + /** Is a block destroyed after a single hit? */ + bool m_OneHitDig; + + /** Can a piston break this block? */ + bool m_PistonBreakable; + + /** Can this block hold snow atop? */ + bool m_IsSnowable; + + /** Does this block require a tool to drop? */ + bool m_RequiresSpecialTool; + + /** Is this block solid (player cannot walk through)? */ + bool m_IsSolid; + + /** Does this block fully occupy its voxel - is it a 'full' block? */ + bool m_FullyOccupiesVoxel; + + // tolua_end + + /** Associated block handler. */ + cBlockHandler * m_Handler; + + // tolua_begin + + inline static NIBBLETYPE GetLightValue (BLOCKTYPE a_Type) { return Get(a_Type).m_LightValue; } + inline static NIBBLETYPE GetSpreadLightFalloff(BLOCKTYPE a_Type) { return Get(a_Type).m_SpreadLightFalloff; } + inline static bool IsTransparent (BLOCKTYPE a_Type) { return Get(a_Type).m_Transparent; } + inline static bool IsOneHitDig (BLOCKTYPE a_Type) { return Get(a_Type).m_OneHitDig; } + inline static bool IsPistonBreakable (BLOCKTYPE a_Type) { return Get(a_Type).m_PistonBreakable; } + inline static bool IsSnowable (BLOCKTYPE a_Type) { return Get(a_Type).m_IsSnowable; } + inline static bool RequiresSpecialTool (BLOCKTYPE a_Type) { return Get(a_Type).m_RequiresSpecialTool; } + inline static bool IsSolid (BLOCKTYPE a_Type) { return Get(a_Type).m_IsSolid; } + inline static bool FullyOccupiesVoxel (BLOCKTYPE a_Type) { return Get(a_Type).m_FullyOccupiesVoxel; } + + // tolua_end + + inline static cBlockHandler * GetHandler (BLOCKTYPE a_Type) { return Get(a_Type).m_Handler; } + + +protected: + + // TODO xdot: Change to std::vector to support dynamic block IDs + static cBlockInfo ms_Info[256]; + + +}; // tolua_export + + + + + +// Shortcut to get the blockhandler for a specific block +inline cBlockHandler * BlockHandler(BLOCKTYPE a_BlockType) +{ + return cBlockInfo::Get(a_BlockType).m_Handler; +} + + + + diff --git a/src/Blocks/BlockButton.h b/src/Blocks/BlockButton.h index ca6850ced..2db9b7ec7 100644 --- a/src/Blocks/BlockButton.h +++ b/src/Blocks/BlockButton.h @@ -101,7 +101,7 @@ public: AddFaceDirection(a_RelX, a_RelY, a_RelZ, BlockMetaDataToBlockFace(Meta), true); BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn); - return (a_RelY > 0) && (g_BlockIsSolid[BlockIsOn]); + return (a_RelY > 0) && (cBlockInfo::IsSolid(BlockIsOn)); } } ; diff --git a/src/Blocks/BlockCactus.h b/src/Blocks/BlockCactus.h index 83595d2b9..ed441517d 100644 --- a/src/Blocks/BlockCactus.h +++ b/src/Blocks/BlockCactus.h @@ -54,7 +54,7 @@ public: NIBBLETYPE BlockMeta; if ( a_Chunk.UnboundedRelGetBlock(a_RelX + Coords[i].x, a_RelY, a_RelZ + Coords[i].z, BlockType, BlockMeta) && - (g_BlockIsSolid[BlockType]) + cBlockInfo::IsSolid(BlockType) ) { return false; diff --git a/src/Blocks/BlockDirt.h b/src/Blocks/BlockDirt.h index 91534c5e5..544424a04 100644 --- a/src/Blocks/BlockDirt.h +++ b/src/Blocks/BlockDirt.h @@ -36,7 +36,7 @@ public: if (a_RelY < cChunkDef::Height - 1) { BLOCKTYPE Above = a_Chunk.GetBlock(a_RelX, a_RelY + 1, a_RelZ); - if ((!g_BlockTransparent[Above] && !g_BlockOneHitDig[Above]) || IsBlockWater(Above)) + if ((!cBlockInfo::IsTransparent(Above) && !cBlockInfo::IsOneHitDig(Above)) || IsBlockWater(Above)) { a_Chunk.FastSetBlock(a_RelX, a_RelY, a_RelZ, E_BLOCK_DIRT, E_META_DIRT_NORMAL); return; @@ -77,7 +77,7 @@ public: BLOCKTYPE AboveDest; NIBBLETYPE AboveMeta; Chunk->GetBlockTypeMeta(BlockX, BlockY + 1, BlockZ, AboveDest, AboveMeta); - if ((g_BlockOneHitDig[AboveDest] || g_BlockTransparent[AboveDest]) && !IsBlockWater(AboveDest)) + if ((cBlockInfo::IsOneHitDig(AboveDest) || cBlockInfo::IsTransparent(AboveDest)) && !IsBlockWater(AboveDest)) { Chunk->FastSetBlock(BlockX, BlockY, BlockZ, E_BLOCK_GRASS, 0); } diff --git a/src/Blocks/BlockHandler.cpp b/src/Blocks/BlockHandler.cpp index 834727c9a..052f88f7a 100644 --- a/src/Blocks/BlockHandler.cpp +++ b/src/Blocks/BlockHandler.cpp @@ -77,33 +77,6 @@ -bool cBlockHandler::m_HandlerInitialized = false; -cBlockHandler * cBlockHandler::m_BlockHandler[256]; - - - - - -cBlockHandler * cBlockHandler::GetBlockHandler(BLOCKTYPE a_BlockType) -{ - if (!m_HandlerInitialized) - { - // We have to initialize - memset(m_BlockHandler, 0, sizeof(m_BlockHandler)); - m_HandlerInitialized = true; - } - if (m_BlockHandler[a_BlockType] != NULL) - { - return m_BlockHandler[a_BlockType]; - } - - return m_BlockHandler[a_BlockType] = CreateBlockHandler(a_BlockType); -} - - - - - cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) { switch(a_BlockType) @@ -192,7 +165,7 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) case E_BLOCK_REDSTONE_REPEATER_ON: return new cBlockRedstoneRepeaterHandler(a_BlockType); case E_BLOCK_REDSTONE_TORCH_OFF: return new cBlockRedstoneTorchHandler (a_BlockType); case E_BLOCK_REDSTONE_TORCH_ON: return new cBlockRedstoneTorchHandler (a_BlockType); - case E_BLOCK_REDSTONE_WIRE: return new cBlockRedstoneHandler (a_BlockType); + case E_BLOCK_REDSTONE_WIRE: return new cBlockRedstoneHandler (a_BlockType); case E_BLOCK_RED_MUSHROOM: return new cBlockMushroomHandler (a_BlockType); case E_BLOCK_RED_ROSE: return new cBlockFlowerHandler (a_BlockType); case E_BLOCK_SAND: return new cBlockSandHandler (a_BlockType); @@ -231,20 +204,6 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType) -void cBlockHandler::Deinit() -{ - for (int i = 0; i < 256; i++) - { - delete m_BlockHandler[i]; - } - memset(m_BlockHandler, 0, sizeof(m_BlockHandler)); // Don't leave any dangling pointers around, just in case - m_HandlerInitialized = false; -} - - - - - cBlockHandler::cBlockHandler(BLOCKTYPE a_BlockType) { m_BlockType = a_BlockType; @@ -329,7 +288,7 @@ void cBlockHandler::NeighborChanged(cChunkInterface & a_ChunkInterface, int a_Bl { if ((a_BlockY >= 0) && (a_BlockY < cChunkDef::Height)) { - GetBlockHandler(a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ))->OnNeighborChanged(a_ChunkInterface, a_BlockX, a_BlockY, a_BlockZ); + cBlockInfo::GetHandler(a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ))->OnNeighborChanged(a_ChunkInterface, a_BlockX, a_BlockY, a_BlockZ); } } diff --git a/src/Blocks/BlockHandler.h b/src/Blocks/BlockHandler.h index a2913d7f8..c46a46045 100644 --- a/src/Blocks/BlockHandler.h +++ b/src/Blocks/BlockHandler.h @@ -136,30 +136,14 @@ public: /// <returns>Block meta following mirroring</returns> virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) { return a_Meta; } - /// <summary>Get the blockhandler for a specific block id</summary> - static cBlockHandler * GetBlockHandler(BLOCKTYPE a_BlockType); - - /// <summary>Deletes all initialised block handlers</summary> - static void Deinit(); - protected: BLOCKTYPE m_BlockType; // Creates a new blockhandler for the given block type. For internal use only, use ::GetBlockHandler() instead. - static cBlockHandler *CreateBlockHandler(BLOCKTYPE a_BlockType); - static cBlockHandler *m_BlockHandler[256]; - static bool m_HandlerInitialized; //used to detect if the blockhandlers are initialized -}; - - + static cBlockHandler * CreateBlockHandler(BLOCKTYPE a_BlockType); - - -// Shortcut to get the blockhandler for a specific block -inline cBlockHandler * BlockHandler(BLOCKTYPE a_BlockType) -{ - return cBlockHandler::GetBlockHandler(a_BlockType); -} + friend class cBlockInfo; +}; diff --git a/src/Blocks/BlockLadder.h b/src/Blocks/BlockLadder.h index 6a105d5c9..a3e9edc6b 100644 --- a/src/Blocks/BlockLadder.h +++ b/src/Blocks/BlockLadder.h @@ -91,7 +91,7 @@ public: AddFaceDirection( a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, true); - return g_BlockIsSolid[a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ)]; + return cBlockInfo::IsSolid(a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ)); } diff --git a/src/Blocks/BlockLever.h b/src/Blocks/BlockLever.h index 48c7e774b..ef6e102cd 100644 --- a/src/Blocks/BlockLever.h +++ b/src/Blocks/BlockLever.h @@ -102,7 +102,7 @@ public: AddFaceDirection(a_RelX, a_RelY, a_RelZ, BlockMetaDataToBlockFace(Meta), true); BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn); - return (a_RelY > 0) && (g_BlockIsSolid[BlockIsOn]); + return (a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn); } } ; diff --git a/src/Blocks/BlockRail.h b/src/Blocks/BlockRail.h index 52d6f60b3..07e9814cd 100644 --- a/src/Blocks/BlockRail.h +++ b/src/Blocks/BlockRail.h @@ -98,7 +98,7 @@ public: { return false; } - if (!g_BlockIsSolid[a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ)]) + if (!cBlockInfo::IsSolid(a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ))) { return false; } @@ -130,7 +130,7 @@ public: // Too close to the edge, cannot simulate return true; } - return g_BlockIsSolid[BlockType]; + return cBlockInfo::IsSolid(BlockType); } } return true; diff --git a/src/Blocks/BlockRedstone.h b/src/Blocks/BlockRedstone.h index 10de96197..a898c9acb 100644 --- a/src/Blocks/BlockRedstone.h +++ b/src/Blocks/BlockRedstone.h @@ -20,7 +20,7 @@ public: virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override { - return ((a_RelY > 0) && g_BlockFullyOccupiesVoxel[a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ)]); + return ((a_RelY > 0) && cBlockInfo::FullyOccupiesVoxel(a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ))); } diff --git a/src/Blocks/BlockSlab.h b/src/Blocks/BlockSlab.h index 3628303ce..7cd2c97b2 100644 --- a/src/Blocks/BlockSlab.h +++ b/src/Blocks/BlockSlab.h @@ -28,7 +28,7 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - a_Pickups.push_back(cItem(m_BlockType, 1, a_BlockMeta)); + a_Pickups.push_back(cItem(m_BlockType, 1, a_BlockMeta & 0x7)); } @@ -41,7 +41,7 @@ public: { a_BlockType = m_BlockType; BLOCKTYPE Type = (BLOCKTYPE) (a_Player->GetEquippedItem().m_ItemType); - NIBBLETYPE Meta = (NIBBLETYPE)(a_Player->GetEquippedItem().m_ItemDamage & 0x07); + NIBBLETYPE Meta = (NIBBLETYPE) a_Player->GetEquippedItem().m_ItemDamage; // HandlePlaceBlock wants a cItemHandler pointer thing, so let's give it one cItemHandler * ItemHandler = cItemHandler::GetItemHandler(GetDoubleSlabType(Type)); @@ -159,21 +159,30 @@ public: virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override { - if (m_BlockType == E_BLOCK_DOUBLE_STONE_SLAB) - { - m_BlockType = E_BLOCK_STONE_SLAB; - } - else + BLOCKTYPE Block = GetSingleSlabType(m_BlockType); + a_Pickups.push_back(cItem(Block, 2, a_BlockMeta & 0x7)); + } + + inline static BLOCKTYPE GetSingleSlabType(BLOCKTYPE a_BlockType) + { + switch (a_BlockType) { - m_BlockType = E_BLOCK_WOODEN_SLAB; + case E_BLOCK_DOUBLE_STONE_SLAB: return E_BLOCK_STONE_SLAB; + case E_BLOCK_DOUBLE_WOODEN_SLAB: return E_BLOCK_WOODEN_SLAB; } - a_Pickups.push_back(cItem(m_BlockType, 2, a_BlockMeta)); + ASSERT(!"Unhandled double slab type!"); + return a_BlockType; } - virtual const char * GetStepSound(void) override - { - return ((m_BlockType == E_BLOCK_DOUBLE_WOODEN_SLAB) || (m_BlockType == E_BLOCK_DOUBLE_WOODEN_SLAB)) ? "step.wood" : "step.stone"; + { + switch (m_BlockType) + { + case E_BLOCK_DOUBLE_STONE_SLAB: return "step.stone"; + case E_BLOCK_DOUBLE_WOODEN_SLAB: return "step.wood"; + } + ASSERT(!"Unhandled double slab type!"); + return ""; } } ; diff --git a/src/Blocks/BlockSnow.h b/src/Blocks/BlockSnow.h index a3daf0393..b21995d3c 100644 --- a/src/Blocks/BlockSnow.h +++ b/src/Blocks/BlockSnow.h @@ -72,7 +72,7 @@ public: BLOCKTYPE BlockBelow = a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ); NIBBLETYPE MetaBelow = a_Chunk.GetMeta(a_RelX, a_RelY - 1, a_RelZ); - if (g_BlockIsSnowable[BlockBelow] || ((BlockBelow == E_BLOCK_SNOW) && (MetaBelow == 7))) + if (cBlockInfo::IsSnowable(BlockBelow) || ((BlockBelow == E_BLOCK_SNOW) && (MetaBelow == 7))) { // If block below is snowable, or it is a thin slow block and has a meta of 7 (full thin snow block), say yay return true; diff --git a/src/Blocks/BlockTorch.h b/src/Blocks/BlockTorch.h index f2a4c8665..84bbb37ec 100644 --- a/src/Blocks/BlockTorch.h +++ b/src/Blocks/BlockTorch.h @@ -99,7 +99,7 @@ public: static bool CanBePlacedOn(BLOCKTYPE a_BlockType, eBlockFace a_BlockFace) { - if ( !g_BlockFullyOccupiesVoxel[a_BlockType] ) + if ( !cBlockInfo::FullyOccupiesVoxel(a_BlockType) ) { return (a_BlockFace == BLOCK_FACE_TOP); // Allow placement only when torch upright (for glass, etc.); exceptions won't even be sent by client, no need to handle } @@ -129,7 +129,7 @@ public: { return Face; } - else if ((g_BlockFullyOccupiesVoxel[BlockInQuestion]) && (i != BLOCK_FACE_BOTTOM)) + else if (cBlockInfo::FullyOccupiesVoxel(BlockInQuestion) && (i != BLOCK_FACE_BOTTOM)) { // Otherwise, if block in that direction is torch placeable and we haven't gotten to it via the bottom face, return that face return Face; @@ -163,7 +163,7 @@ public: // No need to check for upright orientation, it was done when the torch was placed return true; } - else if ( !g_BlockFullyOccupiesVoxel[BlockInQuestion] ) + else if ( !cBlockInfo::FullyOccupiesVoxel(BlockInQuestion) ) { return false; } diff --git a/src/Blocks/BlockTrapdoor.h b/src/Blocks/BlockTrapdoor.h index 08fc28327..a28861e69 100644 --- a/src/Blocks/BlockTrapdoor.h +++ b/src/Blocks/BlockTrapdoor.h @@ -36,8 +36,10 @@ public: { // Flip the ON bit on/off using the XOR bitwise operation NIBBLETYPE Meta = (a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) ^ 0x04); - a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta); + + cWorld * World = (cWorld *) &a_WorldInterface; + World->BroadcastSoundParticleEffect(1003, a_BlockX, a_BlockY, a_BlockZ, 0, a_Player->GetClientHandle()); } virtual bool GetPlacementBlockTypeMeta( @@ -97,7 +99,7 @@ public: AddFaceDirection(a_RelX, a_RelY, a_RelZ, BlockMetaDataToBlockFace(Meta), true); BLOCKTYPE BlockIsOn; a_Chunk.UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, BlockIsOn); - return (a_RelY > 0) && (g_BlockIsSolid[BlockIsOn]); + return (a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn); } }; diff --git a/src/Blocks/BlockVine.h b/src/Blocks/BlockVine.h index ee7dcee8a..d8c114284 100644 --- a/src/Blocks/BlockVine.h +++ b/src/Blocks/BlockVine.h @@ -70,7 +70,7 @@ public: /// Returns true if the specified block type is good for vines to attach to static bool IsBlockAttachable(BLOCKTYPE a_BlockType) { - return (a_BlockType == E_BLOCK_LEAVES) || g_BlockIsSolid[a_BlockType]; + return (a_BlockType == E_BLOCK_LEAVES) || cBlockInfo::IsSolid(a_BlockType); } diff --git a/src/Blocks/ChunkInterface.cpp b/src/Blocks/ChunkInterface.cpp index b2dda19f4..540581ae7 100644 --- a/src/Blocks/ChunkInterface.cpp +++ b/src/Blocks/ChunkInterface.cpp @@ -6,7 +6,7 @@ bool cChunkInterface::DigBlock(cWorldInterface & a_WorldInterface, int a_X, int a_Y, int a_Z) { - cBlockHandler *Handler = cBlockHandler::GetBlockHandler(GetBlock(a_X, a_Y, a_Z)); + cBlockHandler * Handler = cBlockInfo::GetHandler(GetBlock(a_X, a_Y, a_Z)); Handler->OnDestroyed(*this, a_WorldInterface, a_X, a_Y, a_Z); return m_ChunkMap->DigBlock(a_X, a_Y, a_Z); } diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt index 387556775..5e0731264 100644 --- a/src/CMakeLists.txt +++ b/src/CMakeLists.txt @@ -95,6 +95,7 @@ if (NOT MSVC) #add cpp files here add_library(Bindings Bindings/Bindings + Bindings/DeprecatedBindings Bindings/LuaChunkStay Bindings/LuaState Bindings/LuaWindow diff --git a/src/Chunk.cpp b/src/Chunk.cpp index 8dfbbeef5..a75828461 100644 --- a/src/Chunk.cpp +++ b/src/Chunk.cpp @@ -883,7 +883,7 @@ void cChunk::ApplyWeatherToTop() FastSetBlock(X, Height, Z, E_BLOCK_SNOW, TopMeta - 1); } } - else if (g_BlockIsSnowable[TopBlock]) + else if (cBlockInfo::IsSnowable(TopBlock)) { SetBlock(X, Height + 1, Z, E_BLOCK_SNOW, 0); } @@ -1540,10 +1540,10 @@ void cChunk::FastSetBlock(int a_RelX, int a_RelY, int a_RelZ, BLOCKTYPE a_BlockT SetNibble(m_BlockMeta, index, a_BlockMeta); // ONLY recalculate lighting if it's necessary! - if( - (g_BlockLightValue[OldBlockType ] != g_BlockLightValue[a_BlockType]) || - (g_BlockSpreadLightFalloff[OldBlockType] != g_BlockSpreadLightFalloff[a_BlockType]) || - (g_BlockTransparent[OldBlockType] != g_BlockTransparent[a_BlockType]) + if ( + (cBlockInfo::GetLightValue (OldBlockType) != cBlockInfo::GetLightValue (a_BlockType)) || + (cBlockInfo::GetSpreadLightFalloff(OldBlockType) != cBlockInfo::GetSpreadLightFalloff(a_BlockType)) || + (cBlockInfo::IsTransparent (OldBlockType) != cBlockInfo::IsTransparent (a_BlockType)) ) { m_IsLightValid = false; diff --git a/src/ClientHandle.cpp b/src/ClientHandle.cpp index b08ceb5f6..6982a6227 100644 --- a/src/ClientHandle.cpp +++ b/src/ClientHandle.cpp @@ -819,7 +819,7 @@ void cClientHandle::HandleBlockDigStarted(int a_BlockX, int a_BlockY, int a_Bloc if ( (m_Player->IsGameModeCreative()) || // In creative mode, digging is done immediately - g_BlockOneHitDig[a_OldBlock] // One-hit blocks get destroyed immediately, too + cBlockInfo::IsOneHitDig(a_OldBlock) // One-hit blocks get destroyed immediately, too ) { HandleBlockDigFinished(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_OldBlock, a_OldMeta); @@ -838,7 +838,7 @@ void cClientHandle::HandleBlockDigStarted(int a_BlockX, int a_BlockY, int a_Bloc cWorld * World = m_Player->GetWorld(); cChunkInterface ChunkInterface(World->GetChunkMap()); - cBlockHandler * Handler = cBlockHandler::GetBlockHandler(a_OldBlock); + cBlockHandler * Handler = cBlockInfo::GetHandler(a_OldBlock); Handler->OnDigging(ChunkInterface, *World, m_Player, a_BlockX, a_BlockY, a_BlockZ); cItemHandler * ItemHandler = cItemHandler::GetItemHandler(m_Player->GetEquippedItem()); @@ -852,7 +852,7 @@ void cClientHandle::HandleBlockDigStarted(int a_BlockX, int a_BlockY, int a_Bloc int pZ = a_BlockZ; AddFaceDirection(pX, pY, pZ, a_BlockFace); // Get the block in front of the clicked coordinates (m_bInverse defaulted to false) - Handler = cBlockHandler::GetBlockHandler(World->GetBlock(pX, pY, pZ)); + Handler = cBlockInfo::GetHandler(World->GetBlock(pX, pY, pZ)); if (Handler->IsClickedThrough()) { @@ -963,7 +963,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e BLOCKTYPE BlockType; NIBBLETYPE BlockMeta; World->GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, BlockType, BlockMeta); - cBlockHandler * BlockHandler = cBlockHandler::GetBlockHandler(BlockType); + cBlockHandler * BlockHandler = cBlockInfo::GetHandler(BlockType); if (BlockHandler->IsUseable() && !m_Player->IsCrouched()) { @@ -1043,7 +1043,7 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e if ( cBlockSlabHandler::IsAnySlabType(ClickedBlock) && // Is there a slab already? cBlockSlabHandler::IsAnySlabType(EquippedBlock) && // Is the player placing another slab? - ((ClickedBlockMeta & 0x07) == (EquippedBlockDamage & 0x07)) && // Is it the same slab type? + ((ClickedBlockMeta & 0x07) == EquippedBlockDamage) && // Is it the same slab type? ( (a_BlockFace == BLOCK_FACE_TOP) || // Clicking the top of a bottom slab (a_BlockFace == BLOCK_FACE_BOTTOM) // Clicking the bottom of a top slab diff --git a/src/CompositeChat.h b/src/CompositeChat.h index 51600da4f..27319490d 100644 --- a/src/CompositeChat.h +++ b/src/CompositeChat.h @@ -124,14 +124,15 @@ public: /** Removes all parts from the object. */ void Clear(void); + // tolua_end + + // The following are exported in ManualBindings in order to support chaining - they return *this in Lua (#755) + /** Adds a plain text part, with optional style. The default style is plain white text. */ void AddTextPart(const AString & a_Message, const AString & a_Style = ""); - // tolua_end - - /** Adds a part that is translated client-side, with the formatting parameters and optional style. - Exported in ManualBindings due to AStringVector usage - Lua uses an array-table of strings. */ + /** Adds a part that is translated client-side, with the formatting parameters and optional style. */ void AddClientTranslatedPart(const AString & a_TranslationID, const AStringVector & a_Parameters, const AString & a_Style = ""); // tolua_begin @@ -155,12 +156,14 @@ public: /** Sets the message type, which is indicated by prefixes added to the message when serializing. */ void SetMessageType(eMessageType a_MessageType); - /** Returns the message type set previously by SetMessageType(). */ - eMessageType GetMessageType(void) const { return m_MessageType; } - /** Adds the "underline" style to each part that is an URL. */ void UnderlineUrls(void); + // tolua_begin + + /** Returns the message type set previously by SetMessageType(). */ + eMessageType GetMessageType(void) const { return m_MessageType; } + // tolua_end const cParts & GetParts(void) const { return m_Parts; } diff --git a/src/Defines.h b/src/Defines.h index ba2866f83..6ab2274a4 100644 --- a/src/Defines.h +++ b/src/Defines.h @@ -17,33 +17,6 @@ typedef std::vector<int> cSlotNums; // tolua_begin -/// How much light do the blocks emit on their own? -extern unsigned char g_BlockLightValue[]; - -/// How much light do the block consume? -extern unsigned char g_BlockSpreadLightFalloff[]; - -/// Is a block completely transparent? (light doesn't get decreased(?)) -extern bool g_BlockTransparent[]; - -/// Is a block destroyed after a single hit? -extern bool g_BlockOneHitDig[]; - -/// Can a piston break this block? -extern bool g_BlockPistonBreakable[256]; - -/// Can this block hold snow atop? -extern bool g_BlockIsSnowable[256]; - -/// Does this block require a tool to drop? -extern bool g_BlockRequiresSpecialTool[256]; - -/// Is this block solid (player cannot walk through)? -extern bool g_BlockIsSolid[256]; - -/// Does this block fully occupy it's voxel - is it a 'full' block? -extern bool g_BlockFullyOccupiesVoxel[256]; - /// Experience Orb setup enum { @@ -253,6 +226,56 @@ inline const char * ClickActionToString(eClickAction a_ClickAction) +/** Returns a blockface mirrored around the Y axis (doesn't change up/down). */ +inline eBlockFace MirrorBlockFaceY(eBlockFace a_BlockFace) +{ + switch (a_BlockFace) + { + case BLOCK_FACE_XM: return BLOCK_FACE_XP; + case BLOCK_FACE_XP: return BLOCK_FACE_XM; + case BLOCK_FACE_ZM: return BLOCK_FACE_ZP; + case BLOCK_FACE_ZP: return BLOCK_FACE_ZM; + default: return a_BlockFace; + } +} + + + + + +/** Returns a blockface rotated around the Y axis counter-clockwise. */ +inline eBlockFace RotateBlockFaceCCW(eBlockFace a_BlockFace) +{ + switch (a_BlockFace) + { + case BLOCK_FACE_XM: return BLOCK_FACE_ZP; + case BLOCK_FACE_XP: return BLOCK_FACE_ZM; + case BLOCK_FACE_ZM: return BLOCK_FACE_XM; + case BLOCK_FACE_ZP: return BLOCK_FACE_XP; + default: return a_BlockFace; + } +} + + + + + +inline eBlockFace RotateBlockFaceCW(eBlockFace a_BlockFace) +{ + switch (a_BlockFace) + { + case BLOCK_FACE_XM: return BLOCK_FACE_ZM; + case BLOCK_FACE_XP: return BLOCK_FACE_ZP; + case BLOCK_FACE_ZM: return BLOCK_FACE_XP; + case BLOCK_FACE_ZP: return BLOCK_FACE_XM; + default: return a_BlockFace; + } +} + + + + + inline bool IsValidBlock(int a_BlockType) { if ( @@ -654,7 +677,7 @@ namespace ItemCategory inline bool BlockRequiresSpecialTool(BLOCKTYPE a_BlockType) { if(!IsValidBlock(a_BlockType)) return false; - return g_BlockRequiresSpecialTool[a_BlockType]; + return cBlockInfo::RequiresSpecialTool(a_BlockType); } diff --git a/src/Entities/Entity.cpp b/src/Entities/Entity.cpp index 8554ab2a5..96e8c15a5 100644 --- a/src/Entities/Entity.cpp +++ b/src/Entities/Entity.cpp @@ -582,11 +582,11 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk) int RelBlockZ = BlockZ - (NextChunk->GetPosZ() * cChunkDef::Width); BLOCKTYPE BlockIn = NextChunk->GetBlock( RelBlockX, BlockY, RelBlockZ ); BLOCKTYPE BlockBelow = (BlockY > 0) ? NextChunk->GetBlock(RelBlockX, BlockY - 1, RelBlockZ) : E_BLOCK_AIR; - if (!g_BlockIsSolid[BlockIn]) // Making sure we are not inside a solid block + if (!cBlockInfo::IsSolid(BlockIn)) // Making sure we are not inside a solid block { if (m_bOnGround) // check if it's still on the ground { - if (!g_BlockIsSolid[BlockBelow]) // Check if block below is air or water. + if (!cBlockInfo::IsSolid(BlockBelow)) // Check if block below is air or water. { m_bOnGround = false; } @@ -616,7 +616,7 @@ void cEntity::HandlePhysics(float a_Dt, cChunk & a_Chunk) // The pickup is too close to an unloaded chunk, bail out of any physics handling return; } - if (!g_BlockIsSolid[GotBlock]) + if (!cBlockInfo::IsSolid(GotBlock)) { NextPos.x += gCrossCoords[i].x; NextPos.z += gCrossCoords[i].z; diff --git a/src/Entities/Minecart.cpp b/src/Entities/Minecart.cpp index d854906b7..f52a7b6d9 100644 --- a/src/Entities/Minecart.cpp +++ b/src/Entities/Minecart.cpp @@ -720,7 +720,7 @@ bool cMinecart::TestBlockCollision(NIBBLETYPE a_RailMeta) if (GetSpeedZ() > 0) { BLOCKTYPE Block = m_World->GetBlock((int)floor(GetPosX()), (int)floor(GetPosY()), (int)ceil(GetPosZ())); - if (!IsBlockRail(Block) && g_BlockIsSolid[Block]) + if (!IsBlockRail(Block) && cBlockInfo::IsSolid(Block)) { // We could try to