summaryrefslogtreecommitdiffstats
path: root/src
diff options
context:
space:
mode:
Diffstat (limited to 'src')
-rw-r--r--src/Bindings/DeprecatedBindings.cpp363
-rw-r--r--src/Bindings/LuaState.cpp13
-rw-r--r--src/Bindings/LuaState.h2
-rw-r--r--src/Bindings/ManualBindings.cpp102
-rw-r--r--src/Bindings/ManualBindings.h2
-rw-r--r--src/Bindings/Plugin.h2
-rw-r--r--src/Bindings/PluginLua.cpp45
-rw-r--r--src/Bindings/PluginLua.h2
-rw-r--r--src/Bindings/PluginManager.cpp42
-rw-r--r--src/Bindings/PluginManager.h9
-rw-r--r--src/Bindings/WebPlugin.cpp2
-rw-r--r--src/Bindings/lua51.dll (renamed from src/Bindings/lua5.1.dll)bin167424 -> 167424 bytes
-rw-r--r--src/BlockArea.cpp104
-rw-r--r--src/BlockArea.h23
-rw-r--r--src/BlockEntities/CommandBlockEntity.cpp2
-rw-r--r--src/BlockInfo.cpp3
-rw-r--r--src/BlockTracer.h3
-rw-r--r--src/Blocks/BlockAnvil.h20
-rw-r--r--src/Blocks/BlockBed.h6
-rw-r--r--src/Blocks/BlockButton.h6
-rw-r--r--src/Blocks/BlockCauldron.h2
-rw-r--r--src/Blocks/BlockChest.h6
-rw-r--r--src/Blocks/BlockComparator.h6
-rw-r--r--src/Blocks/BlockCrops.h12
-rw-r--r--src/Blocks/BlockDirt.h10
-rw-r--r--src/Blocks/BlockDoor.cpp84
-rw-r--r--src/Blocks/BlockDoor.h72
-rw-r--r--src/Blocks/BlockDropSpenser.h6
-rw-r--r--src/Blocks/BlockEnderchest.h6
-rw-r--r--src/Blocks/BlockFenceGate.h6
-rw-r--r--src/Blocks/BlockFire.h22
-rw-r--r--src/Blocks/BlockFluid.h2
-rw-r--r--src/Blocks/BlockFurnace.h8
-rw-r--r--src/Blocks/BlockHandler.cpp2
-rw-r--r--src/Blocks/BlockHopper.h21
-rw-r--r--src/Blocks/BlockLadder.h4
-rw-r--r--src/Blocks/BlockLeaves.h19
-rw-r--r--src/Blocks/BlockLever.h37
-rw-r--r--src/Blocks/BlockLilypad.h28
-rw-r--r--src/Blocks/BlockMobHead.h114
-rw-r--r--src/Blocks/BlockNetherWart.h15
-rw-r--r--src/Blocks/BlockPluginInterface.h6
-rw-r--r--src/Blocks/BlockPumpkin.h6
-rw-r--r--src/Blocks/BlockRail.h136
-rw-r--r--src/Blocks/BlockRedstoneRepeater.h6
-rw-r--r--src/Blocks/BlockSign.h35
-rw-r--r--src/Blocks/BlockSlab.h55
-rw-r--r--src/Blocks/BlockStairs.h10
-rw-r--r--src/Blocks/BlockStems.h3
-rw-r--r--src/Blocks/BlockTorch.h6
-rw-r--r--src/Blocks/BlockTrapdoor.h6
-rw-r--r--src/Blocks/BlockVine.h10
-rw-r--r--src/Blocks/BroadcastInterface.h3
-rw-r--r--src/Blocks/MetaRotator.h (renamed from src/Blocks/MetaRotater.h)16
-rw-r--r--src/Blocks/WorldInterface.h3
-rw-r--r--src/CMakeLists.txt29
-rw-r--r--src/Chunk.cpp2
-rw-r--r--src/ClientHandle.cpp28
-rw-r--r--src/ClientHandle.h8
-rw-r--r--src/CompositeChat.cpp56
-rw-r--r--src/CompositeChat.h11
-rw-r--r--src/Endianness.h31
-rw-r--r--src/Entities/Boat.cpp2
-rw-r--r--src/Entities/Effects.h2
-rw-r--r--src/Entities/Entity.h14
-rw-r--r--src/Entities/ExpOrb.h2
-rw-r--r--src/Entities/Floater.h2
-rw-r--r--src/Entities/Player.cpp1
-rw-r--r--src/Entities/ProjectileEntity.cpp12
-rw-r--r--src/ForEachChunkProvider.h2
-rw-r--r--src/Generating/ComposableGenerator.cpp17
-rw-r--r--src/Generating/MineShafts.cpp2
-rw-r--r--src/Generating/NetherFortGen.cpp275
-rw-r--r--src/Generating/NetherFortGen.h86
-rw-r--r--src/Generating/Prefab.cpp107
-rw-r--r--src/Generating/Prefab.h9
-rw-r--r--src/Generating/Prefabs/CMakeLists.txt13
-rw-r--r--src/Generating/Prefabs/NetherFortPrefabs.cpp2758
-rw-r--r--src/Generating/Prefabs/NetherFortPrefabs.h15
-rw-r--r--src/Globals.h13
-rw-r--r--src/Group.cpp2
-rw-r--r--src/HTTPServer/EnvelopeParser.cpp4
-rw-r--r--src/HTTPServer/EnvelopeParser.h30
-rw-r--r--src/HTTPServer/HTTPConnection.cpp14
-rw-r--r--src/HTTPServer/HTTPConnection.h6
-rw-r--r--src/HTTPServer/HTTPFormParser.cpp6
-rw-r--r--src/HTTPServer/HTTPFormParser.h11
-rw-r--r--src/HTTPServer/HTTPMessage.cpp28
-rw-r--r--src/HTTPServer/HTTPMessage.h18
-rw-r--r--src/HTTPServer/HTTPServer.cpp6
-rw-r--r--src/HTTPServer/HTTPServer.h14
-rw-r--r--src/HTTPServer/MultipartParser.cpp8
-rw-r--r--src/HTTPServer/MultipartParser.h39
-rw-r--r--src/HTTPServer/NameValueParser.cpp8
-rw-r--r--src/HTTPServer/NameValueParser.h4
-rw-r--r--src/Inventory.h2
-rw-r--r--src/Item.h2
-rw-r--r--src/ItemGrid.h46
-rw-r--r--src/Items/ItemBoat.h26
-rw-r--r--src/Items/ItemBucket.h8
-rw-r--r--src/Items/ItemEmptyMap.h2
-rw-r--r--src/Items/ItemFishingRod.h4
-rw-r--r--src/Items/ItemHandler.cpp8
-rw-r--r--src/Items/ItemLilypad.h110
-rw-r--r--src/Items/ItemMap.h2
-rw-r--r--src/Items/ItemMinecart.h6
-rw-r--r--src/LightingThread.h8
-rw-r--r--src/MCLogger.cpp23
-rw-r--r--src/MCLogger.h33
-rw-r--r--src/MobSpawner.cpp13
-rw-r--r--src/Mobs/Blaze.cpp2
-rw-r--r--src/Mobs/Blaze.h4
-rw-r--r--src/Mobs/Monster.cpp18
-rw-r--r--src/Mobs/Skeleton.cpp2
-rw-r--r--src/Mobs/Wither.cpp26
-rw-r--r--src/Mobs/Wither.h4
-rw-r--r--src/Noise.cpp2
-rw-r--r--src/Noise.h6
-rw-r--r--src/OSSupport/Errors.cpp2
-rw-r--r--src/OSSupport/File.cpp20
-rw-r--r--src/OSSupport/GZipFile.cpp4
-rw-r--r--src/OSSupport/ListenThread.h20
-rw-r--r--src/OSSupport/Sleep.h2
-rw-r--r--src/OSSupport/SocketThreads.h2
-rw-r--r--src/OSSupport/Thread.h2
-rw-r--r--src/Protocol/ChunkDataSerializer.cpp4
-rw-r--r--src/Protocol/Protocol.h29
-rw-r--r--src/Protocol/Protocol125.cpp170
-rw-r--r--src/Protocol/Protocol125.h2
-rw-r--r--src/Protocol/Protocol132.cpp67
-rw-r--r--src/Protocol/Protocol132.h2
-rw-r--r--src/Protocol/Protocol14x.cpp12
-rw-r--r--src/Protocol/Protocol16x.cpp8
-rw-r--r--src/Protocol/Protocol17x.cpp18
-rw-r--r--src/Protocol/Protocol17x.h6
-rw-r--r--src/Protocol/ProtocolRecognizer.cpp8
-rw-r--r--src/Protocol/ProtocolRecognizer.h2
-rw-r--r--src/RCONServer.cpp2
-rw-r--r--src/RCONServer.h4
-rw-r--r--src/Root.cpp1
-rw-r--r--src/Simulator/FluidSimulator.cpp1
-rw-r--r--src/StringCompression.cpp8
-rw-r--r--src/StringCompression.h4
-rw-r--r--src/StringUtils.cpp22
-rw-r--r--src/StringUtils.h6
-rw-r--r--src/UI/WindowOwner.h4
-rw-r--r--src/WebAdmin.cpp4
-rw-r--r--src/WebAdmin.h10
-rw-r--r--src/World.h6
-rw-r--r--src/WorldStorage/FastNBT.h56
-rw-r--r--src/WorldStorage/FireworksSerializer.h2
-rw-r--r--src/WorldStorage/SchematicFileSerializer.cpp33
152 files changed, 5085 insertions, 1044 deletions
diff --git a/src/Bindings/DeprecatedBindings.cpp b/src/Bindings/DeprecatedBindings.cpp
index 408b1b84a..d51ba2da3 100644
--- a/src/Bindings/DeprecatedBindings.cpp
+++ b/src/Bindings/DeprecatedBindings.cpp
@@ -2,6 +2,7 @@
#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules
#include "DeprecatedBindings.h"
+#undef TOLUA_TEMPLATE_BIND
#include "tolua++/include/tolua++.h"
#include "Plugin.h"
@@ -20,47 +21,23 @@
#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockLightValue
static int tolua_get_AllToLua_g_BlockLightValue(lua_State* tolua_S)
{
- int tolua_index;
+ int BlockType;
#ifndef TOLUA_RELEASE
{
tolua_Error tolua_err;
if (!tolua_isnumber(tolua_S,2,0,&tolua_err))
+ {
tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
+ }
}
#endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetLightValue(tolua_index));
- return 1;
-}
-#endif //#ifndef TOLUA_DISABLE
-
-
-
-
-
-/* set function: g_BlockLightValue */
-#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockLightValue
-static int tolua_set_AllToLua_g_BlockLightValue(lua_State* tolua_S)
-{
- int tolua_index;
- #ifndef TOLUA_RELEASE
+ BlockType = (int)tolua_tonumber(tolua_S, 2, 0);
+ if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID))
{
- tolua_Error tolua_err;
- if (!tolua_isnumber(tolua_S,2,0,&tolua_err))
- tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
+ tolua_error(tolua_S, "array indexing out of range.", NULL);
}
- #endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- cBlockInfo::Get(tolua_index).m_LightValue = ((unsigned char) tolua_tonumber(tolua_S,3,0));
- return 0;
+ tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetLightValue((BLOCKTYPE)BlockType));
+ return 1;
}
#endif //#ifndef TOLUA_DISABLE
@@ -72,7 +49,7 @@ static int tolua_set_AllToLua_g_BlockLightValue(lua_State* tolua_S)
#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockSpreadLightFalloff
static int tolua_get_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S)
{
- int tolua_index;
+ int BlockType;
#ifndef TOLUA_RELEASE
{
tolua_Error tolua_err;
@@ -80,39 +57,13 @@ static int tolua_get_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S)
tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
}
#endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- tolua_pushnumber(tolua_S,(lua_Number)cBlockInfo::GetSpreadLightFalloff(tolua_index));
- return 1;
-}
-#endif //#ifndef TOLUA_DISABLE
-
-
-
-
-
-/* set function: g_BlockSpreadLightFalloff */
-#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockSpreadLightFalloff
-static int tolua_set_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S)
-{
- int tolua_index;
- #ifndef TOLUA_RELEASE
+ BlockType = (int)tolua_tonumber(tolua_S, 2, 0);
+ if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID))
{
- tolua_Error tolua_err;
- if (!tolua_isnumber(tolua_S,2,0,&tolua_err))
- tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
+ tolua_error(tolua_S, "array indexing out of range.", NULL);
}
- #endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- cBlockInfo::Get(tolua_index).m_SpreadLightFalloff = ((unsigned char) tolua_tonumber(tolua_S,3,0));
- return 0;
+ tolua_pushnumber(tolua_S, (lua_Number)cBlockInfo::GetSpreadLightFalloff((BLOCKTYPE)BlockType));
+ return 1;
}
#endif //#ifndef TOLUA_DISABLE
@@ -124,7 +75,7 @@ static int tolua_set_AllToLua_g_BlockSpreadLightFalloff(lua_State* tolua_S)
#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockTransparent
static int tolua_get_AllToLua_g_BlockTransparent(lua_State* tolua_S)
{
- int tolua_index;
+ int BlockType;
#ifndef TOLUA_RELEASE
{
tolua_Error tolua_err;
@@ -132,39 +83,13 @@ static int tolua_get_AllToLua_g_BlockTransparent(lua_State* tolua_S)
tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
}
#endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- tolua_pushboolean(tolua_S, cBlockInfo::IsTransparent(tolua_index));
- return 1;
-}
-#endif //#ifndef TOLUA_DISABLE
-
-
-
-
-
-/* set function: g_BlockTransparent */
-#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockTransparent
-static int tolua_set_AllToLua_g_BlockTransparent(lua_State* tolua_S)
-{
- int tolua_index;
- #ifndef TOLUA_RELEASE
+ BlockType = (int)tolua_tonumber(tolua_S, 2, 0);
+ if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID))
{
- tolua_Error tolua_err;
- if (!tolua_isnumber(tolua_S,2,0,&tolua_err))
- tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
+ tolua_error(tolua_S, "array indexing out of range.", NULL);
}
- #endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- cBlockInfo::Get(tolua_index).m_Transparent = (tolua_toboolean(tolua_S,3,0) != 0);
- return 0;
+ tolua_pushboolean(tolua_S, cBlockInfo::IsTransparent((BLOCKTYPE)BlockType));
+ return 1;
}
#endif //#ifndef TOLUA_DISABLE
@@ -176,7 +101,7 @@ static int tolua_set_AllToLua_g_BlockTransparent(lua_State* tolua_S)
#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockOneHitDig
static int tolua_get_AllToLua_g_BlockOneHitDig(lua_State* tolua_S)
{
- int tolua_index;
+ int BlockType;
#ifndef TOLUA_RELEASE
{
tolua_Error tolua_err;
@@ -184,39 +109,13 @@ static int tolua_get_AllToLua_g_BlockOneHitDig(lua_State* tolua_S)
tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
}
#endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsOneHitDig(tolua_index));
- return 1;
-}
-#endif //#ifndef TOLUA_DISABLE
-
-
-
-
-
-/* set function: g_BlockOneHitDig */
-#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockOneHitDig
-static int tolua_set_AllToLua_g_BlockOneHitDig(lua_State* tolua_S)
-{
- int tolua_index;
- #ifndef TOLUA_RELEASE
+ BlockType = (int)tolua_tonumber(tolua_S, 2, 0);
+ if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID))
{
- tolua_Error tolua_err;
- if (!tolua_isnumber(tolua_S,2,0,&tolua_err))
- tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
+ tolua_error(tolua_S, "array indexing out of range.", NULL);
}
- #endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- cBlockInfo::Get(tolua_index).m_OneHitDig = (tolua_toboolean(tolua_S,3,0) != 0);
- return 0;
+ tolua_pushboolean(tolua_S, cBlockInfo::IsOneHitDig((BLOCKTYPE)BlockType));
+ return 1;
}
#endif //#ifndef TOLUA_DISABLE
@@ -228,7 +127,7 @@ static int tolua_set_AllToLua_g_BlockOneHitDig(lua_State* tolua_S)
#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockPistonBreakable
static int tolua_get_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S)
{
- int tolua_index;
+ int BlockType;
#ifndef TOLUA_RELEASE
{
tolua_Error tolua_err;
@@ -236,39 +135,13 @@ static int tolua_get_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S)
tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
}
#endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0 || tolua_index>=256)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsPistonBreakable(tolua_index));
- return 1;
-}
-#endif //#ifndef TOLUA_DISABLE
-
-
-
-
-
-/* set function: g_BlockPistonBreakable */
-#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockPistonBreakable
-static int tolua_set_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S)
-{
- int tolua_index;
- #ifndef TOLUA_RELEASE
+ BlockType = (int)tolua_tonumber(tolua_S, 2, 0);
+ if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID))
{
- tolua_Error tolua_err;
- if (!tolua_isnumber(tolua_S,2,0,&tolua_err))
- tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
+ tolua_error(tolua_S, "array indexing out of range.", NULL);
}
- #endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0 || tolua_index>=256)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- cBlockInfo::Get(tolua_index).m_PistonBreakable = (tolua_toboolean(tolua_S,3,0) != 0);
- return 0;
+ tolua_pushboolean(tolua_S, cBlockInfo::IsPistonBreakable((BLOCKTYPE)BlockType));
+ return 1;
}
#endif //#ifndef TOLUA_DISABLE
@@ -280,7 +153,7 @@ static int tolua_set_AllToLua_g_BlockPistonBreakable(lua_State* tolua_S)
#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockIsSnowable
static int tolua_get_AllToLua_g_BlockIsSnowable(lua_State* tolua_S)
{
- int tolua_index;
+ int BlockType;
#ifndef TOLUA_RELEASE
{
tolua_Error tolua_err;
@@ -288,39 +161,13 @@ static int tolua_get_AllToLua_g_BlockIsSnowable(lua_State* tolua_S)
tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
}
#endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0 || tolua_index>=256)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsSnowable(tolua_index));
- return 1;
-}
-#endif //#ifndef TOLUA_DISABLE
-
-
-
-
-
-/* set function: g_BlockIsSnowable */
-#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockIsSnowable
-static int tolua_set_AllToLua_g_BlockIsSnowable(lua_State* tolua_S)
-{
- int tolua_index;
- #ifndef TOLUA_RELEASE
+ BlockType = (int)tolua_tonumber(tolua_S, 2, 0);
+ if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID))
{
- tolua_Error tolua_err;
- if (!tolua_isnumber(tolua_S,2,0,&tolua_err))
- tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
+ tolua_error(tolua_S, "array indexing out of range.", NULL);
}
- #endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0 || tolua_index>=256)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- cBlockInfo::Get(tolua_index).m_IsSnowable = (tolua_toboolean(tolua_S,3,0) != 0);
- return 0;
+ tolua_pushboolean(tolua_S, cBlockInfo::IsSnowable((BLOCKTYPE)BlockType));
+ return 1;
}
#endif //#ifndef TOLUA_DISABLE
@@ -332,7 +179,7 @@ static int tolua_set_AllToLua_g_BlockIsSnowable(lua_State* tolua_S)
#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockRequiresSpecialTool
static int tolua_get_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S)
{
- int tolua_index;
+ int BlockType;
#ifndef TOLUA_RELEASE
{
tolua_Error tolua_err;
@@ -340,39 +187,13 @@ static int tolua_get_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S)
tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
}
#endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0 || tolua_index>=256)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- tolua_pushboolean(tolua_S,(bool)cBlockInfo::RequiresSpecialTool(tolua_index));
- return 1;
-}
-#endif //#ifndef TOLUA_DISABLE
-
-
-
-
-
-/* set function: g_BlockRequiresSpecialTool */
-#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockRequiresSpecialTool
-static int tolua_set_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S)
-{
- int tolua_index;
- #ifndef TOLUA_RELEASE
+ BlockType = (int)tolua_tonumber(tolua_S, 2, 0);
+ if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID))
{
- tolua_Error tolua_err;
- if (!tolua_isnumber(tolua_S,2,0,&tolua_err))
- tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
+ tolua_error(tolua_S, "array indexing out of range.", NULL);
}
- #endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0 || tolua_index>=256)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- cBlockInfo::Get(tolua_index).m_RequiresSpecialTool = (tolua_toboolean(tolua_S,3,0) != 0);
- return 0;
+ tolua_pushboolean(tolua_S, cBlockInfo::RequiresSpecialTool((BLOCKTYPE)BlockType));
+ return 1;
}
#endif //#ifndef TOLUA_DISABLE
@@ -384,7 +205,7 @@ static int tolua_set_AllToLua_g_BlockRequiresSpecialTool(lua_State* tolua_S)
#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockIsSolid
static int tolua_get_AllToLua_g_BlockIsSolid(lua_State* tolua_S)
{
- int tolua_index;
+ int BlockType;
#ifndef TOLUA_RELEASE
{
tolua_Error tolua_err;
@@ -392,39 +213,13 @@ static int tolua_get_AllToLua_g_BlockIsSolid(lua_State* tolua_S)
tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
}
#endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0 || tolua_index>=256)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- tolua_pushboolean(tolua_S,(bool)cBlockInfo::IsSolid(tolua_index));
- return 1;
-}
-#endif //#ifndef TOLUA_DISABLE
-
-
-
-
-
-/* set function: g_BlockIsSolid */
-#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockIsSolid
-static int tolua_set_AllToLua_g_BlockIsSolid(lua_State* tolua_S)
-{
- int tolua_index;
- #ifndef TOLUA_RELEASE
+ BlockType = (int)tolua_tonumber(tolua_S, 2, 0);
+ if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID))
{
- tolua_Error tolua_err;
- if (!tolua_isnumber(tolua_S,2,0,&tolua_err))
- tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
+ tolua_error(tolua_S, "array indexing out of range.", NULL);
}
- #endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0 || tolua_index>=256)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- cBlockInfo::Get(tolua_index).m_IsSolid = (tolua_toboolean(tolua_S,3,0) != 0);
- return 0;
+ tolua_pushboolean(tolua_S, (bool)cBlockInfo::IsSolid((BLOCKTYPE)BlockType));
+ return 1;
}
#endif //#ifndef TOLUA_DISABLE
@@ -436,7 +231,7 @@ static int tolua_set_AllToLua_g_BlockIsSolid(lua_State* tolua_S)
#ifndef TOLUA_DISABLE_tolua_get_AllToLua_g_BlockFullyOccupiesVoxel
static int tolua_get_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S)
{
- int tolua_index;
+ int BlockType;
#ifndef TOLUA_RELEASE
{
tolua_Error tolua_err;
@@ -444,39 +239,13 @@ static int tolua_get_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S)
tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
}
#endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0 || tolua_index>=256)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- tolua_pushboolean(tolua_S,(bool)cBlockInfo::FullyOccupiesVoxel(tolua_index));
- return 1;
-}
-#endif //#ifndef TOLUA_DISABLE
-
-
-
-
-
-/* set function: g_BlockFullyOccupiesVoxel */
-#ifndef TOLUA_DISABLE_tolua_set_AllToLua_g_BlockFullyOccupiesVoxel
-static int tolua_set_AllToLua_g_BlockFullyOccupiesVoxel(lua_State* tolua_S)
-{
- int tolua_index;
- #ifndef TOLUA_RELEASE
+ BlockType = (int)tolua_tonumber(tolua_S, 2, 0);
+ if ((BlockType < 0) || (BlockType > E_BLOCK_MAX_TYPE_ID))
{
- tolua_Error tolua_err;
- if (!tolua_isnumber(tolua_S,2,0,&tolua_err))
- tolua_error(tolua_S,"#vinvalid type in array indexing.",&tolua_err);
+ tolua_error(tolua_S, "array indexing out of range.", NULL);
}
- #endif
- tolua_index = (int)tolua_tonumber(tolua_S,2,0);
- #ifndef TOLUA_RELEASE
- if (tolua_index<0 || tolua_index>=256)
- tolua_error(tolua_S,"array indexing out of range.",NULL);
- #endif
- cBlockInfo::Get(tolua_index).m_FullyOccupiesVoxel = (tolua_toboolean(tolua_S,3,0) != 0);
- return 0;
+ tolua_pushboolean(tolua_S, (bool)cBlockInfo::FullyOccupiesVoxel((BLOCKTYPE)BlockType));
+ return 1;
}
#endif //#ifndef TOLUA_DISABLE
@@ -488,15 +257,15 @@ void DeprecatedBindings::Bind(lua_State * tolua_S)
{
tolua_beginmodule(tolua_S, NULL);
- tolua_array(tolua_S, "g_BlockLightValue", tolua_get_AllToLua_g_BlockLightValue, tolua_set_AllToLua_g_BlockLightValue);
- tolua_array(tolua_S, "g_BlockSpreadLightFalloff", tolua_get_AllToLua_g_BlockSpreadLightFalloff, tolua_set_AllToLua_g_BlockSpreadLightFalloff);
- tolua_array(tolua_S, "g_BlockTransparent", tolua_get_AllToLua_g_BlockTransparent, tolua_set_AllToLua_g_BlockTransparent);
- tolua_array(tolua_S, "g_BlockOneHitDig", tolua_get_AllToLua_g_BlockOneHitDig, tolua_set_AllToLua_g_BlockOneHitDig);
- tolua_array(tolua_S, "g_BlockPistonBreakable", tolua_get_AllToLua_g_BlockPistonBreakable, tolua_set_AllToLua_g_BlockPistonBreakable);
- tolua_array(tolua_S, "g_BlockIsSnowable", tolua_get_AllToLua_g_BlockIsSnowable, tolua_set_AllToLua_g_BlockIsSnowable);
- tolua_array(tolua_S, "g_BlockRequiresSpecialTool", tolua_get_AllToLua_g_BlockRequiresSpecialTool, tolua_set_AllToLua_g_BlockRequiresSpecialTool);
- tolua_array(tolua_S, "g_BlockIsSolid", tolua_get_AllToLua_g_BlockIsSolid, tolua_set_AllToLua_g_BlockIsSolid);
- tolua_array(tolua_S, "g_BlockFullyOccupiesVoxel", tolua_get_AllToLua_g_BlockFullyOccupiesVoxel, tolua_set_AllToLua_g_BlockFullyOccupiesVoxel);
+ tolua_array(tolua_S, "g_BlockLightValue", tolua_get_AllToLua_g_BlockLightValue, NULL);
+ tolua_array(tolua_S, "g_BlockSpreadLightFalloff", tolua_get_AllToLua_g_BlockSpreadLightFalloff, NULL);
+ tolua_array(tolua_S, "g_BlockTransparent", tolua_get_AllToLua_g_BlockTransparent, NULL);
+ tolua_array(tolua_S, "g_BlockOneHitDig", tolua_get_AllToLua_g_BlockOneHitDig, NULL);
+ tolua_array(tolua_S, "g_BlockPistonBreakable", tolua_get_AllToLua_g_BlockPistonBreakable, NULL);
+ tolua_array(tolua_S, "g_BlockIsSnowable", tolua_get_AllToLua_g_BlockIsSnowable, NULL);
+ tolua_array(tolua_S, "g_BlockRequiresSpecialTool", tolua_get_AllToLua_g_BlockRequiresSpecialTool, NULL);
+ tolua_array(tolua_S, "g_BlockIsSolid", tolua_get_AllToLua_g_BlockIsSolid, NULL);
+ tolua_array(tolua_S, "g_BlockFullyOccupiesVoxel", tolua_get_AllToLua_g_BlockFullyOccupiesVoxel, NULL);
tolua_endmodule(tolua_S);
}
diff --git a/src/Bindings/LuaState.cpp b/src/Bindings/LuaState.cpp
index 47380b8a7..a33459ad2 100644
--- a/src/Bindings/LuaState.cpp
+++ b/src/Bindings/LuaState.cpp
@@ -11,6 +11,7 @@ extern "C"
#include "lua/src/lualib.h"
}
+#undef TOLUA_TEMPLATE_BIND
#include "tolua++/include/tolua++.h"
#include "Bindings.h"
#include "ManualBindings.h"
@@ -479,6 +480,18 @@ void cLuaState::Push(cEntity * a_Entity)
+void cLuaState::Push(cProjectileEntity * a_ProjectileEntity)
+{
+ ASSERT(IsValid());
+
+ tolua_pushusertype(m_LuaState, a_ProjectileEntity, "cProjectileEntity");
+ m_NumCurrentFunctionArgs += 1;
+}
+
+
+
+
+
void cLuaState::Push(cMonster * a_Monster)
{
ASSERT(IsValid());
diff --git a/src/Bindings/LuaState.h b/src/Bindings/LuaState.h
index f0047b362..b9ca2f29b 100644
--- a/src/Bindings/LuaState.h
+++ b/src/Bindings/LuaState.h
@@ -38,6 +38,7 @@ extern "C"
class cWorld;
class cPlayer;
class cEntity;
+class cProjectileEntity;
class cMonster;
class cItem;
class cItems;
@@ -183,6 +184,7 @@ public:
void Push(cPlayer * a_Player);
void Push(const cPlayer * a_Player);
void Push(cEntity * a_Entity);
+ void Push(cProjectileEntity * a_ProjectileEntity);
void Push(cMonster * a_Monster);
void Push(cItem * a_Item);
void Push(cItems * a_Items);
diff --git a/src/Bindings/ManualBindings.cpp b/src/Bindings/ManualBindings.cpp
index 20bbc48f2..92b410481 100644
--- a/src/Bindings/ManualBindings.cpp
+++ b/src/Bindings/ManualBindings.cpp
@@ -2,6 +2,7 @@
#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules
#include "ManualBindings.h"
+#undef TOLUA_TEMPLATE_BIND
#include "tolua++/include/tolua++.h"
#include "Plugin.h"
@@ -115,10 +116,44 @@ static int tolua_StringSplitAndTrim(lua_State * tolua_S)
-static int tolua_LOG(lua_State* tolua_S)
+/** Retrieves the log message from the first param on the Lua stack.
+Can take either a string or a cCompositeChat.
+*/
+static AString GetLogMessage(lua_State * tolua_S)
{
- const char* str = tolua_tocppstring(tolua_S,1,0);
- cMCLogger::GetInstance()->LogSimple( str, 0 );
+ tolua_Error err;
+ if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err))
+ {
+ return ((cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL))->ExtractText();
+ }
+ else
+ {
+ size_t len = 0;
+ const char * str = lua_tolstring(tolua_S, 1, &len);
+ if (str != NULL)
+ {
+ return AString(str, len);
+ }
+ }
+ return "";
+}
+
+
+
+
+
+static int tolua_LOG(lua_State * tolua_S)
+{
+ // If the param is a cCompositeChat, read the log level from it:
+ cMCLogger::eLogLevel LogLevel = cMCLogger::llRegular;
+ tolua_Error err;
+ if (tolua_isusertype(tolua_S, 1, "cCompositeChat", false, &err))
+ {
+ LogLevel = cCompositeChat::MessageTypeToLogLevel(((cCompositeChat *)tolua_tousertype(tolua_S, 1, NULL))->GetMessageType());
+ }
+
+ // Log the message:
+ cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), LogLevel);
return 0;
}
@@ -126,10 +161,9 @@ static int tolua_LOG(lua_State* tolua_S)
-static int tolua_LOGINFO(lua_State* tolua_S)
+static int tolua_LOGINFO(lua_State * tolua_S)
{
- const char* str = tolua_tocppstring(tolua_S,1,0);
- cMCLogger::GetInstance()->LogSimple( str, 1 );
+ cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llInfo);
return 0;
}
@@ -137,10 +171,9 @@ static int tolua_LOGINFO(lua_State* tolua_S)
-static int tolua_LOGWARN(lua_State* tolua_S)
+static int tolua_LOGWARN(lua_State * tolua_S)
{
- const char* str = tolua_tocppstring(tolua_S,1,0);
- cMCLogger::GetInstance()->LogSimple( str, 2 );
+ cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llWarning);
return 0;
}
@@ -148,10 +181,9 @@ static int tolua_LOGWARN(lua_State* tolua_S)
-static int tolua_LOGERROR(lua_State* tolua_S)
+static int tolua_LOGERROR(lua_State * tolua_S)
{
- const char* str = tolua_tocppstring(tolua_S,1,0);
- cMCLogger::GetInstance()->LogSimple( str, 3 );
+ cMCLogger::GetInstance()->LogSimple(GetLogMessage(tolua_S).c_str(), cMCLogger::llError);
return 0;
}
@@ -159,6 +191,50 @@ static int tolua_LOGERROR(lua_State* tolua_S)
+static int tolua_Base64Encode(lua_State * tolua_S)
+{
+ cLuaState L(tolua_S);
+ if (
+ !L.CheckParamString(1) ||
+ !L.CheckParamEnd(2)
+ )
+ {
+ return 0;
+ }
+
+ AString Src;
+ L.GetStackValue(1, Src);
+ AString res = Base64Encode(Src);
+ L.Push(res);
+ return 1;
+}
+
+
+
+
+
+static int tolua_Base64Decode(lua_State * tolua_S)
+{
+ cLuaState L(tolua_S);
+ if (
+ !L.CheckParamString(1) ||
+ !L.CheckParamEnd(2)
+ )
+ {
+ return 0;
+ }
+
+ AString Src;
+ L.GetStackValue(1, Src);
+ AString res = Base64Decode(Src);
+ L.Push(res);
+ return 1;
+}
+
+
+
+
+
cPluginLua * GetLuaPlugin(lua_State * L)
{
// Get the plugin identification out of LuaState:
@@ -2838,6 +2914,8 @@ void ManualBindings::Bind(lua_State * tolua_S)
tolua_function(tolua_S, "LOGWARN", tolua_LOGWARN);
tolua_function(tolua_S, "LOGWARNING", tolua_LOGWARN);
tolua_function(tolua_S, "LOGERROR", tolua_LOGERROR);
+ tolua_function(tolua_S, "Base64Encode", tolua_Base64Encode);
+ tolua_function(tolua_S, "Base64Decode", tolua_Base64Decode);
tolua_beginmodule(tolua_S, "cFile");
tolua_function(tolua_S, "GetFolderContents", tolua_cFile_GetFolderContents);
diff --git a/src/Bindings/ManualBindings.h b/src/Bindings/ManualBindings.h
index e6594947e..f38e26267 100644
--- a/src/Bindings/ManualBindings.h
+++ b/src/Bindings/ManualBindings.h
@@ -5,4 +5,4 @@ class ManualBindings
{
public:
static void Bind( lua_State* tolua_S );
-}; \ No newline at end of file
+};
diff --git a/src/Bindings/Plugin.h b/src/Bindings/Plugin.h
index 057fa0304..df0bd4dcc 100644
--- a/src/Bindings/Plugin.h
+++ b/src/Bindings/Plugin.h
@@ -90,6 +90,8 @@ public:
virtual bool OnPluginsLoaded (void) = 0;
virtual bool OnPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0;
virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) = 0;
+ virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile) = 0;
+ virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) = 0;
virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) = 0;
virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) = 0;
virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) = 0;
diff --git a/src/Bindings/PluginLua.cpp b/src/Bindings/PluginLua.cpp
index 4f0e13f12..dcc816839 100644
--- a/src/Bindings/PluginLua.cpp
+++ b/src/Bindings/PluginLua.cpp
@@ -5,7 +5,11 @@
#include "Globals.h" // NOTE: MSVC stupidness requires this to be the same across all modules
+#ifdef __APPLE__
+#define LUA_USE_MACOSX
+#else
#define LUA_USE_POSIX
+#endif
#include "PluginLua.h"
#include "../CommandOutput.h"
@@ -14,6 +18,7 @@ extern "C"
#include "lua/src/lualib.h"
}
+#undef TOLUA_TEMPLATE_BIND
#include "tolua++/include/tolua++.h"
@@ -1108,6 +1113,46 @@ bool cPluginLua::OnPreCrafting(const cPlayer * a_Player, const cCraftingGrid * a
+bool cPluginLua::OnProjectileHitBlock(cProjectileEntity & a_Projectile)
+{
+ cCSLock Lock(m_CriticalSection);
+ bool res = false;
+ cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PROJECTILE_HIT_BLOCK];
+ for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
+ {
+ m_LuaState.Call((int)(**itr), &a_Projectile, cLuaState::Return, res);
+ if (res)
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
+bool cPluginLua::OnProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity & a_HitEntity)
+{
+ cCSLock Lock(m_CriticalSection);
+ bool res = false;
+ cLuaRefs & Refs = m_HookMap[cPluginManager::HOOK_PROJECTILE_HIT_ENTITY];
+ for (cLuaRefs::iterator itr = Refs.begin(), end = Refs.end(); itr != end; ++itr)
+ {
+ m_LuaState.Call((int)(**itr), &a_Projectile, &a_HitEntity, cLuaState::Return, res);
+ if (res)
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
bool cPluginLua::OnSpawnedEntity(cWorld & a_World, cEntity & a_Entity)
{
cCSLock Lock(m_CriticalSection);
diff --git a/src/Bindings/PluginLua.h b/src/Bindings/PluginLua.h
index f51056186..59542d23a 100644
--- a/src/Bindings/PluginLua.h
+++ b/src/Bindings/PluginLua.h
@@ -113,6 +113,8 @@ public:
virtual bool OnPluginsLoaded (void) override;
virtual bool OnPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override;
virtual bool OnPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe) override;
+ virtual bool OnProjectileHitBlock (cProjectileEntity & a_Projectile) override;
+ virtual bool OnProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity) override;
virtual bool OnSpawnedEntity (cWorld & a_World, cEntity & a_Entity) override;
virtual bool OnSpawnedMonster (cWorld & a_World, cMonster & a_Monster) override;
virtual bool OnSpawningEntity (cWorld & a_World, cEntity & a_Entity) override;
diff --git a/src/Bindings/PluginManager.cpp b/src/Bindings/PluginManager.cpp
index 7d346c522..6a5356c0b 100644
--- a/src/Bindings/PluginManager.cpp
+++ b/src/Bindings/PluginManager.cpp
@@ -1154,6 +1154,48 @@ bool cPluginManager::CallHookPreCrafting(const cPlayer * a_Player, const cCrafti
+bool cPluginManager::CallHookProjectileHitBlock(cProjectileEntity & a_Projectile)
+{
+ HookMap::iterator Plugins = m_Hooks.find(HOOK_PROJECTILE_HIT_BLOCK);
+ if (Plugins == m_Hooks.end())
+ {
+ return false;
+ }
+ for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
+ {
+ if ((*itr)->OnProjectileHitBlock(a_Projectile))
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
+bool cPluginManager::CallHookProjectileHitEntity(cProjectileEntity & a_Projectile, cEntity & a_HitEntity)
+{
+ HookMap::iterator Plugins = m_Hooks.find(HOOK_PROJECTILE_HIT_ENTITY);
+ if (Plugins == m_Hooks.end())
+ {
+ return false;
+ }
+ for (PluginList::iterator itr = Plugins->second.begin(); itr != Plugins->second.end(); ++itr)
+ {
+ if ((*itr)->OnProjectileHitEntity(a_Projectile, a_HitEntity))
+ {
+ return true;
+ }
+ }
+ return false;
+}
+
+
+
+
+
bool cPluginManager::CallHookSpawnedEntity(cWorld & a_World, cEntity & a_Entity)
{
HookMap::iterator Plugins = m_Hooks.find(HOOK_SPAWNED_ENTITY);
diff --git a/src/Bindings/PluginManager.h b/src/Bindings/PluginManager.h
index 03f19e831..512bc1351 100644
--- a/src/Bindings/PluginManager.h
+++ b/src/Bindings/PluginManager.h
@@ -18,6 +18,9 @@ class cChunkDesc;
// fwd: Entities/Entity.h
class cEntity;
+// fwd: Entities/ProjectileEntity.h
+class cProjectileEntity;
+
// fwd: Mobs/Monster.h
class cMonster;
@@ -102,6 +105,8 @@ public: // tolua_export
HOOK_PLUGINS_LOADED,
HOOK_POST_CRAFTING,
HOOK_PRE_CRAFTING,
+ HOOK_PROJECTILE_HIT_BLOCK,
+ HOOK_PROJECTILE_HIT_ENTITY,
HOOK_SPAWNED_ENTITY,
HOOK_SPAWNED_MONSTER,
HOOK_SPAWNING_ENTITY,
@@ -128,6 +133,8 @@ public: // tolua_export
class cCommandEnumCallback
{
public:
+ virtual ~cCommandEnumCallback() {}
+
/** Called for each command; return true to abort enumeration
For console commands, a_Permission is not used (set to empty string)
*/
@@ -199,6 +206,8 @@ public: // tolua_export
bool CallHookPluginsLoaded (void);
bool CallHookPostCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe);
bool CallHookPreCrafting (const cPlayer * a_Player, const cCraftingGrid * a_Grid, cCraftingRecipe * a_Recipe);
+ bool CallHookProjectileHitBlock (cProjectileEntity & a_Projectile);
+ bool CallHookProjectileHitEntity (cProjectileEntity & a_Projectile, cEntity & a_HitEntity);
bool CallHookSpawnedEntity (cWorld & a_World, cEntity & a_Entity);
bool CallHookSpawnedMonster (cWorld & a_World, cMonster & a_Monster);
bool CallHookSpawningEntity (cWorld & a_World, cEntity & a_Entity);
diff --git a/src/Bindings/WebPlugin.cpp b/src/Bindings/WebPlugin.cpp
index 3b71d553c..bf45405ba 100644
--- a/src/Bindings/WebPlugin.cpp
+++ b/src/Bindings/WebPlugin.cpp
@@ -110,4 +110,4 @@ AString cWebPlugin::SafeString( const AString & a_String )
RetVal.push_back( c );
}
return RetVal;
-} \ No newline at end of file
+}
diff --git a/src/Bindings/lua5.1.dll b/src/Bindings/lua51.dll
index 515cf8b30..515cf8b30 100644
--- a/src/Bindings/lua5.1.dll
+++ b/src/Bindings/lua51.dll
Binary files differ
diff --git a/src/BlockArea.cpp b/src/BlockArea.cpp
index f6d54e41c..40cca8882 100644
--- a/src/BlockArea.cpp
+++ b/src/BlockArea.cpp
@@ -54,7 +54,7 @@ template<typename Combinator> void InternalMergeBlocks(
/// Combinator used for cBlockArea::msOverwrite merging
-static void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
a_DstType = a_SrcType;
a_DstMeta = a_SrcMeta;
@@ -65,7 +65,7 @@ static void MergeCombinatorOverwrite(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType,
/// Combinator used for cBlockArea::msFillAir merging
-static void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
if (a_DstType == E_BLOCK_AIR)
{
@@ -80,7 +80,7 @@ static void MergeCombinatorFillAir(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, N
/// Combinator used for cBlockArea::msImprint merging
-static void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
if (a_SrcType != E_BLOCK_AIR)
{
@@ -95,7 +95,7 @@ static void MergeCombinatorImprint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, N
/// Combinator used for cBlockArea::msLake merging
-static void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+static inline void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
{
// Sponge is the NOP block
if (a_SrcType == E_BLOCK_SPONGE)
@@ -158,6 +158,55 @@ static void MergeCombinatorLake(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBB
+/** Combinator used for cBlockArea::msSpongePrint merging */
+static inline void MergeCombinatorSpongePrint(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+{
+ // Sponge overwrites nothing, everything else overwrites anything
+ if (a_SrcType != E_BLOCK_SPONGE)
+ {
+ a_DstType = a_SrcType;
+ a_DstMeta = a_SrcMeta;
+ }
+}
+
+
+
+
+
+/** Combinator used for cBlockArea::msDifference merging */
+static inline void MergeCombinatorDifference(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+{
+ if ((a_DstType == a_SrcType) && (a_DstMeta == a_SrcMeta))
+ {
+ a_DstType = E_BLOCK_AIR;
+ a_DstMeta = 0;
+ }
+ else
+ {
+ a_DstType = a_SrcType;
+ a_DstMeta = a_SrcMeta;
+ }
+}
+
+
+
+
+
+/** Combinator used for cBlockArea::msMask merging */
+static inline void MergeCombinatorMask(BLOCKTYPE & a_DstType, BLOCKTYPE a_SrcType, NIBBLETYPE & a_DstMeta, NIBBLETYPE a_SrcMeta)
+{
+ // If the blocks are the same, keep the dest; otherwise replace with air
+ if ((a_SrcType != a_DstType) || (a_SrcMeta != a_DstMeta))
+ {
+ a_DstType = E_BLOCK_AIR;
+ a_DstMeta = 0;
+ }
+}
+
+
+
+
+
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
// cBlockArea:
@@ -481,7 +530,7 @@ void cBlockArea::DumpToRawFile(const AString & a_FileName)
f.Write(&SizeX, 4);
f.Write(&SizeY, 4);
f.Write(&SizeZ, 4);
- unsigned char DataTypes = GetDataTypes();
+ unsigned char DataTypes = (unsigned char)GetDataTypes();
f.Write(&DataTypes, 1);
int NumBlocks = GetBlockCount();
if (HasBlockTypes())
@@ -680,6 +729,51 @@ void cBlockArea::Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_R
break;
} // case msLake
+ case msSpongePrint:
+ {
+ InternalMergeBlocks(
+ m_BlockTypes, a_Src.GetBlockTypes(),
+ DstMetas, SrcMetas,
+ SizeX, SizeY, SizeZ,
+ SrcOffX, SrcOffY, SrcOffZ,
+ DstOffX, DstOffY, DstOffZ,
+ a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
+ m_Size.x, m_Size.y, m_Size.z,
+ MergeCombinatorSpongePrint
+ );
+ break;
+ } // case msSpongePrint
+
+ case msDifference:
+ {
+ InternalMergeBlocks(
+ m_BlockTypes, a_Src.GetBlockTypes(),
+ DstMetas, SrcMetas,
+ SizeX, SizeY, SizeZ,
+ SrcOffX, SrcOffY, SrcOffZ,
+ DstOffX, DstOffY, DstOffZ,
+ a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
+ m_Size.x, m_Size.y, m_Size.z,
+ MergeCombinatorDifference
+ );
+ break;
+ } // case msDifference
+
+ case msMask:
+ {
+ InternalMergeBlocks(
+ m_BlockTypes, a_Src.GetBlockTypes(),
+ DstMetas, SrcMetas,
+ SizeX, SizeY, SizeZ,
+ SrcOffX, SrcOffY, SrcOffZ,
+ DstOffX, DstOffY, DstOffZ,
+ a_Src.GetSizeX(), a_Src.GetSizeY(), a_Src.GetSizeZ(),
+ m_Size.x, m_Size.y, m_Size.z,
+ MergeCombinatorMask
+ );
+ break;
+ } // case msMask
+
default:
{
LOGWARNING("Unknown block area merge strategy: %d", a_Strategy);
diff --git a/src/BlockArea.h b/src/BlockArea.h
index d28325d7d..c48175b8c 100644
--- a/src/BlockArea.h
+++ b/src/BlockArea.h
@@ -51,6 +51,9 @@ public:
msFillAir,
msImprint,
msLake,
+ msSpongePrint,
+ msDifference,
+ msMask,
} ;
cBlockArea(void);
@@ -127,8 +130,8 @@ public:
- msFillAir overwrites only those blocks that were air
- msImprint overwrites with only those blocks that are non-air
- Special strategies:
- msLake (evaluate top-down, first match wins):
+ Special strategies (evaluate top-down, first match wins):
+ msLake:
| area block | |
| this | Src | result |
+----------+--------+--------+
@@ -143,6 +146,22 @@ public:
| mycelium | stone | stone | ... and mycelium
| A | stone | A | ... but nothing else
| A | * | A | Everything else is left as it is
+
+ msSpongePrint:
+ Used for most generators, it allows carving out air pockets, too, and uses the Sponge as the NOP block
+ | area block | |
+ | this | Src | result |
+ +----------+--------+--------+
+ | A | sponge | A | Sponge is the NOP block
+ | * | B | B | Everything else overwrites anything
+
+ msMask:
+ Combines two areas, the blocks that are the same are kept, differing ones are reset to air
+ | area block | |
+ | this | Src | result |
+ +------+-------+--------+
+ | A | A | A | Same blocks are kept
+ | A | non-A | air | Everything else is replaced with air
*/
void Merge(const cBlockArea & a_Src, int a_RelX, int a_RelY, int a_RelZ, eMergeStrategy a_Strategy);
diff --git a/src/BlockEntities/CommandBlockEntity.cpp b/src/BlockEntities/CommandBlockEntity.cpp
index d395997a6..96ca0ac37 100644
--- a/src/BlockEntities/CommandBlockEntity.cpp
+++ b/src/BlockEntities/CommandBlockEntity.cpp
@@ -160,7 +160,7 @@ bool cCommandBlockEntity::LoadFromJson(const Json::Value & a_Value)
m_Command = a_Value.get("Command", "").asString();
m_LastOutput = a_Value.get("LastOutput", "").asString();
- m_Result = a_Value.get("SuccessCount", 0).asInt();
+ m_Result = (NIBBLETYPE)a_Value.get("SuccessCount", 0).asInt();
return true;
}
diff --git a/src/BlockInfo.cpp b/src/BlockInfo.cpp
index 7d438ba3e..6fb5aa5b3 100644
--- a/src/BlockInfo.cpp
+++ b/src/BlockInfo.cpp
@@ -365,7 +365,7 @@ void cBlockInfo::Initialize(void)
ms_Info[E_BLOCK_WOODEN_SLAB ].m_IsSolid = false;
- // Torch placeable blocks:
+ // Blocks that fully occupy their voxel - used as a guide for torch placeable blocks, amongst other things:
ms_Info[E_BLOCK_NEW_LOG ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_BEDROCK ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_BLOCK_OF_COAL ].m_FullyOccupiesVoxel = true;
@@ -397,6 +397,7 @@ void cBlockInfo::Initialize(void)
ms_Info[E_BLOCK_HAY_BALE ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_HUGE_BROWN_MUSHROOM ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_HUGE_RED_MUSHROOM ].m_FullyOccupiesVoxel = true;
+ ms_Info[E_BLOCK_ICE ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_IRON_BLOCK ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_IRON_ORE ].m_FullyOccupiesVoxel = true;
ms_Info[E_BLOCK_JACK_O_LANTERN ].m_FullyOccupiesVoxel = true;
diff --git a/src/BlockTracer.h b/src/BlockTracer.h
index 40d80da1a..a18c8df4d 100644
--- a/src/BlockTracer.h
+++ b/src/BlockTracer.h
@@ -28,6 +28,9 @@ public:
class cCallbacks abstract
{
public:
+ // Force a virtual destructor in descendants:
+ virtual ~cCallbacks() {}
+
/** Called on each block encountered along the path, including the first block (path start)
When this callback returns true, the tracing is aborted.
*/
diff --git a/src/Blocks/BlockAnvil.h b/src/Blocks/BlockAnvil.h
index 9f5f84be0..93a796ef7 100644
--- a/src/Blocks/BlockAnvil.h
+++ b/src/Blocks/BlockAnvil.h
@@ -18,11 +18,13 @@ public:
{
}
+
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
a_Pickups.push_back(cItem(E_BLOCK_ANVIL, 1, a_BlockMeta >> 2));
}
+
virtual bool GetPlacementBlockTypeMeta(
cChunkInterface & a_ChunkInterface, cPlayer * a_Player,
int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace,
@@ -31,27 +33,23 @@ public:
) override
{
a_BlockType = m_BlockType;
-
- int Direction = (int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 0.5) & 0x3;
- int RawMeta = a_BlockMeta >> 2;
-
- Direction++;
- Direction %= 4;
+ NIBBLETYPE HighBits = a_BlockMeta & 0x0c; // Only highest two bits are preserved
+ int Direction = (int)floor(a_Player->GetYaw() * 4.0 / 360.0 + 1.5) & 0x3;
switch (Direction)
{
- case 0: a_BlockMeta = 0x2 | RawMeta << 2; break;
- case 1: a_BlockMeta = 0x3 | RawMeta << 2; break;
- case 2: a_BlockMeta = 0x0 | RawMeta << 2; break;
- case 3: a_BlockMeta = 0x1 | RawMeta << 2; break;
+ case 0: a_BlockMeta = 0x2 | HighBits; break;
+ case 1: a_BlockMeta = 0x3 | HighBits; break;
+ case 2: a_BlockMeta = 0x0 | HighBits; break;
+ case 3: a_BlockMeta = 0x1 | HighBits; break;
default:
{
return false;
}
}
-
return true;
}
+
virtual bool IsUseable() override
{
return true;
diff --git a/src/Blocks/BlockBed.h b/src/Blocks/BlockBed.h
index 6daa94730..92804aaac 100644
--- a/src/Blocks/BlockBed.h
+++ b/src/Blocks/BlockBed.h
@@ -4,7 +4,7 @@
#include "BlockHandler.h"
#include "ChunkInterface.h"
#include "WorldInterface.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
#include "../Entities/Player.h"
@@ -12,11 +12,11 @@
class cBlockBedHandler :
- public cMetaRotater<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01, true>
+ public cMetaRotator<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01, true>
{
public:
cBlockBedHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01,true>(a_BlockType)
+ : cMetaRotator<cBlockHandler, 0x3, 0x02, 0x03, 0x00, 0x01,true>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockButton.h b/src/Blocks/BlockButton.h
index 740cbe3c4..4b2f6f618 100644
--- a/src/Blocks/BlockButton.h
+++ b/src/Blocks/BlockButton.h
@@ -2,17 +2,17 @@
#include "BlockHandler.h"
#include "Chunk.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockButtonHandler :
- public cMetaRotater<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>
+ public cMetaRotator<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>
{
public:
cBlockButtonHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType)
+ : cMetaRotator<cBlockHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockCauldron.h b/src/Blocks/BlockCauldron.h
index 2e1032d2b..41b79b6c3 100644
--- a/src/Blocks/BlockCauldron.h
+++ b/src/Blocks/BlockCauldron.h
@@ -23,7 +23,7 @@ public:
virtual void OnUse(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ) override
{
- char Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
+ NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
switch (a_Player->GetEquippedItem().m_ItemType)
{
case E_ITEM_WATER_BUCKET:
diff --git a/src/Blocks/BlockChest.h b/src/Blocks/BlockChest.h
index 30588d8fc..a1ded4c26 100644
--- a/src/Blocks/BlockChest.h
+++ b/src/Blocks/BlockChest.h
@@ -4,18 +4,18 @@
#include "BlockEntity.h"
#include "../BlockArea.h"
#include "../Entities/Player.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockChestHandler :
- public cMetaRotater<cBlockEntityHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>
+ public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
{
public:
cBlockChestHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater<cBlockEntityHandler, 0x07, 0x04, 0x01, 0x03, 0x02, true>(a_BlockType)
+ : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockComparator.h b/src/Blocks/BlockComparator.h
index e570ff302..4dd05366d 100644
--- a/src/Blocks/BlockComparator.h
+++ b/src/Blocks/BlockComparator.h
@@ -3,18 +3,18 @@
#include "BlockHandler.h"
#include "BlockRedstoneRepeater.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockComparatorHandler :
- public cMetaRotater<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>
+ public cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>
{
public:
cBlockComparatorHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType)
+ : cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockCrops.h b/src/Blocks/BlockCrops.h
index ffc2b3f8b..8606cf3f3 100644
--- a/src/Blocks/BlockCrops.h
+++ b/src/Blocks/BlockCrops.h
@@ -2,7 +2,7 @@
#pragma once
#include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
@@ -21,7 +21,7 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_Meta) override
{
- MTRand rand;
+ cFastRandom rand;
if (a_Meta == 0x7)
{
@@ -31,18 +31,18 @@ public:
case E_BLOCK_CROPS:
{
a_Pickups.push_back(cItem(E_ITEM_WHEAT, 1, 0));
- a_Pickups.push_back(cItem(E_ITEM_SEEDS, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2
+ a_Pickups.push_back(cItem(E_ITEM_SEEDS, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2
break;
}
case E_BLOCK_CARROTS:
{
- a_Pickups.push_back(cItem(E_ITEM_CARROT, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2
+ a_Pickups.push_back(cItem(E_ITEM_CARROT, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2
break;
}
case E_BLOCK_POTATOES:
{
- a_Pickups.push_back(cItem(E_ITEM_POTATO, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0)); // [1 .. 3] with high preference of 2
- if (rand.randInt(20) == 0)
+ a_Pickups.push_back(cItem(E_ITEM_POTATO, (char)(1 + (rand.NextInt(3) + rand.NextInt(3)) / 2), 0)); // [1 .. 3] with high preference of 2
+ if (rand.NextInt(21) == 0)
{
// With a 5% chance, drop a poisonous potato as well
a_Pickups.push_back(cItem(E_ITEM_POISONOUS_POTATO, 1, 0));
diff --git a/src/Blocks/BlockDirt.h b/src/Blocks/BlockDirt.h
index a1ab74257..aa24b8668 100644
--- a/src/Blocks/BlockDirt.h
+++ b/src/Blocks/BlockDirt.h
@@ -2,7 +2,7 @@
#pragma once
#include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
@@ -44,12 +44,12 @@ public:
}
// Grass spreads to adjacent dirt blocks:
- MTRand rand; // TODO: Replace with cFastRandom
+ cFastRandom rand;
for (int i = 0; i < 2; i++) // Pick two blocks to grow to
{
- int OfsX = rand.randInt(2) - 1; // [-1 .. 1]
- int OfsY = rand.randInt(4) - 3; // [-3 .. 1]
- int OfsZ = rand.randInt(2) - 1; // [-1 .. 1]
+ int OfsX = rand.NextInt(3, a_RelX) - 1; // [-1 .. 1]
+ int OfsY = rand.NextInt(5, a_RelY) - 3; // [-3 .. 1]
+ int OfsZ = rand.NextInt(3, a_RelZ) - 1; // [-1 .. 1]
BLOCKTYPE DestBlock;
NIBBLETYPE DestMeta;
diff --git a/src/Blocks/BlockDoor.cpp b/src/Blocks/BlockDoor.cpp
index 4e38ef334..479c68153 100644
--- a/src/Blocks/BlockDoor.cpp
+++ b/src/Blocks/BlockDoor.cpp
@@ -110,3 +110,87 @@ const char * cBlockDoorHandler::GetStepSound(void)
+
+NIBBLETYPE cBlockDoorHandler::MetaRotateCCW(NIBBLETYPE a_Meta)
+{
+ if (a_Meta & 0x08)
+ {
+ return a_Meta;
+ }
+ else
+ {
+ return super::MetaRotateCCW(a_Meta);
+ }
+}
+
+
+
+NIBBLETYPE cBlockDoorHandler::MetaRotateCW(NIBBLETYPE a_Meta)
+{
+ if (a_Meta & 0x08)
+ {
+ return a_Meta;
+ }
+ else
+ {
+ return super::MetaRotateCW(a_Meta);
+ }
+}
+
+
+
+NIBBLETYPE cBlockDoorHandler::MetaMirrorXY(NIBBLETYPE a_Meta)
+{
+ // Top bit (0x08) contains door panel type (Top/Bottom panel) Only Bottom panels contain position data
+ // Return a_Meta if panel is a top panel (0x08 bit is set to 1)
+
+ // Note: Currently, you can not properly mirror the hinges on a double door. The orientation of the door is stored
+ // in only the bottom tile while the hinge position is in the top tile. This function only operates on one tile at a time,
+ // so the function can only see either the hinge position or orientation, but not both, at any given time. The class itself
+ // needs extra datamembers.
+ if (a_Meta & 0x08) return a_Meta;
+
+ // Holds open/closed meta data. 0x0C == 1100.
+ NIBBLETYPE OtherMeta = a_Meta & 0x0C;
+
+ // Mirrors according to a table. 0x03 == 0011.
+ switch (a_Meta & 0x03)
+ {
+ case 0x03: return 0x01 + OtherMeta; // South -> North
+ case 0x01: return 0x03 + OtherMeta; // North -> South
+ }
+
+ // Not Facing North or South; No change.
+ return a_Meta;
+}
+
+
+
+NIBBLETYPE cBlockDoorHandler::MetaMirrorYZ(NIBBLETYPE a_Meta)
+{
+ // Top bit (0x08) contains door panel type (Top/Bottom panel) Only Bottom panels contain position data
+ // Return a_Meta if panel is a top panel (0x08 bit is set to 1)
+
+ // Note: Currently, you can not properly mirror the hinges on a double door. The orientation of the door is stored
+ // in only the bottom tile while the hinge position is in the top tile. This function only operates on one tile at a time,
+ // so the function can only see either the hinge position or orientation, but not both, at any given time.The class itself
+ // needs extra datamembers.
+
+ if (a_Meta & 0x08) return a_Meta;
+
+ // Holds open/closed meta data. 0x0C == 1100.
+ NIBBLETYPE OtherMeta = a_Meta & 0x0C;
+
+ // Mirrors according to a table. 0x03 == 0011.
+ switch (a_Meta & 0x03)
+ {
+ case 0x00: return 0x02 + OtherMeta; // West -> East
+ case 0x02: return 0x00 + OtherMeta; // East -> West
+ }
+
+ // Not Facing North or South; No change.
+ return a_Meta;
+}
+
+
+
diff --git a/src/Blocks/BlockDoor.h b/src/Blocks/BlockDoor.h
index 981774c17..797fe484c 100644
--- a/src/Blocks/BlockDoor.h
+++ b/src/Blocks/BlockDoor.h
@@ -4,15 +4,15 @@
#include "BlockHandler.h"
#include "../Entities/Player.h"
#include "Chunk.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockDoorHandler :
- public cMetaRotater<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true>
+ public cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true>
{
- typedef cMetaRotater<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> super;
+ typedef cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x03, 0x00, true> super;
public:
cBlockDoorHandler(BLOCKTYPE a_BlockType);
@@ -21,6 +21,10 @@ public:
virtual void OnCancelRightClick(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override;
virtual const char * GetStepSound(void) override;
+ virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override;
+ virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override;
+ virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override;
+ virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override;
virtual bool GetPlacementBlockTypeMeta(
cChunkInterface & a_ChunkInterface, cPlayer * a_Player,
@@ -142,14 +146,14 @@ public:
static void ChangeDoor(cChunkInterface & a_ChunkInterface, int a_X, int a_Y, int a_Z)
{
NIBBLETYPE OldMetaData = a_ChunkInterface.GetBlockMeta(a_X, a_Y, a_Z);
-
+
a_ChunkInterface.SetBlockMeta(a_X, a_Y, a_Z, ChangeStateMetaData(OldMetaData));
-
+
if (OldMetaData & 8)
{
// Current block is top of the door
BLOCKTYPE BottomBlock = a_ChunkInterface.GetBlock(a_X, a_Y - 1, a_Z);
- NIBBLETYPE BottomMeta = a_ChunkInterface.GetBlockMeta(a_X, a_Y - 1, a_Z);
+ NIBBLETYPE BottomMeta = a_ChunkInterface.GetBlockMeta(a_X, a_Y - 1, a_Z);
if (IsDoor(BottomBlock) && !(BottomMeta & 8))
{
@@ -168,62 +172,6 @@ public:
}
}
}
-
-
- virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
- {
- if (a_Meta & 0x08)
- {
- return a_Meta;
- }
- else
- {
- return super::MetaRotateCCW(a_Meta);
- }
- }
-
-
-
- virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
- {
- if (a_Meta & 0x08)
- {
- return a_Meta;
- }
- else
- {
- return super::MetaRotateCW(a_Meta);
- }
- }
-
-
-
- virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
- {
- if (a_Meta & 0x08)
- {
- return a_Meta;
- }
- else
- {
- return super::MetaMirrorXY(a_Meta);
- }
- }
-
-
-
- virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
- {
- if (a_Meta & 0x08)
- {
- return a_Meta;
- }
- else
- {
- return super::MetaMirrorYZ(a_Meta);
- }
- }
-
} ;
diff --git a/src/Blocks/BlockDropSpenser.h b/src/Blocks/BlockDropSpenser.h
index 7e0ad0e55..88b61a418 100644
--- a/src/Blocks/BlockDropSpenser.h
+++ b/src/Blocks/BlockDropSpenser.h
@@ -6,18 +6,18 @@
#pragma once
#include "../Piston.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockDropSpenserHandler :
- public cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
+ public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
{
public:
cBlockDropSpenserHandler(BLOCKTYPE a_BlockType) :
- cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
+ cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockEnderchest.h b/src/Blocks/BlockEnderchest.h
index 97cf484fb..67955f8ce 100644
--- a/src/Blocks/BlockEnderchest.h
+++ b/src/Blocks/BlockEnderchest.h
@@ -2,17 +2,17 @@
#pragma once
#include "BlockEntity.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockEnderchestHandler :
- public cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
+ public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
{
public:
cBlockEnderchestHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
+ : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockFenceGate.h b/src/Blocks/BlockFenceGate.h
index e3162bbd6..e202c6610 100644
--- a/src/Blocks/BlockFenceGate.h
+++ b/src/Blocks/BlockFenceGate.h
@@ -2,17 +2,17 @@
#pragma once
#include "BlockHandler.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockFenceGateHandler :
- public cMetaRotater<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>
+ public cMetaRotator<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>
{
public:
cBlockFenceGateHandler(BLOCKTYPE a_BlockType) :
- cMetaRotater<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>(a_BlockType)
+ cMetaRotator<cBlockHandler, 0x03, 0x02, 0x03, 0x00, 0x01, true>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockFire.h b/src/Blocks/BlockFire.h
index a25b87858..c8f158e7e 100644
--- a/src/Blocks/BlockFire.h
+++ b/src/Blocks/BlockFire.h
@@ -17,25 +17,27 @@ public:
}
/// Portal boundary and direction variables
- int XZP, XZM, Dir; // For wont of a better name...
+ // 2014_03_30 _X: What are these used for? Why do we need extra variables?
+ int XZP, XZM;
+ NIBBLETYPE Dir;
virtual void OnPlaced(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta) override
{
/*
PORTAL FINDING ALGORITH
=======================
- -Get clicked base block
- -Trace upwards to find first obsidian block; aborts if anything other than obsidian or air is encountered.
- Uses this value as a reference (the 'ceiling')
- -For both directions (if one fails, try the other), BASE (clicked) block:
- -Go in one direction, only stop if a non obsidian block is encountered (abort) OR a portal border is encountered (FindObsidianCeiling returns -1)
- -If a border was encountered, go the other direction and repeat above
- -Write borders to XZP and XZM, write direction portal faces to Dir
- -Loop through boundary variables, and fill with portal blocks based on Dir with meta from Dir
+ - Get clicked base block
+ - Trace upwards to find first obsidian block; aborts if anything other than obsidian or air is encountered.
+ Uses this value as a reference (the 'ceiling')
+ - For both directions (if one fails, try the other), BASE (clicked) block:
+ - Go in one direction, only stop if a non obsidian block is encountered (abort) OR a portal border is encountered (FindObsidianCeiling returns -1)
+ - If a border was encountered, go the other direction and repeat above
+ - Write borders to XZP and XZM, write direction portal faces to Dir
+ - Loop through boundary variables, and fill with portal blocks based on Dir with meta from Dir
*/
a_BlockY--; // Because we want the block below the fire
- FindAndSetPortalFrame(a_BlockX, a_BlockY, a_BlockZ, a_ChunkInterface, a_WorldInterface); // Brought to you by Aperture Science
+ FindAndSetPortalFrame(a_BlockX, a_BlockY, a_BlockZ, a_ChunkInterface, a_WorldInterface);
}
virtual void OnDigging(cChunkInterface & a_ChunkInterface, cWorldInterface & a_WorldInterface, cPlayer * a_Player, int a_BlockX, int a_BlockY, int a_BlockZ) override
diff --git a/src/Blocks/BlockFluid.h b/src/Blocks/BlockFluid.h
index 37885e4de..d486d642d 100644
--- a/src/Blocks/BlockFluid.h
+++ b/src/Blocks/BlockFluid.h
@@ -93,6 +93,7 @@ public:
// Check if it's fuel:
BLOCKTYPE BlockType;
if (
+ ((a_RelY + y < 0) || (a_RelY + y > cChunkDef::Height)) ||
!a_Chunk.UnboundedRelGetBlockType(a_RelX + x, a_RelY + y, a_RelZ + z, BlockType) ||
!cFireSimulator::IsFuel(BlockType)
)
@@ -119,6 +120,7 @@ public:
for (size_t i = 0; i < ARRAYCOUNT(CrossCoords); i++)
{
if (
+ ((RelY + CrossCoords[i].y >= 0) && (RelY + CrossCoords[i].y <= cChunkDef::Height)) &&
a_Chunk.UnboundedRelGetBlockType(RelX + CrossCoords[i].x, RelY + CrossCoords[i].y, RelZ + CrossCoords[i].z, BlockType) &&
(BlockType == E_BLOCK_AIR)
)
diff --git a/src/Blocks/BlockFurnace.h b/src/Blocks/BlockFurnace.h
index 27ef2689f..a7a807957 100644
--- a/src/Blocks/BlockFurnace.h
+++ b/src/Blocks/BlockFurnace.h
@@ -4,17 +4,17 @@
#include "BlockEntity.h"
#include "../World.h"
#include "../Piston.h"
-
+#include "MetaRotator.h"
class cBlockFurnaceHandler :
- public cBlockEntityHandler
+ public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
{
public:
- cBlockFurnaceHandler(BLOCKTYPE a_BlockType) :
- cBlockEntityHandler(a_BlockType)
+ cBlockFurnaceHandler(BLOCKTYPE a_BlockType)
+ : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockHandler.cpp b/src/Blocks/BlockHandler.cpp
index 09e00e77d..4a29ff628 100644
--- a/src/Blocks/BlockHandler.cpp
+++ b/src/Blocks/BlockHandler.cpp
@@ -42,6 +42,7 @@
#include "BlockIce.h"
#include "BlockLadder.h"
#include "BlockLeaves.h"
+#include "BlockLilypad.h"
#include "BlockNewLeaves.h"
#include "BlockLever.h"
#include "BlockMelon.h"
@@ -144,6 +145,7 @@ cBlockHandler * cBlockHandler::CreateBlockHandler(BLOCKTYPE a_BlockType)
case E_BLOCK_LAPIS_ORE: return new cBlockOreHandler (a_BlockType);
case E_BLOCK_LAVA: return new cBlockLavaHandler (a_BlockType);
case E_BLOCK_LEAVES: return new cBlockLeavesHandler (a_BlockType);
+ case E_BLOCK_LILY_PAD: return new cBlockLilypadHandler (a_BlockType);
case E_BLOCK_LIT_FURNACE: return new cBlockFurnaceHandler (a_BlockType);
case E_BLOCK_LOG: return new cBlockSidewaysHandler (a_BlockType);
case E_BLOCK_MELON: return new cBlockMelonHandler (a_BlockType);
diff --git a/src/Blocks/BlockHopper.h b/src/Blocks/BlockHopper.h
index 59b84aa0e..a882bb077 100644
--- a/src/Blocks/BlockHopper.h
+++ b/src/Blocks/BlockHopper.h
@@ -3,16 +3,16 @@
// Declares the cBlockHopperHandler class representing the handler for the Hopper block
-
+#include "MetaRotator.h"
class cBlockHopperHandler :
- public cBlockEntityHandler
+ public cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
{
public:
cBlockHopperHandler(BLOCKTYPE a_BlockType)
- : cBlockEntityHandler(a_BlockType)
+ : cMetaRotator<cBlockEntityHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
{
}
@@ -39,6 +39,21 @@ public:
}
return true;
}
+
+
+ virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override
+ {
+ // Bit 0x08 is a flag. Lowest three bits are position. 0x08 == 1000
+ NIBBLETYPE OtherMeta = a_Meta & 0x08;
+ // Mirrors defined by by a table. (Source, mincraft.gamepedia.com) 0x07 == 0111
+ switch (a_Meta & 0x07)
+ {
+ case 0x00: return 0x01 + OtherMeta; // Down -> Up
+ case 0x01: return 0x00 + OtherMeta; // Up -> Down
+ }
+ // Not Facing Up or Down; No change.
+ return a_Meta;
+ }
} ;
diff --git a/src/Blocks/BlockLadder.h b/src/Blocks/BlockLadder.h
index a3e9edc6b..a605edf3f 100644
--- a/src/Blocks/BlockLadder.h
+++ b/src/Blocks/BlockLadder.h
@@ -9,11 +9,11 @@
class cBlockLadderHandler :
- public cBlockHandler
+ public cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04>
{
public:
cBlockLadderHandler(BLOCKTYPE a_BlockType)
- : cBlockHandler(a_BlockType)
+ : cMetaRotator<cBlockHandler, 0x07, 0x02, 0x05, 0x03, 0x04>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockLeaves.h b/src/Blocks/BlockLeaves.h
index a6d3373c1..8af14686e 100644
--- a/src/Blocks/BlockLeaves.h
+++ b/src/Blocks/BlockLeaves.h
@@ -1,6 +1,6 @@
#pragma once
#include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
#include "../World.h"
#include "../BlockArea.h"
@@ -37,16 +37,18 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- MTRand rand;
+ cFastRandom rand;
// Only the first 2 bits contain the display information, the others are for growing
- if (rand.randInt(5) == 0)
+ if (rand.NextInt(6) == 0)
{
a_Pickups.push_back(cItem(E_BLOCK_SAPLING, 1, a_BlockMeta & 3));
}
- if ((a_BlockMeta & 3) == E_META_SAPLING_APPLE)
+
+ // 1 % chance of dropping an apple, if the leaves' type is Apple Leaves
+ if ((a_BlockMeta & 3) == E_META_LEAVES_APPLE)
{
- if (rand.rand(100) == 0)
+ if (rand.NextInt(101) == 0)
{
a_Pickups.push_back(cItem(E_ITEM_RED_APPLE, 1, 0));
}
@@ -58,11 +60,10 @@ public:
{
cBlockHandler::OnDestroyed(a_ChunkInterface, a_WorldInterface, a_BlockX, a_BlockY, a_BlockZ);
- //0.5% chance of dropping an apple
+ // 0.5% chance of dropping an apple, if the leaves' type is Apple Leaves:
NIBBLETYPE Meta = a_ChunkInterface.GetBlockMeta(a_BlockX, a_BlockY, a_BlockZ);
- //check if Oak (0x1 and 0x2 bit not set)
- MTRand rand;
- if(!(Meta & 3) && rand.randInt(200) == 100)
+ cFastRandom rand;
+ if (((Meta & 3) == E_META_LEAVES_APPLE) && (rand.NextInt(201) == 100))
{
cItems Drops;
Drops.push_back(cItem(E_ITEM_RED_APPLE, 1, 0));
diff --git a/src/Blocks/BlockLever.h b/src/Blocks/BlockLever.h
index ef6e102cd..ad2ae29e5 100644
--- a/src/Blocks/BlockLever.h
+++ b/src/Blocks/BlockLever.h
@@ -1,17 +1,18 @@
#pragma once
#include "BlockHandler.h"
-
+#include "MetaRotator.h"
class cBlockLeverHandler :
- public cBlockHandler
+ public cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false>
{
+ typedef cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false> super;
public:
cBlockLeverHandler(BLOCKTYPE a_BlockType)
- : cBlockHandler(a_BlockType)
+ : cMetaRotator<cBlockHandler, 0x07, 0x04, 0x02, 0x03, 0x01, false>(a_BlockType)
{
}
@@ -104,6 +105,36 @@ public:
return (a_RelY > 0) && cBlockInfo::IsSolid(BlockIsOn);
}
+
+
+ virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
+ {
+ switch (a_Meta)
+ {
+ case 0x00: return 0x07; // Ceiling rotation
+ case 0x07: return 0x00;
+
+ case 0x05: return 0x06; // Ground rotation
+ case 0x06: return 0x05;
+
+ default: return super::MetaRotateCCW(a_Meta); // Wall Rotation
+ }
+ }
+
+
+ virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
+ {
+ switch (a_Meta)
+ {
+ case 0x00: return 0x07; // Ceiling rotation
+ case 0x07: return 0x00;
+
+ case 0x05: return 0x06; // Ground rotation
+ case 0x06: return 0x05;
+
+ default: return super::MetaRotateCCW(a_Meta); // Wall Rotation
+ }
+ }
} ;
diff --git a/src/Blocks/BlockLilypad.h b/src/Blocks/BlockLilypad.h
new file mode 100644
index 000000000..2dd4ec768
--- /dev/null
+++ b/src/Blocks/BlockLilypad.h
@@ -0,0 +1,28 @@
+
+#pragma once
+
+#include "BlockHandler.h"
+#include "Entities/Pickup.h"
+
+
+
+
+class cBlockLilypadHandler :
+ public cBlockHandler
+{
+public:
+ cBlockLilypadHandler(BLOCKTYPE a_BlockType)
+ : cBlockHandler(a_BlockType)
+ {
+ }
+
+ virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
+ {
+ // Reset meta to zero
+ a_Pickups.push_back(cItem(E_BLOCK_LILY_PAD, 1, 0));
+ }
+};
+
+
+
+
diff --git a/src/Blocks/BlockMobHead.h b/src/Blocks/BlockMobHead.h
index 6aa01f986..acd1c88fb 100644
--- a/src/Blocks/BlockMobHead.h
+++ b/src/Blocks/BlockMobHead.h
@@ -22,14 +22,99 @@ public:
a_Pickups.push_back(cItem(E_ITEM_HEAD, 1, 0));
}
- bool TrySpawnWither(cChunkInterface & a_ChunkInterface, int a_BlockX, int a_BlockY, int a_BlockZ)
+ bool TrySpawnWither(cChunkInterface & a_ChunkInterface, cWorld * a_World, int a_BlockX, int a_BlockY, int a_BlockZ)
{
if (a_BlockY < 2)
{
return false;
}
+
+ class cCallback : public cMobHeadCallback
+ {
+ bool m_IsWither;
+
+ virtual bool Item (cMobHeadEntity * a_MobHeadEntity)
+ {
+ m_IsWither = (a_MobHeadEntity->GetType() == SKULL_TYPE_WITHER);
+
+ return false;
+ }
+
+ public:
+ cCallback () : m_IsWither(false) {}
+
+ bool IsWither(void) const { return m_IsWither; }
+
+ void Reset(void) { m_IsWither = false; }
+ } CallbackA, CallbackB;
+
+ a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ, CallbackA);
+
+ if (!CallbackA.IsWither())
+ {
+ return false;
+ }
+
+ CallbackA.Reset();
+
+ BLOCKTYPE BlockY1 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ);
+ BLOCKTYPE BlockY2 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 2, a_BlockZ);
+
+ if ((BlockY1 != E_BLOCK_SOULSAND) || (BlockY2 != E_BLOCK_SOULSAND))
+ {
+ return false;
+ }
+
+ a_World->DoWithMobHeadAt(a_BlockX - 1, a_BlockY, a_BlockZ, CallbackA);
+ a_World->DoWithMobHeadAt(a_BlockX + 1, a_BlockY, a_BlockZ, CallbackB);
+
+ BLOCKTYPE Block1 = a_ChunkInterface.GetBlock(a_BlockX - 1, a_BlockY - 1, a_BlockZ);
+ BLOCKTYPE Block2 = a_ChunkInterface.GetBlock(a_BlockX + 1, a_BlockY - 1, a_BlockZ);
+
+ if ((Block1 == E_BLOCK_SOULSAND) && (Block2 == E_BLOCK_SOULSAND) && CallbackA.IsWither() && CallbackB.IsWither())
+ {
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX + 1, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX - 1, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0);
+
+ // Block entities
+ a_World->SetBlock(a_BlockX + 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+ a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+ a_World->SetBlock(a_BlockX - 1, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+
+ // Spawn the wither:
+ a_World->SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither);
+
+ return true;
+ }
+
+ CallbackA.Reset();
+ CallbackB.Reset();
- // TODO 2014-03-24 xdot
+ a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ - 1, CallbackA);
+ a_World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ + 1, CallbackB);
+
+ Block1 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ - 1);
+ Block2 = a_ChunkInterface.GetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1);
+
+ if ((Block1 == E_BLOCK_SOULSAND) && (Block2 == E_BLOCK_SOULSAND) && CallbackA.IsWither() && CallbackB.IsWither())
+ {
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ + 1, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 1, a_BlockZ - 1, E_BLOCK_AIR, 0);
+ a_ChunkInterface.FastSetBlock(a_BlockX, a_BlockY - 2, a_BlockZ, E_BLOCK_AIR, 0);
+
+ // Block entities
+ a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ + 1, E_BLOCK_AIR, 0);
+ a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_AIR, 0);
+ a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ - 1, E_BLOCK_AIR, 0);
+
+ // Spawn the wither:
+ a_World->SpawnMob(a_BlockX + 0.5, a_BlockY - 2, a_BlockZ + 0.5, cMonster::mtWither);
+
+ return true;
+ }
return false;
}
@@ -62,20 +147,37 @@ public:
}
public:
- cCallback (cPlayer * a_Player, NIBBLETYPE a_OldBlockMeta, NIBBLETYPE a_NewBlockMeta) :
- m_Player(a_Player),
+ cCallback (cPlayer * a_CBPlayer, NIBBLETYPE a_OldBlockMeta, NIBBLETYPE a_NewBlockMeta) :
+ m_Player(a_CBPlayer),
m_OldBlockMeta(a_OldBlockMeta),
m_NewBlockMeta(a_NewBlockMeta)
{}
};
cCallback Callback(a_Player, a_BlockMeta, static_cast<NIBBLETYPE>(a_BlockFace));
- a_BlockMeta = a_BlockFace;
+ a_BlockMeta = (NIBBLETYPE)a_BlockFace;
cWorld * World = (cWorld *) &a_WorldInterface;
World->DoWithMobHeadAt(a_BlockX, a_BlockY, a_BlockZ, Callback);
a_ChunkInterface.SetBlockMeta(a_BlockX, a_BlockY, a_BlockZ, a_BlockMeta);
- TrySpawnWither(a_ChunkInterface, a_BlockX, a_BlockY, a_BlockZ);
+ if (a_BlockMeta == SKULL_TYPE_WITHER)
+ {
+ static const Vector3i Coords[] =
+ {
+ Vector3i( 0, 0, 0),
+ Vector3i( 1, 0, 0),
+ Vector3i(-1, 0, 0),
+ Vector3i( 0, 0, 1),
+ Vector3i( 0, 0, -1),
+ };
+ for (size_t i = 0; i < ARRAYCOUNT(Coords); ++i)
+ {
+ if (TrySpawnWither(a_ChunkInterface, World, a_BlockX + Coords[i].x, a_BlockY, a_BlockZ + Coords[i].z))
+ {
+ break;
+ }
+ } // for i - Coords[]
+ }
}
} ;
diff --git a/src/Blocks/BlockNetherWart.h b/src/Blocks/BlockNetherWart.h
index 923180e19..812cf906f 100644
--- a/src/Blocks/BlockNetherWart.h
+++ b/src/Blocks/BlockNetherWart.h
@@ -2,14 +2,13 @@
#pragma once
#include "BlockHandler.h"
-#include "../MersenneTwister.h"
+#include "../FastRandom.h"
#include "../World.h"
-/// Common class that takes care of carrots, potatoes and wheat
class cBlockNetherWartHandler :
public cBlockHandler
{
@@ -22,12 +21,12 @@ public:
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_Meta) override
{
- MTRand rand;
+ cFastRandom rand;
if (a_Meta == 0x7)
{
- // Is fully grown, drop the entire produce:
- a_Pickups.push_back(cItem(E_ITEM_NETHER_WART, 1 + (int)(rand.randInt(2) + rand.randInt(2)) / 2, 0));
+ // Fully grown, drop the entire produce:
+ a_Pickups.push_back(cItem(E_ITEM_NETHER_WART, (char)(1 + (rand.NextInt(3) + rand.NextInt(3))) / 2, 0));
}
else
{
@@ -35,18 +34,20 @@ public:
}
}
+
virtual void OnUpdate(cChunkInterface & cChunkInterface, cWorldInterface & a_WorldInterface, cBlockPluginInterface & a_PluginInterface, cChunk & a_Chunk, int a_RelX, int a_RelY, int a_RelZ) override
{
- NIBBLETYPE Meta = a_Chunk.GetMeta (a_RelX, a_RelY, a_RelZ);
-
+ NIBBLETYPE Meta = a_Chunk.GetMeta(a_RelX, a_RelY, a_RelZ);
if (Meta < 7)
{
a_Chunk.FastSetBlock(a_RelX, a_RelY, a_RelZ, E_BLOCK_NETHER_WART, ++Meta);
}
}
+
virtual bool CanBeAt(cChunkInterface & a_ChunkInterface, int a_RelX, int a_RelY, int a_RelZ, const cChunk & a_Chunk) override
{
+ // Needs to be placed on top of a Soulsand block:
return ((a_RelY > 0) && (a_Chunk.GetBlock(a_RelX, a_RelY - 1, a_RelZ) == E_BLOCK_SOULSAND));
}
} ;
diff --git a/src/Blocks/BlockPluginInterface.h b/src/Blocks/BlockPluginInterface.h
index 7428c9a7a..3a36c40b1 100644
--- a/src/Blocks/BlockPluginInterface.h
+++ b/src/Blocks/BlockPluginInterface.h
@@ -1,8 +1,14 @@
#pragma once
+/** This interface is used to decouple block handlers from the cPluginManager dependancy through cWorld.