detect a block in front based purely on coordinates, but xoft made a bounding box system - why not use? :P cBoundingBox bbBlock(Vector3d((int)floor(GetPosX()), (int)floor(GetPosY()), (int)ceil(GetPosZ())), 0.5, 1); @@ -737,7 +737,7 @@ bool cMinecart::TestBlockCollision(NIBBLETYPE a_RailMeta) else if (GetSpeedZ() < 0) { BLOCKTYPE Block = m_World->GetBlock((int)floor(GetPosX()), (int)floor(GetPosY()), (int)floor(GetPosZ()) - 1); - if (!IsBlockRail(Block) && g_BlockIsSolid[Block]) + if (!IsBlockRail(Block) && cBlockInfo::IsSolid(Block)) { cBoundingBox bbBlock(Vector3d((int)floor(GetPosX()), (int)floor(GetPosY()), (int)floor(GetPosZ()) - 1), 0.5, 1); cBoundingBox bbMinecart(Vector3d(GetPosX(), floor(GetPosY()), GetPosZ() - 1), GetWidth() / 2, GetHeight()); @@ -757,7 +757,7 @@ bool cMinecart::TestBlockCollision(NIBBLETYPE a_RailMeta) if (GetSpeedX() > 0) { BLOCKTYPE Block = m_World->GetBlock((int)ceil(GetPosX()), (int)floor(GetPosY()), (int)floor(GetPosZ())); - if (!IsBlockRail(Block) && g_BlockIsSolid[Block]) + if (!IsBlockRail(Block) && cBlockInfo::IsSolid(Block)) { cBoundingBox bbBlock(Vector3d((int)ceil(GetPosX()), (int)floor(GetPosY()), (int)floor(GetPosZ())), 0.5, 1); cBoundingBox bbMinecart(Vector3d(GetPosX(), floor(GetPosY()), GetPosZ()), GetWidth() / 2, GetHeight()); @@ -773,7 +773,7 @@ bool cMinecart::TestBlockCollision(NIBBLETYPE a_RailMeta) else if (GetSpeedX() < 0) { BLOCKTYPE Block = m_World->GetBlock((int)floor(GetPosX()) - 1, (int)floor(GetPosY()), (int)floor(GetPosZ())); - if (!IsBlockRail(Block) && g_BlockIsSolid[Block]) + if (!IsBlockRail(Block) && cBlockInfo::IsSolid(Block)) { cBoundingBox bbBlock(Vector3d((int)floor(GetPosX()) - 1, (int)floor(GetPosY()), (int)floor(GetPosZ())), 0.5, 1); cBoundingBox bbMinecart(Vector3d(GetPosX() - 1, floor(GetPosY()), GetPosZ()), GetWidth() / 2, GetHeight()); @@ -798,10 +798,10 @@ bool cMinecart::TestBlockCollision(NIBBLETYPE a_RailMeta) BLOCKTYPE BlockZM = m_World->GetBlock((int)floor(GetPosX()), (int)floor(GetPosY()), (int)floor(GetPosZ()) + 1); BLOCKTYPE BlockZP = m_World->GetBlock((int)floor(GetPosX()), (int)floor(GetPosY()), (int)floor(GetPosZ()) + 1); if ( - (!IsBlockRail(BlockXM) && g_BlockIsSolid[BlockXM]) || - (!IsBlockRail(BlockXP) && g_BlockIsSolid[BlockXP]) || - (!IsBlockRail(BlockZM) && g_BlockIsSolid[BlockZM]) || - (!IsBlockRail(BlockZP) && g_BlockIsSolid[BlockZP]) + (!IsBlockRail(BlockXM) && cBlockInfo::IsSolid(BlockXM)) || + (!IsBlockRail(BlockXP) && cBlockInfo::IsSolid(BlockXP)) || + (!IsBlockRail(BlockZM) && cBlockInfo::IsSolid(BlockZM)) || + (!IsBlockRail(BlockZP) && cBlockInfo::IsSolid(BlockZP)) ) { SetSpeed(0, 0, 0); diff --git a/src/Entities/Player.cpp b/src/Entities/Player.cpp index f419ee09c..42ee14cf3 100644 --- a/src/Entities/Player.cpp +++ b/src/Entities/Player.cpp @@ -858,6 +858,8 @@ void cPlayer::KilledBy(cEntity * a_Killer) else if (a_Killer->IsPlayer()) { GetWorld()->BroadcastChatDeath(Printf("%s was killed by %s", GetName().c_str(), ((cPlayer *)a_Killer)->GetName().c_str())); + + m_World->GetScoreBoard().AddPlayerScore(((cPlayer *)a_Killer)->GetName(), cObjective::otPlayerKillCount, 1); } else { @@ -867,24 +869,7 @@ void cPlayer::KilledBy(cEntity * a_Killer) GetWorld()->BroadcastChatDeath(Printf("%s was killed by a %s", GetName().c_str(), KillerClass.c_str())); } - class cIncrementCounterCB - : public cObjectiveCallback - { - AString m_Name; - public: - cIncrementCounterCB(const AString & a_Name) : m_Name(a_Name) {} - - virtual bool Item(cObjective * a_Objective) override - { - a_Objective->AddScore(m_Name, 1); - return true; - } - } IncrementCounter (GetName()); - - cScoreboard & Scoreboard = m_World->GetScoreBoard(); - - // Update scoreboard objectives - Scoreboard.ForEachObjectiveWith(cObjective::E_TYPE_DEATH_COUNT, IncrementCounter); + m_World->GetScoreBoard().AddPlayerScore(GetName(), cObjective::otDeathCount, 1); } @@ -1919,7 +1904,7 @@ void cPlayer::Detach() { for (int z = PosZ - 2; z <= (PosZ + 2); ++z) { - if (!g_BlockIsSolid[m_World->GetBlock(x, y, z)] && g_BlockIsSolid[m_World->GetBlock(x, y - 1, z)]) + if (!cBlockInfo::IsSolid(m_World->GetBlock(x, y, z)) && cBlockInfo::IsSolid(m_World->GetBlock(x, y - 1, z))) { TeleportToCoords(x, y, z); return; diff --git a/src/Entities/ProjectileEntity.cpp b/src/Entities/ProjectileEntity.cpp index ef82c6e94..03bc0c99d 100644 --- a/src/Entities/ProjectileEntity.cpp +++ b/src/Entities/ProjectileEntity.cpp @@ -50,12 +50,12 @@ protected: LOGD("Hit block %d:%d at {%d, %d, %d} face %d, %s (%s)", a_BlockType, a_BlockMeta, a_BlockX, a_BlockY, a_BlockZ, a_EntryFace, - g_BlockIsSolid[a_BlockType] ? "solid" : "non-solid", + cBlockInfo::IsSolid(a_BlockType) ? "solid" : "non-solid", ItemToString(cItem(a_BlockType, 1, a_BlockMeta)).c_str() ); */ - if (g_BlockIsSolid[a_BlockType]) + if (cBlockInfo::IsSolid(a_BlockType)) { // The projectile hit a solid block // Calculate the exact hit coords: diff --git a/src/Generating/Caves.cpp b/src/Generating/Caves.cpp index 2571e6b77..98b7c8681 100644 --- a/src/Generating/Caves.cpp +++ b/src/Generating/Caves.cpp @@ -762,7 +762,7 @@ void cStructGenWormNestCaves::ClearCache(void) -void cStructGenWormNestCaves::GenStructures(cChunkDesc & a_ChunkDesc) +void cStructGenWormNestCaves::GenFinish(cChunkDesc & a_ChunkDesc) { int ChunkX = a_ChunkDesc.GetChunkX(); int ChunkZ = a_ChunkDesc.GetChunkZ(); @@ -902,7 +902,7 @@ static float GetMarbleNoise( float x, float y, float z, cNoise & a_Noise ) -void cStructGenMarbleCaves::GenStructures(cChunkDesc & a_ChunkDesc) +void cStructGenMarbleCaves::GenFinish(cChunkDesc & a_ChunkDesc) { cNoise Noise(m_Seed); for (int z = 0; z < cChunkDef::Width; z++) @@ -938,7 +938,7 @@ void cStructGenMarbleCaves::GenStructures(cChunkDesc & a_ChunkDesc) /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// // cStructGenDualRidgeCaves: -void cStructGenDualRidgeCaves::GenStructures(cChunkDesc & a_ChunkDesc) +void cStructGenDualRidgeCaves::GenFinish(cChunkDesc & a_ChunkDesc) { for (int z = 0; z < cChunkDef::Width; z++) { diff --git a/src/Generating/Caves.h b/src/Generating/Caves.h index ea7f10bf4..7c45c056b 100644 --- a/src/Generating/Caves.h +++ b/src/Generating/Caves.h @@ -20,7 +20,7 @@ class cStructGenMarbleCaves : - public cStructureGen + public cFinishGen { public: cStructGenMarbleCaves(int a_Seed) : m_Seed(a_Seed) {} @@ -29,8 +29,8 @@ protected: int m_Seed; - // cStructureGen override: - virtual void GenStructures(cChunkDesc & a_ChunkDesc) override; + // cFinishGen override: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; } ; @@ -38,7 +38,7 @@ protected: class cStructGenDualRidgeCaves : - public cStructureGen + public cFinishGen { public: cStructGenDualRidgeCaves(int a_Seed, float a_Threshold) : @@ -55,8 +55,8 @@ protected: int m_Seed; float m_Threshold; - // cStructureGen override: - virtual void GenStructures(cChunkDesc & a_ChunkDesc) override; + // cFinishGen override: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; } ; @@ -64,7 +64,7 @@ protected: class cStructGenWormNestCaves : - public cStructureGen + public cFinishGen { public: cStructGenWormNestCaves(int a_Seed, int a_Size = 64, int a_Grid = 96, int a_MaxOffset = 128) : @@ -94,7 +94,7 @@ protected: void GetCavesForChunk(int a_ChunkX, int a_ChunkZ, cCaveSystems & a_Caves); // cStructGen override: - virtual void GenStructures(cChunkDesc & a_ChunkDesc) override; + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; } ; diff --git a/src/Generating/ChunkDesc.cpp b/src/Generating/ChunkDesc.cpp index d9529b4b0..308fbe423 100644 --- a/src/Generating/ChunkDesc.cpp +++ b/src/Generating/ChunkDesc.cpp @@ -209,6 +209,7 @@ bool cChunkDesc::IsUsingDefaultComposition(void) const void cChunkDesc::SetUseDefaultStructures(bool a_bUseDefaultStructures) { + LOGWARNING("%s: Structures are no longer accounted for, use Finishers instead", __FUNCTION__); m_bUseDefaultStructures = a_bUseDefaultStructures; } @@ -218,6 +219,7 @@ void cChunkDesc::SetUseDefaultStructures(bool a_bUseDefaultStructures) bool cChunkDesc::IsUsingDefaultStructures(void) const { + LOGWARNING("%s: Structures are no longer accounted for, use Finishers instead", __FUNCTION__); return m_bUseDefaultStructures; } diff --git a/src/Generating/ComposableGenerator.cpp b/src/Generating/ComposableGenerator.cpp index cfa7e9c6f..e96e9a645 100644 --- a/src/Generating/ComposableGenerator.cpp +++ b/src/Generating/ComposableGenerator.cpp @@ -133,11 +133,6 @@ cComposableGenerator::~cComposableGenerator() delete *itr; } m_FinishGens.clear(); - for (cStructureGenList::const_iterator itr = m_StructureGens.begin(); itr != m_StructureGens.end(); ++itr) - { - delete *itr; - } - m_StructureGens.clear(); delete m_CompositionGen; m_CompositionGen = NULL; @@ -164,7 +159,6 @@ void cComposableGenerator::Initialize(cIniFile & a_IniFile) InitBiomeGen(a_IniFile); InitHeightGen(a_IniFile); InitCompositionGen(a_IniFile); - InitStructureGens(a_IniFile); InitFinishGens(a_IniFile); } @@ -201,14 +195,6 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a m_CompositionGen->ComposeTerrain(a_ChunkDesc); } - if (a_ChunkDesc.IsUsingDefaultStructures()) - { - for (cStructureGenList::iterator itr = m_StructureGens.begin(); itr != m_StructureGens.end(); ++itr) - { - (*itr)->GenStructures(a_ChunkDesc); - } // for itr - m_StructureGens[] - } - if (a_ChunkDesc.IsUsingDefaultFinish()) { for (cFinishGenList::iterator itr = m_FinishGens.begin(); itr != m_FinishGens.end(); ++itr) @@ -290,35 +276,69 @@ void cComposableGenerator::InitCompositionGen(cIniFile & a_IniFile) -void cComposableGenerator::InitStructureGens(cIniFile & a_IniFile) +void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) { - AString Structures = a_IniFile.GetValueSet("Generator", "Structures", "Ravines, WormNestCaves, WaterLakes, LavaLakes, OreNests, Trees"); - int Seed = m_ChunkGenerator.GetSeed(); - AStringVector Str = StringSplitAndTrim(Structures, ","); + eDimension Dimension = StringToDimension(a_IniFile.GetValue("General", "Dimension", "Overworld")); + + // Older configuration used "Structures" in addition to "Finishers"; we don't distinguish between the two anymore (#398) + // Therefore, we load Structures from the ini file for compatibility, but move its contents over to Finishers: + AString Structures = a_IniFile.GetValue("Generator", "Structures", ""); + AString Finishers = a_IniFile.GetValueSet("Generator", "Finishers", "Ravines, WormNestCaves, WaterLakes, LavaLakes, OreNests, Trees, SprinkleFoliage, Ice, Snow, Lilypads, BottomLava, DeadBushes, PreSimulator"); + if (!Structures.empty()) + { + LOGINFO("[Generator].Structures is deprecated, moving the contents to [Generator].Finishers."); + // Structures used to generate before Finishers, so place them first: + Structures.append(", "); + Finishers = Structures + Finishers; + a_IniFile.SetValue("Generator", "Finishers", Finishers); + } + a_IniFile.DeleteValue("Generator", "Structures"); + + // Create all requested finishers: + AStringVector Str = StringSplitAndTrim(Finishers, ","); for (AStringVector::const_iterator itr = Str.begin(); itr != Str.end(); ++itr) { - if (NoCaseCompare(*itr, "DualRidgeCaves") == 0) + // Finishers, alpha-sorted: + if (NoCaseCompare(*itr, "BottomLava") == 0) { - float Threshold = (float)a_IniFile.GetValueSetF("Generator", "DualRidgeCavesThreshold", 0.3); - m_StructureGens.push_back(new cStructGenDualRidgeCaves(Seed, Threshold)); + int DefaultBottomLavaLevel = (Dimension == dimNether) ? 