+The block handlers call this interface, which is then implemented by the specific classes that
+the caller provides.
+*/
class cBlockPluginInterface
{
public:
+ virtual ~cBlockPluginInterface() {}
+
virtual bool CallHookBlockToPickups(cEntity * a_Digger, int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, cItems & a_Pickups) = 0;
};
diff --git a/src/Blocks/BlockPumpkin.h b/src/Blocks/BlockPumpkin.h
index 349f52605..ac2b9817a 100644
--- a/src/Blocks/BlockPumpkin.h
+++ b/src/Blocks/BlockPumpkin.h
@@ -1,16 +1,16 @@
#pragma once
#include "BlockHandler.h"
-
+#include "MetaRotator.h"
class cBlockPumpkinHandler :
- public cBlockHandler
+ public cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false>
{
public:
cBlockPumpkinHandler(BLOCKTYPE a_BlockType)
- : cBlockHandler(a_BlockType)
+ : cMetaRotator<cBlockHandler, 0x07, 0x02, 0x03, 0x00, 0x01, false>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockRail.h b/src/Blocks/BlockRail.h
index 07e9814cd..ad78d290a 100644
--- a/src/Blocks/BlockRail.h
+++ b/src/Blocks/BlockRail.h
@@ -431,9 +431,145 @@ public:
}
break;
}
+ default: break;
}
return true;
}
+
+
+ virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
+ {
+ // Bit 0x08 is a flag when a_Meta is in the range 0x00--0x05 and 0x0A--0x0F.
+ // Bit 0x08 specifies direction when a_Meta is in the range 0x06-0x09.
+ if ((a_Meta < 0x06) || (a_Meta > 0x09))
+ {
+ // Save powered rail flag.
+ NIBBLETYPE OtherMeta = a_Meta & 0x08;
+ // Rotates according to table; 0x07 == 0111.
+ // Rails can either be flat (North/South) or Ascending (Asc. East)
+ switch (a_Meta & 0x07)
+ {
+ case 0x00: return 0x01 + OtherMeta; // North/South -> East/West
+ case 0x01: return 0x00 + OtherMeta; // East/West -> North/South
+
+ case 0x02: return 0x04 + OtherMeta; // Asc. East -> Asc. North
+ case 0x04: return 0x03 + OtherMeta; // Asc. North -> Asc. West
+ case 0x03: return 0x05 + OtherMeta; // Asc. West -> Asc. South
+ case 0x05: return 0x02 + OtherMeta; // Asc. South -> Asc. East
+ }
+ }
+ else
+ {
+ switch (a_Meta)
+ {
+ // Corner Directions
+ case 0x06: return 0x09; // Northwest Cnr. -> Southwest Cnr.
+ case 0x07: return 0x06; // Northeast Cnr. -> Northwest Cnr.
+ case 0x08: return 0x07; // Southeast Cnr. -> Northeast Cnr.
+ case 0x09: return 0x08; // Southwest Cnr. -> Southeast Cnr.
+ }
+ }
+ // To avoid a compiler warning;
+ return a_Meta;
+ }
+
+
+ virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
+ {
+ // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09.
+ if ((a_Meta < 0x06) || (a_Meta > 0x09))
+ {
+ // Save powered rail flag.
+ NIBBLETYPE OtherMeta = a_Meta & 0x08;
+ // Rotates according to table; 0x07 == 0111.
+ // Rails can either be flat (North/South) or Ascending (Asc. East)
+ switch (a_Meta & 0x07)
+ {
+ case 0x00: return 0x01 + OtherMeta; // North/South -> East/West
+ case 0x01: return 0x00 + OtherMeta; // East/West -> North/South
+
+ case 0x02: return 0x05 + OtherMeta; // Asc. East -> Asc. South
+ case 0x05: return 0x03 + OtherMeta; // Asc. South -> Asc. West
+ case 0x03: return 0x04 + OtherMeta; // Asc. West -> Asc. North
+ case 0x04: return 0x02 + OtherMeta; // Asc. North -> Asc. East
+ }
+ }
+ else
+ {
+ switch (a_Meta)
+ {
+ // Corner Directions
+ case 0x06: return 0x07; // Northwest Cnr. -> Northeast Cnr.
+ case 0x07: return 0x08; // Northeast Cnr. -> Southeast Cnr.
+ case 0x08: return 0x09; // Southeast Cnr. -> Southwest Cnr.
+ case 0x09: return 0x06; // Southwest Cnr. -> Northwest Cnr.
+ }
+ }
+ // To avoid a compiler warning;
+ return a_Meta;
+ }
+
+
+ virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
+ {
+ // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09.
+ if ((a_Meta < 0x06) || (a_Meta > 0x09))
+ {
+ // Save powered rail flag.
+ NIBBLETYPE OtherMeta = a_Meta & 0x08;
+ // Mirrors according to table; 0x07 == 0111.
+ // Rails can either be flat (North/South) or Ascending (Asc. East)
+ switch (a_Meta & 0x07)
+ {
+ case 0x05: return 0x04 + OtherMeta; // Asc. South -> Asc. North
+ case 0x04: return 0x05 + OtherMeta; // Asc. North -> Asc. South
+ }
+ }
+ else
+ {
+ switch (a_Meta)
+ {
+ // Corner Directions
+ case 0x06: return 0x09; // Northwest Cnr. -> Southwest Cnr.
+ case 0x07: return 0x08; // Northeast Cnr. -> Southeast Cnr.
+ case 0x08: return 0x07; // Southeast Cnr. -> Northeast Cnr.
+ case 0x09: return 0x06; // Southwest Cnr. -> Northwest Cnr.
+ }
+ }
+ // To avoid a compiler warning;
+ return a_Meta;
+ }
+
+
+ virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
+ {
+ // Bit 0x08 is a flag for value in the range 0x00--0x05 and specifies direction for values withint 0x006--0x09.
+ if ((a_Meta < 0x06) || (a_Meta > 0x09))
+ {
+ // Save powered rail flag.
+ NIBBLETYPE OtherMeta = a_Meta & 0x08;
+ // Mirrors according to table; 0x07 == 0111.
+ // Rails can either be flat (North/South) or Ascending (Asc. East)
+ switch (a_Meta & 0x07)
+ {
+ case 0x02: return 0x03 + OtherMeta; // Asc. East -> Asc. West
+ case 0x03: return 0x02 + OtherMeta; // Asc. West -> Asc. East
+ }
+ }
+ else
+ {
+ switch (a_Meta)
+ {
+ // Corner Directions
+ case 0x06: return 0x07; // Northwest Cnr. -> Northeast Cnr.
+ case 0x07: return 0x06; // Northeast Cnr. -> Northwest Cnr.
+ case 0x08: return 0x09; // Southeast Cnr. -> Southwest Cnr.
+ case 0x09: return 0x08; // Southwest Cnr. -> Southeast Cnr.
+ }
+ }
+ // To avoid a compiler warning;
+ return a_Meta;
+ }
} ;
diff --git a/src/Blocks/BlockRedstoneRepeater.h b/src/Blocks/BlockRedstoneRepeater.h
index 1e2a86949..fe6cd21b9 100644
--- a/src/Blocks/BlockRedstoneRepeater.h
+++ b/src/Blocks/BlockRedstoneRepeater.h
@@ -3,17 +3,17 @@
#include "BlockHandler.h"
#include "Chunk.h"
-
+#include "MetaRotator.h"
class cBlockRedstoneRepeaterHandler :
- public cBlockHandler
+ public cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>
{
public:
cBlockRedstoneRepeaterHandler(BLOCKTYPE a_BlockType)
- : cBlockHandler(a_BlockType)
+ : cMetaRotator<cBlockHandler, 0x03, 0x00, 0x01, 0x02, 0x03, true>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockSign.h b/src/Blocks/BlockSign.h
index cd0c02a40..9d6fede21 100644
--- a/src/Blocks/BlockSign.h
+++ b/src/Blocks/BlockSign.h
@@ -31,7 +31,7 @@ public:
}
- static char RotationToMetaData(double a_Rotation)
+ static NIBBLETYPE RotationToMetaData(double a_Rotation)
{
a_Rotation += 180 + (180 / 16); // So it's not aligned with axis
if (a_Rotation > 360)
@@ -45,7 +45,7 @@ public:
}
- static char DirectionToMetaData(eBlockFace a_Direction)
+ static NIBBLETYPE DirectionToMetaData(eBlockFace a_Direction)
{
switch (a_Direction)
{
@@ -71,6 +71,37 @@ public:
{
a_Player->GetClientHandle()->SendEditSign(a_BlockX, a_BlockY, a_BlockZ);
}
+
+
+ virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override
+ {
+ return (++a_Meta) & 0x0F;
+ }
+
+
+ virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override
+ {
+ return (--a_Meta) & 0x0F;
+ }
+
+ virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
+ {
+ // Mirrors signs over the XY plane (North-South Mirroring)
+
+ // There are 16 meta values which correspond to different directions.
+ // These values are equated to angles on a circle; 0x08 = 180 degrees.
+ return (a_Meta < 0x08) ? 0x08 + a_Meta : 0x08 - a_Meta;
+ }
+
+
+ virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
+ {
+ // Mirrors signs over the YZ plane (East-West Mirroring)
+
+ // There are 16 meta values which correspond to different directions.
+ // These values are equated to angles on a circle; 0x10 = 360 degrees.
+ return 0x10 - a_Meta;
+ }
} ;
diff --git a/src/Blocks/BlockSlab.h b/src/Blocks/BlockSlab.h
index 7cd2c97b2..76f5ed0e7 100644
--- a/src/Blocks/BlockSlab.h
+++ b/src/Blocks/BlockSlab.h
@@ -11,8 +11,7 @@
#include "BlockHandler.h"
#include "../Items/ItemHandler.h"
-
-
+#include "Root.h"
@@ -40,41 +39,9 @@ public:
) override
{
a_BlockType = m_BlockType;
- BLOCKTYPE Type = (BLOCKTYPE) (a_Player->GetEquippedItem().m_ItemType);
NIBBLETYPE Meta = (NIBBLETYPE) a_Player->GetEquippedItem().m_ItemDamage;
- // HandlePlaceBlock wants a cItemHandler pointer thing, so let's give it one
- cItemHandler * ItemHandler = cItemHandler::GetItemHandler(GetDoubleSlabType(Type));
-
- // Check if the block at the coordinates is a slab. Eligibility for combining has already been processed in ClientHandle
- if (IsAnySlabType(a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ)))
- {
- // Call the function in ClientHandle that places a block when the client sends the packet,
- // so that plugins may interfere with the placement.
-
- if ((a_BlockFace == BLOCK_FACE_TOP) || (a_BlockFace == BLOCK_FACE_BOTTOM))
- {
- // Top and bottom faces need no parameter modification
- a_Player->GetClientHandle()->HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler);
- }
- else
- {
- // The other faces need to distinguish between top and bottom cursor positions
- if (a_CursorY > 7)
- {
- // Edit the call to use BLOCK_FACE_BOTTOM, otherwise it places incorrectly
- a_Player->GetClientHandle()->HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, BLOCK_FACE_TOP, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler);
- }
- else
- {
- // Edit the call to use BLOCK_FACE_TOP, otherwise it places incorrectly
- a_Player->GetClientHandle()->HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, BLOCK_FACE_BOTTOM, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler);
- }
- }
- return false; // Cancel the event, because dblslabs were already placed, nothing else needed
- }
-
- // Place the single-slab with correct metas:
+ // Set the correct metadata based on player equipped item (i.e. a_BlockMeta not initialised yet)
switch (a_BlockFace)
{
case BLOCK_FACE_TOP:
@@ -105,7 +72,16 @@ public:
a_BlockMeta = Meta & 0x7; break;
}
}
+ case BLOCK_FACE_NONE: return false;
} // switch (a_BlockFace)
+
+ // Check if the block at the coordinates is a single slab. Eligibility for combining has already been processed in ClientHandle
+ // Changed to-be-placed to a double slab if we are clicking on a single slab, as opposed to placing one for the first time
+ if (IsAnySlabType(a_ChunkInterface.GetBlock(a_BlockX, a_BlockY, a_BlockZ)))
+ {
+ a_BlockType = GetDoubleSlabType(m_BlockType);
+ }
+
return true;
}
@@ -184,6 +160,15 @@ public:
ASSERT(!"Unhandled double slab type!");
return "";
}
+
+
+ virtual NIBBLETYPE MetaMirrorXZ(NIBBLETYPE a_Meta) override
+ {
+ NIBBLETYPE OtherMeta = a_Meta & 0x07; // Contains unrelated meta data.
+
+ // 8th bit is up/down. 1 right-side-up, 0 is up-side-down.
+ return (a_Meta & 0x08) ? 0x00 + OtherMeta : 0x01 + OtherMeta;
+ }
} ;
diff --git a/src/Blocks/BlockStairs.h b/src/Blocks/BlockStairs.h
index ea8405597..09ff254a6 100644
--- a/src/Blocks/BlockStairs.h
+++ b/src/Blocks/BlockStairs.h
@@ -2,17 +2,17 @@
#pragma once
#include "BlockHandler.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockStairsHandler :
- public cMetaRotater<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>
+ public cMetaRotator<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>
{
public:
cBlockStairsHandler(BLOCKTYPE a_BlockType) :
- cMetaRotater<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>(a_BlockType)
+ cMetaRotator<cBlockHandler, 0x03, 0x03, 0x00, 0x02, 0x01, true>(a_BlockType)
{
}
@@ -30,9 +30,7 @@ public:
UNUSED(a_BlockY);
UNUSED(a_BlockZ);
UNUSED(a_CursorX);
- UNUSED(a_CursorY);
UNUSED(a_CursorZ);
- UNUSED(a_BlockMeta);
a_BlockType = m_BlockType;
a_BlockMeta = RotationToMetaData(a_Player->GetYaw());
switch (a_BlockFace)
@@ -51,10 +49,12 @@ public:
}
break;
}
+ case BLOCK_FACE_NONE: return false;
}
return true;
}
+
virtual const char * GetStepSound(void) override
{
if (
diff --git a/src/Blocks/BlockStems.h b/src/Blocks/BlockStems.h
index 705436345..b726a0901 100644
--- a/src/Blocks/BlockStems.h
+++ b/src/Blocks/BlockStems.h
@@ -17,9 +17,10 @@ public:
{
}
+
virtual void ConvertToPickups(cItems & a_Pickups, NIBBLETYPE a_BlockMeta) override
{
- int ItemType = (m_BlockType == E_BLOCK_MELON_STEM) ? E_ITEM_MELON_SEEDS : E_ITEM_PUMPKIN_SEEDS;
+ short ItemType = (m_BlockType == E_BLOCK_MELON_STEM) ? E_ITEM_MELON_SEEDS : E_ITEM_PUMPKIN_SEEDS;
a_Pickups.push_back(cItem(ItemType, 1, 0));
}
diff --git a/src/Blocks/BlockTorch.h b/src/Blocks/BlockTorch.h
index d32c77629..8ddec8de1 100644
--- a/src/Blocks/BlockTorch.h
+++ b/src/Blocks/BlockTorch.h
@@ -2,17 +2,17 @@
#include "BlockHandler.h"
#include "../Chunk.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
class cBlockTorchHandler :
- public cMetaRotater<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>
+ public cMetaRotator<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>
{
public:
cBlockTorchHandler(BLOCKTYPE a_BlockType)
- : cMetaRotater<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>(a_BlockType)
+ : cMetaRotator<cBlockHandler, 0x7, 0x4, 0x1, 0x3, 0x2>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockTrapdoor.h b/src/Blocks/BlockTrapdoor.h
index 9bae92c4d..6a36ab874 100644
--- a/src/Blocks/BlockTrapdoor.h
+++ b/src/Blocks/BlockTrapdoor.h
@@ -2,17 +2,17 @@
#pragma once
#include "BlockHandler.h"
-
+#include "MetaRotator.h"
class cBlockTrapdoorHandler :
- public cBlockHandler
+ public cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x00, 0x03, false>
{
public:
cBlockTrapdoorHandler(BLOCKTYPE a_BlockType)
- : cBlockHandler(a_BlockType)
+ : cMetaRotator<cBlockHandler, 0x03, 0x01, 0x02, 0x00, 0x03, false>(a_BlockType)
{
}
diff --git a/src/Blocks/BlockVine.h b/src/Blocks/BlockVine.h
index d096c81a8..7bb9dc484 100644
--- a/src/Blocks/BlockVine.h
+++ b/src/Blocks/BlockVine.h
@@ -1,7 +1,7 @@
#pragma once
#include "BlockHandler.h"
-#include "MetaRotater.h"
+#include "MetaRotator.h"
@@ -83,7 +83,7 @@ public:
static const struct
{
int x, z;
- int Bit;
+ NIBBLETYPE Bit;
} Coords[] =
{
{ 0, 1, 1}, // south, ZP
@@ -91,7 +91,7 @@ public:
{ 0, -1, 4}, // north, ZM
{ 1, 0, 8}, // east, XP
} ;
- int res = 0;
+ NIBBLETYPE res = 0;
for (size_t i = 0; i < ARRAYCOUNT(Coords); i++)
{
BLOCKTYPE BlockType;
@@ -197,14 +197,14 @@ public:
virtual NIBBLETYPE MetaMirrorXY(NIBBLETYPE a_Meta) override
{
// Bits 2 and 4 stay, bits 1 and 3 swap
- return ((a_Meta & 0x0a) | ((a_Meta & 0x01) << 2) | ((a_Meta & 0x04) >> 2));
+ return (NIBBLETYPE)((a_Meta & 0x0a) | ((a_Meta & 0x01) << 2) | ((a_Meta & 0x04) >> 2));
}
virtual NIBBLETYPE MetaMirrorYZ(NIBBLETYPE a_Meta) override
{
// Bits 1 and 3 stay, bits 2 and 4 swap
- return ((a_Meta & 0x05) | ((a_Meta & 0x02) << 2) | ((a_Meta & 0x08) >> 2));
+ return (NIBBLETYPE)((a_Meta & 0x05) | ((a_Meta & 0x02) << 2) | ((a_Meta & 0x08) >> 2));
}
} ;
diff --git a/src/Blocks/BroadcastInterface.h b/src/Blocks/BroadcastInterface.h
index 01966ffbd..b1b450690 100644
--- a/src/Blocks/BroadcastInterface.h
+++ b/src/Blocks/BroadcastInterface.h
@@ -4,7 +4,8 @@
class cBroadcastInterface
{
public:
-
+ virtual ~cBroadcastInterface() {}
+
virtual void BroadcastUseBed (const cEntity & a_Entity, int a_BlockX, int a_BlockY, int a_BlockZ ) = 0;
virtual void BroadcastSoundEffect(const AString & a_SoundName, int a_SrcX, int a_SrcY, int a_SrcZ, float a_Volume, float a_Pitch, const cClientHandle * a_Exclude = NULL) = 0;
virtual void BroadcastEntityAnimation(const cEntity & a_Entity, char a_Animation, const cClientHandle * a_Exclude = NULL) = 0;
diff --git a/src/Blocks/MetaRotater.h b/src/Blocks/MetaRotator.h
index dde88e6db..899c583e1 100644
--- a/src/Blocks/MetaRotater.h
+++ b/src/Blocks/MetaRotator.h
@@ -1,4 +1,4 @@
-// MetaRotater.h
+// MetaRotator.h
// Provides a mixin for rotations and reflections
@@ -21,15 +21,15 @@ Inherit from this class providing your base class as Base, the BitMask for the d
*/
template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched = false>
-class cMetaRotater : public Base
+class cMetaRotator : public Base
{
public:
- cMetaRotater(BLOCKTYPE a_BlockType) :
+ cMetaRotator(BLOCKTYPE a_BlockType) :
Base(a_BlockType)
{}
- virtual ~cMetaRotater() {}
+ virtual ~cMetaRotator() {}
virtual NIBBLETYPE MetaRotateCCW(NIBBLETYPE a_Meta) override;
virtual NIBBLETYPE MetaRotateCW(NIBBLETYPE a_Meta) override;
@@ -42,7 +42,7 @@ public:
template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
-NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCW(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCW(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
switch (a_Meta & BitMask)
@@ -64,7 +64,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc
template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
-NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCCW(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaRotateCCW(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
switch (a_Meta & BitMask)
@@ -86,7 +86,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc
template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
-NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorXY(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorXY(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
switch (a_Meta & BitMask)
@@ -103,7 +103,7 @@ NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatc
template<class Base, NIBBLETYPE BitMask, NIBBLETYPE North, NIBBLETYPE East, NIBBLETYPE South, NIBBLETYPE West, bool AssertIfNotMatched>
-NIBBLETYPE cMetaRotater<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorYZ(NIBBLETYPE a_Meta)
+NIBBLETYPE cMetaRotator<Base, BitMask, North, East, South, West, AssertIfNotMatched>::MetaMirrorYZ(NIBBLETYPE a_Meta)
{
NIBBLETYPE OtherMeta = a_Meta & (~BitMask);
switch (a_Meta & BitMask)
diff --git a/src/Blocks/WorldInterface.h b/src/Blocks/WorldInterface.h
index 580339d32..bfbb053d9 100644
--- a/src/Blocks/WorldInterface.h
+++ b/src/Blocks/WorldInterface.h
@@ -9,7 +9,8 @@ class cItems;
class cWorldInterface
{
public:
-
+ virtual ~cWorldInterface() {}
+
virtual Int64 GetTimeOfDay(void) const = 0;
virtual Int64 GetWorldAge(void) const = 0;
diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt
index 448dc4b70..30e9dbfd4 100644
--- a/src/CMakeLists.txt
+++ b/src/CMakeLists.txt
@@ -6,14 +6,14 @@ include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/jsoncpp/include")
include_directories (SYSTEM "${PROJECT_SOURCE_DIR}/../lib/polarssl/include")
set(FOLDERS OSSupport HTTPServer Items Blocks Protocol Generating)
-set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities)
+set(FOLDERS ${FOLDERS} WorldStorage Mobs Entities Simulator UI BlockEntities Generating/Prefabs)
if (NOT MSVC)
- #Bindings needs to reference other folders so are done here
+ # Bindings need to reference other folders, so they are done here instead
- #lib dependecies are not included
+ # lib dependencies are not included
set(BINDING_DEPENDECIES
tolua
@@ -104,7 +104,6 @@ if (NOT MSVC)
Bindings/PluginLua
Bindings/PluginManager
Bindings/WebPlugin
- Bindings/WebPlugin
)
target_link_libraries(Bindings lua sqlite tolualib)
@@ -138,6 +137,7 @@ if (NOT MSVC)
else ()
+ # MSVC-specific handling: Put all files into one project, separate by the folders:
# Generate the Bindings if they don't exist:
if (NOT EXISTS "${PROJECT_SOURCE_DIR}/Bindings/Bindings.cpp")
@@ -149,6 +149,14 @@ else ()
)
endif()
+ # Get all files in this folder:
+ file(GLOB_RECURSE SOURCE
+ "*.cpp"
+ "*.h"
+ "*.pkg"
+ )
+ source_group("" FILES ${SOURCE})
+
# Add all subfolders as solution-folders:
list(APPEND FOLDERS "Resources")
list(APPEND FOLDERS "Bindings")
@@ -159,23 +167,16 @@ else ()
"${PATH}/*.rc"
"${PATH}/*.pkg"
)
- source_group("${PATH}" FILES ${FOLDER_FILES})
+ string(REPLACE "/" "\\" PROJECT_PATH ${PATH})
+ source_group("${PROJECT_PATH}" FILES ${FOLDER_FILES})
endfunction(includefolder)
foreach(folder ${FOLDERS})
includefolder(${folder})
endforeach(folder)
- file(GLOB_RECURSE SOURCE
- "*.cpp"
- "*.h"
- "*.pkg"
- )
-
include_directories("${PROJECT_SOURCE_DIR}")
- source_group("" FILES ${SOURCE})
-
# Precompiled headers (1st part)
SET_SOURCE_FILES_PROPERTIES(
Globals.cpp PROPERTIES COMPILE_FLAGS "/Yc\"Globals.h\""
@@ -231,7 +232,7 @@ endif ()
if (NOT MSVC)
target_link_libraries(${EXECUTABLE} OSSupport HTTPServer Bindings Items Blocks)
- target_link_libraries(${EXECUTABLE} Protocol Generating WorldStorage)
+ target_link_libraries(${EXECUTABLE} Protocol Generating Generating_Prefabs WorldStorage)
target_link_libraries(${EXECUTABLE} Mobs Entities Simulator UI BlockEntities)
endif ()
if (WIN32)
diff --git a/src/Chunk.cpp b/src/Chunk.cpp
index bd4cb9937..22b33c595 100644
--- a/src/Chunk.cpp
+++ b/src/Chunk.cpp
@@ -884,7 +884,7 @@ void cChunk::ApplyWeatherToTop()
FastSetBlock(X, Height, Z, E_BLOCK_SNOW, TopMeta - 1);
}
}
- else if (cBlockInfo::IsSnowable(TopBlock))
+ else if (cBlockInfo::IsSnowable(TopBlock) && (Height + 1 < cChunkDef::Height))
{
SetBlock(X, Height + 1, Z, E_BLOCK_SNOW, 0);
}
diff --git a/src/ClientHandle.cpp b/src/ClientHandle.cpp
index 46c10ae82..5876e55c7 100644
--- a/src/ClientHandle.cpp
+++ b/src/ClientHandle.cpp
@@ -941,6 +941,8 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
}
return;
}
+
+ m_NumBlockChangeInteractionsThisTick++;
if (!CheckBlockInteractionsRate())
{
@@ -960,7 +962,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
);
// Let's send the current world block to the client, so that it can immediately "let the user know" that they haven't placed the block
- if (a_BlockFace > -1)
+ if (a_BlockFace != BLOCK_FACE_NONE)
{
AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace);
World->SendBlockTo(a_BlockX, a_BlockY, a_BlockZ, m_Player);
@@ -988,7 +990,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
cItemHandler * ItemHandler = cItemHandler::GetItemHandler(Equipped.m_ItemType);
- if (ItemHandler->IsPlaceable() && (a_BlockFace > -1))
+ if (ItemHandler->IsPlaceable() && (a_BlockFace != BLOCK_FACE_NONE))
{
HandlePlaceBlock(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace, a_CursorX, a_CursorY, a_CursorZ, *ItemHandler);
}
@@ -1026,6 +1028,7 @@ void cClientHandle::HandleRightClick(int a_BlockX, int a_BlockY, int a_BlockZ, e
void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, cItemHandler & a_ItemHandler)
{
+ BLOCKTYPE EquippedBlock = (BLOCKTYPE)(m_Player->GetEquippedItem().m_ItemType);
if (a_BlockFace < 0)
{
// Clicked in air
@@ -1036,7 +1039,6 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
BLOCKTYPE ClickedBlock;
NIBBLETYPE ClickedBlockMeta;
- BLOCKTYPE EquippedBlock = (BLOCKTYPE)(m_Player->GetEquippedItem().m_ItemType);
NIBBLETYPE EquippedBlockDamage = (NIBBLETYPE)(m_Player->GetEquippedItem().m_ItemDamage);
if ((a_BlockY < 0) || (a_BlockY >= cChunkDef::Height))
@@ -1053,8 +1055,8 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
cBlockSlabHandler::IsAnySlabType(EquippedBlock) && // Is the player placing another slab?
((ClickedBlockMeta & 0x07) == EquippedBlockDamage) && // Is it the same slab type?
(
- (a_BlockFace == BLOCK_FACE_TOP) || // Clicking the top of a bottom slab
- (a_BlockFace == BLOCK_FACE_BOTTOM) // Clicking the bottom of a top slab
+ (a_BlockFace == BLOCK_FACE_TOP) || // Clicking the top of a bottom slab
+ (a_BlockFace == BLOCK_FACE_BOTTOM) // Clicking the bottom of a top slab
)
)
{
@@ -1062,7 +1064,7 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
// If clicked top face and slab occupies the top voxel, we want a slab to be placed above it (therefore increment Y)
// Else if clicked bottom face and slab occupies the bottom voxel, decrement Y for the same reason
// Don't touch coordinates if anything else because a dblslab opportunity is present
- if((ClickedBlockMeta & 0x08) && (a_BlockFace == BLOCK_FACE_TOP))
+ if ((ClickedBlockMeta & 0x08) && (a_BlockFace == BLOCK_FACE_TOP))
{
++a_BlockY;
}
@@ -1138,7 +1140,7 @@ void cClientHandle::HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, e
// The actual block placement:
World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, BlockType, BlockMeta);
- if (m_Player->GetGameMode() != gmCreative)
+ if (!m_Player->IsGameModeCreative())
{
m_Player->GetInventory().RemoveOneEquippedItem();
}
@@ -1530,7 +1532,7 @@ void cClientHandle::HandleTabCompletion(const AString & a_Text)
-void cClientHandle::SendData(const char * a_Data, int a_Size)
+void cClientHandle::SendData(const char * a_Data, size_t a_Size)
{
if (m_HasSentDC)
{
@@ -1545,7 +1547,7 @@ void cClientHandle::SendData(const char * a_Data, int a_Size)
if (m_OutgoingDataOverflow.empty())
{
// No queued overflow data; if this packet fits into the ringbuffer, put it in, otherwise put it in the overflow buffer:
- int CanFit = m_OutgoingData.GetFreeSpace();
+ size_t CanFit = m_OutgoingData.GetFreeSpace();
if (CanFit > a_Size)
{
CanFit = a_Size;
@@ -1606,10 +1608,8 @@ void cClientHandle::MoveToWorld(cWorld & a_World, bool a_SendRespawnPacket)
m_Protocol->SendUnloadChunk(itr->m_ChunkX, itr->m_ChunkZ);
} // for itr - Chunks[]
- // Do NOT stream new chunks, the new world runs its own tick thread and may deadlock
- // Instead, the chunks will be streamed when the client is moved to the new world's Tick list,
- // by setting state to csAuthenticated
- m_State = csAuthenticated;
+ // StreamChunks() called in cPlayer::MoveToWorld() after new world has been set
+ // Meanwhile here, we set last streamed values to bogus ones so everything is resent
m_LastStreamedChunkX = 0x7fffffff;
m_LastStreamedChunkZ = 0x7fffffff;
m_HasSentPlayerChunk = false;
@@ -2633,7 +2633,7 @@ void cClientHandle::PacketError(unsigned char a_PacketType)
-void cClientHandle::DataReceived(const char * a_Data, int a_Size)
+void cClientHandle::DataReceived(const char * a_Data, size_t a_Size)
{
// Data is received from the client, store it in the buffer to be processed by the Tick thread:
m_TimeSinceLastPacket = 0;
diff --git a/src/ClientHandle.h b/src/ClientHandle.h
index 8366caa16..0c367ec7d 100644
--- a/src/ClientHandle.h
+++ b/src/ClientHandle.h
@@ -225,15 +225,15 @@ public:
*/
bool HandleLogin(int a_ProtocolVersion, const AString & a_Username);
- void SendData(const char * a_Data, int a_Size);
+ void SendData(const char * a_Data, size_t a_Size);
/** Called when the player moves into a different world; queues sreaming the new chunks */
void MoveToWorld(cWorld & a_World, bool a_SendRespawnPacket);
+private:
+
/** Handles the block placing packet when it is a real block placement (not block-using, item-using or eating) */
void HandlePlaceBlock(int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace, int a_CursorX, int a_CursorY, int a_CursorZ, cItemHandler & a_ItemHandler);
-
-private:
/** The type used for storing the names of registered plugin channels. */
typedef std::set<AString> cChannels;
@@ -362,7 +362,7 @@ private:
void HandleCommandBlockMessage(const char * a_Data, unsigned int a_Length);
// cSocketThreads::cCallback overrides:
- virtual void DataReceived (const char * a_Data, int a_Size) override; // Data is received from the client
+ virtual void DataReceived (const char * a_Data, size_t a_Size) override; // Data is received from the client
virtual void GetOutgoingData(AString & a_Data) override; // Data can be sent to client
virtual void SocketClosed (void) override; // The socket has been closed for any reason
}; // tolua_export
diff --git a/src/CompositeChat.cpp b/src/CompositeChat.cpp
index a917ee70f..c70ef1070 100644
--- a/src/CompositeChat.cpp
+++ b/src/CompositeChat.cpp
@@ -112,8 +112,8 @@ cCompositeChat::cCompositeChat(void) :
-cCompositeChat::cCompositeChat(const AString & a_ParseText) :
- m_MessageType(mtCustom)
+cCompositeChat::cCompositeChat(const AString & a_ParseText, eMessageType a_MessageType) :
+ m_MessageType(a_MessageType)
{
ParseText(a_ParseText);
}
@@ -314,6 +314,58 @@ void cCompositeChat::UnderlineUrls(void)
+AString cCompositeChat::ExtractText(void) const
+{
+ AString Msg;
+ for (cParts::const_iterator itr = m_Parts.begin(), end = m_Parts.end(); itr != end; ++itr)
+ {
+ switch ((*itr)->m_PartType)
+ {
+ case ptText:
+ case ptClientTranslated:
+ case ptRunCommand:
+ case ptSuggestCommand:
+ {
+ Msg.append((*itr)->m_Text);
+ break;
+ }
+ case ptUrl:
+ {
+ Msg.append(((cUrlPart *)(*itr))->m_Url);
+ break;
+ }
+ } // switch (PartType)
+ } // for itr - m_Parts[]
+ return Msg;
+}
+
+
+
+
+
+cMCLogger::eLogLevel cCompositeChat::MessageTypeToLogLevel(eMessageType a_MessageType)
+{
+ switch (a_MessageType)
+ {
+ case mtCustom: return cMCLogger::llRegular;
+ case mtFailure: return cMCLogger::llWarning;
+ case mtInformation: return cMCLogger::llInfo;
+ case mtSuccess: return cMCLogger::llRegular;
+ case mtWarning: return cMCLogger::llWarning;
+ case mtFatal: return cMCLogger::llError;
+ case mtDeath: return cMCLogger::llRegular;
+ case mtPrivateMessage: return cMCLogger::llRegular;
+ case mtJoin: return cMCLogger::llRegular;
+ case mtLeave: return cMCLogger::llRegular;
+ }
+ ASSERT(!"Unhandled MessageType");
+ return cMCLogger::llError;
+}
+
+
+
+
+
void cCompositeChat::AddStyle(AString & a_Style, const AString & a_AddStyle)
{
if (a_AddStyle.empty())
diff --git a/src/CompositeChat.h b/src/CompositeChat.h
index 27319490d..5b9c5f612 100644
--- a/src/CompositeChat.h
+++ b/src/CompositeChat.h
@@ -117,7 +117,7 @@ public:
/** Creates a new chat message and parses the text into parts.
Recognizes "http:" and "https:" links and @color-codes.
Uses ParseText() for the actual parsing. */
- cCompositeChat(const AString & a_ParseText);
+ cCompositeChat(const AString & a_ParseText, eMessageType a_MessageType = mtCustom);
~cCompositeChat();
@@ -164,10 +164,19 @@ public:
/** Returns the message type set previously by SetMessageType(). */
eMessageType GetMessageType(void) const { return m_MessageType; }
+ /** Returns the text from the parts that comprises the human-readable data.
+ Used for older protocols that don't support composite chat
+ and for console-logging. */
+ AString ExtractText(void) const;
+
// tolua_end
const cParts & GetParts(void) const { return m_Parts; }
+ /** Converts the MessageType to a LogLevel value.
+ Used by the logging bindings when logging a cCompositeChat object. */
+ static cMCLogger::eLogLevel MessageTypeToLogLevel(eMessageType a_MessageType);
+
protected:
/** All the parts that */
cParts m_Parts;
diff --git a/src/Endianness.h b/src/Endianness.h
index 86eb369f5..6a2593077 100644
--- a/src/Endianness.h
+++ b/src/Endianness.h
@@ -1,12 +1,14 @@
#pragma once
+#define ntohll(x) ((((UInt64)ntohl((u_long)x)) << 32) + ntohl(x >> 32))
+
// Changes endianness
-inline unsigned long long HostToNetwork8(const void* a_Value )
+inline UInt64 HostToNetwork8(const void * a_Value)
{
unsigned long long __HostToNetwork8;
memcpy( &__HostToNetwork8, a_Value, sizeof( __HostToNetwork8 ) );
@@ -18,7 +20,7 @@ inline unsigned long long HostToNetwork8(const void* a_Value )
-inline unsigned int HostToNetwork4(const void* a_Value )
+inline UInt32 HostToNetwork4(const void* a_Value )
{
unsigned int __HostToNetwork4;
memcpy( &__HostToNetwork4, a_Value, sizeof( __HostToNetwork4 ) );
@@ -30,11 +32,10 @@ inline unsigned int HostToNetwork4(const void* a_Value )
-inline double NetworkToHostDouble8(const void* a_Value )
+inline double NetworkToHostDouble8(const void * a_Value)
{
-#define ntohll(x) ((((unsigned long long)ntohl((u_long)x)) << 32) + ntohl(x >> 32))
- unsigned long long buf = 0;//(*(unsigned long long*)a_Value);
- memcpy( &buf, a_Value, 8 );
+ UInt64 buf = 0;
+ memcpy(&buf, a_Value, 8);
buf = ntohll(buf);
double x;
memcpy(&x, &buf, sizeof(double));
@@ -45,23 +46,25 @@ inline double NetworkToHostDouble8(const void* a_Value )
-inline long long NetworkToHostLong8(const void * a_Value )
+inline Int64 NetworkToHostLong8(const void * a_Value)
{
- unsigned long long buf = *(unsigned long long*)a_Value;
+ UInt64 buf;
+ memcpy(&buf, &a_Value, 8);
buf = ntohll(buf);
- return *reinterpret_cast<long long *>(&buf);
+ return *reinterpret_cast<Int64 *>(&buf);
}
-inline float NetworkToHostFloat4(const void* a_Value )
+inline float NetworkToHostFloat4(const void * a_Value)
{
- u_long buf = *(u_long*)a_Value;
- buf = ntohl( buf );
- float x = 0;
- memcpy( &x, &buf, sizeof(float) );
+ UInt32 buf;
+ float x;
+ memcpy(&buf, &a_Value, 4);
+ buf = ntohl(buf);
+ memcpy(&x, &buf, sizeof(float));
return x;
}
diff --git a/src/Entities/Boat.cpp b/src/Entities/Boat.cpp
index 94b24c5af..921252253 100644
--- a/src/Entities/Boat.cpp
+++ b/src/Entities/Boat.cpp
@@ -122,5 +122,3 @@ void cBoat::HandleSpeedFromAttachee(float a_Forward, float a_Sideways)
AddSpeed(ToAddSpeed);
}
-
- \ No newline at end of file
diff --git a/src/Entities/Effects.h b/src/Entities/Effects.h
index e7611847d..baf3302fb 100644
--- a/src/Entities/Effects.h
+++ b/src/Entities/Effects.h
@@ -27,4 +27,4 @@ enum ENUM_ENTITY_EFFECT
E_EFFECT_ABSORPTION = 22,
E_EFFECT_SATURATION = 23,
} ;
-// tolua_end \ No newline at end of file
+// tolua_end
diff --git a/src/Entities/Entity.h b/src/Entities/Entity.h
index e41f74b09..6e3f8292b 100644
--- a/src/Entities/Entity.h
+++ b/src/Entities/Entity.h
@@ -159,7 +159,7 @@ public:
cWorld * GetWorld(void) const { return m_World; }
- double GetHeadYaw (void) const { return m_HeadYaw; }
+ double GetHeadYaw (void) const { return m_HeadYaw; } // In degrees
double GetHeight (void) const { return m_Height; }
double GetMass (void) const { return m_Mass; }
const Vector3d & GetPosition (void) const { return m_Pos; }
@@ -167,9 +167,9 @@ public:
double GetPosY (void) const { return m_Pos.y; }
double GetPosZ (void) const { return m_Pos.z; }
const Vector3d & GetRot (void) const { return m_Rot; } // OBSOLETE, use individual GetYaw(), GetPitch, GetRoll() components
- double GetYaw (void) const { return m_Rot.x; }
- double GetPitch (void) const { return m_Rot.y; }
- double GetRoll (void) const { return m_Rot.z; }
+ double GetYaw (void) const { return m_Rot.x; } // In degrees, [-180, +180)
+ double GetPitch (void) const { return m_Rot.y; } // In degrees, [-180, +180), but normal client clips to [-90, +90]
+ double GetRoll (void) const { return m_Rot.z; } // In degrees, unused in current client
Vector3d GetLookVector(void) const;
const Vector3d & GetSpeed (void) const { return m_Speed; }
double GetSpeedX (void) const { return m_Speed.x; }
@@ -189,9 +189,9 @@ public:
void SetPosition(double a_PosX, double a_PosY, double a_PosZ);
void SetPosition(const Vector3d & a_Pos) { SetPosition(a_Pos.x, a_Pos.y, a_Pos.z); }
void SetRot (const Vector3f & a_Rot); // OBSOLETE, use individual SetYaw(), SetPitch(), SetRoll() components
- void SetYaw (double a_Yaw);
- void SetPitch (double a_Pitch);
- void SetRoll (double a_Roll);
+ void SetYaw (double a_Yaw); // In degrees, normalizes to [-180, +180)
+ void SetPitch (double a_Pitch); // In degrees, normalizes to [-180, +180)
+ void SetRoll (double a_Roll); // In degrees, normalizes to [-180, +180)
void SetSpeed (double a_SpeedX, double a_SpeedY, double a_SpeedZ);
void SetSpeed (const Vector3d & a_Speed) { SetSpeed(a_Speed.x, a_Speed.y, a_Speed.z); }
void SetSpeedX (double a_SpeedX);
diff --git a/src/Entities/ExpOrb.h b/src/Entities/ExpOrb.h
index c1150bd03..e76274ac9 100644
--- a/src/Entities/ExpOrb.h
+++ b/src/Entities/ExpOrb.h
@@ -42,4 +42,4 @@ protected:
/** The number of ticks that the entity has existed / timer between collect and destroy; in msec */
float m_Timer;
-} ; // tolua_export \ No newline at end of file
+} ; // tolua_export
diff --git a/src/Entities/Floater.h b/src/Entities/Floater.h
index f3b51d77b..547d503f1 100644
--- a/src/Entities/Floater.h
+++ b/src/Entities/Floater.h
@@ -43,4 +43,4 @@ protected:
// Entity IDs
int m_PlayerID;
int m_AttachedMobID;
-} ; // tolua_export \ No newline at end of file
+} ; // tolua_export
diff --git a/src/Entities/Player.cpp b/src/Entities/Player.cpp
index 863aaa799..646aad50f 100644
--- a/src/Entities/Player.cpp
+++ b/src/Entities/Player.cpp
@@ -1489,6 +1489,7 @@ bool cPlayer::MoveToWorld(const char * a_WorldName)
// Add player to all the necessary parts of the new world
SetWorld(World);
+ m_ClientHandle->StreamChunks();
World->AddEntity(this);
World->AddPlayer(this);
diff --git a/src/Entities/ProjectileEntity.cpp b/src/Entities/ProjectileEntity.cpp
index f4ab825f2..a9735a53c 100644
--- a/src/Entities/ProjectileEntity.cpp
+++ b/src/Entities/ProjectileEntity.cpp
@@ -4,6 +4,7 @@
// Implements the cProjectileEntity class representing the common base class for projectiles, as well as individual projectile types
#include "Globals.h"
+#include "../Bindings/PluginManager.h"
#include "ProjectileEntity.h"
#include "../ClientHandle.h"
#include "Player.h"
@@ -66,6 +67,11 @@ protected:
eBlockFace Face;
if (bb.CalcLineIntersection(Line1, Line2, LineCoeff, Face))
{
+ if (cPluginManager::Get()->CallHookProjectileHitBlock(*m_Projectile))
+ {
+ return false;
+ }
+
Vector3d Intersection = Line1 + m_Projectile->GetSpeed() * LineCoeff;
m_Projectile->OnHitSolidBlock(Intersection, Face);
return true;
@@ -147,7 +153,11 @@ public:
}
// TODO: Some entities don't interact with the projectiles (pickups, falling blocks)
- // TODO: Allow plugins to interfere about which entities can be hit
+ if (cPluginManager::Get()->CallHookProjectileHitEntity(*m_Projectile, *a_Entity))
+ {
+ // A plugin disagreed.
+ return false;
+ }
if (LineCoeff < m_MinCoeff)
{
diff --git a/src/ForEachChunkProvider.h b/src/ForEachChunkProvider.h
index 6017173ee..7a6e8c5c6 100644
--- a/src/ForEachChunkProvider.h
+++ b/src/ForEachChunkProvider.h
@@ -24,6 +24,8 @@ class cBlockArea;
class cForEachChunkProvider
{
public:
+ virtual ~cForEachChunkProvider() {}
+
/** Calls the callback for each chunk in the specified range. */
virtual bool ForEachChunkInRect(int a_MinChunkX, int a_MaxChunkX, int a_MinChunkZ, int a_MaxChunkZ, cChunkDataCallback & a_Callback) = 0;
diff --git a/src/Generating/ComposableGenerator.cpp b/src/Generating/ComposableGenerator.cpp
index 6c00b5905..2e886336f 100644
--- a/src/Generating/ComposableGenerator.cpp
+++ b/src/Generating/ComposableGenerator.cpp
@@ -21,6 +21,7 @@
#include "DistortedHeightmap.h"
#include "EndGen.h"
#include "MineShafts.h"
+#include "NetherFortGen.h"
#include "Noise3DGenerator.h"
#include "POCPieceGenerator.h"
#include "Ravines.h"
@@ -191,9 +192,11 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a
m_HeightGen->GenHeightMap(a_ChunkX, a_ChunkZ, a_ChunkDesc.GetHeightMap());
}
+ bool ShouldUpdateHeightmap = false;
if (a_ChunkDesc.IsUsingDefaultComposition())
{
m_CompositionGen->ComposeTerrain(a_ChunkDesc);
+ ShouldUpdateHeightmap = true;
}
if (a_ChunkDesc.IsUsingDefaultFinish())
@@ -202,6 +205,12 @@ void cComposableGenerator::DoGenerate(int a_ChunkX, int a_ChunkZ, cChunkDesc & a
{
(*itr)->GenFinish(a_ChunkDesc);
} // for itr - m_FinishGens[]
+ ShouldUpdateHeightmap = true;
+ }
+
+ if (ShouldUpdateHeightmap)
+ {
+ a_ChunkDesc.UpdateHeightmap();
}
}
@@ -349,7 +358,7 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile)
int ChanceCrossing = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceCrossing", 200);
int ChanceStaircase = a_IniFile.GetValueSetI("Generator", "MineShaftsChanceStaircase", 200);
m_FinishGens.push_back(new cStructGenMineShafts(
- Seed, GridSize, MaxSystemSize,
+ Seed, GridSize, MaxSystemSize,
ChanceCorridor, ChanceCrossing, ChanceStaircase
));
}
@@ -361,6 +370,12 @@ void cComposableGenerator::InitFinishGens(cIniFile & a_IniFile)
{
m_FinishGens.push_back(new cFinishGenNetherClumpFoliage(Seed));
}
+ else if (NoCaseCompare(*itr, "NetherForts") == 0)
+ {
+ int GridSize = a_IniFile.GetValueSetI("Generator", "NetherFortsGridSize", 512);
+ int MaxDepth = a_IniFile.GetValueSetI("Generator", "NetherFortsMaxDepth", 12);
+ m_FinishGens.push_back(new cNetherFortGen(Seed, GridSize, MaxDepth));
+ }
else if (NoCaseCompare(*itr, "OreNests") == 0)
{
m_FinishGens.push_back(new cStructGenOreNests(Seed));
diff --git a/src/Generating/MineShafts.cpp b/src/Generating/MineShafts.cpp
index 28dc37567..231295c3f 100644
--- a/src/Generating/MineShafts.cpp
+++ b/src/Generating/MineShafts.cpp
@@ -1340,7 +1340,7 @@ void cStructGenMineShafts::GetMineShaftSystemsForChunk(
BaseX -= NEIGHBORHOOD_SIZE / 2;
BaseZ -= NEIGHBORHOOD_SIZE / 2;
- // Walk the cache, move each cave system that we want into a_Caves:
+ // Walk the cache, move each cave system that we want into a_Mineshafts:
int StartX = BaseX * m_GridSize;
int EndX = (BaseX + NEIGHBORHOOD_SIZE + 1) * m_GridSize;
int StartZ = BaseZ * m_GridSize;
diff --git a/src/Generating/NetherFortGen.cpp b/src/Generating/NetherFortGen.cpp
new file mode 100644
index 000000000..02779a8a3
--- /dev/null
+++ b/src/Generating/NetherFortGen.cpp
@@ -0,0 +1,275 @@
+
+// NetherFortGen.cpp
+
+// Implements the cNetherFortGen class representing the nether fortress generator
+
+#include "Globals.h"
+#include "NetherFortGen.h"
+#include "Prefabs/NetherFortPrefabs.h"
+
+
+
+
+
+static const int NEIGHBORHOOD_SIZE = 3;
+
+
+
+
+
+///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+// cNetherFortGen::cNetherFort:
+
+class cNetherFortGen::cNetherFort
+{
+public:
+ cNetherFortGen & m_ParentGen;
+ int m_BlockX, m_BlockZ;
+ int m_GridSize;
+ int m_Seed;
+ cPlacedPieces m_Pieces;
+
+
+ cNetherFort(cNetherFortGen & a_ParentGen, int a_BlockX, int a_BlockZ, int a_GridSize, int a_MaxDepth, int a_Seed) :
+ m_ParentGen(a_ParentGen),
+ m_BlockX(a_BlockX),
+ m_BlockZ(a_BlockZ),
+ m_GridSize(a_GridSize),
+ m_Seed(a_Seed)
+ {
+ // TODO: Proper Y-coord placement
+ int BlockY = 64;
+
+ // Generate pieces:
+ for (int i = 0; m_Pieces.size() < (size_t)(a_MaxDepth * a_MaxDepth / 8 + a_MaxDepth); i++)
+ {
+ cBFSPieceGenerator pg(m_ParentGen, a_Seed + i);
+ pg.PlacePieces(a_BlockX, BlockY, a_BlockZ, a_MaxDepth, m_Pieces);
+ }
+ }
+
+
+ ~cNetherFort()
+ {
+ cPieceGenerator::FreePieces(m_Pieces);
+ }
+
+
+ /** Carves the system into the chunk data */
+ void ProcessChunk(cChunkDesc & a_Chunk)
+ {
+ for (cPlacedPieces::const_iterator itr = m_Pieces.begin(), end = m_Pieces.end(); itr != end; ++itr)
+ {
+ const cPrefab & Prefab = (const cPrefab &)((*itr)->GetPiece());
+ Prefab.Draw(a_Chunk, *itr);
+ } // for itr - m_PlacedPieces[]
+ }
+};
+
+
+
+
+
+///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+// cNetherFortGen:
+
+cNetherFortGen::cNetherFortGen(int a_Seed, int a_GridSize, int a_MaxDepth) :
+ m_Seed(a_Seed),
+ m_Noise(a_Seed),
+ m_GridSize(a_GridSize),
+ m_MaxDepth(a_MaxDepth)
+{
+ // Initialize the prefabs:
+ for (size_t i = 0; i < g_NetherFortPrefabs1Count; i++)
+ {
+ cPrefab * Prefab = new cPrefab(g_NetherFortPrefabs1[i]);
+ m_AllPieces.push_back(Prefab);
+ if (Prefab->HasConnectorType(0))
+ {
+ m_OuterPieces.push_back(Prefab);
+ }
+ if (Prefab->HasConnectorType(1))
+ {
+ m_InnerPieces.push_back(Prefab);
+ }
+ }
+
+ // Initialize the starting piece prefabs:
+ for (size_t i = 0; i < g_NetherFortStartingPrefabs1Count; i++)
+ {
+ m_StartingPieces.push_back(new cPrefab(g_NetherFortStartingPrefabs1[i]));
+ }
+
+ // DEBUG: Try one round of placement:
+ cPlacedPieces Pieces;
+ cBFSPieceGenerator pg(*this, a_Seed);
+ pg.PlacePieces(0, 64, 0, a_MaxDepth, Pieces);
+}
+
+
+
+
+
+cNetherFortGen::~cNetherFortGen()
+{
+ ClearCache();
+ for (cPieces::iterator itr = m_AllPieces.begin(), end = m_AllPieces.end(); itr != end; ++itr)
+ {
+ delete *itr;
+ } // for itr - m_AllPieces[]
+ m_AllPieces.clear();
+}
+
+
+
+
+
+void cNetherFortGen::ClearCache(void)
+{
+ // TODO
+}
+
+
+
+
+
+void cNetherFortGen::GetFortsForChunk(int a_ChunkX, int a_ChunkZ, cNetherForts & a_Forts)
+{
+ int BaseX = a_ChunkX * cChunkDef::Width / m_GridSize;
+ int BaseZ = a_ChunkZ * cChunkDef::Width / m_GridSize;
+ if (BaseX < 0)
+ {
+ --BaseX;
+ }
+ if (BaseZ < 0)
+ {
+ --BaseZ;
+ }
+ BaseX -= NEIGHBORHOOD_SIZE / 2;
+ BaseZ -= NEIGHBORHOOD_SIZE / 2;
+
+ // Walk the cache, move each cave system that we want into a_Forts:
+ int StartX = BaseX * m_GridSize;
+ int EndX = (BaseX + NEIGHBORHOOD_SIZE + 1) * m_GridSize;
+ int StartZ = BaseZ * m_GridSize;
+ int EndZ = (BaseZ + NEIGHBORHOOD_SIZE + 1) * m_GridSize;
+ for (cNetherForts::iterator itr = m_Cache.begin(), end = m_Cache.end(); itr != end;)
+ {
+ if (
+ ((*itr)->m_BlockX >= StartX) && ((*itr)->m_BlockX < EndX) &&
+ ((*itr)->m_BlockZ >= StartZ) && ((*itr)->m_BlockZ < EndZ)
+ )
+ {
+ // want
+ a_Forts.push_back(*itr);
+ itr = m_Cache.erase(itr);
+ }
+ else
+ {
+ // don't want
+ ++itr;
+ }
+ } // for itr - m_Cache[]
+
+ // Create those forts that haven't been in the cache:
+ for (int x = 0; x < NEIGHBORHOOD_SIZE; x++)
+ {
+ int RealX = (BaseX + x) * m_GridSize;
+ for (int z = 0; z < NEIGHBORHOOD_SIZE; z++)
+ {
+ int RealZ = (BaseZ + z) * m_GridSize;
+ bool Found = false;
+ for (cNetherForts::const_iterator itr = a_Forts.begin(), end = a_Forts.end(); itr != end; ++itr)
+ {
+ if (((*itr)->m_BlockX == RealX) && ((*itr)->m_BlockZ == RealZ))
+ {
+ Found = true;
+ break;
+ }
+ } // for itr - a_Mineshafts
+ if (!Found)
+ {
+ a_Forts.push_back(new cNetherFort(*this, RealX, RealZ, m_GridSize, m_MaxDepth, m_Seed));
+ }
+ } // for z
+ } // for x
+
+ // Copy a_Forts into m_Cache to the beginning:
+ cNetherForts FortsCopy (a_Forts);
+ m_Cache.splice(m_Cache.begin(), FortsCopy, FortsCopy.begin(), FortsCopy.end());
+
+ // Trim the cache if it's too long:
+ if (m_Cache.size() > 100)
+ {
+ cNetherForts::iterator itr = m_Cache.begin();
+ std::advance(itr, 100);
+ for (cNetherForts::iterator end = m_Cache.end(); itr != end; ++itr)
+ {
+ delete *itr;
+ }
+ itr = m_Cache.begin();
+ std::advance(itr, 100);
+ m_Cache.erase(itr, m_Cache.end());
+ }
+}
+
+
+
+
+
+void cNetherFortGen::GenFinish(cChunkDesc & a_ChunkDesc)
+{
+ int ChunkX = a_ChunkDesc.GetChunkX();
+ int ChunkZ = a_ChunkDesc.GetChunkZ();
+ cNetherForts Forts;
+ GetFortsForChunk(ChunkX, ChunkZ, Forts);
+ for (cNetherForts::const_iterator itr = Forts.begin(); itr != Forts.end(); ++itr)
+ {
+ (*itr)->ProcessChunk(a_ChunkDesc);
+ } // for itr - Forts[]
+}
+
+
+
+
+
+cPieces cNetherFortGen::GetPiecesWithConnector(int a_ConnectorType)
+{
+ switch (a_ConnectorType)
+ {
+ case 0: return m_OuterPieces;
+ case 1: return m_InnerPieces;
+ default: return cPieces();
+ }
+}
+
+
+
+
+
+cPieces cNetherFortGen::GetStartingPieces(void)
+{
+ return m_StartingPieces;
+}
+
+
+
+
+
+void cNetherFortGen::PiecePlaced(const cPiece & a_Piece)
+{
+ UNUSED(a_Piece);
+}
+
+
+
+
+
+void cNetherFortGen::Reset(void)
+{
+ // Nothing needed
+}
+
+
+
+
diff --git a/src/Generating/NetherFortGen.h b/src/Generating/NetherFortGen.h
new file mode 100644
index 000000000..10ba01396
--- /dev/null
+++ b/src/Generating/NetherFortGen.h
@@ -0,0 +1,86 @@
+
+// NetherFortGen.h
+
+// Declares the cNetherFortGen class representing the nether fortress generator
+
+
+
+
+
+#pragma once
+
+#include "ComposableGenerator.h"
+#include "PieceGenerator.h"
+
+
+
+
+
+class cNetherFortGen :
+ public cFinishGen,
+ public cPiecePool
+{
+public:
+ cNetherFortGen(int a_Seed, int a_GridSize, int a_MaxDepth);
+
+ virtual ~cNetherFortGen();
+
+protected:
+ class cNetherFort; // fwd: NetherFortGen.cpp
+ typedef std::list<cNetherFort *> cNetherForts;
+
+
+ /** The seed used for generating*/
+ int m_Seed;
+
+ /** The noise used for generating */
+ cNoise m_Noise;
+
+ /** Average spacing between the fortresses*/
+ int m_GridSize;
+
+ /** Maximum depth of the piece-generator tree */
+ int m_MaxDepth;
+
+ /** Cache of the most recently used systems. MoveToFront used. */
+ cNetherForts m_Cache;
+
+ /** All the pieces that are allowed for building.
+ This is the list that's used for memory allocation and deallocation for the pieces. */
+ cPieces m_AllPieces;
+
+ /** The pieces that are used as starting pieces.
+ This list is not shared and the pieces need deallocation. */
+ cPieces m_StartingPieces;
+
+ /** The pieces that have an "outer" connector.
+ The pieces are copies out of m_AllPieces and shouldn't be ever delete-d. */
+ cPieces m_OuterPieces;
+
+ /** The pieces that have an "inner" connector.
+ The pieces are copies out of m_AllPieces and shouldn't be ever delete-d. */
+ cPieces m_InnerPieces;
+
+
+ /** Clears everything from the cache.
+ Also invalidates the forst returned by GetFortsForChunk(). */
+ void ClearCache(void);
+
+ /** Returns all forts that *may* intersect the given chunk.
+ The returned forts live within m_Cache.They are valid until the next call
+ to this function (which may delete some of the pointers). */
+ void GetFortsForChunk(int a_ChunkX, int a_ChunkZ, cNetherForts & a_Forts);
+
+ // cFinishGen overrides:
+ virtual void GenFinish(cChunkDesc & a_ChunkDesc) override;
+
+ // cPiecePool overrides:
+ virtual cPieces GetPiecesWithConnector(int a_ConnectorType) override;
+ virtual cPieces GetStartingPieces(void) override;
+ virtual void PiecePlaced(const cPiece & a_Piece) override;
+ virtual void Reset(void) override;
+} ;
+
+
+
+
diff --git a/src/Generating/Prefab.cpp b/src/Generating/Prefab.cpp
index 1af1faec1..131b6acb2 100644
--- a/src/Generating/Prefab.cpp
+++ b/src/Generating/Prefab.cpp
@@ -15,6 +15,92 @@ uses a prefabricate in a cBlockArea for drawing itself.
+#ifdef SELF_TEST
+
+// Create one static prefab to test the parser:
+static const cPrefab::sDef g_TestPrefabDef =
+{
+ // Size:
+ 7, 6, 7, // SizeX = 7, SizeY = 6, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* 0 */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 2
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 3
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 4
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 5
+ "aabbbaa"
+ "a.....a"
+ "b.....b"
+ "b.....b"
+ "b.....b"
+ "a.....a"
+ "aabbbaa"
+
+ // Level 6
+ "aaaaaaa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "aaaaaaa",
+
+ // Connections:
+ "0: 0, 3, 2: 4\n"
+ "0: 2, 3, 0: 2\n",
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msImprint
+};
+
+static cPrefab g_TestPrefab(g_TestPrefabDef);
+#endif
+
+
+
+
+
cPrefab::cPrefab(const cPrefab::sDef & a_Def) :
m_Size(a_Def.m_SizeX, a_Def.m_SizeY, a_Def.m_SizeZ),
m_HitBox(0, 0, 0, a_Def.m_SizeX - 1, a_Def.m_SizeY - 1, a_Def.m_SizeZ - 1),
@@ -86,10 +172,13 @@ bool cPrefab::HasConnectorType(int a_ConnectorType) const
void cPrefab::ParseCharMap(CharMap & a_CharMapOut, const char * a_CharMapDef)
{
+ ASSERT(a_CharMapDef != NULL);
+
// Initialize the charmap to all-invalid values:
for (size_t i = 0; i < ARRAYCOUNT(a_CharMapOut); i++)
{
- a_CharMapOut[i] = -1;
+ a_CharMapOut[i].m_BlockType = 0;
+ a_CharMapOut[i].m_BlockMeta = 16; // Mark unassigned entries with a meta that is impossible otherwise
}
// Process the lines in the definition:
@@ -104,15 +193,15 @@ void cPrefab::ParseCharMap(CharMap & a_CharMapOut, const char * a_CharMapDef)
continue;
}
unsigned char Src = (unsigned char)CharDef[0][0];
- BLOCKTYPE BlockType = (BLOCKTYPE)atoi(CharDef[1].c_str());
+ ASSERT(a_CharMapOut[Src].m_BlockMeta == 16); // This letter has not been assigned yet?
+ a_CharMapOut[Src].m_BlockType = (BLOCKTYPE)atoi(CharDef[1].c_str());
NIBBLETYPE BlockMeta = 0;
if ((NumElements >= 3) && !CharDef[2].empty())
{
BlockMeta = (NIBBLETYPE)atoi(CharDef[2].c_str());
ASSERT((BlockMeta >= 0) && (BlockMeta <= 15));
}
- ASSERT(a_CharMapOut[Src] == -1); // Any duplicates letter-wise?
- a_CharMapOut[Src] = (BlockType << 4) | BlockMeta;
+ a_CharMapOut[Src].m_BlockMeta = BlockMeta;
} // for itr - Lines[]
}
@@ -130,11 +219,9 @@ void cPrefab::ParseBlockImage(const CharMap & a_CharMap, const char * a_BlockIma
const unsigned char * BlockImage = (const unsigned char *)a_BlockImage + y * m_Size.x * m_Size.z + z * m_Size.x;
for (int x = 0; x < m_Size.x; x++)
{
- int MappedValue = a_CharMap[BlockImage[x]];
- ASSERT(MappedValue != -1); // Using a letter not defined in the CharMap?
- BLOCKTYPE BlockType = MappedValue >> 4;
- NIBBLETYPE BlockMeta = MappedValue & 0x0f;
- m_BlockArea[0].SetRelBlockTypeMeta(x, y, z, BlockType, BlockMeta);
+ const sBlockTypeDef & MappedValue = a_CharMap[BlockImage[x]];
+ ASSERT(MappedValue.m_BlockMeta != 16); // Using a letter not defined in the CharMap?
+ m_BlockArea[0].SetRelBlockTypeMeta(x, y, z, MappedValue.m_BlockType, MappedValue.m_BlockMeta);
}
}
}
@@ -146,6 +233,8 @@ void cPrefab::ParseBlockImage(const CharMap & a_CharMap, const char * a_BlockIma
void cPrefab::ParseConnectors(const char * a_ConnectorsDef)
{
+ ASSERT(a_ConnectorsDef != NULL);
+
AStringVector Lines = StringSplitAndTrim(a_ConnectorsDef, "\n");
for (AStringVector::const_iterator itr = Lines.begin(), end = Lines.end(); itr != end; ++itr)
{
diff --git a/src/Generating/Prefab.h b/src/Generating/Prefab.h
index 0b254c03b..04c4f09da 100644
--- a/src/Generating/Prefab.h
+++ b/src/Generating/Prefab.h
@@ -53,8 +53,15 @@ public:
bool HasConnectorType(int a_ConnectorType) const;
protected:
+ /** Packs complete definition of a single block, for per-letter assignment. */
+ struct sBlockTypeDef
+ {
+ BLOCKTYPE m_BlockType;
+ NIBBLETYPE m_BlockMeta;
+ };
+
/** Maps letters in the sDef::m_Image onto a number, BlockType * 16 | BlockMeta */
- typedef int CharMap[256];
+ typedef sBlockTypeDef CharMap[256];
/** The cBlockArea that contains the block definitions for the prefab.
diff --git a/src/Generating/Prefabs/CMakeLists.txt b/src/Generating/Prefabs/CMakeLists.txt
new file mode 100644
index 000000000..1e60447e7
--- /dev/null
+++ b/src/Generating/Prefabs/CMakeLists.txt
@@ -0,0 +1,13 @@
+
+cmake_minimum_required (VERSION 2.6)
+project (MCServer)
+
+include_directories ("${PROJECT_SOURCE_DIR}/../../")
+
+file(GLOB SOURCE
+ "*.cpp"
+)
+
+add_library(Generating_Prefabs ${SOURCE})
+
+target_link_libraries(Generating_Prefabs OSSupport iniFile Blocks)
diff --git a/src/Generating/Prefabs/NetherFortPrefabs.cpp b/src/Generating/Prefabs/NetherFortPrefabs.cpp
new file mode 100644
index 000000000..5e8685e32
--- /dev/null
+++ b/src/Generating/Prefabs/NetherFortPrefabs.cpp
@@ -0,0 +1,2758 @@
+
+// NetherFortPrefabs.cpp
+
+// Defines all the prefabs for nether forts
+
+#include "Globals.h"
+#include "NetherFortPrefabs.h"
+
+
+
+
+
+/*
+The nether fortress has two types of connectors, Outer and Inner. Outer is Type 0, Inner is Type 1.
+*/
+
+
+
+
+
+const cPrefab::sDef g_NetherFortPrefabs1[] =
+{
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BalconyCorridor:
+ // The data has been exported from gallery Nether, area index 37, ID 288
+ {
+ // Size:
+ 13, 7, 9, // SizeX = 13, SizeY = 7, SizeZ = 9
+
+ // Block definitions:
+ "a:112: 0\n" /* netherbrick */
+ "b: 19: 0\n" /* sponge */
+ "c:114: 4\n" /* netherbrickstairs */
+ "d:114: 7\n" /* netherbrickstairs */
+ "e:114: 5\n" /* netherbrickstairs */
+ "f: 44: 6\n" /* step */
+ "g:113: 0\n" /* netherbrickfence */
+ "h:114: 2\n" /* netherbrickstairs */
+ "i:114: 3\n" /* netherbrickstairs */
+ "j:114: 0\n" /* netherbrickstairs */
+ "k:114: 1\n" /* netherbrickstairs */
+ ".: 0: 0\n" /* air */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "bbbbaaaaabbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+
+ // Level 2
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaa.aaa.aaaa"
+ "bbcdaaaaadebb"
+ "bbbcdddddebbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+
+ // Level 3
+ "aaaaaaaaaaaaa"
+ "............."
+ "............."
+ "............."
+ "aaaa.fff.aaaa"
+ "bbaaaaaaaaabb"
+ "bbaaaaaaaaabb"
+ "bbaaaaaaaaabb"
+ "bbaaaaaaaaabb"
+
+ // Level 4
+ "agagagagagaga"
+ "............."
+ "............."
+ "............."
+ "agaa.....aaga"
+ "bbaaa...aaabb"
+ "bbg.......gbb"
+ "bbg.......gbb"
+ "bbgggggggggbb"
+
+ // Level 5
+ "agagagagagaga"
+ "............."
+ "............."
+ "............."
+ "agaa.....aaga"
+ "bbaaa...aaabb"
+ "bb.........bb"
+ "bb.........bb"
+ "bb.........bb"
+
+ // Level 6
+ "agagagagagaga"
+ "............."
+ "............."
+ "............."
+ "agaa.....aaga"
+ "bbaaa...aaabb"
+ "bb.........bb"
+ "bb.........bb"
+ "bb.........bb"
+
+ // Level 7
+ "hhhhhhhhhhhhh"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "iijaaaaaaaiii"
+ "bbjiiiiiiikbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb",
+
+ // Connections:
+ "1: 0, 2, 2: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 12, 2, 2: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BalconyCorridor
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BalconyTee2:
+ // The data has been exported from gallery Nether, area index 38, ID 289
+ {
+ // Size:
+ 13, 7, 11, // SizeX = 13, SizeY = 7, SizeZ = 11
+
+ // Block definitions:
+ "a: 19: 0\n" /* sponge */
+ "b:112: 0\n" /* netherbrick */
+ "c:114: 4\n" /* netherbrickstairs */
+ "d:114: 7\n" /* netherbrickstairs */
+ "e:114: 5\n" /* netherbrickstairs */
+ "f: 44: 6\n" /* step */
+ "g:113: 0\n" /* netherbrickfence */
+ "h:114: 0\n" /* netherbrickstairs */
+ "i:114: 1\n" /* netherbrickstairs */
+ "j:114: 2\n" /* netherbrickstairs */
+ "k:114: 3\n" /* netherbrickstairs */
+ ".: 0: 0\n" /* air */,
+
+ // Block data:
+ // Level 1
+ "aaaabbbbbaaaa"
+ "aaaabbbbbaaaa"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "aaaabbbbbaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "aaaabbbbbaaaa"
+ "aaaabbbbbaaaa"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbb.bbb.bbbb"
+ "aacdbbbbbdeaa"
+ "aaacdddddeaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 3
+ "aaaab...baaaa"
+ "aaaab...baaaa"
+ "bbbbb...bbbbb"
+ "............."
+ "............."
+ "............."
+ "bbbb.fff.bbbb"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+
+ // Level 4
+ "aaaab...baaaa"
+ "aaaag...gaaaa"
+ "bgbgb...bgbgb"
+ "............."
+ "............."
+ "............."
+ "bgbb.....bbgb"
+ "aabbb...bbbaa"
+ "aag.......gaa"
+ "aag.......gaa"
+ "aagggggggggaa"
+
+ // Level 5
+ "aaaab...baaaa"
+ "aaaag...gaaaa"
+ "bgbgb...bgbgb"
+ "............."
+ "............."
+ "............."
+ "bgbb.....bbgb"
+ "aabbb...bbbaa"
+ "aa.........aa"
+ "aa.........aa"
+ "aa.........aa"
+
+ // Level 6
+ "aaaab...baaaa"
+ "aaaag...gaaaa"
+ "bgbgb...bgbgb"
+ "............."
+ "............."
+ "............."
+ "bgbb.....bbgb"
+ "aabbb...bbbaa"
+ "aa.........aa"
+ "aa.........aa"
+ "aa.........aa"
+
+ // Level 7
+ "aaaahbbbiaaaa"
+ "aaaahbbbiaaaa"
+ "jjjjjbbbjjjjj"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "bbbbbbbbbbbbb"
+ "kkhbbbbbbbkkk"
+ "aahkkkkkkkiaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa",
+
+ // Connections:
+ "1: 0, 2, 4: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 12, 2, 4: 5\n" /* Type 1, BLOCK_FACE_XP */
+ "1: 6, 2, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BalconyTee2
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BlazePlatform
+ // The data has been exported from gallery Nether, area index 26, ID 276
+ {
+ // Size:
+ 10, 7, 7, // SizeX = 10, SizeY = 7, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b: 52: 0\n" /* mobspawner */
+ "c:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ ".........."
+ "aaaaaaaaaa"
+ "aaaaaaaaaa"
+ "aaaaaaaaaa"
+ "aaaaaaaaaa"
+ "aaaaaaaaaa"
+ ".........."
+
+ // Level 2
+ ".........."
+ "aaaaaaaaaa"
+ "..aaaaaaaa"
+ "..aaaaaaaa"
+ "..aaaaaaaa"
+ "aaaaaaaaaa"
+ ".........."
+
+ // Level 3
+ "....aaaaaa"
+ "aaaaaaaaaa"
+ "...aaaaaaa"
+ "...aaaaaaa"
+ "...aaaaaaa"
+ "aaaaaaaaaa"
+ "....aaaaaa"
+
+ // Level 4
+ "....aaaaaa"
+ "..aaa....a"
+ ".........a"
+ "......b..a"
+ ".........a"
+ "..aaa....a"
+ "....aaaaaa"
+
+ // Level 5
+ "....cccccc"
+ "...cc....c"
+ ".........c"
+ ".........c"
+ ".........c"
+ "...cc....c"
+ "....cccccc"
+
+ // Level 6
+ ".........."
+ ".........c"
+ ".........c"
+ ".........c"
+ ".........c"
+ ".........c"
+ ".........."
+
+ // Level 7
+ ".........."
+ ".........."
+ ".........c"
+ ".........c"
+ ".........c"
+ ".........."
+ "..........",
+
+ // Connections:
+ "0: 0, 1, 3: 4\n" /* Type 0, BLOCK_FACE_XM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BlazePlatform
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BlazePlatformOverhang:
+ // The data has been exported from gallery Nether, area index 20, ID 162
+ {
+ // Size:
+ 14, 9, 7, // SizeX = 14, SizeY = 9, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 5\n" /* netherbrickstairs */
+ "c: 44:14\n" /* step */
+ "d:114: 6\n" /* netherbrickstairs */
+ "e:114: 7\n" /* netherbrickstairs */
+ "f:114: 0\n" /* netherbrickstairs */
+ "g:114: 4\n" /* netherbrickstairs */
+ "h:113: 0\n" /* netherbrickfence */
+ "i: 52: 0\n" /* mobspawner */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "aammmmmmmmmmmm"
+ "aammmmmmmmmmmm"
+ "aammmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 2
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "aabcmmmmmmmmmm"
+ "aabcmmmmmmmmmm"
+ "aabcmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 3
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "aaaaabmmmmmmmm"
+ "aaaaabmmmmmmmm"
+ "aaaaabmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 4
+ "mmmmmmmmmmmmmm"
+ "dddddddmmmmmmm"
+ "aaaaaabmmmmmmm"
+ "aaaaaabmmmmmmm"
+ "aaaaaabmmmmmmm"
+ "eeeeeeemmmmmmm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 5
+ "mmmmmmmmmmmmmm"
+ "aaaaaaadmmmmmm"
+ "aaaaaaabmmmmmm"
+ "aaaaaaabmmmmmm"
+ "aaaaaaabmmmmmm"
+ "aaaaaaaemmmmmm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 6
+ "mmmmmmmmmmmmmm"
+ "aaaaaaaabddddm"
+ "......faaaaabm"
+ "......faaaaabm"
+ "......faaaaabm"
+ "aaaaaaaaabeebm"
+ "mmmmmmmmmmmmmm"
+
+ // Level 7
+ "mmmmmmmmgdddbm"
+ "......aaaaaaad"
+ ".......faaaaab"
+ ".......faaaaab"
+ ".......faaaaab"
+ "......aaaaaaae"
+ "mmmmmmmmgeeebm"
+
+ // Level 8
+ "mmmmmmmmaaaaam"
+ "......haa...aa"
+ ".............a"
+ "..........i..a"
+ ".............a"
+ "......haa...aa"
+ "mmmmmmmmaaaaam"
+
+ // Level 9
+ "mmmmmmmmhhhhhm"
+ "......hhh...hh"
+ ".............h"
+ ".............h"
+ ".............h"
+ "......hhh...hh"
+ "mmmmmmmmhhhhhm",
+
+ // Connections:
+ "0: 0, 5, 3: 4\n" /* Type 0, BLOCK_FACE_XM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BlazePlatformOverhang
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BridgeCrossing:
+ // The data has been exported from gallery Nether, area index 17, ID 159
+ {
+ // Size:
+ 15, 8, 15, // SizeX = 15, SizeY = 8, SizeZ = 15
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 7\n" /* netherbrickstairs */
+ "c:114: 5\n" /* netherbrickstairs */
+ "d:114: 4\n" /* netherbrickstairs */
+ "e:114: 6\n" /* netherbrickstairs */
+ "f: 44:14\n" /* step */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 2
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmbbbmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "aacmmmmmmmmmdaa"
+ "aacmmmmmmmmmdaa"
+ "aacmmmmmmmmmdaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmeeemmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 3
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmbbbmmmmmm"
+ "mmmmmmfffmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "aaacfmmmmmfdaaa"
+ "aaacfmmmmmfdaaa"
+ "aaacfmmmmmfdaaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmfffmmmmmm"
+ "mmmmmmeeemmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 4
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "eeeeeeaaaeeeeee"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "bbbbbdaaacbbbbb"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+ "mmmmmdaaacmmmmm"
+
+ // Level 5
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+
+ // Level 6
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "aaaaaa...aaaaaa"
+ "..............."
+ "..............."
+ "..............."
+ "aaaaaa...aaaaaa"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+
+ // Level 7
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+
+ // Level 8
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm",
+
+ // Connections:
+ "0: 0, 5, 7: 4\n" /* Type 0, BLOCK_FACE_XM */
+ "0: 7, 5, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "0: 14, 5, 7: 5\n" /* Type 0, BLOCK_FACE_XP */
+ "0: 7, 5, 14: 3\n" /* Type 0, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BridgeCrossing
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BridgeCrumble1:
+ // The data has been exported from gallery Nether, area index 19, ID 161
+ {
+ // Size:
+ 9, 6, 5, // SizeX = 9, SizeY = 6, SizeZ = 5
+
+ // Block definitions:
+ ".: 19: 0\n" /* sponge */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 5\n" /* netherbrickstairs */
+ "c: 44:14\n" /* step */
+ "d:114: 6\n" /* netherbrickstairs */
+ "e:114: 7\n" /* netherbrickstairs */,
+
+ // Block data:
+ // Level 1
+ "........."
+ "aa......."
+ "aa......."
+ "aa......."
+ "........."
+
+ // Level 2
+ "........."
+ "aab......"
+ "aab......"
+ "aab......"
+ "........."
+
+ // Level 3
+ "........."
+ "aaabc...."
+ "aaabc...."
+ "aaabc...."
+ "........."
+
+ // Level 4
+ "ddddddd.."
+ "aaaaaaaa."
+ "aaaaaaaaa"
+ "aaaaaaa.."
+ "eeeee...."
+
+ // Level 5
+ "aaaaaaaaa"
+ "aaaaa...."
+ "aaaaaa..."
+ "aaaaaa..."
+ "aaaaaaaa."
+
+ // Level 6
+ "aaaaaa..."
+ "........."
+ "........."
+ "........."
+ "aaaaaaa..",
+
+ // Connections:
+ "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BridgeCrumble1
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BridgeCrumble2
+ // The data has been exported from gallery Nether, area index 18, ID 160
+ {
+ // Size:
+ 13, 6, 5, // SizeX = 13, SizeY = 6, SizeZ = 5
+
+ // Block definitions:
+ ".: 19: 0\n" /* sponge */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 5\n" /* netherbrickstairs */
+ "c: 44:14\n" /* step */
+ "d:114: 6\n" /* netherbrickstairs */
+ "e:114: 7\n" /* netherbrickstairs */,
+
+ // Block data:
+ // Level 1
+ "............."
+ "aa..........."
+ "aa..........."
+ "aa..........."
+ "............."
+
+ // Level 2
+ "............."
+ "aab.........."
+ "aab.........."
+ "aab.........."
+ "............."
+
+ // Level 3
+ "............."
+ "aaabc........"
+ "aaabc........"
+ "aaabc........"
+ "............."
+
+ // Level 4
+ "ddddddddd...."
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaa...."
+ "aaaaaaaaaaaa."
+ "eeeeeeeee...."
+
+ // Level 5
+ "aaaaaaaaaaaa."
+ "aaaaaaaaaa..."
+ "aaaaaaaaaaa.."
+ "aaaaaaaaa...."