30 : 10; + int BottomLavaLevel = a_IniFile.GetValueSetI("Generator", "BottomLavaLevel", DefaultBottomLavaLevel); + m_FinishGens.push_back(new cFinishGenBottomLava(BottomLavaLevel)); + } + else if (NoCaseCompare(*itr, "DeadBushes") == 0) + { + m_FinishGens.push_back(new cFinishGenSingleBiomeSingleTopBlock(Seed, E_BLOCK_DEAD_BUSH, biDesert, 2, E_BLOCK_SAND, E_BLOCK_SAND)); } else if (NoCaseCompare(*itr, "DirectOverhangs") == 0) { - m_StructureGens.push_back(new cStructGenDirectOverhangs(Seed)); + m_FinishGens.push_back(new cStructGenDirectOverhangs(Seed)); } else if (NoCaseCompare(*itr, "DistortedMembraneOverhangs") == 0) { - m_StructureGens.push_back(new cStructGenDistortedMembraneOverhangs(Seed)); + m_FinishGens.push_back(new cStructGenDistortedMembraneOverhangs(Seed)); + } + else if (NoCaseCompare(*itr, "DualRidgeCaves") == 0) + { + float Threshold = (float)a_IniFile.GetValueSetF("Generator", "DualRidgeCavesThreshold", 0.3); + m_FinishGens.push_back(new cStructGenDualRidgeCaves(Seed, Threshold)); + } + else if (NoCaseCompare(*itr, "Ice") == 0) + { + m_FinishGens.push_back(new cFinishGenIce); } else if (NoCaseCompare(*itr, "LavaLakes") == 0) { int Probability = a_IniFile.GetValueSetI("Generator", "LavaLakesProbability", 10); - m_StructureGens.push_back(new cStructGenLakes(Seed * 5 + 16873, E_BLOCK_STATIONARY_LAVA, *m_HeightGen, Probability)); + m_FinishGens.push_back(new cStructGenLakes(Seed * 5 + 16873, E_BLOCK_STATIONARY_LAVA, *m_HeightGen, Probability)); + } + else if (NoCaseCompare(*itr, "LavaSprings") == 0) + { + m_FinishGens.push_back(new cFinishGenFluidSprings(Seed, E_BLOCK_LAVA, a_IniFile, Dimension)); } else if (NoCaseCompare(*itr, "MarbleCaves") == 0) { - m_StructureGens.push_back(new cStructGenMarbleCaves(Seed)); + m_FinishGens.push_back(new cStructGenMarbleCaves(Seed)); } else if (NoCaseCompare(*itr, "MineShafts") == 0) { @@ -327,71 +347,11 @@ void cComposableGenerator::InitStructureGens(cIniFile & a_IniFile) int ChanceCorridor = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceCorridor", 600); int ChanceCrossing = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceCrossing", 200); int ChanceStaircase = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceStaircase", 200); - m_StructureGens.push_back(new cStructGenMineShafts( + m_FinishGens.push_back(new cStructGenMineShafts( Seed, GridSize, MaxSystemSize, ChanceCorridor, ChanceCrossing, ChanceStaircase )); } - else if (NoCaseCompare(*itr, "OreNests") == 0) - { - m_StructureGens.push_back(new cStructGenOreNests(Seed)); - } - else if (NoCaseCompare(*itr, "Ravines") == 0) - { - m_StructureGens.push_back(new cStructGenRavines(Seed, 128)); - } - else if (NoCaseCompare(*itr, "Trees") == 0) - { - m_StructureGens.push_back(new cStructGenTrees(Seed, m_BiomeGen, m_HeightGen, m_CompositionGen)); - } - else if (NoCaseCompare(*itr, "WaterLakes") == 0) - { - int Probability = a_IniFile.GetValueSetI("Generator", "WaterLakesProbability", 25); - m_StructureGens.push_back(new cStructGenLakes(Seed * 3 + 652, E_BLOCK_STATIONARY_WATER, *m_HeightGen, Probability)); - } - else if (NoCaseCompare(*itr, "WormNestCaves") == 0) - { - m_StructureGens.push_back(new cStructGenWormNestCaves(Seed)); - } - else - { - LOGWARNING("Unknown structure generator: \"%s\". Ignoring.", itr->c_str()); - } - } // for itr - Str[] -} - - - - - -void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) -{ - int Seed = m_ChunkGenerator.GetSeed(); - eDimension Dimension = StringToDimension(a_IniFile.GetValue("General", "Dimension", "Overworld")); - - AString Finishers = a_IniFile.GetValueSet("Generator", "Finishers", "SprinkleFoliage,Ice,Snow,Lilypads,BottomLava,DeadBushes,PreSimulator"); - AStringVector Str = StringSplitAndTrim(Finishers, ","); - for (AStringVector::const_iterator itr = Str.begin(); itr != Str.end(); ++itr) - { - // Finishers, alpha-sorted: - if (NoCaseCompare(*itr, "BottomLava") == 0) - { - int DefaultBottomLavaLevel = (Dimension == dimNether) ? 30 : 10; - int BottomLavaLevel = a_IniFile.GetValueSetI("Generator", "BottomLavaLevel", DefaultBottomLavaLevel); - m_FinishGens.push_back(new cFinishGenBottomLava(BottomLavaLevel)); - } - else if (NoCaseCompare(*itr, "DeadBushes") == 0) - { - m_FinishGens.push_back(new cFinishGenSingleBiomeSingleTopBlock(Seed, E_BLOCK_DEAD_BUSH, biDesert, 2, E_BLOCK_SAND, E_BLOCK_SAND)); - } - else if (NoCaseCompare(*itr, "Ice") == 0) - { - m_FinishGens.push_back(new cFinishGenIce); - } - else if (NoCaseCompare(*itr, "LavaSprings") == 0) - { - m_FinishGens.push_back(new cFinishGenFluidSprings(Seed, E_BLOCK_LAVA, a_IniFile, Dimension)); - } else if (NoCaseCompare(*itr, "Lilypads") == 0) { m_FinishGens.push_back(new cFinishGenSingleBiomeSingleTopBlock(Seed, E_BLOCK_LILY_PAD, biSwampland, 4, E_BLOCK_WATER, E_BLOCK_STATIONARY_WATER)); @@ -400,10 +360,18 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) { m_FinishGens.push_back(new cFinishGenNetherClumpFoliage(Seed)); } + else if (NoCaseCompare(*itr, "OreNests") == 0) + { + m_FinishGens.push_back(new cStructGenOreNests(Seed)); + } else if (NoCaseCompare(*itr, "PreSimulator") == 0) { m_FinishGens.push_back(new cFinishGenPreSimulator); } + else if (NoCaseCompare(*itr, "Ravines") == 0) + { + m_FinishGens.push_back(new cStructGenRavines(Seed, 128)); + } else if (NoCaseCompare(*itr, "Snow") == 0) { m_FinishGens.push_back(new cFinishGenSnow); @@ -412,10 +380,27 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile) { m_FinishGens.push_back(new cFinishGenSprinkleFoliage(Seed)); } + else if (NoCaseCompare(*itr, "Trees") == 0) + { + m_FinishGens.push_back(new cStructGenTrees(Seed, m_BiomeGen, m_HeightGen, m_CompositionGen)); + } + else if (NoCaseCompare(*itr, "WaterLakes") == 0) + { + int Probability = a_IniFile.GetValueSetI("Generator", "WaterLakesProbability", 25); + m_FinishGens.push_back(new cStructGenLakes(Seed * 3 + 652, E_BLOCK_STATIONARY_WATER, *m_HeightGen, Probability)); + } else if (NoCaseCompare(*itr, "WaterSprings") == 0) { m_FinishGens.push_back(new cFinishGenFluidSprings(Seed, E_BLOCK_WATER, a_IniFile, Dimension)); } + else if (NoCaseCompare(*itr, "WormNestCaves") == 0) + { + m_FinishGens.push_back(new cStructGenWormNestCaves(Seed)); + } + else + { + LOGWARNING("Unknown Finisher in the [Generator] section: \"%s\". Ignoring.", itr->c_str()); + } } // for itr - Str[] } diff --git a/src/Generating/ComposableGenerator.h b/src/Generating/ComposableGenerator.h index 29add0636..6b7627d2e 100644 --- a/src/Generating/ComposableGenerator.h +++ b/src/Generating/ComposableGenerator.h @@ -43,16 +43,16 @@ class cBiomeGen public: virtual ~cBiomeGen() {} // Force a virtual destructor in descendants - /// Generates biomes for the given chunk + /** Generates biomes for the given chunk */ virtual void GenBiomes(int a_ChunkX, int a_ChunkZ, cChunkDef::BiomeMap & a_BiomeMap) = 0; - /// Reads parameters from the ini file, prepares generator for use. + /** Reads parameters from the ini file, prepares generator for use. */ virtual void InitializeBiomeGen(cIniFile & a_IniFile) {} - /// Creates the correct BiomeGen descendant based on the ini file settings and the seed provided. - /// a_CacheOffByDefault gets set to whether the cache should be disabled by default - /// Used in BiomeVisualiser, too. - /// Implemented in BioGen.cpp! + /** Creates the correct BiomeGen descendant based on the ini file settings and the seed provided. + a_CacheOffByDefault gets set to whether the cache should be disabled by default. + Used in BiomeVisualiser, too. + Implemented in BioGen.cpp! */ static cBiomeGen * CreateBiomeGen(cIniFile & a_IniFile, int a_Seed, bool & a_CacheOffByDefault); } ; @@ -72,10 +72,10 @@ class cTerrainHeightGen public: virtual ~cTerrainHeightGen() {} // Force a virtual destructor in descendants - /// Generates heightmap for the given chunk + /** Generates heightmap for the given chunk */ virtual void GenHeightMap(int a_ChunkX, int a_ChunkZ, cChunkDef::HeightMap & a_HeightMap) = 0; - /// Reads parameters from the ini file, prepares generator for use. + /** Reads parameters from the ini file, prepares generator for use. */ virtual void InitializeHeightGen(cIniFile & a_IniFile) {} /** Creates the correct TerrainHeightGen descendant based on the ini file settings and the seed provided. @@ -102,7 +102,7 @@ public: virtual void ComposeTerrain(cChunkDesc & a_ChunkDesc) = 0; - /// Reads parameters from the ini file, prepares generator for use. + /** Reads parameters from the ini file, prepares generator for use. */ virtual void InitializeCompoGen(cIniFile & a_IniFile) {} /** Creates the correct TerrainCompositionGen descendant based on the ini file settings and the seed provided. @@ -116,28 +116,12 @@ public: -/** The interface that a structure generator must implement -Structures are generated after the terrain composition took place. It should modify the blocktype data to account -for whatever structures the generator is generating. -Note that ores are considered structures too, at least from the interface point of view. -Also note that a worldgenerator may contain multiple structure generators, one for each type of structure -*/ -class cStructureGen -{ -public: - virtual ~cStructureGen() {} // Force a virtual destructor in descendants - - virtual void GenStructures(cChunkDesc & a_ChunkDesc) = 0; -} ; - -typedef std::list<cStructureGen *> cStructureGenList; - - - - - /** The interface that a finisher must implement -Finisher implements small additions after all structures have been generated. +Finisher implements changes to the chunk after the rough terrain has been generated. +Examples of finishers are trees, snow, ore, lilypads and others. +Note that a worldgenerator may contain multiple finishers. +Also note that previously we used to distinguish between a structuregen and a finisher; this distinction is +no longer relevant, all structure generators are considered finishers now (#398) */ class cFinishGen { @@ -171,7 +155,6 @@ protected: cBiomeGen * m_BiomeGen; cTerrainHeightGen * m_HeightGen; cTerrainCompositionGen * m_CompositionGen; - cStructureGenList m_StructureGens; cFinishGenList m_FinishGens; // Generators underlying the caches: @@ -180,19 +163,16 @@ protected: cTerrainCompositionGen * m_UnderlyingCompositionGen; - /// Reads the biome gen settings from the ini and initializes m_BiomeGen accordingly + /** Reads the biome gen settings from the ini and initializes m_BiomeGen accordingly */ void InitBiomeGen(cIniFile & a_IniFile); - /// Reads the HeightGen settings from the ini and initializes m_HeightGen accordingly + /** Reads the HeightGen settings from the ini and initializes m_HeightGen accordingly */ void InitHeightGen(cIniFile & a_IniFile); - /// Reads the CompositionGen settings from the ini and initializes m_CompositionGen accordingly + /** Reads the CompositionGen settings from the ini and initializes m_CompositionGen accordingly */ void InitCompositionGen(cIniFile & a_IniFile); - /// Reads the structures to generate from the ini and initializes m_StructureGens accordingly - void InitStructureGens(cIniFile & a_IniFile); - - /// Reads the finishers from the ini and initializes m_FinishGens accordingly + /** Reads the finishers from the ini and initializes m_FinishGens accordingly */ void InitFinishGens(cIniFile & a_IniFile); } ; diff --git a/src/Generating/FinishGen.cpp b/src/Generating/FinishGen.cpp index 02045f76a..f2d66af70 100644 --- a/src/Generating/FinishGen.cpp +++ b/src/Generating/FinishGen.cpp @@ -88,7 +88,7 @@ void cFinishGenNetherClumpFoliage::GenFinish(cChunkDesc & a_ChunkDesc) { continue; } - if (!g_BlockIsSolid[a_ChunkDesc.GetBlockType(PosX, y - 1, PosZ)]) // Only place on solid blocks + if (!cBlockInfo::IsSolid(a_ChunkDesc.GetBlockType(PosX, y - 1, PosZ))) // Only place on solid blocks { continue; } @@ -131,7 +131,7 @@ void cFinishGenNetherClumpFoliage::TryPlaceClump(cChunkDesc & a_ChunkDesc, int a } BLOCKTYPE BlockBelow = a_ChunkDesc.GetBlockType(x, y - 1, z); - if (!g_BlockIsSolid[BlockBelow]) // Only place on solid blocks + if (!cBlockInfo::IsSolid(BlockBelow)) // Only place on solid blocks { continue; } @@ -329,7 +329,7 @@ void cFinishGenSnow::GenFinish(cChunkDesc & a_ChunkDesc) case biFrozenOcean: { int Height = a_ChunkDesc.GetHeight(x, z); - if (g_BlockIsSnowable[a_ChunkDesc.GetBlockType(x, Height, z)]) + if (cBlockInfo::IsSnowable(a_ChunkDesc.GetBlockType(x, Height, z))) { a_ChunkDesc.SetBlockType(x, Height + 1, z, E_BLOCK_SNOW); a_ChunkDesc.SetHeight(x, z, Height + 1); diff --git a/src/Generating/MineShafts.cpp b/src/Generating/MineShafts.cpp index cc39cef7b..d9acc57bb 100644 --- a/src/Generating/MineShafts.cpp +++ b/src/Generating/MineShafts.cpp @@ -1407,7 +1407,7 @@ void cStructGenMineShafts::GetMineShaftSystemsForChunk( -void cStructGenMineShafts::GenStructures(cChunkDesc & a_ChunkDesc) +void cStructGenMineShafts::GenFinish(cChunkDesc & a_ChunkDesc) { int ChunkX = a_ChunkDesc.GetChunkX(); int ChunkZ = a_ChunkDesc.GetChunkZ(); diff --git a/src/Generating/MineShafts.h b/src/Generating/MineShafts.h index c53d3bc53..ba32e75ad 100644 --- a/src/Generating/MineShafts.h +++ b/src/Generating/MineShafts.h @@ -17,7 +17,7 @@ class cStructGenMineShafts : - public cStructureGen + public cFinishGen { public: cStructGenMineShafts( @@ -52,8 +52,8 @@ protected: */ void