+ "aaaaaaaaaaaaa"
+
+ // Level 6
+ "aaaaaaaaa...."
+ "............."
+ "............."
+ "............."
+ "aaaaaaaaaa...",
+
+ // Connections:
+ "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BridgeCrumble2
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // BridgeSegment:
+ // The data has been exported from gallery Nether, area index 16, ID 158
+ {
+ // Size:
+ 15, 8, 5, // SizeX = 15, SizeY = 8, SizeZ = 5
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 5\n" /* netherbrickstairs */
+ "c:114: 4\n" /* netherbrickstairs */
+ "d: 44:14\n" /* step */
+ "e:114: 6\n" /* netherbrickstairs */
+ "f:114: 7\n" /* netherbrickstairs */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmmmmmmmmmmmm"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "mmmmmmmmmmmmmmm"
+
+ // Level 2
+ "mmmmmmmmmmmmmmm"
+ "aabmmmmmmmmmcaa"
+ "aabmmmmmmmmmcaa"
+ "aabmmmmmmmmmcaa"
+ "mmmmmmmmmmmmmmm"
+
+ // Level 3
+ "mmmmmmmmmmmmmmm"
+ "aaabdmmmmmdcaaa"
+ "aaabdmmmmmdcaaa"
+ "aaabdmmmmmdcaaa"
+ "mmmmmmmmmmmmmmm"
+
+ // Level 4
+ "eeeeeeeeeeeeeee"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "fffffffffffffff"
+
+ // Level 5
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+
+ // Level 6
+ "aaaaaaaaaaaaaaa"
+ "..............."
+ "..............."
+ "..............."
+ "aaaaaaaaaaaaaaa"
+
+ // Level 7
+ "mmmmmmmmmmmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmmmmmmmmmmm"
+
+ // Level 8
+ "mmmmmmmmmmmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmmmmmmmmmmm",
+
+ // Connections:
+ "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */
+ "0: 14, 5, 2: 5\n" /* Type 0, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BridgeSegment
+
+
+ // BridgeTee:
+ // The data has been exported from gallery Nether, area index 39, ID 290
+ {
+ // Size:
+ 15, 8, 10, // SizeX = 15, SizeY = 8, SizeZ = 10
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 5\n" /* netherbrickstairs */
+ "c:114: 4\n" /* netherbrickstairs */
+ "d:114: 6\n" /* netherbrickstairs */
+ "e: 44:14\n" /* step */
+ "f:114: 7\n" /* netherbrickstairs */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmmmmmmmmmmmm"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "aammmmmmmmmmmaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 2
+ "mmmmmmmmmmmmmmm"
+ "aabmmmmmmmmmcaa"
+ "aabmmmmmmmmmcaa"
+ "aabmmmmmmmmmcaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmdddmmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 3
+ "mmmmmmmmmmmmmmm"
+ "aaabemmmmmecaaa"
+ "aaabemmmmmecaaa"
+ "aaabemmmmmecaaa"
+ "mmmmmmmmmmmmmmm"
+ "mmmmmmeeemmmmmm"
+ "mmmmmmdddmmmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+ "mmmmmmaaammmmmm"
+
+ // Level 4
+ "ddddddddddddddd"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "fffffcaaabfffff"
+ "mmmmmcaaabmmmmm"
+ "mmmmmcaaabmmmmm"
+ "mmmmmcaaabmmmmm"
+ "mmmmmcaaabmmmmm"
+ "mmmmmcaaabmmmmm"
+
+ // Level 5
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+ "mmmmmaaaaammmmm"
+
+ // Level 6
+ "aaaaaaaaaaaaaaa"
+ "..............."
+ "..............."
+ "..............."
+ "aaaaaa...aaaaaa"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+ "mmmmma...ammmmm"
+
+ // Level 7
+ "mmmmmmmmmmmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+
+ // Level 8
+ "mmmmmmmmmmmmmmm"
+ "..............."
+ "..............."
+ "..............."
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm"
+ "mmmmmm...mmmmmm",
+
+ // Connections:
+ "0: 0, 5, 2: 4\n" /* Type 0, BLOCK_FACE_XM */
+ "0: 14, 5, 2: 5\n" /* Type 0, BLOCK_FACE_XP */
+ "0: 7, 5, 9: 3\n" /* Type 0, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // BridgeTee
+
+
+ // Corridor11:
+ // The data has been exported from gallery Nether, area index 36, ID 287
+ {
+ // Size:
+ 11, 6, 5, // SizeX = 11, SizeY = 6, SizeZ = 5
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c:114: 2\n" /* netherbrickstairs */
+ "d:114: 3\n" /* netherbrickstairs */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaaaaa"
+ "..........."
+ "..........."
+ "..........."
+ "aaaaaaaaaaa"
+
+ // Level 3
+ "abababababa"
+ "..........."
+ "..........."
+ "..........."
+ "abababababa"
+
+ // Level 4
+ "abababababa"
+ "..........."
+ "..........."
+ "..........."
+ "abababababa"
+
+ // Level 5
+ "abababababa"
+ "..........."
+ "..........."
+ "..........."
+ "abababababa"
+
+ // Level 6
+ "ccccccccccc"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "ddddddddddd",
+
+ // Connections:
+ "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // Corridor11
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // Corridor13:
+ // The data has been exported from gallery Nether, area index 35, ID 286
+ {
+ // Size:
+ 13, 6, 5, // SizeX = 13, SizeY = 6, SizeZ = 5
+
+ // Block definitions:
+ "a:112: 0\n" /* netherbrick */
+ ".: 0: 0\n" /* air */
+ "c:113: 0\n" /* netherbrickfence */
+ "d:114: 2\n" /* netherbrickstairs */
+ "e:114: 3\n" /* netherbrickstairs */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaaaaaaa"
+ "............."
+ "............."
+ "............."
+ "aaaaaaaaaaaaa"
+
+ // Level 3
+ "acacacacacaca"
+ "............."
+ "............."
+ "............."
+ "acacacacacaca"
+
+ // Level 4
+ "acacacacacaca"
+ "............."
+ "............."
+ "............."
+ "acacacacacaca"
+
+ // Level 5
+ "acacacacacaca"
+ "............."
+ "............."
+ "............."
+ "acacacacacaca"
+
+ // Level 6
+ "ddddddddddddd"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "eeeeeeeeeeeee",
+
+ // Connections:
+ "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 12, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // Corridor13
+
+
+ // CorridorCorner5:
+ // The data has been exported from gallery Nether, area index 10, ID 40
+ {
+ // Size:
+ 11, 6, 11, // SizeX = 11, SizeY = 6, SizeZ = 11
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c:114: 2\n" /* netherbrickstairs */
+ "d:114: 0\n" /* netherbrickstairs */
+ "e:114: 3\n" /* netherbrickstairs */
+ "f:114: 1\n" /* netherbrickstairs */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+
+ // Level 2
+ "aaaaaaaaaaa"
+ "a.........."
+ "a.........."
+ "a.........."
+ "a...aaaaaaa"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+
+ // Level 3
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 4
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 5
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 6
+ "ccccccccccc"
+ "daaaaaaaaaa"
+ "daaaaaaaaaa"
+ "daaaaaaaaaa"
+ "daaaeeeeeee"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm",
+
+ // Connections:
+ "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */
+ "1: 2, 1, 10: 3\n" /* Type 1, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // CorridorCorner5
+
+
+ // CorridorCorner5:
+ // The data has been exported from gallery Nether, area index 10, ID 40
+ {
+ // Size:
+ 11, 6, 11, // SizeX = 11, SizeY = 6, SizeZ = 11
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c:114: 2\n" /* netherbrickstairs */
+ "d:114: 0\n" /* netherbrickstairs */
+ "e:114: 3\n" /* netherbrickstairs */
+ "f:114: 1\n" /* netherbrickstairs */
+ "g: 54: 5\n" /* chest */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaaaaaaaa"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+ "aaaaammmmmm"
+
+ // Level 2
+ "aaaaaaaaaaa"
+ "ag........."
+ "a.........."
+ "a.........."
+ "a...aaaaaaa"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+ "a...ammmmmm"
+
+ // Level 3
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 4
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 5
+ "abababababa"
+ "b.........."
+ "a.........."
+ "b.........."
+ "a...abababa"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+ "b...bmmmmmm"
+ "a...ammmmmm"
+
+ // Level 6
+ "ccccccccccc"
+ "daaaaaaaaaa"
+ "daaaaaaaaaa"
+ "daaaaaaaaaa"
+ "daaaeeeeeee"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm"
+ "daaafmmmmmm",
+
+ // Connections:
+ "1: 10, 1, 2: 5\n" /* Type 1, BLOCK_FACE_XP */
+ "1: 2, 1, 10: 3\n" /* Type 1, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // CorridorCorner5Chest
+
+
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // CorridorStairs:
+ // The data has been exported from gallery Nether, area index 12, ID 42
+ {
+ // Size:
+ 9, 13, 5, // SizeX = 9, SizeY = 13, SizeZ = 5
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:114: 0\n" /* netherbrickstairs */
+ "c:113: 0\n" /* netherbrickfence */
+ "d:114: 2\n" /* netherbrickstairs */
+ "e:114: 3\n" /* netherbrickstairs */
+ "f: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaa"
+ "aaaaaaaaa"
+ "aaaaaaaaa"
+ "aaaaaaaaa"
+ "aaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaaa"
+ ".baaaaaaa"
+ ".baaaaaaa"
+ ".baaaaaaa"
+ "aaaaaaaaa"
+
+ // Level 3
+ "acaaaaaaa"
+ "..baaaaaa"
+ "..baaaaaa"
+ "..baaaaaa"
+ "acaaaaaaa"
+
+ // Level 4
+ "acaaaaaaa"
+ "...baaaaa"
+ "...baaaaa"
+ "...baaaaa"
+ "acaaaaaaa"
+
+ // Level 5
+ "acacaaaaa"
+ "....baaaa"
+ "....baaaa"
+ "....baaaa"
+ "acacaaaaa"
+
+ // Level 6
+ "aaacaaaaa"
+ ".....baaa"
+ ".....baaa"
+ ".....baaa"
+ "aaacaaaaa"
+
+ // Level 7
+ "daacacaaa"
+ "a.....baa"
+ "a.....baa"
+ "a.....baa"
+ "eaacacaaa"
+
+ // Level 8
+ "fdaaacaaa"
+ "fa.....ba"
+ "fa.....ba"
+ "fa.....ba"
+ "feaaacaaa"
+
+ // Level 9
+ "ffdaacaca"
+ "ffa......"
+ "ffa......"
+ "ffa......"
+ "ffeaacaca"
+
+ // Level 10
+ "fffdaaaca"
+ "fffa....."
+ "fffa....."
+ "fffa....."
+ "fffeaaaca"
+
+ // Level 11
+ "ffffdaaca"
+ "ffffa...."
+ "ffffa...."
+ "ffffa...."
+ "ffffeaaca"
+
+ // Level 12
+ "fffffdaaa"
+ "fffffa..."
+ "fffffa..."
+ "fffffa..."
+ "fffffeaaa"
+
+ // Level 13
+ "ffffffddd"
+ "ffffffaaa"
+ "ffffffaaa"
+ "ffffffaaa"
+ "ffffffeee",
+
+ // Connections:
+ "1: 0, 1, 2: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 8, 8, 2: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // CorridorStairs
+
+
+ // LavaStaircase:
+ // The data has been exported from gallery Nether, area index 28, ID 278
+ {
+ // Size:
+ 15, 11, 15, // SizeX = 15, SizeY = 11, SizeZ = 15
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c: 11: 0\n" /* lava */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaa...aaaa"
+ "aaaaa.........a"
+ "aaaaa.........a"
+ "aaaaab........a"
+ "accca...aaaa..a"
+ "accca...acca..a"
+ "acccaaaaacca..a"
+ "acccccccccca..a"
+ "acccaaaaacca..a"
+ "accca...acca..a"
+ "accca...aaaa..a"
+ "aaaaab........a"
+ "aaaaa.........a"
+ "aaaaa.........a"
+ "aaaaaaaa...aaaa"
+
+ // Level 3
+ "aaaaaaaa...aaaa"
+ "aaaa..........a"
+ "aaaa..........a"
+ "aaaabb........a"
+ "aaaa..........a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "aaaa..........a"
+ "aaaabb........a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "aaaaaaaa...aaaa"
+
+ // Level 4
+ "aaaaaaaa...aaaa"
+ "a.............a"
+ "a.............a"
+ "a..bb.........a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "a..bb.........a"
+ "a.............a"
+ "a.............a"
+ "aaaaaaaa...aaaa"
+
+ // Level 5
+ "aaaaaaaabbbaaaa"
+ "a.............a"
+ "a.............a"
+ "a..b..........a"
+ "a..b..........a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "a.............a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "a..b..........a"
+ "a..b..........a"
+ "a.............a"
+ "a.............a"
+ "aaaaaaaabbbaaaa"
+
+ // Level 6
+ "aaaaaaaaaaaaaaa"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a..b..........a"
+ "a..b..........a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "aaaa..........a"
+ "a..b..........a"
+ "a..b..........a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "aaaaaaaaaaaaaaa"
+
+ // Level 7
+ "aaaaaaaaaaaaaaa"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a..b..........a"
+ "...b..........a"
+ "...b..........a"
+ "...b..........a"
+ "a..b..........a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "a.............a"
+ "aaaaaaaaaaaaaaa"
+
+ // Level 8
+ "aababababababaa"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "..............b"
+ "..............a"
+ "..............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "aababababababaa"
+
+ // Level 9
+ "aababababababaa"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "..............b"
+ "..............a"
+ "..............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "aababababababaa"
+
+ // Level 10
+ "aababababababaa"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "..............b"
+ "..............a"
+ "..............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "b.............b"
+ "a.............a"
+ "aababababababaa"
+
+ // Level 11
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa"
+ "aaaaaaaaaaaaaaa",
+
+ // Connections:
+ "1: 0, 6, 7: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "0: 9, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "0: 9, 1, 14: 3\n" /* Type 0, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // LavaStaircase
+
+
+ // LavaStaircaseBig:
+ // The data has been exported from gallery Nether, area index 31, ID 282
+ {
+ // Size:
+ 12, 15, 15, // SizeX = 12, SizeY = 15, SizeZ = 15
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b: 10: 0\n" /* lava */
+ "c:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "abbbbbaaaaaa"
+ "abbbbbbaaaaa"
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbbaaaaa"
+ "abbbbb.aaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+
+ // Level 3
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "abbbbbaaaaaa"
+ "abbbbbba...a"
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbba...a"
+ "abbbbb.aaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+
+ // Level 4
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "abbbbbaa...a"
+ "abbbbbba...a"
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbba...."
+ "abbbbbba...a"
+ "abbbbbaa...a"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+
+ // Level 5
+ "aaaaaaaaaaaa"
+ "aaaaa......a"
+ "aaaaa......a"
+ "aaaaacc....a"
+ "a.....cc...a"
+ "a......c...a"
+ "a......c...."
+ "a......c...."
+ "a......c...."
+ "a......c...a"
+ "a.....cc...a"
+ "aaaaacc....a"
+ "aaaaa......a"
+ "aaaaa......a"
+ "aaaaaaaaaaaa"
+
+ // Level 6
+ "aaaaaaaaaaaa"
+ "aaaa.......a"
+ "aaaa.......a"
+ "aaaacc.....a"
+ "aaaa.......a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaa.......a"
+ "aaaacc.....a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "aaaaaaaaaaaa"
+
+ // Level 7
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..cc......a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "a..cc......a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 8
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..c.......a"
+ "a..c.......a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "a..........a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "a..c.......a"
+ "a..c.......a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 9
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..c.......a"
+ "a..c.......a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "aaaa.......a"
+ "a..c.......a"
+ "a..c.......a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 10
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..c.......a"
+ "...c.......a"
+ "...c.......a"
+ "...c.......a"
+ "a..c.......a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 11
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "...........a"
+ "...........a"
+ "...........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 12
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "...........a"
+ "...........a"
+ "...........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 13
+ "aaaaaaaaaaaa"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "...........a"
+ "...........a"
+ "...........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "a..........a"
+ "aaaaaaaaaaaa"
+
+ // Level 14
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+ "aaaaaaaaaaaa"
+
+ // Level 15
+ "aaaaaaaaaaaa"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "abbbbbbbbbba"
+ "aaaaaaaaaaaa",
+
+ // Connections:
+ "1: 0, 9, 7: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 11, 1, 7: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // LavaStaircaseBig
+
+
+ // MidStaircase:
+ // The data has been exported from gallery Nether, area index 23, ID 165
+ {
+ // Size:
+ 13, 8, 13, // SizeX = 13, SizeY = 8, SizeZ = 13
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b: 88: 0\n" /* soulsand */
+ "c:115: 7\n" /* netherwartblock */
+ "d:114: 3\n" /* netherbrickstairs */
+ "e:114: 0\n" /* netherbrickstairs */
+ "f:114: 1\n" /* netherbrickstairs */
+ "g:114: 2\n" /* netherbrickstairs */
+ "h: 10: 0\n" /* lava */
+ "i:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaabbbbbaaaa"
+ "aaaabbbbbaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaabbbbbaaaa"
+ "aaaabbbbbaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaacccccaaaa"
+ "addecccccfdda"
+ "...eaaaaad..."
+ "...eaaaaa...."
+ "...eaaaaag..."
+ "agggcccccfgga"
+ "aaaacccccaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 3
+ "aaaaaaaaaaaaa"
+ "aha.......aha"
+ "aaa.......aaa"
+ "a...........a"
+ "a...........a"
+ "....eaaaa...."
+ "....eaaaa...."
+ "....eaaaa...."
+ "a...........a"
+ "a...........a"
+ "aaa.......aaa"
+ "aha.......aha"
+ "aaaaaaaaaaaaa"
+
+ // Level 4
+ "aaaiiaaaiiaaa"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ ".....eaaa...."
+ ".....eaaa...."
+ ".....eaaa...."
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "aaaiiaaaiiaaa"
+
+ // Level 5
+ "aaaiiaaaiiaaa"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "......eaa...."
+ "......eaa...."
+ "......eaa...."
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "aaaiiaaaiiaaa"
+
+ // Level 6
+ "aaaaaaaaaaaaa"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a......ea...a"
+ "a......ea...a"
+ "a......ea...a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "a...........a"
+ "aaaaaaaaaaaaa"
+
+ // Level 7
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaa....eaaaa"
+ "aaaa....eaaaa"
+ "aaaa....eaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 8
+ "iaiaiaiaiaiai"
+ "a...........a"
+ "i...........i"
+ "a...........a"
+ "i...........i"
+ "a............"
+ "i............"
+ "a............"
+ "i...........i"
+ "a...........a"
+ "i...........i"
+ "a...........a"
+ "iaiaiaiaiaiai",
+
+ // Connections:
+ "1: 0, 1, 6: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 12, 1, 6: 5\n" /* Type 1, BLOCK_FACE_XP */
+ "1: 12, 7, 6: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // MidStaircase
+
+
+ // StairsToOpen1:
+ // The data has been exported from gallery Nether, area index 27, ID 277
+ {
+ // Size:
+ 7, 10, 7, // SizeX = 7, SizeY = 10, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 2
+ "aa...aa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 3
+ "aa...aa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a.aaaaa"
+ "aabaaba"
+
+ // Level 4
+ "aa...aa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a..aaaa"
+ "aabaaba"
+
+ // Level 5
+ "aabbbaa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a...aaa"
+ "aabaaba"
+
+ // Level 6
+ "aaaaaaa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a....aa"
+ "aaaaaaa"
+
+ // Level 7
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "a.....a"
+ "aaaaaaa"
+
+ // Level 8
+ "aaaaaaa"
+ "a.....a"
+ "a......"
+ "a......"
+ "a......"
+ "a.....a"
+ "aaaaaaa"
+
+ // Level 9
+ "mmmmmmm"
+ "m.....m"
+ "m......"
+ "m......"
+ "m......"
+ "m.....m"
+ "mmmmmmm"
+
+ // Level 10
+ "mmmmmmm"
+ "m.....m"
+ "m......"
+ "m......"
+ "m......"
+ "m.....m"
+ "mmmmmmm",
+
+ // Connections:
+ "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "0: 6, 7, 3: 5\n" /* Type 0, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // StairsToOpen1
+
+
+ // StairsToOpen2:
+ // The data has been exported from gallery Nether, area index 8, ID 35
+ {
+ // Size:
+ 7, 10, 7, // SizeX = 7, SizeY = 10, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 2
+ "aa...aa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 3
+ "aa...aa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a.aaaaa"
+ "aabaaba"
+
+ // Level 4
+ "aa...aa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a..aaaa"
+ "aabaaba"
+
+ // Level 5
+ "aabbbaa"
+ "a.....a"
+ "b.....b"
+ "a.....a"
+ "b.....b"
+ "a...aaa"
+ "aabaaba"
+
+ // Level 6
+ "aaaaaaa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a....aa"
+ "aaaaaaa"
+
+ // Level 7
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "a.....a"
+ "aaaaaaa"
+
+ // Level 8
+ "aaaaaaa"
+ "a.....a"
+ "......a"
+ "......a"
+ "......a"
+ "a.....a"
+ "aaaaaaa"
+
+ // Level 9
+ "mmmmmmm"
+ "m.....m"
+ "......m"
+ "......m"
+ "......m"
+ "m.....m"
+ "mmmmmmm"
+
+ // Level 10
+ "mmmmmmm"
+ "m.....m"
+ "......m"
+ "......m"
+ "......m"
+ "m.....m"
+ "mmmmmmm",
+
+ // Connections:
+ "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "0: 0, 7, 3: 4\n" /* Type 0, BLOCK_FACE_XM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // StairsToOpen2
+
+
+ // Tee2x4:
+ // The data has been exported from gallery Nether, area index 40, ID 291
+ {
+ // Size:
+ 13, 6, 7, // SizeX = 13, SizeY = 6, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c:114: 0\n" /* netherbrickstairs */
+ "d:114: 1\n" /* netherbrickstairs */
+ "e:114: 2\n" /* netherbrickstairs */
+ "f:114: 3\n" /* netherbrickstairs */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmaaaaammmm"
+ "mmmmaaaaammmm"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "mmmma...ammmm"
+ "mmmma...ammmm"
+ "aaaaa...aaaaa"
+ "............."
+ "............."
+ "............."
+ "aaaaaaaaaaaaa"
+
+ // Level 3
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 4
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 5
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 6
+ "mmmmcaaadmmmm"
+ "mmmmcaaadmmmm"
+ "eeeecaaadeeee"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "fffffffffffff",
+
+ // Connections:
+ "1: 0, 1, 4: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 6, 1, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */
+ "1: 12, 1, 4: 5\n" /* Type 1, BLOCK_FACE_XP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // Tee2x4
+
+
+ // Tee4x4:
+ // The data has been exported from gallery Nether, area index 41, ID 292
+ {
+ // Size:
+ 13, 6, 9, // SizeX = 13, SizeY = 6, SizeZ = 9
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */
+ "c:114: 0\n" /* netherbrickstairs */
+ "d:114: 1\n" /* netherbrickstairs */
+ "e:114: 2\n" /* netherbrickstairs */
+ "f:114: 3\n" /* netherbrickstairs */
+ "m: 19: 0\n" /* sponge */,
+
+ // Block data:
+ // Level 1
+ "mmmmaaaaammmm"
+ "mmmmaaaaammmm"
+ "mmmmaaaaammmm"
+ "mmmmaaaaammmm"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "mmmma...ammmm"
+ "mmmma...ammmm"
+ "mmmma...ammmm"
+ "mmmma...ammmm"
+ "aaaaa...aaaaa"
+ "............."
+ "............."
+ "............."
+ "aaaaaaaaaaaaa"
+
+ // Level 3
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 4
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 5
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "mmmma...ammmm"
+ "mmmmb...bmmmm"
+ "ababa...ababa"
+ "............."
+ "............."
+ "............."
+ "ababababababa"
+
+ // Level 6
+ "mmmmcaaadmmmm"
+ "mmmmcaaadmmmm"
+ "mmmmcaaadmmmm"
+ "mmmmcaaadmmmm"
+ "eeeecaaadeeee"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "fffffffffffff",
+
+ // Connections:
+ "1: 0, 1, 6: 4\n" /* Type 1, BLOCK_FACE_XM */
+ "1: 12, 1, 6: 5\n" /* Type 1, BLOCK_FACE_XP */
+ "1: 6, 1, 0: 2\n" /* Type 1, BLOCK_FACE_ZM */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // Tee4x4
+
+ // Turret:
+ // The data has been exported from gallery Nether, area index 7, ID 34
+ {
+ // Size:
+ 7, 6, 7, // SizeX = 7, SizeY = 6, SizeZ = 7
+
+ // Block definitions:
+ ".: 0: 0\n" /* air */
+ "a:112: 0\n" /* netherbrick */
+ "b:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+ "aaaaaaa"
+
+ // Level 2
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 3
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 4
+ "aa...aa"
+ "a.....a"
+ "......."
+ "......."
+ "......."
+ "a.....a"
+ "aa...aa"
+
+ // Level 5
+ "aabbbaa"
+ "a.....a"
+ "b.....b"
+ "b.....b"
+ "b.....b"
+ "a.....a"
+ "aabbbaa"
+
+ // Level 6
+ "aaaaaaa"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "a.....a"
+ "aaaaaaa",
+
+ // Connections:
+ "0: 0, 1, 3: 4\n" /* Type 0, BLOCK_FACE_XM */
+ "0: 3, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "0: 6, 1, 3: 5\n" /* Type 0, BLOCK_FACE_XP */
+ "0: 3, 1, 6: 3\n" /* Type 0, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ }, // Turret
+
+} ; // g_NetherFortPrefabs1
+
+
+
+
+
+const cPrefab::sDef g_NetherFortStartingPrefabs1[] =
+{
+ ///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+ // CentralRoom:
+ // The data has been exported from gallery Nether, area index 22, ID 164
+ {
+ // Size:
+ 13, 9, 13, // SizeX = 13, SizeY = 9, SizeZ = 13
+
+ // Block definitions:
+ "a:112: 0\n" /* netherbrick */
+ "b: 0: 0\n" /* air */
+ "c: 10: 0\n" /* lava */
+ "d:113: 0\n" /* netherbrickfence */,
+
+ // Block data:
+ // Level 1
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 2
+ "aaaaabbbaaaaa"
+ "aaaaabbbaaaaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbaaabbbaa"
+ "aabbbacabbbaa"
+ "aabbbaaabbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aabbbbbbbbbaa"
+ "aaaaabbbaaaaa"
+ "aaaaabbbaaaaa"
+
+ // Level 3
+ "aaaaabbbaaaaa"
+ "aaadabbbadaaa"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "aaadabbbadaaa"
+ "aaaaabbbaaaaa"
+
+ // Level 4
+ "aaaaabbbaaaaa"
+ "aaadabbbadaaa"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "adbbbbbbbbbda"
+ "aabbbbbbbbbaa"
+ "aaadabbbadaaa"
+ "aaaaabbbaaaaa"
+
+ // Level 5
+ "adadadddadada"
+ "daaaabbbaaaad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "daaaabbbaaaad"
+ "adadabbbadada"
+
+ // Level 6
+ "adadaaaaadada"
+ "daaaaaaaaaaad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "dabbbbbbbbbad"
+ "aabbbbbbbbbaa"
+ "daaaaaaaaaaad"
+ "adadaaaaadada"
+
+ // Level 7
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 8
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+ "aaaaaaaaaaaaa"
+
+ // Level 9
+ "dadadadadadad"
+ "abbbbbbbbbbba"
+ "dbbbbbbbbbbbd"
+ "abbbbbbbbbbba"
+ "dbbbbbbbbbbbd"
+ "abbbbbbbbbbba"
+ "dbbbbbbbbbbbd"
+ "abbbbbbbbbbba"
+ "dbbbbbbbbbbbd"
+ "abbbbbbbbbbba"
+ "dbbbbbbbbbbbd"
+ "abbbbbbbbbbba"
+ "dadadadadadad",
+
+ // Connections:
+ "0: 6, 1, 0: 2\n" /* Type 0, BLOCK_FACE_ZM */
+ "1: 6, 1, 12: 3\n" /* Type 1, BLOCK_FACE_ZP */,
+
+ // AllowedRotations:
+ 7, /* 1, 2, 3 CCW rotations */
+
+ // Merge strategy:
+ cBlockArea::msSpongePrint,
+ },
+} ; // g_NetherFortStartingPrefabs1
+
+const size_t g_NetherFortPrefabs1Count = ARRAYCOUNT(g_NetherFortPrefabs1);
+const size_t g_NetherFortStartingPrefabs1Count = ARRAYCOUNT(g_NetherFortStartingPrefabs1);
+
+
+
+
diff --git a/src/Generating/Prefabs/NetherFortPrefabs.h b/src/Generating/Prefabs/NetherFortPrefabs.h
new file mode 100644
index 000000000..37a91689d
--- /dev/null
+++ b/src/Generating/Prefabs/NetherFortPrefabs.h
@@ -0,0 +1,15 @@
+
+// NetherFortPrefabs.h
+
+// Declares the data used for nether fortress prefabs
+
+#include "../Prefab.h"
+
+
+
+
+
+extern const cPrefab::sDef g_NetherFortPrefabs1[];
+extern const cPrefab::sDef g_NetherFortStartingPrefabs1[];
+extern const size_t g_NetherFortPrefabs1Count;
+extern const size_t g_NetherFortStartingPrefabs1Count;
diff --git a/src/Globals.h b/src/Globals.h
index 3e62832b7..26a0d87a9 100644
--- a/src/Globals.h
+++ b/src/Globals.h
@@ -29,6 +29,9 @@
// Disabling this warning, because we know what we're doing when we're doing this:
#pragma warning(disable: 4355) // 'this' used in initializer list
+
+ // Disabled because it's useless:
+ #pragma warning(disable: 4512) // 'class': assignment operator could not be generated - reported for each class that has a reference-type member
// 2014_01_06 xoft: Disabled this warning because MSVC is stupid and reports it in obviously wrong places
// #pragma warning(3 : 4244) // Conversion from 'type1' to 'type2', possible loss of data
@@ -264,11 +267,17 @@ template class SizeChecker<UInt16, 2>;
#define assert_test(x) ( !!(x) || (assert(!#x), exit(1), 0))
#endif
-/// A generic interface used mainly in ForEach() functions
+
+
+
+
+/** A generic interface used mainly in ForEach() functions */
template <typename Type> class cItemCallback
{
public:
- /// Called for each item in the internal list; return true to stop the loop, or false to continue enumerating
+ virtual ~cItemCallback() {}
+
+ /** Called for each item in the internal list; return true to stop the loop, or false to continue enumerating */
virtual bool Item(Type * a_Type) = 0;
} ;
diff --git a/src/Group.cpp b/src/Group.cpp
index 5f1f25782..9c2467144 100644
--- a/src/Group.cpp
+++ b/src/Group.cpp
@@ -38,4 +38,4 @@ void cGroup::InheritFrom( cGroup* a_Group )
void cGroup::ClearPermission()
{
m_Permissions.clear();
-} \ No newline at end of file
+}
diff --git a/src/HTTPServer/EnvelopeParser.cpp b/src/HTTPServer/EnvelopeParser.cpp
index 8dbe05f14..fd4f3836d 100644
--- a/src/HTTPServer/EnvelopeParser.cpp
+++ b/src/HTTPServer/EnvelopeParser.cpp
@@ -20,7 +20,7 @@ cEnvelopeParser::cEnvelopeParser(cCallbacks & a_Callbacks) :
-int cEnvelopeParser::Parse(const char * a_Data, int a_Size)
+size_t cEnvelopeParser::Parse(const char * a_Data, size_t a_Size)
{
if (!m_IsInHeaders)
{
@@ -55,7 +55,7 @@ int cEnvelopeParser::Parse(const char * a_Data, int a_Size)
{
// An error has occurred
m_IsInHeaders = false;
- return -1;
+ return AString::npos;
}
Last = idxCRLF + 2;
idxCRLF = m_IncomingData.find("\r\n", idxCRLF + 2);
diff --git a/src/HTTPServer/EnvelopeParser.h b/src/HTTPServer/EnvelopeParser.h
index 6430fbebf..e96d80abe 100644
--- a/src/HTTPServer/EnvelopeParser.h
+++ b/src/HTTPServer/EnvelopeParser.h
@@ -19,7 +19,10 @@ public:
class cCallbacks
{
public:
- /// Called when a full header line is parsed
+ // Force a virtual destructor in descendants:
+ virtual ~cCallbacks() {}
+
+ /** Called when a full header line is parsed */
virtual void OnHeaderLine(const AString & a_Key, const AString & a_Value) = 0;
} ;
@@ -27,40 +30,41 @@ public:
cEnvelopeParser(cCallbacks & a_Callbacks);
/** Parses the incoming data.
- Returns the number of bytes consumed from the input. The bytes not consumed are not part of the envelope header
+ Returns the number of bytes consumed from the input. The bytes not consumed are not part of the envelope header.
+ Returns AString::npos on error
*/
- int Parse(const char * a_Data, int a_Size);
+ size_t Parse(const char * a_Data, size_t a_Size);
- /// Makes the parser forget everything parsed so far, so that it can be reused for parsing another datastream
+ /** Makes the parser forget everything parsed so far, so that it can be reused for parsing another datastream */
void Reset(void);
- /// Returns true if more input is expected for the envelope header
+ /** Returns true if more input is expected for the envelope header */
bool IsInHeaders(void) const { return m_IsInHeaders; }
- /// Sets the IsInHeaders flag; used by cMultipartParser to simplify the parser initial conditions
+ /** Sets the IsInHeaders flag; used by cMultipartParser to simplify the parser initial conditions */
void SetIsInHeaders(bool a_IsInHeaders) { m_IsInHeaders = a_IsInHeaders; }
public:
- /// Callbacks to call for the various events
+ /** Callbacks to call for the various events */
cCallbacks & m_Callbacks;
- /// Set to true while the parser is still parsing the envelope headers. Once set to true, the parser will not consume any more data.
+ /** Set to true while the parser is still parsing the envelope headers. Once set to true, the parser will not consume any more data. */
bool m_IsInHeaders;
- /// Buffer for the incoming data until it is parsed
+ /** Buffer for the incoming data until it is parsed */
AString m_IncomingData;
- /// Holds the last parsed key; used for line-wrapped values
+ /** Holds the last parsed key; used for line-wrapped values */
AString m_LastKey;
- /// Holds the last parsed value; used for line-wrapped values
+ /** Holds the last parsed value; used for line-wrapped values */
AString m_LastValue;
- /// Notifies the callback of the key/value stored in m_LastKey/m_LastValue, then erases them
+ /** Notifies the callback of the key/value stored in m_LastKey/m_LastValue, then erases them */
void NotifyLast(void);
- /// Parses one line of header data. Returns true if successful
+ /** Parses one line of header data. Returns true if successful */
bool ParseLine(const char * a_Data, size_t a_Size);
} ;
diff --git a/src/HTTPServer/HTTPConnection.cpp b/src/HTTPServer/HTTPConnection.cpp
index 78b7ce4d9..44a3d3f88 100644
--- a/src/HTTPServer/HTTPConnection.cpp
+++ b/src/HTTPServer/HTTPConnection.cpp
@@ -67,10 +67,10 @@ void cHTTPConnection::Send(const cHTTPResponse & a_Response)
-void cHTTPConnection::Send(const void * a_Data, int a_Size)
+void cHTTPConnection::Send(const void * a_Data, size_t a_Size)
{
ASSERT(m_State == wcsSendingResp);
- AppendPrintf(m_OutgoingData, "%x\r\n", a_Size);
+ AppendPrintf(m_OutgoingData, SIZE_T_FMT "\r\n", a_Size);
m_OutgoingData.append((const char *)a_Data, a_Size);
m_OutgoingData.append("\r\n");
m_HTTPServer.NotifyConnectionWrite(*this);
@@ -144,7 +144,7 @@ void cHTTPConnection::Terminate(void)
-void cHTTPConnection::DataReceived(const char * a_Data, int a_Size)
+void cHTTPConnection::DataReceived(const char * a_Data, size_t a_Size)
{
switch (m_State)
{
@@ -155,8 +155,8 @@ void cHTTPConnection::DataReceived(const char * a_Data, int a_Size)
m_CurrentRequest = new cHTTPRequest;
}
- int BytesConsumed = m_CurrentRequest->ParseHeaders(a_Data, a_Size);
- if (BytesConsumed < 0)
+ size_t BytesConsumed = m_CurrentRequest->ParseHeaders(a_Data, a_Size);
+ if (BytesConsumed == AString::npos)
{
delete m_CurrentRequest;
m_CurrentRequest = NULL;
@@ -174,7 +174,7 @@ void cHTTPConnection::DataReceived(const char * a_Data, int a_Size)
m_State = wcsRecvBody;
m_HTTPServer.NewRequest(*this, *m_CurrentRequest);
m_CurrentRequestBodyRemaining = m_CurrentRequest->GetContentLength();
- if (m_CurrentRequestBodyRemaining < 0)
+ if (m_CurrentRequestBodyRemaining == AString::npos)
{
// The body length was not specified in the request, assume zero
m_CurrentRequestBodyRemaining = 0;
@@ -197,7 +197,7 @@ void cHTTPConnection::DataReceived(const char * a_Data, int a_Size)
ASSERT(m_CurrentRequest != NULL);
if (m_CurrentRequestBodyRemaining > 0)
{
- int BytesToConsume = std::min(m_CurrentRequestBodyRemaining, a_Size);
+ size_t BytesToConsume = std::min(m_CurrentRequestBodyRemaining, (size_t)a_Size);
m_HTTPServer.RequestBody(*this, *m_CurrentRequest, a_Data, BytesToConsume);
m_CurrentRequestBodyRemaining -= BytesToConsume;
}
diff --git a/src/HTTPServer/HTTPConnection.h b/src/HTTPServer/HTTPConnection.h
index 5b8103554..fc11f1ba6 100644
--- a/src/HTTPServer/HTTPConnection.h
+++ b/src/HTTPServer/HTTPConnection.h
@@ -51,7 +51,7 @@ public:
void Send(const cHTTPResponse & a_Response);
/** Sends the data as the response (may be called multiple times) */
- void Send(const void * a_Data, int a_Size);
+ void Send(const void * a_Data, size_t a_Size);
/** Sends the data as the response (may be called multiple times) */
void Send(const AString & a_Data) { Send(a_Data.data(), a_Data.size()); }
@@ -87,11 +87,11 @@ protected:
/** Number of bytes that remain to read for the complete body of the message to be received.
Valid only in wcsRecvBody */
- int m_CurrentRequestBodyRemaining;
+ size_t m_CurrentRequestBodyRemaining;
// cSocketThreads::cCallback overrides:
- virtual void DataReceived (const char * a_Data, int a_Size) override; // Data is received from the client
+ virtual void DataReceived (const char * a_Data, size_t a_Size) override; // Data is received from the client
virtual void GetOutgoingData(AString & a_Data) override; // Data can be sent to client
virtual void SocketClosed (void) override; // The socket has been closed for any reason
} ;
diff --git a/src/HTTPServer/HTTPFormParser.cpp b/src/HTTPServer/HTTPFormParser.cpp
index e661ea6f9..9ddfb82f1 100644
--- a/src/HTTPServer/HTTPFormParser.cpp
+++ b/src/HTTPServer/HTTPFormParser.cpp
@@ -52,7 +52,7 @@ cHTTPFormParser::cHTTPFormParser(cHTTPRequest & a_Request, cCallbacks & a_Callba
-cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, int a_Size, cCallbacks & a_Callbacks) :
+cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, size_t a_Size, cCallbacks & a_Callbacks) :
m_Callbacks(a_Callbacks),
m_Kind(a_Kind),
m_IsValid(true)
@@ -64,7 +64,7 @@ cHTTPFormParser::cHTTPFormParser(eKind a_Kind, const char * a_Data, int a_Size,
-void cHTTPFormParser::Parse(const char * a_Data, int a_Size)
+void cHTTPFormParser::Parse(const char * a_Data, size_t a_Size)
{
if (!m_IsValid)
{
@@ -243,7 +243,7 @@ void cHTTPFormParser::OnPartHeader(const AString & a_Key, const AString & a_Valu
-void cHTTPFormParser::OnPartData(const char * a_Data, int a_Size)
+void cHTTPFormParser::OnPartData(const char * a_Data, size_t a_Size)
{
if (m_CurrentPartName.empty())
{
diff --git a/src/HTTPServer/HTTPFormParser.h b/src/HTTPServer/HTTPFormParser.h
index a554ca5a4..edc6d2471 100644
--- a/src/HTTPServer/HTTPFormParser.h
+++ b/src/HTTPServer/HTTPFormParser.h
@@ -36,11 +36,14 @@ public:
class cCallbacks
{
public:
+ // Force a virtual destructor in descendants:
+ virtual ~cCallbacks() {}
+
/// Called when a new file part is encountered in the form data
virtual void OnFileStart(cHTTPFormParser & a_Parser, const AString & a_FileName) = 0;
/// Called when more file data has come for the current file in the form data
- virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, int a_Size) = 0;
+ virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, size_t a_Size) = 0;
/// Called when the current file part has ended in the form data
virtual void OnFileEnd(cHTTPFormParser & a_Parser) = 0;
@@ -51,10 +54,10 @@ public:
cHTTPFormParser(cHTTPRequest & a_Request, cCallbacks & a_Callbacks);
/// Creates a parser with the specified content type that reads data from a string
- cHTTPFormParser(eKind a_Kind, const char * a_Data, int a_Size, cCallbacks & a_Callbacks);
+ cHTTPFormParser(eKind a_Kind, const char * a_Data, size_t a_Size, cCallbacks & a_Callbacks);
/// Adds more data into the parser, as the request body is received
- void Parse(const char * a_Data, int a_Size);
+ void Parse(const char * a_Data, size_t a_Size);
/** Notifies that there's no more data incoming and the parser should finish its parsing.
Returns true if parsing successful
@@ -103,7 +106,7 @@ protected:
// cMultipartParser::cCallbacks overrides:
virtual void OnPartStart (void) override;
virtual void OnPartHeader(const AString & a_Key, const AString & a_Value) override;
- virtual void OnPartData (const char * a_Data, int a_Size) override;
+ virtual void OnPartData (const char * a_Data, size_t a_Size) override;
virtual void OnPartEnd (void) override;
} ;
diff --git a/src/HTTPServer/HTTPMessage.cpp b/src/HTTPServer/HTTPMessage.cpp
index 98627eb8e..4a3611050 100644
--- a/src/HTTPServer/HTTPMessage.cpp
+++ b/src/HTTPServer/HTTPMessage.cpp
@@ -25,7 +25,7 @@
cHTTPMessage::cHTTPMessage(eKind a_Kind) :
m_Kind(a_Kind),
- m_ContentLength(-1)
+ m_ContentLength(AString::npos)
{
}
@@ -81,23 +81,23 @@ cHTTPRequest::cHTTPRequest(void) :
-int cHTTPRequest::ParseHeaders(const char * a_Data, int a_Size)
+size_t cHTTPRequest::ParseHeaders(const char * a_Data, size_t a_Size)
{
if (!m_IsValid)
{
- return -1;
+ return AString::npos;
}
if (m_Method.empty())
{
// The first line hasn't been processed yet
- int res = ParseRequestLine(a_Data, a_Size);
- if ((res < 0) || (res == a_Size))
+ size_t res = ParseRequestLine(a_Data, a_Size);
+ if ((res == AString::npos) || (res == a_Size))
{
return res;
}
- int res2 = m_EnvelopeParser.Parse(a_Data + res, a_Size - res);
- if (res2 < 0)
+ size_t res2 = m_EnvelopeParser.Parse(a_Data + res, a_Size - res);
+ if (res2 == AString::npos)
{
m_IsValid = false;
return res2;
@@ -107,8 +107,8 @@ int cHTTPRequest::ParseHeaders(const char * a_Data, int a_Size)
if (m_EnvelopeParser.IsInHeaders())
{
- int res = m_EnvelopeParser.Parse(a_Data, a_Size);
- if (res < 0)
+ size_t res = m_EnvelopeParser.Parse(a_Data, a_Size);
+ if (res == AString::npos)
{
m_IsValid = false;
}
@@ -138,7 +138,7 @@ AString cHTTPRequest::GetBareURL(void) const
-int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size)
+size_t cHTTPRequest::ParseRequestLine(const char * a_Data, size_t a_Size)
{
m_IncomingHeaderData.append(a_Data, a_Size);
size_t IdxEnd = m_IncomingHeaderData.size();
@@ -158,7 +158,7 @@ int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size)
if (LineStart >= IdxEnd)
{
m_IsValid = false;
- return -1;
+ return AString::npos;
}
int NumSpaces = 0;
@@ -186,7 +186,7 @@ int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size)
{
// Too many spaces in the request
m_IsValid = false;
- return -1;
+ return AString::npos;
}
}
NumSpaces += 1;
@@ -198,13 +198,13 @@ int cHTTPRequest::ParseRequestLine(const char * a_Data, int a_Size)
{
// LF too early, without a CR, without two preceeding spaces or too soon after the second space
m_IsValid = false;
- return -1;
+ return AString::npos;
}
// Check that there's HTTP/version at the end
if (strncmp(a_Data + URLEnd + 1, "HTTP/1.", 7) != 0)
{
m_IsValid = false;
- return -1;
+ return AString::npos;
}
m_Method = m_IncomingHeaderData.substr(LineStart, MethodEnd - LineStart);
m_URL = m_IncomingHeaderData.substr(MethodEnd + 1, URLEnd - MethodEnd - 1);
diff --git a/src/HTTPServer/HTTPMessage.h b/src/HTTPServer/HTTPMessage.h
index ab3338db7..dab942136 100644
--- a/src/HTTPServer/HTTPMessage.h
+++ b/src/HTTPServer/HTTPMessage.h
@@ -39,10 +39,10 @@ public:
void AddHeader(const AString & a_Key, const AString & a_Value);
void SetContentType (const AString & a_ContentType) { m_ContentType = a_ContentType; }
- void SetContentLength(int a_ContentLength) { m_ContentLength = a_ContentLength; }
+ void SetContentLength(size_t a_ContentLength) { m_ContentLength = a_ContentLength; }
const AString & GetContentType (void) const { return m_ContentType; }
- int GetContentLength(void) const { return m_ContentLength; }
+ size_t GetContentLength(void) const { return m_ContentLength; }
protected:
typedef std::map<AString, AString> cNameValueMap;
@@ -54,8 +54,10 @@ protected:
/** Type of the content; parsed by AddHeader(), set directly by SetContentLength() */
AString m_ContentType;
- /** Length of the content that is to be received. -1 when the object is created, parsed by AddHeader() or set directly by SetContentLength() */
- int m_ContentLength;
+ /** Length of the content that is to be received.
+ AString::npos when the object is created.
+ Parsed by AddHeader() or set directly by SetContentLength() */
+ size_t m_ContentLength;
} ;
@@ -72,12 +74,12 @@ public:
cHTTPRequest(void);
/** Parses the request line and then headers from the received data.
- Returns the number of bytes consumed or a negative number for error
+ Returns the number of bytes consumed or AString::npos number for error
*/
- int ParseHeaders(const char * a_Data, int a_Size);
+ size_t ParseHeaders(const char * a_Data, size_t a_Size);
/** Returns true if the request did contain a Content-Length header */
- bool HasReceivedContentLength(void) const { return (m_ContentLength >= 0); }
+ bool HasReceivedContentLength(void) const { return (m_ContentLength != AString::npos); }
/** Returns the method used in the request */
const AString & GetMethod(void) const { return m_Method; }
@@ -145,7 +147,7 @@ protected:
/** Parses the incoming data for the first line (RequestLine)
Returns the number of bytes consumed, or -1 for an error
*/
- int ParseRequestLine(const char * a_Data, int a_Size);
+ size_t ParseRequestLine(const char * a_Data, size_t a_Size);
// cEnvelopeParser::cCallbacks overrides:
virtual void OnHeaderLine(const AString & a_Key, const AString & a_Value) override;
diff --git a/src/HTTPServer/HTTPServer.cpp b/src/HTTPServer/HTTPServer.cpp
index 4e9195a00..eaf8405a3 100644
--- a/src/HTTPServer/HTTPServer.cpp
+++ b/src/HTTPServer/HTTPServer.cpp
@@ -38,7 +38,7 @@ class cDebugCallbacks :
}
- virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) override
+ virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) override
{
UNUSED(a_Connection);
@@ -100,7 +100,7 @@ class cDebugCallbacks :
}
- virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, int a_Size) override
+ virtual void OnFileData(cHTTPFormParser & a_Parser, const char * a_Data, size_t a_Size) override
{
// TODO
}
@@ -242,7 +242,7 @@ void cHTTPServer::NewRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Re
-void cHTTPServer::RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size)
+void cHTTPServer::RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size)
{
m_Callbacks->OnRequestBody(a_Connection, a_Request, a_Data, a_Size);
}
diff --git a/src/HTTPServer/HTTPServer.h b/src/HTTPServer/HTTPServer.h
index 24baf8c95..8eff7d879 100644
--- a/src/HTTPServer/HTTPServer.h
+++ b/src/HTTPServer/HTTPServer.h
@@ -37,20 +37,23 @@ public:
class cCallbacks
{
public:
+ virtual ~cCallbacks() {}
+
/** Called when a new request arrives over a connection and its headers have been parsed.
The request body needn't have arrived yet.
*/
virtual void OnRequestBegun(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) = 0;
- /// Called when another part of request body has arrived.
- virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) = 0;
+ /** Called when another part of request body has arrived.
+ May be called multiple times for a single request. */
+ virtual void OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) = 0;
/// Called when the request body has been fully received in previous calls to OnRequestBody()
virtual void OnRequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) = 0;
} ;
cHTTPServer(void);
- ~cHTTPServer();
+ virtual ~cHTTPServer();
/// Initializes the server on the specified ports
bool Initialize(const AString & a_PortsIPv4, const AString & a_PortsIPv6);
@@ -88,8 +91,9 @@ protected:
/// Called by cHTTPConnection when it finishes parsing the request header
void NewRequest(cHTTPConnection & a_Connection, cHTTPRequest & a_Request);
- /// Called by cHTTPConenction when it receives more data for the request body
- void RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size);
+ /** Called by cHTTPConenction when it receives more data for the request body.
+ May be called multiple times for a single request. */
+ void RequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size);
/// Called by cHTTPConnection when it detects that the request has finished (all of its body has been received)
void RequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & a_Request);
diff --git a/src/HTTPServer/MultipartParser.cpp b/src/HTTPServer/MultipartParser.cpp
index 14c2c00fa..309495dd7 100644
--- a/src/HTTPServer/MultipartParser.cpp
+++ b/src/HTTPServer/MultipartParser.cpp
@@ -97,8 +97,6 @@ cMultipartParser::cMultipartParser(const AString & a_ContentType, cCallbacks & a
m_EnvelopeParser(*this),
m_HasHadData(false)
{
- static AString s_Multipart = "multipart/";
-
// Check that the content type is multipart:
AString ContentType(a_ContentType);
if (strncmp(ContentType.c_str(), "multipart/", 10) != 0)
@@ -146,7 +144,7 @@ cMultipartParser::cMultipartParser(const AString & a_ContentType, cCallbacks & a
-void cMultipartParser::Parse(const char * a_Data, int a_Size)
+void cMultipartParser::Parse(const char * a_Data, size_t a_Size)
{
// Skip parsing if invalid
if (!m_IsValid)
@@ -160,8 +158,8 @@ void cMultipartParser::Parse(const char * a_Data, int a_Size)
{
if (m_EnvelopeParser.IsInHeaders())
{
- int BytesConsumed = m_EnvelopeParser.Parse(m_IncomingData.data(), m_IncomingData.size());
- if (BytesConsumed < 0)
+ size_t BytesConsumed = m_EnvelopeParser.Parse(m_IncomingData.data(), m_IncomingData.size());
+ if (BytesConsumed == AString::npos)
{
m_IsValid = false;
return;
diff --git a/src/HTTPServer/MultipartParser.h b/src/HTTPServer/MultipartParser.h
index d853929ed..ad76ad650 100644
--- a/src/HTTPServer/MultipartParser.h
+++ b/src/HTTPServer/MultipartParser.h
@@ -22,50 +22,53 @@ public:
class cCallbacks
{
public:
- /// Called when a new part starts
+ // Force a virtual destructor in descendants:
+ virtual ~cCallbacks() {}
+
+ /** Called when a new part starts */
virtual void OnPartStart(void) = 0;
- /// Called when a complete header line is received for a part
+ /** Called when a complete header line is received for a part */
virtual void OnPartHeader(const AString & a_Key, const AString & a_Value) = 0;
- /// Called when body for a part is received
- virtual void OnPartData(const char * a_Data, int a_Size) = 0;
+ /** Called when body for a part is received */
+ virtual void OnPartData(const char * a_Data, size_t a_Size) = 0;
- /// Called when the current part ends
+ /** Called when the current part ends */
virtual void OnPartEnd(void) = 0;
} ;
- /// Creates the parser, expects to find the boundary in a_ContentType
+ /** Creates the parser, expects to find the boundary in a_ContentType */
cMultipartParser(const AString & a_ContentType, cCallbacks & a_Callbacks);
- /// Parses more incoming data
- void Parse(const char * a_Data, int a_Size);
+ /** Parses more incoming data */
+ void Parse(const char * a_Data, size_t a_Size);
protected:
- /// The callbacks to call for various parsing events
+ /** The callbacks to call for various parsing events */
cCallbacks & m_Callbacks;
- /// True if the data parsed so far is valid; if false, further parsing is skipped
+ /** True if the data parsed so far is valid; if false, further parsing is skipped */
bool m_IsValid;
- /// Parser for each part's envelope
+ /** Parser for each part's envelope */
cEnvelopeParser m_EnvelopeParser;
- /// Buffer for the incoming data until it is parsed
+ /** Buffer for the incoming data until it is parsed */
AString m_IncomingData;
- /// The boundary, excluding both the initial "--" and the terminating CRLF
+ /** The boundary, excluding both the initial "--" and the terminating CRLF */
AString m_Boundary;
- /// Set to true if some data for the current part has already been signalized to m_Callbacks. Used for proper CRLF inserting.
+ /** Set to true if some data for the current part has already been signalized to m_Callbacks. Used for proper CRLF inserting. */
bool m_HasHadData;
- /// Parse one line of incoming data. The CRLF has already been stripped from a_Data / a_Size
- void ParseLine(const char * a_Data, int a_Size);
+ /** Parse one line of incoming data. The CRLF has already been stripped from a_Data / a_Size */
+ void ParseLine(const char * a_Data, size_t a_Size);
- /// Parse one line of incoming data in the headers section of a part. The CRLF has already been stripped from a_Data / a_Size
- void ParseHeaderLine(const char * a_Data, int a_Size);
+ /** Parse one line of incoming data in the headers section of a part. The CRLF has already been stripped from a_Data / a_Size */
+ void ParseHeaderLine(const char * a_Data, size_t a_Size);
// cEnvelopeParser overrides:
virtual void OnHeaderLine(const AString & a_Key, const AString & a_Value) override;
diff --git a/src/HTTPServer/NameValueParser.cpp b/src/HTTPServer/NameValueParser.cpp
index 9ea8594ae..3f6c17dda 100644
--- a/src/HTTPServer/NameValueParser.cpp
+++ b/src/HTTPServer/NameValueParser.cpp
@@ -24,7 +24,7 @@ public:
// Now try parsing char-by-char, to debug transitions across datachunk boundaries:
cNameValueParser Parser2;
- for (int i = 0; i < sizeof(Data) - 1; i++)
+ for (size_t i = 0; i < sizeof(Data) - 1; i++)
{
Parser2.Parse(Data + i, 1);
}
@@ -82,7 +82,7 @@ cNameValueParser::cNameValueParser(bool a_AllowsKeyOnly) :
-cNameValueParser::cNameValueParser(const char * a_Data, int a_Size, bool a_AllowsKeyOnly) :
+cNameValueParser::cNameValueParser(const char * a_Data, size_t a_Size, bool a_AllowsKeyOnly) :
m_State(psKeySpace),
m_AllowsKeyOnly(a_AllowsKeyOnly)
{
@@ -93,12 +93,12 @@ cNameValueParser::cNameValueParser(const char * a_Data, int a_Size, bool a_Allow
-void cNameValueParser::Parse(const char * a_Data, int a_Size)
+void cNameValueParser::Parse(const char * a_Data, size_t a_Size)
{
ASSERT(m_State != psFinished); // Calling Parse() after Finish() is wrong!
int Last = 0;
- for (int i = 0; i < a_Size;)
+ for (size_t i = 0; i < a_Size;)
{
switch (m_State)
{
diff --git a/src/HTTPServer/NameValueParser.h b/src/HTTPServer/NameValueParser.h
index 07dc0b942..9794614fa 100644
--- a/src/HTTPServer/NameValueParser.h
+++ b/src/HTTPServer/NameValueParser.h
@@ -21,10 +21,10 @@ public:
cNameValueParser(bool a_AllowsKeyOnly = true);
/// Creates an empty parser, then parses the data given. Doesn't call Finish(), so more data can be parsed later
- cNameValueParser(const char * a_Data, int a_Size, bool a_AllowsKeyOnly = true);
+ cNameValueParser(const char * a_Data, size_t a_Size, bool a_AllowsKeyOnly = true);
/// Parses the data given
- void Parse(const char * a_Data, int a_Size);
+ void Parse(const char * a_Data, size_t a_Size);
/// Notifies the parser that no more data will be coming. Returns true if the parser state is valid
bool Finish(void);
diff --git a/src/Inventory.h b/src/Inventory.h
index fd2089a13..1ad7c4776 100644
--- a/src/Inventory.h
+++ b/src/Inventory.h
@@ -52,6 +52,8 @@ public:
cInventory(cPlayer & a_Owner);
+ virtual ~cInventory() {}
+
// tolua_begin
/// Removes all items from the entire inventory
diff --git a/src/Item.h b/src/Item.h
index 4bdfb12dd..910ecb382 100644
--- a/src/Item.h
+++ b/src/Item.h
@@ -209,7 +209,7 @@ public:
void Add (const cItem & a_Item) {push_back(a_Item); }
void Delete(int a_Idx);
void Clear (void) {clear(); }
- int Size (void) {return size(); }
+ size_t Size (void) {return size(); }
void Set (int a_Idx, short a_ItemType, char a_ItemCount, short a_ItemDamage);
void Add (short a_ItemType, char a_ItemCount, short a_ItemDamage)
diff --git a/src/ItemGrid.h b/src/ItemGrid.h
index b344e3daf..c34d5e9e2 100644
--- a/src/ItemGrid.h
+++ b/src/ItemGrid.h
@@ -20,11 +20,13 @@ class cItemGrid
public:
// tolua_end
- /// This class is used as a callback for when a slot changes
+ /** This class is used as a callback for when a slot changes */
class cListener
{
public:
- /// Called whenever a slot changes
+ virtual ~cListener() {}
+
+ /** Called whenever a slot changes */
virtual void OnSlotChanged(cItemGrid * a_ItemGrid, int a_SlotNum) = 0;
} ;
typedef std::vector<cListener *> cListeners;
@@ -38,12 +40,12 @@ public:
int GetHeight (void) const { return m_Height; }
int GetNumSlots(void) const { return m_NumSlots; }
- /// Converts XY coords into slot number; returns -1 on invalid coords
+ /** Converts XY coords into slot number; returns -1 on invalid coords */
int GetSlotNum(int a_X, int a_Y) const;
// tolua_end
- /// Converts slot number into XY coords; sets coords to -1 on invalid slot number. Exported in ManualBindings.cpp
+ /** Converts slot number into XY coords; sets coords to -1 on invalid slot number. Exported in ManualBindings.cpp */
void GetSlotCoords(int a_SlotNum, int & a_X, int & a_Y) const;
// tolua_begin
@@ -62,16 +64,16 @@ public:
void EmptySlot(int a_X, int a_Y);
void EmptySlot(int a_SlotNum);
- /// Returns true if the specified slot is empty or the slot doesn't exist
+ /** Returns true if the specified slot is empty or the slot doesn't exist */
bool IsSlotEmpty(int a_SlotNum) const;
- /// Returns true if the specified slot is empty or the slot doesn't exist
+ /** Returns true if the specified slot is empty or the slot doesn't exist */
bool IsSlotEmpty(int a_X, int a_Y) const;
- /// Sets all items as empty
+ /** Sets all items as empty */
void Clear(void);
- /// Returns number of items out of a_ItemStack that can fit in the storage
+ /** Returns number of items out of a_ItemStack that can fit in the storage */
int HowManyCanFit(const cItem & a_ItemStack, bool a_AllowNewStacks = true);
/** Adds as many items out of a_ItemStack as can fit.
@@ -117,37 +119,37 @@ public:
*/
cItem RemoveOneItem(int a_X, int a_Y);
- /// Returns the number of items of type a_Item that are stored
+ /** Returns the number of items of type a_Item that are stored */
int HowManyItems(const cItem & a_Item);
- /// Returns true if there are at least as many items of type a_ItemStack as in a_ItemStack
+ /** Returns true if there are at least as many items of type a_ItemStack as in a_ItemStack */
bool HasItems(const cItem & a_ItemStack);
- /// Returns the index of the first empty slot; -1 if all full
+ /** Returns the index of the first empty slot; -1 if all full */
int GetFirstEmptySlot(void) const;
- /// Returns the index of the first non-empty slot; -1 if all empty
+ /** Returns the index of the first non-empty slot; -1 if all empty */
int GetFirstUsedSlot(void) const;
- /// Returns the index of the last empty slot; -1 if all full
+ /** Returns the index of the last empty slot; -1 if all full */
int GetLastEmptySlot(void) const;
- /// Returns the index of the last used slot; -1 if all empty
+ /** Returns the index of the last used slot; -1 if all empty */
int GetLastUsedSlot(void) const;
- /// Returns the index of the first empty slot following a_StartFrom (a_StartFrom is not checked)
+ /** Returns the index of the first empty slot following a_StartFrom (a_StartFrom is not checked) */
int GetNextEmptySlot(int a_StartFrom) const;
- /// Returns the index of the first used slot following a_StartFrom (a_StartFrom is not checked)
+ /** Returns the index of the first used slot following a_StartFrom (a_StartFrom is not checked) */
int GetNextUsedSlot(int a_StartFrom) const;
- /// Copies the contents into a cItems object; preserves the original a_Items contents
+ /** Copies the contents into a cItems object; preserves the original a_Items contents */
void CopyToItems(cItems & a_Items) const;
- /// Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact)
+ /** Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) */
bool DamageItem(int a_SlotNum, short a_Amount);
- /// Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact)
+ /** Adds the specified damage to the specified item; returns true if the item broke (but the item is left intact) */
bool DamageItem(int a_X, int a_Y, short a_Amount);
// tolua_end
@@ -159,10 +161,10 @@ public:
*/
void GenerateRandomLootWithBooks(const cLootProbab * a_LootProbabs, size_t a_CountLootProbabs, int a_NumSlots, int a_Seed);
- /// Adds a callback that gets called whenever a slot changes. Must not be called from within the listener callback!
+ /** Adds a callback that gets called whenever a slot changes. Must not be called from within the listener callback! */
void AddListener(cListener & a_Listener);
- /// Removes a slot-change-callback. Must not be called from within the listener callback!
+ /** Removes a slot-change-callback. Must not be called from within the listener callback! */
void RemoveListener(cListener & a_Listener);
// tolua_begin
@@ -177,7 +179,7 @@ protected:
cCriticalSection m_CSListeners; ///< CS that guards the m_Listeners against multi-thread access
bool m_IsInTriggerListeners; ///< Set to true while TriggerListeners is running, to detect attempts to manipulate listener list while triggerring
- /// Calls all m_Listeners for the specified slot number
+ /** Calls all m_Listeners for the specified slot number */
void TriggerListeners(int a_SlotNum);
/** Adds up to a_Num items out of a_ItemStack, as many as can fit, in specified slot
diff --git a/src/Items/ItemBoat.h b/src/Items/ItemBoat.h
index a28ec8e22..42f4ffc8f 100644
--- a/src/Items/ItemBoat.h
+++ b/src/Items/ItemBoat.h
@@ -39,12 +39,20 @@ public:
public cBlockTracer::cCallbacks
{
public:
- Vector3d Pos;
- virtual bool OnNextBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, char a_EntryFace) override
+ Vector3d m_Pos;
+ bool m_HasFound;
+
+ cCallbacks(void) :
+ m_HasFound(false)
{
- if (a_BlockType != E_BLOCK_AIR)
+ }
+
+ virtual bool OnNextBlock(int a_CBBlockX, int a_CBBlockY, int a_CBBlockZ, BLOCKTYPE a_CBBlockType, NIBBLETYPE a_CBBlockMeta, char a_CBEntryFace) override
+ {
+ if (a_CBBlockType != E_BLOCK_AIR)
{
- Pos = Vector3d(a_BlockX, a_BlockY, a_BlockZ);
+ m_Pos.Set(a_CBBlockX, a_CBBlockY, a_CBBlockZ);
+ m_HasFound = true;
return true;
}
return false;
@@ -57,15 +65,15 @@ public:
Tracer.Trace(Start.x, Start.y, Start.z, End.x, End.y, End.z);
- double x = Callbacks.Pos.x;
- double y = Callbacks.Pos.y;
- double z = Callbacks.Pos.z;
-
- if ((x == 0) && (y == 0) && (z == 0))
+ if (!Callbacks.m_HasFound)
{
return false;
}
+ double x = Callbacks.m_Pos.x;
+ double y = Callbacks.m_Pos.y;
+ double z = Callbacks.m_Pos.z;
+
cBoat * Boat = new cBoat(x + 0.5, y + 1, z + 0.5);
Boat->Initialize(a_World);
diff --git a/src/Items/ItemBucket.h b/src/Items/ItemBucket.h
index 72cb8fa0a..68c89dd85 100644
--- a/src/Items/ItemBucket.h
+++ b/src/Items/ItemBucket.h
@@ -172,12 +172,12 @@ public:
virtual bool OnNextBlock(int a_BlockX, int a_BlockY, int a_BlockZ, BLOCKTYPE a_BlockType, NIBBLETYPE a_BlockMeta, char a_EntryFace) override
{
- if (a_BlockMeta != 0) // Even if it was a water block it would not be a source.
- {
- return false;
- }
if (IsBlockWater(a_BlockType) || IsBlockLava(a_BlockType))
{
+ if (a_BlockMeta != 0) // GetBlockFromTrace is called for scooping up fluids; the hit block should be a source
+ {
+ return false;
+ }
m_HasHitFluid = true;
m_Pos.Set(a_BlockX, a_BlockY, a_BlockZ);
return true;
diff --git a/src/Items/ItemEmptyMap.h b/src/Items/ItemEmptyMap.h
index f0b1e1424..953673382 100644
--- a/src/Items/ItemEmptyMap.h
+++ b/src/Items/ItemEmptyMap.h
@@ -55,7 +55,7 @@ public:
return true;
}
- a_Player->GetInventory().AddItem(cItem(E_ITEM_MAP, 1, NewMap->GetID()), true, true);
+ a_Player->GetInventory().AddItem(cItem(E_ITEM_MAP, 1, (short)(NewMap->GetID() & 0x7fff)), true, true);
return true;
}
diff --git a/src/Items/ItemFishingRod.h b/src/Items/ItemFishingRod.h
index 15acbd9fe..0431b88b7 100644
--- a/src/Items/ItemFishingRod.h
+++ b/src/Items/ItemFishingRod.h
@@ -123,7 +123,7 @@ public:
}
case 2:
{
- Drops.Add(cItem(E_ITEM_FISHING_ROD, 1, a_World->GetTickRandomNumber(50))); // Fishing rod with durability. TODO: Enchantments on it
+ Drops.Add(cItem(E_ITEM_FISHING_ROD, 1, (short)a_World->GetTickRandomNumber(50))); // Fishing rod with durability. TODO: Enchantments on it
break;
}
case 3:
@@ -152,7 +152,7 @@ public:
}
else if (Junk <= 4)
{
- Drops.Add(cItem(E_ITEM_BOW, 1, a_World->GetTickRandomNumber(64)));
+ Drops.Add(cItem(E_ITEM_BOW, 1, (short)a_World->GetTickRandomNumber(64)));
}
else if (Junk <= 9)
{
diff --git a/src/Items/ItemHandler.cpp b/src/Items/ItemHandler.cpp
index 454fabdd7..1e77717e3 100644
--- a/src/Items/ItemHandler.cpp
+++ b/src/Items/ItemHandler.cpp
@@ -27,6 +27,7 @@
#include "ItemHoe.h"
#include "ItemLeaves.h"
#include "ItemLighter.h"
+#include "ItemLilypad.h"
#include "ItemMap.h"
#include "ItemMinecart.h"
#include "ItemNetherWart.h"
@@ -115,6 +116,7 @@ cItemHandler *cItemHandler::CreateItemHandler(int a_ItemType)
case E_ITEM_FISHING_ROD: return new cItemFishingRodHandler(a_ItemType);
case E_ITEM_FLINT_AND_STEEL: return new cItemLighterHandler(a_ItemType);
case E_ITEM_FLOWER_POT: return new cItemFlowerPotHandler(a_ItemType);
+ case E_BLOCK_LILY_PAD: return new cItemLilypadHandler(a_ItemType);
case E_ITEM_MAP: return new cItemMapHandler();
case E_ITEM_ITEM_FRAME: return new cItemItemFrameHandler(a_ItemType);
case E_ITEM_NETHER_WART: return new cItemNetherWartHandler(a_ItemType);
@@ -504,13 +506,13 @@ bool cItemHandler::GetPlacementBlockTypeMeta(
{
ASSERT(m_ItemType < 256); // Items with IDs above 255 should all be handled by specific handlers
- if (m_ItemType > 256)
+ if (m_ItemType >= 256)
{
- LOGERROR("%s: Item %d has no valid block!", __FUNCTION__, m_ItemType);
+ LOGERROR("%s: Item %d is not eligible for direct block placement!", __FUNCTION__, m_ItemType);
return false;
}
- cBlockHandler * BlockH = BlockHandler(m_ItemType);
+ cBlockHandler * BlockH = BlockHandler((BLOCKTYPE)m_ItemType);
cChunkInterface ChunkInterface(a_World->GetChunkMap());
return BlockH->GetPlacementBlockTypeMeta(
ChunkInterface, a_Player,
diff --git a/src/Items/ItemLilypad.h b/src/Items/ItemLilypad.h
new file mode 100644
index 000000000..8fc1d8543
--- /dev/null
+++ b/src/Items/ItemLilypad.h
@@ -0,0 +1,110 @@
+#pragma once
+
+#include "ItemHandler.h"
+#include "../Entities/Player.h"
+#include "Vector3.h"
+#include "../LineBlockTracer.h"
+#include "BlockInfo.h"
+
+
+
+
+
+class cItemLilypadHandler :
+ public cItemHandler
+{
+ typedef cItemHandler super;
+
+public:
+ cItemLilypadHandler(int a_ItemType):
+ super(a_ItemType)
+ {
+
+ }
+
+
+ virtual bool IsPlaceable(void) override
+ {
+ return false; // Set as not placeable so OnItemUse is called
+ }
+
+
+ virtual bool OnItemUse(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item, int a_BlockX, int a_BlockY, int a_BlockZ, eBlockFace a_BlockFace) override
+ {
+ if (a_BlockFace > BLOCK_FACE_NONE)
+ {
+ // Clicked on the side of a submerged block; vanilla allows placement, so should we
+ AddFaceDirection(a_BlockX, a_BlockY, a_BlockZ, a_BlockFace);
+ a_World->SetBlock(a_BlockX, a_BlockY, a_BlockZ, E_BLOCK_LILY_PAD, 0);
+ if (!a_Player->IsGameModeCreative())
+ {
+ a_Player->GetInventory().RemoveOneEquippedItem();
+ }
+ return true;
+ }
+
+ class cCallbacks :
+ public cBlockTracer::cCallbacks
+ {
+ public:
+ cCallbacks(cWorld * a_CBWorld) :
+ m_HasHitFluid(false),
+ m_World(a_CBWorld)
+ {
+ }
+
+ virtual bool OnNextBlock(int a_CBBlockX, int a_CBBlockY, int a_CBBlockZ, BLOCKTYPE a_CBBlockType, NIBBLETYPE a_CBBlockMeta, char a_CBEntryFace) override
+ {
+ if (IsBlockWater(a_CBBlockType))
+ {
+ if ((a_CBBlockMeta != 0) || (a_CBEntryFace == BLOCK_FACE_NONE)) // The hit block should be a source. The FACE_NONE check is clicking whilst submerged
+ {
+ return false;
+ }
+ AddFaceDirection(a_CBBlockX, a_CBBlockY, a_CBBlockZ, BLOCK_FACE_YP); // Always place pad at top of water block
+ BLOCKTYPE Block = m_World->GetBlock(a_CBBlockX, a_CBBlockY, a_CBBlockZ);
+ if (
+ !IsBlockWater(Block) &&
+ cBlockInfo::FullyOccupiesVoxel(Block)
+ )
+ {
+ // Can't place lilypad on air/in another block!
+ return true;
+ }
+ m_HasHitFluid = true;
+ m_Pos.Set(a_CBBlockX, a_CBBlockY, a_CBBlockZ);
+ return true;
+ }
+ return false;
+ }
+
+ Vector3i m_Pos;
+ bool m_HasHitFluid;
+ cWorld * m_World;
+
+ };
+
+ cCallbacks Callbacks(a_World);
+ cLineBlockTracer Tracer(*a_Player->GetWorld(), Callbacks);
+ Vector3d Start(a_Player->GetEyePosition() + a_Player->GetLookVector());
+ Vector3d End(a_Player->GetEyePosition() + a_Player->GetLookVector() * 5);
+
+ Tracer.Trace(Start.x, Start.y, Start.z, End.x, End.y, End.z);
+
+ if (Callbacks.m_HasHitFluid)
+ {
+ a_World->SetBlock(Callbacks.m_Pos.x, Callbacks.m_Pos.y, Callbacks.m_Pos.z, E_BLOCK_LILY_PAD, 0);
+ if (!a_Player->IsGameModeCreative())
+ {
+ a_Player->GetInventory().RemoveOneEquippedItem();
+ }
+ return true;
+ }
+
+ return false;
+ }
+};
+
+
+
+
diff --git a/src/Items/ItemMap.h b/src/Items/ItemMap.h
index e8ff9da88..056fe0fe7 100644
--- a/src/Items/ItemMap.h
+++ b/src/Items/ItemMap.h
@@ -29,7 +29,7 @@ public:
virtual void OnUpdate(cWorld * a_World, cPlayer * a_Player, const cItem & a_Item)
{
- cMap * Map = a_World->GetMapManager().GetMapData(a_Item.m_ItemDamage);
+ cMap * Map = a_World->GetMapManager().GetMapData((unsigned)a_Item.m_ItemDamage);
if (Map == NULL)
{
diff --git a/src/Items/ItemMinecart.h b/src/Items/ItemMinecart.h
index bcaa5635a..25500aeb9 100644
--- a/src/Items/ItemMinecart.h
+++ b/src/Items/ItemMinecart.h
@@ -1,4 +1,3 @@
-
// ItemMinecart.h
// Declares the various minecart ItemHandlers
@@ -72,6 +71,11 @@ public:
}
} // switch (m_ItemType)
Minecart->Initialize(a_World);
+
+ if (!a_Player->IsGameModeCreative())
+ {
+ a_Player->GetInventory().RemoveOneEquippedItem();
+ }
return true;
}
diff --git a/src/LightingThread.h b/src/LightingThread.h
index 198f27248..770ae809f 100644
--- a/src/LightingThread.h
+++ b/src/LightingThread.h
@@ -160,14 +160,12 @@ protected:
inline void PropagateLight(
NIBBLETYPE * a_Light,
- int a_SrcIdx, int a_DstIdx,
+ unsigned int a_SrcIdx, unsigned int a_DstIdx,
int & a_NumSeedsOut, unsigned char * a_IsSeedOut, unsigned int * a_SeedIdxOut
)
{
- ASSERT(a_SrcIdx >= 0);
- ASSERT(a_SrcIdx < (int)ARRAYCOUNT(m_SkyLight));
- ASSERT(a_DstIdx >= 0);
- ASSERT(a_DstIdx < (int)ARRAYCOUNT(m_BlockTypes));
+ ASSERT(a_SrcIdx < ARRAYCOUNT(m_SkyLight));
+ ASSERT(a_DstIdx < ARRAYCOUNT(m_BlockTypes));
if (a_Light[a_SrcIdx] <= a_Light[a_DstIdx] + cBlockInfo::GetSpreadLightFalloff(m_BlockTypes[a_DstIdx]))
{
diff --git a/src/MCLogger.cpp b/src/MCLogger.cpp
index 4f3e5dc0f..80fa7b173 100644
--- a/src/MCLogger.cpp
+++ b/src/MCLogger.cpp
@@ -93,25 +93,30 @@ void cMCLogger::InitLog(const AString & a_FileName)
-void cMCLogger::LogSimple(const char* a_Text, int a_LogType /* = 0 */ )
+void cMCLogger::LogSimple(const char * a_Text, eLogLevel a_LogLevel)
{
- switch( a_LogType )
+ switch (a_LogLevel)
{
- case 0:
+ case llRegular:
+ {
LOG("%s", a_Text);
break;
- case 1:
+ }
+ case llInfo:
+ {
LOGINFO("%s", a_Text);
break;
- case 2:
+ }
+ case llWarning:
+ {
LOGWARN("%s", a_Text);
break;
- case 3:
+ }
+ case llError:
+ {
LOGERROR("%s", a_Text);
break;
- default:
- LOG("(#%d#: %s", a_LogType, a_Text);
- break;
+ }
}
}
diff --git a/src/MCLogger.h b/src/MCLogger.h
index 996e60329..c0150c124 100644
--- a/src/MCLogger.h
+++ b/src/MCLogger.h
@@ -10,25 +10,36 @@ class cLog;
-class cMCLogger // tolua_export
-{ // tolua_export
-public: // tolua_export
- /// Creates a logger with the default filename, "logs/LOG_<timestamp>.log"
+// tolua_begin
+class cMCLogger
+{
+public:
+ enum eLogLevel
+ {
+ llRegular,
+ llInfo,
+ llWarning,
+ llError,
+ };
+ // tolua_end
+
+ /** Creates a logger with the default filename, "logs/LOG_<timestamp>.log" */
cMCLogger(void);
- /// Creates a logger with the specified filename inside "logs" folder
+ /** Creates a logger with the specified filename inside "logs" folder */
cMCLogger(const AString & a_FileName); // tolua_export
~cMCLogger(); // tolua_export
- void Log(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
- void Info(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
- void Warn(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
- void Error(const char* a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+ void Log (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+ void Info (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+ void Warn (const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
+ void Error(const char * a_Format, va_list a_ArgList) FORMATSTRING(2, 0);
- void LogSimple(const char* a_Text, int a_LogType = 0 ); // tolua_export
+ /** Logs the simple text message at the specified log level. */
+ void LogSimple(const char * a_Text, eLogLevel a_LogLevel = llRegular); // tolua_export
- static cMCLogger* GetInstance();
+ static cMCLogger * GetInstance();
private:
enum eColorScheme
{
diff --git a/src/MobSpawner.cpp b/src/MobSpawner.cpp
index a0d0f5c54..05da5d01c 100644
--- a/src/MobSpawner.cpp
+++ b/src/MobSpawner.cpp
@@ -129,6 +129,11 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R
BLOCKTYPE TargetBlock = E_BLOCK_AIR;
if (m_AllowedTypes.find(a_MobType) != m_AllowedTypes.end() && a_Chunk->UnboundedRelGetBlockType(a_RelX, a_RelY, a_RelZ, TargetBlock))
{
+ if ((a_RelY + 1 > cChunkDef::Height) || (a_RelY - 1 < 0))
+ {
+ return false;
+ }
+
NIBBLETYPE BlockLight = a_Chunk->GetBlockLight(a_RelX, a_RelY, a_RelZ);
NIBBLETYPE SkyLight = a_Chunk->GetSkyLight(a_RelX, a_RelY, a_RelZ);
BLOCKTYPE BlockAbove = a_Chunk->GetBlock(a_RelX, a_RelY + 1, a_RelZ);
@@ -200,7 +205,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R
case cMonster::mtSpider:
{
bool CanSpawn = true;
- bool HaveFloor = false;
+ bool HasFloor = false;
for (int x = 0; x < 2; ++x)
{
for(int z = 0; z < 2; ++z)
@@ -211,8 +216,8 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R
{
return false;
}
- HaveFloor = (
- HaveFloor ||
+ HasFloor = (
+ HasFloor ||
(
a_Chunk->UnboundedRelGetBlockType(a_RelX + x, a_RelY - 1, a_RelZ + z, TargetBlock) &&
!cBlockInfo::IsTransparent(TargetBlock)
@@ -220,7 +225,7 @@ bool cMobSpawner::CanSpawnHere(cChunk * a_Chunk, int a_RelX, int a_RelY, int a_R
);
}
}
- return CanSpawn && HaveFloor && (SkyLight <= 7) && (BlockLight <= 7);
+ return CanSpawn && HasFloor && (SkyLight <= 7) && (BlockLight <= 7);
}
case cMonster::mtCreeper:
diff --git a/src/Mobs/Blaze.cpp b/src/Mobs/Blaze.cpp
index ac42cf40b..84ff8929b 100644
--- a/src/Mobs/Blaze.cpp
+++ b/src/Mobs/Blaze.cpp
@@ -53,4 +53,4 @@ void cBlaze::Attack(float a_Dt)
m_AttackInterval = 0.0;
// ToDo: Shoot 3 fireballs instead of 1.