GetMineShaftSystemsForChunk(int a_ChunkX, int a_ChunkZ, cMineShaftSystems & a_MineShaftSystems); - // cStructureGen overrides: - virtual void GenStructures(cChunkDesc & a_ChunkDesc) override; + // cFinishGen overrides: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; } ; diff --git a/src/Generating/Ravines.cpp b/src/Generating/Ravines.cpp index cfda47e32..e64f55214 100644 --- a/src/Generating/Ravines.cpp +++ b/src/Generating/Ravines.cpp @@ -117,7 +117,7 @@ void cStructGenRavines::ClearCache(void) -void cStructGenRavines::GenStructures(cChunkDesc & a_ChunkDesc) +void cStructGenRavines::GenFinish(cChunkDesc & a_ChunkDesc) { int ChunkX = a_ChunkDesc.GetChunkX(); int ChunkZ = a_ChunkDesc.GetChunkZ(); diff --git a/src/Generating/Ravines.h b/src/Generating/Ravines.h index 05164a5b2..c76b9f19f 100644 --- a/src/Generating/Ravines.h +++ b/src/Generating/Ravines.h @@ -17,7 +17,7 @@ class cStructGenRavines : - public cStructureGen + public cFinishGen { public: cStructGenRavines(int a_Seed, int a_Size); @@ -37,8 +37,8 @@ protected: /// Returns all ravines that *may* intersect the given chunk. All the ravines are valid until the next call to this function. void GetRavinesForChunk(int a_ChunkX, int a_ChunkZ, cRavines & a_Ravines); - // cStructureGen override: - virtual void GenStructures(cChunkDesc & a_ChunkDesc) override; + // cFinishGen override: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; } ; diff --git a/src/Generating/StructGen.cpp b/src/Generating/StructGen.cpp index 47945cc2b..3cc8a09c3 100644 --- a/src/Generating/StructGen.cpp +++ b/src/Generating/StructGen.cpp @@ -54,7 +54,7 @@ const int NEST_SIZE_GRAVEL = 32; /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// // cStructGenTrees: -void cStructGenTrees::GenStructures(cChunkDesc & a_ChunkDesc) +void cStructGenTrees::GenFinish(cChunkDesc & a_ChunkDesc) { int ChunkX = a_ChunkDesc.GetChunkX(); int ChunkZ = a_ChunkDesc.GetChunkZ(); @@ -306,7 +306,7 @@ int cStructGenTrees::GetNumTrees( /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// // cStructGenOreNests: -void cStructGenOreNests::GenStructures(cChunkDesc & a_ChunkDesc) +void cStructGenOreNests::GenFinish(cChunkDesc & a_ChunkDesc) { int ChunkX = a_ChunkDesc.GetChunkX(); int ChunkZ = a_ChunkDesc.GetChunkZ(); @@ -413,7 +413,7 @@ void cStructGenOreNests::GenerateOre(int a_ChunkX, int a_ChunkZ, BLOCKTYPE a_Ore /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// // cStructGenLakes: -void cStructGenLakes::GenStructures(cChunkDesc & a_ChunkDesc) +void cStructGenLakes::GenFinish(cChunkDesc & a_ChunkDesc) { int ChunkX = a_ChunkDesc.GetChunkX(); int ChunkZ = a_ChunkDesc.GetChunkZ(); @@ -545,7 +545,7 @@ cStructGenDirectOverhangs::cStructGenDirectOverhangs(int a_Seed) : -void cStructGenDirectOverhangs::GenStructures(cChunkDesc & a_ChunkDesc) +void cStructGenDirectOverhangs::GenFinish(cChunkDesc & a_ChunkDesc) { // If there is no column of the wanted biome, bail out: if (!HasWantedBiome(a_ChunkDesc)) @@ -665,7 +665,7 @@ cStructGenDistortedMembraneOverhangs::cStructGenDistortedMembraneOverhangs(int a -void cStructGenDistortedMembraneOverhangs::GenStructures(cChunkDesc & a_ChunkDesc) +void cStructGenDistortedMembraneOverhangs::GenFinish(cChunkDesc & a_ChunkDesc) { const NOISE_DATATYPE Frequency = (NOISE_DATATYPE)16; const NOISE_DATATYPE Amount = (NOISE_DATATYPE)1; diff --git a/src/Generating/StructGen.h b/src/Generating/StructGen.h index 853748bb8..9176bc192 100644 --- a/src/Generating/StructGen.h +++ b/src/Generating/StructGen.h @@ -21,7 +21,7 @@ class cStructGenTrees : - public cStructureGen + public cFinishGen { public: cStructGenTrees(int a_Seed, cBiomeGen * a_BiomeGen, cTerrainHeightGen * a_HeightGen, cTerrainCompositionGen * a_CompositionGen) : @@ -64,8 +64,8 @@ protected: const cChunkDef::BiomeMap & a_Biomes ); - // cStructureGen override: - virtual void GenStructures(cChunkDesc & a_ChunkDesc) override; + // cFinishGen override: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; } ; @@ -73,7 +73,7 @@ protected: class cStructGenOreNests : - public cStructureGen + public cFinishGen { public: cStructGenOreNests(int a_Seed) : m_Noise(a_Seed), m_Seed(a_Seed) {} @@ -82,8 +82,8 @@ protected: cNoise m_Noise; int m_Seed; - // cStructureGen override: - virtual void GenStructures(cChunkDesc & a_ChunkDesc) override; + // cFinishGen override: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; void GenerateOre(int a_ChunkX, int a_ChunkZ, BLOCKTYPE a_OreType, int a_MaxHeight, int a_NumNests, int a_NestSize, cChunkDef::BlockTypes & a_BlockTypes, int a_Seq); } ; @@ -93,7 +93,7 @@ protected: class cStructGenLakes : - public cStructureGen + public cFinishGen { public: cStructGenLakes(int a_Seed, BLOCKTYPE a_Fluid, cTerrainHeightGen & a_HeiGen, int a_Probability) : @@ -112,8 +112,8 @@ protected: cTerrainHeightGen & m_HeiGen; int m_Probability; ///< Chance, 0 .. 100, of a chunk having the lake - // cStructureGen override: - virtual void GenStructures(cChunkDesc & a_ChunkDesc) override; + // cFinishGen override: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; /// Creates a lake image for the specified chunk into a_Lake void CreateLakeImage(int a_ChunkX, int a_ChunkZ, cBlockArea & a_Lake); @@ -125,7 +125,7 @@ protected: class cStructGenDirectOverhangs : - public cStructureGen + public cFinishGen { public: cStructGenDirectOverhangs(int a_Seed); @@ -134,8 +134,8 @@ protected: cNoise m_Noise1; cNoise m_Noise2; - // cStructureGen override: - virtual void GenStructures(cChunkDesc & a_ChunkDesc) override; + // cFinishGen override: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; bool HasWantedBiome(cChunkDesc & a_ChunkDesc) const; } ; @@ -145,7 +145,7 @@ protected: class cStructGenDistortedMembraneOverhangs : - public cStructureGen + public cFinishGen { public: cStructGenDistortedMembraneOverhangs(int a_Seed); @@ -156,8 +156,8 @@ protected: cNoise m_NoiseZ; cNoise m_NoiseH; - // cStructureGen override: - virtual void GenStructures(cChunkDesc & a_ChunkDesc) override; + // cFinishGen override: + virtual void GenFinish(cChunkDesc & a_ChunkDesc) override; } ; diff --git a/src/Globals.h b/src/Globals.h index e4737a98a..28805a83f 100644 --- a/src/Globals.h +++ b/src/Globals.h @@ -250,6 +250,7 @@ T Clamp(T a_Value, T a_Min, T a_Max) #include "ChunkDef.h" #include "BiomeDef.h" #include "BlockID.h" +#include "BlockInfo.h" #include "Entities/Effects.h" diff --git a/src/Items/ItemHandler.cpp b/src/Items/ItemHandler.cpp index 507f7fa86..1d357fcf1 100644 --- a/src/Items/ItemHandler.cpp +++ b/src/Items/ItemHandler.cpp @@ -285,7 +285,7 @@ void cItemHandler::OnBlockDestroyed(cWorld * a_World, cPlayer * a_Player, const UNUSED(a_Item); BLOCKTYPE Block = a_World->GetBlock(a_BlockX, a_BlockY, a_BlockZ); - cBlockHandler * Handler = cBlockHandler::GetBlockHandler(Block); + cBlockHandler * Handler = cBlockInfo::GetHandler(Block); if (a_Player->IsGameModeSurvival()) { diff --git a/src/Items/ItemRedstoneDust.h b/src/Items/ItemRedstoneDust.h index 18c6b8615..274d905a5 100644 --- a/src/Items/ItemRedstoneDust.h +++ b/src/Items/ItemRedstoneDust.h @@ -27,7 +27,7 @@ public: BLOCKTYPE & a_BlockType, NIBBLETYPE & a_BlockMeta ) override { - if (!g_BlockFullyOccupiesVoxel[a_World->GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ)]) // Some solid blocks, such as cocoa beans, are not suitable for dust + if (!cBlockInfo::FullyOccupiesVoxel(a_World->GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ))) // Some solid blocks, such as cocoa beans, are not suitable for dust { return false; } diff --git a/src/LightingThread.cpp b/src/LightingThread.cpp index 9c81d004d..44dadb8a9 100644 --- a/src/LightingThread.cpp +++ b/src/LightingThread.cpp @@ -391,7 +391,7 @@ void cLightingThread::PrepareBlockLight(void) int idx = BaseZ + x; for (int y = m_HeightMap[idx], Index = idx + y * BlocksPerYLayer; y >= 0; y--, Index -= BlocksPerYLayer) { - if (g_BlockLightValue[m_BlockTypes[Index]] == 0) + if (cBlockInfo::GetLightValue(m_BlockTypes[Index]) == 0) { continue; } @@ -401,7 +401,7 @@ void cLightingThread::PrepareBlockLight(void) m_SeedIdx1[m_NumSeeds++] = Index; // Light it up: - m_BlockLight[Index] = g_BlockLightValue[m_BlockTypes[Index]]; + m_BlockLight[Index] = cBlockInfo::GetLightValue(m_BlockTypes[Index]); } } } diff --git a/src/LightingThread.h b/src/LightingThread.h index 72d561348..198f27248 100644 --- a/src/LightingThread.h +++ b/src/LightingThread.h @@ -169,13 +169,13 @@ protected: ASSERT(a_DstIdx >= 0); ASSERT(a_DstIdx < (int)ARRAYCOUNT(m_BlockTypes)); - if (a_Light[a_SrcIdx] <= a_Light[a_DstIdx] + g_BlockSpreadLightFalloff[m_BlockTypes[a_DstIdx]]) + if (a_Light[a_SrcIdx] <= a_Light[a_DstIdx] + cBlockInfo::GetSpreadLightFalloff(m_BlockTypes[a_DstIdx])) { // We're not offering more light than the dest block already has return; } - a_Light[a_DstIdx] = a_Light[a_SrcIdx] - g_BlockSpreadLightFalloff[m_BlockTypes[a_DstIdx]]; + a_Light[a_DstIdx] = a_Light[a_SrcIdx] - cBlockInfo::GetSpreadLightFalloff(m_BlockTypes[a_DstIdx]); if (!a_IsSeedOut[a_DstIdx]) { a_IsSeedOut[a_DstIdx] = true; diff --git a/src/MobSpawner.cpp b/src/MobSpawner.cpp index c86268e63..7704f6cf3 100644 --- a/src/MobSpawner.cpp +++ b/src/MobSpawner.cpp @@ -145,7 +145,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R case cMonster::mtBat: { - return (a_RelY <= 63) && (BlockLight <= 4) && (SkyLight <= 4) && (TargetBlock == E_BLOCK_AIR) && (!g_BlockTransparent[BlockAbove]); + return (a_RelY <= 63) && (BlockLight <= 4) && (SkyLight <= 4) && (TargetBlock == E_BLOCK_AIR) && !cBlockInfo::IsTransparent(BlockAbove); } case cMonster::mtChicken: @@ -157,7 +157,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R return ( (TargetBlock == E_BLOCK_AIR) && (BlockAbove == E_BLOCK_AIR) && - (!g_BlockTransparent[BlockBelow]) && + (!cBlockInfo::IsTransparent(BlockBelow)) && (BlockBelow == E_BLOCK_GRASS) && (SkyLight >= 9) ); @@ -188,7 +188,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R (TargetBlock == E_BLOCK_AIR) && (BlockAbove == E_BLOCK_AIR) && (BlockTop == E_BLOCK_AIR) && - (!g_BlockTransparent[BlockBelow]) && + (!cBlockInfo::IsTransparent(BlockBelow)) && (SkyLight <= 7) && (BlockLight <= 7) ); @@ -215,7 +215,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R HaveFloor || ( a_Chunk->UnboundedRelGetBlockType(a_RelX + x, a_RelY - 1, a_RelZ + z, TargetBlock) && - !g_BlockTransparent[TargetBlock] + !cBlockInfo::IsTransparent(TargetBlock) ) ); } @@ -230,7 +230,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R return ( (TargetBlock == E_BLOCK_AIR) && (BlockAbove == E_BLOCK_AIR) && - (!g_BlockTransparent[BlockBelow]) && + (!cBlockInfo::IsTransparent(BlockBelow)) && (SkyLight <= 7) && (BlockLight <= 7) && (m_Random.NextInt(2, a_Biome) == 0) @@ -242,7 +242,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R return ( (TargetBlock == E_BLOCK_AIR) && (BlockAbove == E_BLOCK_AIR) && - (!g_BlockTransparent[BlockBelow]) && + (!cBlockInfo::IsTransparent(BlockBelow)) && ( (a_RelY <= 40) || (a_Biome == biSwampland) ) @@ -255,7 +255,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R return ( (TargetBlock == E_BLOCK_AIR) && (BlockAbove == E_BLOCK_AIR) && - (!g_BlockTransparent[BlockBelow]) && + (!cBlockInfo::IsTransparent(BlockBelow)) && (m_Random.NextInt(20, a_Biome) == 0) ); } diff --git a/src/Mobs/Creeper.cpp b/src/Mobs/Creeper.cpp index 40ee20e44..3471b4cf1 100644 --- a/src/Mobs/Creeper.cpp +++ b/src/Mobs/Creeper.cpp @@ -4,6 +4,7 @@ #include "Creeper.h" #include "../World.h" #include "../Entities/ProjectileEntity.h" +#include "../Entities/Player.h" @@ -13,6 +14,7 @@ cCreeper::cCreeper(void) : super("Creeper", mtCreeper, "mob.creeper.say", "mob.creeper.say", 0.6, 1.8), m_bIsBlowing(false), m_bIsCharged(false), + m_BurnedWithFlintAndSteel(false), m_ExplodingTimer(0) { } @@ -25,12 +27,25 @@ void cCreeper::Tick(float a_Dt, cChunk & a_Chunk) { super::Tick(a_Dt, a_Chunk); - if (!ReachedFinalDestination()) + if (!ReachedFinalDestination() && !m_BurnedWithFlintAndSteel) { m_ExplodingTimer = 0; m_bIsBlowing = false; m_World->BroadcastEntityMetadata(*this); } + else + { + if (m_bIsBlowing) + { + m_ExplodingTimer += 1; + } + + if (m_ExplodingTimer == 30) + { + m_World->DoExplosionAt((m_bIsCharged ? 5 : 3), GetPosX(), GetPosY(), GetPosZ(), false, esMonster, this); + Destroy(); + } + } } @@ -80,22 +95,30 @@ void cCreeper::Attack(float a_Dt) { UNUSED(a_Dt); - m_ExplodingTimer += 1; - if (!m_bIsBlowing) { m_World->BroadcastSoundEffect("game.tnt.primed", (int)GetPosX() * 8, (int)GetPosY() * 8, (int)GetPosZ() * 8, 1.f, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64)); m_bIsBlowing = true; m_World->BroadcastEntityMetadata(*this); } - - if (m_ExplodingTimer == 20) - { - m_World->DoExplosionAt((m_bIsCharged ? 5 : 3), GetPosX(), GetPosY(), GetPosZ(), false, esMonster, this); - Destroy(); - } } + +void cCreeper::OnRightClicked(cPlayer & a_Player) +{ + if ((a_Player.GetEquippedItem().m_ItemType == E_ITEM_FLINT_AND_STEEL)) + { + if (!a_Player.IsGameModeCreative()) + { + a_Player.UseEquippedItem(); + } + m_World->BroadcastSoundEffect("game.tnt.primed", (int)GetPosX() * 8, (int)GetPosY() * 8, (int)GetPosZ() * 8, 1.f, (float)(0.75 + ((float)((GetUniqueID() * 23) % 32)) / 64)); + m_bIsBlowing = true; + m_World->BroadcastEntityMetadata(*this); + m_BurnedWithFlintAndSteel = true; + } +} + diff --git a/src/Mobs/Creeper.h b/src/Mobs/Creeper.h index 0f71e5ad2..9abca369b 100644 --- a/src/Mobs/Creeper.h +++ b/src/Mobs/Creeper.h @@ -21,13 +21,14 @@ public: virtual void DoTakeDamage(TakeDamageInfo & a_TDI) override; virtual void Attack(float a_Dt) override; virtual void Tick(float a_Dt, cChunk & a_Chunk) override; + virtual void OnRightClicked(cPlayer & a_Player) override; bool IsBlowing(void) const {return m_bIsBlowing; } bool IsCharged(void) const {return m_bIsCharged; } private: - bool m_bIsBlowing, m_bIsCharged; + bool m_bIsBlowing, m_bIsCharged, m_BurnedWithFlintAndSteel; int m_ExplodingTimer; } ; diff --git a/src/Mobs/Monster.cpp b/src/Mobs/Monster.cpp index ac9137ccd..6e3c91d58 100644 --- a/src/Mobs/Monster.cpp +++ b/src/Mobs/Monster.cpp @@ -148,11 +148,11 @@ void cMonster::TickPathFinding() BLOCKTYPE BlockAtYPP = m_World->GetBlock(gCrossCoords[i].x + PosX, PosY + 2, gCrossCoords[i].z + PosZ); BLOCKTYPE BlockAtYM = m_World->GetBlock(gCrossCoords[i].x + PosX, PosY - 1, gCrossCoords[i].z + PosZ); - if ((!g_BlockIsSolid[BlockAtY]) && (!g_BlockIsSolid[BlockAtYP]) && (!IsBlockLava(BlockAtYM)) && (BlockAtY != E_BLOCK_FENCE) && (BlockAtY != E_BLOCK_FENCE_GATE)) + if ((!cBlockInfo::IsSolid(BlockAtY)) && (!cBlockInfo::IsSolid(BlockAtYP)) && (!IsBlockLava(BlockAtYM)) && (BlockAtY != E_BLOCK_FENCE) && (BlockAtY != E_BLOCK_FENCE_GATE)) { m_PotentialCoordinates.push_back(Vector3d((gCrossCoords[i].x + PosX), PosY, gCrossCoords[i].z + PosZ)); } - else if ((g_BlockIsSolid[BlockAtY]) && (!g_BlockIsSolid[BlockAtYP]) && (!g_BlockIsSolid[BlockAtYPP]) && (!IsBlockLava(BlockAtYM)) && (BlockAtY != E_BLOCK_FENCE) && (BlockAtY != E_BLOCK_FENCE_GATE)) + else if ((cBlockInfo::IsSolid(BlockAtY)) && (!cBlockInfo::IsSolid(BlockAtYP)) && (!cBlockInfo::IsSolid(BlockAtYPP)) && (!IsBlockLava(BlockAtYM)) && (BlockAtY != E_BLOCK_FENCE) && (BlockAtY != E_BLOCK_FENCE_GATE)) { m_PotentialCoordinates.push_back(Vector3d((gCrossCoords[i].x + PosX), PosY + 1, gCrossCoords[i].z + PosZ)); } @@ -416,9 +416,9 @@ int cMonster::FindFirstNonAirBlockPosition(double a_PosX, double a_PosZ) else if (PosY > cChunkDef::Height) PosY = cChunkDef::Height; - if (!g_BlockIsSolid[m_World->GetBlock((int)floor(a_PosX), PosY, (int)floor(a_PosZ))]) + if (!cBlockInfo::IsSolid(m_World->GetBlock((int)floor(a_PosX), PosY, (int)floor(a_PosZ)))) { - while (!g_BlockIsSolid[m_World->GetBlock((int)floor(a_PosX), PosY, (int)floor(a_PosZ))] && (PosY > 0)) + while (!cBlockInfo::IsSolid(m_World->GetBlock((int)floor(a_PosX), PosY, (int)floor(a_PosZ))) && (PosY > 0)) { PosY--; } @@ -427,7 +427,7 @@ int cMonster::FindFirstNonAirBlockPosition(double a_PosX, double a_PosZ) } else { - while (g_BlockIsSolid[m_World->GetBlock((int)floor(a_PosX), PosY, (int)floor(a_PosZ))] && (PosY < cChunkDef::Height)) + while (cBlockInfo::IsSolid(m_World->GetBlock((int)floor(a_PosX), PosY, (int)floor(a_PosZ))) && (PosY < cChunkDef::Height)) { PosY++; } diff --git a/src/Mobs/SnowGolem.cpp b/src/Mobs/SnowGolem.cpp index 67e3a3bb8..c1979a495 100644 --- a/src/Mobs/SnowGolem.cpp +++ b/src/Mobs/SnowGolem.cpp @@ -38,7 +38,7 @@ void cSnowGolem::Tick(float a_Dt, cChunk & a_Chunk) { BLOCKTYPE BlockBelow = m_World->GetBlock((int) floor(GetPosX()), (int) floor(GetPosY()) - 1, (int) floor(GetPosZ())); BLOCKTYPE Block = m_World->GetBlock((int) floor(GetPosX()), (int) floor(GetPosY()), (int) floor(GetPosZ())); - if (Block == E_BLOCK_AIR && g_BlockIsSolid[BlockBelow]) + if (Block == E_BLOCK_AIR && cBlockInfo::IsSolid(BlockBelow)) { m_World->SetBlock((int) floor(GetPosX()), (int) floor(GetPosY()), (int) floor(GetPosZ()), E_BLOCK_SNOW, 0); } diff --git a/src/Mobs/Villager.cpp b/src/Mobs/Villager.cpp index 09a6e2d09..bbd8d6aaa 100644 --- a/src/Mobs/Villager.cpp +++ b/src/Mobs/Villager.cpp @@ -150,7 +150,7 @@ void cVillager::HandleFarmerTryHarvestCrops() BLOCKTYPE CropBlock = m_World->GetBlock(m_CropsPos.x, m_CropsPos.y, m_CropsPos.z); if (IsBlockFarmable(CropBlock) && m_World->GetBlockMeta(m_CropsPos.x, m_CropsPos.y, m_CropsPos.z) == 0x7) { - cBlockHandler * Handler = cBlockHandler::GetBlockHandler(CropBlock); + cBlockHandler * Handler = cBlockInfo::GetHandler(CropBlock); cChunkInterface ChunkInterface(m_World->GetChunkMap()); cBlockInServerPluginInterface PluginInterface(*m_World); Handler->DropBlock(ChunkInterface, *m_World, PluginInterface, this, m_CropsPos.x, m_CropsPos.y, m_CropsPos.z); diff --git a/src/Piston.cpp b/src/Piston.cpp index 5eb14451d..b21d576f3 100644 --- a/src/Piston.cpp +++ b/src/Piston.cpp @@ -242,7 +242,7 @@ bool cPiston::CanPush(BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) bool cPiston::CanBreakPush(BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) { UNUSED(a_BlockMeta); - return g_BlockPistonBreakable[a_BlockType]; + return cBlockInfo::IsPistonBreakable(a_BlockType); } diff --git a/src/Root.cpp b/src/Root.cpp index af2cb9e4b..78c94888d 100644 --- a/src/Root.cpp +++ b/src/Root.cpp @@ -245,7 +245,6 @@ void cRoot::Start(void) delete m_PluginManager; m_PluginManager = NULL; cItemHandler::Deinit(); - cBlockHandler::Deinit(); LOG("Cleaning up..."); delete m_Server; m_Server = NULL; diff --git a/src/Scoreboard.cpp b/src/Scoreboard.cpp index 61ecac5b7..c1da27086 100644 --- a/src/Scoreboard.cpp +++ b/src/Scoreboard.cpp @@ -17,19 +17,19 @@ AString cObjective::TypeToString(eType a_Type) { switch (a_Type) { - case E_TYPE_DUMMY: return "dummy"; - case E_TYPE_DEATH_COUNT: return "deathCount"; - case E_TYPE_PLAYER_KILL_COUNT: return "playerKillCount"; - case E_TYPE_TOTAL_KILL_COUNT: return "totalKillCount"; - case E_TYPE_HEALTH: return "health"; - case E_TYPE_ACHIEVEMENT: return "achievement"; - case E_TYPE_STAT: return "stat"; - case E_TYPE_STAT_ITEM_CRAFT: return "stat.craftItem"; - case E_TYPE_STAT_ITEM_USE: return "stat.useItem"; - case E_TYPE_STAT_ITEM_BREAK: return "stat.breakItem"; - case E_TYPE_STAT_BLOCK_MINE: return "stat.mineBlock"; - case E_TYPE_STAT_ENTITY_KILL: return "stat.killEntity"; - case E_TYPE_STAT_ENTITY_KILLED_BY: return "stat.entityKilledBy"; + case otDummy: return "dummy"; + case otDeathCount: return "deathCount"; + case otPlayerKillCount: return "playerKillCount"; + case otTotalKillCount: return "totalKillCount"; + case otHealth: return "health"; + case otAchievement: return "achievement"; + case otStat: return "stat"; + case otStatItemCraft: return "stat.craftItem"; + case otStatItemUse: return "stat.useItem"; + case otStatItemBreak: return "stat.breakItem"; + case otStatBlockMine: return "stat.mineBlock"; + case otStatEntityKill: return "stat.killEntity"; + case otStatEntityKilledBy: return "stat.entityKilledBy"; default: return ""; } @@ -46,19 +46,19 @@ cObjective::eType cObjective::StringToType(const AString & a_Name) const char * m_String; } TypeMap [] = { - {E_TYPE_DUMMY, "dummy"}, - {E_TYPE_DEATH_COUNT, "deathCount"}, - {E_TYPE_PLAYER_KILL_COUNT, "playerKillCount"}, - {E_TYPE_TOTAL_KILL_COUNT, "totalKillCount"}, - {E_TYPE_HEALTH, "health"}, - {E_TYPE_ACHIEVEMENT, "achievement"}, - {E_TYPE_STAT, "stat"}, - {E_TYPE_STAT_ITEM_CRAFT, "stat.craftItem"}, - {E_TYPE_STAT_ITEM_USE, "stat.useItem"}, - {E_TYPE_STAT_ITEM_BREAK, "stat.breakItem"}, - {E_TYPE_STAT_BLOCK_MINE, "stat.mineBlock"}, - {E_TYPE_STAT_ENTITY_KILL, "stat.killEntity"}, - {E_TYPE_STAT_ENTITY_KILLED_BY, "stat.entityKilledBy"} + {otDummy, "dummy" }, + {otDeathCount, "deathCount" }, + {otPlayerKillCount, "playerKillCount" }, + {otTotalKillCount, "totalKillCount" }, + {otHealth, "health" }, + {otAchievement, "achievement" }, + {otStat, "stat" }, + {otStatItemCraft, "stat.craftItem" }, + {otStatItemUse, "stat.useItem" }, + {otStatItemBreak, "stat.breakItem" }, + {otStatBlockMine, "stat.mineBlock" }, + {otStatEntityKill, "stat.killEntity" }, + {otStatEntityKilledBy, "stat.entityKilledBy"} }; for (size_t i = 0; i < ARRAYCOUNT(TypeMap); i++) { @@ -67,7 +67,7 @@ cObjective::eType cObjective::StringToType(const AString & a_Name) return TypeMap[i].m_Type; } } // for i - TypeMap[] - return E_TYPE_DUMMY; + return otDummy; } @@ -246,6 +246,17 @@ void cTeam::Reset(void) +void cTeam::SetDisplayName(const AString & a_Name) +{ + m_DisplayName = a_Name; + + // TODO 2014-03-01 xdot: Update clients +} + + + + + unsigned int cTeam::GetNumPlayers(void) const { return m_Players.size(); @@ -257,7 +268,7 @@ unsigned int cTeam::GetNumPlayers(void) const cScoreboard::cScoreboard(cWorld * a_World) : m_World(a_World) { - for (int i = 0; i < (int) E_DISPLAY_SLOT_COUNT; ++i) + for (int i = 0; i < (int) dsCount; ++i) { m_Display[i] = NULL; } @@ -301,11 +312,19 @@ bool cScoreboard::RemoveObjective(const AString & a_Name) return false; } - m_Objectives.erase(it); - ASSERT(m_World != NULL); m_World->BroadcastScoreboardObjective(it->second.GetName(), it->second.GetDisplayName(), 1); + for (unsigned int i = 0; i < (unsigned int) dsCount; ++i) + { + if (m_Display[i] == &it->second) + { + SetDisplay(NULL, (eDisplaySlot) i); + } + } + + m_Objectives.erase(it); + return true; } @@ -410,7 +429,7 @@ cTeam * cScoreboard::QueryPlayerTeam(const AString & a_Name) void cScoreboard::SetDisplay(const AString & a_Objective, eDisplaySlot a_Slot) { - ASSERT(a_Slot < E_DISPLAY_SLOT_COUNT); + ASSERT(a_Slot < dsCount); cObjective * Objective = GetObjective(a_Objective); @@ -435,7 +454,7 @@ void cScoreboard::SetDisplay(cObjective * a_Objective, eDisplaySlot a_Slot) cObjective * cScoreboard::GetObjectiveIn(eDisplaySlot a_Slot) { - ASSERT(a_Slot < E_DISPLAY_SLOT_COUNT); + ASSERT(a_Slot < dsCount); return m_Display[a_Slot]; } @@ -444,7 +463,7 @@ cObjective * cScoreboard::GetObjectiveIn(eDisplaySlot a_Slot) -void cScoreboard::ForEachObjectiveWith(cObjective::eType a_Type, cObjectiveCallback& a_Callback) +bool cScoreboard::ForEachObjectiveWith(cObjective::eType a_Type, cObjectiveCallback& a_Callback) { cCSLock Lock(m_CSObjectives); @@ -455,10 +474,66 @@ void cScoreboard::ForEachObjectiveWith(cObjective::eType a_Type, cObjectiveCallb // Call callback if (a_Callback.Item(&it->second)) { - return; + return false; } } } + return true; +} + + + + + +bool cScoreboard::ForEachObjective(cObjectiveCallback& a_Callback) +{ + cCSLock Lock(m_CSObjectives); + + for (cObjectiveMap::iterator it = m_Objectives.begin(); it != m_Objectives.end(); ++it) + { + // Call callback + if (a_Callback.Item(&it->second)) + { + return false; + } + } + return true; +} + + + + + +bool cScoreboard::ForEachTeam(cTeamCallback& a_Callback) +{ + cCSLock Lock(m_CSObjectives); + + for (cTeamMap::iterator it = m_Teams.begin(); it != m_Teams.end(); ++it) + { + // Call callback + if (a_Callback.Item(&it->second)) + { + return false; + } + } + return true; +} + + + + + +void cScoreboard::AddPlayerScore(const AString & a_Name, cObjective::eType a_Type, cObjective::Score a_Value) +{ + cCSLock Lock(m_CSObjectives); + + for (cObjectiveMap::iterator it = m_Objectives.begin(); it != m_Objectives.end(); ++it) + { + if (it->second.GetType() == a_Type) + { + it->second.AddScore(a_Name, a_Value); + } + } } @@ -474,7 +549,7 @@ void cScoreboard::SendTo(cClientHandle & a_Client) it->second.SendTo(a_Client); } - for (int i = 0; i < (int) E_DISPLAY_SLOT_COUNT; ++i) + for (int i = 0; i < (int) dsCount; ++i) { // Avoid race conditions cObjective * Objective = m_Display[i]; diff --git a/src/Scoreboard.h b/src/Scoreboard.h index f64ba2bce..e22ecaeb1 100644 --- a/src/Scoreboard.h +++ b/src/Scoreboard.h @@ -14,9 +14,11 @@ class cObjective; +class cTeam; class cWorld; typedef cItemCallback<cObjective> cObjectiveCallback; +typedef cItemCallback<cTeam> cTeamCallback; @@ -31,23 +33,23 @@ public: enum eType { - E_TYPE_DUMMY, + otDummy, - E_TYPE_DEATH_COUNT, - E_TYPE_PLAYER_KILL_COUNT, - E_TYPE_TOTAL_KILL_COUNT, - E_TYPE_HEALTH, + otDeathCount, + otPlayerKillCount, + otTotalKillCount, + otHealth, - E_TYPE_ACHIEVEMENT, + otAchievement, - E_TYPE_STAT, - E_TYPE_STAT_ITEM_CRAFT, - E_TYPE_STAT_ITEM_USE, - E_TYPE_STAT_ITEM_BREAK, + otStat, + otStatItemCraft, + otStatItemUse, + otStatItemBreak, - E_TYPE_STAT_BLOCK_MINE, - E_TYPE_STAT_ENTITY_KILL, - E_TYPE_STAT_ENTITY_KILLED_BY + otStatBlockMine, + otStatEntityKill, + otStatEntityKilledBy }; // tolua_end @@ -67,31 +69,37 @@ public: const AString & GetName(void) const { return m_Name; } const AString & GetDisplayName(void) const { return m_DisplayName; } - /// Resets the objective + /** Resets the objective */ void Reset(void); - /// Returns the score of the specified player + /** Returns the score of the specified player */ Score GetScore(const AString & a_Name) const; - /// Sets the score of the specified player + /** Sets the score of the specified player */ void SetScore(const AString & a_Name, Score a_Score); - /// Resets the score of the specified player + /** Resets the score of the specified player */ void ResetScore(const AString & a_Name); - /// Adds a_Delta and returns the new score + /** Adds a_Delta and returns the new score */ Score AddScore(const AString & a_Name, Score a_Delta); - /// Subtracts a_Delta and returns the new score + /** Subtracts a_Delta and returns the new score */ Score SubScore(const AString & a_Name, Score a_Delta); void SetDisplayName(const AString & a_Name); // tolua_end - /// Send this objective to the specified client + /** Send this objective to the specified client */ void SendTo(cClientHandle & a_Client); + static const char * GetClassStatic(void) // Needed for ManualBindings's ForEach templates + { + return "cObjective"; + } + + private: typedef std::pair<AString, Score> cTrackedPlayer; @@ -109,7 +117,8 @@ private: friend class cScoreboardSerializer; -}; + +}; // tolua_export @@ -127,21 +136,21 @@ public: const AString & a_Prefix, const AString & a_Suffix ); - /// Adds a new player to the team + // tolua_begin + + /** Adds a new player to the team */ bool AddPlayer(const AString & a_Name); - /// Removes a player from the team + /** Removes a player from the team */ bool RemovePlayer(const AString & a_Name); - /// Returns whether the specified player is in this team + /** Returns whether the specified player is in this team */ bool HasPlayer(const AString & a_Name) const; - /// Removes all registered players + /** Removes all registered players */ void Reset(void); - // tolua_begin - - /// Returns the number of registered players + /** Returns the number of registered players */ unsigned int GetNumPlayers(void) const; bool AllowsFriendlyFire(void) const { return m_AllowsFriendlyFire; } @@ -163,6 +172,11 @@ public: // tolua_end + static const char * GetClassStatic(void) // Needed for ManualBindings's ForEach templates + { + return "cTeam"; + } + private: typedef std::set<AString> cPlayerNameSet; @@ -180,7 +194,8 @@ private: friend class cScoreboardSerializer; -}; + +}; // tolua_export @@ -193,11 +208,11 @@ public: enum eDisplaySlot { - E_DISPLAY_SLOT_LIST = 0, - E_DISPLAY_SLOT_SIDEBAR, - E_DISPLAY_SLOT_NAME, + dsList = 0, + dsSidebar, + dsName, - E_DISPLAY_SLOT_COUNT + dsCount }; // tolua_end @@ -209,44 +224,61 @@ public: // tolua_begin - /// Registers a new scoreboard objective, returns the cObjective instance, NULL on name collision + /** Registers a new scoreboard objective, returns the cObjective instance, NULL on name collision */ cObjective * RegisterObjective(const AString & a_Name, const AString & a_DisplayName, cObjective::eType a_Type); - /// Removes a registered objective, returns true if operation was successful + /** Removes a registered objective, returns true if operation was successful */ bool RemoveObjective(const AString & a_Name); - /// Retrieves the objective with the specified name, NULL if not found + /** Retrieves the objective with the specified name, NULL if not found */ cObjective * GetObjective(const AString & a_Name); - /// Registers a new team, returns the cTeam instance, NULL on name collision + /** Registers a new team, returns the cTeam instance, NULL on name collision */ cTeam * RegisterTeam(const AString & a_Name, const AString & a_DisplayName, const AString & a_Prefix, const AString & a_Suffix); - /// Removes a registered team, returns true if operation was successful + /** Removes a registered team, returns true if operation was successful */ bool RemoveTeam(const AString & a_Name); - /// Retrieves the team with the specified name, NULL if not found + /** Retrieves the team with the specified name, NULL if not found */ cTeam * GetTeam(const AString & a_Name); - cTeam * QueryPlayerTeam(const AString & a_Name); // WARNING: O(n logn) - void SetDisplay(const AString & a_Objective, eDisplaySlot a_Slot); - void SetDisplay(cObjective * a_Objective, eDisplaySlot a_Slot); - cObjective * GetObjectiveIn(eDisplaySlot a_Slot); - /// Execute callback for each objective with the specified type - void ForEachObjectiveWith(cObjective::eType a_Type, cObjectiveCallback& a_Callback); - unsigned int GetNumObjectives(void) const; unsigned int GetNumTeams(void) const; + void AddPlayerScore(const AString & a_Name, cObjective::eType a_Type, cObjective::Score a_Value = 1); + // tolua_end - /// Send this scoreboard to the specified client + /** Send this scoreboard to the specified client */ void SendTo(cClientHandle & a_Client); + cTeam * QueryPlayerTeam(const AString & a_Name); // WARNING: O(n logn) + + /** Execute callback for each objective with the specified type + * + * Returns true if all objectives processed, false if the callback aborted by returning true. + */ + bool ForEachObjectiveWith(cObjective::eType a_Type, cObjectiveCallback& a_Callback); + + /** Execute callback for each objective. + * + * Returns true if all objectives have been processed, false if the callback aborted by returning true. + */ + bool ForEachObjective(cObjectiveCallback& a_Callback); // Exported in ManualBindings.cpp + + /** Execute callback for each team. + * + * Returns true if all teams have been processed, false if the callback aborted by returning true. + */ + bool ForEachTeam(cTeamCallback& a_Callback); // Exported in ManualBindings.cpp + + void SetDisplay(cObjective * a_Objective, eDisplaySlot a_Slot); + private: @@ -265,11 +297,12 @@ private: cWorld * m_World; - cObjective* m_Display[E_DISPLAY_SLOT_COUNT]; + cObjective * m_Display[dsCount]; friend class cScoreboardSerializer; -} ; + +}; // tolua_export diff --git a/src/Simulator/FireSimulator.cpp b/src/Simulator/FireSimulator.cpp index b77fa1658..4967c83f9 100644 --- a/src/Simulator/FireSimulator.cpp +++ b/src/Simulator/FireSimulator.cpp @@ -162,14 +162,27 @@ bool cFireSimulator::IsFuel(BLOCKTYPE a_BlockType) switch (a_BlockType) { case E_BLOCK_PLANKS: + case E_BLOCK_DOUBLE_WOODEN_SLAB: + case E_BLOCK_WOODEN_SLAB: + case E_BLOCK_WOODEN_STAIRS: + case E_BLOCK_SPRUCE_WOOD_STAIRS: + case E_BLOCK_BIRCH_WOOD_STAIRS: + case E_BLOCK_JUNGLE_WOOD_STAIRS: case E_BLOCK_LEAVES: + case E_BLOCK_NEW_LEAVES: case E_BLOCK_LOG: + case E_BLOCK_NEW_LOG: case E_BLOCK_WOOL: case E_BLOCK_BOOKCASE: case E_BLOCK_FENCE: case E_BLOCK_TNT: case E_BLOCK_VINES: case E_BLOCK_HAY_BALE: + case E_BLOCK_TALL_GRASS: + case E_BLOCK_BIG_FLOWER: + case E_BLOCK_DANDELION: + case E_BLOCK_FLOWER: + case E_BLOCK_CARPET: { return true; } @@ -239,7 +252,7 @@ int cFireSimulator::GetBurnStepTime(cChunk * a_Chunk, int a_RelX, int a_RelY, in { return m_BurnStepTimeFuel; } - IsBlockBelowSolid = g_BlockIsSolid[BlockBelow]; + IsBlockBelowSolid = cBlockInfo::IsSolid(BlockBelow); } for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++) diff --git a/src/Simulator/IncrementalRedstoneSimulator.cpp b/src/Simulator/IncrementalRedstoneSimulator.cpp index 91de9e0cc..f377b0aa7 100644 --- a/src/Simulator/IncrementalRedstoneSimulator.cpp +++ b/src/Simulator/IncrementalRedstoneSimulator.cpp @@ -566,14 +566,14 @@ void cIncrementalRedstoneSimulator::HandleRedstoneWire(int a_BlockX, int a_Block { if ((i >= 4) && (i <= 7)) // If we are currently checking for wire surrounding ourself one block above... { - if (g_BlockIsSolid[m_World.GetBlock(a_BlockX, a_BlockY + 1, a_BlockZ)]) // If there is something solid above us (wire cut off)... + if (cBlockInfo::IsSolid(m_World.GetBlock(a_BlockX, a_BlockY + 1, a_BlockZ))) // If there is something solid above us (wire cut off)... { continue; // We don't receive power from that wire } } else if ((i >= 8) && (i <= 11)) // See above, but this is for wire below us { - if (g_BlockIsSolid[m_World.GetBlock(a_BlockX + gCrossCoords[i].x, a_BlockY + gCrossCoords[i].y + 1, a_BlockZ + gCrossCoords[i].z)]) + if (cBlockInfo::IsSolid(m_World.GetBlock(a_BlockX + gCrossCoords[i].x, a_BlockY + gCrossCoords[i].y + 1, a_BlockZ + gCrossCoords[i].z))) { continue; } @@ -937,17 +937,15 @@ void cIncrementalRedstoneSimulator::HandleTrapdoor(int a_BlockX, int a_BlockY, i { if (!AreCoordsSimulated(a_BlockX, a_BlockY, a_BlockZ, true)) { - m_World.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, m_World.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) | 0x4); - m_World.BroadcastSoundParticleEffect(1003, a_BlockX, a_BlockY, a_BlockZ, 0); + m_World.SetTrapdoorOpen(a_BlockX, a_BlockY, a_BlockZ, true); SetPlayerToggleableBlockAsSimulated(a_BlockX, a_BlockY, a_BlockZ, true); - } + } } else { if (!AreCoordsSimulated(a_BlockX, a_BlockY, a_BlockZ, false)) { - m_World.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, m_World.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ) & 0xB); // Take into account that the fourth bit is needed for trapdoors too - m_World.BroadcastSoundParticleEffect(1003, a_BlockX, a_BlockY, a_BlockZ, 0); + m_World.SetTrapdoorOpen(a_BlockX, a_BlockY, a_BlockZ, false); SetPlayerToggleableBlockAsSimulated(a_BlockX, a_BlockY, a_BlockZ, false); } } diff --git a/src/Simulator/IncrementalRedstoneSimulator.h b/src/Simulator/IncrementalRedstoneSimulator.h index e6bc28621..8b7363366 100644 --- a/src/Simulator/IncrementalRedstoneSimulator.h +++ b/src/Simulator/IncrementalRedstoneSimulator.h @@ -170,7 +170,7 @@ private: /* ====== Misc Functions ====== */ /** Returns if a block is viable to be the MiddleBlock of a SetLinkedPowered operation */ - inline static bool IsViableMiddleBlock(BLOCKTYPE Block) { return g_BlockFullyOccupiesVoxel[Block]; } + inline static bool IsViableMiddleBlock(BLOCKTYPE Block) { return cBlockInfo::FullyOccupiesVoxel(Block); } /** Returns if a block is a mechanism (something that accepts power and does something) */ inline static bool IsMechanism(BLOCKTYPE Block) diff --git a/src/Tracer.cpp b/src/Tracer.cpp index ef136302f..968a64439 100644 --- a/src/Tracer.cpp +++ b/src/Tracer.cpp @@ -226,7 +226,7 @@ bool cTracer::Trace( const Vector3f & a_Start, const Vector3f & a_Direction, int BLOCKTYPE BlockID = m_World->GetBlock(pos.x, pos.y, pos.z); // Block is counted as a collision if we are not doing a line of sight and it is solid, // or if the block is not air and not water. That way mobs can still see underwater. - if ((!a_LineOfSight && g_BlockIsSolid[BlockID]) || (a_LineOfSight && (BlockID != E_BLOCK_AIR) && !IsBlockWater(BlockID))) + if ((!a_LineOfSight && cBlockInfo::IsSolid(BlockID)) || (a_LineOfSight && (BlockID != E_BLOCK_AIR) && !IsBlockWater(BlockID))) { BlockHitPosition = pos; int Normal = GetHitNormal(a_Start, End, pos ); diff --git a/src/World.cpp b/src/World.cpp index ffdae2a37..37c07b398 100644 --- a/src/World.cpp +++ b/src/World.cpp @@ -264,8 +264,6 @@ cWorld::cWorld(const AString & a_WorldName) : // Load the scoreboard cScoreboardSerializer Serializer(m_WorldName, &m_Scoreboard); Serializer.Load(); - - m_MapManager.LoadMapData(); } @@ -307,25 +305,52 @@ void cWorld::CastThunderbolt (int a_BlockX, int a_BlockY, int a_BlockZ) +int cWorld::GetDefaultWeatherInterval(eWeather a_Weather) +{ + switch (a_Weather) + { + case eWeather_Sunny: + { + return 14400 + (m_TickRand.randInt() % 4800); // 12 - 16 minutes + } + case eWeather_Rain: + { + return 9600 + (m_TickRand.randInt() % 7200); // 8 - 14 minutes + } + case eWeather_ThunderStorm: + { + return 2400 + (m_TickRand.randInt() % 4800); // 2 - 6 minutes + } + default: + { + LOGWARNING("%s: Missing default weather interval for weather %d.", __FUNCTION__, a_Weather); + return -1; + } + } // switch (Weather) +} + + + + + void cWorld::SetWeather(eWeather a_NewWeather) { // Do the plugins agree? Do they want a different weather? - cRoot::Get()->GetPluginManager()->CallHookWeatherChanging(*this, a_NewWeather); + if (cRoot::Get()->GetPluginManager()->CallHookWeatherChanging(*this, a_NewWeather)) + { + m_WeatherInterval = GetDefaultWeatherInterval(m_Weather); + return; + } // Set new period for the selected weather: - switch (a_NewWeather) + m_WeatherInterval = GetDefaultWeatherInterval(a_NewWeather); + + // The weather can't be found: + if (m_WeatherInterval < 0) { - case eWeather_Sunny: m_WeatherInterval = 14400 + (m_TickRand.randInt() % 4800); break; // 12 - 16 minutes - case eWeather_Rain: m_WeatherInterval = 9600 + (m_TickRand.randInt() % 7200); break; // 8 - 14 minutes - case eWeather_ThunderStorm: m_WeatherInterval = 2400 + (m_TickRand.randInt() % 4800); break; // 2 - 6 minutes - default: - { - LOGWARNING("Requested unknown weather %d, setting sunny for a minute instead.", a_NewWeather); - a_NewWeather = eWeather_Sunny; - m_WeatherInterval = 1200; - break; - } - } // switch (NewWeather) + return; + } + m_Weather = a_NewWeather; BroadcastWeather(m_Weather); @@ -625,13 +650,13 @@ void cWorld::Start(void) m_LastSpawnMonster.insert(std::map<cMonster::eFamily, Int64>::value_type(cMonster::mfAmbient, 0)); m_LastSpawnMonster.insert(std::map<cMonster::eFamily, Int64>::value_type(cMonster::mfWater, 0)); + m_MapManager.LoadMapData(); // Save any changes that the defaults may have done to the ini file: if (!IniFile.WriteFile(m_IniFileName)) { LOGWARNING("Could not write world config to %s", m_IniFileName.c_str()); } - } @@ -1723,7 +1748,7 @@ bool cWorld::GetBlocks(sSetBlockVector & a_Blocks, bool a_ContinueOnFailure) bool cWorld::DigBlock(int a_X, int a_Y, int a_Z) { - cBlockHandler *Handler = cBlockHandler::GetBlockHandler(GetBlock(a_X, a_Y, a_Z)); + cBlockHandler * Handler = cBlockInfo::GetHandler(GetBlock(a_X, a_Y, a_Z)); cChunkInterface ChunkInterface(GetChunkMap()); Handler->OnDestroyed(ChunkInterface, *this, a_X, a_Y, a_Z); return m_ChunkMap->DigBlock(a_X, a_Y, a_Z); @@ -2647,6 +2672,47 @@ bool cWorld::SetCommandBlockCommand(int a_BlockX, int a_BlockY, int a_BlockZ, co +bool cWorld::IsTrapdoorOpen(int a_BlockX, int a_BlockY, int a_BlockZ) +{ + BLOCKTYPE Block; + NIBBLETYPE Meta; + GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, Block, Meta); + if (Block != E_BLOCK_TRAPDOOR) + { + return false; + } + + return (Meta & 0x4) > 0; +} + + + + + +bool cWorld::SetTrapdoorOpen(int a_BlockX, int a_BlockY, int a_BlockZ, bool a_Open) +{ + BLOCKTYPE Block; + NIBBLETYPE Meta; + GetBlockTypeMeta(a_BlockX, a_BlockY, a_BlockZ, Block, Meta); + if (Block != E_BLOCK_TRAPDOOR) + { + return false; + } + + bool IsOpen = (Meta & 0x4) > 0; + if (a_Open != IsOpen) + { + SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, Meta ^ 0x4); + BroadcastSoundParticleEffect(1003, a_BlockX, a_BlockY, a_BlockZ, 0); + return true; + } + return false; +} + + + + + void cWorld::RegenerateChunk(int a_ChunkX, int a_ChunkZ) { m_ChunkMap->MarkChunkRegenerating(a_ChunkX, a_ChunkZ); diff --git a/src/World.h b/src/World.h index 4b74f7aba..93397c014 100644 --- a/src/World.h +++ b/src/World.h @@ -139,6 +139,10 @@ public: BroadcastTimeUpdate(); } + /** Returns the default weather interval for the specific weather type. + Returns -1 for any unknown weather. */ + int GetDefaultWeatherInterval(eWeather a_Weather); + /** Returns the current game mode. Partly OBSOLETE, you should use IsGameModeXXX() functions wherever applicable */ eGameMode GetGameMode(void) const { return m_GameMode; } @@ -342,6 +346,12 @@ public: /** Sets the command block command. Returns true if command changed. */ bool SetCommandBlockCommand(int a_BlockX, int a_BlockY, int a_BlockZ, const AString & a_Command); // tolua_export + /** Is the trapdoor open? Returns false if there is no trapdoor at the specified coords. */ + bool IsTrapdoorOpen(int a_BlockX, int a_BlockY, int a_BlockZ); // tolua_export + + /** Set the state of a trapdoor. Returns true if the trapdoor was update, false if there was no trapdoor at those coords. */ + bool SetTrapdoorOpen(int a_BlockX, int a_BlockY, int a_BlockZ, bool a_Open); // tolua_export + /** Regenerate the given chunk: */ void RegenerateChunk(int a_ChunkX, int a_ChunkZ); // tolua_export diff --git a/src/WorldStorage/FastNBT.h b/src/WorldStorage/FastNBT.h index d68ebd54c..01a9ad274 100644 --- a/src/WorldStorage/FastNBT.h +++ b/src/WorldStorage/FastNBT.h @@ -106,6 +106,10 @@ public: /** Parses and contains the parsed data Also implements data accessor functions for tree traversal and value getters The data pointer passed in the constructor is assumed to be valid throughout the object's life. Care must be taken not to initialize from a temporary. +The parser decomposes the input data into a tree of tags that is stored as an array of cFastNBTTag items, +and accessing the tree is done by using the array indices for tags. Each tag stores the indices for its parent, +first child, last child, prev sibling and next sibling, a value of -1 indicates that the indice is not valid. +Each primitive tag also stores the length of the contained data, in bytes. */ class cParsedNBT { @@ -114,13 +118,32 @@ public: bool IsValid(void) const {return m_IsValid; } + /** Returns the root tag of the hierarchy. */ int GetRoot(void) const {return 0; } + + /** Returns the first child of the specified tag, or -1 if none / not applicable. */ int GetFirstChild (int a_Tag) const { return m_Tags[a_Tag].m_FirstChild; } + + /** Returns the last child of the specified tag, or -1 if none / not applicable. */ int GetLastChild (int a_Tag) const { return m_Tags[a_Tag].m_LastChild; } + + /** Returns the next sibling of the specified tag, or -1 if none. */ int GetNextSibling(int a_Tag) const { return m_Tags[a_Tag].m_NextSibling; } + + /** Returns the previous sibling of the specified tag, or -1 if none. */ int GetPrevSibling(int a_Tag) const { return m_Tags[a_Tag].m_PrevSibling; } - int GetDataLength (int a_Tag) const { return m_Tags[a_Tag].m_DataLength; } + + /** Returns the length of the tag's data, in bytes. + Not valid for Compound or List tags! */ + int GetDataLength (int a_Tag) const + { + ASSERT(m_Tags[a_Tag].m_Type != TAG_List); + ASSERT(m_Tags[a_Tag].m_Type != TAG_Compound); + return m_Tags[a_Tag].m_DataLength; + } + /** Returns the data stored in this tag. + Not valid for Compound or List tags! */ const char * GetData(int a_Tag) const { ASSERT(m_Tags[a_Tag].m_Type != TAG_List); @@ -128,47 +151,56 @@ public: return m_Data + m_Tags[a_Tag].m_DataStart; } + /** Returns the direct child tag of the specified name, or -1 if no such tag. */ int FindChildByName(int a_Tag, const AString & a_Name) const { return FindChildByName(a_Tag, a_Name.c_str(), a_Name.length()); } + /** Returns the direct child tag of the specified name, or -1 if no such tag. */ int FindChildByName(int a_Tag, const char * a_Name, size_t a_NameLength = 0) const; - int FindTagByPath (int a_Tag, const AString & a_Path) const; + + /** Returns the child tag of the specified path (Name1\Name2\Name3...), or -1 if no such tag. */ + int FindTagByPath(int a_Tag, const AString & a_Path) const; eTagType GetType(int a_Tag) const { return m_Tags[a_Tag].m_Type; } - /// Returns the children type for a list tag; undefined on other tags. If list empty, returns TAG_End + /** Returns the children type for a List tag; undefined on other tags. If list empty, returns TAG_End. */ eTagType GetChildrenType(int a_Tag) const { ASSERT(m_Tags[a_Tag].m_Type == TAG_List); return (m_Tags[a_Tag].m_FirstChild < 0) ? TAG_End : m_Tags[m_Tags[a_Tag].m_FirstChild].m_Type; } + /** Returns the value stored in a Byte tag. Not valid for any other tag type. */ inline unsigned char GetByte(int a_Tag) const { ASSERT(m_Tags[a_Tag].m_Type == TAG_Byte); return (unsigned char)(m_Data[m_Tags[a_Tag].m_DataStart]); } + /** Returns the value stored in a Short tag. Not valid for any other tag type. */ inline Int16 GetShort(int a_Tag) const { ASSERT(m_Tags[a_Tag].m_Type == TAG_Short); return GetBEShort(m_Data + m_Tags[a_Tag].m_DataStart); } + /** Returns the value stored in an Int tag. Not valid for any other tag type. */ inline Int32 GetInt(int a_Tag) const { ASSERT(m_Tags[a_Tag].m_Type == TAG_Int); return GetBEInt(m_Data + m_Tags[a_Tag].m_DataStart); } + /** Returns the value stored in a Long tag. Not valid for any other tag type. */ inline Int64 GetLong(int a_Tag) const { ASSERT(m_Tags[a_Tag].m_Type == TAG_Long); return NetworkToHostLong8(m_Data + m_Tags[a_Tag].m_DataStart); } + /** Returns the value stored in a Float tag. Not valid for any other tag type. */ inline float GetFloat(int a_Tag) const { ASSERT(m_Tags[a_Tag].m_Type == TAG_Float); @@ -186,12 +218,21 @@ public: return f; } + /** Returns the value stored in a Double tag. Not valid for any other tag type. */ inline double GetDouble(int a_Tag) const { + // Cause a compile-time error if sizeof(double) != 8 + // If your platform produces a compiler error here, you'll need to add code that manually decodes 64-bit doubles + char Check1[9 - sizeof(double)]; // Fails if sizeof(double) > 8 + char Check2[sizeof(double) - 7]; // Fails if sizeof(double) < 8 + UNUSED(Check1); + UNUSED(Check2); + ASSERT(m_Tags[a_Tag].m_Type == TAG_Double); return NetworkToHostDouble8(m_Data + m_Tags[a_Tag].m_DataStart); } + /** Returns the value stored in a String tag. Not valid for any other tag type. */ inline AString GetString(int a_Tag) const { ASSERT(m_Tags[a_Tag].m_Type == TAG_String); @@ -200,6 +241,7 @@ public: return res; } + /** Returns the tag's name. For tags that are not named, returns an empty string. */ inline AString GetName(int a_Tag) const { AString res; diff --git a/src/WorldStorage/ScoreboardSerializer.cpp b/src/WorldStorage/ScoreboardSerializer.cpp index 9b8b661c4..6c885bb45 100644 --- a/src/WorldStorage/ScoreboardSerializer.cpp +++ b/src/WorldStorage/ScoreboardSerializer.cpp @@ -173,13 +173,13 @@ void cScoreboardSerializer::SaveScoreboardToNBT(cFastNBTWriter & a_Writer) a_Writer.BeginCompound("DisplaySlots"); - cObjective * Objective = m_ScoreBoard->GetObjectiveIn(cScoreboard::E_DISPLAY_SLOT_LIST); + cObjective * Objective = m_ScoreBoard->GetObjectiveIn(cScoreboard::dsList); a_Writer.AddString("slot_0", (Objective == NULL) ? "" : Objective->GetName()); - Objective = m_ScoreBoard->GetObjectiveIn(cScoreboard::E_DISPLAY_SLOT_SIDEBAR); + Objective = m_ScoreBoard->GetObjectiveIn(cScoreboard::dsSidebar); a_Writer.AddString("slot_1", (Objective == NULL) ? "" : Objective->GetName()); - Objective = m_ScoreBoard->GetObjectiveIn(cScoreboard::E_DISPLAY_SLOT_NAME); + Objective = m_ScoreBoard->GetObjectiveIn(cScoreboard::dsName); a_Writer.AddString("slot_2", (Objective == NULL) ? "" : Objective->GetName()); a_Writer.EndCompound(); // DisplaySlots @@ -280,7 +280,7 @@ bool cScoreboardSerializer::LoadScoreboardFromNBT(const cParsedNBT & a_NBT) { AString Name, DisplayName, Prefix, Suffix; - bool AllowsFriendlyFire = false, CanSeeFriendlyInvisible = false; + bool AllowsFriendlyFire = true, CanSeeFriendlyInvisible = false; int CurrLine = a_NBT.FindChildByName(Child, "Name"); if (CurrLine >= 0) @@ -346,7 +346,7 @@ bool cScoreboardSerializer::LoadScoreboardFromNBT(const cParsedNBT & a_NBT) { AString Name = a_NBT.GetString(CurrLine); - m_ScoreBoard->SetDisplay(Name, cScoreboard::E_DISPLAY_SLOT_LIST); + m_ScoreBoard->SetDisplay(Name, cScoreboard::dsList); } CurrLine = a_NBT.FindChildByName(DisplaySlots, "slot_1"); @@ -354,7 +354,7 @@ bool cScoreboardSerializer::LoadScoreboardFromNBT(const cParsedNBT & a_NBT) { AString Name = a_NBT.GetString(CurrLine); - m_ScoreBoard->SetDisplay(Name, cScoreboard::E_DISPLAY_SLOT_SIDEBAR); + m_ScoreBoard->SetDisplay(Name, cScoreboard::dsSidebar); } CurrLine = a_NBT.FindChildByName(DisplaySlots, "slot_2"); @@ -362,7 +362,7 @@ bool cScoreboardSerializer::LoadScoreboardFromNBT(const cParsedNBT & a_NBT) { AString Name = a_NBT.GetString(CurrLine); - m_ScoreBoard->SetDisplay(Name, cScoreboard::E_DISPLAY_SLOT_NAME); + m_ScoreBoard->SetDisplay(Name, cScoreboard::dsName); } return true; |