}
-} \ No newline at end of file
+}
diff --git a/src/Mobs/Blaze.h b/src/Mobs/Blaze.h
index cdb3a1306..5970451c7 100644
--- a/src/Mobs/Blaze.h
+++ b/src/Mobs/Blaze.h
@@ -20,7 +20,3 @@ public:
virtual void GetDrops(cItems & a_Drops, cEntity * a_Killer = NULL) override;
virtual void Attack(float a_Dt) override;
} ;
-
-
-
-
diff --git a/src/Mobs/Monster.cpp b/src/Mobs/Monster.cpp
index d3e0f1c26..aa6071515 100644
--- a/src/Mobs/Monster.cpp
+++ b/src/Mobs/Monster.cpp
@@ -111,9 +111,9 @@ void cMonster::SpawnOn(cClientHandle & a_Client)
void cMonster::TickPathFinding()
{
- int PosX = (int)floor(GetPosX());
- int PosY = (int)floor(GetPosY());
- int PosZ = (int)floor(GetPosZ());
+ const int PosX = (int)floor(GetPosX());
+ const int PosY = (int)floor(GetPosY());
+ const int PosZ = (int)floor(GetPosZ());
m_FinalDestination.y = (double)FindFirstNonAirBlockPosition(m_FinalDestination.x, m_FinalDestination.z);
@@ -130,14 +130,16 @@ void cMonster::TickPathFinding()
{ 0, 1},
{ 0,-1},
} ;
+
+ if ((PosY - 1 < 0) || (PosY + 2 > cChunkDef::Height) /* PosY + 1 will never be true if PosY + 2 is not */)
+ {
+ // Too low/high, can't really do anything
+ FinishPathFinding();
+ return;
+ }
for (size_t i = 0; i < ARRAYCOUNT(gCrossCoords); i++)
{
- if ((gCrossCoords[i].x + PosX == PosX) && (gCrossCoords[i].z + PosZ == PosZ))
- {
- continue;
- }
-
if (IsCoordinateInTraversedList(Vector3i(gCrossCoords[i].x + PosX, PosY, gCrossCoords[i].z + PosZ)))
{
continue;
diff --git a/src/Mobs/Skeleton.cpp b/src/Mobs/Skeleton.cpp
index 47fcdbb26..1685f40c5 100644
--- a/src/Mobs/Skeleton.cpp
+++ b/src/Mobs/Skeleton.cpp
@@ -88,4 +88,4 @@ void cSkeleton::Attack(float a_Dt)
m_World->BroadcastSpawnEntity(*Arrow);
m_AttackInterval = 0.0;
}
-} \ No newline at end of file
+}
diff --git a/src/Mobs/Wither.cpp b/src/Mobs/Wither.cpp
index 0e42194ac..8f5d28b68 100644
--- a/src/Mobs/Wither.cpp
+++ b/src/Mobs/Wither.cpp
@@ -13,8 +13,27 @@ cWither::cWither(void) :
m_InvulnerableTicks(220)
{
SetMaxHealth(300);
+}
+
+
+
+
+
+bool cWither::IsArmored(void) const
+{
+ return GetHealth() <= (GetMaxHealth() / 2);
+}
+
+
+
+
+bool cWither::Initialize(cWorld * a_World)
+{
+ // Set health before BroadcastSpawnEntity()
SetHealth(GetMaxHealth() / 3);
+
+ return super::Initialize(a_World);
}
@@ -33,6 +52,11 @@ void cWither::DoTakeDamage(TakeDamageInfo & a_TDI)
return;
}
+ if (IsArmored() && (a_TDI.DamageType == dtRangedAttack))
+ {
+ return;
+ }
+
super::DoTakeDamage(a_TDI);
}
@@ -60,6 +84,8 @@ void cWither::Tick(float a_Dt, cChunk & a_Chunk)
Heal(10);
}
}
+
+ m_World->BroadcastEntityMetadata(*this);
}
diff --git a/src/Mobs/Wither.h b/src/Mobs/Wither.h
index d09e3607a..bc78bfaad 100644
--- a/src/Mobs/Wither.h
+++ b/src/Mobs/Wither.h
@@ -20,8 +20,12 @@ public:
unsigned int GetNumInvulnerableTicks(void) const { return m_InvulnerableTicks; }
void SetNumInvulnerableTicks(unsigned int a_Ticks) { m_InvulnerableTicks = a_Ticks; }
+
+ /** Returns whether the wither is invulnerable to arrows. */
+ bool IsArmored(void) const;
// cEntity overrides
+ virtual bool Initialize(cWorld * a_World) override;
virtual void GetDrops(cItems & a_Drops, cEntity * a_Killer = NULL) override;
virtual void DoTakeDamage(TakeDamageInfo & a_TDI) override;
virtual void Tick(float a_Dt, cChunk & a_Chunk) override;
diff --git a/src/Noise.cpp b/src/Noise.cpp
index a97ea70c6..32922c8f3 100644
--- a/src/Noise.cpp
+++ b/src/Noise.cpp
@@ -425,7 +425,7 @@ void cCubicCell3D::Move(int a_NewFloorX, int a_NewFloorY, int a_NewFloorZ)
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
// cNoise:
-cNoise::cNoise(unsigned int a_Seed) :
+cNoise::cNoise(int a_Seed) :
m_Seed(a_Seed)
{
}
diff --git a/src/Noise.h b/src/Noise.h
index ea72c64e9..62004503f 100644
--- a/src/Noise.h
+++ b/src/Noise.h
@@ -25,7 +25,7 @@
class cNoise
{
public:
- cNoise(unsigned int a_Seed);
+ cNoise(int a_Seed);
cNoise(const cNoise & a_Noise);
// The following functions, if not marked INLINE, are about 20 % slower
@@ -47,14 +47,14 @@ public:
NOISE_DATATYPE CubicNoise3D (NOISE_DATATYPE a_X, NOISE_DATATYPE a_Y, NOISE_DATATYPE a_Z) const;
- void SetSeed(unsigned int a_Seed) { m_Seed = a_Seed; }
+ void SetSeed(int a_Seed) { m_Seed = a_Seed; }
INLINE static NOISE_DATATYPE CubicInterpolate (NOISE_DATATYPE a_A, NOISE_DATATYPE a_B, NOISE_DATATYPE a_C, NOISE_DATATYPE a_D, NOISE_DATATYPE a_Pct);
INLINE static NOISE_DATATYPE CosineInterpolate(NOISE_DATATYPE a_A, NOISE_DATATYPE a_B, NOISE_DATATYPE a_Pct);
INLINE static NOISE_DATATYPE LinearInterpolate(NOISE_DATATYPE a_A, NOISE_DATATYPE a_B, NOISE_DATATYPE a_Pct);
private:
- unsigned int m_Seed;
+ int m_Seed;
} ;
diff --git a/src/OSSupport/Errors.cpp b/src/OSSupport/Errors.cpp
index 2e05f1df1..6072b6ac6 100644
--- a/src/OSSupport/Errors.cpp
+++ b/src/OSSupport/Errors.cpp
@@ -22,7 +22,7 @@ AString GetOSErrorString( int a_ErrNo )
// According to http://linux.die.net/man/3/strerror_r there are two versions of strerror_r():
- #if ( _GNU_SOURCE ) && !defined(ANDROID_NDK) // GNU version of strerror_r()
+ #if !defined(__APPLE__) && ( _GNU_SOURCE ) && !defined(ANDROID_NDK) // GNU version of strerror_r()
char * res = strerror_r( errno, buffer, ARRAYCOUNT(buffer) );
if( res != NULL )
diff --git a/src/OSSupport/File.cpp b/src/OSSupport/File.cpp
index 17070030f..7f0f0ad2f 100644
--- a/src/OSSupport/File.cpp
+++ b/src/OSSupport/File.cpp
@@ -152,7 +152,7 @@ int cFile::Read (void * iBuffer, int iNumBytes)
return -1;
}
- return fread(iBuffer, 1, iNumBytes, m_File); // fread() returns the portion of Count parameter actually read, so we need to send iNumBytes as Count
+ return (int)fread(iBuffer, 1, (size_t)iNumBytes, m_File); // fread() returns the portion of Count parameter actually read, so we need to send iNumBytes as Count
}
@@ -168,7 +168,7 @@ int cFile::Write(const void * iBuffer, int iNumBytes)
return -1;
}
- int res = fwrite(iBuffer, 1, iNumBytes, m_File); // fwrite() returns the portion of Count parameter actually written, so we need to send iNumBytes as Count
+ int res = (int)fwrite(iBuffer, 1, (size_t)iNumBytes, m_File); // fwrite() returns the portion of Count parameter actually written, so we need to send iNumBytes as Count
return res;
}
@@ -189,7 +189,7 @@ int cFile::Seek (int iPosition)
{
return -1;
}
- return ftell(m_File);
+ return (int)ftell(m_File);
}
@@ -206,7 +206,7 @@ int cFile::Tell (void) const
return -1;
}
- return ftell(m_File);
+ return (int)ftell(m_File);
}
@@ -222,7 +222,7 @@ int cFile::GetSize(void) const
return -1;
}
- int CurPos = ftell(m_File);
+ int CurPos = Tell();
if (CurPos < 0)
{
return -1;
@@ -231,8 +231,8 @@ int cFile::GetSize(void) const
{
return -1;
}
- int res = ftell(m_File);
- if (fseek(m_File, CurPos, SEEK_SET) != 0)
+ int res = Tell();
+ if (fseek(m_File, (long)CurPos, SEEK_SET) != 0)
{
return -1;
}
@@ -255,7 +255,7 @@ int cFile::ReadRestOfFile(AString & a_Contents)
int DataSize = GetSize() - Tell();
// HACK: This depends on the internal knowledge that AString's data() function returns the internal buffer directly
- a_Contents.assign(DataSize, '\0');
+ a_Contents.assign((size_t)DataSize, '\0');
return Read((void *)a_Contents.data(), DataSize);
}
@@ -350,7 +350,7 @@ int cFile::GetSize(const AString & a_FileName)
struct stat st;
if (stat(a_FileName.c_str(), &st) == 0)
{
- return st.st_size;
+ return (int)st.st_size;
}
return -1;
}
@@ -456,7 +456,7 @@ int cFile::Printf(const char * a_Fmt, ...)
va_start(args, a_Fmt);
AppendVPrintf(buf, a_Fmt, args);
va_end(args);
- return Write(buf.c_str(), buf.length());
+ return Write(buf.c_str(), (int)buf.length());
}
diff --git a/src/OSSupport/GZipFile.cpp b/src/OSSupport/GZipFile.cpp
index b13e519e0..7a8433f4f 100644
--- a/src/OSSupport/GZipFile.cpp
+++ b/src/OSSupport/GZipFile.cpp
@@ -78,7 +78,7 @@ int cGZipFile::ReadRestOfFile(AString & a_Contents)
while ((NumBytesRead = gzread(m_File, Buffer, sizeof(Buffer))) > 0)
{
TotalBytes += NumBytesRead;
- a_Contents.append(Buffer, NumBytesRead);
+ a_Contents.append(Buffer, (size_t)NumBytesRead);
}
// NumBytesRead is < 0 on error
return (NumBytesRead >= 0) ? TotalBytes : NumBytesRead;
@@ -102,7 +102,7 @@ bool cGZipFile::Write(const char * a_Contents, int a_Size)
return false;
}
- return (gzwrite(m_File, a_Contents, a_Size) != 0);
+ return (gzwrite(m_File, a_Contents, (unsigned int)a_Size) != 0);
}
diff --git a/src/OSSupport/ListenThread.h b/src/OSSupport/ListenThread.h
index 4e337d814..b2d806c82 100644
--- a/src/OSSupport/ListenThread.h
+++ b/src/OSSupport/ListenThread.h
@@ -29,43 +29,45 @@ class cListenThread :
typedef cIsThread super;
public:
- /// Used as the callback for connection events
+ /** Used as the callback for connection events */
class cCallback
{
public:
- /// This callback is called whenever a socket connection is accepted
+ virtual ~cCallback() {}
+
+ /** This callback is called whenever a socket connection is accepted */
virtual void OnConnectionAccepted(cSocket & a_Socket) = 0;
} ;
cListenThread(cCallback & a_Callback, cSocket::eFamily a_Family, const AString & a_ServiceName = "");
~cListenThread();
- /// Creates all the sockets, returns trus if successful, false if not.
+ /** Creates all the sockets, returns trus if successful, false if not. */
bool Initialize(const AString & a_PortsString);
bool Start(void);
void Stop(void);
- /// Call before Initialize() to set the "reuse" flag on the sockets
+ /** Call before Initialize() to set the "reuse" flag on the sockets */
void SetReuseAddr(bool a_Reuse = true);
protected:
typedef std::vector<cSocket> cSockets;
- /// The callback which to notify of incoming connections
+ /** The callback which to notify of incoming connections */
cCallback & m_Callback;
- /// Socket address family to use
+ /** Socket address family to use */
cSocket::eFamily m_Family;
- /// Sockets that are being monitored
+ /** Sockets that are being monitored */
cSockets m_Sockets;
- /// If set to true, the SO_REUSEADDR socket option is set to true
+ /** If set to true, the SO_REUSEADDR socket option is set to true */
bool m_ShouldReuseAddr;
- /// Name of the service that's listening on the ports; for logging purposes only
+ /** Name of the service that's listening on the ports; for logging purposes only */
AString m_ServiceName;
diff --git a/src/OSSupport/Sleep.h b/src/OSSupport/Sleep.h
index 5298c15da..0ec0adf9d 100644
--- a/src/OSSupport/Sleep.h
+++ b/src/OSSupport/Sleep.h
@@ -4,4 +4,4 @@ class cSleep
{
public:
static void MilliSleep( unsigned int a_MilliSeconds );
-}; \ No newline at end of file
+};
diff --git a/src/OSSupport/SocketThreads.h b/src/OSSupport/SocketThreads.h
index b2eb5950f..679e374e1 100644
--- a/src/OSSupport/SocketThreads.h
+++ b/src/OSSupport/SocketThreads.h
@@ -64,7 +64,7 @@ public:
virtual ~cCallback() {}
/** Called when data is received from the remote party */
- virtual void DataReceived(const char * a_Data, int a_Size) = 0;
+ virtual void DataReceived(const char * a_Data, size_t a_Size) = 0;
/** Called when data can be sent to remote party
The function is supposed to *set* outgoing data to a_Data (overwrite) */
diff --git a/src/OSSupport/Thread.h b/src/OSSupport/Thread.h
index 3c9316424..4153b2427 100644
--- a/src/OSSupport/Thread.h
+++ b/src/OSSupport/Thread.h
@@ -23,4 +23,4 @@ private:
cEvent* m_StopEvent;
AString m_ThreadName;
-}; \ No newline at end of file
+};
diff --git a/src/Protocol/ChunkDataSerializer.cpp b/src/Protocol/ChunkDataSerializer.cpp
index 78318a5ee..ebe61631b 100644
--- a/src/Protocol/ChunkDataSerializer.cpp
+++ b/src/Protocol/ChunkDataSerializer.cpp
@@ -105,7 +105,7 @@ void cChunkDataSerializer::Serialize29(AString & a_Data)
a_Data.append((const char *)&BitMap1, sizeof(short));
a_Data.append((const char *)&BitMap2, sizeof(short));
- Int32 CompressedSizeBE = htonl(CompressedSize);
+ UInt32 CompressedSizeBE = htonl((UInt32)CompressedSize);
a_Data.append((const char *)&CompressedSizeBE, sizeof(CompressedSizeBE));
Int32 UnusedInt32 = 0;
@@ -163,7 +163,7 @@ void cChunkDataSerializer::Serialize39(AString & a_Data)
a_Data.append((const char *)&BitMap1, sizeof(short));
a_Data.append((const char *)&BitMap2, sizeof(short));
- Int32 CompressedSizeBE = htonl(CompressedSize);
+ UInt32 CompressedSizeBE = htonl((UInt32)CompressedSize);
a_Data.append((const char *)&CompressedSizeBE, sizeof(CompressedSizeBE));
// Unlike 29, 39 doesn't have the "unused" int
diff --git a/src/Protocol/Protocol.h b/src/Protocol/Protocol.h
index d3383bf0d..ae06f2f9e 100644
--- a/src/Protocol/Protocol.h
+++ b/src/Protocol/Protocol.h
@@ -132,7 +132,7 @@ protected:
cCriticalSection m_CSPacket; //< Each SendXYZ() function must acquire this CS in order to send the whole packet at once
/// A generic data-sending routine, all outgoing packet data needs to be routed through this so that descendants may override it
- virtual void SendData(const char * a_Data, int a_Size) = 0;
+ virtual void SendData(const char * a_Data, size_t a_Size) = 0;
/// Called after writing each packet, enables descendants to flush their buffers
virtual void Flush(void) {};
@@ -143,10 +143,15 @@ protected:
SendData((const char *)&a_Value, 1);
}
+ void WriteChar(char a_Value)
+ {
+ SendData(&a_Value, 1);
+ }
+
void WriteShort(short a_Value)
{
- a_Value = htons(a_Value);
- SendData((const char *)&a_Value, 2);
+ u_short Value = htons((u_short)a_Value);
+ SendData((const char *)&Value, 2);
}
/*
@@ -159,8 +164,8 @@ protected:
void WriteInt(int a_Value)
{
- a_Value = htonl(a_Value);
- SendData((const char *)&a_Value, 4);
+ u_long Value = htonl((u_long)a_Value);
+ SendData((const char *)&Value, 4);
}
void WriteUInt(unsigned int a_Value)
@@ -171,19 +176,19 @@ protected:
void WriteInt64 (Int64 a_Value)
{
- a_Value = HostToNetwork8(&a_Value);
- SendData((const char *)&a_Value, 8);
+ UInt64 Value = HostToNetwork8(&a_Value);
+ SendData((const char *)Value, 8);
}
void WriteFloat (float a_Value)
{
- unsigned int val = HostToNetwork4(&a_Value);
+ UInt32 val = HostToNetwork4(&a_Value);
SendData((const char *)&val, 4);
}
void WriteDouble(double a_Value)
{
- unsigned long long val = HostToNetwork8(&a_Value);
+ UInt64 val = HostToNetwork8(&a_Value);
SendData((const char *)&val, 8);
}
@@ -191,7 +196,7 @@ protected:
{
AString UTF16;
UTF8ToRawBEUTF16(a_Value.c_str(), a_Value.length(), UTF16);
- WriteShort((unsigned short)(UTF16.size() / 2));
+ WriteShort((short)(UTF16.size() / 2));
SendData(UTF16.data(), UTF16.size());
}
@@ -211,7 +216,7 @@ protected:
{
// A 32-bit integer can be encoded by at most 5 bytes:
unsigned char b[5];
- int idx = 0;
+ size_t idx = 0;
do
{
b[idx] = (a_Value & 0x7f) | ((a_Value > 0x7f) ? 0x80 : 0x00);
@@ -224,7 +229,7 @@ protected:
void WriteVarUTF8String(const AString & a_String)
{
- WriteVarInt(a_String.size());
+ WriteVarInt((UInt32)a_String.size());
SendData(a_String.data(), a_String.size());
}
} ;
diff --git a/src/Protocol/Protocol125.cpp b/src/Protocol/Protocol125.cpp
index 69f4934d8..bf946ef19 100644
--- a/src/Protocol/Protocol125.cpp
+++ b/src/Protocol/Protocol125.cpp
@@ -161,8 +161,8 @@ void cProtocol125::SendBlockAction(int a_BlockX, int a_BlockY, int a_BlockZ, cha
WriteInt (a_BlockX);
WriteShort((short)a_BlockY);
WriteInt (a_BlockZ);
- WriteByte (a_Byte1);
- WriteByte (a_Byte2);
+ WriteChar (a_Byte1);
+ WriteChar (a_Byte2);
Flush();
}
@@ -209,12 +209,12 @@ void cProtocol125::SendBlockChanges(int a_ChunkX, int a_ChunkZ, const sSetBlockV
WriteByte (PACKET_MULTI_BLOCK);
WriteInt (a_ChunkX);
WriteInt (a_ChunkZ);
- WriteShort((unsigned short)a_Changes.size());
- WriteUInt (sizeof(int) * a_Changes.size());
+ WriteShort((short)a_Changes.size());
+ WriteUInt ((UInt32)(4 * a_Changes.size()));
for (sSetBlockVector::const_iterator itr = a_Changes.begin(), end = a_Changes.end(); itr != end; ++itr)
{
- unsigned int Coords = itr->y | (itr->z << 8) | (itr->x << 12);
- unsigned int Blocks = itr->BlockMeta | (itr->BlockType << 4);
+ UInt32 Coords = ((UInt32)itr->y) | ((UInt32)(itr->z << 8)) | ((UInt32)(itr->x << 12));
+ UInt32 Blocks = ((UInt32)itr->BlockMeta) | ((UInt32)(itr->BlockType << 4));
WriteUInt(Coords << 16 | Blocks);
}
Flush();
@@ -239,32 +239,11 @@ void cProtocol125::SendChat(const AString & a_Message)
void cProtocol125::SendChat(const cCompositeChat & a_Message)
{
// This version doesn't support composite messages, just extract each part's text and use it:
- AString Msg;
- const cCompositeChat::cParts & Parts = a_Message.GetParts();
- for (cCompositeChat::cParts::const_iterator itr = Parts.begin(), end = Parts.end(); itr != end; ++itr)
- {
- switch ((*itr)->m_PartType)
- {
- case cCompositeChat::ptText:
- case cCompositeChat::ptClientTranslated:
- case cCompositeChat::ptRunCommand:
- case cCompositeChat::ptSuggestCommand:
- {
- Msg.append((*itr)->m_Text);
- break;
- }
- case cCompositeChat::ptUrl:
- {
- Msg.append(((cCompositeChat::cUrlPart *)(*itr))->m_Url);
- break;
- }
- } // switch (PartType)
- } // for itr - Parts[]
// Send the message:
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_CHAT);
- WriteString(Msg);
+ WriteString(a_Message.ExtractText());
Flush();
}
@@ -346,8 +325,8 @@ void cProtocol125::SendEntityEffect(const cEntity & a_Entity, int a_EffectID, in
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_ENTITY_EFFECT);
WriteInt (a_Entity.GetUniqueID());
- WriteByte (a_EffectID);
- WriteByte (a_Amplifier);
+ WriteByte ((Byte)a_EffectID);
+ WriteByte ((Byte)a_Amplifier);
WriteShort(a_Duration);
Flush();
}
@@ -378,7 +357,7 @@ void cProtocol125::SendEntityHeadLook(const cEntity & a_Entity)
cCSLock Lock(m_CSPacket);
WriteByte(PACKET_ENT_HEAD_LOOK);
WriteInt (a_Entity.GetUniqueID());
- WriteByte((char)((a_Entity.GetHeadYaw() / 360.f) * 256));
+ WriteChar((char)((a_Entity.GetHeadYaw() / 360.f) * 256));
Flush();
}
@@ -393,8 +372,8 @@ void cProtocol125::SendEntityLook(const cEntity & a_Entity)
cCSLock Lock(m_CSPacket);
WriteByte(PACKET_ENT_LOOK);
WriteInt (a_Entity.GetUniqueID());
- WriteByte((char)((a_Entity.GetYaw() / 360.f) * 256));
- WriteByte((char)((a_Entity.GetPitch() / 360.f) * 256));
+ WriteChar((char)((a_Entity.GetYaw() / 360.f) * 256));
+ WriteChar((char)((a_Entity.GetPitch() / 360.f) * 256));
Flush();
}
@@ -442,9 +421,9 @@ void cProtocol125::SendEntityRelMove(const cEntity & a_Entity, char a_RelX, char
cCSLock Lock(m_CSPacket);
WriteByte(PACKET_ENT_REL_MOVE);
WriteInt (a_Entity.GetUniqueID());
- WriteByte(a_RelX);
- WriteByte(a_RelY);
- WriteByte(a_RelZ);
+ WriteChar(a_RelX);
+ WriteChar(a_RelY);
+ WriteChar(a_RelZ);
Flush();
}
@@ -459,11 +438,11 @@ void cProtocol125::SendEntityRelMoveLook(const cEntity & a_Entity, char a_RelX,
cCSLock Lock(m_CSPacket);
WriteByte(PACKET_ENT_REL_MOVE_LOOK);
WriteInt (a_Entity.GetUniqueID());
- WriteByte(a_RelX);
- WriteByte(a_RelY);
- WriteByte(a_RelZ);
- WriteByte((char)((a_Entity.GetYaw() / 360.f) * 256));
- WriteByte((char)((a_Entity.GetPitch() / 360.f) * 256));
+ WriteChar(a_RelX);
+ WriteChar(a_RelY);
+ WriteChar(a_RelZ);
+ WriteChar((char)((a_Entity.GetYaw() / 360.f) * 256));
+ WriteChar((char)((a_Entity.GetPitch() / 360.f) * 256));
Flush();
}
@@ -476,7 +455,7 @@ void cProtocol125::SendEntityStatus(const cEntity & a_Entity, char a_Status)
cCSLock Lock(m_CSPacket);
WriteByte(PACKET_ENT_STATUS);
WriteInt (a_Entity.GetUniqueID());
- WriteByte(a_Status);
+ WriteChar(a_Status);
Flush();
}
@@ -509,7 +488,7 @@ void cProtocol125::SendExplosion(double a_BlockX, double a_BlockY, double a_Bloc
WriteDouble (a_BlockY);
WriteDouble (a_BlockZ);
WriteFloat (a_Radius);
- WriteInt (a_BlocksAffected.size());
+ WriteInt ((Int32)a_BlocksAffected.size());
int BlockX = (int)a_BlockX;
int BlockY = (int)a_BlockY;
int BlockZ = (int)a_BlockZ;
@@ -534,7 +513,7 @@ void cProtocol125::SendGameMode(eGameMode a_GameMode)
cCSLock Lock(m_CSPacket);
WriteByte(PACKET_CHANGE_GAME_STATE);
WriteByte(3);
- WriteByte((char)a_GameMode);
+ WriteChar((char)a_GameMode);
Flush();
}
@@ -559,7 +538,7 @@ void cProtocol125::SendHealth(void)
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_UPDATE_HEALTH);
WriteShort((short)m_Client->GetPlayer()->GetHealth());
- WriteShort(m_Client->GetPlayer()->GetFoodLevel());
+ WriteShort((short)m_Client->GetPlayer()->GetFoodLevel());
WriteFloat((float)m_Client->GetPlayer()->GetFoodSaturationLevel());
Flush();
}
@@ -572,7 +551,7 @@ void cProtocol125::SendInventorySlot(char a_WindowID, short a_SlotNum, const cIt
{
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_INVENTORY_SLOT);
- WriteByte (a_WindowID);
+ WriteChar (a_WindowID);
WriteShort(a_SlotNum);
WriteItem (a_Item);
Flush();
@@ -621,17 +600,14 @@ void cProtocol125::SendMapColumn(int a_ID, int a_X, int a_Y, const Byte * a_Colo
WriteByte (PACKET_ITEM_DATA);
WriteShort(E_ITEM_MAP);
- WriteShort(a_ID);
- WriteShort(3 + a_Length);
+ WriteShort((short)a_ID);
+ WriteShort((short)(3 + a_Length));
WriteByte(0);
- WriteByte(a_X);
- WriteByte(a_Y);
+ WriteChar((char)a_X);
+ WriteChar((char)a_Y);
- for (unsigned int i = 0; i < a_Length; ++i)
- {
- WriteByte(a_Colors[i]);
- }
+ SendData((const char *)a_Colors, a_Length);
Flush();
}
@@ -646,16 +622,16 @@ void cProtocol125::SendMapDecorators(int a_ID, const cMapDecoratorList & a_Decor
WriteByte (PACKET_ITEM_DATA);
WriteShort(E_ITEM_MAP);
- WriteShort(a_ID);
- WriteShort(1 + (3 * a_Decorators.size()));
+ WriteShort((short)a_ID);
+ WriteShort((short)(1 + (3 * a_Decorators.size())));
WriteByte(1);
for (cMapDecoratorList::const_iterator it = a_Decorators.begin(); it != a_Decorators.end(); ++it)
{
- WriteByte((it->GetType() << 4) | (it->GetRot() & 0xf));
- WriteByte(it->GetPixelX());
- WriteByte(it->GetPixelZ());
+ WriteByte((Byte)(it->GetType() << 4) | (it->GetRot() & 0xf));
+ WriteByte((Byte)it->GetPixelX());
+ WriteByte((Byte)it->GetPixelZ());
}
Flush();
@@ -672,7 +648,7 @@ void cProtocol125::SendPickupSpawn(const cPickup & a_Pickup)
WriteByte (PACKET_PICKUP_SPAWN);
WriteInt (a_Pickup.GetUniqueID());
WriteShort (a_Pickup.GetItem().m_ItemType);
- WriteByte (a_Pickup.GetItem().m_ItemCount);
+ WriteChar (a_Pickup.GetItem().m_ItemCount);
WriteShort (a_Pickup.GetItem().m_ItemDamage);
WriteVectorI((Vector3i)(a_Pickup.GetPosition() * 32));
WriteByte ((char)(a_Pickup.GetSpeed().x * 8));
@@ -690,7 +666,7 @@ void cProtocol125::SendEntityAnimation(const cEntity & a_Entity, char a_Animatio
cCSLock Lock(m_CSPacket);
WriteByte(PACKET_ANIMATION);
WriteInt (a_Entity.GetUniqueID());
- WriteByte(a_Animation);
+ WriteChar(a_Animation);
Flush();
}
@@ -784,8 +760,8 @@ void cProtocol125::SendPlayerSpawn(const cPlayer & a_Player)
WriteInt ((int)(a_Player.GetPosX() * 32));
WriteInt ((int)(a_Player.GetPosY() * 32));
WriteInt ((int)(a_Player.GetPosZ() * 32));
- WriteByte ((char)((a_Player.GetYaw() / 360.f) * 256));
- WriteByte ((char)((a_Player.GetPitch() / 360.f) * 256));
+ WriteChar ((char)((a_Player.GetYaw() / 360.f) * 256));
+ WriteChar ((char)((a_Player.GetPitch() / 360.f) * 256));
WriteShort (HeldItem.IsEmpty() ? 0 : HeldItem.m_ItemType);
Flush();
}
@@ -811,9 +787,9 @@ void cProtocol125::SendPluginMessage(const AString & a_Channel, const AString &
void cProtocol125::SendRemoveEntityEffect(const cEntity & a_Entity, int a_EffectID)
{
cCSLock Lock(m_CSPacket);
- WriteByte (PACKET_REMOVE_ENTITY_EFFECT);
- WriteInt (a_Entity.GetUniqueID());
- WriteByte (a_EffectID);
+ WriteByte(PACKET_REMOVE_ENTITY_EFFECT);
+ WriteInt (a_Entity.GetUniqueID());
+ WriteChar((char)a_EffectID);
Flush();
}
@@ -827,7 +803,7 @@ void cProtocol125::SendRespawn(void)
WriteByte (PACKET_RESPAWN);
WriteInt ((int)(m_Client->GetPlayer()->GetWorld()->GetDimension()));
WriteByte (2); // TODO: Difficulty; 2 = Normal
- WriteByte ((char)m_Client->GetPlayer()->GetGameMode());
+ WriteChar ((char)m_Client->GetPlayer()->GetGameMode());
WriteShort (256); // Current world height
WriteString("default");
}
@@ -858,7 +834,7 @@ void cProtocol125::SendExperienceOrb(const cExpOrb & a_ExpOrb)
WriteInt((int) a_ExpOrb.GetPosX());
WriteInt((int) a_ExpOrb.GetPosY());
WriteInt((int) a_ExpOrb.GetPosZ());
- WriteShort(a_ExpOrb.GetReward());
+ WriteShort((short)a_ExpOrb.GetReward());
Flush();
}
@@ -899,7 +875,7 @@ void cProtocol125::SendSpawnMob(const cMonster & a_Mob)
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_SPAWN_MOB);
WriteInt (a_Mob.GetUniqueID());
- WriteByte (a_Mob.GetMobType());
+ WriteByte ((Byte)a_Mob.GetMobType());
WriteVectorI((Vector3i)(a_Mob.GetPosition() * 32));
WriteByte (0);
WriteByte (0);
@@ -924,7 +900,7 @@ void cProtocol125::SendSpawnObject(const cEntity & a_Entity, char a_ObjectType,
cCSLock Lock(m_CSPacket);
WriteByte(PACKET_SPAWN_OBJECT);
WriteInt (a_Entity.GetUniqueID());
- WriteByte(a_ObjectType);
+ WriteChar(a_ObjectType);
WriteInt ((int)(a_Entity.GetPosX() * 32));
WriteInt ((int)(a_Entity.GetPosY() * 32));
WriteInt ((int)(a_Entity.GetPosZ() * 32));
@@ -949,7 +925,7 @@ void cProtocol125::SendSpawnVehicle(const cEntity & a_Vehicle, char a_VehicleTyp
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_SPAWN_OBJECT);
WriteInt (a_Vehicle.GetUniqueID());
- WriteByte (a_VehicleType);
+ WriteChar (a_VehicleType);
WriteInt ((int)(a_Vehicle.GetPosX() * 32));
WriteInt ((int)(a_Vehicle.GetPosY() * 32));
WriteInt ((int)(a_Vehicle.GetPosZ() * 32));
@@ -987,8 +963,8 @@ void cProtocol125::SendTeleportEntity(const cEntity & a_Entity)
WriteInt ((int)(floor(a_Entity.GetPosX() * 32)));
WriteInt ((int)(floor(a_Entity.GetPosY() * 32)));
WriteInt ((int)(floor(a_Entity.GetPosZ() * 32)));
- WriteByte ((char)((a_Entity.GetYaw() / 360.f) * 256));
- WriteByte ((char)((a_Entity.GetPitch() / 360.f) * 256));
+ WriteChar ((char)((a_Entity.GetYaw() / 360.f) * 256));
+ WriteChar ((char)((a_Entity.GetPitch() / 360.f) * 256));
Flush();
}
@@ -1063,7 +1039,7 @@ void cProtocol125::SendUseBed(const cEntity & a_Entity, int a_BlockX, int a_Bloc
WriteInt (a_Entity.GetUniqueID());
WriteByte(0); // Unknown byte only 0 has been observed
WriteInt (a_BlockX);
- WriteByte(a_BlockY);
+ WriteByte((Byte)a_BlockY);
WriteInt (a_BlockZ);
Flush();
}
@@ -1107,7 +1083,7 @@ void cProtocol125::SendWholeInventory(const cWindow & a_Window)
cCSLock Lock(m_CSPacket);
cItems Slots;
a_Window.GetSlots(*(m_Client->GetPlayer()), Slots);
- SendWindowSlots(a_Window.GetWindowID(), Slots.size(), &(Slots[0]));
+ SendWindowSlots(a_Window.GetWindowID(), (int)Slots.size(), &(Slots[0]));
}
@@ -1124,7 +1100,7 @@ void cProtocol125::SendWindowClose(const cWindow & a_Window)
cCSLock Lock(m_CSPacket);
WriteByte(PACKET_WINDOW_CLOSE);
- WriteByte(a_Window.GetWindowID());
+ WriteChar(a_Window.GetWindowID());
Flush();
}
@@ -1141,10 +1117,10 @@ void cProtocol125::SendWindowOpen(const cWindow & a_Window)
}
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_WINDOW_OPEN);
- WriteByte (a_Window.GetWindowID());
- WriteByte (a_Window.GetWindowType());
+ WriteChar (a_Window.GetWindowID());
+ WriteByte ((Byte)a_Window.GetWindowType());
WriteString(a_Window.GetWindowTitle());
- WriteByte (a_Window.GetNumNonInventorySlots());
+ WriteByte ((Byte)a_Window.GetNumNonInventorySlots());
Flush();
}
@@ -1156,7 +1132,7 @@ void cProtocol125::SendWindowProperty(const cWindow & a_Window, short a_Property
{
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_WINDOW_PROPERTY);
- WriteByte (a_Window.GetWindowID());
+ WriteChar (a_Window.GetWindowID());
WriteShort(a_Property);
WriteShort(a_Value);
Flush();
@@ -1177,7 +1153,7 @@ AString cProtocol125::GetAuthServerID(void)
-void cProtocol125::SendData(const char * a_Data, int a_Size)
+void cProtocol125::SendData(const char * a_Data, size_t a_Size)
{
m_Client->SendData(a_Data, a_Size);
}
@@ -1548,7 +1524,7 @@ int cProtocol125::ParsePluginMessage(void)
HANDLE_PACKET_READ(ReadBEUTF16String16, AString, ChannelName);
HANDLE_PACKET_READ(ReadBEShort, short, Length);
AString Data;
- if (!m_ReceivedData.ReadString(Data, Length))
+ if (!m_ReceivedData.ReadString(Data, (size_t)Length))
{
m_ReceivedData.CheckValid();
return PARSE_INCOMPLETE;
@@ -1709,7 +1685,7 @@ void cProtocol125::SendPreChunk(int a_ChunkX, int a_ChunkZ, bool a_ShouldLoad)
void cProtocol125::SendWindowSlots(char a_WindowID, int a_NumItems, const cItem * a_Items)
{
WriteByte (PACKET_INVENTORY_WHOLE);
- WriteByte (a_WindowID);
+ WriteChar (a_WindowID);
WriteShort((short)a_NumItems);
for (int j = 0; j < a_NumItems; j++)
@@ -1739,7 +1715,7 @@ void cProtocol125::WriteItem(const cItem & a_Item)
return;
}
- WriteByte (a_Item.m_ItemCount);
+ WriteChar (a_Item.m_ItemCount);
WriteShort(a_Item.m_ItemDamage);
if (cItem::IsEnchantable(a_Item.m_ItemType))
@@ -1786,7 +1762,7 @@ int cProtocol125::ParseItem(cItem & a_Item)
}
// TODO: Enchantment not implemented yet!
- if (!m_ReceivedData.SkipRead(EnchantNumBytes))
+ if (!m_ReceivedData.SkipRead((size_t)EnchantNumBytes))
{
return PARSE_INCOMPLETE;
}
@@ -1871,7 +1847,7 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob)
case cMonster::mtCreeper:
{
WriteByte(0x10);
- WriteByte(((const cCreeper &)a_Mob).IsBlowing() ? 1 : -1); // Blowing up?
+ WriteChar(((const cCreeper &)a_Mob).IsBlowing() ? 1 : -1); // Blowing up?
WriteByte(0x11);
WriteByte(((const cCreeper &)a_Mob).IsCharged() ? 1 : 0); // Lightning-charged?
break;
@@ -1941,9 +1917,9 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob)
WriteByte(0x10);
Byte SheepMetadata = 0;
- SheepMetadata = ((const cSheep &)a_Mob).GetFurColor(); // Fur colour
+ SheepMetadata = (Byte)((const cSheep &)a_Mob).GetFurColor();
- if (((const cSheep &)a_Mob).IsSheared()) // Is sheared?
+ if (((const cSheep &)a_Mob).IsSheared())
{
SheepMetadata |= 0x16;
}
@@ -1972,17 +1948,25 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob)
WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0); // Aggravated? Doesn't seem to do anything
break;
}
+ case cMonster::mtWither:
+ {
+ WriteByte(0x54); // Int at index 20
+ WriteInt((Int32)((const cWither &)a_Mob).GetNumInvulnerableTicks());
+ WriteByte(0x66); // Float at index 6
+ WriteFloat((float)(a_Mob.GetHealth()));
+ break;
+ }
case cMonster::mtSlime:
case cMonster::mtMagmaCube:
{
WriteByte(0x10);
if (a_Mob.GetMobType() == cMonster::mtSlime)
{
- WriteByte(((const cSlime &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME
+ WriteByte((Byte)((const cSlime &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME
}
else
{
- WriteByte(((const cMagmaCube &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME
+ WriteByte((Byte)((const cMagmaCube &)a_Mob).GetSize()); // Size of slime - HEWGE, meh, cute BABBY SLIME
}
break;
}
@@ -2021,7 +2005,7 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob)
WriteInt(Flags);
WriteByte(0x13);
- WriteByte(((const cHorse &)a_Mob).GetHorseType()); // Type of horse (donkey, chestnut, etc.)
+ WriteByte((Byte)((const cHorse &)a_Mob).GetHorseType()); // Type of horse (donkey, chestnut, etc.)
WriteByte(0x54);
int Appearance = 0;
@@ -2033,6 +2017,10 @@ void cProtocol125::WriteMobMetadata(const cMonster & a_Mob)
WriteInt(((const cHorse &)a_Mob).GetHorseArmour()); // Horshey armour
break;
}
+ default:
+ {
+ break;
+ }
}
}
diff --git a/src/Protocol/Protocol125.h b/src/Protocol/Protocol125.h
index aca24c03a..08d3ebbe9 100644
--- a/src/Protocol/Protocol125.h
+++ b/src/Protocol/Protocol125.h
@@ -125,7 +125,7 @@ protected:
AString m_Username; ///< Stored in ParseHandshake(), compared to Login username
- virtual void SendData(const char * a_Data, int a_Size) override;
+ virtual void SendData(const char * a_Data, size_t a_Size) override;
/// Sends the Handshake packet
void SendHandshake(const AString & a_ConnectionHash);
diff --git a/src/Protocol/Protocol132.cpp b/src/Protocol/Protocol132.cpp
index be9c503ed..ce5942a5c 100644
--- a/src/Protocol/Protocol132.cpp
+++ b/src/Protocol/Protocol132.cpp
@@ -115,7 +115,7 @@ void cProtocol132::DataReceived(const char * a_Data, size_t a_Size)
Byte Decrypted[512];
while (a_Size > 0)
{
- int NumBytes = (a_Size > (int)sizeof(Decrypted)) ? (int)sizeof(Decrypted) : a_Size;
+ size_t NumBytes = (a_Size > sizeof(Decrypted)) ? sizeof(Decrypted) : a_Size;
m_Decryptor.ProcessData(Decrypted, (Byte *)a_Data, NumBytes);
super::DataReceived((const char *)Decrypted, NumBytes);
a_Size -= NumBytes;
@@ -139,8 +139,8 @@ void cProtocol132::SendBlockAction(int a_BlockX, int a_BlockY, int a_BlockZ, cha
WriteInt (a_BlockX);
WriteShort((short)a_BlockY);
WriteInt (a_BlockZ);
- WriteByte (a_Byte1);
- WriteByte (a_Byte2);
+ WriteChar (a_Byte1);
+ WriteChar (a_Byte2);
WriteShort(a_BlockType);
Flush();
}
@@ -157,7 +157,7 @@ void cProtocol132::SendBlockBreakAnim(int a_entityID, int a_BlockX, int a_BlockY
WriteInt (a_BlockX);
WriteInt (a_BlockY);
WriteInt (a_BlockZ);
- WriteByte (stage);
+ WriteChar (stage);
Flush();
}
@@ -259,7 +259,7 @@ void cProtocol132::SendLogin(const cPlayer & a_Player, const cWorld & a_World)
WriteByte (PACKET_LOGIN);
WriteInt (a_Player.GetUniqueID()); // EntityID of the player
WriteString("default"); // Level type
- WriteByte ((int)a_Player.GetGameMode());
+ WriteByte ((Byte)a_Player.GetGameMode());
WriteByte ((Byte)(a_World.GetDimension()));
WriteByte (2); // TODO: Difficulty
WriteByte (0); // Unused, used to be world height
@@ -283,8 +283,8 @@ void cProtocol132::SendPlayerSpawn(const cPlayer & a_Player)
WriteInt ((int)(a_Player.GetPosX() * 32));
WriteInt ((int)(a_Player.GetPosY() * 32));
WriteInt ((int)(a_Player.GetPosZ() * 32));
- WriteByte ((char)((a_Player.GetYaw() / 360.f) * 256));
- WriteByte ((char)((a_Player.GetPitch() / 360.f) * 256));
+ WriteChar ((char)((a_Player.GetYaw() / 360.f) * 256));
+ WriteChar ((char)((a_Player.GetPitch() / 360.f) * 256));
WriteShort (HeldItem.IsEmpty() ? 0 : HeldItem.m_ItemType);
// Player metadata: just use a default metadata value, since the client doesn't like starting without any metadata:
WriteByte (0); // Index 0, byte (flags)
@@ -306,7 +306,7 @@ void cProtocol132::SendSoundEffect(const AString & a_SoundName, int a_SrcX, int
WriteInt (a_SrcY);
WriteInt (a_SrcZ);
WriteFloat (a_Volume);
- WriteByte ((char)(a_Pitch * 63.0f));
+ WriteChar ((char)(a_Pitch * 63.0f));
Flush();
}
@@ -320,7 +320,7 @@ void cProtocol132::SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_Src
WriteByte(PACKET_SOUND_PARTICLE_EFFECT);
WriteInt (a_EffectID);
WriteInt (a_SrcX);
- WriteByte(a_SrcY);
+ WriteByte((Byte)a_SrcY);
WriteInt (a_SrcZ);
WriteInt (a_Data);
Flush();
@@ -335,7 +335,7 @@ void cProtocol132::SendSpawnMob(const cMonster & a_Mob)
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_SPAWN_MOB);
WriteInt (a_Mob.GetUniqueID());
- WriteByte (a_Mob.GetMobType());
+ WriteByte ((Byte)a_Mob.GetMobType());
WriteVectorI((Vector3i)(a_Mob.GetPosition() * 32));
WriteByte ((Byte)((a_Mob.GetYaw() / 360.f) * 256));
WriteByte ((Byte)((a_Mob.GetPitch() / 360.f) * 256));
@@ -411,12 +411,12 @@ void cProtocol132::SendWholeInventory(const cWindow & a_Window)
const cInventory & Inventory = m_Client->GetPlayer()->GetInventory();
int BaseOffset = a_Window.GetNumSlots() - (cInventory::invNumSlots - cInventory::invInventoryOffset); // Number of non-inventory slots
char WindowID = a_Window.GetWindowID();
- for (int i = 0; i < cInventory::invInventoryCount; i++)
+ for (short i = 0; i < cInventory::invInventoryCount; i++)
{
SendInventorySlot(WindowID, BaseOffset + i, Inventory.GetInventorySlot(i));
} // for i - Inventory[]
BaseOffset += cInventory::invInventoryCount;
- for (int i = 0; i < cInventory::invHotbarCount; i++)
+ for (short i = 0; i < cInventory::invHotbarCount; i++)
{
SendInventorySlot(WindowID, BaseOffset + i, Inventory.GetHotbarSlot(i));
} // for i - Hotbar[]
@@ -527,21 +527,30 @@ int cProtocol132::ParseClientStatuses(void)
int cProtocol132::ParseEncryptionKeyResponse(void)
{
+ // Read the encryption key:
HANDLE_PACKET_READ(ReadBEShort, short, EncKeyLength);
+ if (EncKeyLength > MAX_ENC_LEN)
+ {
+ LOGD("Too long encryption key");
+ m_Client->Kick("Hacked client");
+ return PARSE_OK;
+ }
AString EncKey;
- if (!m_ReceivedData.ReadString(EncKey, EncKeyLength))
+ if (!m_ReceivedData.ReadString(EncKey, (size_t)EncKeyLength))
{
return PARSE_INCOMPLETE;
}
+
+ // Read the encryption nonce:
HANDLE_PACKET_READ(ReadBEShort, short, EncNonceLength);
AString EncNonce;
- if (!m_ReceivedData.ReadString(EncNonce, EncNonceLength))
+ if (!m_ReceivedData.ReadString(EncNonce, (size_t)EncNonceLength))
{
return PARSE_INCOMPLETE;
}
- if ((EncKeyLength > MAX_ENC_LEN) || (EncNonceLength > MAX_ENC_LEN))
+ if (EncNonceLength > MAX_ENC_LEN)
{
- LOGD("Too long encryption");
+ LOGD("Too long encryption nonce");
m_Client->Kick("Hacked client");
return PARSE_OK;
}
@@ -605,7 +614,7 @@ int cProtocol132::ParseTabCompletion(void)
-void cProtocol132::SendData(const char * a_Data, int a_Size)
+void cProtocol132::SendData(const char * a_Data, size_t a_Size)
{
m_DataToSend.append(a_Data, a_Size);
}
@@ -623,23 +632,23 @@ void cProtocol132::Flush(void)
LOGD("Flushing empty");
return;
}
- const char * a_Data = m_DataToSend.data();
- int a_Size = m_DataToSend.size();
+ const char * Data = m_DataToSend.data();
+ size_t Size = m_DataToSend.size();
if (m_IsEncrypted)
{
Byte Encrypted[8192]; // Larger buffer, we may be sending lots of data (chunks)
- while (a_Size > 0)
+ while (Size > 0)
{
- int NumBytes = (a_Size > (int)sizeof(Encrypted)) ? (int)sizeof(Encrypted) : a_Size;
- m_Encryptor.ProcessData(Encrypted, (Byte *)a_Data, NumBytes);
+ size_t NumBytes = (Size > sizeof(Encrypted)) ? sizeof(Encrypted) : Size;
+ m_Encryptor.ProcessData(Encrypted, (Byte *)Data, NumBytes);
super::SendData((const char *)Encrypted, NumBytes);
- a_Size -= NumBytes;
- a_Data += NumBytes;
+ Size -= NumBytes;
+ Data += NumBytes;
}
}
else
{
- super::SendData(a_Data, a_Size);
+ super::SendData(Data, Size);
}
m_DataToSend.clear();
}
@@ -665,7 +674,7 @@ void cProtocol132::WriteItem(const cItem & a_Item)
}
WriteShort(ItemType);
- WriteByte (a_Item.m_ItemCount);
+ WriteChar (a_Item.m_ItemCount);
WriteShort(a_Item.m_ItemDamage);
if (a_Item.m_Enchantments.IsEmpty())
@@ -681,7 +690,7 @@ void cProtocol132::WriteItem(const cItem & a_Item)
Writer.Finish();
AString Compressed;
CompressStringGZIP(Writer.GetResult().data(), Writer.GetResult().size(), Compressed);
- WriteShort(Compressed.size());
+ WriteShort((short)Compressed.size());
SendData(Compressed.data(), Compressed.size());
}
@@ -717,8 +726,8 @@ int cProtocol132::ParseItem(cItem & a_Item)
// Read the metadata
AString Metadata;
- Metadata.resize(MetadataLength);
- if (!m_ReceivedData.ReadBuf((void *)Metadata.data(), MetadataLength))
+ Metadata.resize((size_t)MetadataLength);
+ if (!m_ReceivedData.ReadBuf((void *)Metadata.data(), (size_t)MetadataLength))
{
return PARSE_INCOMPLETE;
}
diff --git a/src/Protocol/Protocol132.h b/src/Protocol/Protocol132.h
index 0702fbf5a..b280c8a41 100644
--- a/src/Protocol/Protocol132.h
+++ b/src/Protocol/Protocol132.h
@@ -87,7 +87,7 @@ protected:
/// The ServerID used for session authentication; set in StartEncryption(), used in GetAuthServerID()
AString m_AuthServerID;
- virtual void SendData(const char * a_Data, int a_Size) override;
+ virtual void SendData(const char * a_Data, size_t a_Size) override;
// DEBUG:
virtual void Flush(void) override;
diff --git a/src/Protocol/Protocol14x.cpp b/src/Protocol/Protocol14x.cpp
index 232b2718e..f694af1eb 100644
--- a/src/Protocol/Protocol14x.cpp
+++ b/src/Protocol/Protocol14x.cpp
@@ -103,9 +103,9 @@ void cProtocol142::SendPickupSpawn(const cPickup & a_Pickup)
WriteInt (a_Pickup.GetUniqueID());
WriteItem (a_Pickup.GetItem());
WriteVectorI((Vector3i)(a_Pickup.GetPosition() * 32));
- WriteByte ((char)(a_Pickup.GetSpeed().x * 8));
- WriteByte ((char)(a_Pickup.GetSpeed().y * 8));
- WriteByte ((char)(a_Pickup.GetSpeed().z * 8));
+ WriteChar ((char)(a_Pickup.GetSpeed().x * 8));
+ WriteChar ((char)(a_Pickup.GetSpeed().y * 8));
+ WriteChar ((char)(a_Pickup.GetSpeed().z * 8));
Flush();
}
@@ -119,7 +119,7 @@ void cProtocol142::SendSoundParticleEffect(int a_EffectID, int a_SrcX, int a_Src
WriteByte(PACKET_SOUND_PARTICLE_EFFECT);
WriteInt (a_EffectID);
WriteInt (a_SrcX);
- WriteByte(a_SrcY);
+ WriteByte((Byte)a_SrcY);
WriteInt (a_SrcZ);
WriteInt (a_Data);
WriteBool(0);
@@ -218,7 +218,7 @@ void cProtocol146::SendSpawnObject(const cEntity & a_Entity, char a_ObjectType,
cCSLock Lock(m_CSPacket);
WriteByte(PACKET_SPAWN_OBJECT);
WriteInt (a_Entity.GetUniqueID());
- WriteByte(a_ObjectType);
+ WriteChar(a_ObjectType);
WriteInt ((int)(a_Entity.GetPosX() * 32));
WriteInt ((int)(a_Entity.GetPosY() * 32));
WriteInt ((int)(a_Entity.GetPosZ() * 32));
@@ -243,7 +243,7 @@ void cProtocol146::SendSpawnVehicle(const cEntity & a_Vehicle, char a_VehicleTyp
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_SPAWN_OBJECT);
WriteInt (a_Vehicle.GetUniqueID());
- WriteByte (a_VehicleType);
+ WriteChar (a_VehicleType);
WriteInt ((int)(a_Vehicle.GetPosX() * 32));
WriteInt ((int)(a_Vehicle.GetPosY() * 32));
WriteInt ((int)(a_Vehicle.GetPosZ() * 32));
diff --git a/src/Protocol/Protocol16x.cpp b/src/Protocol/Protocol16x.cpp
index ecb24254f..bf7d9a0b1 100644
--- a/src/Protocol/Protocol16x.cpp
+++ b/src/Protocol/Protocol16x.cpp
@@ -119,7 +119,7 @@ void cProtocol161::SendHealth(void)
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_UPDATE_HEALTH);
WriteFloat((float)m_Client->GetPlayer()->GetHealth());
- WriteShort(m_Client->GetPlayer()->GetFoodLevel());
+ WriteShort((short)m_Client->GetPlayer()->GetFoodLevel());
WriteFloat((float)m_Client->GetPlayer()->GetFoodSaturationLevel());
Flush();
}
@@ -163,10 +163,10 @@ void cProtocol161::SendWindowOpen(const cWindow & a_Window)
}
cCSLock Lock(m_CSPacket);
WriteByte (PACKET_WINDOW_OPEN);
- WriteByte (a_Window.GetWindowID());
- WriteByte (a_Window.GetWindowType());
+ WriteChar (a_Window.GetWindowID());
+ WriteByte ((Byte)a_Window.GetWindowType());
WriteString(a_Window.GetWindowTitle());
- WriteByte (a_Window.GetNumNonInventorySlots());
+ WriteByte ((Byte)a_Window.GetNumNonInventorySlots());
WriteByte (1); // Use title
if (a_Window.GetWindowType() == cWindow::wtAnimalChest)
{
diff --git a/src/Protocol/Protocol17x.cpp b/src/Protocol/Protocol17x.cpp
index 721ed349e..a4319df37 100644
--- a/src/Protocol/Protocol17x.cpp
+++ b/src/Protocol/Protocol17x.cpp
@@ -1236,7 +1236,7 @@ void cProtocol172::SendWindowProperty(const cWindow & a_Window, short a_Property
-void cProtocol172::AddReceivedData(const char * a_Data, int a_Size)
+void cProtocol172::AddReceivedData(const char * a_Data, size_t a_Size)
{
// Write the incoming data into the comm log file:
if (g_ShouldLogCommIn)
@@ -1258,7 +1258,7 @@ void cProtocol172::AddReceivedData(const char * a_Data, int a_Size)
AString Hex;
CreateHexDump(Hex, a_Data, a_Size, 16);
m_CommLogFile.Printf("Incoming data: %d (0x%x) bytes: \n%s\n",
- a_Size, a_Size, Hex.c_str()
+ (unsigned)a_Size, (unsigned)a_Size, Hex.c_str()
);
m_CommLogFile.Flush();
}
@@ -1988,14 +1988,14 @@ void cProtocol172::WritePacket(cByteBuffer & a_Packet)
-void cProtocol172::SendData(const char * a_Data, int a_Size)
+void cProtocol172::SendData(const char * a_Data, size_t a_Size)
{
if (m_IsEncrypted)
{
Byte Encrypted[8192]; // Larger buffer, we may be sending lots of data (chunks)
while (a_Size > 0)
{
- size_t NumBytes = ((size_t)a_Size > sizeof(Encrypted)) ? sizeof(Encrypted) : (size_t)a_Size;
+ size_t NumBytes = (a_Size > sizeof(Encrypted)) ? sizeof(Encrypted) : a_Size;
m_Encryptor.ProcessData(Encrypted, (Byte *)a_Data, NumBytes);
m_Client->SendData((const char *)Encrypted, NumBytes);
a_Size -= NumBytes;
@@ -2535,6 +2535,7 @@ void cProtocol172::cPacketizer::WriteEntityMetadata(const cEntity & a_Entity)
WriteByte(Frame.GetRotation());
break;
}
+ default: break;
}
}
@@ -2659,6 +2660,15 @@ void cProtocol172::cPacketizer::WriteMobMetadata(const cMonster & a_Mob)
WriteByte(((const cWitch &)a_Mob).IsAngry() ? 1 : 0);
break;
}
+
+ case cMonster::mtWither:
+ {
+ WriteByte(0x54); // Int at index 20
+ WriteInt(((const cWither &)a_Mob).GetNumInvulnerableTicks());
+ WriteByte(0x66); // Float at index 6
+ WriteFloat((float)(a_Mob.GetHealth()));
+ break;
+ }
case cMonster::mtSlime:
{
diff --git a/src/Protocol/Protocol17x.h b/src/Protocol/Protocol17x.h
index 41163009e..91186b270 100644
--- a/src/Protocol/Protocol17x.h
+++ b/src/Protocol/Protocol17x.h
@@ -196,7 +196,7 @@ protected:
m_Out.WriteVarUTF8String(a_Value);
}
- void WriteBuf(const char * a_Data, int a_Size)
+ void WriteBuf(const char * a_Data, size_t a_Size)
{
m_Out.Write(a_Data, a_Size);
}
@@ -243,7 +243,7 @@ protected:
/** Adds the received (unencrypted) data to m_ReceivedData, parses complete packets */
- void AddReceivedData(const char * a_Data, int a_Size);
+ void AddReceivedData(const char * a_Data, size_t a_Size);
/** Reads and handles the packet. The packet length and type have already been read.
Returns true if the packet was understood, false if it was an unknown packet
@@ -287,7 +287,7 @@ protected:
void WritePacket(cByteBuffer & a_Packet);
/** Sends the data to the client, encrypting them if needed. */
- virtual void SendData(const char * a_Data, int a_Size) override;
+ virtual void SendData(const char * a_Data, size_t a_Size) override;
void SendCompass(const cWorld & a_World);
diff --git a/src/Protocol/ProtocolRecognizer.cpp b/src/Protocol/ProtocolRecognizer.cpp
index 3b9003e60..3f7d7b254 100644
--- a/src/Protocol/ProtocolRecognizer.cpp
+++ b/src/Protocol/ProtocolRecognizer.cpp
@@ -794,7 +794,7 @@ AString cProtocolRecognizer::GetAuthServerID(void)
-void cProtocolRecognizer::SendData(const char * a_Data, int a_Size)
+void cProtocolRecognizer::SendData(const char * a_Data, size_t a_Size)
{
// This is used only when handling the server ping
m_Client->SendData(a_Data, a_Size);
@@ -854,7 +854,7 @@ bool cProtocolRecognizer::TryRecognizeProtocol(void)
// This must be a lengthed protocol, try if it has the entire initial handshake packet:
m_Buffer.ResetRead();
UInt32 PacketLen;
- UInt32 ReadSoFar = m_Buffer.GetReadableSpace();
+ UInt32 ReadSoFar = (UInt32)m_Buffer.GetReadableSpace();
if (!m_Buffer.ReadVarInt(PacketLen))
{
// Not enough bytes for the packet length, keep waiting
@@ -931,7 +931,7 @@ bool cProtocolRecognizer::TryRecognizeLengthlessProtocol(void)
bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRemaining)
{
UInt32 PacketType;
- UInt32 NumBytesRead = m_Buffer.GetReadableSpace();
+ UInt32 NumBytesRead = (UInt32)m_Buffer.GetReadableSpace();
if (!m_Buffer.ReadVarInt(PacketType))
{
return false;
@@ -962,7 +962,7 @@ bool cProtocolRecognizer::TryRecognizeLengthedProtocol(UInt32 a_PacketLengthRema
m_Buffer.ReadBEShort(ServerPort);
m_Buffer.ReadVarInt(NextState);
m_Buffer.CommitRead();
- m_Protocol = new cProtocol172(m_Client, ServerAddress, ServerPort, NextState);
+ m_Protocol = new cProtocol172(m_Client, ServerAddress, (UInt16)ServerPort, NextState);
return true;
}
}
diff --git a/src/Protocol/ProtocolRecognizer.h b/src/Protocol/ProtocolRecognizer.h
index d7fb8fad2..072d7c2d2 100644
--- a/src/Protocol/ProtocolRecognizer.h
+++ b/src/Protocol/ProtocolRecognizer.h
@@ -133,7 +133,7 @@ public:
virtual AString GetAuthServerID(void) override;
- virtual void SendData(const char * a_Data, int a_Size) override;
+ virtual void SendData(const char * a_Data, size_t a_Size) override;
protected:
cProtocol * m_Protocol; //< The recognized protocol
diff --git a/src/RCONServer.cpp b/src/RCONServer.cpp
index 72f2d9ba9..d7083ff2b 100644
--- a/src/RCONServer.cpp
+++ b/src/RCONServer.cpp
@@ -169,7 +169,7 @@ cRCONServer::cConnection::cConnection(cRCONServer & a_RCONServer, cSocket & a_So
-void cRCONServer::cConnection::DataReceived(const char * a_Data, int a_Size)
+void cRCONServer::cConnection::DataReceived(const char * a_Data, size_t a_Size)
{
// Append data to the buffer:
m_Buffer.append(a_Data, a_Size);
diff --git a/src/RCONServer.h b/src/RCONServer.h
index 0e89800a2..b964852ab 100644
--- a/src/RCONServer.h
+++ b/src/RCONServer.h
@@ -29,7 +29,7 @@ class cRCONServer :
{
public:
cRCONServer(cServer & a_Server);
- ~cRCONServer();
+ virtual ~cRCONServer();
void Initialize(cIniFile & a_IniFile);
@@ -65,7 +65,7 @@ protected:
// cSocketThreads::cCallback overrides:
- virtual void DataReceived(const char * a_Data, int a_Size) override;
+ virtual void DataReceived(const char * a_Data, size_t a_Size) override;
virtual void GetOutgoingData(AString & a_Data) override;
virtual void SocketClosed(void) override;
diff --git a/src/Root.cpp b/src/Root.cpp
index 3555afb45..ba4398b35 100644
--- a/src/Root.cpp
+++ b/src/Root.cpp
@@ -304,6 +304,7 @@ void cRoot::LoadWorlds(cIniFile & IniFile)
{
if (IniFile.GetKeyComment("Worlds", 0) != " World=secondworld")
{
+ IniFile.DeleteKeyComment("Worlds", 0);
IniFile.AddKeyComment("Worlds", " World=secondworld");
}
}
diff --git a/src/Simulator/FluidSimulator.cpp b/src/Simulator/FluidSimulator.cpp
index 61c93ed73..7779573d7 100644
--- a/src/Simulator/FluidSimulator.cpp
+++ b/src/Simulator/FluidSimulator.cpp
@@ -36,6 +36,7 @@ bool cFluidSimulator::CanWashAway(BLOCKTYPE a_BlockType)
case E_BLOCK_COBWEB:
case E_BLOCK_CROPS:
case E_BLOCK_DEAD_BUSH:
+ case E_BLOCK_LILY_PAD:
case E_BLOCK_RAIL:
case E_BLOCK_REDSTONE_TORCH_OFF:
case E_BLOCK_REDSTONE_TORCH_ON:
diff --git a/src/StringCompression.cpp b/src/StringCompression.cpp
index 5b9a3bb0a..2a85649a1 100644
--- a/src/StringCompression.cpp
+++ b/src/StringCompression.cpp
@@ -53,7 +53,7 @@ int UncompressString(const char * a_Data, int a_Length, AString & a_Uncompressed
-int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed)
+int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Compressed)
{
// Compress a_Data into a_Compressed using GZIP; return Z_XXX error constants same as zlib's compress2()
@@ -83,6 +83,7 @@ int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed
{
// Some data has been compressed. Consume the buffer and continue compressing
a_Compressed.append(Buffer, sizeof(Buffer) - strm.avail_out);
+ strm.next_out = (Bytef *)Buffer;
strm.avail_out = sizeof(Buffer);
if (strm.avail_in == 0)
{
@@ -116,7 +117,7 @@ int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed
-extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_Uncompressed)
+extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed)
{
// Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib
@@ -139,13 +140,14 @@ extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_U
for (;;)
{
- res = inflate(&strm, Z_FINISH);
+ res = inflate(&strm, Z_NO_FLUSH);
switch (res)
{
case Z_OK:
{
// Some data has been uncompressed. Consume the buffer and continue uncompressing
a_Uncompressed.append(Buffer, sizeof(Buffer) - strm.avail_out);
+ strm.next_out = (Bytef *)Buffer;
strm.avail_out = sizeof(Buffer);
if (strm.avail_in == 0)
{
diff --git a/src/StringCompression.h b/src/StringCompression.h
index 3f4e12d2d..c3a9eca91 100644
--- a/src/StringCompression.h
+++ b/src/StringCompression.h
@@ -16,10 +16,10 @@ extern int CompressString(const char * a_Data, int a_Length, AString & a_Compres
extern int UncompressString(const char * a_Data, int a_Length, AString & a_Uncompressed, int a_UncompressedSize);
/// Compresses a_Data into a_Compressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib
-extern int CompressStringGZIP(const char * a_Data, int a_Length, AString & a_Compressed);
+extern int CompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Compressed);
/// Uncompresses a_Data into a_Uncompressed using GZIP; returns Z_OK for success or Z_XXX error constants same as zlib
-extern int UncompressStringGZIP(const char * a_Data, int a_Length, AString & a_Uncompressed);
+extern int UncompressStringGZIP(const char * a_Data, size_t a_Length, AString & a_Uncompressed);
diff --git a/src/StringUtils.cpp b/src/StringUtils.cpp
index ad622d707..33b04505f 100644
--- a/src/StringUtils.cpp
+++ b/src/StringUtils.cpp
@@ -531,32 +531,32 @@ AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a
format binary data this way:
00001234: 31 32 33 34 35 36 37 38 39 30 61 62 63 64 65 66 1234567890abcdef
*/
-AString & CreateHexDump(AString & a_Out, const void * a_Data, int a_Size, int a_LineLength)
+AString & CreateHexDump(AString & a_Out, const void * a_Data, size_t a_Size, size_t a_BytesPerLine)
{
- ASSERT(a_LineLength <= 120); // Due to using a fixed size line buffer; increase line[]'s size to lift this max
+ ASSERT(a_BytesPerLine <= 120); // Due to using a fixed size line buffer; increase line[]'s size to lift this max
char line[512];
char * p;
char * q;
- a_Out.reserve(a_Size / a_LineLength * (18 + 6 * a_LineLength));
- for (int i = 0; i < a_Size; i += a_LineLength)
+ a_Out.reserve(a_Size / a_BytesPerLine * (18 + 6 * a_BytesPerLine));
+ for (size_t i = 0; i < a_Size; i += a_BytesPerLine)
{
- int k = a_Size - i;
- if (k > a_LineLength)
+ size_t k = a_Size - i;
+ if (k > a_BytesPerLine)
{
- k = a_LineLength;
+ k = a_BytesPerLine;
}
#ifdef _MSC_VER
// MSVC provides a "secure" version of sprintf()
- int Count = sprintf_s(line, sizeof(line), "%08x:", i);
+ int Count = sprintf_s(line, sizeof(line), "%08x:", (unsigned)i);
#else
- int Count = sprintf(line, "%08x:", i);
+ int Count = sprintf(line, "%08x:", (unsigned)i);
#endif
// Remove the terminating NULL / leftover garbage in line, after the sprintf-ed value
memset(line + Count, 32, sizeof(line) - Count);
p = line + 10;
- q = p + 2 + a_LineLength * 3 + 1;
- for (int j = 0; j < k; j++)
+ q = p + 2 + a_BytesPerLine * 3 + 1;
+ for (size_t j = 0; j < k; j++)
{
unsigned char c = ((unsigned char *)a_Data)[i + j];
p[0] = HEX(c >> 4);
diff --git a/src/StringUtils.h b/src/StringUtils.h
index 4feff7553..b69e47d3c 100644
--- a/src/StringUtils.h
+++ b/src/StringUtils.h
@@ -64,7 +64,7 @@ extern AString & RawBEToUTF8(const char * a_RawData, int a_NumShorts, AString &
extern AString & UTF8ToRawBEUTF16(const char * a_UTF8, size_t a_UTF8Length, AString & a_UTF16);
/// Creates a nicely formatted HEX dump of the given memory block. Max a_BytesPerLine is 120
-extern AString & CreateHexDump(AString & a_Out, const void * a_Data, int a_Size, int a_BytesPerLine);
+extern AString & CreateHexDump(AString & a_Out, const void * a_Data, size_t a_Size, size_t a_BytesPerLine);
/// Returns a copy of a_Message with all quotes and backslashes escaped by a backslash
extern AString EscapeString(const AString & a_Message); // tolua_export
@@ -79,10 +79,10 @@ extern AString URLDecode(const AString & a_String); // Cannot export to Lua aut
extern AString ReplaceAllCharOccurrences(const AString & a_String, char a_From, char a_To); // Needn't export to Lua, since Lua doesn't have chars anyway
/// Decodes a Base64-encoded string into the raw data
-extern AString Base64Decode(const AString & a_Base64String);
+extern AString Base64Decode(const AString & a_Base64String); // Exported manually due to embedded NULs and extra parameter
/// Encodes a string into Base64
-extern AString Base64Encode(const AString & a_Input);
+extern AString Base64Encode(const AString & a_Input); // Exported manually due to embedded NULs and extra parameter
/// Reads two bytes from the specified memory location and interprets them as BigEndian short
extern short GetBEShort(const char * a_Mem);
diff --git a/src/UI/WindowOwner.h b/src/UI/WindowOwner.h
index d41abf66d..e3c73edc4 100644
--- a/src/UI/WindowOwner.h
+++ b/src/UI/WindowOwner.h
@@ -33,6 +33,10 @@ public:
{
}
+ virtual ~cWindowOwner()
+ {
+ }
+
void CloseWindow(void)
{
m_Window = NULL;
diff --git a/src/WebAdmin.cpp b/src/WebAdmin.cpp
index 402cd3035..cd141f7eb 100644
--- a/src/WebAdmin.cpp
+++ b/src/WebAdmin.cpp
@@ -490,7 +490,7 @@ void cWebAdmin::OnRequestBegun(cHTTPConnection & a_Connection, cHTTPRequest & a_
-void cWebAdmin::OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size)
+void cWebAdmin::OnRequestBody(cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size)
{
UNUSED(a_Connection);
cRequestData * Data = (cRequestData *)(a_Request.GetUserData());
@@ -537,7 +537,7 @@ void cWebAdmin::OnRequestFinished(cHTTPConnection & a_Connection, cHTTPRequest &
///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
// cWebAdmin::cWebadminRequestData
-void cWebAdmin::cWebadminRequestData::OnBody(const char * a_Data, int a_Size)
+void cWebAdmin::cWebadminRequestData::OnBody(const char * a_Data, size_t a_Size)
{
m_Form.Parse(a_Data, a_Size);
}
diff --git a/src/WebAdmin.h b/src/WebAdmin.h
index a2a07a543..d5e45828f 100644
--- a/src/WebAdmin.h
+++ b/src/WebAdmin.h
@@ -151,7 +151,7 @@ protected:
virtual ~cRequestData() {} // Force a virtual destructor in all descendants
/** Called when a new chunk of body data is received */
- virtual void OnBody(const char * a_Data, int a_Size) = 0;
+ virtual void OnBody(const char * a_Data, size_t a_Size) = 0;
} ;
/** The body handler for requests in the "/webadmin" and "/~webadmin" paths */
@@ -169,14 +169,14 @@ protected:
}
// cRequestData overrides:
- virtual void OnBody(const char * a_Data, int a_Size) override;
+ virtual void OnBody(const char * a_Data, size_t a_Size) override;
// cHTTPFormParser::cCallbacks overrides. Files are ignored:
- virtual void OnFileStart(cHTTPFormParser &, const AString & a_FileName) override
+ virtual void OnFileStart(cHTTPFormParser &, const AString & a_FileName) override
{
UNUSED(a_FileName);
}
- virtual void OnFileData(cHTTPFormParser &, const char * a_Data, int a_Size) override
+ virtual void OnFileData(cHTTPFormParser &, const char * a_Data, size_t a_Size) override
{
UNUSED(a_Data);
UNUSED(a_Size);
@@ -216,7 +216,7 @@ protected:
// cHTTPServer::cCallbacks overrides:
virtual void OnRequestBegun (cHTTPConnection & a_Connection, cHTTPRequest & a_Request) override;
- virtual void OnRequestBody (cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, int a_Size) override;
+ virtual void OnRequestBody (cHTTPConnection & a_Connection, cHTTPRequest & a_Request, const char * a_Data, size_t a_Size) override;
virtual void OnRequestFinished(cHTTPConnection & a_Connection, cHTTPRequest & a_Request) override;
} ; // tolua_export
diff --git a/src/World.h b/src/World.h
index bb2eb0b21..b3ee94a27 100644
--- a/src/World.h
+++ b/src/World.h
@@ -646,9 +646,9 @@ public:
// Various queues length queries (cannot be const, they lock their CS):
inline int GetGeneratorQueueLength (void) { return m_Generator.GetQueueLength(); } // tolua_export
- inline int GetLightingQueueLength (void) { return m_Lighting.GetQueueLength(); } // tolua_export
- inline int GetStorageLoadQueueLength(void) { return m_Storage.GetLoadQueueLength(); } // tolua_export
- inline int GetStorageSaveQueueLength(void) { return m_Storage.GetSaveQueueLength(); } // tolua_export
+ inline size_t GetLightingQueueLength (void) { return m_Lighting.GetQueueLength(); } // tolua_export
+ inline size_t GetStorageLoadQueueLength(void) { return m_Storage.GetLoadQueueLength(); } // tolua_export
+ inline size_t GetStorageSaveQueueLength(void) { return m_Storage.GetSaveQueueLength(); } // tolua_export
void InitializeSpawn(void);
diff --git a/src/WorldStorage/FastNBT.h b/src/WorldStorage/FastNBT.h
index 1b8b09c21..5e5af3ca3 100644
--- a/src/WorldStorage/FastNBT.h
+++ b/src/WorldStorage/FastNBT.h
@@ -122,33 +122,33 @@ public:
int GetRoot(void) const {return 0; }
/** Returns the first child of the specified tag, or -1 if none / not applicable. */
- int GetFirstChild (int a_Tag) const { return m_Tags[a_Tag].m_FirstChild; }
+ int GetFirstChild (int a_Tag) const { return m_Tags[(size_t)a_Tag].m_FirstChild; }
/** Returns the last child of the specified tag, or -1 if none / not applicable. */
- int GetLastChild (int a_Tag) const { return m_Tags[a_Tag].m_LastChild; }
+ int GetLastChild (int a_Tag) const { return m_Tags[(size_t)a_Tag].m_LastChild; }
/** Returns the next sibling of the specified tag, or -1 if none. */
- int GetNextSibling(int a_Tag) const { return m_Tags[a_Tag].m_NextSibling; }
+ int GetNextSibling(int a_Tag) const { return m_Tags[(size_t)a_Tag].m_NextSibling; }
/** Returns the previous sibling of the specified tag, or -1 if none. */
- int GetPrevSibling(int a_Tag) const { return m_Tags[a_Tag].m_PrevSibling; }
+ int GetPrevSibling(int a_Tag) const { return m_Tags[(size_t)a_Tag].m_PrevSibling; }
/** Returns the length of the tag's data, in bytes.
Not valid for Compound or List tags! */
int GetDataLength (int a_Tag) const
{
- ASSERT(m_Tags[a_Tag].m_Type != TAG_List);
- ASSERT(m_Tags[a_Tag].m_Type != TAG_Compound);
- return m_Tags[a_Tag].m_DataLength;
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_List);
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_Compound);
+ return m_Tags[(size_t)a_Tag].m_DataLength;
}
/** Returns the data stored in this tag.
Not valid for Compound or List tags! */
const char * GetData(int a_Tag) const
{
- ASSERT(m_Tags[a_Tag].m_Type != TAG_List);
- ASSERT(m_Tags[a_Tag].m_Type != TAG_Compound);
- return m_Data + m_Tags[a_Tag].m_DataStart;
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_List);
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type != TAG_Compound);
+ return m_Data + m_Tags[(size_t)a_Tag].m_DataStart;
}
/** Returns the direct child tag of the specified name, or -1 if no such tag. */
@@ -163,47 +163,47 @@ public:
/** Returns the child tag of the specified path (Name1\Name2\Name3...), or -1 if no such tag. */
int FindTagByPath(int a_Tag, const AString & a_Path) const;
- eTagType GetType(int a_Tag) const { return m_Tags[a_Tag].m_Type; }
+ eTagType GetType(int a_Tag) const { return m_Tags[(size_t)a_Tag].m_Type; }
/** Returns the children type for a List tag; undefined on other tags. If list empty, returns TAG_End. */
eTagType GetChildrenType(int a_Tag) const
{
- ASSERT(m_Tags[a_Tag].m_Type == TAG_List);
- return (m_Tags[a_Tag].m_FirstChild < 0) ? TAG_End : m_Tags[m_Tags[a_Tag].m_FirstChild].m_Type;
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_List);
+ return (m_Tags[(size_t)a_Tag].m_FirstChild < 0) ? TAG_End : m_Tags[(size_t)m_Tags[(size_t)a_Tag].m_FirstChild].m_Type;
}
/** Returns the value stored in a Byte tag. Not valid for any other tag type. */
inline unsigned char GetByte(int a_Tag) const
{
- ASSERT(m_Tags[a_Tag].m_Type == TAG_Byte);
- return (unsigned char)(m_Data[m_Tags[a_Tag].m_DataStart]);
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Byte);
+ return (unsigned char)(m_Data[(size_t)m_Tags[(size_t)a_Tag].m_DataStart]);
}
/** Returns the value stored in a Short tag. Not valid for any other tag type. */
inline Int16 GetShort(int a_Tag) const
{
- ASSERT(m_Tags[a_Tag].m_Type == TAG_Short);
- return GetBEShort(m_Data + m_Tags[a_Tag].m_DataStart);
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Short);
+ return GetBEShort(m_Data + m_Tags[(size_t)a_Tag].m_DataStart);
}
/** Returns the value stored in an Int tag. Not valid for any other tag type. */
inline Int32 GetInt(int a_Tag) const
{
- ASSERT(m_Tags[a_Tag].m_Type == TAG_Int);
- return GetBEInt(m_Data + m_Tags[a_Tag].m_DataStart);
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Int);
+ return GetBEInt(m_Data + m_Tags[(size_t)a_Tag].m_DataStart);
}
/** Returns the value stored in a Long tag. Not valid for any other tag type. */
inline Int64 GetLong(int a_Tag) const
{
- ASSERT(m_Tags[a_Tag].m_Type == TAG_Long);
- return NetworkToHostLong8(m_Data + m_Tags[a_Tag].m_DataStart);
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Long);
+ return NetworkToHostLong8(m_Data + m_Tags[(size_t)a_Tag].m_DataStart);
}
/** Returns the value stored in a Float tag. Not valid for any other tag type. */
inline float GetFloat(int a_Tag) const
{
- ASSERT(m_Tags[a_Tag].m_Type == TAG_Float);
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Float);
// Cause a compile-time error if sizeof(float) != 4
// If your platform produces a compiler error here, you'll need to add code that manually decodes 32-bit floats
@@ -212,7 +212,7 @@ public:
UNUSED(Check1);
UNUSED(Check2);
- Int32 i = GetBEInt(m_Data + m_Tags[a_Tag].m_DataStart);
+ Int32 i = GetBEInt(m_Data + m_Tags[(size_t)a_Tag].m_DataStart);
float f;
memcpy(&f, &i, sizeof(f));
return f;
@@ -228,16 +228,16 @@ public:
UNUSED(Check1);
UNUSED(Check2);
- ASSERT(m_Tags[a_Tag].m_Type == TAG_Double);
- return NetworkToHostDouble8(m_Data + m_Tags[a_Tag].m_DataStart);
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_Double);
+ return NetworkToHostDouble8(m_Data + m_Tags[(size_t)a_Tag].m_DataStart);
}
/** Returns the value stored in a String tag. Not valid for any other tag type. */
inline AString GetString(int a_Tag) const
{
- ASSERT(m_Tags[a_Tag].m_Type == TAG_String);
+ ASSERT(m_Tags[(size_t)a_Tag].m_Type == TAG_String);
AString res;
- res.assign(m_Data + m_Tags[a_Tag].m_DataStart, m_Tags[a_Tag].m_DataLength);
+ res.assign(m_Data + m_Tags[(size_t)a_Tag].m_DataStart, m_Tags[(size_t)a_Tag].m_DataLength);
return res;
}
@@ -245,7 +245,7 @@ public:
inline AString GetName(int a_Tag) const
{
AString res;
- res.assign(m_Data + m_Tags[a_Tag].m_NameStart, m_Tags[a_Tag].m_NameLength);
+ res.assign(m_Data + m_Tags[(size_t)a_Tag].m_NameStart, m_Tags[(size_t)a_Tag].m_NameLength);
return res;
}
diff --git a/src/WorldStorage/FireworksSerializer.h b/src/WorldStorage/FireworksSerializer.h
index 5b87bafdb..cbc544a14 100644
--- a/src/WorldStorage/FireworksSerializer.h
+++ b/src/WorldStorage/FireworksSerializer.h
@@ -89,4 +89,4 @@ public:
short m_FlightTimeInTicks;
std::vector<int> m_Colours;
std::vector<int> m_FadeColours;
-}; \ No newline at end of file
+};
diff --git a/src/WorldStorage/SchematicFileSerializer.cpp b/src/WorldStorage/SchematicFileSerializer.cpp
index d8531d965..9d594a084 100644
--- a/src/WorldStorage/SchematicFileSerializer.cpp
+++ b/src/WorldStorage/SchematicFileSerializer.cpp
@@ -14,6 +14,39 @@
+#ifdef SELF_TEST
+
+static class cSchematicStringSelfTest
+{
+public:
+ cSchematicStringSelfTest(void)
+ {
+ cBlockArea ba;
+ ba.Create(21, 256, 21);
+ ba.RelLine(0, 0, 0, 9, 8, 7, cBlockArea::baTypes | cBlockArea::baMetas, E_BLOCK_WOODEN_STAIRS, 1);
+ AString Schematic;
+ if (!cSchematicFileSerializer::SaveToSchematicString(ba, Schematic))
+ {
+ assert_test(!"Schematic failed to save!");
+ }
+ cBlockArea ba2;
+ if (!cSchematicFileSerializer::LoadFromSchematicString(ba2, Schematic))
+ {
+ assert_test(!"Schematic failed to load!");
+ }
+ }
+} g_SelfTest;
+
+#endif
+
+
+
+
+
+
+///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////
+// cSchematicFileSerializer:
+
bool cSchematicFileSerializer::LoadFromSchematicFile(cBlockArea & a_BlockArea, const AString & a_FileName)
{
// Un-GZip the contents: