summaryrefslogtreecommitdiffstats
path: root/src (follow)
Commit message (Expand)AuthorAgeFilesLines
* Merge pull request #12825 from liamwhite/whyliamwhite2024-01-281-1/+2
|\
| * kernel: clear pinned waiter list on unpinLiam2024-01-281-1/+2
* | Merge pull request #12823 from german77/set-audioliamwhite2024-01-289-61/+353
|\ \
| * | service: set: Increase settings versiongerman772024-01-281-2/+2
| * | service: set: Implement more Qlaunch Settingsgerman772024-01-289-59/+351
* | | Merge pull request #12802 from german77/mii_interfaceliamwhite2024-01-284-412/+171
|\ \ \
| * | | service: mii: Migrate service to new interfaceNarr the Reg2024-01-264-412/+171
* | | | android: Disable focus on loading cardt8952024-01-281-1/+3
| |_|/ |/| |
* | | android: Multi-program app switchingt8952024-01-288-34/+117
| |/ |/|
* | input: add a missing null pointer checkK9002024-01-271-1/+1
* | android: Reload global settings on closing emulationt8952024-01-271-0/+1
* | Merge pull request #12808 from t895/uri-momentliamwhite2024-01-261-0/+9
|\ \
| * | vfs: Fix getting URI filenamet8952024-01-261-0/+9
* | | Merge pull request #12769 from german77/no-logliamwhite2024-01-263-4/+26
|\ \ \ | |/ / |/| |
| * | core: hid: Skip duplicated vibrationsNarr the Reg2024-01-233-3/+21
| * | core: hid: Only set polling mode if neededNarr the Reg2024-01-231-1/+5
* | | Merge pull request #12809 from t895/error-messageliamwhite2024-01-261-1/+7
|\ \ \
| * | | android: Add cancel condition to installed content checkt8952024-01-261-1/+7
| | |/ | |/|
* | | Merge pull request #12765 from german77/sys-hidliamwhite2024-01-2616-88/+289
|\ \ \
| * | | service: set: Implement more settings functions for QlaunchNarr the Reg2024-01-2616-88/+289
* | | | Merge pull request #12801 from german77/vibration-fixliamwhite2024-01-263-0/+9
|\ \ \ \
| * | | | service: hid: Don't try to vibrate if device isn't initializedNarr the Reg2024-01-263-0/+9
| |/ / /
* | | | Merge pull request #12707 from FearlessTobi/fs-housekeepingliamwhite2024-01-26141-974/+3350
|\ \ \ \ | |_|/ / |/| | |
| * | | Address review comments and fix compilation problemsFearlessTobi2024-01-2516-269/+249
| * | | fs: Add path classFearlessTobi2024-01-2511-30/+2228
| * | | result: Make fully constexpr, add ON_RESULT_INCLUDEDFearlessTobi2024-01-259-29/+57
| * | | fs/errors: Unify naming of result codesFearlessTobi2024-01-257-42/+37
| * | | fs: Replace Mode enum by OpenMode enumFearlessTobi2024-01-2521-188/+195
| * | | vfs: Move vfs files to their own directoryFearlessTobi2024-01-25100-160/+183
| * | | fs: Move fsp_srv subclasses to separate filesFearlessTobi2024-01-2517-542/+687
| |/ /
* | | Merge pull request #12796 from t895/controller-optimizationsliamwhite2024-01-2625-24/+247
|\ \ \
| * | | android: Disable default focus highlight on views that shouldn't be selectedt8952024-01-2611-5/+19
| * | | android: Allow controller to focus on toolbar menu itemst8952024-01-2611-6/+28
| * | | android: Add 600dp layout for GameInfoFragmentt8952024-01-261-0/+155
| * | | android: Fix button click listener for build version namet8952024-01-261-1/+1
| * | | android: Disable focus for the root of cards that contain buttonst8952024-01-264-5/+5
| * | | android: Focus on the in game menu when openedt8952024-01-264-7/+39
| |/ /
* | | cmif_serialization: support non-domain sessions on domain serversLiam2024-01-261-33/+32
* | | cmif_types: improve ergonomics of typesLiam2024-01-264-38/+97
|/ /
* | Merge pull request #12759 from liamwhite/mp-miscliamwhite2024-01-254-4/+25
|\ \
| * | nvservices: close map handles on session closeLiam2024-01-233-0/+16
| * | kernel: target invalidate to given processLiam2024-01-231-4/+9
* | | Merge pull request #12777 from t895/firmware-warningliamwhite2024-01-2511-172/+145
|\ \ \
| * | | android: Add key checkt8952024-01-256-2/+67
| * | | android: Add option to make MessageDialogFragments non-dismissiblet8952024-01-251-8/+24
| * | | frontend_common: Consistently use referencest8952024-01-253-41/+41
| * | | frontend_common: Remove key rederivation and keep key checkt8952024-01-254-121/+13
* | | | Merge pull request #12783 from liamwhite/cmif-generationliamwhite2024-01-258-353/+729
|\ \ \ \
| * | | | service: add template serializer for method callsLiam2024-01-258-353/+729
* | | | | Merge pull request #12787 from t895/game-list-refreshliamwhite2024-01-253-9/+22
|\ \ \ \ \
| * | | | | android: Only compare game contents for GameAdaptert8952024-01-253-9/+22
* | | | | | Merge pull request #12786 from t895/driver-overlayliamwhite2024-01-254-15/+39
|\ \ \ \ \ \
| * | | | | | android: Fix waiting for driver install on startupt8952024-01-253-13/+24
| * | | | | | android: Add current driver vendor to FPS overlayt8952024-01-253-2/+15
| |/ / / / /
* | | | | | Merge pull request #12499 from Kelebek1/timeliamwhite2024-01-25141-3972/+7014
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Rework time service to fix time passing offline.Kelebek12024-01-24141-3972/+7014
* | | | | | Demote Mesa dozen to the bottom of the device listMatías Locatti2024-01-251-0/+10
| |/ / / / |/| | | |
* | | | | Merge pull request #12763 from liamwhite/fix-hbl-againliamwhite2024-01-231-0/+8
|\ \ \ \ \
| * | | | | loader: also register fs process for raw exefs partitionLiam2024-01-231-0/+8
| | |_|/ / | |/| | |
* | | | | Merge pull request #12768 from german77/wrong_conversionliamwhite2024-01-233-8/+8
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | service: properly convert buffers to stringsNarr the Reg2024-01-233-8/+8
| | |_|/ | |/| |
* / | | device_memory_manager: fix ScratchBuffer indexingLiam2024-01-221-3/+2
|/ / /
* | | Merge pull request #12579 from FernandoS27/smmuliamwhite2024-01-22121-1414/+2741
|\ \ \
| * | | device_memory_manager: use unique_lock for updateLiam2024-01-191-14/+8
| * | | nvhost_vic: use map erase by keyLiam2024-01-191-4/+1
| * | | nvdrv: clean up preallocationLiam2024-01-191-3/+5
| * | | nvdrv: use correct names for interface factoryLiam2024-01-191-3/+3
| * | | nvdrv: use static typing for SessionId, smmu Asid typesLiam2024-01-1933-87/+99
| * | | Core: Invert guest memory depandancyFernando Sahmkow2024-01-192-6/+7
| * | | Core: Make sure GPU Dirty Managers ae shared by all processes.Fernando Sahmkow2024-01-194-15/+19
| * | | Core: Eliminate core/memory dependancies.Fernando Sahmkow2024-01-1921-54/+46
| * | | SMMU: Fix Right Shift UB.Fernando Sahmkow2024-01-192-4/+4
| * | | SMMU: Fix 8Gb layout.Fernando Sahmkow2024-01-192-5/+8
| * | | Core: Clang format and other small issues.Fernando Sahmkow2024-01-1940-106/+152
| * | | SMMU: Fix software rendering and cleanupFernando Sahmkow2024-01-197-30/+24
| * | | SMMU: Add continuity tracking optimization.Fernando Sahmkow2024-01-194-13/+63
| * | | SMMU: Simplify and remove old code.Fernando Sahmkow2024-01-193-71/+13
| * | | SMMU: Add Android compatibilityFernando Sahmkow2024-01-199-50/+42
| * | | GPU-SMMU: Estimate game leak and preallocate device region.Fernando Sahmkow2024-01-199-27/+329
| * | | GPU SMMU: Expand to 34 bitsFernando Sahmkow2024-01-1912-29/+86
| * | | SMMU: Fix Unregister on MultiAddressFernando Sahmkow2024-01-191-1/+1
| * | | SMMU: Implement physical memory mirroringFernando Sahmkow2024-01-198-40/+226
| * | | SMMU: Initial adaptation to video_core.Fernando Sahmkow2024-01-1979-1263/+1262
| * | | SMMU: Implement backing CPU page protect/unprotectFernando Sahmkow2024-01-194-6/+141
| * | | NVDRV: Implement sessions and initial implementation of SMMUFernando Sahmkow2024-01-1937-100/+260
| * | | Core: Initial implementation of device memory mappingFernando Sahmkow2024-01-196-0/+459
* | | | android: Add to launcher buttont8952024-01-227-52/+116
| |_|/ |/| |
* | | Merge pull request #12739 from t895/debug-keystoreCharles Lombardo2024-01-222-4/+11
|\ \ \
| * | | android: Provide debug.keystore for debug and relWithDebInfo buildst8952024-01-222-4/+11
* | | | Merge pull request #12738 from t895/lock-drawerCharles Lombardo2024-01-226-4/+70
|\ \ \ \
| * | | | android: Port "Lock drawer" feature from Citrat8952024-01-226-4/+70
| |/ / /
* | | | Merge pull request #12736 from t895/verify-contentsCharles Lombardo2024-01-2210-127/+335
|\ \ \ \ | |/ / / |/| | |
| * | | frontend_common: Remove default value for installer callbackst8952024-01-221-13/+13
| * | | android: Add options to verify installed contentt8952024-01-228-4/+165
| * | | frontend_common: Move integrity verification to content_managert8952024-01-212-114/+161
* | | | Merge pull request #12734 from german77/enable-appletliamwhite2024-01-223-2/+17
|\ \ \ \
| * | | | service: hid: Implement EnableAppletForInputNarr the Reg2024-01-213-2/+17
* | | | | Merge pull request #12735 from german77/disable-vibrationliamwhite2024-01-221-2/+7
|\ \ \ \ \
| * | | | | core: hid: Allow to disable vibrationNarr the Reg2024-01-211-2/+7
| |/ / / /
* | | | | Merge pull request #12733 from german77/settings_servicesCharles Lombardo2024-01-211-0/+5
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service: set: Don't allow invalid mii author idgerman772024-01-211-0/+5
| |/ / /
* / / / android: Sync translationst8952024-01-2120-338/+2062
|/ / /
* | | android: Change "Clear" to "Use global setting" for per-game settingst8952024-01-205-10/+8
* | | Merge pull request #12688 from liamwhite/wl-present-fixliamwhite2024-01-201-1/+1
|\ \ \
| * | | renderer_vulkan: recreate swapchain when frame size changesLiam2024-01-161-1/+1
* | | | Merge pull request #12724 from merryhime/fs-u8str-overloadsliamwhite2024-01-201-1/+1
|\ \ \ \
| * | | | fs/file: Explicitly convert std::u8string to std::filesystem::pathMerry2024-01-201-1/+1
* | | | | Merge pull request #12721 from t895/card-elevationliamwhite2024-01-201-3/+3
|\ \ \ \ \
| * | | | | android: Use elevated card style for home setting cardt8952024-01-201-3/+3
| |/ / / /
* | | | | Merge pull request #12719 from t895/sort-searchliamwhite2024-01-201-2/+2
|\ \ \ \ \
| * | | | | android: Sort recently added/played games by timet8952024-01-201-2/+2
| |/ / / /
* | | | | Merge pull request #12715 from t895/remove-addonsliamwhite2024-01-2033-424/+912
|\ \ \ \ \
| * | | | | frontend_common: Add documentation for content_manangert8952024-01-201-0/+53
| * | | | | android: Add addon delete buttont8952024-01-2017-82/+305
| * | | | | android: Use callback to update progress bar dialogst8952024-01-1910-121/+236
| * | | | | frontend_common: Add content manager utility functionst8952024-01-1912-221/+318
| |/ / / /
* | | | | Merge pull request #12660 from german77/better-vibrationliamwhite2024-01-2031-448/+905
|\ \ \ \ \
| * | | | | service: hid: Fully implement abstract vibrationNarr the Reg2024-01-1631-448/+905
| | |/ / / | |/| | |
* | | | | Merge pull request #12701 from liamwhite/flinger-layer-issuesliamwhite2024-01-206-15/+42
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | vi: check layer state before opening or closingLiam2024-01-184-12/+27
| * | | | nvnflinger: ensure display abandonment considers all layers and future layersLiam2024-01-183-3/+15
* | | | | Bump MoltenVK to v1.2.7shinra-electric2024-01-191-1/+1
* | | | | Merge pull request #12687 from german77/amiibo-lockliamwhite2024-01-191-0/+1
|\ \ \ \ \
| * | | | | core: hid: Disable special features before disconnecting the controllersNarr the Reg2024-01-161-0/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #12695 from anpilley/user-arguments-v2liamwhite2024-01-194-4/+40
|\ \ \ \ \
| * | | | | Update based on feedbackAndrew Pilley2024-01-181-2/+2
| * | | | | Allow -u to accept a username string in addition to index, and suppress the User selector even if settings requires it to be shown for one instance only.Andrew Pilley2024-01-174-4/+40
| | |/ / / | |/| | |
* | | | | Merge pull request #12709 from german77/npad-discliamwhite2024-01-191-0/+7
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | service: hid: Clear controller status when aruid is no longer usedNarr the Reg2024-01-191-0/+7
| |/ / /
* | | | Merge pull request #12678 from german77/settings_implliamwhite2024-01-1917-651/+850
|\ \ \ \
| * | | | service: set: Implement stubbed functionsNarr the Reg2024-01-168-64/+232
| * | | | service: set: Refractor setting serviceNarr the Reg2024-01-1614-588/+619
| | |/ / | |/| |
* | | | Merge pull request #12683 from german77/amiibo-dumpliamwhite2024-01-191-1/+4
|\ \ \ \
| * | | | service: nfc: Create backup when none existNarr the Reg2024-01-151-1/+4
* | | | | Merge pull request #12644 from liamwhite/vkspec-image-offsetliamwhite2024-01-192-23/+55
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | shader_recompiler: fix Offset operand usage for non-OpImage*GatherLiam2024-01-112-23/+55
* | | | | Merge pull request #12702 from german77/android-inputCharles Lombardo2024-01-186-0/+136
|\ \ \ \ \
| * | | | | input_common: Add android input engineNarr the Reg2024-01-186-0/+136
| | |_|_|/ | |/| | |
* / | | | android: Save overlay data while using emulation fragmentt8952024-01-182-7/+4
|/ / / /
* | | | Merge pull request #12380 from flodavid/save-profileNarr the Reg2024-01-177-12/+55
|\ \ \ \ | |_|_|/ |/| | |
| * | | Save profile name usedflodavid2024-01-087-12/+55
* | | | Fix typos in masterViktor Szépe2024-01-162-5/+5
* | | | Merge remote-tracking branch 'origin/master' into typos3Viktor Szépe2024-01-16135-1286/+4999
|\ \ \ \ | | |_|/ | |/| |
| * | | Merge pull request #12681 from t895/stick-togglesliamwhite2024-01-151-2/+2
| |\ \ \
| | * | | android: Fix overlay toggle orderingt8952024-01-151-2/+2
| * | | | Merge pull request #12677 from GPUCode/whyy-moddersliamwhite2024-01-156-79/+154
| |\ \ \ \
| | * | | | core: Support multiple modules per patcherGPUCode2024-01-146-79/+154
| | |/ / /
| * | | | Merge pull request #12665 from german77/proofliamwhite2024-01-153-3/+21
| |\ \ \ \
| | * | | | service: acc: Only save profiles when profiles have changedgerman772024-01-133-3/+21
| | | |_|/ | | |/| |
| * | | | Merge pull request #12659 from liamwhite/audio-memoryCharles Lombardo2024-01-158-35/+85
| |\ \ \ \
| | * | | | audio: fetch process object from handle tableLiam2024-01-128-35/+85
| | |/ / /
| * | | | Merge pull request #12652 from liamwhite/huge-pile-of-spirv-spaghettiCharles Lombardo2024-01-153-8/+86
| |\ \ \ \
| | * | | | shader_recompiler: emulate 8-bit and 16-bit storage writes with cas loopLiam2024-01-113-8/+86
| | |/ / /
| * | | | Merge pull request #12612 from liamwhite/fs-pidCharles Lombardo2024-01-1520-274/+364
| |\ \ \ \
| | * | | | loader: fix homebrew nro registrationLiam2024-01-131-6/+6
| | * | | | fsp-srv: use program registry for SetCurrentProcessLiam2024-01-1120-272/+362
| | | |_|/ | | |/| |
| * | | | Merge pull request #12611 from liamwhite/resource-management-is-hardCharles Lombardo2024-01-1515-138/+212
| |\ \ \ \
| | * | | | kernel: optimize page free on shutdownLiam2024-01-133-63/+18
| | * | | | kernel: fix debugger and process list lifetimeLiam2024-01-139-107/+160
| | * | | | kernel: fix page leak on process terminationLiam2024-01-134-25/+91
| * | | | | Merge pull request #12610 from liamwhite/reply-and-dont-receiveCharles Lombardo2024-01-151-2/+7
| |\ \ \ \ \ | | |_|_|_|/ | |/| | | |
| | * | | | server_manager: respond to session close correctlyLiam2024-01-081-2/+7
| | | |/ / | | |/| |
| * | | | Merge pull request #12667 from t895/version-infoliamwhite2024-01-144-62/+24
| |\ \ \ \
| | * | | | android: Show version name instead of git hash in the about fragmentt8952024-01-143-6/+6
| | * | | | android: Clean up git commands in build.gradlet8952024-01-141-56/+18
| | | |/ / | | |/| |
| * / | | android: Move ktlintCheck to yuzu-verifyt8952024-01-131-1/+8
| |/ / /
| * | | Merge pull request #12605 from german77/abstractliamwhite2024-01-1251-43/+3333
| |\ \ \
| | * | | service: hid: Create abstracted pad structuregerman772024-01-1251-43/+3333
| | | |/ | | |/|
| * | | android: Fix added driver patht8952024-01-111-1/+1
| * | | android: Add button to use global driver valuet8952024-01-114-2/+65
| * | | android: Reload driver data on importing user datat8952024-01-111-0/+3
| * | | android: Rework driver fragmentt8952024-01-114-110/+84
| * | | android: Refactor DriverAdapter to use AbstractSingleSelectionListt8952024-01-111-73/+23
| * | | android: Create generic single selection list adaptert8952024-01-112-0/+114
| * | | android: Refactor recycler view adapters to use AbstractListAdaptert8952024-01-117-236/+140
| * | | android: Create generic list adapter for basic listst8952024-01-111-0/+98
| * | | android: Refactor async diff adapters to use AbstractDiffAdaptert8952024-01-113-172/+92
| * | | android: Create generic adapter and viewholdert8952024-01-112-0/+51
| |/ /
| * | Merge pull request #12609 from liamwhite/wrong-name-againNarr the Reg2024-01-095-51/+38
| |\ \
| | * | vi: connect vsync event handle lifetime to application display service interfaceLiam2024-01-084-24/+11
| | * | vi: fix name of nvnflingerLiam2024-01-082-27/+27
| | |/
* | | Fix typos in arrays.xmlViktor Szépe2024-01-161-1/+1
* | | Fix one more typoViktor Szépe2024-01-161-1/+1
* | | Fix more typosViktor Szépe2024-01-1636-86/+86
|/ /
* / Fix typos in src/core (#12625)Viktor Szépe2024-01-0828-116/+116
|/
* Merge pull request #12608 from szepeviktor/typosliamwhite2024-01-0820-56/+56
|\
| * Fix "Propietary" typo elsewhereViktor Szépe2024-01-082-4/+4
| * Fix typos in video_coreViktor Szépe2024-01-0718-52/+52
* | Merge pull request #12606 from german77/npad_closeliamwhite2024-01-081-0/+1
|\ \
| * | service: hid: Delete shared memory handle when unusedgerman772024-01-071-0/+1
| |/
* | Merge pull request #12600 from german77/npad-implliamwhite2024-01-085-21/+129
|\ \
| * | service: hid: Implement GetLastActiveNpadgerman772024-01-073-3/+14
| * | service: hid: Implement AssigningSingleOnSlSrPressgerman772024-01-073-2/+24
| * | service: hid: Implement SetNpadSystemExtStateEnabledgerman772024-01-075-8/+34
| * | service: hid: Implement CaptureButtonAssignmentgerman772024-01-075-8/+57
* | | Merge pull request #12599 from german77/settingsliamwhite2024-01-0814-380/+394
|\ \ \ | |_|/ |/| |
| * | service: set: Rename filesgerman772024-01-0714-21/+21
| * | service: set: Use official namesgerman772024-01-079-359/+373
* | | Merge pull request #12560 from GayPotatoEmma/masterCharles Lombardo2024-01-072-0/+10
|\ \ \
| * | | android: add basic support for google game dashboardEmma2024-01-042-0/+10
* | | | Merge pull request #12601 from german77/rocketliamwhite2024-01-071-0/+5
|\ \ \ \
| * | | | service: hid: Make sure there's an active aruid handlegerman772024-01-071-0/+5
| | |_|/ | |/| |
* | | | Merge pull request #12576 from t895/total-save-managerliamwhite2024-01-076-0/+264
|\ \ \ \ | |/ / / |/| | |
| * | | android: Re-add global save managert8952024-01-046-0/+264
| |/ /
* | | Merge pull request #12596 from german77/hid_qlaunchliamwhite2024-01-072-6/+60
|\ \ \
| * | | service: hid: Add functions needed by QlaunchNarr the Reg2024-01-062-6/+60
| | |/ | |/|
* / | service: hid: Handle pending deleteNarr the Reg2024-01-063-21/+18
|/ /
* | hid_core: Move hid to it's own subprojectNarr the Reg2024-01-05141-438/+481
* | Merge pull request #12437 from ameerj/gl-amd-fixesliamwhite2024-01-045-14/+15
|\ \
| * | Settings: Indicate AMD's compatibility with SPIR-V on OGLAmeer J2023-12-221-1/+1
| * | spirv_emit_context: Fix BaseInstance for OGL spirvAmeer J2023-12-221-1/+1
| * | emit_glsl_image: Use inlined texelFetch offsetsAmeer J2023-12-212-7/+7
| * | gl_device: Remove AMD blacklists that are no longer applicableAmeer J2023-12-211-5/+6
* | | Merge pull request #12575 from t895/inconsistent-settings-applicationliamwhite2024-01-044-11/+6
|\ \ \
| * | | android: Save global config synchronously in onCloseGameFoldersFragmentt8952024-01-041-2/+3
| * | | frontend_common: config: Only write setting related to opened config filet8952024-01-041-2/+3
| * | | android: Don't save settings on config destructiont8952024-01-042-7/+0
| | |/ | |/|
* | | Merge pull request #12571 from t895/apply-orientation-on-startliamwhite2024-01-044-14/+49
|\ \ \
| * | | android: Update orientation on emulation fragment startt8952024-01-041-0/+1
| * | | android: Expose all orientation locking optionst8952024-01-044-14/+48
| |/ /
* | | Merge pull request #12570 from t895/generic-config-painliamwhite2024-01-042-16/+11
|\ \ \
| * | | frontend_common: config: Move WriteIntegerSetting definition to headert8952024-01-032-16/+11
| |/ /
* | | Merge pull request #12558 from t895/zip-storage-methodliamwhite2024-01-043-3/+15
|\ \ \
| * | | android: Add internal option to disable compression for zip exportst8952024-01-033-3/+15
| |/ /
* | | Merge pull request #12557 from merryhime/termination-ipiliamwhite2024-01-041-4/+4
|\ \ \
| * | | KThread: Send termination interrupt to all cores a thread has affinity toMerry2024-01-021-4/+4
| |/ /
* | | service: hid: Remove data races when handling shared memoryNarr the Reg2024-01-0417-29/+45
* | | service: hid: Implement NpadResource and NpadDataNarr the Reg2024-01-0419-676/+1930
|/ /
* | Merge pull request #12554 from german77/directconnectliamwhite2024-01-021-1/+1
|\ \
| * | yuzu: Use displayed port on direct connectNarr the Reg2024-01-021-1/+1
* | | Merge pull request #12551 from t895/dpad-save-fixliamwhite2024-01-021-2/+1
|\ \ \
| * | | android: Fix dpad position savingt8952024-01-021-2/+1
| |/ /
* / / android: Use case-insensitive check for addon directoryt8952024-01-021-1/+1
|/ /
* | Merge pull request #12543 from FernandoS27/stop-liking-posts-from-ur-friends-exliamwhite2024-01-013-4/+5
|\ \
| * | Vulkan: Only recreate swapchain if the frame is bigger than the swap image.Fernando Sahmkow2023-12-312-2/+3
| * | MaxwellDMA: Don't flush the outputs of a dma copy.Fernando Sahmkow2023-12-312-3/+3
* | | Merge pull request #12536 from german77/npad_interfaceliamwhite2024-01-0137-230/+711
|\ \ \
| * | | service: hid: Use applet resource to get latest shared memory handleNarr the Reg2023-12-3137-230/+711
* | | | Merge pull request #12518 from t895/theme-settingsliamwhite2024-01-0138-1044/+1545
|\ \ \ \
| * | | | android: Expose touchscreen togglet8952023-12-303-0/+13
| * | | | android: Don't apply material you below android 12t8952023-12-301-1/+8
| * | | | frontend_common: config: Do not count "." as a special charactert8952023-12-301-3/+2
| * | | | android: Migrate in-game overlay settings to init8952023-12-3027-847/+1209
| * | | | frontend_common: config: Refactor WriteSetting to stricter typest8952023-12-305-134/+188
| * | | | android: Migrate theme settings to init8952023-12-308-61/+127
| * | | | android: Update Kotlin version to 1.9.20t8952023-12-302-2/+2
| |/ / /
* | | | Merge pull request #12454 from liamwhite/ct-stuffNarr the Reg2024-01-0115-110/+101
|\ \ \ \
| * | | | core_timing: block advance thread while clearing and signal afterLiam2023-12-231-1/+2
| * | | | core_timing: handle concurrent unscheduling of looping eventsLiam2023-12-232-4/+15
| * | | | core_timing: use static typing for no-wait unscheduleLiam2023-12-233-8/+12
| * | | | core_timing: remove user data valueLiam2023-12-2315-104/+79
* | | | | Merge pull request #12466 from liamwhite/sh2Narr the Reg2024-01-0116-93/+616
|\ \ \ \ \
| * | | | | heap_tracker: use linear-time mapping evictionLiam2023-12-272-9/+28
| * | | | | core: track separate heap allocation for linuxLiam2023-12-2616-93/+597
* | | | | | Merge pull request #12501 from liamwhite/ipsNarr the Reg2024-01-011-0/+7
|\ \ \ \ \ \
| * | | | | | ips_layer: prevent out of bounds access with offset exceeding module sizeLiam2023-12-281-0/+7
* | | | | | | Merge pull request #12513 from liamwhite/jit-fixNarr the Reg2024-01-014-18/+146
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | jit: use code memory handles correctlyLiam2023-12-294-18/+146
| |/ / / / /
* | | | | | Merge pull request #12509 from liamwhite/ktraceliamwhite2023-12-301-2/+4
|\ \ \ \ \ \
| * | | | | | k_capabilities: simplify KTrace map skip logicLiam2023-12-281-2/+4
| |/ / / / /
* | | | | | Merge pull request #12527 from DCNick3/log-more-sdl-errorsliamwhite2023-12-302-2/+3
|\ \ \ \ \ \
| * | | | | | yuzu_cmd: Report more SDL errorsNikita Strygin2023-12-302-2/+3
| |/ / / / /
* | | | | | Merge pull request #12521 from ReillyBrogan/fix-wayland-appidliamwhite2023-12-301-0/+4
|\ \ \ \ \ \
| * | | | | | Fix Wayland appIdReilly Brogan2023-12-301-0/+4
| |/ / / / /
* | | | | | Merge pull request #12520 from t895/settings-tomfooleryliamwhite2023-12-306-2/+39
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | android: Expose anisotropic filtering settingt8952023-12-295-1/+37
| * | | | | android: Center switch setting title when no description is presentt8952023-12-291-1/+1
| * | | | | android: Pair fastmem toggle to CPU Debug togglet8952023-12-291-0/+1
| |/ / / /
* | | | | Merge pull request #12479 from GPUCode/linear-bcnFernando S2023-12-303-33/+35
|\ \ \ \ \
| * | | | | video_core: Fix buffer_row_length computation for linear compressed texturesGPUCode2023-12-263-33/+35
| | |/ / / | |/| | |
* | | | | shader_recompiler: use default value for clip distances arrayLiam2023-12-271-7/+13
* | | | | shader_recompiler: respect clip distance limits in indexed storeLiam2023-12-271-18/+28
| |/ / / |/| | |
* | | | Merge pull request #12455 from liamwhite/end-waitliamwhite2023-12-263-31/+10
|\ \ \ \
| * | | | kernel: use simple mutex for object list containerLiam2023-12-233-31/+10
| | |/ / | |/| |
* | | | Merge pull request #12465 from liamwhite/proper-handle-tableliamwhite2023-12-2614-77/+55
|\ \ \ \
| * | | | am/jit: reference memory instance from contextLiam2023-12-253-5/+7
| * | | | kernel: remove unecessary process member from handle tableLiam2023-12-252-6/+3
| * | | | service: fetch objects from the client handle tableLiam2023-12-2512-66/+45
| | |/ / | |/| |
* | | | Merge pull request #12471 from FearlessTobi/port-7146liamwhite2023-12-263-0/+23
|\ \ \ \
| * | | | assert/logging: Stop the logging thread and flush the backends before crashingFearlessTobi2023-12-263-0/+23
| |/ / /
* | | | Merge pull request #12472 from FearlessTobi/port-7239liamwhite2023-12-262-9/+1
|\ \ \ \
| * | | | ring_buffer: Use feature macroFearlessTobi2023-12-251-1/+1
| * | | | main: Remove unused enumFearlessTobi2023-12-251-8/+0
| |/ / /
* | | | Merge pull request #12449 from liamwhite/debug-utilsliamwhite2023-12-261-1/+3
|\ \ \ \
| * | | | renderer_vulkan: skip SetObjectNameEXT on unsupported driverLiam2023-12-231-1/+3
| | |/ / | |/| |
* | | | Merge pull request #12448 from liamwhite/format-assertliamwhite2023-12-261-8/+8
|\ \ \ \
| * | | | renderer_vulkan: demote format assert to error logLiam2023-12-231-8/+8
| |/ / /
* | | | Merge pull request #12415 from ameerj/ogl-draw-autoliamwhite2023-12-268-2/+90
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_rasterizer: Implement DrawTransformFeedback macroAmeer J2023-12-208-2/+90
| | |/ | |/|
* | | kernel: fix resource limit imbalanceLiam2023-12-233-8/+7
* | | kernel: restrict nce to applicationsLiam2023-12-233-6/+6
* | | general: properly support multiple memory instancesLiam2023-12-2317-102/+102
* | | k_server_session: remove scratch buffer usage in favor of direct copyLiam2023-12-231-39/+124
* | | k_server_session: process for guest serversLiam2023-12-236-250/+1135
* | | kernel: instantiate memory separately for each guest processLiam2023-12-2317-127/+82
| |/ |/|
* | Merge pull request #12412 from ameerj/gl-query-primsliamwhite2023-12-226-45/+91
|\ \
| * | gl_rasterizer: Less spammy log for unimplemented resetsAmeer J2023-12-201-1/+1
| * | OpenGL: Add GL_PRIMITIVES_GENERATED and GL_TRANSFORM_FEEDBACK_PRIMITIVES_WRITTEN queriesAmeer J2023-12-196-49/+93
* | | Merge pull request #12435 from liamwhite/type-checkFernando S2023-12-221-1/+11
|\ \ \
| * | | shader_recompiler: ensure derivatives for textureGrad are f32Liam2023-12-221-1/+11
* | | | Merge pull request #12410 from liamwhite/more-mali-nullFernando S2023-12-222-8/+26
|\ \ \ \
| * | | | renderer_vulkan: don't pass null view when nullDescriptor is not supportedLiam2023-12-192-8/+26
* | | | | shader_recompiler: use float image operations on load/store when requiredLiam2023-12-2110-39/+184
| |/ / / |/| | |
* | | | Merge pull request #12424 from t895/vsync-per-game-qtliamwhite2023-12-212-30/+68
|\ \ \ \
| * | | | qt: settings: Fix per-game vsync comboboxt8952023-12-212-30/+68
| |/ / /
* | | | Merge pull request #12425 from german77/temp-fixliamwhite2023-12-211-1/+1
|\ \ \ \
| * | | | service: hid: Fix crash on InitializeVibrationDeviceNarr the Reg2023-12-211-1/+1
* | | | | android: Fix "No games found" text appearing on loadt8952023-12-211-6/+8
|/ / / /
* | | | Merge pull request #12414 from jbeich/vk274liamwhite2023-12-201-0/+2
|\ \ \ \
| * | | | vulkan_common: unbreak build with Vulkan-Headers 1.3.274Jan Beich2023-12-201-0/+2
| |/ / /
* | | | Merge pull request #12400 from ameerj/vk-query-prefix-fixliamwhite2023-12-201-3/+6
|\ \ \ \
| * | | | vk_query_cache: Fix prefix sum max_accumulation_limit logicAmeer J2023-12-181-3/+6
* | | | | Merge pull request #12417 from liamwhite/arm64-gcc-fixFernando S2023-12-202-2/+6
|\ \ \ \ \
| * | | | | nce: hide shadowing warnings from dynarmic headersLiam2023-12-202-2/+6
| | |_|_|/ | |/| | |
* | | | | Merge pull request #12409 from liamwhite/bits-and-bytesFernando S2023-12-202-2/+3
|\ \ \ \ \
| * | | | | nce: increase handler stack sizeLiam2023-12-191-1/+1
| * | | | | nce: fix read size in simd immediate emulationLiam2023-12-191-1/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #12403 from liamwhite/clipdistanceFernando S2023-12-208-2/+22
|\ \ \ \ \
| * | | | | shader_recompiler: use minimal clip distance arrayLiam2023-12-193-2/+9
| * | | | | shader_recompiler: ignore clip distances beyond driver support levelLiam2023-12-196-1/+14
* | | | | | Merge pull request #12390 from liamwhite/binding-insanityFernando S2023-12-202-13/+23
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | renderer_vulkan: work around turnip binding bug in a610Liam2023-12-172-13/+23
* | | | | | Merge pull request #12411 from ameerj/gl-nv-tfb-fixupsliamwhite2023-12-206-14/+68
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | gl_rasterizer: Silence spammy logsAmeer J2023-12-191-6/+8
| * | | | | gl_buffer_cache: Reintroduce NV_vertex_buffer_unified_memoryAmeer J2023-12-195-8/+60
| | |_|/ / | |/| | |
* | | | | Merge pull request #12408 from german77/langCharles Lombardo2023-12-191-0/+4
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | yuzu: Read/Save category PathsNarr the Reg2023-12-191-0/+4
* | | | | Merge pull request #12382 from liamwhite/image-limitFernando S2023-12-194-6/+6
|\ \ \ \ \
| * | | | | renderer_vulkan: allow up to 7 swapchain imagesLiam2023-12-174-6/+6
| | |/ / / | |/| | |
* | | | | Merge pull request #12387 from liamwhite/oboeFernando S2023-12-197-4/+328
|\ \ \ \ \
| * | | | | oboe_sink: specify additional required parametersLiam2023-12-181-13/+27
| * | | | | oboe_sink: set low latency performance modeLiam2023-12-181-0/+2
| * | | | | android: add oboe to audio configurationLiam2023-12-172-0/+3
| * | | | | oboe_sink: implement channel count queryingLiam2023-12-171-12/+35
| * | | | | android: add oboe audio sinkLiam2023-12-175-4/+286
| |/ / / /
* | | | | Merge pull request #12392 from liamwhite/modeFernando S2023-12-192-8/+17
|\ \ \ \ \
| * | | | | fs: implement OpenDirectoryModeLiam2023-12-182-8/+17
* | | | | | Merge pull request #12391 from yuzu-emu/revert-12344-its-free-real-estateFernando S2023-12-197-73/+79
|\ \ \ \ \ \
| * | | | | | Revert "video_core: use interval map for page count tracking"liamwhite2023-12-187-73/+79
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #12304 from liamwhite/flinger-wtfFernando S2023-12-193-3/+37
|\ \ \ \ \ \
| * | | | | | nvnflinger: mark buffer as acquired when acquiredLiam2023-12-163-3/+37
* | | | | | | Merge pull request #12402 from german77/langliamwhite2023-12-194-12/+6
|\ \ \ \ \ \ \ | | |_|_|/ / / | |/| | | / / | |_|_|_|/ / |/| | | | |
| * | | | | yuzu: Make language persistent and remove symbols_pathNarr the Reg2023-12-194-12/+6
| |/ / / /
* | | | | Merge pull request #12349 from Kelebek1/return_system_channels_activeliamwhite2023-12-185-20/+41
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | audio: skip coefficient normalization for downmixLiam2023-12-161-4/+2
| * | | | Have GetActiveChannelCount return the system channels instead of host device channelsKelebek12023-12-165-20/+43
| | |_|/ | |/| |
* | | | path_util: copy output for GetParentPathLiam2023-12-172-4/+4
| |_|/ |/| |
* | | Merge pull request #12378 from liamwhite/offsetofliamwhite2023-12-162-0/+2
|\ \ \
| * | | set: add cstddef for offsetof macroLiam2023-12-162-0/+2
| |/ /
* | | Merge pull request #12377 from ameerj/tfb-batch-oopsieliamwhite2023-12-161-1/+1
|\ \ \
| * | | gl_buffer_cache: Fix tfb binding typoAmeer J2023-12-161-1/+1
| |/ /
* | | Merge pull request #12345 from liamwhite/a-flock-of-seagullsliamwhite2023-12-162-3/+12
|\ \ \
| * | | renderer_vulkan: bound async presentation queue growthLiam2023-12-142-3/+12
| | |/ | |/|
* | | Merge pull request #12335 from t895/per-game-settingsliamwhite2023-12-16108-872/+3511
|\ \ \
| * | | android: Rework InstallableProperty view with icont8952023-12-126-11/+191
| * | | android: Prevent editing non-savable settings in per-game settingst8952023-12-124-0/+23
| * | | android: Pre-select custom config in game launch dialogt8952023-12-121-2/+2
| * | | android: Use confirmation dialog when deleting shader cachet8952023-12-123-15/+45
| * | | android: Always use custom settings when launched from intentt8952023-12-121-2/+3
| * | | settings: Allow vsync to be changed per-gamet8952023-12-121-1/+1
| * | | android: Adjust variable name format for native configt8952023-12-121-6/+6
| * | | android: Add game dir entries to FilesystemProvidert8952023-12-126-9/+80
| * | | android: Fix games list loading thread safetyt8952023-12-121-36/+38
| * | | android: Collect latest information for games listt8952023-12-122-2/+3
| * | | android: Remove global save import/exporter UIt8952023-12-121-24/+0
| * | | android: Compare all properties between games in DiffCallbackt8952023-12-122-1/+2
| * | | android: Expose MemoryUtil size formatting functiont8952023-12-122-2/+3
| * | | android: Add JNI initialization information for Game classt8952023-12-122-0/+64
| * | | settings: Allow CPU Debug and Fastmem to be changed per-gamet8952023-12-121-4/+4
| * | | android: Add per-game driverst8952023-12-1214-95/+218
| * | | android: Add per-game settingst8952023-12-1227-83/+303
| * | | android: Add Game propertiest8952023-12-1240-253/+2227
| * | | frontend_common: Fix settings reload bugt8952023-12-121-0/+1
| * | | android: Refactor settings to expose more optionst8952023-12-1234-353/+324
| |/ /
* | | Merge pull request #12331 from liamwhite/layer-confusionliamwhite2023-12-168-42/+74
|\ \ \ | |_|/ |/| |
| * | vi: fix confusion between closing and destroying layersLiam2023-12-128-42/+74
* | | Merge pull request #12184 from Kelebek1/system_settingsliamwhite2023-12-1613-406/+1617
|\ \ \
| * | | Make system settings persistent across bootsKelebek12023-12-1613-406/+1617
| | |/ | |/|
* | | Merge pull request #12237 from liamwhite/nce-sigtrapliamwhite2023-12-169-45/+3854
|\ \ \
| * | | nce: adjust initialization for repeated callsLiam2023-12-121-8/+11
| * | | nce: implement instruction emulation for misaligned memory accessesLiam2023-12-119-44/+3850
* | | | Merge pull request #12290 from liamwhite/deferred-path-splitliamwhite2023-12-165-28/+38
|\ \ \ \
| * | | | Improve path splitting speedBreadFish642023-12-065-28/+38
* | | | | Merge pull request #12344 from liamwhite/its-free-real-estateliamwhite2023-12-167-79/+73
|\ \ \ \ \
| * | | | | video_core: lock interval map updateLiam2023-12-152-0/+4
| * | | | | video_core: use interval map for page count trackingLiam2023-12-157-79/+69
| | |_|/ / | |/| | |
* | | | | Merge pull request #12358 from liamwhite/optimized-allocliamwhite2023-12-164-17/+42
|\ \ \ \ \
| * | | | | common: use memory holepunching when clearing memoryLiam2023-12-154-17/+42
| |/ / / /
* | | | | Merge pull request #12359 from german77/real_sharedliamwhite2023-12-1642-870/+1076
|\ \ \ \ \
| * | | | | core: Make sure npad is initializedNarr the Reg2023-12-152-1/+4
| * | | | | core: hid: Clean up headersNarr the Reg2023-12-1420-36/+16
| * | | | | service: hid: Allow to create multiple instances of shared memoryNarr the Reg2023-12-1440-842/+1065
| |/ / / /
* / / / / ssl: fix output byte buffer size issue (#12372)liamwhite2023-12-161-3/+3
|/ / / /
* | | | configure_debug: Fix small typoFearlessTobi2023-12-121-1/+1
* | | | Merge pull request #12328 from german77/profile_managerliamwhite2023-12-1213-73/+94
|\ \ \ \
| * | | | core: Use single instance of profile managergerman772023-12-1013-73/+94
| | |_|/ | |/| |
* | | | Merge pull request #12333 from german77/aruid_freeliamwhite2023-12-126-13/+149
|\ \ \ \ | |_|_|/ |/| | |
| * | | service: hid: Improve CreateAppletResource implementation and free resourcesgerman772023-12-106-13/+149
| |/ /
* | | Merge pull request #12322 from liamwhite/savedata-absurdityliamwhite2023-12-113-5/+13
|\ \ \
| * | | fs: don't enumerate hidden savedata size fileLiam2023-12-093-5/+13
* | | | Merge pull request #12327 from liamwhite/tipcliamwhite2023-12-112-7/+25
|\ \ \ \
| * | | | sm:: fix tipc deserializationLiam2023-12-102-7/+25
| | |/ / | |/| |
* | | | Merge pull request #12317 from liamwhite/sc-fixliamwhite2023-12-111-1/+1
|\ \ \ \
| * | | | kernel: fix single coreLiam2023-12-091-1/+1
* | | | | Merge pull request #12321 from liamwhite/ro2liamwhite2023-12-1116-670/+1203
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | ro: add separate ro serviceLiam2023-12-099-634/+1147
| * | | | service: populate pid and handle table from clientLiam2023-12-093-13/+19
| * | | | service: use interface factory in server managerLiam2023-12-095-23/+37
| | |/ / | |/| |
* | | | Merge pull request #12296 from liamwhite/client-sessionliamwhite2023-12-106-105/+244
|\ \ \ \
| * | | | kernel: implement remaining IPC syscallsLiam2023-12-066-105/+244
* | | | | Merge pull request #12299 from liamwhite/light-ipcliamwhite2023-12-1018-20/+813
|\ \ \ \ \
| * | | | | kernel: implement light IPCLiam2023-12-0718-20/+813
| |/ / / /
* | | | | Merge pull request #12323 from liamwhite/buffer-formatliamwhite2023-12-101-0/+1
|\ \ \ \ \
| * | | | | fbshare: set external format correctlyLiam2023-12-091-0/+1
| | |/ / / | |/| | |
* / | | | settings: Clearer NCE error messagesGPUCode2023-12-091-2/+6
|/ / / /
* | | | Merge pull request #12289 from german77/aruidliamwhite2023-12-0910-13/+526
|\ \ \ \
| * | | | service: hid: Introduce proper AppletResource emulationNarr the Reg2023-12-0710-13/+526
| | |_|/ | |/| |
* | | | Merge pull request #12320 from liamwhite/debug-fixliamwhite2023-12-091-1/+4
|\ \ \ \
| * | | | debug: fix reading of module namesLiam2023-12-091-1/+4
| | |_|/ | |/| |
* | | | Merge pull request #12319 from t895/refresh-list-bugliamwhite2023-12-094-8/+33
|\ \ \ \
| * | | | android: Listen for directory selection in viewmodelt8952023-12-094-8/+33
| |/ / /
* / / / settings: Enable NCE by default on capable systemst8952023-12-091-4/+10
|/ / /
* | | Merge pull request #12274 from liamwhite/srgb-nonsenseliamwhite2023-12-0813-83/+73
|\ \ \
| * | | texture_cache: fix max_element comparison functionLiam2023-12-041-1/+1
| * | | renderer_opengl: remove srgb conversion logicLiam2023-12-033-9/+2
| * | | renderer_vulkan: do not recreate swapchain for srgbLiam2023-12-0311-74/+71
* | | | Merge pull request #12208 from liamwhite/romfsliamwhite2023-12-086-113/+137
|\ \ \ \
| * | | | fsmitm_romfsbuild: optimize for data localityLiam2023-12-035-85/+82
| * | | | romfs: cache file and directory metadata tablesLiam2023-12-031-28/+55
| |/ / /
* | | | Merge pull request #11214 from lat9nq/ff-deprecatedliamwhite2023-12-081-1/+6
|\ \ \ \ | |_|_|/ |/| | |
| * | | codec: Update to use av frame flagslat9nq2023-12-061-1/+6
* | | | Merge pull request #12236 from liamwhite/cpu-refactorFernando S2023-12-0646-3274/+2924
|\ \ \ \ | |_|_|/ |/| | |
| * | | arm: fix context save of vector regsLiam2023-12-051-6/+4
| * | | core: refactor emulated cpu core activationLiam2023-12-0446-3274/+2926
| |/ /
* | | Merge pull request #12271 from liamwhite/pretext-fixliamwhite2023-12-051-0/+2
|\ \ \
| * | | nce: fix pre-text patch for single modulesLiam2023-12-021-0/+2
* | | | frontend_common: Use optional for language defaultt8952023-12-051-1/+2
| |/ / |/| |
* | | Merge pull request #12235 from liamwhite/flip-clipliamwhite2023-12-041-4/+10
|\ \ \ | |_|/ |/| |
| * | renderer_vulkan: adjust window origin and swizzle independentlyLiam2023-11-301-4/+10
* | | Merge pull request #12094 from ameerj/gl-buffer-cache-batch-vtxliamwhite2023-12-035-64/+36
|\ \ \
| * | | gl_buffer_cache: Batch vertex/tfb buffer bindingAmeer J2023-11-195-64/+36
* | | | Merge pull request #12196 from ameerj/glsl-cbuf-sizesliamwhite2023-12-031-1/+4
|\ \ \ \
| * | | | GLSL: Prefer known used cbuf sizesAmeer J2023-11-271-1/+4
* | | | | Merge pull request #12263 from liamwhite/null-romfsliamwhite2023-12-035-20/+16
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | file_sys: handle null romfsLiam2023-12-025-20/+16
* | | | | Merge pull request #12261 from liamwhite/fruit-companyliamwhite2023-12-023-6/+6
|\ \ \ \ \
| * | | | | texture_cache: use pedantic type namesLiam2023-12-023-6/+6
| |/ / / /
* | | | | Merge pull request #12260 from t895/install-reload-fixliamwhite2023-12-021-3/+0
|\ \ \ \ \
| * | | | | android: Don't reload filesystem on update installt8952023-12-021-3/+0
| |/ / / /
* | | | | Merge pull request #12259 from jbeich/freebsd-mmapliamwhite2023-12-021-13/+15
|\ \ \ \ \
| * | | | | host_memory: move MAP_ALIGNED_SUPER attempt after 448d4815deceJan Beich2023-12-021-13/+11
| * | | | | host_memory: allow missing MAP_NORESERVE on FreeBSD after 448d4815deceJan Beich2023-12-021-0/+4
* | | | | | Merge pull request #12256 from GPUCode/fxaaliamwhite2023-12-021-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | vk_blit_screen: Use correct format for fxaa renderpassGPUCode2023-12-011-1/+1
| |/ / / /
* | | | | Merge pull request #12255 from german77/amiiboliamwhite2023-12-021-5/+5
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | service: nfc: Don't tag amiibos as corrupted if they are loaded as read onlyNarr the Reg2023-12-011-5/+5
* | | | | Merge pull request #12056 from ameerj/opengl-neglectliamwhite2023-12-016-44/+74
|\ \ \ \ \
| * | | | | gl_texture_cache: Enable async downloadsAmeer J2023-08-145-9/+16
| * | | | | gl_buffer_cache: Enable async downloadsAmeer J2023-08-144-9/+34
| * | | | | gl_staging_buffer_pool: Refactor allocation variables into a structAmeer J2023-08-142-30/+28
* | | | | | cmake: prefer system gamemode libraryAlexandre Bouvier2023-11-302-2/+2
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #12229 from liamwhite/qcom-wtfliamwhite2023-11-302-19/+25
|\ \ \ \ \
| * | | | | renderer_vulkan: exclude more qcom drivers from extensionsLiam2023-11-302-19/+25
| | |/ / / | |/| | |
* | | | | Merge pull request #12227 from jbeich/gamemodeliamwhite2023-11-301-1/+1
|\ \ \ \ \
| * | | | | cmake: sync gamemode conditionals with code after 5eec980a2d71Jan Beich2023-11-301-1/+1
| |/ / / /
* | | | | Merge pull request #12074 from GPUCode/yuwu-on-the-metalliamwhite2023-11-3053-141/+2374
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | core: Rename patcher fileGPUCode2023-11-297-7/+7
| * | | | cmake: Move HAS_NCE to root cmakeGPUCode2023-11-291-1/+1
| * | | | qt: add cpu_backend configurationamazingfate2023-11-278-6/+54
| * | | | general: fix mac compileLiam2023-11-272-1/+3
| * | | | loader: fix gcc compileLiam2023-11-271-1/+1
| * | | | oaknut: Address warningsGPUCode2023-11-251-4/+0
| * | | | host_memory: Simplify randomness generationGPUCode2023-11-251-11/+2
| * | | | Address more review commentsGPUCode2023-11-258-19/+84
| * | | | loader: apply nso patch to offset program imageLiam2023-11-251-4/+6
| * | | | arm_nce: skip data aborts for crash handling parityLiam2023-11-251-3/+11
| * | | | android: show current backend in fps overlayLiam2023-11-253-1/+16
| * | | | arm: Print backtrace on data abortGPUCode2023-11-251-0/+2
| * | | | patch: check offsets from first code wordLiam2023-11-251-3/+4
| * | | | core: Define HAS_NCE macroGPUCode2023-11-2510-16/+26
| * | | | common: Enforce fastmem for nce usageGPUCode2023-11-251-1/+1
| * | | | arm_nce: skip dc cvac on possibly write-protected areasLiam2023-11-251-3/+1
| * | | | Address some review commentsGPUCode2023-11-2511-34/+29
| * | | | android: Add cpu bakend gui toggleGPUCode2023-11-2510-8/+42
| * | | | arm: Implement native code execution backendLiam2023-11-2530-47/+1799
| * | | | device_memory: Enable direct mapped addresses for nceGPUCode2023-11-255-8/+21
| * | | | settings: Add cpu backend settingGPUCode2023-11-253-0/+17
| * | | | kernel: Manually specify aslr region startLiam2023-11-258-18/+25
| * | | | core: Respect memory permissions in MapGPUCode2023-11-256-58/+117
| * | | | host_memory: Switch to FreeRegionManagerLiam2023-11-252-29/+67
| * | | | host_memory: ensure map base is between 36 and 39 bitsLiam2023-11-251-2/+58
| * | | | common: Add free region manager--author=Liam2023-11-252-0/+56
| * | | | common: Add libc sigaction hookGPUCode2023-11-253-0/+68
* | | | | general: conditionally compile gamemode on linux onlyLiam2023-11-292-1/+2
* | | | | Merge pull request #12204 from t895/config-migrationliamwhite2023-11-2932-122/+848
|\ \ \ \ \
| * | | | | android: Save global settings in onStopt8952023-11-286-63/+11
| * | | | | android: Multi directory UIt8952023-11-2827-59/+837
* | | | | | Merge pull request #12203 from liamwhite/crash-fixliamwhite2023-11-291-1/+3
|\ \ \ \ \ \
| * | | | | | set: don't load version nca with null romfsLiam2023-11-271-1/+3
* | | | | | | Merge pull request #12201 from Macj0rdan/controller-applet-fixliamwhite2023-11-294-3/+30
|\ \ \ \ \ \ \
| * | | | | | | Fixed controller applet crashing when on FW17+FrozenAra2023-11-274-3/+30
| |/ / / / / /
* | | | | | | Merge pull request #12194 from liamwhite/fruit-companyliamwhite2023-11-291-2/+2
|\ \ \ \ \ \ \
| * | | | | | | video_core: fix mac compileLiam2023-11-271-2/+2
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #12154 from liamwhite/more-driversliamwhite2023-11-292-11/+41
|\ \ \ \ \ \ \
| * | | | | | | vulkan_device: add names for more driverID enumeration valuesLiam2023-11-242-11/+41
* | | | | | | | Merge pull request #11946 from flodavid/gamemodeliamwhite2023-11-2914-9/+189
|\ \ \ \ \ \ \ \
| * | | | | | | | cmake: move gamemode target include into its fileflodavid2023-11-251-1/+0
| * | | | | | | | yuzu: create linux group in general settingsflodavid2023-11-2514-79/+172
| * | | | | | | | yuzu: integrate gamemode support on linuxxcfrg2023-11-258-1/+89
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #11902 from ameerj/ssbo-alignliamwhite2023-11-2914-16/+56
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | Merge branch 'master' into ssbo-alignAmeer J2023-11-27370-16371/+23771
| |\ \ \ \ \ \ \ | | | |_|/ / / / | | |/| | | | |
| * | | | | | | shader_recompiler: Align SSBO offsets in GlobalMemory functionsAmeer J2023-11-017-6/+19
| * | | | | | | buffer_cache: Apply storage buffer alignment only to the offsetAmeer J2023-11-011-8/+12
| * | | | | | | shader_recompiler: Align SSBO offsets to meet host requirementsAmeer J2023-11-0110-9/+32
* | | | | | | | Merge pull request #12183 from german77/justmiiliamwhite2023-11-274-34/+39
|\ \ \ \ \ \ \ \
| * | | | | | | | service: nfc: Validate mii datagerman772023-11-264-34/+39
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #12160 from german77/mouse_constrainliamwhite2023-11-275-54/+65
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | yuzu: Constrain mouse in render window when emulatedNarr the Reg2023-11-255-54/+65
* | | | | | | | Merge pull request #11535 from GPUCode/upload_cmdbufFernando S2023-11-2619-144/+317
|\ \ \ \ \ \ \ \
| * | | | | | | | Vulkan: Add a final barrier to the upload command bufferFernando Sahmkow2023-11-121-0/+8
| * | | | | | | | renderer_vulkan: Introduce separate cmd buffer for uploadsGPUCode2023-11-1219-144/+309
* | | | | | | | | Merge pull request #12180 from german77/cabinetmiiliamwhite2023-11-261-1/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service: am: Create random mii for cabinet appletgerman772023-11-261-1/+2
* | | | | | | | | | Merge pull request #12156 from german77/firmwarevsliamwhite2023-11-264-33/+98
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu: Display firmware versionNarr the Reg2023-11-244-33/+98
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | cmake: prefer system simpleini libraryAlexandre Bouvier2023-11-262-1/+2
* | | | | | | | | | Merge pull request #12166 from german77/redmagicliamwhite2023-11-261-0/+38
|\ \ \ \ \ \ \ \ \ \ | | |/ / / / / / / / | |/| | | | | | | |
| * | | | | | | | | android: input: Flip abxy on backbone labs controllersgerman772023-11-261-0/+19
| * | | | | | | | | android: input: Flip abxy on redmagic controllersgerman772023-11-251-0/+19
| | |_|/ / / / / / | |/| | | | | | |
* / | | | | | | | time: undef GetCurrentTime for WindowsLiam2023-11-251-0/+5
|/ / / / / / / /
* | | | | | | | Merge pull request #12153 from liamwhite/deck2liamwhite2023-11-251-1/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | renderer_vulkan: exclude steam deck oled from force max clock settingLiam2023-11-241-1/+2
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #12151 from german77/no-crashliamwhite2023-11-252-0/+51
|\ \ \ \ \ \ \ \
| * | | | | | | | core: hid: Ensure output devices are initializedNarr the Reg2023-11-242-0/+51
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #12110 from liamwhite/mali-nullviewliamwhite2023-11-252-2/+17
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | vk_texture_cache: add workaround for nullDescriptor on MaliLiam2023-11-212-2/+17
* | | | | | | | Merge pull request #11889 from t895/ini-libCharles Lombardo2023-11-2562-3492/+2690
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | frontend_common: Don't specify default value for screenshot_patht8952023-11-231-2/+1
| * | | | | | | frontend_common: Don't load config files that we fail to opent8952023-11-231-0/+10
| * | | | | | | frontend_common: Add option to read unsigned integerst8952023-11-223-2/+34
| * | | | | | | frontend_common: Set config array size to 0 if the array is ended without changing its indext8952023-11-211-4/+8
| * | | | | | | frontend_common: Manually handle opening config filet8952023-11-211-2/+31
| * | | | | | | frontend_common: Add special config case for unmapped windows network drivest8952023-11-211-1/+9
| * | | | | | | frontend_common: Disable UTF-8 BOM in configt8952023-11-211-1/+1
| * | | | | | | android: Rework config lifecyclet8952023-11-216-6/+31
| * | | | | | | android: Remove ini4jt8952023-11-212-43/+0
| * | | | | | | common: settings: Add ifdefs to define android's default settingst8952023-11-211-6/+36
| * | | | | | | general: Remove iniht8952023-11-212-2/+2
| * | | | | | | config: Unify config handling under frontend_commont8952023-11-2153-3435/+2539
| |/ / / / / /
* | | | | | | Merge pull request #12140 from liamwhite/qcr-unreachableliamwhite2023-11-241-1/+1
|\ \ \ \ \ \ \
| * | | | | | | query_cache: demote report synced unreachable to assertLiam2023-11-231-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #12076 from german77/resourceliamwhite2023-11-2336-1415/+1625
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | service: hid: Create appropriate hid resourcesNarr the Reg2023-11-2136-1415/+1625
| |/ / / / /
* | | | | | game_list_worker: Explicit caputure of 'this'Merry2023-11-211-1/+1
* | | | | | shared_widget: Explicit capture of 'this'Merry2023-11-211-2/+2
* | | | | | Merge pull request #12107 from daisymlleung/patch-1liamwhite2023-11-211-1/+12
|\ \ \ \ \ \
| * | | | | | Stub CheckBlockedUserListAvailabilitydaisymlleung2023-11-201-1/+12
* | | | | | | Merge pull request #12045 from liamwhite/codec-refactorliamwhite2023-11-2111-374/+705
|\ \ \ \ \ \ \
| * | | | | | | video_core: refactor video frame and packet parsingLiam2023-11-1611-374/+705
* | | | | | | | Merge pull request #11984 from lat9nq/lupdateliamwhite2023-11-212-258/+310
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | CMakeLists: Add option to call lupdate directlylat9nq2023-11-081-9/+42
| * | | | | | | shared_translation: Call tr for each stringlat9nq2023-11-081-249/+268
* | | | | | | | Merge pull request #12011 from Macj0rdan/controller-appletNarr the Reg2023-11-2016-89/+594
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | Implemented qlaunch version of the controller appletFrozenAra2023-11-1916-89/+594
* | | | | | | | Merge pull request #12093 from t895/zip-intentliamwhite2023-11-203-72/+33
|\ \ \ \ \ \ \ \
| * | | | | | | | android: Use file picker intent for save exportert8952023-11-193-72/+33
* | | | | | | | | Merge pull request #12092 from t895/recent-games-defaultliamwhite2023-11-202-2/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | android: Use path instead of programId for recently added / played keyt8952023-11-191-2/+2
| * | | | | | | | | android: Select recently played games by default in search tabt8952023-11-191-0/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #12091 from t895/silly-speedliamwhite2023-11-201-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | android: Allow up to 400% for the limit speed percent settingt8952023-11-191-1/+1
| |/ / / / / / / /
* / / / / / / / / service: hid: Ensure resource manager is initializedSquall-Leonhart2023-11-201-1/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #12083 from liamwhite/viewportliamwhite2023-11-195-1/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | renderer_vulkan: ignore viewport stores on non-supporting driversLiam2023-11-195-1/+11
* | | | | | | | | qt: fix linux buildLiam2023-11-191-0/+3
|/ / / / / / / /
* | | | | | | | Merge pull request #12081 from FernandoS27/check-out-on-your-broke-crypto-friendsliamwhite2023-11-193-5/+31
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ |/| | | | | | |
| * | | | | | | Vulkan: Be more generous with pipeline workers for AndroidFernando Sahmkow2023-11-193-5/+31
* | | | | | | | Merge pull request #12036 from FernandoS27/you-should-have-more-than-one-towelliamwhite2023-11-191-0/+13
|\ \ \ \ \ \ \ \
| * | | | | | | | Query Cache: Disable write syncing on AndroidFernando Sahmkow2023-11-151-0/+13
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #11792 from boludoz/new-shortcutliamwhite2023-11-195-208/+259
|\ \ \ \ \ \ \ \
| * | | | | | | | Fix out_icon_path = Common::FS::GetYuzuPath(Common::FS::YuzuPath::IconsDir);Franco M2023-11-091-1/+1
| * | | | | | | | Minor changesFranco M2023-11-091-2/+2
| * | | | | | | | Final change, i thinkFranco M2023-11-081-6/+5
| * | | | | | | | Fixed clangFranco M2023-11-071-2/+3
| * | | | | | | | modified: src/yuzu/main.cppFranco M2023-11-051-66/+7
| * | | | | | | | Merge branch 'master' into new-shortcutFranco M2023-11-05166-2990/+7647
| |\ \ \ \ \ \ \ \ | | | |_|_|/ / / / | | |/| | | | | |
| * | | | | | | | We dont need thatboludoz2023-10-271-15/+19
| * | | | | | | | Merge branch 'yuzu-emu:master' into new-shortcutFranco M2023-10-2731-107/+493
| |\ \ \ \ \ \ \ \ | | | |_|_|_|_|_|/ | | |/| | | | | |
| * | | | | | | | Merge branch 'yuzu-emu:master' into new-shortcutFranco M2023-10-2133-289/+588
| |\ \ \ \ \ \ \ \
| * | | | | | | | | Reverted dirty code in main.boludoz2023-10-192-9/+2
| * | | | | | | | | TODO: Implement shortcut creation for Apple.boludoz2023-10-183-2/+15
| * | | | | | | | | Useless code removed related to admin privileges, if it is not an error we can add it later, that is what git is for.boludoz2023-10-182-7/+0
| * | | | | | | | | Deleted admin requisite (maybe it was another mistake).boludoz2023-10-181-7/+1
| * | | | | | | | | Merge branch 'yuzu-emu:master' into new-shortcutFranco M2023-10-1819-99/+120
| |\ \ \ \ \ \ \ \ \
| * | | | | | | | | | Final refactorizationboludoz2023-10-171-86/+45
| * | | | | | | | | | Merge branch 'yuzu-emu:master' into new-shortcutFranco M2023-10-176-8/+91
| |\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Moved check.boludoz2023-10-171-6/+8
| * | | | | | | | | | | More @liamwhite suggestions applied.boludoz2023-10-172-122/+90
| * | | | | | | | | | | shortcut_stream.close(); fixedboludoz2023-10-161-1/+1
| * | | | | | | | | | | Comment using fmt instead qt.boludoz2023-10-161-2/+1
| * | | | | | | | | | | .clear() instead = ""; and switch improved.boludoz2023-10-161-16/+8
| * | | | | | | | | | | More missed suggestionsboludoz2023-10-161-6/+2
| * | | | | | | | | | | Sugestions and fixes.boludoz2023-10-163-54/+56
| * | | | | | | | | | | Merge branch 'new-shortcut' of https://github.com/boludoz/yuzu into new-shortcutboludoz2023-10-162-10/+1
| |\ \ \ \ \ \ \ \ \ \ \
| | * \ \ \ \ \ \ \ \ \ \ Merge branch 'yuzu-emu:master' into new-shortcutFranco M2023-10-162-10/+1
| | |\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | Some improvements (suggestions)boludoz2023-10-163-91/+79
| |/ / / / / / / / / / / /
| * | | | | | | | | | | | Less code, simpler, better.boludoz2023-10-163-82/+15
| * | | | | | | | | | | | Typing and formatting errors fixed.boludoz2023-10-166-54/+43
| * | | | | | | | | | | | Unnecessary feature removedboludoz2023-10-154-99/+5
| * | | | | | | | | | | | Fixes and improvementsboludoz2023-10-153-11/+30
| * | | | | | | | | | | | Improved shortcut: add games in applist for Windows, question for start game at fullscreen & better unicode support for some Windows path funcs.boludoz2023-10-159-215/+515
* | | | | | | | | | | | | Merge pull request #12066 from ameerj/nvidia-nsanityliamwhite2023-11-194-0/+82
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | shader_recompiler: add byteswap pattern workaround for NvidiaAmeer J2023-11-184-0/+82
* | | | | | | | | | | | | | Merge pull request #12068 from ameerj/glasm-xfb-fixesliamwhite2023-11-192-1/+6
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | gl_graphics_pipeline: GLASM: Fix transform feedback attribs buffer modeAmeer J2023-11-182-1/+6
| |/ / / / / / / / / / / / /
* | | | | | | | | | / / / / Buffer Cache: Eliminate clears on Indirect buffersFernando Sahmkow2023-11-182-6/+1
| |_|_|_|_|_|_|_|_|/ / / / |/| | | | | | | | | | | |
* | | | | | | | | | | | | shader_recompiler: Fix spelling of "derivate" (#12067)Ameer J2023-11-1810-60/+61
* | | | | | | | | | | | | Merge pull request #12058 from liamwhite/opus-againliamwhite2023-11-182-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | opus: fix stereo stream count check in multistream decoder objectLiam2023-11-172-2/+2
| | |_|_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #11912 from liamwhite/nv-graphic-bufferliamwhite2023-11-1812-37/+71
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | nvnflinger: use graphic buffer lifetime for map handleLiam2023-10-3012-37/+71
* | | | | | | | | | | | | | Merge pull request #11917 from liamwhite/abandonmentliamwhite2023-11-188-21/+60
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | nvnflinger: implement consumer abandonmentLiam2023-10-308-21/+60
* | | | | | | | | | | | | | service: hid: Introduce firmware settings and update activate controller callsNarr the Reg2023-11-1712-54/+295
| |_|/ / / / / / / / / / / |/| | | | | | | | | | | |
* | | | | | | | | | | | | service: hid: Implement xpad callsNarr the Reg2023-11-162-36/+139
* | | | | | | | | | | | | Merge pull request #11995 from FernandoS27/you-dont-need-the-new-iphoneliamwhite2023-11-166-30/+32
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | Memory: Fix invalidation handling from the CPU/ServicesFernando Sahmkow2023-11-123-7/+22
| * | | | | | | | | | | | | Revert "renderer_vulkan: add locks to avoid scheduler flushes from CPU"Fernando Sahmkow2023-11-104-23/+10
* | | | | | | | | | | | | | Merge pull request #12038 from german77/no_implementliamwhite2023-11-1617-3070/+3276
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | service: hid: Split hid.cpp into individual interfacesNarr the Reg2023-11-1517-3070/+3276
* | | | | | | | | | | | | | | Merge pull request #12007 from german77/moar_buttonsliamwhite2023-11-1613-185/+382
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | core: hid: Split SL and SR buttonsgerman772023-11-1213-185/+382
| | |_|_|_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | android: Disable PiP by defaultt8952023-11-151-1/+1
* | | | | | | | | | | | | | Merge pull request #12034 from t895/fps-outlineliamwhite2023-11-151-2/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | android: Add drop shadow to FPS countert8952023-11-141-2/+3
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* / | | | | | | | | | | | | android: Don't enter PiP during startup or shutdownt8952023-11-151-1/+3
|/ / / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #12032 from liamwhite/fruit-compilerliamwhite2023-11-141-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | fix apple clang build againLiam2023-11-141-2/+2
* | | | | | | | | | | | | | Merge pull request #12030 from t895/blocking-fixliamwhite2023-11-142-24/+35
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | android: Use suspend function for creating dynamic shortcutst8952023-11-142-24/+35
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #12028 from liamwhite/coretiming-shutdownliamwhite2023-11-142-1/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | core_timing: lock event queue accessLiam2023-11-142-1/+3
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #12025 from liamwhite/kernel-shutdown-deadlockliamwhite2023-11-141-8/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | core: check for thread dpc before eretLiam2023-11-131-8/+8
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #12019 from liamwhite/more-shutdown-deadlocksliamwhite2023-11-144-4/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | audio_core: ignore renderer wait when stream is pausedLiam2023-11-134-4/+18
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #11990 from german77/audioliamwhite2023-11-137-13/+26
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | yuzu: Make mute audio persistentNarr the Reg2023-11-102-7/+7
| * | | | | | | | | | | | | yuzu: Save mute when in background settingNarr the Reg2023-11-105-6/+19
| | |_|_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #12014 from t895/shrink-logoliamwhite2023-11-135-15/+249
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | android: Add a landscape-specific layout to the about paget8952023-11-121-0/+233
| * | | | | | | | | | | | | android: Shrink logo in about paget8952023-11-121-5/+5
| * | | | | | | | | | | | | android: Shrink logo in settings tabt8952023-11-122-6/+7
| * | | | | | | | | | | | | android: Fix top app bar tint being cut off in the about fragmentt8952023-11-121-4/+4
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #12015 from t895/remove-autoliamwhite2023-11-131-2/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | android: Remove "auto" region optiont8952023-11-121-2/+0
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | android: Use the same transition animation between every fragment in settingst8952023-11-133-28/+4
* | | | | | | | | | | | | android: Use more padding on top of each settings headert8952023-11-131-1/+2
* | | | | | | | | | | | | android: Remove dividers between each settingt8952023-11-131-7/+0
* | | | | | | | | | | | | android: Add icons and descriptions to the first-level advanced settings paget8952023-11-1313-47/+165
* | | | | | | | | | | | | android: Remove general section from settingst8952023-11-132-11/+3
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #11980 from german77/momentliamwhite2023-11-126-17/+169
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | service: irs: Implement moment image processorNarr the Reg2023-11-116-17/+169
* | | | | | | | | | | | | Merge pull request #12005 from german77/homebrew_idliamwhite2023-11-121-4/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | yuzu: Keep homebrew on the recently played listgerman772023-11-111-4/+5
* | | | | | | | | | | | | | Merge pull request #12004 from liamwhite/fix-hblliamwhite2023-11-121-0/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | k_capabilities: ignore map region when KTrace is disabledLiam2023-11-111-0/+3
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #12003 from liamwhite/read-modulesliamwhite2023-11-121-47/+118
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | gdbstub: read module information from memory layoutLiam2023-11-111-47/+118
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #11992 from t895/frame-checkliamwhite2023-11-124-4/+13
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | android: Hide loading animation on first framet8952023-11-104-4/+13
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | k_page_table: fix shutdownLiam2023-11-101-7/+0
* | | | | | | | | | | | | k_page_table: use more precise icache invalidatesLiam2023-11-101-4/+9
* | | | | | | | | | | | | kernel: add KPageTableBaseLiam2023-11-1031-4879/+7204
| |/ / / / / / / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Allocate resources for test window before getting system infoLucas Reis2023-11-081-0/+1
|/ / / / / / / / / / /
* | | | | | | | | | | Update CMakeLists.txtSamay Navale2023-11-061-2/+2
* | | | | | | | | | | Update CMakeLists.txtSamay Navale2023-11-061-5/+5
* | | | | | | | | | | Merge pull request #11896 from liamwhite/cropliamwhite2023-11-064-68/+95
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | renderer_vulkan: fix FSR croppingLiam2023-10-283-70/+86
| * | | | | | | | | | | renderer_vulkan: fix cropping for presentationLiam2023-10-282-46/+57
| | |_|_|_|_|_|_|_|/ / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11873 from liamwhite/buffer-controlliamwhite2023-11-0618-428/+407
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | nvdrv: rework to remove memcpyLiam2023-10-2516-225/+243
| * | | | | | | | | | | nvdrv: fix up remaining copy callsLiam2023-10-253-17/+22
| * | | | | | | | | | | nvdrv: convert nvmapLiam2023-10-253-60/+26
| * | | | | | | | | | | nvdrv: convert codec devicesLiam2023-10-256-34/+29
| * | | | | | | | | | | nvdrv: convert nvhost_gpuLiam2023-10-252-76/+49
| * | | | | | | | | | | nvdrv: convert nvhost_ctrlLiam2023-10-252-34/+29
| * | | | | | | | | | | nvdrv: convert nvhost_ctrl_gpuLiam2023-10-252-97/+43
| * | | | | | | | | | | nvdrv: add ioctl command serialization, convert nvhost_as_gpuLiam2023-10-255-71/+152
* | | | | | | | | | | | Merge pull request #11972 from t895/fps-counter-adjustmentsliamwhite2023-11-064-38/+11
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | android: Simplify FPS counter paddingCharles Lombardo2023-11-062-24/+5
| * | | | | | | | | | | | android: Color the FPS counter whiteCharles Lombardo2023-11-061-2/+0
| * | | | | | | | | | | | android: Always update FPS counterCharles Lombardo2023-11-043-12/+6
* | | | | | | | | | | | | service: am: Set the correct album program idgerman772023-11-061-2/+2
* | | | | | | | | | | | | renderer_vulkan: render on bottom of surface clip when flipped (#11894)liamwhite2023-11-051-1/+1
* | | | | | | | | | | | | Merge pull request #11957 from liamwhite/null2liamwhite2023-11-051-3/+10
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | renderer_null: fixLiam2023-11-041-3/+10
* | | | | | | | | | | | | | Merge pull request #11969 from german77/profileliamwhite2023-11-052-12/+50
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | service: acc: Ensure proper profile sizegerman772023-11-052-12/+50
| | |_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #11961 from german77/recentliamwhite2023-11-052-4/+31
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | yuzu: Only store games in the recently played listgerman772023-11-052-4/+31
* | | | | | | | | | | | | | | Merge pull request #11965 from german77/colorliamwhite2023-11-055-16/+42
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | core: hid: Signal color updatesNarr the Reg2023-11-045-16/+42
| | |/ / / / / / / / / / / / / | |/| | | | | | | | | | | | |
* / | | | | | | | | | | | | | Convert files to LF eolKelebek12023-11-0416-884/+884
|/ / / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #11952 from liamwhite/opus_stereo_countliamwhite2023-11-042-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | Allow 0 stereo countKelebek12023-11-032-3/+3
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #11960 from german77/silenceliamwhite2023-11-041-7/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | service: hid: Silence EnableUnintendedHomeButtonInputProtectiongerman772023-11-041-7/+5
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #11959 from t895/firmware-reload-fixliamwhite2023-11-045-13/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | android: Don't reload log/system after loading firmware/backupCharles Lombardo2023-11-045-13/+18
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #11881 from liamwhite/sockets-safe-accessliamwhite2023-11-042-41/+38
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | sockets: use safe access helpersLiam2023-10-252-41/+38
| | |_|_|/ / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #11885 from liamwhite/stop-nagging-meliamwhite2023-11-043-8/+9
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | qt: remove duplicate exit confirmation settingLiam2023-10-313-8/+9
* | | | | | | | | | | | | | Merge pull request #11954 from t895/log-hardwareCharles Lombardo2023-11-044-19/+31
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | android: Log more system information during startupCharles Lombardo2023-11-032-0/+14
| * | | | | | | | | | | | | | android: Fix fetching system memory size from MemoryUtilCharles Lombardo2023-11-032-19/+17
| | |_|_|/ / / / / / / / / / | |/| | | | | | | | | | | |
* / | | | | | | | | | | | | arm: NativeClock: Special handling for bad system counter clock frequency reportingCharles Lombardo2023-11-031-1/+20
|/ / / / / / / / / / / / /
* | | / / / / / / / / / / android: Update surface parameters on emulation startCharles Lombardo2023-11-031-0/+9
| |_|/ / / / / / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11948 from german77/hard_ringliamwhite2023-11-031-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | service: hid: Ensure GetNextEntryIndex can't failgerman772023-11-031-3/+3
* | | | | | | | | | | | | Merge pull request #11947 from german77/batteryliamwhite2023-11-033-15/+20
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | core: hid: Fix wrong battery valuesgerman772023-11-033-15/+20
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #11943 from liamwhite/silence-logspamliamwhite2023-11-031-1/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | renderer_vulkan: minimize transform feedback support logLiam2023-11-021-1/+5
* | | | | | | | | | | | | | Merge pull request #11936 from liamwhite/romfs-nonsenseliamwhite2023-11-034-40/+18
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | romfs: fix extraction of single-directory rootLiam2023-11-014-40/+18
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #11942 from t895/log-versionliamwhite2023-11-017-40/+68
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | android: Adjust log lifecycleCharles Lombardo2023-11-014-10/+30
| * | | | | | | | | | | | | android: Use yuzu logging systemCharles Lombardo2023-11-014-31/+39
* | | | | | | | | | | | | | android: Default to player number 0 if we get an input from an unrecognized controllerCharles Lombardo2023-11-011-1/+1
* | | | | | | | | | | | | | android: Adjust driver manager source stringCharles Lombardo2023-11-011-1/+1
* | | | | | | | | | | | | | android: Reorganize settings tabCharles Lombardo2023-11-011-33/+33
|/ / / / / / / / / / / / /
* | | | | | | | | | | | | android: Auto-generate locale configCharles Lombardo2023-11-014-18/+5
* | | | | | | | | | | | | android: Update translations from transifexCharles Lombardo2023-11-0119-687/+3425
| |_|_|_|_|_|_|_|_|_|_|/ |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11931 from t895/applet-launcherliamwhite2023-10-3125-18/+717
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | android: Initialize filesystem components during application startCharles Lombardo2023-10-312-9/+14
| * | | | | | | | | | | | android: Implement applet launcherCharles Lombardo2023-10-3124-9/+703
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #11929 from dima-xd/swkbd-appletliamwhite2023-10-312-2/+80
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | service: am: Add support for LLE Software Keyboard AppletDzmitry Dubrova2023-10-312-2/+80
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #11925 from t895/controller-fixliamwhite2023-10-313-87/+54
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | android: Reorder controller indexes and only use controllersCharles Lombardo2023-10-312-6/+50
| * | | | | | | | | | | | android: InputHandler: Convert to objectCharles Lombardo2023-10-302-6/+4
| * | | | | | | | | | | | android: Removed unused ControllerMappingHelperCharles Lombardo2023-10-302-75/+0
* | | | | | | | | | | | | Merge pull request #11892 from german77/pkm_screenshotliamwhite2023-10-316-17/+82
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | service: am: Implement ISelfController::SaveCurrentScreenshotNarr the Reg2023-10-276-17/+82
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11922 from t895/simplify-card-layoutliamwhite2023-10-301-27/+18
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | android: Simplify game card layoutCharles Lombardo2023-10-301-27/+18
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #11903 from Macj0rdan/scrollable-volume-buttonliamwhite2023-10-302-2/+53
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Implemented wheel event for volume control in VolumeButtonFrozenAra2023-10-292-2/+53
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | android: FileUtil: Add option to suppress log for native exists() callsCharles Lombardo2023-10-302-3/+5
* | | | | | | | | | | | android: Fix resolving android URIs in native codeCharles Lombardo2023-10-307-9/+115
* | | | | | | | | | | | android: Refactor game metadata collection to new fileCharles Lombardo2023-10-3010-102/+154
* | | | | | | | | | | | android: Use header for EmulationSessionCharles Lombardo2023-10-303-406/+392
| |/ / / / / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #11920 from Termynat0r/masterliamwhite2023-10-301-3/+3
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Fix macOS buildTermynat0r2023-10-301-3/+3
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11916 from t895/focus-fixliamwhite2023-10-301-0/+28
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | android: Release touch on input overlay when opening in-game menuCharles Lombardo2023-10-301-0/+28
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11915 from t895/startup-freezeliamwhite2023-10-301-16/+23
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | android: Move game deserialization to another threadCharles Lombardo2023-10-301-16/+23
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11910 from liamwhite/surface-lost-on-creationliamwhite2023-10-301-0/+6
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | renderer_vulkan: ensure exception on surface lossLiam2023-10-291-0/+6
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11689 from liamwhite/breakpadliamwhite2023-10-3012-265/+101
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | qt: implement automatic crash dump supportLiam2023-10-0812-265/+101
* | | | | | | | | | Merge pull request #11911 from german77/leak_eventliamwhite2023-10-306-5/+26
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | core: Close all KEventsgerman772023-10-296-5/+26
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11909 from t895/card-gridliamwhite2023-10-302-3/+5
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | android: Break home settings into grid with large screensCharles Lombardo2023-10-292-3/+5
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11904 from ameerj/gl_threaded_opts_onliamwhite2023-10-301-0/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | nvidia_flags: Enable GL Threaded optimizationsAmeer J2023-10-291-0/+1
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11893 from liamwhite/swizzleliamwhite2023-10-301-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | renderer_vulkan: fix viewport swizzle dirty state trackingLiam2023-10-271-1/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11866 from liamwhite/more-qt-nonsenseliamwhite2023-10-294-61/+112
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | qt: fix game list shutdown crashLiam2023-10-244-61/+112
* | | | | | | | | | Merge pull request #11862 from liamwhite/pascal-robustliamwhite2023-10-291-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Manually robust on Pascal and earlierLiam2023-10-231-1/+1
* | | | | | | | | | | Merge pull request #11859 from Kelebek1/compute_findbufferliamwhite2023-10-292-6/+9
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Add missing dowhile loops around FindBuffer callsKelebek12023-10-232-6/+9
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #11852 from german77/async_brrliamwhite2023-10-292-2/+19
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | input_common: joycon: Move vibrations to a queuegerman772023-10-222-2/+19
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #11843 from liamwhite/sync-processliamwhite2023-10-2939-1021/+1820
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel: make sure new process is in listLiam2023-10-251-0/+1
| * | | | | | | | | | | kernel: fix extraneous refLiam2023-10-221-1/+0
| * | | | | | | | | | | kernel: shutdown app before gpuLiam2023-10-221-1/+1
| * | | | | | | | | | | kernel: signal thread on termination completedLiam2023-10-221-4/+7
| * | | | | | | | | | | kernel: add missing TLR clearLiam2023-10-221-0/+1
| * | | | | | | | | | | kernel: update KProcessLiam2023-10-2239-1016/+1811
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #11827 from liamwhite/preallocatedliamwhite2023-10-292-5/+6
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | nvnflinger: fix reporting and freeing of preallocated buffersLiam2023-10-202-5/+6
* | | | | | | | | | | | Merge pull request #11803 from flodavid/improve-controller-applet-clickNarr the Reg2023-10-295-40/+87
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | yuzu: Improve behavior when clicking on controller box in Controller appletflodavid2023-10-175-40/+87
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11880 from abouvier/unbundle-stbliamwhite2023-10-254-11/+31
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | cmake: prefer system stb headersAlexandre Bouvier2023-10-254-11/+31
* | | | | | | | | | | Merge pull request #11876 from liamwhite/apiversionliamwhite2023-10-251-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | vulkan_common: use highest API versionLiam2023-10-241-1/+1
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11812 from german77/save_captureliamwhite2023-10-258-13/+250
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | service: caps: Implement SaveScreenShotEx0 and variantsgerman772023-10-238-13/+250
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | service: ipc: Add third read buffer indexNarr the Reg2023-10-231-0/+6
* | | | | | | | | Merge pull request #11841 from german77/halpliamwhite2023-10-233-2/+10
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu: Fix restore shortcuts buttonNarr the Reg2023-10-223-2/+10
| | |_|_|_|_|_|_|/ | |/| | | | | | |
* | | | | | | | | Merge pull request #11846 from german77/cheatsliamwhite2023-10-231-7/+16
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | cheats: Clamp cheat names without failinggerman772023-10-221-7/+16
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11847 from ameerj/glsl-shfl-fixliamwhite2023-10-232-4/+9
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | emit_glsl_warp: Fix shfl_in_bounds conditionalAmeer J2023-10-222-4/+9
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | yuzu: Fix vibration reseting to 1%german772023-10-221-5/+5
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #11831 from liamwhite/hosversionbetweenliamwhite2023-10-222-19/+34
|\ \ \ \ \ \ \ \
| * | | | | | | | set: return version info from system archiveLiam2023-10-202-19/+34
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #11830 from liamwhite/ts-sessionliamwhite2023-10-222-6/+40
|\ \ \ \ \ \ \ \
| * | | | | | | | ts: add OpenSessionLiam2023-10-202-6/+40
| |/ / / / / / /
* | | | | | | | Merge pull request #11828 from liamwhite/setthreadescriptionliamwhite2023-10-221-22/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | common: use SetThreadDescription API for thread namesLiam2023-10-201-22/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #11789 from Kelebek1/spirv_shift_rightliamwhite2023-10-226-25/+97
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Manually robust on Maxwell and earlierKelebek12023-10-196-25/+97
* | | | | | | | Merge pull request #11748 from liamwhite/kern_1700Fernando S2023-10-2016-227/+438
|\ \ \ \ \ \ \ \
| * | | | | | | | gdbstub: add PermissionLocked to mappings tableLiam2023-10-201-4/+6
| * | | | | | | | kernel: fix format string errorLiam2023-10-201-1/+1
| * | | | | | | | kernel: make check fully constexpr for broken msvc constant foldingLiam2023-10-201-1/+1
| * | | | | | | | k_page_table: add MapFirstGroupLiam2023-10-203-34/+49
| * | | | | | | | kernel: update KMemoryRegionType valuesLiam2023-10-202-48/+80
| * | | | | | | | k_page_table: implement PermissionLockedLiam2023-10-206-26/+128
| * | | | | | | | k_page_table: add new CheckMemoryState helperLiam2023-10-202-12/+40
| * | | | | | | | kernel: split Io memory state, add PermissionLocked attributeLiam2023-10-205-92/+116
| * | | | | | | | kernel: reshuffle ini1 size, add slab clear noteLiam2023-10-204-10/+18
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #11825 from liamwhite/system-resourceFernando S2023-10-201-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel: fix incorrect calculation of used non system memory valueLiam2023-10-201-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #11806 from liamwhite/needs-more-lockingliamwhite2023-10-204-10/+23
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | renderer_vulkan: add locks to avoid scheduler flushes from CPULiam2023-10-174-10/+23
* | | | | | | | Merge pull request #11822 from german77/no-nameliamwhite2023-10-191-0/+1
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | service: mii: Create random mii with nameNarr the Reg2023-10-191-0/+1
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #11810 from liamwhite/clang-17liamwhite2023-10-192-4/+4
|\ \ \ \ \ \ \
| * | | | | | | general: fix build failure on clang 17Liam2023-10-182-4/+4
| |/ / / / / /
* | | | | | | Merge pull request #11795 from Squall-Leonhart/D32FToOtherliamwhite2023-10-186-1/+51
|\ \ \ \ \ \ \
| * | | | | | | Changes based on hardware testsSquall-Leonhart2023-10-166-37/+5
| * | | | | | | Make Clang happy.Squall Leonhart2023-10-161-1/+1
| * | | | | | | Added missing BuildShader lineSquall Leonhart2023-10-161-0/+1
| * | | | | | | added missing trailing line.Squall Leonhart2023-10-151-1/+1
| * | | | | | | meant to add the unorms as wellSquall Leonhart2023-10-151-1/+3
| * | | | | | | use texelfetch instead of texturelodSquall-Leonhart2023-10-152-2/+2
| * | | | | | | appease the format godsSquall Leonhart2023-10-151-1/+1
| * | | | | | | Another missing copy connected to Bravely Default IISquall-Leonhart2023-10-155-0/+35
| * | | | | | | missed this line when editing the copypastaSquall-Leonhart2023-10-151-1/+1
| * | | | | | | moved line to appease the format godsSquall-Leonhart2023-10-151-1/+1
| * | | | | | | Implement missing formats for Bravely Default 2Squall-Leonhart2023-10-155-0/+44
* | | | | | | | Merge pull request #11791 from german77/bufferxliamwhite2023-10-184-46/+70
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | service: hle: Allow to access read buffer A and X directlygerman772023-10-174-46/+70
* | | | | | | | Merge pull request #11774 from liamwhite/refcount-issueliamwhite2023-10-1710-85/+77
|\ \ \ \ \ \ \ \
| * | | | | | | | fsmitm_romfsbuild: avoid unnecessary copies of vfs pointersLiam2023-10-1310-85/+77
* | | | | | | | | Merge pull request #11747 from Kelebek1/image_alias_sample_namesliamwhite2023-10-174-4/+9
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Get out of render pass before query barriers, fix image names with samples > 1, remove image alias bitKelebek12023-10-114-4/+9
* | | | | | | | | | Merge pull request #11349 from vonchenplus/buffer_cache_crashliamwhite2023-10-174-8/+25
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | |
| * | | | | | | | | video_core: Fix d24r8/s8d24 convert shader build error in moltenvkFeng Chen2023-09-072-8/+8
| * | | | | | | | | video_core: Add missing scissor update when viewport scale offset disableFeng Chen2023-09-071-0/+13
| * | | | | | | | | video_core: set vertex buffer num to 16, because mvk have when using more than 16Feng Chen2023-08-231-0/+4
* | | | | | | | | | Merge pull request #11788 from Squall-Leonhart/IFREMOVEDFernando S2023-10-171-2/+9
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ |/| | | | | | | | |
| * | | | | | | | | brings back the removed If statement and adds the num_level testSquall Leonhart2023-10-141-2/+9
* | | | | | | | | | service: acc: Implement functions needed for profile select (#11653)Narr the Reg2023-10-176-8/+91
| |_|_|_|_|_|/ / / |/| | | | | | | |
* | | | | | | | | Merge pull request #11786 from v1993/cuda-on-linuxliamwhite2023-10-161-10/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | host1x/codecs: enable CUDA on LinuxValeri2023-10-141-10/+0
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #11794 from german77/linemotliamwhite2023-10-161-0/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | input_common: udp: Avoid crash when trying to map motion before client is readygerman772023-10-151-0/+1
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #11780 from Darkness4/masterliamwhite2023-10-141-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Revert "cmake: only add network component if qt used"Nguyen Marc2023-10-141-4/+1
| * | | | | | | | cmake: only add network component if qt usedNguyen Marc2023-10-141-1/+4
| * | | | | | | | qt: add missing target_link_libraries for discordrpcNguyen Marc2023-10-141-1/+1
* | | | | | | | | Merge pull request #11779 from flodavid/improve-player-config-clickliamwhite2023-10-142-10/+27
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu: Improve behavior when clicking on controller box in Control Configurationflodavid2023-10-142-10/+27
* | | | | | | | | | Merge pull request #11778 from liamwhite/audren-shutdown-lockliamwhite2023-10-141-0/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | audio: fix shutdown deadlock in audio rendererLiam2023-10-131-0/+4
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11775 from Kelebek1/draw_vertex_arrayliamwhite2023-10-142-1/+25
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Implement vertex array first and subsequent drawsKelebek12023-10-142-1/+25
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11159 from flodavid/master_bisliamwhite2023-10-148-43/+125
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | fix styleF David2023-10-121-2/+3
| * | | | | | | | | yuzu: Enable to use controller to restart a gameflodavid2023-10-123-18/+29
| * | | | | | | | | yuzu: Use new setting method for stop emulationFlorian2023-10-126-9/+36
| * | | | | | | | | yuzu: Enable to use controller to close a gameflodavid2023-10-125-32/+75
* | | | | | | | | | Merge pull request #11772 from v1993/polyfill-thread-fixesliamwhite2023-10-131-10/+11
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | common/polyfill_thread: use std::forward where appropriate, qualify std::move callsValeri Ochinski2023-10-131-10/+11
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #11767 from t895/gradle-stuffCharles Lombardo2023-10-133-11/+10
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | android: Remove unnecessary flag to extract native libs in AndroidManifest.xmlCharles Lombardo2023-10-131-1/+0
| * | | | | | | | | android: Update dependenciesCharles Lombardo2023-10-131-7/+7
| * | | | | | | | | android: Update ndk to 26.1.10909125Charles Lombardo2023-10-131-1/+1
| * | | | | | | | | android: Update AGP to 8.1.2Charles Lombardo2023-10-131-2/+2
* | | | | | | | | | android: Fix incorrect assumption for driver installation validationCharles Lombardo2023-10-131-12/+13
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | Improvement in Directory Path Detection for Shortcuts (#11749)DanielSvoboda2023-10-131-30/+38
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #11769 from liamwhite/qt-ownership-issueliamwhite2023-10-133-6/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | qt: ensure worker cancellation is complete before clearingLiam2023-10-133-6/+11
| |/ / / / / / /
* | | | | | | | Merge pull request #11766 from liamwhite/open-sesameliamwhite2023-10-131-0/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | k_page_table: add missing page group open when locking memoryLiam2023-10-121-0/+5
* | | | | | | | | Merge pull request #11649 from t895/driver-managerliamwhite2023-10-1336-299/+1039
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | android: Add GPU driver management fragmentCharles Lombardo2023-10-1232-263/+1010
| * | | | | | | | android: Use application context for all FileUtil functionsCharles Lombardo2023-10-018-41/+34
* | | | | | | | | Merge pull request #11746 from liamwhite/relrliamwhite2023-10-132-2/+42
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | jit: add support for relr-type relocationsLiam2023-10-112-2/+42
* | | | | | | | | | Merge pull request #11763 from liamwhite/lto-noinlineliamwhite2023-10-132-8/+12
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel: mark TLS accessors as noinline for non-MSVC LTOLiam2023-10-122-8/+12
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | service: caps: Remove ambiguous callNarr the Reg2023-10-121-2/+2
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #11753 from german77/timex2liamwhite2023-10-125-51/+134
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service: caps: Fix GetAlbumFileList3AaeAruid and GetAlbumFileList0AafeAruidDeprecatedNarr the Reg2023-10-125-51/+134
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11751 from Kelebek1/transition_msaa_imageliamwhite2023-10-124-0/+33
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | Transition MSAA images to general layout without uploading dataKelebek12023-10-124-0/+33
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #11740 from german77/shorcutsliamwhite2023-10-111-28/+53
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu: Save multiple resolutions per iconNarr the Reg2023-10-111-28/+53
* | | | | | | | | Merge pull request #11744 from Kelebek1/no_res_no_rescaledliamwhite2023-10-112-14/+16
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | Do not set rescaled flag when rescaling is disabledKelebek12023-10-112-14/+16
* | | | | | | | | Merge pull request #11734 from Kelebek1/device_local_buffer_allocliamwhite2023-10-111-4/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Not not allocate DeviceLocal buffers as mappedKelebek12023-10-101-4/+4
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11735 from Kelebek1/clear_command_buffer_post_dspliamwhite2023-10-112-0/+11
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Clear DSP buffer after each executionKelebek12023-10-102-0/+11
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11683 from Kelebek1/do_not_sync_on_written_bufferliamwhite2023-10-111-22/+24
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Mark a buffer GPU modified after the buffers are confirmed, do not double synch themKelebek12023-10-051-22/+24
* | | | | | | | | | Merge pull request #11144 from flodavid/masterliamwhite2023-10-113-7/+92
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | yuzu: Enable controller interaction in Controller Appletflodavid2023-07-253-7/+92
* | | | | | | | | | Merge pull request #11743 from Squall-Leonhart/IFREMOVEDFernando S2023-10-111-2/+2
|\ \ \ \ \ \ \ \ \ \ | | |_|_|_|_|/ / / / | |/| | | | | | | |
| * | | | | | | | | Fix mistaken usage of info.block instead of level_info.blockSquall-Leonhart2023-10-111-2/+2
* | | | | | | | | | Merge pull request #11534 from Squall-Leonhart/IFREMOVEDliamwhite2023-10-101-21/+20
|\| | | | | | | | | | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | Reuse part of my previous idea to to use num_levels to check within AdjustMipBlockSizeSquall-Leonhart2023-09-191-14/+20
| * | | | | | | | Partial revert of #10433Squall Leonhart2023-09-181-9/+2
* | | | | | | | | Merge pull request #11718 from liamwhite/arm64-native-clockFernando S2023-10-104-1/+134
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common: add arm64 native clockLiam2023-10-084-1/+134
* | | | | | | | | | Merge pull request #11650 from german77/lle_albumFernando S2023-10-1031-246/+1206
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | service: caps: Implement album manager and reorganize serviceNarr the Reg2023-10-0820-521/+855
| * | | | | | | | | | service: Stub multiple functions to increase stability of album appletNarr the Reg2023-10-087-6/+144
| * | | | | | | | | | service: caps: Partially implement IAlbumAccessorServiceNarr the Reg2023-10-025-15/+450
| * | | | | | | | | | yuzu: Allow to launch album applet from firmwareNarr the Reg2023-10-025-0/+53
* | | | | | | | | | | Merge pull request #11686 from liamwhite/trmemFernando S2023-10-105-17/+160
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | kernel: implement transfer memoryLiam2023-10-055-17/+160
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11716 from Squall-Leonhart/Z327444liamwhite2023-10-081-0/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | add Z32, FLOAT, UINT, UINT, UINT, LINEAR to format lookup tableSquall Leonhart2023-10-081-0/+2
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11705 from FearlessTobi/windows-scliamwhite2023-10-087-26/+157
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu: Add desktop shortcut support for WindowsFearlessTobi2023-10-087-26/+157
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10519 from mdmrk/masterliamwhite2023-10-0816-14/+337
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Address review commentsLiam2023-08-2811-270/+259
| * | | | | | | | | yuzu-qt: Track play timeMario2023-08-2715-0/+334
* | | | | | | | | | Merge pull request #11656 from liamwhite/recreate-surface-automaticallyliamwhite2023-10-076-52/+36
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | vk_present_manager: recreate surface on any surface lossLiam2023-10-036-52/+36
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11677 from Squall-Leonhart/D32FTOABGR8liamwhite2023-10-075-0/+31
|\ \ \ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
| * | | | | | | | | update shader to confirmed format copySquall Leonhart2023-10-071-1/+1
| * | | | | | | | | lets not convert depth to greyscale since this makes the exhaust and tire smoke light gray/whiteSquall-Leonhart2023-10-041-1/+1
| * | | | | | | | | Fix CI Formatting checkSquall-Leonhart2023-10-041-2/+2
| * | | | | | | | | Implements D32_Float to A8B8G8R8_UNORM format copySquall-Leonhart2023-10-045-0/+31
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11630 from Kelebek1/clear_stencil_requires_depth_testliamwhite2023-10-072-2/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Enable depth test on stencil clear pathKelebek12023-09-282-2/+5
* | | | | | | | | | Merge pull request #11639 from liamwhite/no-program-id-changeliamwhite2023-10-073-1/+10
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | loader: don't reassign program ID on npdm reparseLiam2023-09-303-1/+10
* | | | | | | | | | | Merge pull request #11648 from liamwhite/unicode-nonsenseliamwhite2023-10-073-2/+21
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gdbserver: use numeric character references for unicodeLiam2023-10-023-2/+21
| | |_|_|_|_|_|_|_|/ / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11544 from Kelebek1/reduce_stream_buffer_renderdocliamwhite2023-10-074-14/+59
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Allow GPUs without rebar to open multiple RenderDoc capturesKelebek12023-10-064-14/+59
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11669 from german77/settings2liamwhite2023-10-075-2/+11
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core: Update clocks when settings are savedNarr the Reg2023-10-041-0/+4
| * | | | | | | | | | | yuzu: Fix mute when in background settingNarr the Reg2023-10-044-2/+7
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11688 from Kelebek1/x8d42liamwhite2023-10-0710-2/+21
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Implement X8_D24 formatKelebek12023-10-0610-2/+21
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11684 from Kelebek1/disable_push_descriptor_maxwellliamwhite2023-10-071-12/+43
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Rework nvidia architecture detection, disable push descriptor for Pascal and olderKelebek12023-10-051-12/+43
| | |_|_|_|_|_|_|/ / | |/| | | | | | | |
* | | | | | | | | | ci: fix new codespell errorsLiam2023-10-0310-10/+10
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #11652 from liamwhite/shutdown-goes-brrrliamwhite2023-10-021-4/+8
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | k_page_table: skip page table clearing on finalizationLiam2023-10-021-4/+8
* | | | | | | | | | Merge pull request #11655 from liamwhite/additional-dump-targetsliamwhite2023-10-021-9/+17
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | qt: add additional romfs dump targetsLiam2023-10-021-9/+17
| |/ / / / / / / / /
* / / / / / / / / / fsp-srv: enable auto save data creation on initLiam2023-10-021-0/+3
|/ / / / / / / / /
* | | | | | | | | Merge pull request #11632 from german77/hle_cabinetliamwhite2023-10-0223-60/+985
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | service: nfc: Implement SetRegisterInfoPrivate mii supportNarr the Reg2023-10-011-7/+2
| * | | | | | | | service: am: Implement shared bufferNarr the Reg2023-10-012-10/+125
| * | | | | | | | service: nvnflinger: Implement shared bufferNarr the Reg2023-10-0112-22/+572
| * | | | | | | | service: ldn: Implement lp2p:m and stub IMonitorServiceNarr the Reg2023-10-011-2/+89
| * | | | | | | | service: am: Set push in arguments according to the launched appletNarr the Reg2023-10-017-17/+120
| * | | | | | | | yuzu: Allow to launch cabinet applet from firmwareNarr the Reg2023-10-013-2/+77
| |/ / / / / / /
* | | / / / / / Query Cache: Fix memory leak.Fernando Sahmkow2023-10-012-0/+2
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #11493 from merryhime/evtFernando S2023-09-292-39/+52
|\ \ \ \ \ \ \
| * | | | | | | core_timing: Attempt to reduce heap siftingMerry2023-09-161-11/+22
| * | | | | | | core_timing: Use a fibonacci heapMerry2023-09-162-33/+35
* | | | | | | | Merge pull request #11546 from Kelebek1/core_timing_mutexFernando S2023-09-293-6/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | Reduce core timing mutex contentionKelebek12023-09-203-6/+11
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #11622 from liamwhite/qcr-reg1Fernando S2023-09-291-2/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | renderer_vulkan: fix query cache for homebrewLiam2023-09-281-2/+4
* | | | | | | | | Don't send a double focus change messageKelebek12023-09-291-3/+0
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | Merge pull request #11626 from german77/mii-fixliamwhite2023-09-285-4/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | service: mii: Fix reported bugsgerman772023-09-285-4/+6
* | | | | | | | | Merge pull request #11402 from FernandoS27/depth-bias-controlliamwhite2023-09-287-3/+69
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Vulkan: add temporary workaround for AMDVLKFernando Sahmkow2023-09-165-2/+20
| * | | | | | | | | Vulkan: Implement Depth Bias ControlFernando Sahmkow2023-09-164-3/+51
* | | | | | | | | | Merge pull request #11590 from liamwhite/attributeliamwhite2023-09-281-0/+41
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | fsp-srv: add GetFileSystemAttributeLiam2023-09-261-0/+41
* | | | | | | | | | | Merge pull request #11604 from t895/only-install-nspliamwhite2023-09-283-12/+5
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Qt: Remove ability to install xci filesCharles Lombardo2023-09-272-8/+5
| * | | | | | | | | | | android: Remove ability to install xci filesCharles Lombardo2023-09-271-4/+0
* | | | | | | | | | | | Merge pull request #11556 from GPUCode/msaa-image-vkFernando S2023-09-287-36/+229
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | host_shaders: More proper handling of x2 MSAA copiesGPUCode2023-09-252-4/+10
| * | | | | | | | | | | renderer_vulkan: Implement MSAA copiesGPUCode2023-09-255-32/+219
* | | | | | | | | | | | Merge pull request #11613 from t895/fragment-exception-changeCharles Lombardo2023-09-283-17/+40
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | android: Prevent crash when trying to change pages in setup fragmentCharles Lombardo2023-09-271-2/+6
| * | | | | | | | | | | android: Prevent setup fragment crash in backgroundCharles Lombardo2023-09-271-2/+4
| * | | | | | | | | | | android: Don't update views if binding is null in onConfigurationChangedCharles Lombardo2023-09-271-0/+4
| * | | | | | | | | | | android: Don't wait for post to update input overlay visibilityCharles Lombardo2023-09-271-9/+3
| * | | | | | | | | | | android: Close activity with toast if emulation has no gameCharles Lombardo2023-09-272-4/+23
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11616 from t895/save-errorCharles Lombardo2023-09-271-1/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | android: Correctly reload settings file during resetCharles Lombardo2023-09-271-1/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #11603 from t895/consolidate-installsCharles Lombardo2023-09-2733-421/+616
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | android: Adjust failure dialogs for user data and firmware installersCharles Lombardo2023-09-262-3/+13
| * | | | | | | | | | android: Fix cancel behavior on indeterminate progress dialog fragmentCharles Lombardo2023-09-261-4/+14
| * | | | | | | | | | android: Refactor zip code into FileUtilCharles Lombardo2023-09-264-91/+89
| * | | | | | | | | | android: Consolidate installers to one fragmentCharles Lombardo2023-09-2630-339/+516
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11602 from t895/case-fixCharles Lombardo2023-09-264-8/+21
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | android: Use a different string for the content install dialogCharles Lombardo2023-09-262-1/+2
| * | | | | | | | | | android: Fix case bug for installing game contentCharles Lombardo2023-09-263-7/+19
* | | | | | | | | | | settings_setting: Read audio enginelat9nq2023-09-261-0/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #11594 from t895/rotation-fixCharles Lombardo2023-09-262-5/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | android: Prevent nav bar shade from laying out across screenCharles Lombardo2023-09-262-5/+7
| |/ / / / / / / / /
* | | | | | | | | | android: Prevent click ripple from appearing on loading cardCharles Lombardo2023-09-261-1/+2
* | | | | | | | | | android: Remove bottom attribute from navigation viewCharles Lombardo2023-09-261-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #11583 from t895/overlay-fix-2Charles Lombardo2023-09-251-6/+9
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | android: Use measured size of view for input overlay boundsCharles Lombardo2023-09-251-6/+9
* | | | | | | | | Merge pull request #11225 from FernandoS27/no-laxatives-in-santas-cookiesliamwhite2023-09-2545-366/+3553
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Query Cache: Fix Prefix SumsFernando Sahmkow2023-09-235-132/+175
| * | | | | | | | | Query Cache: Fix behavior in Normal AccuracyFernando Sahmkow2023-09-232-0/+23
| * | | | | | | | | Query Cache: Simplify Prefix Sum compute shaderFernando Sahmkow2023-09-236-74/+253
| * | | | | | | | | Query Cache: Implement host side sample counting.Fernando Sahmkow2023-09-235-48/+348
| * | | | | | | | | Query Cache: Fix guest side sample countingFernando Sahmkow2023-09-235-46/+97
| * | | | | | | | | Query Cache: address issuesFernando Sahmkow2023-09-2321-214/+270
| * | | | | | | | | QueryCache: Implement dependant queries.Fernando Sahmkow2023-09-234-5/+180
| * | | | | | | | | Macro HLE: Add DrawIndirectByteCountFernando Sahmkow2023-09-234-5/+40
| * | | | | | | | | Query Cachge: Fully rework Vulkan's query cacheFernando Sahmkow2023-09-2335-337/+1555
| * | | | | | | | | Query Cache: Setup Base reworkFernando Sahmkow2023-09-237-0/+1107
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11569 from german77/lle_appletliamwhite2023-09-2411-33/+360
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service: mii: Limit checks to string sizegerman772023-09-241-1/+1
| * | | | | | | | | service: hid: Set last connected controller as activegerman772023-09-241-0/+1
| * | | | | | | | | service: am: Stub to exit applet cleanlygerman772023-09-242-3/+31
| * | | | | | | | | service: am: Implement stuff needed for Mii Editgerman772023-09-243-22/+238
| * | | | | | | | | service: fsp: Implement CreateSaveDataFileSystemBySystemSaveDataId and OpenSaveDataFileSystemBySystemSaveDataIdgerman772023-09-242-2/+24
| * | | | | | | | | service: ns: Implement GetSharedFontInOrderOfPriorityForSystemgerman772023-09-241-4/+13
| * | | | | | | | | yuzu: Add button to boot mii edit from firmwaregerman772023-09-243-1/+52
* | | | | | | | | | Merge pull request #11562 from GPUCode/srgb-madnessliamwhite2023-09-241-15/+5
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | vk_texture_cache: Limit srgb block to transcoding onlyGPUCode2023-09-211-15/+5
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11165 from Morph1984/ds_blitliamwhite2023-09-243-29/+47
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | vulkan_device: Test depth stencil blit support by formatMorph2023-08-013-29/+47
| * | | | | | | | | vulkan_device: Return true if either depth/stencil format supports blitMorph2023-07-271-1/+1
* | | | | | | | | | Merge pull request #11567 from liamwhite/fixing-my-errorFernando S2023-09-232-13/+9
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | emit_spirv: fix incorrect use of descriptor index in image atomicsLiam2023-09-222-13/+9
* | | | | | | | | | android: Use smaller read buffer size for exporting user dataCharles Lombardo2023-09-221-1/+10
* | | | | | | | | | android: Adjust valid user data checkCharles Lombardo2023-09-221-1/+2
* | | | | | | | | | Merge pull request #11561 from german77/hle_appletliamwhite2023-09-228-73/+139
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | am: mii_edit: Implement DB operationsNarr the Reg2023-09-228-73/+139
* | | | | | | | | | | Merge pull request #11557 from GPUCode/brr-formatliamwhite2023-09-224-3/+25
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | renderer_vulkan: Correct component order for A4B4G4R4_UNORMGPUCode2023-09-214-3/+25
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11563 from Kelebek1/dma_regsliamwhite2023-09-222-28/+32
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Fix DMA engine register offsetsKelebek12023-09-212-28/+32
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11564 from t895/overlay-inset-fixCharles Lombardo2023-09-221-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | android: Update androidx window library to 1.2.0-beta03Charles Lombardo2023-09-211-1/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11555 from yuzu-emu/revert-11551-allow-save-imports-alwaysliamwhite2023-09-2116-13/+48
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Revert "android: Allow save imports always"Charles Lombardo2023-09-2116-13/+48
* | | | | | | | | | pfs: Fix reading filenames past the buffer endrkfg2023-09-211-0/+1
|/ / / / / / / / /
* | | | | | | | | android: Remove unused strings related to the save managerCharles Lombardo2023-09-2015-30/+0
* | | | | | | | | android: Allow importing saves even if no saves are foundCharles Lombardo2023-09-201-18/+13
* | | | | | | | | android: Add import/export buttons for user dataCharles Lombardo2023-09-1913-40/+311
|/ / / / / / / /
* | | | | | | | Merge pull request #11542 from t895/touch-offset-fixliamwhite2023-09-194-28/+23
|\ \ \ \ \ \ \ \
| * | | | | | | | android: Ignore validation layers library in gitCharles Lombardo2023-09-191-0/+3
| * | | | | | | | android: Don't pause emulation when entering PiPCharles Lombardo2023-09-191-1/+1
| * | | | | | | | android: Fix showing input overlay in PiPCharles Lombardo2023-09-191-1/+1
| * | | | | | | | android: Properly update emulation surfaceCharles Lombardo2023-09-192-25/+11
| * | | | | | | | android: Export PiP receiver on API 33 and laterCharles Lombardo2023-09-171-1/+7
* | | | | | | | | Merge pull request #11526 from german77/mii_service_v2liamwhite2023-09-1919-244/+1861
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service: mii: Address review commentsgerman772023-09-187-22/+24
| * | | | | | | | | service: mii: Implement the rest of the servicegerman772023-09-183-103/+751
| * | | | | | | | | service: mii: Implement database managergerman772023-09-183-0/+480
| * | | | | | | | | service: mii: Implement figurine databasegerman772023-09-183-0/+210
| * | | | | | | | | service: mii: Add device crc16german772023-09-181-0/+26
| * | | | | | | | | service: nfc: Fully Implement GetRegisterInfoPrivategerman772023-09-181-3/+5
| * | | | | | | | | service: mii: Complete structs and fix mistakesgerman772023-09-189-138/+387
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #11536 from abouvier/renderdocliamwhite2023-09-191-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | cmake: prefer system renderdoc headerAlexandre Bouvier2023-09-181-1/+1
* | | | | | | | | | Merge pull request #11538 from cathyjf/renderdoc-check-correct-win32-symbolliamwhite2023-09-191-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | renderdoc: Check for `_WIN32` symbol rather than `WIN32`Cathy J. Fitzpatrick2023-09-181-1/+1
| |/ / / / / / / / /
* / / / / / / / / / aoc: stub purchase info callsLiam2023-09-181-2/+18
|/ / / / / / / / /
* | | | | | | | | Merge pull request #11258 from Squall-Leonhart/Z16_Assert_Fixliamwhite2023-09-181-0/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Needed to make this an extra case so it didnt also start asserting in BOTW.Squall-Leonhart2023-08-111-0/+2
| * | | | | | | | | Fix an assert in the format lookup table fir Z16Squall Leonhart2023-08-111-1/+1
* | | | | | | | | | Merge pull request #11520 from Kelebek1/estimated_timeliamwhite2023-09-182-6/+8
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Do not consider voice commands in time estimation, fix adpcm estimateKelebek12023-09-182-6/+8
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | mii_types: Remove null terminator checklat9nq2023-09-171-4/+1
* | | | | | | | | Merge pull request #11524 from t895/signing-ciliamwhite2023-09-171-1/+18
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | android: Set up signing config for release buildsCharles Lombardo2023-09-171-1/+18
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #11522 from liamwhite/vfs-needs-resultsliamwhite2023-09-171-1/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | registered_cache: correct file deletion caseLiam2023-09-171-1/+3
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #11460 from Kelebek1/hw_opusliamwhite2023-09-1727-411/+1898
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | Reimplement HardwareOpusKelebek12023-09-1627-411/+1898
| |/ / / / / / /
* | | | | | | | android: Use 1 worker for shader compilation for all devicesCharles Lombardo2023-09-171-4/+5
* | | | | | | | android: Collect task state once view is createdCharles Lombardo2023-09-161-9/+25
|/ / / / / / /
* | | | | | | Merge pull request #11519 from german77/system-policyliamwhite2023-09-164-8/+52
|\ \ \ \ \ \ \
| * | | | | | | service: hid: Implement ApplyNpadSystemCommonPolicygerman772023-09-164-8/+52
* | | | | | | | Merge pull request #11518 from german77/bad-npadliamwhite2023-09-165-36/+42
|\ \ \ \ \ \ \ \
| * | | | | | | | hid: service: Remove outdated field from npadgerman772023-09-162-27/+14
| * | | | | | | | hid: service: Implement Last active Npadgerman772023-09-164-1/+20
| * | | | | | | | service: hid: Ensure state is correctgerman772023-09-161-8/+8
| |/ / / / / / /
* | | | | | | | Merge pull request #11517 from german77/amiibo-formatliamwhite2023-09-161-6/+8
|\ \ \ \ \ \ \ \
| * | | | | | | | service: nfc: Fix amiibo formattinggerman772023-09-161-6/+8
| |/ / / / / / /
* | | | | | | | Merge pull request #11500 from liamwhite/debug-stuffliamwhite2023-09-1612-17/+36
|\ \ \ \ \ \ \ \
| * | | | | | | | core: improve debug workflowLiam2023-09-1412-17/+36
* | | | | | | | | Merge pull request #11499 from Squall-Leonhart/bitlockerfixliamwhite2023-09-161-6/+9
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | add std::error_code for std::filesystem exceptionsSquall-Leonhart2023-09-141-6/+9
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11492 from lat9nq/c-numeric-conversionsliamwhite2023-09-1611-65/+200
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | shared_widget: Use default literals morelat9nq2023-09-142-21/+22
| * | | | | | | | | settings_common: Fix typolat9nq2023-09-141-1/+1
| * | | | | | | | | settings_setting: Don't remove the AudioEngine workaroundlat9nq2023-09-131-0/+3
| * | | | | | | | | cmd/yuzu: Remove uncaught usage of stoilat9nq2023-09-131-2/+3
| * | | | | | | | | cmd/config: Remove uncaught usage of stoullat9nq2023-09-131-1/+1
| * | | | | | | | | shared_widget: Forward-port Citra changeslat9nq2023-09-132-31/+134
| * | | | | | | | | configure_ui: Remove unnecessary usage of stoullat9nq2023-09-131-5/+2
| * | | | | | | | | cheat_engine: Remove uncaught usage of stoullat9nq2023-09-131-1/+1
| * | | | | | | | | ips_layer: Remove uncaught usage of stoul/lllat9nq2023-09-131-2/+2
| * | | | | | | | | key_manager: Remove uncaught usage of stoullat9nq2023-09-131-4/+4
| * | | | | | | | | settings: Retro-port Citra Settings worklat9nq2023-09-132-8/+38
| * | | | | | | | | android/config: Remove uncaught usage of stoullat9nq2023-09-131-1/+1
* | | | | | | | | | Merge pull request #11483 from FearlessTobi/save-size-maxliamwhite2023-09-163-2/+15
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | am: Stub GetSaveDataSizeMaxFearlessTobi2023-09-122-1/+14
| * | | | | | | | | | bsd: Demote "Select" log to dehugFearlessTobi2023-09-121-1/+1
* | | | | | | | | | | Merge pull request #11475 from GPUCode/renderdoc-hotkeyliamwhite2023-09-1610-48/+165
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
| * | | | | | | | | | debug: Add renderdoc capture hotkeyGPUCode2023-09-1410-48/+165
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | android: Remove settings interface specifically for audio muteCharles Lombardo2023-09-154-31/+5
* | | | | | | | | | Merge pull request #11507 from t895/emulation-stop-fixCharles Lombardo2023-09-151-2/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | android: Return the correct status code on emulation stopCharles Lombardo2023-09-151-2/+3
* | | | | | | | | | | Merge pull request #11506 from t895/icon-fixCharles Lombardo2023-09-154-3/+43
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | android: Use resource as shortcut intermediaryCharles Lombardo2023-09-154-3/+43
* | | | | | | | | | | Merge pull request #11505 from t895/config-patchCharles Lombardo2023-09-151-3/+0
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | android: Don't reinitialize settings on emulation startCharles Lombardo2023-09-151-3/+0
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #11504 from t895/emu-argsCharles Lombardo2023-09-151-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | android: Fix emulation to settings navigation argsCharles Lombardo2023-09-151-1/+1
* | | | | | | | | | | android: Delay collecting UI state in games fragmentCharles Lombardo2023-09-151-4/+4
|/ / / / / / / / / /
* | | | | | | | | | android: Refactor menu tags to enumCharles Lombardo2023-09-149-46/+39
* | | | | | | | | | android: Use StateFlow instead of LiveDataCharles Lombardo2023-09-1416-249/+367
|/ / / / / / / / /
* | | | | | | | | Merge pull request #11496 from liamwhite/ngcliamwhite2023-09-147-70/+158
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | ngc: implement serviceLiam2023-09-147-70/+158
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #11479 from Kelebek1/check_all_fbsliamwhite2023-09-141-1/+14
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Look for the most recently modified image for presentKelebek12023-09-111-1/+14
* | | | | | | | | | Merge pull request #11433 from liamwhite/shutdown-oopsieliamwhite2023-09-141-7/+13
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | polyfill_thread: ensure mutex was locked before signaling stopLiam2023-09-021-7/+13
* | | | | | | | | | | shader_recompiler: skip sampler for buffer textures (#11435)liamwhite2023-09-143-6/+2
| |_|/ / / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #11385 from liamwhite/acceptcancelliamwhite2023-09-133-3/+91
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | internal_network: log error on interrupt pipe read failureLiam2023-09-081-1/+4
| * | | | | | | | | internal_network: cancel pending socket operations on application process terminationLiam2023-08-273-3/+88
* | | | | | | | | | Merge pull request #11486 from liamwhite/system-verificationliamwhite2023-09-137-1/+148
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | qt: add verification for installed contentsLiam2023-09-127-1/+148
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11480 from german77/mii_serviceliamwhite2023-09-1324-1943/+4466
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | service: mii: Remove most magic valuesNarr the Reg2023-09-1210-1069/+1537
| * | | | | | | | | | mii: service: Address reviewgerman772023-09-1113-104/+135
| * | | | | | | | | | mii: Prepare Interface for new implementationgerman772023-09-116-138/+210
| * | | | | | | | | | service: mii: Fix ver3 inconsistenciesgerman772023-09-119-217/+473
| * | | | | | | | | | service: mii: move char info operationsgerman772023-09-114-21/+576
| * | | | | | | | | | service: mii: Move store data operationsgerman772023-09-115-73/+512
| * | | | | | | | | | service: mii: Move core data operationsgerman772023-09-115-246/+730
| * | | | | | | | | | service: mii: Move ver3 operationsgerman772023-09-117-243/+241
| * | | | | | | | | | service: mii: separate mii types into their own filegerman772023-09-1120-542/+586
| * | | | | | | | | | service: mii: Move all raw data to it's filegerman772023-09-115-381/+479
| * | | | | | | | | | service: mii: Add mii util and resultgerman772023-09-115-11/+89
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11473 from liamwhite/fix-launch-paramliamwhite2023-09-1310-36/+71
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | am: Implement UserChannel parametersFearlessTobi2023-09-109-19/+70
| * | | | | | | | | | am: Remove bcat from PopLaunchParameterFearlessTobi2023-09-102-21/+5
* | | | | | | | | | | Merge pull request #11447 from xcfrg/portable-compile-outliamwhite2023-09-122-2/+8
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | add a compile time option to allow disabling portable modexcfrg2023-09-072-2/+8
* | | | | | | | | | | ci: fix msvc when used with LTO (#11459)liamwhite2023-09-111-0/+1
| |_|/ / / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #11450 from lat9nq/no-vk-device-fixliamwhite2023-09-102-13/+26
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu-qt: Use Null when OpenGL is not compiledlat9nq2023-09-051-1/+9
| * | | | | | | | | | yuzu-qt: Update API Text for broken Vulkanlat9nq2023-09-051-0/+1
| * | | | | | | | | | configure_graphics: Capture by referencelat9nq2023-09-051-1/+1
| * | | | | | | | | | configure_graphics: Fix handling of broken Vulkanlat9nq2023-09-051-12/+16
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11436 from liamwhite/bad-formatliamwhite2023-09-101-1/+6
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | shader_recompiler: always declare image format for image buffersLiam2023-09-021-1/+6
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11456 from liamwhite/worse-integrity-verificationliamwhite2023-09-1012-1/+220
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | core: implement basic integrity verificationLiam2023-09-0612-1/+220
* | | | | | | | | | | Merge pull request #11465 from Kelebek1/skip_remaining_resetliamwhite2023-09-105-27/+14
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Do not reset the command buffer command count each timeKelebek12023-09-075-27/+14
* | | | | | | | | | | | Merge pull request #11467 from Kelebek1/fix_decodeliamwhite2023-09-104-52/+72
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Fix data source version 1 command loopingKelebek12023-09-084-52/+72
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #11470 from GPUCode/bundle-vvlliamwhite2023-09-105-53/+6
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | renderer_vulkan: Remove debug reportGPUCode2023-09-085-53/+6
* | | | | | | | | | | | vk_buffer_cache: Respect max vertex bindings in BindVertexBuffers (#11471)GPUCode2023-09-101-4/+7
* | | | | | | | | | | | service: mii: Fix broken mii on MK8Narr the Reg2023-09-076-7/+118
| |/ / / / / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #11428 from Kelebek1/adsp_reworkliamwhite2023-09-06173-1257/+1051
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Rework ADSP into a wrapper for appsKelebek12023-09-04173-1257/+1051
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #11434 from danilaml/fix-warningsliamwhite2023-09-0613-20/+17
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | msvc: set warning level to /W4 globallyDanila Malyutin2023-09-0313-20/+17
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11437 from liamwhite/dump-shenanigansliamwhite2023-09-061-26/+50
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | qt: measure romfs dump completion by bytes readLiam2023-09-031-26/+50
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #11451 from german77/mob_miiliamwhite2023-09-063-105/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | service: mii: Fix default mii databasegerman772023-09-053-105/+3
| |/ / / / / / / / /
* / / / / / / / / / core: Add support for loading NSPs with personalized tickets. (#10048)Steveice102023-09-055-145/+186
|/ / / / / / / / /
* | | | | | | | | Merge pull request #11381 from liamwhite/romfs-dumpliamwhite2023-09-022-51/+72
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | qt: ensure packed update nca is applied to the correct baseLiam2023-08-291-0/+7
| * | | | | | | | | qt: fix romfs dumping for multiprogram applicationsLiam2023-08-292-51/+65
* | | | | | | | | | Merge pull request #11383 from FernandoS27/are-you-a-wabbitliamwhite2023-09-0213-13/+141
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | VideoCore: Implement DispatchIndirectFernando Sahmkow2023-08-2711-13/+119
| * | | | | | | | | | Shader Recompiler: Auto stub special registers and dump pipelines on exception.Fernando Sahmkow2023-08-272-1/+15
| * | | | | | | | | | DMA Pusher: Fix regression caused by guest memory optimizationsFernando Sahmkow2023-08-261-0/+8
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11384 from liamwhite/am-shutdownliamwhite2023-09-024-13/+41
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | am: shorten shutdown timeout when lock is not heldLiam2023-08-264-13/+41
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #11393 from FernandoS27/bayo-got-busted-upliamwhite2023-09-021-1/+5
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Maxwell3D: Improve Index buffer size estimation.Fernando Sahmkow2023-08-271-1/+5
* | | | | | | | | | | Merge pull request #11412 from liamwhite/key-area-keysliamwhite2023-09-021-4/+13
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | vfs: ensure key area keys are validatedLiam2023-08-291-4/+13
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | general: make -fwrapv generic to all architectures (#11379)liamwhite2023-09-021-1/+2
| |_|_|/ / / / / / / |/| | | | | | | | |
* | | | | | | | | | shader_recompiler: fix emulation of 3D textureGradLiam2023-09-022-3/+34
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | android: Fix game content installerCharles Lombardo2023-08-312-85/+80
* | | | | | | | | android: Combine LongMessageDialogFragment with MessageDialogFragmentCharles Lombardo2023-08-315-98/+47
* | | | | | | | | android: Support dynamic app shortcutsCharles Lombardo2023-08-301-0/+21
* | | | | | | | | Merge pull request #11405 from t895/emulation-loadingCharles Lombardo2023-08-3028-237/+393
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | android: Separate emulation states from emulation mutexCharles Lombardo2023-08-301-4/+2
| * | | | | | | | | android: Game loading/shutting down indicatorsCharles Lombardo2023-08-3026-211/+312
| * | | | | | | | | android: Create custom game icon loaderCharles Lombardo2023-08-302-22/+79
* | | | | | | | | | hwopus: Implement GetWorkBufferSizeExExFearlessTobi2023-08-302-1/+6
|/ / / / / / / / /
* | | | | | | | | Merge pull request #11380 from t895/settings-integrationCharles Lombardo2023-08-3076-2109/+2219
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | android: Don't reload settings when stopping settings activityCharles Lombardo2023-08-301-2/+0
| * | | | | | | | | android: Add optional androidDefault property to settingsCharles Lombardo2023-08-303-7/+15
| * | | | | | | | | android: Proper state restoration on settings dialogsCharles Lombardo2023-08-309-198/+319
| * | | | | | | | | android: Add search for settingsCharles Lombardo2023-08-308-1/+372
| * | | | | | | | | android: Implement paired settingsCharles Lombardo2023-08-309-241/+335
| * | | | | | | | | android: Prevent infinite switch toggle loopCharles Lombardo2023-08-301-1/+3
| * | | | | | | | | android: Migrate settings to navigation componentCharles Lombardo2023-08-3028-567/+371
| * | | | | | | | | android: Trim settings enums and itemsCharles Lombardo2023-08-3016-321/+133
| * | | | | | | | | android: Expose interface for getting settings from native codeCharles Lombardo2023-08-3049-969/+869
* | | | | | | | | | Merge pull request #11413 from t895/intentsCharles Lombardo2023-08-305-12/+45
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | android: Support intents to emulation activityCharles Lombardo2023-08-295-12/+45
* | | | | | | | | | Merge pull request #11408 from Kelebek1/fix_audio_node_idliamwhite2023-08-291-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Fix node id index in DropVoicesKelebek12023-08-281-1/+1
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11409 from liamwhite/splatoon-nsd-v2liamwhite2023-08-292-2/+21
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | sfdnsres: ensure lp1 is not resolvedLiam2023-08-282-2/+21
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #11112 from danilaml/nvdec-deinterlaceliamwhite2023-08-291-1/+2
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | Use initial_frame to check interlaced flagDanila Malyutin2023-08-271-1/+2
| |/ / / / / / / /
* | | | | | | | | Merge pull request #11392 from t895/layout-troublesCharles Lombardo2023-08-294-46/+33
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | android: Don't set a default emulation orientationCharles Lombardo2023-08-271-1/+0
| * | | | | | | | android: Properly adjust emulation surface aspect ratioCharles Lombardo2023-08-273-45/+33
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #11390 from FearlessTobi/hwopus-multiliamwhite2023-08-292-3/+51
|\ \ \ \ \ \ \ \
| * | | | | | | | hwopus: Implement OpenHardwareOpusDecoderForMultiStreamEx and DecodeInterleavedForMultiStreamFearlessTobi2023-08-272-3/+51
| |/ / / / / / /
* | / / / / / / audio: allow more latency in cubeb initializationLiam2023-08-272-8/+3
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #11389 from FernandoS27/discard-fixFernando S2023-08-271-1/+9
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Buffer Cache: fix discard writes.Fernando Sahmkow2023-08-271-1/+9
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #11356 from lat9nq/console-mode-pgliamwhite2023-08-2725-40/+162
|\ \ \ \ \ \
| * | | | | | main: Fix docked mode button, clang 14 errorlat9nq2023-08-231-6/+6
| * | | | | | native: Use Docked Mode helperlat9nq2023-08-231-1/+1
| * | | | | | main: Access by referencelat9nq2023-08-231-1/+1
| * | | | | | config-android: Translate console mode settinglat9nq2023-08-231-1/+4
| * | | | | | general: Use console mode helper across projectlat9nq2023-08-2313-49/+34
| * | | | | | settings: Add docked mode helper functionlat9nq2023-08-232-0/+7
| * | | | | | config(qt): Sanitize docked handheld controllerlat9nq2023-08-222-0/+13
| * | | | | | shared_translation: Define use_docked_mode textslat9nq2023-08-221-1/+4
| * | | | | | general: Convert use_docked_mode to an enumerationlat9nq2023-08-2217-35/+74
| * | | | | | shared_widget: Implement radio groupslat9nq2023-08-222-1/+73
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #11359 from Kelebek1/check_suitable_backendliamwhite2023-08-275-38/+117
|\ \ \ \ \ \
| * | | | | | Pre-test opening a stream for audio backends, fall back to null if not suitable.Kelebek12023-08-235-38/+117
| |/ / / / /
* | | | | | Merge pull request #11317 from Kelebek1/macro_dumpsliamwhite2023-08-272-11/+20
|\ \ \ \ \ \
| * | | | | | Mark decompiled macros as decompiled on dump, dump shaders after translationKelebek12023-08-262-11/+20
* | | | | | | Avoid `$<CXX_COMPILER_ID:Clang>` because it doesn't include AppleClang.comex2023-08-261-9/+11
* | | | | | | Warnings cleanup for GCC 13 and Clang 16comex2023-08-264-10/+7
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #11377 from BenjaminHalko/reverse-slider-inputliamwhite2023-08-261-0/+1
|\ \ \ \ \ \
| * | | | | | ui: Fixed inverted controls on ReverseSlider widgetsBenjaminHalko2023-08-251-0/+1
* | | | | | | Merge pull request #11378 from t895/game-flagliamwhite2023-08-261-0/+1
|\ \ \ \ \ \ \
| * | | | | | | android: Use appCategory to specify the app is a gameCharles Lombardo2023-08-251-0/+1
* | | | | | | | Merge pull request #11370 from FearlessTobi/fix-filesizeliamwhite2023-08-261-1/+10
|\ \ \ \ \ \ \ \
| * | | | | | | | filesystem: Return correct error for RenameFile when dest_path already existsFearlessTobi2023-08-241-1/+10
* | | | | | | | | Merge pull request #11371 from FearlessTobi/fix-cli-updatesliamwhite2023-08-262-0/+39
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu/main: Ensure NCAs are registered in content provider when launching from CLIFearlessTobi2023-08-242-0/+39
* | | | | | | | | | ssl: tolerate handshake without hostname set (#11328)liamwhite2023-08-263-24/+14
* | | | | | | | | | registered_cache: create fake CNMT entries for program updates of multiprogram applications (#11319)liamwhite2023-08-261-9/+28
* | | | | | | | | | kernel: offset code entry point for 39-bit address space type (#11326)liamwhite2023-08-257-11/+33
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #11357 from liamwhite/lime-vfsbunnei2023-08-251-0/+44
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | android: jni: ensure NCAs from loaded filepath are registered in manual content providerLiam2023-08-231-0/+44
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | nvhost_as_gpu: ensure mappings are aligned to big page size when deallocatedLiam2023-08-251-1/+3
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #11327 from liamwhite/skyline-2liamwhite2023-08-243-2/+10
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | sockets: avoid locking around socket session callsLiam2023-08-203-2/+10
* | | | | | | | game_list_worker: Display correct size for NAX gamesFearlessTobi2023-08-241-10/+13
* | | | | | | | Merge pull request #11352 from t895/recurse-subfoldersliamwhite2023-08-231-9/+26
|\ \ \ \ \ \ \ \
| * | | | | | | | android: Search game directory recursivelyCharles Lombardo2023-08-221-9/+26
| | |/ / / / / / | |/| | | | | |
* / | | | | | | android: Set default build variant to mainlineRelWithDebInfo (#11358)Charles Lombardo2023-08-231-0/+2
|/ / / / / / /
* | | | | | | Merge pull request #11302 from vonchenplus/vulkan_macosliamwhite2023-08-223-9/+27
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Add macos moltenvk bundle, Add copy moltevk dylib scriptFeng Chen2023-08-223-9/+27
* | | | | | | Merge pull request #11303 from lat9nq/screenshots-configurableliamwhite2023-08-2214-27/+241
|\ \ \ \ \ \ \
| * | | | | | | uisettings: Add TODO for stretched aspect being ignoredlat9nq2023-08-171-0/+1
| * | | | | | | configure_ui: Silence MSVC warninglat9nq2023-08-161-1/+1
| * | | | | | | yuzu-qt: Screenshots depend more on the graphics settingslat9nq2023-08-1612-142/+127
| * | | | | | | yuzu-qt: Implement unspecified screenshot ratiolat9nq2023-08-164-11/+30
| * | | | | | | bootmanager: Remove old pathlat9nq2023-08-161-8/+3
| * | | | | | | configure_ui: Update the screenshots datalat9nq2023-08-161-4/+13
| * | | | | | | config: Read the entire screenshots categorylat9nq2023-08-161-2/+1
| * | | | | | | bootmanager: Consider the default resolutionlat9nq2023-08-161-1/+5
| * | | | | | | yuzu-qt: Enable specifying screenshot resolutionlat9nq2023-08-165-3/+198
| * | | | | | | settings: Add AspectRatio enum, split res scale functionlat9nq2023-08-163-3/+10
* | | | | | | | Merge pull request #11316 from FernandoS27/stop-premature-christmas-decoratingliamwhite2023-08-228-11/+261
|\ \ \ \ \ \ \ \
| * | | | | | | | Shader Recomnpiler: implement textuzreGrad 3D emulation constant propagationFernando Sahmkow2023-08-198-11/+261
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #11346 from t895/ktlint-fixliamwhite2023-08-221-0/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | android: lint: Delete generated ktlint folder between buildsCharles Lombardo2023-08-211-0/+5
* | | | | | | | | android: Show associated value in home settings (#11272)Charles Lombardo2023-08-216-4/+75
* | | | | | | | | Merge pull request #11309 from liamwhite/full-xciliamwhite2023-08-212-7/+42
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | file_sys/card_image: support dumps with prepended key areaLiam2023-08-182-7/+42
* | | | | | | | | | Merge pull request #11342 from liamwhite/skyline-4liamwhite2023-08-211-1/+8
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | patch_manager: apply manual HTML patches when presentLiam2023-08-211-1/+8
* | | | | | | | | | | Merge pull request #11149 from ameerj/astc-perf-prodliamwhite2023-08-212-535/+454
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | flatten color_valuesAmeer J2023-08-101-14/+9
| * | | | | | | | | | flatten encoding_valuesAmeer J2023-08-101-11/+10
| * | | | | | | | | | flatten result vectorAmeer J2023-08-101-14/+5
| * | | | | | | | | | GetUnquantizedWeightVectorAmeer J2023-08-091-69/+63
| * | | | | | | | | | Revert "HACK: Avoid swizzling and reuploading ASTC image every frame"Ameer J2023-08-065-39/+4
| * | | | | | | | | | HACK: Avoid swizzling and reuploading ASTC image every frameAmeer J2023-08-065-4/+39
| * | | | | | | | | | Compute ReplicateAmeer J2023-08-061-85/+20
| * | | | | | | | | | minorAmeer J2023-08-061-12/+6
| * | | | | | | | | | undo uintAmeer J2023-08-061-3/+3
| * | | | | | | | | | Revert "vulkan dims specialization"Ameer J2023-08-065-198/+27
| * | | | | | | | | | vulkan dims specializationameerj2023-08-065-27/+198
| * | | | | | | | | | small_block optAmeer J2023-08-061-4/+3
| * | | | | | | | | | remove TexelWeightParamsAmeer J2023-08-061-46/+31
| * | | | | | | | | | error/void extent funcsAmeer J2023-08-061-48/+43
| * | | | | | | | | | more packingAmeer J2023-08-061-109/+109
| * | | | | | | | | | Revert "uint result index"Ameer J2023-08-061-1/+1
| * | | | | | | | | | Revert "bfe instead of mod"Ameer J2023-08-061-15/+13
| * | | | | | | | | | Revert "global endpoints"Ameer J2023-08-061-36/+40
| * | | | | | | | | | global endpointsAmeer J2023-08-061-40/+36
| * | | | | | | | | | bfe instead of modAmeer J2023-08-061-13/+15
| * | | | | | | | | | uint result indexAmeer J2023-08-061-1/+1
| * | | | | | | | | | amd optsAmeer J2023-08-061-16/+13
| * | | | | | | | | | glAmeer J2023-08-061-0/+1
| * | | | | | | | | | const, pack result_vector and replicate tables,Ameer J2023-08-061-227/+260
| * | | | | | | | | | minor redundancy cleanupAmeer J2023-08-061-12/+2
| * | | | | | | | | | extractbits robustnessAmeer J2023-08-061-5/+8
| * | | | | | | | | | reuse vectors memoryAmeer J2023-08-061-33/+17
| * | | | | | | | | | EncodingData packAmeer J2023-08-061-44/+69
| * | | | | | | | | | flatteningAmeer J2023-08-061-43/+44
| * | | | | | | | | | weights refactorAmeer J2023-08-061-26/+22
| * | | | | | | | | | params.max_weightAmeer J2023-08-061-5/+2
| * | | | | | | | | | skip bitsAmeer J2023-08-061-9/+14
| * | | | | | | | | | restrictAmeer J2023-08-061-2/+2
* | | | | | | | | | | android: Use sensor landscape for landscape mode (#11337)Charles Lombardo2023-08-211-2/+2
| |/ / / / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #11284 from liamwhite/nca-releaseFernando S2023-08-2175-1026/+8017
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | |
| * | | | | | | | | file_sys: tolerate empty NCALiam2023-08-163-3/+3
| * | | | | | | | | fssystem: rework for yuzu styleLiam2023-08-1534-340/+345
| * | | | | | | | | fssystem: reduce overalignment of unbuffered storage operationsLiam2023-08-155-54/+28
| * | | | | | | | | vfs: expand support for NCA readingLiam2023-08-1575-1028/+8040
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Masked depthstencil clearsKelebek12023-08-195-9/+132
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | Merge pull request #11278 from Kelebek1/dma_syncliamwhite2023-08-183-5/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | Mark accelerted DMA destination buffers and images as GPU-modifiedKelebek12023-08-133-5/+15
* | | | | | | | | Merge pull request #11288 from liamwhite/svc-tickliamwhite2023-08-1811-33/+67
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel: remove relative task registrationLiam2023-08-1511-33/+67
* | | | | | | | | | video_core: Fix vulkan assert errorFeng Chen2023-08-182-1/+9
| |_|_|_|/ / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #10989 from comex/epipeliamwhite2023-08-174-7/+36
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Improve behavior when sending to closed connectioncomex2023-08-164-7/+36
| | |_|/ / / / / / | |/| | | | | | |
* / | | | | | | | cmake: mark warning disable for gcc 11 (#11301)liamwhite2023-08-171-1/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #11287 from liamwhite/replaced-bytesFernando S2023-08-151-0/+17
|\ \ \ \ \ \ \ \
| * | | | | | | | gdbstub: fixup replaced instruction bytes in memory readsLiam2023-08-141-0/+17
| |/ / / / / / /
* | | | | | | | Merge pull request #11256 from FearlessTobi/revert-10075bunnei2023-08-152-2/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | Revert "Silence nifm spam"FearlessTobi2023-08-142-2/+15
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #11273 from t895/setup-completionbunnei2023-08-1511-184/+370
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | android: Page forward on setup step completionCharles Lombardo2023-08-133-0/+17
| * | | | | | | android: Adjust setup fragment layoutCharles Lombardo2023-08-123-63/+88
| * | | | | | | android: Show complete indicator during setupCharles Lombardo2023-08-128-121/+265
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #11271 from t895/settings-tweaksbunnei2023-08-1412-59/+106
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | android: Remove redundant option from slider dialogCharles Lombardo2023-08-121-4/+0
| * | | | | | android: Reduce opacity of non-editable settingsCharles Lombardo2023-08-127-3/+28
| * | | | | | android: Use string resource for slider value/unitsCharles Lombardo2023-08-122-13/+13
| * | | | | | android: Display setting value in setting list itemsCharles Lombardo2023-08-127-38/+64
| * | | | | | android: Set switch listener before assigning new valueCharles Lombardo2023-08-121-1/+1
| |/ / / / /
* | | | | | Merge pull request #11282 from ameerj/glasm-xfbliamwhite2023-08-142-15/+1
|\ \ \ \ \ \
| * | | | | | gl_graphics_pipeline: GLASM: Fix transform feedback with multiple buffersAmeer J2023-08-132-15/+1
| |/ / / / /
* | | | | | Merge pull request #11283 from ameerj/glasm-pipeline-detectionliamwhite2023-08-141-2/+2
|\ \ \ \ \ \
| * | | | | | gl_graphics_pipeline: Fix GLASM storage buffer detectionAmeer J2023-08-131-2/+2
* | | | | | | Merge pull request #11281 from liamwhite/vi-scale-modeliamwhite2023-08-142-0/+2
|\ \ \ \ \ \ \
| * | | | | | | nvnflinger: add missing scale modeLiam2023-08-132-0/+2
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #11259 from german77/hidliamwhite2023-08-143-24/+86
|\ \ \ \ \ \ \
| * | | | | | | service: hid: Implement functions needed by QLaunchNarr the Reg2023-08-113-24/+86
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #11263 from liamwhite/my-feature-branchliamwhite2023-08-142-74/+114
|\ \ \ \ \ \ \
| * | | | | | | vulkan_device: disable features associated with unloaded extensionsLiam2023-08-112-74/+114
| |/ / / / / /
* | / / / / / ssl_backend_securetransport: remove stray .Code()Liam2023-08-121-1/+1
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #11219 from zeltermann/title-id-searchliamwhite2023-08-111-2/+6
|\ \ \ \ \ \
| * | | | | | Allow searching by a substring of the title IDzeltermann2023-08-101-2/+6
| |/ / / / /
* | | | | | Merge pull request #11253 from liamwhite/i-hate-this-toolchainliamwhite2023-08-115-73/+81
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | general: fix apple clang buildLiam2023-08-105-73/+81
* | | | | | Merge pull request #11093 from liamwhite/result-ergonomicsbunnei2023-08-1039-600/+514
|\ \ \ \ \ \
| * | | | | | fs: return result on null outputsLiam2023-08-081-4/+24
| * | | | | | general: fix incorrect conversionsLiam2023-08-084-5/+5
| * | | | | | ssl: remove ResultVal useLiam2023-08-087-124/+127
| * | | | | | core: remove ResultVal typeLiam2023-08-0832-475/+366
| |/ / / / /
* / / / / / service: pctl: Partially revert 11221Narr the Reg2023-08-091-9/+15
|/ / / / /
* | | | | Merge pull request #11216 from lat9nq/no-mesa-astcliamwhite2023-08-071-1/+42
|\ \ \ \ \
| * | | | | gl_device: Filter more specifically for slow ASTClat9nq2023-08-051-1/+42
* | | | | | Merge pull request #11217 from german77/olscliamwhite2023-08-071-6/+152
|\ \ \ \ \ \
| * | | | | | service: olsc: Implement IOlscServiceForSystemService ITransferTaskListController interfaces for QLaunchgerman772023-08-051-6/+152
| |/ / / / /
* | | | | | Merge pull request #11221 from german77/pctlliamwhite2023-08-071-18/+134
|\ \ \ \ \ \
| * | | | | | service: pctl: Implement functions needed for QLaunchgerman772023-08-051-18/+134
| |/ / / / /
* | | / / / service: audctl: Stub functions needed by Qlaunchgerman772023-08-062-4/+64
| |_|/ / / |/| | | |
* | | | | Merge pull request #11212 from Kelebek1/shader_stuffliamwhite2023-08-057-26/+42
|\ \ \ \ \
| * | | | | Fix shader dumps with nvdisasmKelebek12023-08-037-26/+42
| | |/ / / | |/| | |
* | | | | Merge pull request #11210 from german77/settingsliamwhite2023-08-055-119/+723
|\ \ \ \ \
| * | | | | service: set: Add more system settings and address commentsNarr the Reg2023-08-052-7/+100
| * | | | | service: set: Implement system settings for QlaunchNarr the Reg2023-08-035-114/+625
| |/ / / /
* | | | | Merge pull request #11208 from german77/interfaceliamwhite2023-08-053-3/+55
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service: am: Fix wrong interfaceNarr the Reg2023-08-023-3/+55
| |/ / /
* | | | vulkan_device: Fix subgroup_size_control detection on Vulkan 1.3Ameer J2023-08-032-3/+3
* | | | vulkan_device: Fix VK_EXT_subgroup_size_control detectionAmeer J2023-08-031-1/+1
|/ / /
* | | Merge pull request #11202 from abouvier/vulkan-configliamwhite2023-08-0215-45/+36
|\ \ \
| * | | vulkan: centralize configAlexandre Bouvier2023-08-0215-45/+36
* | | | Merge pull request #10839 from lat9nq/pgc-plusliamwhite2023-08-0277-4835/+4629
|\ \ \ \
| * | | | config(qt): Fix name of network categorylat9nq2023-08-021-2/+1
| * | | | config(qt): Use qt_config directly to read configlat9nq2023-08-021-2/+4
| * | | | shared_widget: Only save global settings as neededlat9nq2023-07-301-2/+4
| * | | | config(qt): Write the UiGeneral categorylat9nq2023-07-301-0/+1
| * | | | Merge branch 'pgc-plus' of github.com:lat9nq/yuzu into pgc-pluslat9nq2023-07-293-11/+29
| |\ \ \ \
| | * | | | (ui)settings: Add more runtime_modifiable settingslat9nq2023-07-262-10/+28
| | * | | | backend: Remove usage of explicit operator overloadlat9nq2023-07-261-1/+1
| * | | | | config(qt): Fix generic read settinglat9nq2023-07-291-7/+11
| |/ / / /
| * | | | settings: Correct Linkage member impl locationlat9nq2023-07-252-3/+3
| * | | | settings: Set GPU as default ASTC decoderlat9nq2023-07-241-1/+1
| * | | | shared_widget: Determine default request earlierlat9nq2023-07-231-19/+22
| * | | | settings_common: Document specializationslat9nq2023-07-231-9/+10
| * | | | shared_widget: Use QRegularExpressionlat9nq2023-07-221-3/+3
| * | | | config: Read the Network categorylat9nq2023-07-222-0/+12
| * | | | configure_audio/cpu: Sort settingslat9nq2023-07-222-3/+12
| * | | | configure_dialog: Focus the button box on startlat9nq2023-07-221-0/+3
| * | | | qt/configuration: Use deleteLaterlat9nq2023-07-226-7/+7
| * | | | common,qt-config: Remove usage of forward_listlat9nq2023-07-2221-65/+64
| * | | | settings_common: Use a vector in category linkagelat9nq2023-07-212-2/+2
| * | | | settings: Remove sorting from loglat9nq2023-07-211-4/+0
| * | | | configure_system: Use lambda template to group settingslat9nq2023-07-211-1/+1
| * | | | config-android: Update memory layout member namelat9nq2023-07-211-1/+1
| * | | | k_system_control: Always return some memory sizelat9nq2023-07-211-0/+2
| * | | | common: Move global configuration state modifiers back to settingslat9nq2023-07-215-13/+14
| * | | | settings_setting: Fix typolat9nq2023-07-211-4/+4
| * | | | common,configure_system: Rename method to GetCategorylat9nq2023-07-214-8/+8
| * | | | settings: Cleanuplat9nq2023-07-213-32/+51
| * | | | shared_translation: Update memory layout mode stringslat9nq2023-07-211-2/+7
| * | | | core,common: Give memory layout setting an enumlat9nq2023-07-214-9/+31
| * | | | settings: Require time zone setting value for stirnglat9nq2023-07-214-5/+7
| * | | | shared_translation: Add missing time zoneslat9nq2023-07-211-0/+3
| * | | | shared_translation: Add controller_applet_disabledlat9nq2023-07-211-0/+1
| * | | | shared_translation: Add barrier_feedback_loopslat9nq2023-07-211-0/+2
| * | | | cmake: Reposition preprocessor switch commenttoast29032023-07-211-1/+2
| * | | | configuration: Use enum indexlat9nq2023-07-216-26/+31
| * | | | settings: Give indices to enumslat9nq2023-07-213-6/+36
| * | | | cmake: Use standard preprocessor on MSVClat9nq2023-07-211-0/+1
| * | | | settings_common: Remove unncessary enum speclat9nq2023-07-211-2/+2
| * | | | shared_translation: Deobfuscate auto time zonelat9nq2023-07-211-46/+52
| * | | | settings_enums: Remove castinglat9nq2023-07-211-55/+55
| * | | | settings_setting: Silence shadowing warningslat9nq2023-07-211-17/+18
| * | | | settings,configuration: Add a default suffixlat9nq2023-07-219-74/+93
| * | | | configuration: Use paired settingslat9nq2023-07-212-12/+6
| * | | | settings: Define paired settingslat9nq2023-07-214-21/+49
| * | | | shared_widget: Internalize component restoringlat9nq2023-07-213-61/+49
| * | | | configuration: Use specialization of settingslat9nq2023-07-214-18/+36
| * | | | settings: Define specializations for settingslat9nq2023-07-214-64/+130
| * | | | configuration: Use a builder to create widgetslat9nq2023-07-2118-209/+206
| * | | | shared_translation: Fix context usagelat9nq2023-07-211-1/+3
| * | | | settings,translation: Fix time zone enumlat9nq2023-07-212-28/+28
| * | | | settings,opengl,yuzu-qt: Fix AA, Filter maximumslat9nq2023-07-213-9/+8
| * | | | settings_enums: More aggressively use macroslat9nq2023-07-211-351/+149
| * | | | config_shared: Remove storing the group from tablat9nq2023-07-212-6/+2
| * | | | settings,uisettings: Remove leading underscorelat9nq2023-07-216-6/+6
| * | | | configuration: Move speed_limit to corelat9nq2023-07-213-10/+8
| * | | | settings: Move speed_limit to corelat9nq2023-07-211-4/+4
| * | | | android-config: Update enum labelslat9nq2023-07-211-4/+4
| * | | | common,yuzu-qt: Avoid explicit instantiation on old clanglat9nq2023-07-216-3/+22
| * | | | settings_setting: Fix MSVC errorlat9nq2023-07-211-1/+1
| * | | | shared_widget: Correct spellinglat9nq2023-07-211-1/+1
| * | | | (android)config: Clang formatlat9nq2023-07-211-2/+5
| * | | | common,yuzu-qt: GCC warning silenceslat9nq2023-07-219-34/+37
| * | | | configure_graphics: Simplify UpdateAPILayoutlat9nq2023-07-211-27/+16
| * | | | configure_graphcs: Fix setting shader/device in custom configlat9nq2023-07-211-0/+3
| * | | | configuration: Use shorter constructor as neededlat9nq2023-07-213-10/+9
| * | | | shared_widget: Some documentation, add shorter constructorlat9nq2023-07-212-8/+65
| * | | | config: Remove unused functionslat9nq2023-07-212-128/+0
| * | | | settings: Delete cpu_accuracy_first_timelat9nq2023-07-213-8/+0
| * | | | shared_widget: Improve logging, use Setting::Rangedlat9nq2023-07-211-7/+19
| * | | | settings: Document BasicSetting, add Rangedlat9nq2023-07-212-9/+110
| * | | | settings: Move IsConfiguringGlobal to settings_commonlat9nq2023-07-214-12/+13
| * | | | configuration/shared: Clean up includes [IWYU]lat9nq2023-07-214-21/+36
| * | | | configure_graphics: Fix vulkan_device buglat9nq2023-07-211-4/+2
| * | | | settings: Move some simple data to BasicSettinglat9nq2023-07-215-108/+129
| * | | | settings_setting: Fix errorslat9nq2023-07-211-2/+3
| * | | | (ui,)settings: Use explicit instantiationlat9nq2023-07-2110-477/+615
| * | | | settings: Remove redundant false literalslat9nq2023-07-211-19/+16
| * | | | shared_widget: Avoid calling QWidgetPrivate::setVisiblelat9nq2023-07-211-2/+0
| * | | | FIXME configuration: Avoid unnecessary allocationslat9nq2023-07-215-2/+22
| * | | | shared_widget: Add SPDX headerlat9nq2023-07-212-0/+6
| * | | | general: Add typeinfo where neededlat9nq2023-07-216-0/+6
| * | | | settings_enums: Add const type where neededlat9nq2023-07-211-2/+2
| * | | | shared_widget: Use actionTriggered for user input signalslat9nq2023-07-211-1/+1
| * | | | shared_translation: Populate combobox enums with macrolat9nq2023-07-211-168/+158
| * | | | settings: yuzu is not capitalized why is it capitalized stop no badlat9nq2023-07-211-1/+1
| * | | | configuration: Document odd widget caseslat9nq2023-07-215-1/+25
| * | | | settings: Reorderlat9nq2023-07-211-75/+78
| * | | | shared_translation: Add translation for use video framratelat9nq2023-07-211-0/+3
| * | | | settings: Report all contained settings valueslat9nq2023-07-211-45/+19
| * | | | settings_enums: Cannonicalize settings nameslat9nq2023-07-211-2/+163
| * | | | settings,general: Rename non-confirming enumslat9nq2023-07-2123-130/+136
| * | | | configuration: Use IDs to sort holdslat9nq2023-07-214-27/+16
| * | | | settings,general: Rename/reorder setting idslat9nq2023-07-211-1/+1
| * | | | shared_widget: Fix includeslat9nq2023-07-211-7/+4
| * | | | shared_widget: Complete refactoringlat9nq2023-07-212-378/+168
| * | | | shared_widget: Refactor againlat9nq2023-07-212-52/+121
| * | | | android-config: Adapt settings reworklat9nq2023-07-211-4/+6
| * | | | c_per_game: Inform when settings might not be configurablelat9nq2023-07-211-14/+33
| * | | | shared_translation: Fix pragma oncelat9nq2023-07-211-0/+2
| * | | | shared_translation: Add translation for AstcRecompressionlat9nq2023-07-211-0/+9
| * | | | configure_system: Hide locale warn at startlat9nq2023-07-211-1/+4
| * | | | shared_widget: Force min width of 100 for restore buttonlat9nq2023-07-211-2/+13
| * | | | configuration: Workaround for Windows Qt buglat9nq2023-07-213-53/+58
| * | | | shared_translation: Add missing tooltipslat9nq2023-07-211-7/+21
| * | | | settings: Make volume runtime-configurablelat9nq2023-07-211-1/+1
| * | | | configuration: Clean up includes a bitlat9nq2023-07-2114-51/+26
| * | | | configuration_shared: Remove old custom config setup functionslat9nq2023-07-212-144/+0
| * | | | configure_cpu: Generate UIlat9nq2023-07-215-190/+94
| * | | | configuration: Use a mapping of setting value to namelat9nq2023-07-2118-229/+355
| * | | | settings, shared_widget: typo fixeslat9nq2023-07-211-2/+8
| * | | | configure_audio: Implement ui generationlat9nq2023-07-2114-329/+219
| * | | | settings: Split enums to new filelat9nq2023-07-213-186/+241
| * | | | shared_widget: Use a better iconlat9nq2023-07-211-7/+5
| * | | | shared_widget: Refactor helperslat9nq2023-07-216-220/+254
| * | | | settings, uisettings: Initialize linkage counterlat9nq2023-07-213-3/+3
| * | | | configure_system: Implement with for looplat9nq2023-07-2118-648/+508
| * | | | per_game: Remove general tablat9nq2023-07-212-5/+0
| * | | | shared_widget: Internalize extra setting configurationlat9nq2023-07-213-48/+66
| * | | | settings: Move runtime and save to parameterslat9nq2023-07-212-68/+89
| * | | | graphics: Set speed limit to spinboxlat9nq2023-07-211-2/+2
| * | | | shared_widget: Support checkbox + spinboxlat9nq2023-07-213-10/+55
| * | | | configure_debug: Reorganizelat9nq2023-07-211-336/+522
| * | | | configure_graphics: Reimplement bg_colorlat9nq2023-07-213-15/+111
| * | | | shared_widget: Make button creation staticlat9nq2023-07-212-10/+12
| * | | | configure_general: Hide reset button in custom configslat9nq2023-07-211-0/+4
| * | | | configure_general: Sort datalat9nq2023-07-211-1/+7
| * | | | configure_general: Generate UI using containerslat9nq2023-07-215-163/+41
| * | | | shared_translation: Add UI widget translationslat9nq2023-07-211-55/+73
| * | | | shared_widget: Fix headerlat9nq2023-07-211-0/+2
| * | | | settings: Add UiGeneral classlat9nq2023-07-214-7/+16
| * | | | config: Don't merge the mapslat9nq2023-07-212-11/+10
| * | | | configure_graphics: Remove redundant loglat9nq2023-07-211-1/+0
| * | | | configuration: Move CreateWidget to a classlat9nq2023-07-2110-453/+507
| * | | | configuration: Implement sliderlat9nq2023-07-217-71/+188
| * | | | configuration: Use buttons instead of highlightslat9nq2023-07-219-103/+204
| * | | | shared_translations: Re flow stringslat9nq2023-07-211-6/+6
| * | | | configure_graphics: More complete reimplementationlat9nq2023-07-214-348/+116
| * | | | settings: Define base renderer runtime modifiable settingslat9nq2023-07-212-25/+27
| * | | | configuration_shared: Fix blank state hiding check boxlat9nq2023-07-211-2/+1
| * | | | settings: Add anisotropy mode enumlat9nq2023-07-212-0/+15
| * | | | shared_translation: Finish using int idslat9nq2023-07-216-158/+117
| * | | | settings,uisettings: Add IDs to settingslat9nq2023-07-211-3/+13
| * | | | configure_graphics: Partial runtime implementationlat9nq2023-07-2110-1148/+513
| * | | | settings: Recategorize a bitlat9nq2023-07-216-45/+77
| * | | | shared_translation: Add the rest of the settingslat9nq2023-07-211-1/+80
| * | | | shared_translation: Add copyright and licenselat9nq2023-07-212-0/+6
| * | | | configure_graphics_advance: Generate UI at runtimelat9nq2023-07-2115-402/+451
| * | | | configure_per_game: Rename group to tab_grouplat9nq2023-07-212-10/+11
| * | | | configuration: Add base class to tabslat9nq2023-07-2118-101/+110
| * | | | configuration_shared: Create Tab base classlat9nq2023-07-212-0/+22
| * | | | settings: Add a registry of settingslat9nq2023-07-219-870/+700
| * | | | uisettings: Fix typingslat9nq2023-07-214-57/+63
| * | | | settings,core,config_sys: Remove optional type from custom_rtc, rng_seedlat9nq2023-07-216-26/+33
| * | | | settings: Pool SetGlobal functionslat9nq2023-07-212-61/+14
| * | | | settings,video_core: Consolidate ASTC decoding optionslat9nq2023-07-2112-52/+105
* | | | | vulkan_device: disable EDS3 blending on all AMD driversLiam2023-08-021-8/+7
| |/ / / |/| | |
* | | | audren_u: Fix parameter alignmentMorph2023-08-011-2/+3
* | | | Merge pull request #11188 from abouvier/vma-fixliamwhite2023-07-318-19/+32
|\ \ \ \
| * | | | vma: enable options everywhereAlexandre Bouvier2023-07-318-19/+32
* | | | | Merge pull request #11181 from Kelebek1/audrenparaminternalliamwhite2023-07-311-3/+3
|\ \ \ \ \
| * | | | | Fix AudioRendererParameterInternal's sizeKelebek12023-07-301-3/+3
| |/ / / /
* | | | | Merge pull request #11169 from GPUCode/desc-stuffliamwhite2023-07-314-5/+5
|\ \ \ \ \
| * | | | | vk_descriptor_pool: Disallow descriptor set freeGPUCode2023-07-274-5/+5
| | |_|/ / | |/| | |
* | | | | Merge pull request #11173 from Morph1984/atleast_nanosecond_precisionliamwhite2023-07-311-2/+2
|\ \ \ \ \
| * | | | | wall_clock: Increase precision requirementsMorph2023-07-281-2/+2
| |/ / / /
* | | | | Merge pull request #11186 from lat9nq/tz-gen-onceliamwhite2023-07-312-8/+11
|\ \ \ \ \
| * | | | | tz_content_man: Generate the time zone binary oncelat9nq2023-07-302-8/+11
| | |/ / / | |/| | |
* | | | | Formatting fixMoonlacer2023-07-311-2/+1
* | | | | Match log warningMoonlacer2023-07-311-1/+1
* | | | | Formatting fixMoonlacer2023-07-301-1/+2
* | | | | Address feedback and change log warningMoonlacer2023-07-301-3/+3
* | | | | Revert "Revert "Blacklist EDS3 blending from new AMD drivers""Moonlacer2023-07-301-0/+8
|/ / / /
* | | | Merge pull request #11155 from liamwhite/memory3liamwhite2023-07-281-3/+18
|\ \ \ \
| * | | | memory: check page against address space sizeLiam2023-07-251-3/+18
| | |_|/ | |/| |
* | | | Merge pull request #11156 from 8bitDream/localizeliamwhite2023-07-2815-272/+18
|\ \ \ \
| * | | | android: Only label language with languageAbandoned Cart2023-07-2515-272/+18
| |/ / /
* | / / Revert "Blacklist EDS3 blending from new AMD drivers"Moonlacer2023-07-261-8/+0
| |/ / |/| |
* | | Merge pull request #11128 from german77/discordliamwhite2023-07-262-36/+53
|\ \ \
| * | | Address feedbackMorph2023-07-261-10/+8
| * | | yuzu: Replace httplib with QtNetworkRequestNarr the Reg2023-07-222-36/+55
* | | | Merge pull request #10990 from comex/ubsanliamwhite2023-07-2611-32/+42
|\ \ \ \
| * | | | Fixes and workarounds to make UBSan happier on macOScomex2023-07-1511-32/+42
* | | | | Merge pull request #11142 from german77/avoid_crashliamwhite2023-07-261-1/+5
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | yuzu: Avoid reading broken gamesgerman772023-07-241-1/+5
* | | | | Merge pull request #11095 from liamwhite/memory2liamwhite2023-07-245-85/+74
|\ \ \ \ \
| * | | | | core: reduce TOCTTOU memory accessLiam2023-07-223-20/+11
| * | | | | memory: minimize dependency on processLiam2023-07-222-65/+63
| |/ / / /
* | | | | Merge pull request #11135 from liamwhite/getaddrinfoliamwhite2023-07-2410-5/+115
|\ \ \ \ \
| * | | | | core: implement GetGaiStringErrorRequest, IContextRegistrarLiam2023-07-2310-5/+115
| |/ / / /
* / / / / ssa_rewrite_pass: use proper mapsLiam2023-07-231-6/+5
|/ / / /
* | | | Merge pull request #11094 from liamwhite/getliamwhite2023-07-2228-171/+98
|\ \ \ \
| * | | | kernel: reduce page table region checkingLiam2023-07-158-87/+23
| * | | | k_process: PageTable -> GetPageTableLiam2023-07-1527-90/+81
| |/ / /
* | | | Merge pull request #11098 from GPUCode/texel-buffersliamwhite2023-07-222-1/+11
|\ \ \ \
| * | | | buffer_cache: Increase number of texture buffersGPUCode2023-07-152-1/+11
| |/ / /
* | | | Merge pull request #11113 from liamwhite/nsd1bunnei2023-07-222-1/+17
|\ \ \ \
| * | | | nsd: add GetApplicationServerEnvironmentTypeLiam2023-07-182-1/+17
* | | | | core: remove remaining uses of dynamic_castLiam2023-07-226-16/+21
* | | | | general: reduce use of dynamic_castLiam2023-07-224-2/+13
* | | | | Merge pull request #11069 from lat9nq/mingw-no-tzdbliamwhite2023-07-212-29/+21
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | time_zone: Clean up includeslat9nq2023-07-121-1/+1
| * | | | time_zone: Swap subtraction orderlat9nq2023-07-121-1/+1
| * | | | time_zone: Account for leap yearslat9nq2023-07-121-4/+6
| * | | | settings: Disable C++20 tzdb path on MinGWlat9nq2023-07-101-1/+2
| * | | | time_zone: Remove string ops for determing zonelat9nq2023-07-101-27/+16
* | | | | Merge pull request #11096 from german77/amiiboooliamwhite2023-07-217-54/+143
|\ \ \ \ \
| * | | | | service: nfc: Update Implementation to match with latest RENarr the Reg2023-07-177-54/+143
| | |_|/ / | |/| | |
* | | | | Merge pull request #11116 from lat9nq/clang-shadowingliamwhite2023-07-1912-56/+59
|\ \ \ \ \
| * | | | | vk_buffer_cache: Formatlat9nq2023-07-191-2/+2
| * | | | | general: Silence -Wshadow{,-uncaptured-local} warningslat9nq2023-07-1912-58/+61
| | |_|_|/ | |/| | |
* | | | | Merge pull request #11114 from Kelebek1/warningsliamwhite2023-07-191-2/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Debug SetIdleTimeDetectionExtensionKelebek12023-07-181-2/+2
| |/ / /
* | | | ssl: Link with crypt32 for secure channel backendMorph2023-07-172-1/+2
* | | | ssl: Reorder inclusionsMorph2023-07-176-26/+30
* | | | network: Forward declarationsMorph2023-07-175-5/+11
| |_|/ |/| |
* | | Merge pull request #10934 from abouvier/cmake-vmaliamwhite2023-07-172-1/+13
|\ \ \
| * | | cmake: allow using system VMA libraryAlexandre Bouvier2023-07-122-1/+13
* | | | Merge pull request #11102 from v1993/your-mom-is-encryptedliamwhite2023-07-171-1/+1
|\ \ \ \
| * | | | android: fix links to re-dumping guidesValeri Ochinski2023-07-161-1/+1
| | |/ / | |/| |
* | | | Merge pull request #10912 from comex/sslliamwhite2023-07-1622-282/+2397
|\ \ \ \ | |/ / / |/| | |
| * | | Rename variables to avoid -Wshadow warnings under GCCcomex2023-07-021-5/+5
| * | | ...actually add the SecureTransport backend to Git.comex2023-07-021-0/+219
| * | | Updates:comex2023-07-027-211/+276
| * | | Merge remote-tracking branch 'origin/master' into sslcomex2023-07-02266-2810/+4819
| |\ \ \
| * | | | PR feedback + constificationcomex2023-06-268-60/+62
| * | | | network.cpp: include expected.hcomex2023-06-261-0/+1
| * | | | re-formatcomex2023-06-261-4/+5
| * | | | Fix more Windows build errorscomex2023-06-265-28/+35
| * | | | ssl: fix compatibility with OpenSSL 1.1.1comex2023-06-261-1/+10
| * | | | Fixes:comex2023-06-263-4/+12
| * | | | ssl: rename argument to avoid false positive codespell warningcomex2023-06-251-2/+2
| * | | | socket_types: Improve commentcomex2023-06-251-3/+3
| * | | | Implement SSL servicecomex2023-06-2521-277/+2080
* | | | | file_sys/content_archive: Detect compressed NCAs (#11047)Tobias2023-07-122-1/+40
| |_|/ / |/| | |
* | | | Merge pull request #10985 from liamwhite/handle-translatebunnei2023-07-123-7/+771
|\ \ \ \
| * | | | k_server_session: translate special header for non-HLE requestsLiam2023-07-083-7/+771
* | | | | Merge pull request #11070 from t895/home-setting-warningbunnei2023-07-124-53/+84
|\ \ \ \ \
| * | | | | android: Visualize disabled home optionsCharles Lombardo2023-07-114-53/+84
| | |_|_|/ | |/| | |
* | | | | Merge pull request #10996 from Kelebek1/readblock_optimisationbunnei2023-07-1123-236/+478
|\ \ \ \ \
| * | | | | Fix ScratchBuffer movesKelebek12023-07-041-2/+15
| * | | | | Use spans over guest memory where possible instead of copying data.Kelebek12023-07-0322-234/+463
* | | | | | Merge pull request #11050 from SuperSamus/sdl-button-labelsbunnei2023-07-112-42/+11
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | input_common: set `SDL_HINT_GAMECONTROLLER_USE_BUTTON_LABELS` to 0Martino Fontana2023-07-072-42/+11
| | |/ / / | |/| | |
* | | | | Merge pull request #11067 from t895/fragile-databunnei2023-07-101-1/+1
|\ \ \ \ \
| * | | | | android: Don't prompt to save user data on uninstallCharles Lombardo2023-07-101-1/+1
* | | | | | Merge pull request #11055 from lat9nq/tzdb-catch-Morph2023-07-101-3/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | settings: Catch runtime error from STLlat9nq2023-07-091-3/+2
* | | | | | Merge pull request #11063 from liamwhite/oopsMorph2023-07-091-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | arm_interface: correct breakpoint rewind conditionLiam2023-07-091-1/+1
| |/ / / /
* | | | | Merge pull request #11030 from lat9nq/tz-restrict-msvcMorph2023-07-091-1/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | settings: Disable C++20 path on MSVClat9nq2023-07-051-1/+2
* | | | | Merge pull request #10999 from Morph1984/fix-install-progressliamwhite2023-07-071-4/+6
|\ \ \ \ \
| * | | | | main: Use 1_MiB as a constant for copy buffer sizeMorph2023-07-061-3/+5
| * | | | | main: Fix install progress calculationMorph2023-07-061-3/+3
* | | | | | Merge pull request #11031 from german77/zeroliamwhite2023-07-071-2/+3
|\ \ \ \ \ \
| * | | | | | input_common: Avoid potential division by zeroNarr the Reg2023-07-061-2/+3
| |/ / / / /
* / / / / / vfs_real: use open file size for getting size (#11016)liamwhite2023-07-061-1/+2
|/ / / / /
* | | | | Merge pull request #10994 from liamwhite/ue4-preferredliamwhite2023-07-051-2/+2
|\ \ \ \ \
| * | | | | vulkan_common: use device local preferred for image memoryLiam2023-07-021-2/+2
* | | | | | Merge pull request #11006 from german77/nfc_nfcliamwhite2023-07-054-11/+42
|\ \ \ \ \ \
| * | | | | | android: Reintroduce launch mode as single topgerman772023-07-031-0/+1
| * | | | | | service: nfc: Ensure controller is in the correct modegerman772023-07-033-11/+41
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #11012 from gidoly/metroid-fixliamwhite2023-07-051-0/+4
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | oops re opengidoly2023-07-031-0/+4
| |/ / / /
* | | | | video_core: vulkan_device: Disable timeline semaphore on Turnip, fix qcom version check.bunnei2023-07-042-9/+16
* | | | | Merge pull request #10964 from bunnei/gpu-remove-qcom-checkbunnei2023-07-041-3/+27
|\ \ \ \ \
| * | | | | video_core: vulkan_device: Change to driver version check.bunnei2023-07-031-15/+23
| * | | | | video_core: vulkan_device: Scope S8Gen2 checks to just Qualcomm.bunnei2023-06-301-2/+2
| * | | | | video_core: vulkan_device: Fix S8Gen2 dynamic state checks.bunnei2023-06-301-3/+19
* | | | | | Merge pull request #10943 from t895/stick-modifiersbunnei2023-07-0311-170/+751
|\ \ \ \ \ \
| * | | | | | android: Version the input overlayCharles Lombardo2023-07-0311-170/+751
| | |/ / / / | |/| | | |
* / | | | | Use `toUtf8()` for string passed to DBuszeltermann2023-07-031-1/+1
|/ / / / /
* | | | | Merge pull request #10998 from Morph1984/qt-stop-messing-with-meliamwhite2023-07-024-5/+22
|\ \ \ \ \
| * | | | | core_timing: Remove GetCurrentTimerResolution in CoreTiming loopMorph2023-07-024-5/+22
* | | | | | Merge pull request #10479 from GPUCode/format-listliamwhite2023-07-026-14/+58
|\ \ \ \ \ \
| * | | | | | renderer_vulkan: Fix some missing view formatsGPUCode2023-07-012-3/+8
| * | | | | | renderer_vulkan: Add support for VK_KHR_image_format_listGPUCode2023-07-015-14/+53
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #10969 from Morph1984/k-synchronizeliamwhite2023-07-023-36/+52
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | kernel: SynchronizeMorph2023-07-013-36/+52
* | | | | | Merge pull request #10949 from t895/memory-requirementsliamwhite2023-07-024-44/+114
|\ \ \ \ \ \
| * | | | | | android: Show memory warning onceCharles Lombardo2023-06-302-13/+24
| * | | | | | android: Rework MemoryUtilCharles Lombardo2023-06-303-25/+85
| * | | | | | android: Make MemoryUtil an objectCharles Lombardo2023-06-292-13/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #10942 from FernandoS27/android-is-a-pain-in-the-a--liamwhite2023-07-0220-41/+329
|\ \ \ \ \ \
| * | | | | | Memory Tracker: Use 64 bit atomics instead of 128 bitsFernando Sahmkow2023-06-291-9/+13
| * | | | | | Memory Tracking: Optimize tracking to only use atomic writes when contested with the host GPUFernando Sahmkow2023-06-2819-38/+153
| * | | | | | MemoryTracking: Initial setup of atomic writes.Fernando Sahmkow2023-06-288-14/+183
* | | | | | | Merge pull request #10710 from liamwhite/romfs2liamwhite2023-07-021-21/+17
|\ \ \ \ \ \ \
| * | | | | | | fsmitm_romfsbuild: avoid full path lookupsLiam2023-06-281-21/+17
* | | | | | | | Revert "texture_cache: Fix incorrect logic for AccelerateDMA"Liam2023-07-021-4/+8
| |_|_|_|_|/ / |/| | | | | |
* | | | | | | Merge pull request #10984 from comex/cobliamwhite2023-07-021-2/+1
|\ \ \ \ \ \ \
| * | | | | | | Minor cleanup in BufferCacheRuntime::ReserveNullBuffercomex2023-07-011-2/+1
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #10974 from Steveice10/macos_vkliamwhite2023-07-025-16/+23
|\ \ \ \ \ \ \
| * | | | | | | yuzu: Use test window with VulkanSurface to check for present modes.Steveice102023-07-011-1/+4
| * | | | | | | vulkan: Use newer VK_EXT_metal_surface to create surface for MoltenVK.Steveice102023-07-014-15/+19
| |/ / / / / /
* | | | | | | Merge pull request #10970 from Morph1984/thingliamwhite2023-07-0218-100/+124
|\ \ \ \ \ \ \
| * | | | | | | parcel: Optimize small_vector sizesMorph2023-07-011-11/+13
| * | | | | | | maxwell_dma: Specify dst_operand.pitch instead of a temp varMorph2023-07-011-4/+3
| * | | | | | | general: Use ScratchBuffer where possibleMorph2023-07-0114-64/+81
| * | | | | | | ring_buffer: Fix const usage on std::spanMorph2023-06-301-1/+1
| * | | | | | | scratch_buffer: Add member types to ScratchBufferMorph2023-06-301-20/+26
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #10966 from Morph1984/heap-corruptionliamwhite2023-07-022-17/+20
|\ \ \ \ \ \ \
| * | | | | | | sink_stream: Resolve heap buffer corruption due to out of bounds writeMorph2023-06-302-17/+20
* | | | | | | | Merge pull request #10950 from german77/mouse_tuneliamwhite2023-07-027-116/+88
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | yuzu: Ensure mouse panning can't be enabled with real mouse emulationgerman772023-07-015-30/+39
| * | | | | | | input_common: Tune mouse controlsNarr the Reg2023-06-295-88/+51
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #10953 from FernandoS27/oh-oopsies-yfcFernando S2023-06-301-9/+0
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | Texture cache: Fix YFC regression due to code testingFernando Sahmkow2023-06-291-9/+0
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #10956 from FernandoS27/pikmin-another-game-ill-hateFernando S2023-06-301-0/+4
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | AccelerateDMA: Don't accelerate 3D texture DMA operationsFernando Sahmkow2023-06-291-0/+4
| |/ / / /
* | | | | Merge pull request #10955 from 8bitDream/gradleCharles Lombardo2023-06-291-0/+3
|\ \ \ \ \
| * | | | | android: Suppress a known incompatibilityAbandoned Cart2023-06-291-0/+3
| | |_|/ / | |/| | |
* | | | | Merge pull request #10935 from Morph1984/mwaitxliamwhite2023-06-294-14/+41
|\ \ \ \ \
| * | | | | x64: cpu_wait: Implement MWAITX for non-MSVC compilersMorph2023-06-281-0/+10
| * | | | | x64: cpu_wait: Remove magic valuesMorph2023-06-281-3/+8
| * | | | | x64: cpu_wait: Make use of MWAITX in MicroSleepMorph2023-06-281-12/+21
| * | | | | x64: Add detection of monitorx instructionsMorph2023-06-283-0/+3
| | |_|/ / | |/| | |
* | | | | Merge pull request #10937 from german77/ringliamwhite2023-06-2921-481/+526
|\ \ \ \ \
| * | | | | input_common: Allow timeouts to happen while scanning for a ringgerman772023-06-292-3/+4
| * | | | | input_common: Remove duplicated DriverResult enumgerman772023-06-2821-479/+523
| |/ / / /
* | | | | Merge pull request #10946 from goldenx86/amdBlendingliamwhite2023-06-291-0/+8
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Blacklist EDS3 blending from new AMD driversMatías Locatti2023-06-291-0/+8
| | |/ / | |/| |
* / | | android: Android 14 supportCharles Lombardo2023-06-282-3/+6
|/ / /
* | | renderer_vulkan: Prevent crashes when blitting depth stencilGPUCode2023-06-281-0/+3
* | | video_core: Add BCn decoding supportGPUCode2023-06-2813-120/+221
* | | renderer_vulkan: Add more feature checkingGPUCode2023-06-283-3/+24
* | | renderer_vulkan: Don't assume debug tool with debug rendererGPUCode2023-06-281-1/+1
* | | renderer_vulkan: Bump minimum SPIRV versionGPUCode2023-06-281-1/+1
* | | renderer_vulkan: Respect viewport limitGPUCode2023-06-283-6/+19
* | | renderer_vulkan: Don't add transform feedback flag if unsupportedGPUCode2023-06-282-7/+12
* | | renderer_vulkan: Add suport for debug report callbackGPUCode2023-06-288-37/+113
|/ /
* | Merge pull request #10933 from merryhime/dunnoliamwhite2023-06-281-5/+0
|\ \
| * | arm_dynarmic_32: Remove disabling of block linking on arm64Merry2023-06-281-5/+0
* | | settings: Clean up includeslat9nq2023-06-281-2/+3
* | | settings: Catch runtime_error, fallback time zonelat9nq2023-06-281-3/+15
|/ /
* | yuzu: Fix clang formatgerman772023-06-272-12/+15
* | Merge pull request #9663 from EBADBEEF/disable-controller-appletNarr the Reg2023-06-275-0/+16
|\ \
| * | qt: add option to disable controller appletEBADBEEF2023-01-235-0/+16
* | | Merge pull request #10867 from Kelebek1/dma_safeliamwhite2023-06-271-5/+6
|\ \ \
| * | | Use safe reads in DMA engineKelebek12023-06-261-5/+6
* | | | Merge pull request #10473 from GPUCode/vmaliamwhite2023-06-2723-366/+398
|\ \ \ \
| * | | | externals: Use cmake subdirectoryGPUCode2023-06-263-6/+0
| * | | | vulkan_common: Remove required flagsGPUCode2023-06-221-15/+1
| * | | | renderer_vulkan: Add missing initializersGPUCode2023-06-182-5/+13
| * | | | renderer_vulkan: Use VMA for buffersGPUCode2023-06-1816-211/+262
| * | | | renderer_vulkan: Use VMA for imagesGPUCode2023-06-1816-91/+119
| * | | | memory_allocator: Remove OpenGL interopGPUCode2023-06-184-67/+8
| * | | | externals: Add vma and initialize itlat9nq2023-06-183-2/+26
* | | | | Merge pull request #10495 from bm01/masterliamwhite2023-06-2714-103/+581
|\ \ \ \ \
| * | | | | input_common: Redesign mouse panningBaptiste Marie2023-06-1214-103/+581
* | | | | | Merge pull request #10679 from zeltermann/wakelock-reasonliamwhite2023-06-273-52/+12
|\ \ \ \ \ \
| * | | | | | Only use SDL wakelock on Linuxzeltermann2023-06-243-52/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #10916 from ameerj/lolmemliamwhite2023-06-2714-1/+94
|\ \ \ \ \ \
| * | | | | | OpenGL: Limit lmem warmup to NVIDIAameerj2023-06-263-4/+15
| * | | | | | shaders: Track local memory usageameerj2023-06-267-2/+23
| * | | | | | emit_glasm: Fix lmem size computationameerj2023-06-261-1/+1
| * | | | | | OpenGL: Add Local Memory warmup shaderameerj2023-06-265-1/+62
| |/ / / / /
* | | | | | android: Fix size check for content urisCharles Lombardo2023-06-271-0/+6
* | | | | | Merge pull request #10908 from kiri11/clarify-ring-uiliamwhite2023-06-261-1/+1
|\ \ \ \ \ \
| * | | | | | Hyphenate Joy-Con and clarify furtherKirill Ignatev2023-06-251-1/+1
| * | | | | | Clarify Ring-Con configuration message in UIKirill Ignatev2023-06-251-1/+1
| |/ / / / /
* | | | | | Merge pull request #10903 from german77/nfc_stateliamwhite2023-06-264-18/+52
|\ \ \ \ \ \
| * | | | | | core: hid: Allow to read bin files while switch controller is availablegerman772023-06-251-4/+10
| * | | | | | input_common: Dont try to read/write data from 3rd party controllersgerman772023-06-254-14/+42
| |/ / / / /
* | | | | | Merge pull request #10901 from german77/sdl_fixliamwhite2023-06-261-8/+20
|\ \ \ \ \ \
| * | | | | | input_common: Make use of new SDL featuresgerman772023-06-251-8/+20
| |/ / / / /
* | | | | | Merge pull request #10888 from 8bitDream/nativeliamwhite2023-06-261-44/+47
|\ \ \ \ \ \
| * | | | | | android: define [[maybe_unused]] (const) autoAbandoned Cart2023-06-231-41/+43
| * | | | | | android: Parameter types from Android StudioAbandoned Cart2023-06-231-4/+5
| |/ / / / /
* | | | | | Merge pull request #10865 from t895/extension-memeliamwhite2023-06-265-50/+19
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | android: Clean up file extension checksCharles Lombardo2023-06-265-50/+19
* | | | | | Merge pull request #10811 from 8bitDream/pip_muteliamwhite2023-06-239-255/+148
|\ \ \ \ \ \
| * | | | | | android: Refactor native and corresponding variablesAbandoned Cart2023-06-226-22/+25
| * | | | | | Fix JNI and expose mute settings to AndroidAbandoned Cart2023-06-227-277/+99
| * | | | | | android: Add a PiP interface to mute / unmuteAbandoned Cart2023-06-214-0/+68
* | | | | | | Merge pull request #10859 from liamwhite/no-more-atomic-waitliamwhite2023-06-239-40/+26
|\ \ \ \ \ \ \
| * | | | | | | general: remove atomic signal and waitLiam2023-06-229-40/+26
* | | | | | | | Merge pull request #10842 from german77/native_mifareliamwhite2023-06-2325-193/+1165
|\ \ \ \ \ \ \ \
| * | | | | | | | input_common: Implement native mifare supportNarr the Reg2023-06-2225-193/+1165
* | | | | | | | | vfs_real: lock concurrent accessesLiam2023-06-232-25/+45
* | | | | | | | | Merge pull request #10457 from Kelebek1/optimisebunnei2023-06-2384-460/+503
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Remove memory allocations in some hot pathsKelebek12023-06-2284-460/+503
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10806 from liamwhite/worst-fs-implementation-everbunnei2023-06-235-29/+47
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vfs_real: ensure size cache is reset on writeLiam2023-06-161-0/+2
| * | | | | | | | | patch_manager: remove unnecessary GetSize callsLiam2023-06-161-5/+4
| * | | | | | | | | vfs_real: misc optimizationsLiam2023-06-164-24/+41
* | | | | | | | | | Merge pull request #10794 from 8bitDream/multiplesbunnei2023-06-223-40/+154
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | android: Generalize string message dialogAbandoned Cart2023-06-222-11/+11
| * | | | | | | | | | android: Add support for concurrent installsAbandoned Cart2023-06-223-40/+154
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10878 from GPUCode/log-droidMorph2023-06-221-0/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | android: Log settingsGPUCode2023-06-221-0/+1
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10869 from 8bitDream/memorybunnei2023-06-223-1/+85
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | android: Convert memory sizes to resourceAbandoned Cart2023-06-223-11/+21
| * | | | | | | | | android: Add a notice when RAM inadequateAbandoned Cart2023-06-223-1/+75
| |/ / / / / / / /
* | | | | | | | | Merge pull request #10086 from Morph1984/coretiming-ng-1bunnei2023-06-2231-429/+280
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | nvdisp: Fix SingleCore frametime reportingMorph2023-06-081-1/+1
| * | | | | | | | | core_timing: Fix SingleCore cycle timerMorph2023-06-084-43/+31
| * | | | | | | | | (wall, native)_clock: Add GetGPUTickMorph2023-06-087-12/+47
| * | | | | | | | | time: Use compile time division for TimeSpanType conversionMorph2023-06-085-11/+15
| * | | | | | | | | core_timing: Use CNTPCT as the guest CPU tickMorph2023-06-0814-122/+47
| * | | | | | | | | nvnflinger: Acquire lock prior to signaling the vsync variableMorph2023-06-081-1/+2
| * | | | | | | | | (wall, native)_clock: Rework NativeClockMorph2023-06-085-259/+94
| * | | | | | | | | x64: Deduplicate RDTSC usageMorph2023-06-085-19/+82
* | | | | | | | | | Merge pull request #10777 from liamwhite/no-barrierbunnei2023-06-226-0/+28
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core: optionally skip barriers on feedback loopsLiam2023-06-146-0/+28
* | | | | | | | | | | Merge pull request #10841 from liamwhite/math-is-hardbunnei2023-06-221-4/+10
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | vfs_concat: verify short readLiam2023-06-191-0/+5
| * | | | | | | | | | | vfs_concat: fix offset calculation when not aligned to file boundaryLiam2023-06-191-4/+5
| | |_|_|_|_|_|_|_|_|/ | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #10863 from lat9nq/tz-end-of-stringbunnei2023-06-221-1/+5
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | time_zone_manager: Add null terminatorlat9nq2023-06-201-2/+4
| * | | | | | | | | | time_zone_manager: Stop on commalat9nq2023-06-201-1/+3
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* / | | | | | | | | android: Don't show custom driver button on mali and x86Charles Lombardo2023-06-213-71/+123
|/ / / / / / / / /
* | | | | | | | | Merge pull request #10818 from vonchenplus/render_target_samplesliamwhite2023-06-202-18/+14
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | video_core: add samples check when find render targetFengChen2023-06-172-18/+14
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10835 from lat9nq/intel-restrict-compute-disableliamwhite2023-06-206-12/+38
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vulkan_device: Remove brace initializertoast29032023-06-191-1/+1
| * | | | | | | | | video_core: Check broken compute earlierlat9nq2023-06-192-2/+3
| * | | | | | | | | vk_device_info: Check only affected Intel driverslat9nq2023-06-183-8/+11
| * | | | | | | | | video_core: Formalize HasBrokenComputelat9nq2023-06-183-4/+26
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10840 from Kelebek1/unbug_blinks_brainliamwhite2023-06-201-2/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | Use current GPU address when unmapping GPU pages, not the baseKelebek12023-06-191-2/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #10829 from lat9nq/remove-external-memliamwhite2023-06-182-19/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | vulkan_device: Remove external memory extensionlat9nq2023-06-182-19/+0
* | | | | | | | | Merge pull request #10486 from lat9nq/vk-device-find-onceliamwhite2023-06-1811-50/+138
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vk_device_info: Clean up includes [IWYU]lat9nq2023-06-062-3/+11
| * | | | | | | | | vk_device_info: Add SPDX datalat9nq2023-06-062-0/+6
| * | | | | | | | | yuzu-qt: Load Vulkan device info at startuplat9nq2023-06-0611-50/+124
* | | | | | | | | | Merge pull request #10798 from vonchenplus/draw_texture_scaleliamwhite2023-06-181-3/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core: drawtexture support upscaleFeng Chen2023-06-161-3/+7
* | | | | | | | | | | Merge pull request #10809 from Kelebek1/reduce_vertex_bindingsliamwhite2023-06-182-13/+16
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | |
| * | | | | | | | | | Synchronize vertex buffer even when it doesn't require bindingKelebek12023-06-172-13/+16
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10797 from lat9nq/tzdb-patchbunnei2023-06-183-11/+6
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | time_zone_service: Always write time zone rule datalat9nq2023-06-181-8/+2
| * | | | | | | | | | time_zone_manager: Compare to the correct booleanlat9nq2023-06-161-2/+3
| * | | | | | | | | | nx_tzdb: Correct Antarctica spellinglat9nq2023-06-161-1/+1
* | | | | | | | | | | renderer_vulkan: add missing includeLiam2023-06-181-0/+1
* | | | | | | | | | | Merge pull request #10813 from lat9nq/no-atomic-boolMorph2023-06-182-5/+14
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | k_thread: Use a mutex and cond_var to sync boollat9nq2023-06-172-5/+14
* | | | | | | | | | | Merge pull request #10744 from Wollnashorn/af-for-allFernando S2023-06-1814-80/+243
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | video_core: Only apply AF to 2D (array) image typesWollnashorn2023-06-171-2/+7
| * | | | | | | | | | video_core: Removed AF for all mip modes option as it's default nowWollnashorn2023-06-179-40/+3
| * | | | | | | | | | video_core: Use sampler IDs instead pointers in the pipeline configWollnashorn2023-06-168-23/+68
| * | | | | | | | | | video_core: Fallback to default anisotropy instead to 1x anisotropyWollnashorn2023-06-157-16/+20
| * | | | | | | | | | video_core: Disable AF for non-color image formatsWollnashorn2023-06-151-0/+9
| * | | | | | | | | | video_core: Fixed compilation errors because of name shadowingWollnashorn2023-06-152-9/+9
| * | | | | | | | | | video_core: Add per-image anisotropy heuristics (format & mip count)Wollnashorn2023-06-1511-71/+168
| * | | | | | | | | | video_core: Apply AF only to samplers with normal LOD range [0, 1+x]Wollnashorn2023-06-141-4/+6
| * | | | | | | | | | video_core: Fix default anisotropic heuristicWollnashorn2023-06-141-4/+4
| * | | | | | | | | | video_core: Never apply AF to None mipmap modeWollnashorn2023-06-141-3/+4
| * | | | | | | | | | video_core: Disable anisotropic filtering for samplers with depth compareWollnashorn2023-06-131-2/+3
| * | | | | | | | | | video_core: Option to apply anisotropic filtering for all mipmap modesWollnashorn2023-06-139-1/+37
* | | | | | | | | | | Merge pull request #10783 from liamwhite/memorybunnei2023-06-172-6/+6
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core: preallocate fewer IR blocksLiam2023-06-152-6/+6
* | | | | | | | | | | | Merge pull request #10808 from t895/settings-stuffsbunnei2023-06-1712-74/+165
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | android: Expose audio output engine settingCharles Lombardo2023-06-167-21/+59
| * | | | | | | | | | | | android: Expose CPU debugging optionCharles Lombardo2023-06-165-23/+30
| * | | | | | | | | | | | android: Expose fastmem optionCharles Lombardo2023-06-164-29/+59
| * | | | | | | | | | | | android: Support changing multiple settings at onceCharles Lombardo2023-06-162-1/+17
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #10807 from t895/ktlint-fixesbunnei2023-06-171-2/+3
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | android: Bump ktlint version to 0.47.1Charles Lombardo2023-06-161-1/+1
| * | | | | | | | | | | android: Disable import-ordering ktlint checkCharles Lombardo2023-06-161-1/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #10731 from german77/misc_fixesliamwhite2023-06-1710-115/+198
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | service: nfc: Read tag protocol only for nfc backendNarr the Reg2023-06-152-5/+6
| * | | | | | | | | | service: nfc: Accuracy fixesNarr the Reg2023-06-1510-110/+192
* | | | | | | | | | | android: Fix aspect ratio when rotating screenAbandoned Cart2023-06-162-28/+20
| |_|_|_|/ / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #10795 from german77/foomiiboliamwhite2023-06-162-0/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | input_common: Add amiibo with originality signature supportNarr the Reg2023-06-162-0/+3
| |/ / / / / / / / /
* | | | | | | | | | android: Apply ktlint codestyleCharles Lombardo2023-06-1653-278/+476
* | | | | | | | | | Android: Use ktlint for Kotlin code styleCharles Lombardo2023-06-161-0/+20
* | | | | | | | | | android: Enable android lintingCharles Lombardo2023-06-162-11/+1
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #10796 from bunnei/fix-safbunnei2023-06-164-1/+54
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | android: fs: Fix Exists / IsFile for SAF.bunnei2023-06-164-1/+54
* | | | | | | | | | Merge pull request #10790 from liamwhite/arm-driver-momentbunnei2023-06-161-5/+10
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | vulkan_device: disable extended_dynamic_state2 on ARM driversLiam2023-06-151-5/+10
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10775 from liamwhite/cb2bunnei2023-06-161-0/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | renderer_vulkan: propagate conditional barrier supportLiam2023-06-141-0/+1
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10639 from 8bitDream/pictureinpicturebunnei2023-06-1618-159/+647
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | android: Move overlays to their own layoutAbandoned Cart2023-06-145-108/+117
| * | | | | | | | android: Initialize defaults for each orientationsAbandoned Cart2023-06-146-173/+187
| * | | | | | | | android: Display FPS with emulation on hingeAbandoned Cart2023-06-142-17/+13
| * | | | | | | | android: Remove PiP reliance on fragmentAbandoned Cart2023-06-145-63/+69
| * | | | | | | | android: Set layout by fragment, not viewAbandoned Cart2023-06-143-63/+63
| * | | | | | | | android: Add a separate foldable layout setAbandoned Cart2023-06-143-206/+222
| * | | | | | | | android: Set portrait default control paramsAbandoned Cart2023-06-144-17/+186
| * | | | | | | | android: Actually implement portrait controlsAbandoned Cart2023-06-142-33/+82
| * | | | | | | | android: Enable automated portrait controlsAbandoned Cart2023-06-142-81/+40
| * | | | | | | | android: Add Picture in Picture / OrientationAbandoned Cart2023-06-1415-66/+336
* | | | | | | | | Merge pull request #10729 from liamwhite/windows-is-a-memebunnei2023-06-152-99/+118
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | vfs_real: require file existence on openLiam2023-06-131-0/+4
| * | | | | | | | vfs_real: add simplified open file cacheLiam2023-06-132-1/+18
| * | | | | | | | vfs_real: lazily open filesLiam2023-06-132-11/+3
| * | | | | | | | vfs_real: add file LRU cache for open file limitsLiam2023-06-132-100/+106
* | | | | | | | | Merge pull request #10749 from Morph1984/strong-typingMorph2023-06-156-37/+35
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | buffer_cache_base: Specify buffer type in HostBindingsMorph2023-06-136-37/+35
| |/ / / / / / /
* | / / / / / / android: Adapt EmulationActivity to navigation componentCharles Lombardo2023-06-149-74/+86
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #10603 from lat9nq/tz-more-completebunnei2023-06-1313-710/+383
|\ \ \ \ \ \ \
| * | | | | | | tz_manager: Fix comparison to wrong integerlat9nq2023-06-051-1/+1
| * | | | | | | tz_manager: Implement missing transition timeslat9nq2023-06-051-1/+59
| * | | | | | | tz_manager: Warn on unimplemented codelat9nq2023-06-051-0/+7
| * | | | | | | tz_manager: Fix character offset not advancinglat9nq2023-06-051-0/+1
| * | | | | | | tz_manager: Fix off-by-one errorlat9nq2023-06-051-4/+4
| * | | | | | | time_zone: Handle offset time zoneslat9nq2023-06-051-38/+26
| * | | | | | | time_zone_binary: Add zoneinfo datalat9nq2023-06-052-643/+65
| * | | | | | | time: Implement missing servicesNarr the Reg2023-06-057-11/+106
| * | | | | | | time_zone_manager: Implement go_ahead/go_backlat9nq2023-06-051-1/+39
| * | | | | | | tz_content_manager: Try the system time zone firstlat9nq2023-06-051-2/+9
| * | | | | | | common: Move system time zone string detectionlat9nq2023-06-053-76/+84
| * | | | | | | configure_system: Remove external offset on custom rtclat9nq2023-06-051-2/+1
| * | | | | | | time: Remove auto timezone considerationlat9nq2023-06-053-33/+3
| * | | | | | | settings: Always report a valid time zonelat9nq2023-06-051-2/+76
| * | | | | | | time_manager: Don't offset RTC by system time zonelat9nq2023-06-051-5/+1
| * | | | | | | tz_content_manager: Detect system time zonelat9nq2023-06-051-1/+11
* | | | | | | | Merge pull request #10760 from FearlessTobi/translationsCharles Lombardo2023-06-132-0/+18
|\ \ \ \ \ \ \ \
| * | | | | | | | android: Declare languages in locales_config.xmlFearlessTobi2023-06-132-0/+18
* | | | | | | | | Merge pull request #10751 from german77/touchCharles Lombardo2023-06-131-2/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | android: Fix touch inputgerman772023-06-131-2/+4
* | | | | | | | | | Merge pull request #10747 from liamwhite/arm-interface-decouplebunnei2023-06-1315-172/+189
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | core: decouple ARM interface from DynarmicLiam2023-06-1315-172/+189
| |/ / / / / / / /
* | | | | | | | | Merge pull request #10746 from bunnei/update-android-settingsbunnei2023-06-1319-110/+28
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | android: settings: Disable force_max_clock by default.bunnei2023-06-133-5/+5
| * | | | | | | | | android: settings: Add reactive flushing as a default-disabled setting.bunnei2023-06-135-0/+24
| * | | | | | | | | android: res: Remove translated strings that no longer exist.bunnei2023-06-1314-106/+0
| |/ / / / / / / /
* | | | | | | | | Merge pull request #10675 from liamwhite/scalerliamwhite2023-06-131-8/+12
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | image_info: adjust rescale thresholds and refactor constant useLiam2023-06-081-8/+12
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #10743 from FearlessTobi/translationsbunnei2023-06-1314-0/+4816
|\ \ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | |
| * | | | | | | android: Add translation files manuallyFearlessTobi2023-06-1314-0/+4816
* | | | | | | | Merge pull request #10705 from german77/updatesbunnei2023-06-137-5/+183
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | android: Add update supportNarr the Reg2023-06-127-5/+183
* | | | | | | | Merge pull request #10728 from t895/game-hashbunnei2023-06-121-7/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | android: Use autogenerated hash code function for Game classCharles Lombardo2023-06-121-7/+12
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #10724 from t895/auto-version-propertybunnei2023-06-121-1/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | android: Use autoVersion when gradle property is setCharles Lombardo2023-06-121-1/+15
| |/ / / / / / /
* | | | | | | | Merge pull request #10699 from liamwhite/conditional-barrierMatías Locatti2023-06-1210-0/+65
|\ \ \ \ \ \ \ \
| * | | | | | | | shader_recompiler: remove barriers in conditional control flow when device lacks supportLiam2023-06-1010-0/+65
* | | | | | | | | Merge pull request #10693 from liamwhite/f64-to-f32bunnei2023-06-128-0/+198
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | shader_recompiler: translate f64 to f32 when unsupported on hostLiam2023-06-108-0/+198
* | | | | | | | | Merge pull request #10718 from liamwhite/buffered-ioMorph2023-06-121-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | qt: use larger buffer for update installLiam2023-06-111-1/+1
* | | | | | | | | Merge pull request #10668 from Kelebek1/reduce_vertex_bindingsbunnei2023-06-116-24/+148
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Combine vertex/transform feedback buffer binding into a single callKelebek12023-06-086-24/+148
* | | | | | | | | | Merge pull request #10713 from t895/gradle-updatesbunnei2023-06-112-16/+11
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | android: Update dependenciesCharles Lombardo2023-06-111-4/+4
| * | | | | | | | | | android: Differentiate build types with new namesCharles Lombardo2023-06-112-2/+7
| * | | | | | | | | | Android: Remove unused relWithVersionCode build typeCharles Lombardo2023-06-111-10/+0
| | |_|_|_|/ / / / / | |/| | | | | | | |
* / | | | | | | | | android: Use ContentResolver to get file extensionCharles Lombardo2023-06-113-11/+28
|/ / / / / / / / /
* | / / / / / / / android: Fix screen orientation & blurriness.bunnei2023-06-114-95/+5
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #10670 from liamwhite/fxaa2bunnei2023-06-101-4/+4
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | vk_blit_screen: use higher bit depth for fxaaLiam2023-06-081-4/+4
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #10685 from liamwhite/serialization-is-hardMorph2023-06-101-0/+2
|\ \ \ \ \ \ \
| * | | | | | | qt: persist framerate sync optionLiam2023-06-091-0/+2
* | | | | | | | Merge pull request #10691 from t895/nro-checkbunnei2023-06-108-13/+51
|\ \ \ \ \ \ \ \
| * | | | | | | | android: Add proper homebrew checkCharles Lombardo2023-06-108-13/+51
| | |_|_|/ / / / | |/| | | | | |
* / | | | | | | android: Fix input overlay version checkCharles Lombardo2023-06-091-12/+14
|/ / / / / / /
* | | | | | | Merge pull request #10614 from xcfrg/shader-backend-status-barliamwhite2023-06-093-1/+14
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | yuzu: add opengl shader backend info in status barxcfrg2023-06-043-1/+14
* | | | | | | Merge pull request #10623 from german77/backupliamwhite2023-06-0910-39/+184
|\ \ \ \ \ \ \
| * | | | | | | service: nfc: Add backup supportgerman772023-06-0710-39/+184
* | | | | | | | Merge pull request #10666 from liamwhite/my-framerate-is-fineliamwhite2023-06-0911-24/+48
|\ \ \ \ \ \ \ \
| * | | | | | | | nvnflinger: allow locking framerate during video playbackLiam2023-06-0811-24/+48
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #10676 from bunnei/fix-mi-5-androidliamwhite2023-06-091-1/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | android: EmulationActivity: Fix orientation on Mi Pad 5.bunnei2023-06-091-1/+2
| |/ / / / / / /
* / / / / / / / Fix potentially uninitialized local variable warningTokarev Artem2023-06-091-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #10650 from qurious-pixel/android_tvbunnei2023-06-082-14/+8
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | remove version code declarationqurious-pixel2023-06-071-1/+0
| * | | | | | Android TV bannerLive session user2023-06-063-14/+9
* | | | | | | Merge pull request #10655 from Morph1984/msvc-cxx20liamwhite2023-06-071-2/+4
|\ \ \ \ \ \ \
| * | | | | | | CMakeLists: Force C++20 on MSVC due to conflicts with C++23 modulesMorph2023-06-071-2/+4
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #10635 from mrcmunir/l4t-tx1-nvidialiamwhite2023-06-071-4/+4
|\ \ \ \ \ \ \
| * | | | | | | Updated to lexicographical order suggestionsCarlos Estrague / Mrc_munir2023-06-061-3/+3
| * | | | | | | Make VK_EXT_robustness2 optionalCarlos Estrague / Mrc_munir2023-06-061-4/+4
* | | | | | | | Merge pull request #10476 from ameerj/gl-memory-mapsliamwhite2023-06-0715-204/+316
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_staging_buffers: Optimization to reduce fence waitingameerj2023-05-282-4/+22
| * | | | | | | | OpenGL: Make use of persistent buffer maps in buffer cache downloadsameerj2023-05-2815-204/+298
* | | | | | | | | Merge pull request #10583 from ameerj/ill-logicliamwhite2023-06-071-8/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | texture_cache: Fix incorrect logic for AccelerateDMAameerj2023-06-031-8/+4
* | | | | | | | | | Merge pull request #10591 from keve1227/localized-game-iconsliamwhite2023-06-074-10/+42
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | Fix typoKevin Sundqvist Norlén2023-06-031-1/+1
| * | | | | | | | | Update Chinese NX language namesKeve12272023-06-032-8/+8
| * | | | | | | | | Issue a reload if the system language changedKeve12272023-06-031-1/+2
| * | | | | | | | | Pick game icon based on the configured system languageKeve12272023-06-031-1/+32
| |/ / / / / / / /
* | | | / / / / / android: Set version codeNarr the Reg2023-06-061-0/+1
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | android: Improve Gradle build configurationAbandoned Cart2023-06-061-1/+2
| |_|_|_|_|/ / |/| | | | | |
* | | | | | | android: audio_core: sink_stream: Remove unnecessary check.bunnei2023-06-061-3/+0
* | | | | | | Merge pull request #10508 from yuzu-emu/limebunnei2023-06-06328-176/+21104
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | Merge pull request #10633 from t895/variable-surface-ratiobunnei2023-06-063-1/+62
| |\ \ \ \ \ \
| | * | | | | | android: Use a custom view for changing emulation aspect ratioCharles Lombardo2023-06-063-1/+62
| * | | | | | | Merge pull request #10578 from PabloG02/lime-firmware&logsbunnei2023-06-069-33/+270
| |\ \ \ \ \ \ \
| | * | | | | | | android: HomeSettingsFragment: Use string resource for "Share log".bunnei2023-06-061-1/+1
| | * | | | | | | Address feedbackPabloG022023-06-064-19/+28
| | * | | | | | | Attempt to move the unzip coroutine to a ViewModelPabloG022023-06-043-27/+94
| | * | | | | | | android: update stringsPabloG022023-06-041-5/+5
| | * | | | | | | android: add option to share logPabloG022023-06-043-0/+36
| | * | | | | | | android: add option to install firmwarePabloG022023-06-045-1/+124
| | * | | | | | | android: move unzip function to FileUtil and use SecurityExceptionPabloG022023-06-042-32/+34
| * | | | | | | | Merge pull request #10618 from t895/licensesbunnei2023-06-0610-4/+918
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | |
| | * | | | | | | android: Create licenses pageCharles Lombardo2023-06-0510-4/+918
| * | | | | | | | Merge pull request #10613 from t895/settings-changesbunnei2023-06-057-104/+116
| |\ \ \ \ \ \ \ \
| | * | | | | | | | android: Move settings to debug submenuCharles Lombardo2023-06-054-26/+38
| | * | | | | | | | android: Several string changesCharles Lombardo2023-06-045-78/+78
| * | | | | | | | | android: Load settings at the start of each activityCharles Lombardo2023-06-054-6/+19
| | |/ / / / / / / | |/| | | | | | |
| * | | | | | | | android: Resolve a couple Gradle warningsAbandoned Cart2023-06-041-1/+4
| |/ / / / / / /
| * | | | | | | android: Add support for split foldable viewAbandoned Cart2023-06-043-1/+55
| * | | | | | | android: Replace deprecated and Java codeAbandoned Cart2023-06-031-27/+20
| |/ / / / / /
| * | | | | | android: Fix crash on importing invalid saveCharles Lombardo2023-06-031-3/+5
| * | | | | | android: vk_presentation_manager: Fix unusued needs_recreation.bunnei2023-06-031-3/+3
| * | | | | | android: Rename "Input Overlay" to "Overlay Options"Charles Lombardo2023-06-031-1/+1
| * | | | | | android: Adjust import/export saves dialogCharles Lombardo2023-06-033-15/+21
| * | | | | | android: Warning dialogs for key errorsCharles Lombardo2023-06-033-31/+95
| * | | | | | android: vk_turbo_mode: Remove unnecessary device recreation.bunnei2023-06-032-2/+11
| * | | | | | android: EmulationFragment: Remove unnecessary surface destroy on pause.bunnei2023-06-031-3/+0
| * | | | | | android: renderer_vulkan: Fix crash with surface recreation.bunnei2023-06-035-1/+36
| * | | | | | android: Fix presentation layout on foldable and tablet devices.bunnei2023-06-035-22/+94
| * | | | | | android: Enable overlay scale/opacity dialogCharles Lombardo2023-06-0310-65/+182
| * | | | | | Add image to card_game.xml to preview in the Layout EditorPabloG022023-06-031-1/+2
| * | | | | | Save the position of buttons as a percentagePabloG022023-06-031-80/+136
| * | | | | | android: Don't crash the app when selecting a zip that causes a SecurityExceptionCharles Lombardo2023-06-031-1/+5
| * | | | | | input_common: Fix virtual amiibosbunnei2023-06-031-4/+4
| * | | | | | android: audio_core: Avoid shutdown hang.bunnei2023-06-031-0/+3
| * | | | | | android: ForegroundService: Handle null intent.bunnei2023-06-031-1/+4
| * | | | | | android: ImportExportSavesFragment: Cleanup strings.bunnei2023-06-032-7/+10
| * | | | | | Update src/android/app/src/main/java/org/yuzu/yuzu_emu/fragments/ImportExportSavesFragment.ktbunnei2023-06-031-1/+1
| * | | | | | Remove `?.`PabloG022023-06-031-1/+1
| * | | | | | Check if folder exists before letting the user import/export savesPabloG022023-06-031-9/+17
| * | | | | | Add save import/export in UIPabloG022023-06-035-0/+247
| * | | | | | android: Fix FPS text getting cut off by rounded display cornersCharles Lombardo2023-06-032-7/+20
| * | | | | | android: Prevent deleting the settings file while a game is runningCharles Lombardo2023-06-033-2/+7
| * | | | | | android: Fix link text color for base theme dialogCharles Lombardo2023-06-031-0/+1
| * | | | | | android: Various fixes for CI.bunnei2023-06-0326-60/+121
| * | | | | | android: externals: Update libadrenotools, use useLegacyPackaging.bunnei2023-06-031-0/+5
| * | | | | | android: Re-enable service notificationCharles Lombardo2023-06-034-24/+29
| * | | | | | android: Ensure keys are loaded before populating games listCharles Lombardo2023-06-031-0/+3
| * | | | | | android: Use dialog fragment for the reset settings dialogCharles Lombardo2023-06-032-12/+37
| * | | | | | android: Upgrade AGP to 8.0.2Charles Lombardo2023-06-031-2/+2
| * | | | | | android: Show notification permission page during setupCharles Lombardo2023-06-034-59/+151
| * | | | | | android: DIsable FPS counter by defaultCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Improve searches with one characterCharles Lombardo2023-06-031-1/+2
| * | | | | | android: Stop building x86 packages in APKsCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Add FPS toggleCharles Lombardo2023-06-034-10/+37
| * | | | | | android: Clean up app build.gradleCharles Lombardo2023-06-031-22/+2
| * | | | | | video_core: vk_rasterizer: Decrease draw dispatch count for Android.bunnei2023-06-031-0/+4
| * | | | | | android: config: Expose VSync as a configurable setting.bunnei2023-06-035-9/+44
| * | | | | | android: GPU: Enable async presentation, increase frames in flight.bunnei2023-06-032-2/+4
| * | | | | | android: Enable onBackInvokedCallbackCharles Lombardo2023-06-031-1/+2
| * | | | | | android: Remove deprecated use of onBackPressed()Charles Lombardo2023-06-031-1/+16
| * | | | | | android: Add option for touch overlay hapticsCharles Lombardo2023-06-036-4/+51
| * | | | | | android: Improve missing game handlingCharles Lombardo2023-06-032-1/+19
| * | | | | | android: Clean up dependenciesCharles Lombardo2023-06-031-7/+3
| * | | | | | android: Delete java code style fileCharles Lombardo2023-06-031-241/+0
| * | | | | | android: Settings UI tweaksCharles Lombardo2023-06-036-23/+24
| * | | | | | android: Simplify setup in search and games fragmentsCharles Lombardo2023-06-032-57/+62
| * | | | | | android: Use collapsing toolbar layout in settingsCharles Lombardo2023-06-033-11/+26
| * | | | | | android: Remove unnecessary JvmStatic/JvmField annotationsCharles Lombardo2023-06-0311-17/+0
| * | | | | | android: Fix navigation rail animation in rtl layoutCharles Lombardo2023-06-031-4/+14
| * | | | | | android: Use cutout insets on setup fragmentCharles Lombardo2023-06-031-5/+6
| * | | | | | android: Button to reset all settingsCharles Lombardo2023-06-0321-23/+138
| * | | | | | android: Use proguard file in relWithDebInfoCharles Lombardo2023-06-031-0/+4
| * | | | | | android: Fix background color within inset areasCharles Lombardo2023-06-032-2/+4
| * | | | | | android: Shortcut to settings activity on reselectionCharles Lombardo2023-06-031-2/+11
| * | | | | | android: Expose custom RTC settingCharles Lombardo2023-06-039-31/+72
| * | | | | | android: Reset setting on long pressCharles Lombardo2023-06-0316-7/+89
| * | | | | | android: Fix issues with ea/main icons and version codesCharles Lombardo2023-06-037-28/+19
| * | | | | | android: Move theme options out of advanced settingsCharles Lombardo2023-06-034-9/+17
| * | | | | | android: Check if cached games are validCharles Lombardo2023-06-031-1/+9
| * | | | | | android: Invert rotation to match phone orientationgerman772023-06-031-5/+27
| * | | | | | android: vulkan_device: Skip BGR565 emulation on S8gen2.bunnei2023-06-031-1/+3
| * | | | | | android: config: Use default anisotropic filtering.bunnei2023-06-031-1/+4
| * | | | | | android: Remove top padding from in game menu itemsCharles Lombardo2023-06-031-20/+12
| * | | | | | android: Use different icons for mainline/eaCharles Lombardo2023-06-0310-5/+835
| * | | | | | android: Add early access upgrade fragmentCharles Lombardo2023-06-0313-2/+419
| * | | | | | android: vulkan_device: Only compile OverrideBcnFormats when used.bunnei2023-06-031-0/+2
| * | | | | | android: remove spurious warnings about BCn formats when patched with adrenotoolsLiam2023-06-031-1/+27
| * | | | | | android: video_core: Disable some problematic things on GPU Normal.bunnei2023-06-033-0/+40
| * | | | | | android: settings: Use mailbox vsync by default.bunnei2023-06-032-2/+5
| * | | | | | android: video_core: Disable problematic compute shaders.bunnei2023-06-035-5/+17
| * | | | | | android: Update progard to fix settings crashCharles Lombardo2023-06-031-0/+8
| * | | | | | android: vulkan: Recreate surface after suspension & adapt to async. presentation.bunnei2023-06-038-26/+39
| * | | | | | android: Game data cacheCharles Lombardo2023-06-038-17/+63
| * | | | | | android: Update to Kotlin 1.8.21Charles Lombardo2023-06-031-1/+1
| * | | | | | android: Disable jetifierCharles Lombardo2023-06-031-2/+1
| * | | | | | android: Update dependenciesCharles Lombardo2023-06-031-2/+2
| * | | | | | android: Migrate to AGP 8.0.1Charles Lombardo2023-06-034-6/+17
| * | | | | | android: Enable non-transitive R classesCharles Lombardo2023-06-034-5/+15
| * | | | | | android: config: Enable asynchronous presentation by default on Android.bunnei2023-06-032-0/+8
| * | | | | | video_core: Enable support_descriptor_aliasing on Turnip, disable storage atomic otherwise.bunnei2023-06-033-5/+16
| * | | | | | android: fix deadzone calculationgerman772023-06-031-4/+12
| * | | | | | android: Fix background color when starting emulationCharles Lombardo2023-06-031-0/+1
| * | | | | | android: Persistent scrollbars on home settings fragmentCharles Lombardo2023-06-032-5/+14
| * | | | | | android: Use short build hashCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Use navigation bar shade viewCharles Lombardo2023-06-034-49/+54
| * | | | | | android: About fragmentCharles Lombardo2023-06-0310-3/+415
| * | | | | | android: Use x-axis animation for navigation railCharles Lombardo2023-06-033-3/+23
| * | | | | | android: Sort games alphabetically by defaultCharles Lombardo2023-06-031-2/+9
| * | | | | | android: New icons for navigation barCharles Lombardo2023-06-037-4/+47
| * | | | | | android: New icons for home settings fragmentCharles Lombardo2023-06-034-21/+11
| * | | | | | android: Add navigation railCharles Lombardo2023-06-0314-93/+208
| * | | | | | android: Search FragmentCharles Lombardo2023-06-0320-189/+551
| * | | | | | android: Fix potential zip traversal exploitCharles Lombardo2023-06-031-3/+9
| * | | | | | android: Add dedicated show overlay checkboxgerman772023-06-033-6/+30
| * | | | | | android: Add user directory shortcutCharles Lombardo2023-06-036-25/+140
| * | | | | | android: Fix inline keyboard inputgerman772023-06-031-5/+7
| * | | | | | android: Fix grammatical mistake in video core error messageCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Adjust wording on GPU driver install buttonCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Add deadzone to stick inputNarr the Reg2023-06-031-19/+45
| * | | | | | android: Move motion listener to emulation activitygerman772023-06-032-64/+71
| * | | | | | core: hid: Finish linking motion from virtual controllersNarr the Reg2023-06-035-9/+57
| * | | | | | android: Change wording for "Add Games" button (#100)Charles Lombardo2023-06-032-4/+6
| * | | | | | android: Scroll shortcut for games listCharles Lombardo2023-06-033-1/+34
| * | | | | | android: Setup screen hotfixCharles Lombardo2023-06-033-12/+32
| * | | | | | android: Swap Default and Install buttons for GPU driver installation dialogCharles Lombardo2023-06-031-2/+2
| * | | | | | android: Add warnings to setup screensCharles Lombardo2023-06-034-13/+149
| * | | | | | android: Allow search bar to scroll offscreenCharles Lombardo2023-06-033-15/+8
| * | | | | | android: Update app iconCharles Lombardo2023-06-032-34/+30
| * | | | | | android: Change organization of the settings tab in the home screenCharles Lombardo2023-06-037-44/+44
| * | | | | | android: Properly pop setup fragment from the back stackCharles Lombardo2023-06-031-1/+3
| * | | | | | android: Vertically scalable setup pagesCharles Lombardo2023-06-032-23/+45
| * | | | | | android: Fix setup rotation bugCharles Lombardo2023-06-032-4/+26
| * | | | | | android: Temporarily switch for a fixed version code for testingCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Fix alignment of SwipeRefreshLayoutCharles Lombardo2023-06-031-5/+9
| * | | | | | android: Shape/spacing adjustments to game cardCharles Lombardo2023-06-033-58/+64
| * | | | | | android: Manual tweaks for dialog colorsCharles Lombardo2023-06-036-2/+21
| * | | | | | android: Fix black backgrounds bugCharles Lombardo2023-06-031-6/+18
| * | | | | | android: Use navigation bar shade view for settings activityCharles Lombardo2023-06-032-3/+20
| * | | | | | android: Disable editing themes during emulationCharles Lombardo2023-06-031-3/+3
| * | | | | | android: Prevent situation where binding is called on a null viewCharles Lombardo2023-06-031-0/+3
| * | | | | | android: Add black backgrounds toggleCharles Lombardo2023-06-036-1/+42
| * | | | | | android: Add theme mode pickerCharles Lombardo2023-06-035-11/+76
| * | | | | | android: Add theme pickerCharles Lombardo2023-06-037-3/+127
| * | | | | | android: Prevent potential abstract settings crashCharles Lombardo2023-06-031-0/+4
| * | | | | | android: Fix cast for abstract settingsCharles Lombardo2023-06-034-5/+5
| * | | | | | android: Create xml for Material You themeCharles Lombardo2023-06-032-0/+58
| * | | | | | android: Remove check for API 29 in themesCharles Lombardo2023-06-032-15/+4
| * | | | | | android: Adjustments to home option cardCharles Lombardo2023-06-031-4/+10
| * | | | | | android: Use different colors for logo in options menuCharles Lombardo2023-06-032-3/+3
| * | | | | | android: New default theme colorsCharles Lombardo2023-06-032-30/+34
| * | | | | | android: Use libnx default iconCharles Lombardo2023-06-034-1/+1
| * | | | | | android: enable LTOLiam2023-06-031-1/+2
| * | | | | | android: Show error if invalid keys file is selectedCharles Lombardo2023-06-032-0/+23
| * | | | | | android: Fix first time setup scrolling bugCharles Lombardo2023-06-032-18/+17
| * | | | | | android: Fix A button preference keyCharles Lombardo2023-06-031-1/+1
| * | | | | | android: First time setup screenCharles Lombardo2023-06-0319-163/+769
| * | | | | | android: Prevent editing unsafe settings at runtimeCharles Lombardo2023-06-035-14/+35
| * | | | | | android: Abstract settingsCharles Lombardo2023-06-0324-363/+418
| * | | | | | android: Implement gamepad inputgerman772023-06-036-11/+510
| * | | | | | android: Bump minimum version to Android 11Charles Lombardo2023-06-031-1/+1
| * | | | | | android: Decouple status bar shade from navigation bar visibilityCharles Lombardo2023-06-033-14/+34
| * | | | | | android: Enable code minificationCharles Lombardo2023-06-035-22/+18
| * | | | | | android: Switch from a colored status bar to a custom viewCharles Lombardo2023-06-034-23/+35
| * | | | | | android: Adjustments to card_gameCharles Lombardo2023-06-031-20/+5
| * | | | | | android: MainActivity overhaulCharles Lombardo2023-06-0332-626/+1031
| * | | | | | android: Enforce Vulkan 1.1 support as minimumCharles Lombardo2023-06-031-3/+4
| * | | | | | android: Update gradle version to 8.1Charles Lombardo2023-06-031-1/+1
| * | | | | | android: Update app dependenciesCharles Lombardo2023-06-031-5/+5
| * | | | | | android: Convert gradle scripts to Kotlin DSLCharles Lombardo2023-06-035-201/+241
| * | | | | | android: vulkan: Disable vertex_input_dynamic_state on Qualcomm.bunnei2023-06-031-1/+2
| * | | | | | android: settings: Add scaling filter & anti-aliasing options. (#66)bunnei2023-06-034-0/+75
| * | | | | | android: video_core: Add support for disk shader cache. (#64)bunnei2023-06-0312-4/+258
| * | | | | | android: vulkan_debug_callback: Ignore many innocuous errors.bunnei2023-06-031-0/+28
| * | | | | | android: config: Change docked mode and GPU accuracy to favor performance on Android.bunnei2023-06-033-7/+11
| * | | | | | service: account: Save user profile folder on first user creationgerman772023-06-031-0/+1
| * | | | | | android: Initialize account managergerman772023-06-031-0/+5
| * | | | | | android: Remove unsafe null checkgerman772023-06-031-4/+2
| * | | | | | android: Scale input overlay independently of system display scaleCharles Lombardo2023-06-032-30/+41
| * | | | | | android: Use apply instead of commit for shared preferencesCharles Lombardo2023-06-033-4/+3
| * | | | | | android: Add DPad slide toggleCharles Lombardo2023-06-035-2/+14
| * | | | | | android: Add relative stick center toggleCharles Lombardo2023-06-033-0/+13
| * | | | | | android: Make hash and branch accessible from BuildConfigCharles Lombardo2023-06-031-0/+25
| * | | | | | android: Backup shared preferences where applicableCharles Lombardo2023-06-032-0/+12
| * | | | | | android: Enable retaining app data after uninstallCharles Lombardo2023-06-031-1/+2
| * | | | | | android: Remove unused doFrame functionCharles Lombardo2023-06-031-2/+0
| * | | | | | android: Convert NativeLibrary to KotlinCharles Lombardo2023-06-0315-766/+523
| * | | | | | android: Remove LocalBroadcastManagerCharles Lombardo2023-06-0311-225/+17
| * | | | | | android: Remove game databaseCharles Lombardo2023-06-0318-773/+154
| * | | | | | android: Adjust game icon loadingCharles Lombardo2023-06-031-15/+9
| * | | | | | android: Remove unused dimensions filesCharles Lombardo2023-06-032-9/+0
| * | | | | | android: Slightly reduce game card sizeCharles Lombardo2023-06-032-3/+3
| * | | | | | android: Only show company text view if it has contentCharles Lombardo2023-06-031-5/+8
| * | | | | | android: Fix check for ok text in software keyboardCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Implement amiibo reading from nfc tagNarr the Reg2023-06-0315-8/+327
| * | | | | | android: vulkan_device: Disable VK_EXT_custom_border_color on Adreno.bunnei2023-06-031-0/+7
| * | | | | | android: Add toggle controls option to input overlayCharles Lombardo2023-06-035-6/+62
| * | | | | | android: Do not update FPS text on null viewCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Convert keyboard applet to kotlin and refactorCharles Lombardo2023-06-036-279/+255
| * | | | | | android: Implement basic software keyboard applet.bunnei2023-06-0312-152/+625
| * | | | | | android: config: Disable shader cache by default on Android.bunnei2023-06-031-0/+4
| * | | | | | android: Fix fps counter not showing upgerman772023-06-034-11/+13
| * | | | | | android: Prevent showing games on an invalid viewCharles Lombardo2023-06-031-0/+3
| * | | | | | android: Re-implement overlay editingCharles Lombardo2023-06-035-25/+245
| * | | | | | android: Fix popup menu going out of boundsCharles Lombardo2023-06-032-20/+11
| * | | | | | android: Use autofit grid for games fragmentCharles Lombardo2023-06-033-28/+72
| * | | | | | android: Prevent updating empty game list text on invalid viewCharles Lombardo2023-06-031-0/+3
| * | | | | | android: Persist settings across configuration changesCharles Lombardo2023-06-039-93/+51
| * | | | | | android: Store settings object in viewmodelCharles Lombardo2023-06-037-57/+45
| * | | | | | android: Remove configChanges exceptionsCharles Lombardo2023-06-031-1/+0
| * | | | | | Android: Enable resizeable activitiesCharles Lombardo2023-06-031-6/+2
| * | | | | | android: Fix emulation fragment commentsCharles Lombardo2023-06-031-2/+2
| * | | | | | android: Use modal navigation drawer as in game menuCharles Lombardo2023-06-0317-373/+343
| * | | | | | android: Make Game class parcelableCharles Lombardo2023-06-031-1/+4
| * | | | | | android: Add kotlin parcelize pluginCharles Lombardo2023-06-031-0/+1
| * | | | | | android: Remove deprecated use of onActivityResultCharles Lombardo2023-06-032-139/+107
| * | | | | | android: Fix RTL layoutsCharles Lombardo2023-06-033-1/+6
| * | | | | | android: Use ellipsis characterCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Move all array strings to main strings fileCharles Lombardo2023-06-032-48/+109
| * | | | | | android: Remove unused stringsCharles Lombardo2023-06-031-9/+0
| * | | | | | android: Remove unused colorsCharles Lombardo2023-06-032-6/+0
| * | | | | | android: Remove citra date time pickerCharles Lombardo2023-06-031-22/+0
| * | | | | | android: Remove unused premium header layoutCharles Lombardo2023-06-031-42/+0
| * | | | | | android: Remove unused fragment animationsCharles Lombardo2023-06-032-41/+0
| * | | | | | android: Remove unused string arraysCharles Lombardo2023-06-031-34/+0
| * | | | | | android: Remove unused integer xmlsCharles Lombardo2023-06-034-13/+0
| * | | | | | android: Refactor ic_launcher.xml to drawablesCharles Lombardo2023-06-033-3/+3
| * | | | | | android: Suppress lint in InsetsHelperCharles Lombardo2023-06-031-0/+2
| * | | | | | android: Add data extraction rulesCharles Lombardo2023-06-033-2/+56
| * | | | | | android: Remove requestLegacyExternalStorage attributeCharles Lombardo2023-06-031-3/+1
| * | | | | | android: Remove unused permissionsCharles Lombardo2023-06-031-3/+0
| * | | | | | android: Inset input overlay based on system cutoutsCharles Lombardo2023-06-035-59/+94
| * | | | | | Use yuzu as category instead of citraNarr the Reg2023-06-031-1/+1
| * | | | | | android: Stop updating fps counter when emulation stopsCharles Lombardo2023-06-031-1/+4
| * | | | | | android: Move driver installation off of main threadCharles Lombardo2023-06-034-21/+42
| * | | | | | android: Fix crash when decodeGameIcon creates a null BitmapCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Use view bindingCharles Lombardo2023-06-0316-284/+189
| * | | | | | android: Enable view bindingCharles Lombardo2023-06-031-0/+2
| * | | | | | android: Refactor CheckBoxSetting to SwitchSettingCharles Lombardo2023-06-035-14/+14
| * | | | | | android: EmulationActivity: Fix variable shadowing in fragment creation.bunnei2023-06-031-2/+2
| * | | | | | android: res: fragment_emulation: Ensure FPS counter is shown.bunnei2023-06-031-7/+7
| * | | | | | common: link libandroid on androidLiam2023-06-031-0/+5
| * | | | | | build: only enable adrenotools on arm64Liam2023-06-037-10/+18
| * | | | | | android: Use Skyline's document providerCharles Lombardo2023-06-033-4/+319
| * | | | | | android: Use androidx splash screenCharles Lombardo2023-06-034-2/+12
| * | | | | | android: Replace Picasso with CoilCharles Lombardo2023-06-037-138/+41
| * | | | | | android: New swipe to refresh color schemeCharles Lombardo2023-06-031-1/+9
| * | | | | | android: New settings fragment animationsCharles Lombardo2023-06-0312-163/+80
| * | | | | | android: Use edge to edgeCharles Lombardo2023-06-039-21/+110
| * | | | | | android: Use Material 3 componentsCharles Lombardo2023-06-0323-174/+268
| * | | | | | android: Modernize theme systemCharles Lombardo2023-06-038-94/+130
| * | | | | | android: Use vector iconsCharles Lombardo2023-06-0342-9/+27
| * | | | | | android: Use adaptive iconCharles Lombardo2023-06-0313-3/+24
| * | | | | | android: settings: Dynamically evaluate valueAsStringbunnei2023-06-034-4/+4
| * | | | | | android: Add license identifierCharles Lombardo2023-06-0366-5/+199
| * | | | | | android: Convert YuzuApplication to KotlinCharles Lombardo2023-06-032-59/+56
| * | | | | | android: Convert Action1 to KotlinCharles Lombardo2023-06-032-5/+5
| * | | | | | android: Convert GameViewHolder to KotlinCharles Lombardo2023-06-032-44/+32
| * | | | | | android: Remove ThemeUtilCharles Lombardo2023-06-031-34/+0
| * | | | | | android: Convert StartupHandler to KotlinCharles Lombardo2023-06-032-45/+45
| * | | | | | android: Convert Log to KotlinCharles Lombardo2023-06-032-39/+42
| * | | | | | android: Convert GpuDriverMetadata to KotlinCharles Lombardo2023-06-032-45/+44
| * | | | | | android: Convert GpuDriverHelper to KotlinCharles Lombardo2023-06-032-130/+145
| * | | | | | android: Convert GameIconRequestHandler to KotlinCharles Lombardo2023-06-032-29/+22
| * | | | | | android: Convert ForegroundService to KotlinCharles Lombardo2023-06-032-63/+56
| * | | | | | android: Convert FileUtil to KotlinCharles Lombardo2023-06-032-296/+292
| * | | | | | android: Convert FileBrowserHelper to KotlinCharles Lombardo2023-06-032-25/+26
| * | | | | | android: Convert EmulationMenuSettings to KotlinCharles Lombardo2023-06-032-78/+59
| * | | | | | android: Convert DocumentsTree to KotlinCharles Lombardo2023-06-032-125/+110
| * | | | | | android: Convert DirectoryStateReceiver to KotlinCharles Lombardo2023-06-032-22/+15
| * | | | | | android: Convert DirectoryInitialization to KotlinCharles Lombardo2023-06-032-72/+66
| * | | | | | android: Convert ControllerMappingHelper to KotlinCharles Lombardo2023-06-031-25/+24
| * | | | | | android: Convert BiMap to KotlinCharles Lombardo2023-06-032-22/+22
| * | | | | | android: Convert AddDirectoryHelper to KotlinCharles Lombardo2023-06-032-38/+27
| * | | | | | android: Convert PlatformGamesView to KotlinCharles Lombardo2023-06-031-6/+6
| * | | | | | android: Convert PlatformGamesPresenter to KotlinCharles Lombardo2023-06-032-42/+30
| * | | | | | android: Convert PlatformGamesFragment to KotlinCharles Lombardo2023-06-032-105/+94
| * | | | | | android: Convert MainView to KotlinCharles Lombardo2023-06-031-8/+6
| * | | | | | android: Convert MainPresenter to KotlinCharles Lombardo2023-06-032-81/+66
| * | | | | | android: Convert InputOverlayDrawableJoystick to KotlinCharles Lombardo2023-06-032-243/+205
| * | | | | | android: Convert MainActivity to KotlinCharles Lombardo2023-06-033-250/+229
| * | | | | | android: Remove ExampleInstrumentedTestCharles Lombardo2023-06-031-3/+0
| * | | | | | android: Remove TwoPaneOnBackPressedCallbackCharles Lombardo2023-06-031-37/+0
| * | | | | | android: Convert InputOverlayDrawableDpad to KotlinCharles Lombardo2023-06-032-276/+232
| * | | | | | android: Convert InputOverlayDrawableButton to KotlinCharles Lombardo2023-06-032-139/+118
| * | | | | | android: Convert InputOverlay to KotlinCharles Lombardo2023-06-032-656/+886
| * | | | | | android: Remove DividerItemDecorationCharles Lombardo2023-06-031-130/+0
| * | | | | | android: Inherit from Material 3 themesCharles Lombardo2023-06-031-8/+4
| * | | | | | android: Convert MinimalDocumentFile to KotlinCharles Lombardo2023-06-032-28/+8
| * | | | | | android: Convert GameProvider to KotlinCharles Lombardo2023-06-032-138/+127
| * | | | | | android: Convert GameDatabase to KotlinCharles Lombardo2023-06-032-275/+260
| * | | | | | android: Convert Game to KotlinCharles Lombardo2023-06-032-76/+56
| * | | | | | android: Convert EmulationFragment to KotlinCharles Lombardo2023-06-032-375/+348
| * | | | | | android: Convert SettingsFile to KotlinCharles Lombardo2023-06-032-272/+245
| * | | | | | android: Convert SettingsFrameLayout to KotlinCharles Lombardo2023-06-032-48/+43
| * | | | | | android: Convert SettingsFragmentView to KotlinCharles Lombardo2023-06-031-18/+15
| * | | | | | android: Convert SettingsFragmentPresenter to KotlinCharles Lombardo2023-06-032-184/+333
| * | | | | | android: Convert SettingsFragment to KotlinCharles Lombardo2023-06-032-136/+120
| * | | | | | android: Convert SettingsActivityView to KotlinCharles Lombardo2023-06-031-27/+20
| * | | | | | android: Convert SettingsActivityPresenter to KotlinCharles Lombardo2023-06-032-122/+99
| * | | | | | android: Convert SettingsActivity to KotlinCharles Lombardo2023-06-032-209/+186
| * | | | | | android: Convert SubmenuViewHolder to KotlinCharles Lombardo2023-06-032-45/+35
| * | | | | | android: Convert SliderViewHolder to KotlinCharles Lombardo2023-06-032-45/+34
| * | | | | | android: Convert SingleChoiceViewHolder to KotlinCharles Lombardo2023-06-032-62/+54
| * | | | | | android: Convert SettingViewHolder to KotlinCharles Lombardo2023-06-032-49/+38
| * | | | | | android: Convert HeaderViewHolder to KotlinCharles Lombardo2023-06-032-32/+28
| * | | | | | android: Convert DateTimeViewHolder to KotlinCharles Lombardo2023-06-032-47/+35
| * | | | | | android: Convert CheckBoxSettingViewHolder to KotlinCharles Lombardo2023-06-032-54/+41
| * | | | | | android: Convert StringSetting to KotlinCharles Lombardo2023-06-032-23/+9
| * | | | | | android: Convert SettingSection to KotlinCharles Lombardo2023-06-032-55/+34
| * | | | | | android: Convert Setting to KotlinCharles Lombardo2023-06-031-24/+6
| * | | | | | android: Convert IntSetting to KotlinCharles Lombardo2023-06-032-23/+9
| * | | | | | android: Convert FloatSetting to KotlinCharles Lombardo2023-06-032-23/+9
| * | | | | | android: Convert BooleanSetting to KotlinCharles Lombardo2023-06-032-23/+9
| * | | | | | android: Convert SubmenuSetting to KotlinCharles Lombardo2023-06-032-21/+15
| * | | | | | android: Convert StringSingleChoiceSetting to KotlinCharles Lombardo2023-06-032-82/+61
| * | | | | | android: Convert SliderSetting to KotlinCharles Lombardo2023-06-032-101/+72
| * | | | | | android: Convert SingleChoiceSetting to KotlinCharles Lombardo2023-06-032-60/+44
| * | | | | | android: Convert SettingsItem to KotlinCharles Lombardo2023-06-032-100/+30
| * | | | | | android: Convert HeaderSetting to KotlinCharles Lombardo2023-06-032-14/+12
| * | | | | | android: Convert DateTimeSetting to KotlinCharles Lombardo2023-06-032-40/+35
| * | | | | | android: Convert CheckBoxSetting to KotlinCharles Lombardo2023-06-032-80/+91
| * | | | | | android: Convert GameAdapter to KotlinCharles Lombardo2023-06-032-244/+178
| * | | | | | android: Convert SettingsAdapter to KotlinCharles Lombardo2023-06-033-366/+315
| * | | | | | android: Convert EmulationActivity to KotlinCharles Lombardo2023-06-032-347/+286
| * | | | | | android: Use material slider in settings dialogCharles Lombardo2023-06-031-20/+20
| * | | | | | android: Convert Settings to KotlinCharles Lombardo2023-06-032-127/+145
| * | | | | | android: Use androidx preferencesCharles Lombardo2023-06-031-0/+2
| * | | | | | android: frontend: Add unique error strings for Vulkan initialization errors.bunnei2023-06-032-19/+25
| * | | | | | android: Use the center of the object and reduce draw callsgerman772023-06-038-59/+76
| * | | | | | android: Replace old buttons with vectorsgerman772023-06-03149-71/+613
| * | | | | | android: Enable Kotlin supportCharles Lombardo2023-06-034-26/+30
| * | | | | | android: Upgrade java version to 11Charles Lombardo2023-06-031-2/+2
| * | | | | | android: Upgrade dependenciesCharles Lombardo2023-06-031-4/+4
| * | | | | | android: Upgrade to AGP 7.4.2Charles Lombardo2023-06-031-1/+1
| * | | | | | android: Replace lintOptions with lintCharles Lombardo2023-06-031-1/+1
| * | | | | | android: Move namespace to app module build.gradleCharles Lombardo2023-06-032-2/+3
| * | | | | | android: bump compile/target sdk to 33Charles Lombardo2023-06-031-2/+2
| * | | | | | android: Upgrade gradle to 8.0.1Charles Lombardo2023-06-031-1/+1
| * | | | | | video_core: fix clang-format errorsliushuyu2023-06-032-4/+3
| * | | | | | CMake: fix pkg-config behavior when building for Androidliushuyu2023-06-031-0/+1
| * | | | | | CI: add Android build systemsliushuyu2023-06-031-0/+0
| * | | | | | android: build.gradle: Cleanup build types.bunnei2023-06-031-7/+1
| * | | | | | android: frontend: settings: Add graphics debugging.bunnei2023-06-034-6/+18
| * | | | | | android: jni: Ensure system is only initialized once.bunnei2023-06-034-8/+8
| * | | | | | video_core: vulkan_device: Correct error message for unsuitable driver.bunnei2023-06-031-1/+1
| * | | | | | android: frontend: Cleanup framerate counter.bunnei2023-06-032-4/+3
| * | | | | | android: vulkan: Implement adrenotools turbo mode.bunnei2023-06-037-3/+27
| * | | | | | android: vulkan_device: Disable VK_EXT_extended_dynamic_state2 on Qualcomm.bunnei2023-06-031-3/+3
| * | | | | | android: frontend: Add support for GPU driver selection.bunnei2023-06-039-3/+251
| * | | | | | android: native: Add support for custom Vulkan driver loading.bunnei2023-06-0314-76/+146
| * | | | | | core: frontend: Refactor GraphicsContext to its own module.bunnei2023-06-0313-50/+84
| * | | | | | common: dynamic_library: Add ctor for existing handle.bunnei2023-06-032-0/+5
| * | | | | | android: EmulationFragment: Always reset overlay.bunnei2023-06-031-1/+2
| * | | | | | Avoid using VectorExtractDynamic for subgroup mask on Adreno GPUsBilly Laws2023-06-033-1/+19
| * | | | | | Implement scaled vertex buffer format emulationBilly Laws2023-06-039-51/+97
| * | | | | | Disable push descriptors on adreno driversBilly Laws2023-06-031-0/+4
| * | | | | | Disable VK_EXT_extended_dynamic_state on maliBilly Laws2023-06-031-0/+7
| * | | | | | Disable multithreaded pipeline compilation on Qualcomm driversBilly Laws2023-06-031-1/+4
| * | | | | | android: Add motion sensorNarr the Reg2023-06-034-21/+92
| * | | | | | android: Hook jni input properlyNarr the Reg2023-06-035-90/+104
| * | | | | | android: cleanup touch update loopNarr the Reg2023-06-031-28/+50
| * | | | | | android: Clean joystick overlayNarr the Reg2023-06-033-135/+131
| * | | | | | android: Clean dpad overlayNarr the Reg2023-06-032-192/+174
| * | | | | | android: Clean button overlayNarr the Reg2023-06-032-195/+65
| * | | | | | android: Add all buttons to screen controllerNarr the Reg2023-06-034-209/+104
| * | | | | | android: Apply clang formatNarr the Reg2023-06-032-9/+9
| * | | | | | android: frontend: Implement game grid view. (#9)bunnei2023-06-0315-174/+272
| * | | | | | android: Replace notification icon with yuzugerman772023-06-033-0/+0
| * | | | | | android: strings: Refresh key dumping URL.bunnei2023-06-031-1/+1
| * | | | | | android: frontend: Modify ROM load messaging for invalid keys.bunnei2023-06-032-7/+11
| * | | | | | android: frontend: Integrate key installation for SAF.bunnei2023-06-0320-21/+102
| * | | | | | android: jni: Add function to reload keys.bunnei2023-06-033-2/+14
| * | | | | | core: crypto: key_manager: Add methods to reload & validate keys.bunnei2023-06-032-0/+11
| * | | | | | android: EmulationActivity: Temporarily disable running notification.bunnei2023-06-032-7/+12
| * | | | | | android: Implement SAF support & migrate to SDK 31. (#4)bunnei2023-06-0338-697/+851
| * | | | | | android: Harden emulation shutdown when loader fails.bunnei2023-06-031-6/+12
| * | | | | | android: SettingsFragmentPresenter: Fix default renderer backend.bunnei2023-06-031-1/+1
| * | | | | | android: jni: native: Add lock around HaltEmulation, tighten run loop.bunnei2023-06-031-1/+3
| * | | | | | android: jni: native: Refactor locking for is_running.bunnei2023-06-031-8/+21
| * | | | | | android: jni: native: Remove unnecessary atomic for is_running.bunnei2023-06-031-6/+5
| * | | | | | android: jni: native: Tighten up emulation start/stop signaling.bunnei2023-06-031-58/+64
| * | | | | | android: jni: native: Consolidate emulation state into EmulationSession singleton.bunnei2023-06-031-67/+164
| * | | | | | android: Frontend: Fix rendering aspect ratio & add a setting for it.bunnei2023-06-037-2/+25
| * | | | | | android: Integrate settings frontend with yuzu & remove unused code.bunnei2023-06-0325-1759/+949
| * | | | | | externals: add adrenotools for bcenablerLiam2023-06-032-0/+34
| * | | | | | device_memory: Use smaller virtual reservation size for compatibility with 39-bit pagingLiam2023-06-032-1/+12
| * | | | | | video_core: vulkan_device: Device initialization for Adreno.bunnei2023-06-031-3/+4
| * | | | | | video_core: vk_pipeline_cache: Disable support_descriptor_aliasing on Android.bunnei2023-06-031-0/+4
| * | | | | | video_core: vk_swapchain: Fix image format for Android.bunnei2023-06-032-0/+10
| * | | | | | android: Minimize frontend & convert to yuzu.bunnei2023-06-03128-2509/+934
| * | | | | | video_core: vk_blit_screen: Rotate viewport for Android landscape.bunnei2023-06-031-0/+8
| * | | | | | common: error: Fix for Android.bunnei2023-06-031-1/+2
| * | | | | | common: fs: Implement for Android.bunnei2023-06-031-0/+7
| * | | | | | common: logging: Implement Android logcat backend.bunnei2023-06-033-0/+63
| * | | | | | common: host_memory: Implement for Android.bunnei2023-06-031-2/+10
| * | | | | | android: Minimal JNI for yuzu.bunnei2023-06-038-0/+645
| * | | | | | android: Add Citra frontend.bunnei2023-06-03319-0/+13799
| * | | | | | cmake: Integrate bundled FFmpeg for Android.bunnei2023-06-031-1/+1
| |/ / / / /
* | | | | | Merge pull request #10611 from liamwhite/audio-deadlockbunnei2023-06-064-10/+12
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | audio_renderer: resolve adsp thread deadlock shutdownLiam2023-06-044-10/+12
| | |_|/ / | |/| | |
* | | | | Merge pull request #10594 from liamwhite/double-patchbunnei2023-06-041-8/+12
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | fsp-srv: avoid patching romfs multiple timesLiam2023-06-031-8/+12
| |/ / /
* | | | Merge pull request #10588 from liamwhite/vfs-cachedbunnei2023-06-047-26/+101
|\ \ \ \
| * | | | romfs: use vfs_cached for romfs outputLiam2023-06-033-24/+2
| * | | | vfs: add vfs_cached for romfs buildLiam2023-06-034-2/+99
| |/ / /
* / / / host_memory: merge adjacent placeholder mappings on Linuxkkoniuszy2023-06-011-0/+22
|/ / /
* | | Merge pull request #10091 from Kelebek1/bc_buggggggliamwhite2023-06-011-3/+3
|\ \ \
| * | | Fix buffer overlap checking skipping a page for stream score right expandKelebek12023-05-261-3/+3
* | | | Merge pull request #10530 from Kelebek1/syncpt_oobliamwhite2023-06-011-1/+1
|\ \ \ \
| * | | | Fix incorrect id check and potential out of bounds lookupKelebek12023-05-311-1/+1
* | | | | Merge pull request #10474 from GPUCode/you-left-me-waitingliamwhite2023-06-011-7/+4
|\ \ \ \ \
| * | | | | renderer_vulkan: Remove timeline semaphore waitGPUCode2023-05-281-7/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #10352 from grimkor/add-context-menu-status-bar-settingsliamwhite2023-06-013-71/+152
|\ \ \ \ \
| * | | | | add context menu for filter and anti-aliasing status buttonsgrimkor2023-05-243-71/+152
* | | | | | Merge pull request #10482 from german77/gamelistliamwhite2023-06-011-0/+4
|\ \ \ \ \ \
| * | | | | | yuzu: Disable game list while game is runninggerman772023-05-291-0/+4
* | | | | | | Skip BufferCache tickframe with no channel state setKelebek12023-05-301-1/+5
| |_|_|/ / / |/| | | | |
* | | | | | input_common: rename PAGE_SIZE to avoid conflict121011112023-05-301-3/+3
|/ / / / /
* | | | | externals: Update to fmt 10 and add format_as formatter for BitFieldMorph2023-05-281-0/+5
* | | | | Merge pull request #10483 from ameerj/gl-cpu-astcliamwhite2023-05-281-2/+7
|\ \ \ \ \
| * | | | | gl_texture_cache: Fix ASTC CPU decoding with compression disabledameerj2023-05-281-2/+7
| | |_|/ / | |/| | |
* | | | | Merge pull request #10280 from danilaml/cmake-bin-dirliamwhite2023-05-281-5/+1
|\ \ \ \ \
| * | | | | Use TARGET_FILE_DIR generator expressionDanila Malyutin2023-05-131-5/+1
* | | | | | Merge pull request #10283 from danilaml/support-interlaced-videosliamwhite2023-05-282-2/+99
|\ \ \ \ \ \
| * | | | | | Add support for deinterlaced videos playbackDanila Malyutin2023-05-212-2/+99
* | | | | | | Merge pull request #10463 from liamwhite/this-is-why-we-need-gliamwhite2023-05-284-70/+125
|\ \ \ \ \ \ \
| * | | | | | | vfs_concat: fix time complexity of readLiam2023-05-264-70/+125
* | | | | | | | Merge pull request #10464 from liamwhite/clear-cacheliamwhite2023-05-284-0/+26
|\ \ \ \ \ \ \ \
| * | | | | | | | qt: add menu item to remove cache storageLiam2023-05-274-0/+26
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #10469 from Kelebek1/bc_stateliamwhite2023-05-284-210/+228
|\ \ \ \ \ \ \ \
| * | | | | | | | Move buffer bindings to per-channel stateKelebek12023-05-274-210/+228
| |/ / / / / / /
* / / / / / / / Audren wait as suggested by ByLawsKelebek12023-05-271-0/+3
|/ / / / / / /
* | | | | | | Merge pull request #10414 from liamwhite/anv-push-descriptorMatías Locatti2023-05-261-2/+3
|\ \ \ \ \ \ \
| * | | | | | | vulkan_device: Enable VK_KHR_push_descriptor on newer ANVLiam2023-05-231-2/+3
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #10418 from liamwhite/blink-and-youll-miss-itMatías Locatti2023-05-264-61/+105
|\ \ \ \ \ \ \
| * | | | | | | texture_cache: process aliases and overlaps in the correct orderFernando Sahmkow2023-05-244-61/+105
| |/ / / / / /
* | / / / / / shader_recompiler: fix copy-paste errorLiam2023-05-261-1/+1
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #10221 from Kelebek1/partial_dsp_revertbunnei2023-05-264-16/+12
|\ \ \ \ \ \
| * | | | | | Smooth out the DSP callback by adding a 5ms wait time limitKelebek12023-05-184-16/+12
* | | | | | | Merge pull request #10396 from german77/amiibo_writebunnei2023-05-258-68/+387
|\ \ \ \ \ \ \
| * | | | | | | input_common: Implement amiibo writtingNarr the Reg2023-05-228-68/+387
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #10454 from 521337/fix-u-optionliamwhite2023-05-251-1/+1
|\ \ \ \ \ \ \
| * | | | | | | Don't exit when using "-u" option in yuzu-cmdAriel Cabello2023-05-251-1/+1
* | | | | | | | Merge pull request #10452 from liamwhite/ibgcFernando S2023-05-252-6/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | video_core: don't garbage collect during configurationLiam2023-05-252-6/+0
* | | | | | | | Add short "-u" option for yuzu_cmd.Ariel Cabello2023-05-251-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #10415 from german77/amiibo-no-keybunnei2023-05-253-21/+52
|\ \ \ \ \ \ \
| * | | | | | | service: nfc: Remove encryption key requirementNarr the Reg2023-05-233-21/+52
| |/ / / / / /
* | | | | | | Merge pull request #10435 from FernandoS27/gotta-clean-mess-upsbunnei2023-05-251-1/+1
|\ \ \ \ \ \ \
| * | | | | | | Texture cache: revert wrong acceleration assumptionFernando Sahmkow2023-05-241-1/+1
| | |_|_|_|/ / | |/| | | | |
* / | | | | | Texture Cache Util: Fix block depth adjustment on slices.Fernando Sahmkow2023-05-241-2/+13
|/ / / / / /
* | | | | | Merge pull request #10422 from liamwhite/gcFernando S2023-05-242-6/+8
|\ \ \ \ \ \
| * | | | | | video_core: tune garbage collection aggressivenessLiam2023-05-232-6/+8
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #10417 from liamwhite/check-stateFernando S2023-05-241-6/+2
|\ \ \ \ \ \
| * | | | | | k_memory_block_manager: remove auditing callsLiam2023-05-231-6/+2
| |/ / / / /
* | | | | | Merge pull request #10398 from liamwhite/bcnFernando S2023-05-2420-26/+344
|\ \ \ \ \ \
| * | | | | | textures: add BC1 and BC3 compressors and recompression settingLiam2023-05-2320-26/+344
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #10388 from GPUCode/fence-waitliamwhite2023-05-232-3/+58
|\ \ \ \ \ \
| * | | | | | vk_master_semaphore: Move fence wait on separate threadGPUCode2023-05-202-3/+58
| |/ / / / /
* | | | | | Merge pull request #10402 from liamwhite/uhliamwhite2023-05-236-1/+51
|\ \ \ \ \ \
| * | | | | | renderer_vulkan: barrier attachment feedback loopsLiam2023-05-236-1/+51
| |/ / / / /
* | | | | | Merge pull request #10411 from scorpion81/gc-steamdeck-fix-attemptliamwhite2023-05-231-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Limit the device access memory to 4 GBscorpion812023-05-221-1/+1
| |/ / / /
* / / / / input_common: Map motion with relative values not absolute onesgerman772023-05-201-4/+7
|/ / / /
* | | | Merge pull request #10344 from german77/pro-amiibobunnei2023-05-196-103/+70
|\ \ \ \
| * | | | input_common: Fix pro controller amiibo supportNarr the Reg2023-05-176-103/+70
* | | | | renderer_vulkan: remove wrong constexprLiam2023-05-191-2/+2
| |/ / / |/| | |
* | | | vulkan_device: Disable VK_KHR_push_descriptor on ANVlat9nq2023-05-181-0/+11
* | | | Merge pull request #10262 from liamwhite/depth-clampbunnei2023-05-171-0/+8
|\ \ \ \
| * | | | vulkan_common: disable depth clamp dynamic state for older radvLiam2023-05-131-0/+8
| | |/ / | |/| |
* | | | Merge pull request #10217 from Kelebek1/clear_valueliamwhite2023-05-161-19/+6
|\ \ \ \
| * | | | Use the rendertarget format of the correct RT rather than the first validKelebek12023-05-091-19/+6
* | | | | Merge pull request #10107 from grimkor/allow-fully-customised-hotkeysliamwhite2023-05-164-32/+56
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Allow fully customisable controller hotkeysgrimkor2023-05-104-32/+56
* | | | | Merge pull request #10181 from lat9nq/intel-compute-toggleliamwhite2023-05-1513-10/+67
|\ \ \ \ \
| * | | | | configure_graphics_advanced: Hide input compute toggle a little laterlat9nq2023-05-081-2/+2
| * | | | | yuzu-qt/config: Add option to disable compute on Intellat9nq2023-05-0710-9/+63
| * | | | | vk_pipeline_cache: Use setting to disable intel computelat9nq2023-05-071-1/+2
| * | | | | settings: Add enable compute pipelineslat9nq2023-05-072-0/+2
* | | | | | Merge pull request #10234 from Kelebek1/clouds_depthliamwhite2023-05-152-12/+3
|\ \ \ \ \ \
| * | | | | | Fix Tears of the Kingdom flickering clouds and depths.Kelebek12023-05-112-12/+3
* | | | | | | Merge pull request #10249 from FernandoS27/sorry-i-am-lateliamwhite2023-05-152-28/+4
|\ \ \ \ \ \ \
| * | | | | | | Buffer Cache: Clear sync code.Fernando Sahmkow2023-05-152-28/+4
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #10254 from danilaml/fix-h264-decodeliamwhite2023-05-151-2/+2
|\ \ \ \ \ \ \
| * | | | | | | Fix missing pic_order_present_flag in h264 headerDanila Malyutin2023-05-121-2/+2
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #10265 from german77/amiibo-lagliamwhite2023-05-153-4/+13
|\ \ \ \ \ \ \
| * | | | | | | input_common: Make amiibo scanning less demandinggerman772023-05-143-4/+13
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #10294 from german77/vibration_spanliamwhite2023-05-153-14/+14
|\ \ \ \ \ \ \
| * | | | | | | service: hid: Use span instead of vector referencegerman772023-05-153-14/+14
* | | | | | | | Merge pull request #10288 from liamwhite/vram-limitsliamwhite2023-05-141-0/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | vulkan_device: reserve extra memory to prevent swapsLiam2023-05-141-0/+2
| |/ / / / / /
* / / / / / / vulkan_common: fix incompatible property flagsLiam2023-05-141-1/+1
|/ / / / / /
* | | | | | Merge pull request #10244 from liamwhite/lower-upperFernando S2023-05-133-2/+34
|\ \ \ \ \ \
| * | | | | | time: implement ContinuousAdjustmentTimePointLiam2023-05-123-2/+34
| |/ / / / /
* | | | | | Merge pull request #10243 from Kelebek1/red_dotFernando S2023-05-132-1/+3
|\ \ \ \ \ \
| * | | | | | Correctly track RT indexes for image aspect lookup during clearsKelebek12023-05-122-1/+3
| |/ / / / /
* | | | | | Merge pull request #10237 from liamwhite/cache-storagebunnei2023-05-135-6/+50
|\ \ \ \ \ \
| * | | | | | fs: adjust future save pathLiam2023-05-112-4/+4
| * | | | | | am: stub CreateCacheStorageLiam2023-05-112-1/+33
| * | | | | | fs: stub cache storage and fix params alignmentLiam2023-05-112-5/+17
| |/ / / / /
* | | | | | nvnflinger: fix Parcel serializationLiam2023-05-113-39/+49
* | | | | | nvnflinger: fix producer slot fence initLiam2023-05-111-0/+1
|/ / / / /
* | | | | Merge pull request #10132 from Kelebek1/fermi_blit2liamwhite2023-05-113-12/+24
|\ \ \ \ \
| * | | | | Allow Fermi blit accelerate to add src/dst to the cache if they don't exist already. Use ScratchBuffers in the software blit path.Kelebek12023-05-113-12/+24
| | |_|/ / | |/| | |
* | | | | Merge pull request #10216 from Kelebek1/buffer_cache_region_checksliamwhite2023-05-111-4/+4
|\ \ \ \ \
| * | | | | Swap order of checking/setting region modifications in the buffer_cacheKelebek12023-05-091-4/+4
| |/ / / /
* | | | | renderer_vulkan: separate guest and host compute descriptor queuesLiam2023-05-1016-75/+81
* | | | | Merge pull request #10207 from german77/amiibo_cheaterliamwhite2023-05-107-13/+53
|\ \ \ \ \
| * | | | | service: nfc: Seed all random valuesNarr the Reg2023-05-102-6/+14
| * | | | | service: nfp: Allow to load with a different amiibo idgerman772023-05-106-7/+39
| |/ / / /
* | | | | Merge pull request #10119 from marius851000/improved_non_hd_feebackNarr the Reg2023-05-101-6/+29
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Improve emulation of HD Rumblemarius david2023-05-051-6/+29
* | | | | Merge pull request #10183 from liamwhite/modsliamwhite2023-05-093-3/+29
|\ \ \ \ \
| * | | | | vfs_layered: avoid n^2 lookup in layeredfs buildingLiam2023-05-081-3/+6
| * | | | | vfs_vector: avoid n^2 lookup in layeredfs buildingLiam2023-05-072-0/+23
* | | | | | Merge pull request #10203 from german77/calibrationliamwhite2023-05-096-11/+53
|\ \ \ \ \ \
| * | | | | | yuzu: Make 3d cube with joycon shapeNarr the Reg2023-05-081-10/+10
| * | | | | | core: hid: Allow to calibrate gyro sensorNarr the Reg2023-05-085-1/+43
* | | | | | | Merge pull request #10206 from FernandoS27/astc-3dliamwhite2023-05-093-7/+7
|\ \ \ \ \ \ \
| * | | | | | | Texture Cache: Fix ASTC texturesFernando Sahmkow2023-05-093-7/+7
* | | | | | | | input_common: Fix nfc detection for joyconsgerman772023-05-094-19/+21
|/ / / / / / /
* / / / / / / qt_common: consistently ifdef QPlatform after cbd79df23375Jan Beich2023-05-081-1/+1
|/ / / / / /
* | | | | | Merge pull request #10075 from Kelebek1/silence_nifm_spambunnei2023-05-083-5/+5
|\ \ \ \ \ \
| * | | | | | Silence nifm spamKelebek12023-04-223-5/+5
* | | | | | | bootmanager: remove stop_token headerLiam2023-05-081-1/+0
* | | | | | | Merge pull request #10195 from german77/mutexliamwhite2023-05-085-22/+20
|\ \ \ \ \ \ \
| * | | | | | | core: hid: Update motion on a better placegerman772023-05-085-22/+20
* | | | | | | | Texture cache: Only force flush the dma downloadsFernando Sahmkow2023-05-075-6/+6
* | | | | | | | Buffer Cache: disable reactive flushing in it.Fernando Sahmkow2023-05-073-18/+8
* | | | | | | | Texture cache: reverse inmediate flush changesFernando Sahmkow2023-05-073-28/+14
* | | | | | | | Buffer cache: always use async buffer downloads and fix regression.Fernando Sahmkow2023-05-074-63/+70
* | | | | | | | Address feedback, add CR notice, etcFernando Sahmkow2023-05-075-10/+18
* | | | | | | | Query cache: stop updating pages as it's not affected by cpu writesFernando Sahmkow2023-05-071-2/+0
* | | | | | | | Settings: add option to enable / disable reactive flushingFernando Sahmkow2023-05-0711-5/+38
* | | | | | | | Texture cache: sync the first flush.Fernando Sahmkow2023-05-072-3/+30
* | | | | | | | GPU: Add Reactive flushingFernando Sahmkow2023-05-0724-30/+240
|/ / / / / / /
* | | | | | | Merge pull request #10097 from german77/nfp_fullbunnei2023-05-0734-2632/+2254
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | service: nfc: Merge device interfaces and create the device managerNarr the Reg2023-05-0632-2410/+2031
| * | | | | | core: service: Add FunctionInfoTyped to allow expanding existing interfacesgerman772023-04-261-8/+12
| * | | | | | service: nfc: Create mifare interfaceNarr the Reg2023-04-243-50/+58
| * | | | | | service: nfc: Create interfaceNarr the Reg2023-04-245-115/+104
* | | | | | | Merge pull request #10081 from Kelebek1/copy_overlap_tickliamwhite2023-05-071-0/+6
|\ \ \ \ \ \ \
| * | | | | | | Sort overlap_ids by modification tick before copyKelebek12023-04-221-0/+6
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #10172 from Kelebek1/debug_validation_namesliamwhite2023-05-0710-30/+35
|\ \ \ \ \ \ \
| * | | | | | | Log object names with debug renderer, add a GPU address to ImageViewsKelebek12023-05-0610-30/+35
* | | | | | | | yuzu/applets/qt_profile_select: connect double-click to accept()QGJ2023-05-071-0/+1
* | | | | | | | Fix address space allocator slow path to avoid OOBKelebek12023-05-071-1/+1
* | | | | | | | Merge pull request #10180 from german77/debugbunnei2023-05-071-2/+0
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | input_common: Revert debugging changesgerman772023-05-071-2/+0
* | | | | | | | Merge pull request #10125 from lat9nq/vsync-selectbunnei2023-05-0722-129/+456
|\ \ \ \ \ \ \ \
| * | | | | | | | qt_common: Remove yuzu prefixlat9nq2023-05-044-7/+7
| * | | | | | | | configure_graphics: No there isn't a hyphen in VSynclat9nq2023-05-032-5/+5
| * | | | | | | | configure_input_player: Add missing includelat9nq2023-05-031-0/+1
| * | | | | | | | configure_graphics: Clean up includes [IWYU]lat9nq2023-05-032-6/+31
| * | | | | | | | bootmanager: Clean up includes [IWYU]lat9nq2023-05-032-15/+50
| * | | | | | | | configure_graphics: Actively find present modeslat9nq2023-05-033-27/+161
| * | | | | | | | vk_swapchain: Use certain modes for unlockedlat9nq2023-05-032-26/+50
| * | | | | | | | bootmanager: Remove inaccurate switchlat9nq2023-05-032-11/+3
| * | | | | | | | qt_common: Move window info function out of bootmanagerlat9nq2023-05-034-44/+75
| * | | | | | | | vulkan_surface: Pass only window info for surface creationlat9nq2023-05-033-10/+7
| * | | | | | | | settings: Enable FIFO relaxedlat9nq2023-05-032-7/+10
| * | | | | | | | configure_graphics: Fix another typolat9nq2023-05-031-1/+1
| * | | | | | | | telemetry_session: Make translate function staticlat9nq2023-05-031-1/+1
| * | | | | | | | bootmanager: Return value in impossible caselat9nq2023-05-031-0/+1
| * | | | | | | | configure_graphics: Fix typolat9nq2023-05-031-1/+1
| * | | | | | | | default_ini: Update V-Sync descriptionlat9nq2023-05-031-2/+8
| * | | | | | | | configuration: Expose separate swap present modeslat9nq2023-05-0311-37/+115
* | | | | | | | | Merge pull request #10174 from german77/motriodbunnei2023-05-072-0/+10
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | input_common: Add experimental motion to buttongerman772023-05-062-0/+10
* | | | | | | | | Merge pull request #10162 from lat9nq/sdl-remove-oldliamwhite2023-05-072-21/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu-sdl,audio_core: Remove antiquated warning ignorelat9nq2023-05-052-21/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10167 from german77/motion_previewliamwhite2023-05-0712-6/+165
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | input_common: Add property to invert an axis buttonNarr the Reg2023-05-066-3/+15
| * | | | | | | | | yuzu: Add motion preview to controller inputNarr the Reg2023-05-057-4/+151
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Fix read access violationRoni Kirla2023-05-061-1/+1
| |_|/ / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #10159 from german77/home_screenshotbunnei2023-05-051-0/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | core: hid: Fix state of capture and home buttonsgerman772023-05-051-0/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #10128 from Kelebek1/audren_terminateliamwhite2023-05-041-4/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Wait for the terminate event before destroying a system instanceKelebek12023-05-011-4/+1
* | | | | | | | | Merge pull request #10145 from Kelebek1/code_sizeliamwhite2023-05-043-10/+16
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | Fix code resize to use word size rather than byte sizeKelebek12023-05-033-10/+16
* | | | | | | | | Merge pull request #10153 from FernandoS27/a-quickie-fixieFernando S2023-05-041-4/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Memory manager: Fix possible softlockFernando Sahmkow2023-05-041-4/+5
* | | | | | | | | | Merge pull request #10154 from liamwhite/optimisticFernando S2023-05-048-28/+0
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | settings: remove pessimistic flushingLiam2023-05-048-28/+0
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #10142 from FernandoS27/missing-astcbunnei2023-05-048-9/+49
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | GPU: implement missing ASTCFernando Sahmkow2023-05-038-9/+49
* | | | | | | | | | Merge pull request #10088 from FernandoS27/100-gelato-flavor-test-builds-laterbunnei2023-05-0414-80/+286
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | QueryCache: Fix write invalidation.Fernando Sahmkow2023-04-282-6/+13
| * | | | | | | | | | MemoryManager: Fix race conditions.Fernando Sahmkow2023-04-282-3/+11
| * | | | | | | | | | Clang format and ddress feedbackFernando Sahmkow2023-04-243-16/+30
| * | | | | | | | | | QueryCache: rework async downloads.Fernando Sahmkow2023-04-237-45/+118
| * | | | | | | | | | Accuracy Normal: reduce accuracy further for perf improvements in Project LimeFernando Sahmkow2023-04-234-5/+11
| * | | | | | | | | | Fence Manager: implement async fence management in a sepparate thread.Fernando Sahmkow2023-04-235-35/+133
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #10117 from liamwhite/sync-registerbunnei2023-05-039-5/+50
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel: match calls to Register and UnregisterLiam2023-04-309-5/+50
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10151 from GPUCode/no-softlocks-pleaseliamwhite2023-05-033-6/+9
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vk_present_manager: Fix softlocks when disabling async presentGPUCode2023-05-033-6/+9
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #10144 from liamwhite/dont-turboMorph2023-05-031-1/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vulkan: disable turbo when debugging tool is attachedLiam2023-05-031-1/+3
* | | | | | | | | | Merge pull request #10143 from liamwhite/fruit-company-momentMorph2023-05-033-4/+6
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core: fix build on Apple ClangLiam2023-05-033-4/+6
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #10124 from liamwhite/pebkacMorph2023-05-0313-30/+34
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | settings: rename extended memory layout to unsafe, move from general to systemLiam2023-04-3013-30/+34
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9973 from GPUCode/async-presentbunnei2023-05-0321-226/+772
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | vk_present_manager: Add toggle for async presentationGPUCode2023-05-0110-6/+45
| * | | | | | | | vk_blit_screen: Recreate FSR when frame is recreatedGPUCode2023-05-011-1/+1
| * | | | | | | | renderer_vulkan: Fix crashing when updating descriptorsGPUCode2023-05-012-4/+17
| * | | | | | | | renderer_vulkan: Async presentationGPUCode2023-05-0111-218/+712
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #10133 from lat9nq/clang-shadow-and-fallthroughliamwhite2023-05-031-0/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | CMake: Enable type limits on Clanglat9nq2023-05-021-0/+1
| * | | | | | | | CMakeLists: Enable checks on Clanglat9nq2023-05-021-0/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #10130 from liamwhite/keysliamwhite2023-05-032-0/+34
|\ \ \ \ \ \ \ \
| * | | | | | | | qt: warn on inoperable keysLiam2023-05-012-0/+34
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #10123 from Kelebek1/sample_maskliamwhite2023-05-032-2/+4
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Define SampleMask as an arrayKelebek12023-04-302-2/+4
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #10084 from FernandoS27/yuzu-goes-broom-broomMorph2023-05-0115-1727/+2255
|\ \ \ \ \ \ \
| * | | | | | | BufferCache: Fixes and address feedbackFernando Sahmkow2023-05-016-322/+243
| * | | | | | | Buffer Cache: Release stagging buffers on tick frameFernando Sahmkow2023-04-292-12/+22
| * | | | | | | Tests: Add memory tracker tests.Fernando Sahmkow2023-04-293-550/+548
| * | | | | | | Clang: format and ficx compile errors.Fernando Sahmkow2023-04-295-68/+78
| * | | | | | | Implement Async downloads in normal and fix a few issues.Fernando Sahmkow2023-04-293-39/+61
| * | | | | | | Buffer Cache rework: Setup async downloads.Fernando Sahmkow2023-04-292-140/+154
| * | | | | | | Buffer Cache: Fully rework the buffer cache.Fernando Sahmkow2023-04-2912-1091/+1644
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #10116 from liamwhite/deboostliamwhite2023-05-018-19/+657
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | kernel: remove general boost listsLiam2023-04-307-19/+26
| * | | | | | common: add intrusive list typeLiam2023-04-291-0/+631
| |/ / / / /
* | | | | | Merge pull request #10110 from Morph1984/intel-disable-computebunnei2023-04-301-0/+7
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | vk_pipeline_cache: Skip compute pipelines on Intel proprietary driversMorph2023-04-281-0/+7
| |/ / / /
* | | | | Texture Cache: Release stagging buffers on tick frameFernando Sahmkow2023-04-296-19/+46
* | | | | Address Feedback & Clang FormatFernando Sahmkow2023-04-292-17/+14
* | | | | Maxwell3D: only update parameters on HighFernando Sahmkow2023-04-291-0/+3
* | | | | Accelerate DMA: Use texture cache async downloads to perform the copiesFernando Sahmkow2023-04-296-53/+123
* | | | | TextureCache: refactor DMA downloads to allow multiple buffers.Fernando Sahmkow2023-04-298-41/+75
|/ / / /
* | | | Merge pull request #10051 from liamwhite/surface-capabilitiesFernando S2023-04-241-1/+14
|\ \ \ \
| * | | | vulkan: pick alpha composite flags based on available valuesLiam2023-04-131-1/+14
* | | | | Merge pull request #10056 from vonchenplus/audout_uFernando S2023-04-241-6/+8
|\ \ \ \ \
| * | | | | core: audio: return result when audio_out initialize failedFengChen2023-04-161-6/+8
* | | | | | Merge pull request #10069 from liamwhite/logFernando S2023-04-241-4/+6
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | maxwell_3d: fix out of bounds array access in size estimationLiam2023-04-221-4/+6
| | |_|/ / | |/| | |
* | | | | Merge pull request #10074 from Kelebek1/fermi_blitFernando S2023-04-221-4/+12
|\ \ \ \ \
| * | | | | Account for a pre-added offset when using Corner sample mode for 2D blitsKelebek12023-04-211-4/+12
| |/ / / /
* | | | | Merge pull request #10076 from german77/TryPopMyFriendbunnei2023-04-221-1/+1
|\ \ \ \ \
| * | | | | core: am: Demote TryPopFromFriendInvitationStorageChannel Log levelgerman772023-04-221-1/+1
| |/ / / /
* | | | | Merge pull request #10068 from twitchax/twitchax/dr_bind_addressbunnei2023-04-221-3/+13
|\ \ \ \ \
| * | | | | Run clang-format to fix all.Aaron Roney2023-04-191-1/+2
| * | | | | Fix formatting.Aaron Roney2023-04-191-2/+2
| * | | | | Allow passing `bind_address` to dedicated room.Aaron Roney2023-04-191-2/+11
| | |/ / / | |/| | |
* | | | | Merge pull request #10060 from german77/no_deadbunnei2023-04-221-0/+4
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | core: hid: Remove deadzone of virtual controllergerman772023-04-161-0/+4
| |/ / /
* | | | Merge pull request #10057 from liamwhite/its-not-in-the-timelinebunnei2023-04-204-68/+161
|\ \ \ \
| * | | | vulkan: use plain fences when timeline semaphores are not availableLiam2023-04-154-68/+161
| |/ / /
* | | | Merge pull request #10053 from german77/nfp_fullbunnei2023-04-197-74/+938
|\ \ \ \ | |/ / / |/| | |
| * | | service: nfp: Implement debug InterfaceNarr the Reg2023-04-156-8/+444
| * | | service: nfp: Implement system interfaceNarr the Reg2023-04-156-17/+289
| * | | service: nfp: Use an unique interfaceNarr the Reg2023-04-144-71/+227
| |/ /
* | | Merge pull request #10030 from Wollnashorn/botw-amd-fixbunnei2023-04-156-0/+73
|\ \ \
| * | | video_core: Enable ImageGather rounding fix on AMD open source driversWollnashorn2023-04-121-0/+2
| * | | shader_recompiler: Use vector arithmetic rather than component-wise in ImageGatherSubpixelOffsetWollnashorn2023-04-081-18/+9
| * | | video_core: Enable ImageGather with subpixel offset on IntelWollnashorn2023-04-087-17/+11
| * | | shader_recompiler: Add subpixel offset for correct rounding at `ImageGather`Wollnashorn2023-04-089-0/+86
* | | | input_common: minor fix to mouse movementValeri2023-04-141-1/+1
| |/ / |/| |
* | | Merge pull request #10008 from vonchenplus/texture_cacheliamwhite2023-04-114-50/+57
|\ \ \
| * | | video_core: Keep the definition of DimensionControl consistent with nvidia open docFeng Chen2023-03-312-19/+22
| * | | video_core: Better defined ImageInfo parametersFengChen2023-03-143-39/+43
* | | | Merge pull request #10027 from bylaws/masterliamwhite2023-04-102-5/+5
|\ \ \ \
| * | | | Use GetGlobalTimeNs as opposed to clock ticksBilly Laws2023-04-082-4/+3
| * | | | Add some explicit latency to sample count reportingBilly Laws2023-04-041-1/+2
| | |/ / | |/| |
* | | | kernel: move more memory to application in 8GB arrangementLiam2023-04-101-2/+4
* | | | kernel: switch extended memory setting to 8GB arrangementLiam2023-04-083-4/+4
* | | | Merge pull request #10022 from liamwhite/gcc-13bunnei2023-04-086-28/+14
|\ \ \ \ | |/ / / |/| | |
| * | | general: fixes for gcc 13Liam2023-04-036-28/+14
* | | | Merge pull request #10024 from german77/crysisliamwhite2023-04-031-5/+1
|\ \ \ \
| * | | | service: hid: Fix handle validationgerman772023-04-021-5/+1
* | | | | Merge pull request #10004 from Kelebek1/cubemapliamwhite2023-04-031-15/+15
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Only upload GPU-modified overlapsKelebek12023-03-281-15/+15
* | | | | Merge pull request #10020 from merryhime/update-dynarmicbunnei2023-04-021-13/+10
|\ \ \ \ \
| * | | | | core: arm_dynarmic_32: Update SaveContext/LoadContext.bunnei2023-04-021-13/+10
| | |/ / / | |/| | |
* | | | | Merge pull request #9969 from bylaws/masterbunnei2023-04-019-79/+55
|\ \ \ \ \
| * | | | | audio_core: No longer stall when sink queue is fullBilly Laws2023-03-274-64/+1
| * | | | | Run clang-formatBilly Laws2023-03-273-7/+6
| * | | | | audio: Wait for samples on the emulated DSP side to avoid desyncsBilly Laws2023-03-276-24/+28
| * | | | | audio: Interpolate system manager sample count using host sink sample infoBilly Laws2023-03-264-3/+39
* | | | | | Merge pull request #10006 from german77/profile_selectliamwhite2023-04-018-34/+270
|\ \ \ \ \ \
| * | | | | | service: am: Improve profile select appletNarr the Reg2023-03-298-34/+270
* | | | | | | Merge pull request #9997 from german77/cancel_controllerliamwhite2023-04-019-19/+33
|\ \ \ \ \ \ \
| * | | | | | | applet: controller: Implement cancel buttongerman772023-03-309-19/+33
| |/ / / / / /
* | | | | | | Merge pull request #9999 from german77/new_hid_hurraliamwhite2023-04-014-22/+56
|\ \ \ \ \ \ \
| * | | | | | | service: hid: Implement SetNpadJoyAssignmentModeSingleWithDestinationgerman772023-03-304-22/+56
* | | | | | | | Merge pull request #10017 from jbeich/vk-246liamwhite2023-04-011-0/+2
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | externals: update Vulkan-Headers to v1.3.246Jan Beich2023-04-011-0/+2
* | | | | | | | Merge pull request #10005 from liamwhite/kernel-atomicsbunnei2023-04-012-39/+56
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel: fix unbounded stack usage in atomicsLiam2023-03-292-39/+56
* | | | | | | | Fixes 'Continous' typoMax Dunbar2023-03-306-38/+38
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #9505 from liamwhite/request-exitliamwhite2023-03-2948-61/+312
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | qt: implement RequestExit for appletsLiam2023-03-2538-69/+250
| * | | | | | applets: implement RequestExitLiam2023-03-2518-1/+71
* | | | | | | Merge pull request #10003 from german77/disconnectliamwhite2023-03-281-1/+2
|\ \ \ \ \ \ \
| * | | | | | | service: hid: Silence warning on MergeSingleJoyAsDualJoyNarr the Reg2023-03-271-1/+2
| | |/ / / / / | |/| | | | |
* | | | | | | telemetry: Add waitpkg instructionMorph2023-03-271-0/+1
* | | | | | | x64: Simplify RDTSC on non-MSVC compilersMorph2023-03-272-16/+10
* | | | | | | core_timing: Make use of MicroSleep for x64 CPUsMorph2023-03-271-0/+8
* | | | | | | x64: Add MicroSleepMorph2023-03-273-0/+84
* | | | | | | x64: cpu_detect: Add detection of waitpkg instructionsMorph2023-03-272-0/+2
* | | | | | | Merge pull request #10002 from german77/logliamwhite2023-03-271-2/+2
|\ \ \ \ \ \ \
| * | | | | | | qt: Fix log softlockNarr the Reg2023-03-271-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #9984 from liamwhite/global-memoryliamwhite2023-03-2744-226/+185
|\ \ \ \ \ \ \
| * | | | | | | memory: rename global memory references to application memoryLiam2023-03-2444-226/+185
* | | | | | | | Merge pull request #9995 from german77/plainliamwhite2023-03-275-8/+37
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | service: nfp: Add plain amiibo supportgerman772023-03-265-8/+37
| | |/ / / / / | |/| | | | |
* / | | | | | tests: mark integer literals as unsignedLiam2023-03-261-17/+20
|/ / / / / /
* | | / / / container_hash: use climitsLiam2023-03-261-0/+1
| |_|/ / / |/| | | |
* | | | | video_core/macro: Make use of Common::HashValueMorph2023-03-261-3/+3
* | | | | tests: Implement tests for verifying HashValueMorph2023-03-262-0/+42
* | | | | common: Port boost's hash_value implementationMorph2023-03-262-0/+92
| |/ / / |/| | |
* | | | Merge pull request #9985 from liamwhite/funny-memebunnei2023-03-251-1/+1
|\ \ \ \
| * | | | vulkan: fix scheduler chunk reserveLiam2023-03-241-1/+1
* | | | | Pass GPU page table by referenceRoss Schlaikjer2023-03-251-31/+32
* | | | | Merge pull request #9983 from Morph1984/boostliamwhite2023-03-241-1/+1
|\ \ \ \ \
| * | | | | zstd: Use ZSTD_getFrameContentSize instead of ZSTD_getDecompressedSizeMorph2023-03-241-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #9981 from german77/nfp_connectliamwhite2023-03-244-4/+30
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | nfc: Initialize device when controller is connectedNarr the Reg2023-03-224-4/+30
* | | | | Merge pull request #9975 from liamwhite/more-waitingMorph2023-03-241-4/+5
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | vulkan: fix more excessive waiting in schedulerLiam2023-03-191-4/+5
| |/ / /
* | | | Merge pull request #9971 from Morph1984/qliamwhite2023-03-233-124/+215
|\ \ \ \
| * | | | bounded_threadsafe_queue: Refactor PopMorph2023-03-221-140/+62
| * | | | bounded_threadsafe_queue: Add producer cv to avoid busy waitingMorph2023-03-221-17/+29
| * | | | bounded_threadsafe_queue: Deduplicate and add PushModesMorph2023-03-223-88/+86
| * | | | bounded_threadsafe_queue: Add TryPushMorph2023-03-221-0/+71
| * | | | logging: Make use of bounded queueMorph2023-03-221-8/+8
| * | | | bounded_threadsafe_queue: Use simplified impl of bounded queueMorph2023-03-222-115/+203
* | | | | Merge pull request #9964 from liamwhite/typed-addressliamwhite2023-03-23101-1102/+1574
|\ \ \ \ \
| * | | | | kernel: use KTypedAddress for addressesLiam2023-03-22101-1102/+1574
* | | | | | Merge pull request #9962 from Kelebek1/disable_srgbMorph2023-03-231-6/+8
|\ \ \ \ \ \
| * | | | | | Disable SRGB border color conversion for now, to fix shadows in Xenoblade.Kelebek12023-03-171-6/+8
| |/ / / / /
* | | | | | Merge pull request #9965 from german77/thankYouEpicBoybunnei2023-03-221-0/+3
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | config: Fix controller config from resettingNarr the Reg2023-03-181-0/+3
| |/ / / /
* | | | | Merge pull request #9970 from bunnei/string-util-viewbunnei2023-03-192-11/+11
|\ \ \ \ \
| * | | | | common: string_util: Use std::string_view for UTF16ToUTF8/UTF8ToUTF16W.bunnei2023-03-192-11/+11
| | |/ / / | |/| | |
* / | | | kernel: fix LOG_TRACE in ipcLiam2023-03-191-1/+1
|/ / / /
* | | | common: bounded_threadsafe_queue: Use polyfill_thread.bunnei2023-03-181-2/+3
* | | | Merge pull request #9778 from behunin/my-box-chevybunnei2023-03-182-3/+4
|\ \ \ \
| * | | | gpu_thread: Use bounded queueBehunin2023-03-042-3/+4
* | | | | Merge pull request #9953 from german77/amiibo_crcbunnei2023-03-187-52/+157
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service: nfp: Replace crc function with boost equivalentNarr the Reg2023-03-172-28/+17
| * | | | service: nfp: Close app area and recreate crcNarr the Reg2023-03-161-0/+10
| * | | | service: nfp: Convert mii colors to v3Narr the Reg2023-03-166-15/+100
| * | | | service: nfp: Actually write correct crcNarr the Reg2023-03-156-23/+44
* | | | | Merge pull request #9955 from liamwhite/color-blend-equationliamwhite2023-03-161-0/+6
|\ \ \ \ \
| * | | | | vulkan: disable extendedDynamicState3ColorBlendEquation on radvLiam2023-03-151-0/+6
| |/ / / /
* | | | | Merge pull request #9931 from liamwhite/schedliamwhite2023-03-162-28/+62
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | vk_scheduler: split work queue waits and execution waitsLiam2023-03-122-28/+62
* | | | | Merge pull request #9933 from vonchenplus/texture_formatliamwhite2023-03-143-72/+67
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | video_core: Update texture formatFeng Chen2023-03-103-72/+67
| |/ / /
* | | | configure_audio: Fix output mode setting not savingMorph2023-03-132-9/+9
* | | | Merge pull request #9939 from german77/vibrationliamwhite2023-03-131-1/+16
|\ \ \ \
| * | | | input_common: sdl: Only send last vibration commandgerman772023-03-131-1/+16
* | | | | Merge pull request #9941 from german77/settingsliamwhite2023-03-137-98/+62
|\ \ \ \ \
| * | | | | yuzu: Move audio settings to audio sectiongerman772023-03-126-45/+56
| * | | | | yuzu: Remove console id settinggerman772023-03-123-53/+6
* | | | | | Merge pull request #9943 from vonchenplus/gentlemanliamwhite2023-03-133-2/+3
|\ \ \ \ \ \
| * | | | | | video_core: Fix ogl status error when draw_textureFengChen2023-03-122-2/+2
| * | | | | | video_core: Invalid index_buffer flag when inline_index drawFengChen2023-03-121-0/+1
| | |_|/ / / | |/| | | |
* | | | | | kernel: additional style fixes to KThread, KProcessLiam2023-03-132-27/+27
* | | | | | kernel: fix clang buildLiam2023-03-131-2/+2
* | | | | | kernel: remove unnecessary finalize callsLiam2023-03-132-7/+1
* | | | | | kernel: convert KProcess to new styleLiam2023-03-1310-240/+254
* | | | | | kernel: convert KThread to new styleLiam2023-03-1315-670/+519
* | | | | | kernel: prefer std::addressofLiam2023-03-1321-134/+139
* | | | | | kernel: convert KResourceLimitLiam2023-03-132-59/+59
* | | | | | kernel: remove kernel_Liam2023-03-1341-295/+290
* | | | | | kernel: remove gratitutous attribute usageLiam2023-03-138-29/+24
* | | | | | kernel/svc: convert to new styleLiam2023-03-1321-304/+192
* | | | | | kernel: convert miscellaneousLiam2023-03-137-94/+81
* | | | | | kernel: conver KScopedLock, KScopedResourceReservation, KSessionRequest, KSharedMemory, KSpinLockLiam2023-03-139-97/+99
* | | | | | kernel: convert KAbstractSchedulerLockLiam2023-03-131-31/+24
* | | | | | kernel: convert KMemoryLayout, KMemoryRegion*, KPageTableSlabHeap, KPriorityQueueLiam2023-03-136-121/+121
* | | | | | kernel: move KMemoryLayout for NX boardLiam2023-03-132-1/+1
* | | | | | kernel: remove KLinkedListLiam2023-03-135-245/+0
* | | | | | kernel: convert KConditionVariable, KLightConditionVariable, KLightLockLiam2023-03-137-75/+77
* | | | | | kernel: convert KPort, KSessionLiam2023-03-1328-226/+196
* | | | | | kernel: convert GlobalSchedulerContext, KAddressArbiter, KScopedSchedulerLockAndSleep, KThreadQueue to new styleLiam2023-03-138-142/+130
| |_|/ / / |/| | | |
* | | | | general: fix spelling mistakesLiam2023-03-12102-206/+206
* | | | | Merge pull request #9913 from ameerj/acc-dma-refactorFernando S2023-03-1110-260/+208
|\ \ \ \ \
| * | | | | gl_rasterizer: Implement AccelerateDMA DmaBufferImageCopyameerj2023-03-072-9/+52
| * | | | | Refactor AccelerateDMA codeameerj2023-03-078-251/+156
* | | | | | Merge pull request #9923 from liamwhite/khtliamwhite2023-03-108-15/+42
|\ \ \ \ \ \
| * | | | | | kernel: add timer pointer to KThreadQueueLiam2023-03-088-15/+42
* | | | | | | Merge pull request #9928 from german77/super_nfpliamwhite2023-03-105-52/+234
|\ \ \ \ \ \ \
| * | | | | | | service: nfp: Improve implementationNarr the Reg2023-03-105-52/+234
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9925 from ameerj/gl-sync-signalliamwhite2023-03-105-10/+16
|\ \ \ \ \ \ \
| * | | | | | | OpenGL: Prefer glClientWaitSync for OGLSync objectsameerj2023-03-095-10/+16
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #9917 from Morph1984/the-real-timeliamwhite2023-03-1011-18/+83
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | perf_stats: Check multicore firstMorph2023-03-081-2/+2
| * | | | | | hid: Use nanosecond timestamps instead of ticksMorph2023-03-082-5/+5
| * | | | | | core: Promote CPU/GPU threads to time criticalMorph2023-03-084-4/+4
| * | | | | | native_clock: Wait for 10 seconds instead of 30Morph2023-03-081-3/+3
| * | | | | | native_clock: Use RealTimeClock instead of SteadyClockMorph2023-03-081-4/+4
| * | | | | | steady_clock: Introduce a real time clockMorph2023-03-082-0/+36
| * | | | | | native_clock: Re-adjust the RDTSC frequencyMorph2023-03-082-5/+34
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #9916 from liamwhite/fpuliamwhite2023-03-093-1/+28
|\ \ \ \ \ \
| * | | | | | kernel: clone fpu status on CreateThreadLiam2023-03-083-1/+28
| |/ / / / /
* | | | | | Merge pull request #9822 from ameerj/buffcache-ssbo-addrliamwhite2023-03-092-5/+27
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | buffer_cache: Add logic for non-NVN storage buffer trackingameerj2023-02-252-5/+27
* | | | | | Merge pull request #9906 from german77/metroid2bunnei2023-03-083-10/+20
|\ \ \ \ \ \
| * | | | | | input_common: Increase mouse sensitivity rangegerman772023-03-083-10/+20
* | | | | | | Merge pull request #9912 from liamwhite/errliamwhite2023-03-0835-183/+169
|\ \ \ \ \ \ \
| * | | | | | | hle: rename legacy errors to ResultsLiam2023-03-0735-183/+169
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9904 from liamwhite/wsliamwhite2023-03-081-16/+29
|\ \ \ \ \ \ \
| * | | | | | | kernel: fix WaitSynchronizationLiam2023-03-051-16/+29
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9896 from Kelebek1/d24s8liamwhite2023-03-083-10/+16
|\ \ \ \ \ \ \
| * | | | | | | Check all swizzle components for red, not just [0], pass float border color rather than intKelebek12023-03-043-10/+16
* | | | | | | | Merge pull request #9921 from liamwhite/overrideMorph2023-03-084-7/+7
|\ \ \ \ \ \ \ \
| * | | | | | | | general: fix type inconsistenciesLiam2023-03-084-7/+7
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #9918 from liamwhite/fwrapvMorph2023-03-083-1/+25
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel: avoid signed overflow UB on MSVCLiam2023-03-083-1/+25
| |/ / / / / / /
* | | | | | | | Merge pull request #9920 from liamwhite/constexpr-bit-castMorph2023-03-081-9/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | common: make BitCast constexprLiam2023-03-081-9/+11
| |/ / / / / / /
* / / / / / / / input_common: Minor typo issues (#9922)Narr the Reg2023-03-088-48/+48
|/ / / / / / /
* | | | | | | Merge pull request #9889 from Morph1984/time-is-tickingliamwhite2023-03-0714-57/+322
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | native_clock: Round RDTSC frequency to the nearest 1000Morph2023-03-051-5/+12
| * | | | | | timer_resolution: Set current process to High QoSMorph2023-03-051-0/+22
| * | | | | | hardware_properties: Update BASE_CLOCK_RATE to exactly 1020 MHzMorph2023-03-051-5/+3
| * | | | | | core_timing: Use higher precision sleeps on WindowsMorph2023-03-055-24/+47
| * | | | | | main: (Windows) Set the current timer resolution to the maximumMorph2023-03-052-0/+13
| * | | | | | wall_clock: Make use of SteadyClockMorph2023-03-051-23/+11
| * | | | | | common: Implement a method to change the Windows timer resolutionMorph2023-03-053-0/+133
| * | | | | | common: Implement a high resolution steady clockMorph2023-03-053-0/+81
* | | | | | | Merge pull request #9890 from Kelebek1/reverb_fixliamwhite2023-03-063-6/+8
|\ \ \ \ \ \ \
| * | | | | | | Fix a bug with the Reverb command in reading from the pre_delay line.Kelebek12023-03-023-6/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9910 from jbeich/libc++liamwhite2023-03-061-0/+1
|\ \ \ \ \ \ \
| * | | | | | | kernel: add missing header for libc++Jan Beich2023-03-061-0/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #9905 from german77/usbsslliamwhite2023-03-063-62/+102
|\ \ \ \ \ \ \
| * | | | | | | service: psc: Update namesNarr the Reg2023-03-051-9/+9
| * | | | | | | service: ssl: Add missing properties and update namesNarr the Reg2023-03-051-18/+58
| * | | | | | | service: usb: Update namesNarr the Reg2023-03-051-35/+35
| |/ / / / / /
* | | | | | | Merge pull request #9907 from german77/joyconliamwhite2023-03-063-32/+84
|\ \ \ \ \ \ \
| * | | | | | | input_common: joycon: Add stick input from passive reportsgerman772023-03-053-32/+84
| |/ / / / / /
* | | | | | | Merge pull request #9908 from german77/pfpliamwhite2023-03-062-9/+20
|\ \ \ \ \ \ \
| * | | | | | | service: acc: Replace default image with a 32x32 imageNarr the Reg2023-03-052-9/+20
| |/ / / / / /
* / / / / / / fix typo in settings.hIkko Eltociear Ashimine2023-03-061-4/+4
|/ / / / / /
* | / / / / Engines: Implement Accelerate DMA Texture.Fernando Sahmkow2023-03-0515-97/+658
| |/ / / / |/| | | |
* | | | | Merge pull request #9884 from liamwhite/service-cleanupMorph2023-03-04181-2179/+2112
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | nvnflinger: fix nameLiam2023-03-0154-444/+443
| * | | | service: move hle_ipc from kernelLiam2023-03-01148-1734/+1669
| * | | | sm:: remove unused memberLiam2023-03-011-1/+0
| |/ / /
* | | | Merge pull request #9855 from liamwhite/kern-16-supportbunnei2023-03-0313-288/+510
|\ \ \ \
| * | | | kernel: be more careful about kernel address keysLiam2023-03-015-11/+23
| * | | | kernel: refactor priority inheritance to represent locks as C++ objectsLiam2023-03-018-190/+436
| * | | | kernel: simplify AddressSpaceInfo, update valuesLiam2023-03-011-66/+13
| * | | | kernel: barrier memory before condition variable writeLiam2023-03-011-15/+15
| * | | | kernel: document previous location of interrupt disables in arbiter/condvarLiam2023-03-012-3/+9
| * | | | kernel: adjust pool allocationsLiam2023-03-012-7/+16
| * | | | kernel: simplify KAbstractSchedulerLock::LockLiam2023-03-011-5/+6
| * | | | kernel: add InfoType::IoRegionHintLiam2023-03-011-0/+1
| |/ / /
* / / / vulkan_common: disable vertexInputDynamicState on unsupported driverLiam2023-03-021-0/+1
|/ / /
* | | Merge pull request #9832 from liamwhite/hle-mpliamwhite2023-03-01141-1153/+1569
|\ \ \
| * | | sm:: fix lingering session initialization issuesLiam2023-02-212-2/+19
| * | | cheat_engine: add check for hid initializationLiam2023-02-211-2/+7
| * | | sm:: support service registration deferralLiam2023-02-215-8/+151
| * | | service: refactor server architectureLiam2023-02-21140-1143/+1393
| * | | core: defer cpu shutdownLiam2023-02-211-3/+4
* | | | cmake: use correct boost imported targetsAlexandre Bouvier2023-02-285-5/+5
* | | | Merge pull request #9859 from liamwhite/tmem-useliamwhite2023-02-2821-75/+95
|\ \ \ \
| * | | | am: avoid direct pointer access of transfer memory objectsLiam2023-02-241-6/+4
| * | | | hid: avoid direct pointer access of transfer memory objectsLiam2023-02-2420-69/+91
* | | | | Merge pull request #9874 from german77/violetliamwhite2023-02-281-4/+8
|\ \ \ \ \
| * | | | | service: btm: Fix handle functionsNarr the Reg2023-02-271-4/+8
* | | | | | Merge pull request #9872 from goldenx86/partialLTOMatías Locatti2023-02-272-0/+8
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Partially apply LTO to only core and video_core projects.Matías Locatti2023-02-272-0/+8
* | | | | | Revert "yuzu: config: Remove player 8 and 9 from config file"Narr the Reg2023-02-268-104/+38
|/ / / / /
* | | | | Merge pull request #9849 from ameerj/async-astcliamwhite2023-02-2615-8/+138
|\ \ \ \ \
| * | | | | configuration: Add async ASTC decode settingameerj2023-02-2312-8/+49
| * | | | | texture_cache: Add async texture decodingameerj2023-02-224-0/+89
* | | | | | yuzu: config: Remove player 8 and 9 from config fileNarr the Reg2023-02-268-38/+104
| |_|_|/ / |/| | | |
* | | | | Merge pull request #9848 from german77/metroid_motionliamwhite2023-02-256-26/+115
|\ \ \ \ \
| * | | | | core: hid: Restore motion state on refresh and clamp motion valuesNarr the Reg2023-02-223-2/+30
| * | | | | input_common: Implement dedicated motion from mouseNarr the Reg2023-02-223-24/+85
| |/ / / /
* | | | | Merge pull request #9857 from german77/fwupdateliamwhite2023-02-2513-2/+63
|\ \ \ \ \
| * | | | | core: Update service function tables to 16.0.0+Narr the Reg2023-02-2513-2/+63
| | |/ / / | |/| | |
* | | | | Merge pull request #9861 from german77/bustypeliamwhite2023-02-252-15/+15
|\ \ \ \ \
| * | | | | core: hidbus: Fix BusType sizeNarr the Reg2023-02-252-15/+15
| |/ / / /
* / / / / config: Fix per game Force max clockgerman772023-02-252-5/+1
|/ / / /
* | | | settings: Add more input settings to the logNarr the Reg2023-02-221-0/+7
* | | | core: hid: Fix native mouse mappingsNarr the Reg2023-02-225-63/+62
|/ / /
* | | Merge pull request #9847 from german77/timeoutliamwhite2023-02-221-0/+2
|\ \ \
| * | | yuzu: Set a lower timeout for discord presenceNarr the Reg2023-02-221-0/+2
| |/ /
* | | Merge pull request #9846 from merryhime/type-constliamwhite2023-02-2214-54/+54
|\ \ \
| * | | svc: Fix type consistency (exposed on macOS)Merry2023-02-2114-54/+54
| |/ /
* | | Merge pull request #9841 from abouvier/httplib-updateliamwhite2023-02-222-2/+2
|\ \ \
| * | | externals: Update cpp-httplib to latestAlexandre Bouvier2023-02-212-2/+2
| |/ /
* / / net: translate ECONNRESET network errorMonsterDruide12023-02-214-0/+8
|/ /
* | Qt: Reintroduce scaling for touch inputgerman772023-02-202-6/+16
* | Merge pull request #9771 from ameerj/host-thread-idliamwhite2023-02-191-27/+18
|\ \
| * | kernel: Refactor thread_local variable usageameerj2023-02-111-27/+18
* | | Merge pull request #9588 from liamwhite/bylaws-revertsliamwhite2023-02-1910-34/+9
|\ \ \
| * | | Revert "shader_recompiler: Align SSBO offsets to meet host requirements"Liam2023-01-074-12/+6
| * | | Revert "Vulkan, OpenGL: Hook up storage buffer alignment code"Liam2023-01-076-22/+3
* | | | Merge pull request #9815 from german77/qt-mouseliamwhite2023-02-1811-47/+120
|\ \ \ \
| * | | | input_common: Split mouse input into individual devicesNarr the Reg2023-02-1610-31/+114
| * | | | Qt: Fix mouse scallinggerman772023-02-162-18/+8
* | | | | Merge pull request #9825 from liamwhite/object-nameMorph2023-02-187-3/+265
|\ \ \ \ \
| * | | | | kernel: add KObjectNameLiam2023-02-177-3/+265
* | | | | | Merge pull request #9810 from Kelebek1/nvdec_threadsbunnei2023-02-171-0/+2
|\ \ \ \ \ \
| * | | | | | Allow >1 cpu threads on video decoding, disable multi-frame decodingKelebek12023-02-141-0/+2
* | | | | | | Merge pull request #9817 from german77/saveMai2023-02-174-2/+11
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | yuzu: Shutdown game on restart to reload per game configNarr the Reg2023-02-171-2/+4
| * | | | | | yuzu: Write to config file on important config changesNarr the Reg2023-02-174-0/+7
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9802 from Kelebek1/wait_data_cachebunnei2023-02-161-0/+4
|\ \ \ \ \ \
| * | | | | | Reimplement the invalidate_texture_data_cache registerKelebek12023-02-141-0/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9769 from Kelebek1/audio_oobbunnei2023-02-162-40/+92
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Add fallback for memory read/write in case the address goes over a 4K pageKelebek12023-02-111-12/+64
| * | | | | Fix depop prepare receiving bad mix infos and writing out of bounds, and update aux a bit, may helpKelebek12023-02-112-40/+40
* | | | | | Merge pull request #9796 from liamwhite/currentliamwhite2023-02-1572-291/+315
|\ \ \ \ \ \
| * | | | | | general: rename CurrentProcess to ApplicationProcessLiam2023-02-1441-164/+169
| * | | | | | kernel: use GetCurrentProcessLiam2023-02-1334-128/+147
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9782 from arades79/fix-consexpr-value-declaration-usageliamwhite2023-02-1526-60/+54
|\ \ \ \ \ \
| * | | | | | remove constexpr from virtual functionarades792023-02-152-5/+5
| * | | | | | use a string view to skip allocationarades792023-02-142-13/+7
| * | | | | | remove static from pointer sized or smaller types for aesthetics, change constexpr static to static constexpr for consistencyarades792023-02-14102-307/+300
| * | | | | | apply clang-formatarades792023-02-142-4/+5
| * | | | | | don't use static inside constexpr functionarades792023-02-141-6/+6
| * | | | | | add static lifetime to constexpr values to force compile time evaluation where possiblearades792023-02-14101-303/+309
* | | | | | | Merge pull request #9809 from liamwhite/unused-servicebunnei2023-02-1524-621/+0
|\ \ \ \ \ \ \
| * | | | | | | service: remove deleted servicesLiam2023-02-1424-621/+0
| |/ / / / / /
* / / / / / / Revert "main: Fix borderless fullscreen for high dpi scaled displays"liamwhite2023-02-141-13/+1
|/ / / / / /
* | | | | | Merge pull request #9795 from Kelebek1/biquad_fixliamwhite2023-02-141-2/+2
|\ \ \ \ \ \
| * | | | | | Fix biquad filter command's state buffer offsetKelebek12023-02-131-2/+2
| |/ / / / /
* | | | | | Merge pull request #9793 from Morph1984/borderless-hidpiliamwhite2023-02-141-1/+13
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | main: Fix borderless fullscreen for high dpi scaled displaysMorph2023-02-131-1/+13
* | | | | | Merge pull request #9784 from m-HD/masterbunnei2023-02-131-0/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Update settings.cppm-HD2023-02-121-0/+4
* | | | | | Merge pull request #9757 from german77/gyrobunnei2023-02-128-21/+67
|\ \ \ \ \ \
| * | | | | | core: hid: Use gyro thresholds modes set by the gameNarr the Reg2023-02-108-21/+67
* | | | | | | Merge pull request #9746 from ameerj/ogl-msaa-texcachebunnei2023-02-1212-14/+136
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | texture_cache: OpenGL: Implement MSAA uploads and copiesameerj2023-02-1112-14/+136
* | | | | | | kernel/svc: Fix undefined info_idColin Kinloch2023-02-111-2/+2
* | | | | | | Merge pull request #9777 from vonchenplus/speed_up_video_copyliamwhite2023-02-111-9/+5
|\ \ \ \ \ \ \
| * | | | | | | video_core: Speed up video frame data copyFengChen2023-02-111-9/+5
* | | | | | | | Merge pull request #9773 from bunnei/fix-process-resourceliamwhite2023-02-113-1/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | core: kernel: k_process: Use application system resource.bunnei2023-02-113-1/+15
| |/ / / / / / /
* | | | | | | | Merge pull request #9768 from merryhime/biquad-roundingliamwhite2023-02-112-27/+19
|\ \ \ \ \ \ \ \
| * | | | | | | | biquad_filter: Clamp f64 in ApplyBiquadFilterFloatMerry2023-02-101-3/+3
| * | | | | | | | biquad_filter: Fix rounding in ApplyBiquadFilterIntMerry2023-02-102-24/+16
| |/ / / / / / /
* | | | | | | | Merge pull request #9744 from behunin/quick-releaseliamwhite2023-02-113-14/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | Remove OnCommandListEndCommandBehunin2023-02-083-14/+2
* | | | | | | | | Merge pull request #9742 from liamwhite/svc-wrap-onlybunnei2023-02-1145-1570/+7468
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel/svc: switch to generated wrappersLiam2023-02-0745-1570/+7468
* | | | | | | | | | Merge pull request #9759 from german77/pro_controllerbunnei2023-02-119-7/+92
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | input_common: Reintroduce custom pro controller supportNarr the Reg2023-02-109-7/+92
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #9761 from Morph1984/oopsliamwhite2023-02-101-0/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | main: Re-add QtWebEngine zoom factorMorph2023-02-101-0/+2
| | |_|_|_|_|/ / / | |/| | | | | | |
* / | | | | | | | kernel: avoid usage of bit_castLiam2023-02-101-2/+2
|/ / / / / / / /
* | | | | | | | Merge pull request #9736 from Kelebek1/dynamic_vertex_attribsliamwhite2023-02-101-25/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Remove fake vertex bindings when dynamic state is enabledKelebek12023-02-051-25/+1
* | | | | | | | | Merge pull request #9750 from ameerj/glsl-sample-id-maskliamwhite2023-02-101-6/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | glsl_emit_context: Remove redeclarations of gl_SampleID and gl_SampleMaskameerj2023-02-091-6/+0
* | | | | | | | | | audio: cubeb: Fix yuzu crashing when it test for latencyNarr the Reg2023-02-101-0/+20
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | buffer_base: Partially revert changes from #9559ameerj2023-02-092-7/+9
|/ / / / / / / /
* | | | | | | | Merge pull request #9747 from german77/SetSupportedNpadIdTypesliamwhite2023-02-084-6/+15
|\ \ \ \ \ \ \ \ | | |_|_|_|/ / / | |/| | | | | |
| * | | | | | | service: hid: Return error if arguments of SetSupportedNpadIdType is invalidNarr the Reg2023-02-084-6/+15
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #9739 from liamwhite/old-gcc-fixMai2023-02-082-4/+5
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | kernel: fix compilation with older gccLiam2023-02-062-4/+5
* | | | | | | Merge pull request #4949 from Morph1984/hidpi-temp-fixliamwhite2023-02-073-8/+65
|\ \ \ \ \ \ \
| * | | | | | | main: Convert to device independent coordinates for scalingMorph2023-01-263-8/+13
| * | | | | | | main: Use passthrough scaling for non-windows OSesMorph2023-01-261-3/+12
| * | | | | | | main: Enable High DPI fixes for Qt >= 5.14Morph2023-01-261-0/+43
* | | | | | | | Merge pull request #9644 from SaiKai/volume_quicksettingbunnei2023-02-072-24/+90
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | remove disambiguation argument from mute textJonas Gutenschwager2023-02-041-1/+1
| * | | | | | | add volume quicksetting with volume sliderJonas Gutenschwager2023-01-192-24/+90
* | | | | | | | Update yuzu_cmd's default_ini.hMatías Locatti2023-02-061-7/+10
| |_|_|/ / / / |/| | | | | |
* | | | | | | kernel/svc: Split implementations into separate filesLiam2023-02-0540-2688/+3196
* | | | | | | Merge pull request #9720 from SoRadGaming/discordPresenceUpdatebunnei2023-02-052-8/+61
|\ \ \ \ \ \ \
| * | | | | | | Add Game Icon for Discord RPCSorab2023-02-052-8/+61
* | | | | | | | Merge pull request #9730 from german77/cmd_argliamwhite2023-02-041-19/+36
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu_cmd: Order arguments alphabetically and port arguments from Qtgerman772023-02-041-19/+36
* | | | | | | | | Merge pull request #9729 from german77/sdl_inputliamwhite2023-02-044-35/+39
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu_cmd: Fix mismatching controller inputgerman772023-02-043-2/+18
| * | | | | | | | | yuzu_cmd: Fix touch inputgerman772023-02-042-33/+21
| |/ / / / / / / /
* | | | | / / / / shader_recompiler/value.h: Remove lingering references to S32ameerj2023-02-041-11/+0
| |_|_|_|/ / / / |/| | | | | | |
* | | | | | | | Merge pull request #9717 from german77/less_is_betterbunnei2023-02-041-32/+13
|\ \ \ \ \ \ \ \
| * | | | | | | | input_common: Simplify stick from buttonNarr the Reg2023-02-021-32/+13
| |/ / / / / / /
* | | | | | | | fsp_srv: Copy HLE Read Buffer for OutputAccessLogToSdCardameerj2023-02-031-1/+1
* | | | | | | | Revert "Merge pull request #9718 from yuzu-emu/revert-9508-hle-ipc-buffer-span"ameerj2023-02-0361-326/+368
* | | | | | | | Merge pull request #9713 from unfamiliarplace/masterMai2023-02-033-0/+25
|\ \ \ \ \ \ \ \
| * | | | | | | | added 'Hide empty rooms' toggle to lobbyLuke Sawczak2023-02-033-0/+25
| |/ / / / / / /
* | | | | | | | Merge pull request #9718 from yuzu-emu/revert-9508-hle-ipc-buffer-spanbunnei2023-02-0361-368/+326
|\ \ \ \ \ \ \ \
| * | | | | | | | Revert "hle_ipc: Use std::span to avoid heap allocations/copies when calling ReadBuffer"liamwhite2023-02-0261-368/+326
| |/ / / / / / /
* | | | | | | | Merge pull request #9704 from liamwhite/dasbunnei2023-02-036-0/+232
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel: add KDeviceAddressSpaceLiam2023-02-016-0/+232
* | | | | | | | Merge pull request #9708 from ameerj/gl-context-flushliamwhite2023-02-026-16/+49
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_compute_pipeline: Force context flush when loading shader cacheameerj2023-01-304-7/+37
| * | | | | | | | gl_graphics_pipeline: Force context flush when loading shader cacheameerj2023-01-304-9/+12
* | | | | | | | | Merge pull request #9703 from ameerj/txq-msliamwhite2023-02-025-18/+51
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | spirv: Fix TXQ with MSAA texturesameerj2023-01-293-8/+19
| * | | | | | | | emit_glasm_image: Fix TXQ with MSAA texturesameerj2023-01-291-1/+9
| * | | | | | | | emit_glsl_image: Implement TXQ with MSAA texturesameerj2023-01-291-9/+23
| |/ / / / / / /
* | | | | | | | Merge pull request #9696 from german77/please_forgive_me_for_this_sinbunnei2023-02-018-32/+138
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu: config: Draw turbo buttons with a different colorgerman772023-02-012-14/+23
| * | | | | | | | input_common: Implement turbo buttonsgerman772023-02-016-18/+115
* | | | | | | | | Merge pull request #9697 from liamwhite/kcapbunnei2023-01-316-0/+738
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | kernel: add KCapabilitiesLiam2023-01-306-0/+738
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9508 from ameerj/hle-ipc-buffer-spanbunnei2023-01-3061-326/+368
|\ \ \ \ \ \ \ \
| * | | | | | | | hle_ipc: Use thread_local ReadBufferameerj2022-12-291-4/+14
| * | | | | | | | hle_ipc: Rename ReadBufferSpan to ReadBufferameerj2022-12-2933-97/+97
| * | | | | | | | hle_ipc: Rename ReadBuffer to ReadBufferCopyameerj2022-12-293-4/+6
| * | | | | | | | bsd: Use std::span for read payloadsameerj2022-12-296-36/+38
| * | | | | | | | nvdrv: Use std::span for inputsameerj2022-12-2924-211/+209
| * | | | | | | | hidbus: Use ReadBufferSpanameerj2022-12-2911-12/+16
| * | | | | | | | nvflinger: Split Parcel class into InputParcel and OutputParcelameerj2022-12-255-48/+53
| * | | | | | | | service: Use ReadBufferSpan where it is trivial to do soameerj2022-12-2531-77/+78
| * | | | | | | | fsp_srv: Use ReadBufferSpanameerj2022-12-253-19/+17
| * | | | | | | | hle_ipc: Add ReadBufferSpan functionameerj2022-12-252-0/+22
* | | | | | | | | Merge pull request #9701 from german77/common_protocolliamwhite2023-01-3012-190/+269
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | input_common: joycon: Remove Magic numbers from common protocolNarr the Reg2023-01-309-154/+221
| * | | | | | | | | input_common: joycon: Fill missing enum dataNarr the Reg2023-01-306-41/+53
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9631 from vonchenplus/vulkan_clearliamwhite2023-01-306-20/+152
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | video_core: Implement vulkan clear specified channelFengChen2023-01-286-20/+152
* | | | | | | | | Move to Clang Format 15Levi Behunin2023-01-3025-189/+185
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | Merge pull request #9699 from ameerj/texture-pass-descliamwhite2023-01-291-2/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | texture_pass: Fix texture descriptors comparisonsameerj2023-01-291-2/+9
* | | | | | | | | Merge pull request #9698 from ameerj/texture-pass-handleliamwhite2023-01-291-7/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | texture_pass: Refactor texture handle retrievalameerj2023-01-291-7/+7
* | | | | | | | | | Merge pull request #9694 from ameerj/txq-mipsliamwhite2023-01-2911-29/+37
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | shader_recompiler: TXQ: Skip QueryLevels when possibleameerj2023-01-2811-29/+37
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #9684 from liamwhite/read-the-specliamwhite2023-01-291-37/+46
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | polyfill_thread: satisfy execution ordering requirements of stop_callbackLiam2023-01-281-37/+46
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #9689 from german77/joycon-calibrationbunnei2023-01-296-114/+215
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | input_common: joycon: Replace ReadSPI vector with spanNarr the Reg2023-01-283-20/+26
| * | | | | | | | | | input_common: joycon: Remove magic numbers from calibration protocolNarr the Reg2023-01-286-107/+202
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #9691 from ameerj/msaa-texcachebunnei2023-01-292-0/+48
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | texture_cache: Adjust image view sizes by MSAA samplesameerj2023-01-282-0/+48
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #9690 from german77/whoopsliamwhite2023-01-291-2/+5
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | yuzu: config: Avoid reading deleted objectNarr the Reg2023-01-281-2/+5
| |/ / / / / / / /
* | | | | | | | | Merge pull request #9687 from ameerj/ogl-shader-msbunnei2023-01-294-33/+46
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | emit_glsl_image: Fix ImageFetch for MSAA texturesameerj2023-01-281-6/+11
| * | | | | | | | glasm: Add MS sampler typesameerj2023-01-272-5/+8
| * | | | | | | | glsl: Add MS sampler typesameerj2023-01-271-22/+27
| |/ / / / / / /
* | | | | | | | Merge pull request #9682 from ameerj/shader-s32bunnei2023-01-2813-46/+19
|\ \ \ \ \ \ \ \
| * | | | | | | | shader_recompiler: Remove S32 IR typeameerj2023-01-2613-46/+19
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Merge pull request #9661 from SoRadGaming/LDNhostnameSupportliamwhite2023-01-283-31/+38
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | LDN Hostname Support in Direct ConnectSoRadGaming2023-01-283-31/+38
* | | | | | | | Merge pull request #9677 from Morph1984/sleep-onebunnei2023-01-283-5/+42
|\ \ \ \ \ \ \ \
| * | | | | | | | input_common: Make use of StoppableTimedWaitMorph2023-01-252-5/+6
| * | | | | | | | polyfill_thread: Implement StoppableTimedWaitMorph2023-01-251-0/+36
* | | | | | | | | Merge pull request #9539 from Wollnashorn/opengl-fsrliamwhite2023-01-2814-172/+547
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | video_core/opengl: Add FSR upscaling filter to the OpenGL rendererWollnashorn2023-01-2614-172/+547
* | | | | | | | | | Merge pull request #9666 from liamwhite/wait-for-mebunnei2023-01-286-42/+52
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / |/| | | | | | | | |
| * | | | | | | | | kernel: split SetAddressKey into user and kernel variantsLiam2023-01-245-11/+29
| * | | | | | | | | kernel: fix incorrect locking order in suspensionLiam2023-01-233-31/+23
* | | | | | | | | | kernel: unbreak min/max template deduction on Apple ClangLiam2023-01-261-2/+2
* | | | | | | | | | Merge pull request #9683 from german77/high_power_joyconbunnei2023-01-264-0/+21
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | input_common: Implement SetLowPowerMode and TriggersElapsed for the joycon driverNarr the Reg2023-01-264-0/+21
* | | | | | | | | | | Merge pull request #9670 from merryhime/revert-af5ecb0b15d4449f58434e70eed835cf71fc5527bunnei2023-01-263-34/+11
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Revert "MemoryManager: use fastmem directly."Merry2023-01-253-34/+11
* | | | | | | | | | | | Merge pull request #9652 from liamwhite/msbunnei2023-01-264-2/+16
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | spirv: fix multisampled image fetchLiam2023-01-234-2/+16
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #9604 from liamwhite/ptbunnei2023-01-266-215/+477
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | | |
| * | | | | | | | | | | kernel: KPageTable: updateLiam2023-01-226-215/+477
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | main: Only set AA_DisableWindowContextHelpButton below Qt6Morph2023-01-261-1/+3
* | | | | | | | | | | Merge pull request #9675 from Morph1984/ini-concatliamwhite2023-01-251-2/+8
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | default_ini: Split and concatenate the config string literalMorph2023-01-251-2/+8
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #9668 from Morph1984/qt-why-is-this-not-the-defaultliamwhite2023-01-2510-17/+8
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | main: Globally disable the "?" button on dialogsMorph2023-01-2510-17/+8
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #9676 from german77/revert-stick-rangeliamwhite2023-01-252-12/+9
|\ \ \ \ \ \ \ \ \ \ \ | | |_|_|/ / / / / / / | |/| | | | / / / / / | |_|_|_|_|/ / / / / |/| | | | | | | | |
| * | | | | | | | | Revert 9617 and fix it on input_commonNarr the Reg2023-01-252-12/+9
| |/ / / / / / / /
* / / / / / / / / input_common: add missing header for libc++ after 340f15d1fa79Jan Beich2023-01-251-0/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #9662 from abouvier/cmake-llvmbunnei2023-01-242-5/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | cmake: prefer system llvm libraryAlexandre Bouvier2023-01-232-5/+3
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9492 from german77/joycon_releaseliamwhite2023-01-2458-408/+5812
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | core: hid: Make use of SCOPE_EXIT and SCOPE_GUARD where applicableNarr the Reg2023-01-201-67/+38
| * | | | | | | input_common: Fix joycon mappingsgerman772023-01-202-57/+53
| * | | | | | | input_common: Address byte reviewgerman772023-01-2016-243/+220
| * | | | | | | core: hid: Only set the polling mode to the correct sideNarr the Reg2023-01-208-27/+70
| * | | | | | | input_common: Drop Pro controller support from custom drivergerman772023-01-204-43/+4
| * | | | | | | input_common: Fix issue where ring and irs are enabled at the same timegerman772023-01-204-15/+24
| * | | | | | | input_common: Implement joycon ir cameraNarr the Reg2023-01-2015-23/+608
| * | | | | | | yuzu: Add ring controller test buttongerman772023-01-2010-174/+370
| * | | | | | | input_common: Use DriverResult on all enginesgerman772023-01-2017-104/+100
| * | | | | | | Address review commentsgerman772023-01-2014-46/+44
| * | | | | | | core: hid: Fix input regressionsNarr the Reg2023-01-206-41/+56
| * | | | | | | input_common: Implement joycon nfcgerman772023-01-209-13/+544
| * | | | | | | input_common: Add dual joycon supportNarr the Reg2023-01-201-24/+101
| * | | | | | | input_common: Add support for joycon ring controllerNarr the Reg2023-01-209-4/+272
| * | | | | | | input_common: Add support for joycon input reportsNarr the Reg2023-01-208-100/+798
| * | | | | | | input_common: Use calibration from joyconNarr the Reg2023-01-205-0/+231
| * | | | | | | input_common: Add support for joycon generic functionsNarr the Reg2023-01-205-3/+310
| * | | | | | | input_common: Add joycon low level functionsNarr the Reg2023-01-203-0/+434
| * | | | | | | service: hid: Set led pattern and fix color detectionNarr the Reg2023-01-201-0/+5
| * | | | | | | core: hid: Enable pulling color data from controllersNarr the Reg2023-01-209-2/+246
| * | | | | | | core: hid: Migrate ring from emulated devices to emulated controllerNarr the Reg2023-01-208-88/+105
| * | | | | | | yuzu: Update controller colors and button namesNarr the Reg2023-01-202-3/+27
| * | | | | | | input_common: Disable SDL driver with switch controllersNarr the Reg2023-01-206-6/+44
| * | | | | | | input_common: Initial skeleton for custom joycon driverNarr the Reg2023-01-208-3/+1786
* | | | | | | | Merge pull request #9555 from abouvier/catch2-updateliamwhite2023-01-2315-23/+14
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | tests: update catch2 to 3.0.1Alexandre Bouvier2023-01-0515-23/+14
* | | | | | | | Merge pull request #9660 from german77/koreaToTaiwanliamwhite2023-01-224-8/+21
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu: Fix language comobox crashgerman772023-01-224-8/+21
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9656 from liamwhite/nsightliamwhite2023-01-221-4/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | nsight_aftermath_tracker: update for latest Aftermath SDKLiam2023-01-211-4/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #9637 from SaiKai/repeat_shortcutsliamwhite2023-01-224-27/+30
|\ \ \ \ \ \ \ \
| * | | | | | | | fix formatJonas Gutenschwager2023-01-182-4/+2
| * | | | | | | | allow volume up/down hotkeys to be repeatedJonas Gutenschwager2023-01-184-27/+32
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #9617 from german77/off_by_oneliamwhite2023-01-221-2/+10
|\ \ \ \ \ \ \ \
| * | | | | | | | core: hid: Fix stick minimum rangegerman772023-01-141-2/+10
* | | | | | | | | Merge pull request #9613 from Kelebek1/demangleliamwhite2023-01-224-19/+56
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | Be careful of mangled out of bounds readKelebek12023-01-142-9/+9
| * | | | | | | | Move demangle impl to cppKelebek12023-01-143-23/+36
| * | | | | | | | Add stacktrace symbol demanglingKelebek12023-01-143-15/+39
| |/ / / / / / /
* | | | | | | | Merge pull request #9611 from liamwhite/patch-1bunnei2023-01-201-3/+23
|\ \ \ \ \ \ \ \
| * | | | | | | | debugger: add host fastmem pointer fetch commandLiam2023-01-131-3/+23
| |/ / / / / / /
* | | | | | | | Merge pull request #9640 from german77/why_sdlbunnei2023-01-201-19/+35
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | input_common: reset sdl motion if data is invalidgerman772023-01-181-19/+35
| |/ / / / / /
* | | | | | | Merge pull request #9556 from vonchenplus/draw_textureliamwhite2023-01-1925-125/+502
|\ \ \ \ \ \ \
| * | | | | | | Address feedbackFeng Chen2023-01-165-14/+62
| * | | | | | | video_core: Implement opengl/vulkan draw_textureFeng Chen2023-01-0519-138/+291
| * | | | | | | video_core: Implement maxwell3d draw texture methodFeng Chen2023-01-057-1/+177
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #9623 from liamwhite/wp-oopsbunnei2023-01-191-0/+4
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | memory: fix watchpoint use when fastmem is enabledLiam2023-01-151-0/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9638 from Kelebek1/firmware4Narr the Reg2023-01-191-1/+1
|\ \ \ \ \ \
| * | | | | | Demote maxwell3d Firmware4 call log to debugKelebek12023-01-181-1/+1
| |/ / / / /
* | | | | | Merge pull request #9619 from liamwhite/timing-spaghettibunnei2023-01-193-29/+28
|\ \ \ \ \ \
| * | | | | | timing: wait for completion on unregisterLiam2023-01-143-29/+28
| |/ / / / /
* | | | | | Merge pull request #9615 from merryhime/upsample-ob1bunnei2023-01-181-59/+38
|\ \ \ \ \ \
| * | | | | | upsample: Fix coefficient formatMerry2023-01-141-26/+26
| * | | | | | audio_core: Fix off-by-one error in upsamplerMerry2023-01-141-33/+12
| |/ / / / /
* | | | | | Merge pull request #9608 from liamwhite/fpsbunnei2023-01-182-5/+5
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | nvnflinger: correct swap interval handlingLiam2023-01-122-5/+5
| |/ / / /
* | | | | Update settings.hMatías Locatti2023-01-131-0/+2
* | | | | CPPMatías Locatti2023-01-131-0/+8
* | | | | UI changeMatías Locatti2023-01-131-0/+10
* | | | | 1.5X resolution scaler optionMatías Locatti2023-01-133-5/+15
|/ / / /
* | | | Merge pull request #9605 from german77/mouse_mappingbunnei2023-01-113-1/+10
|\ \ \ \
| * | | | yuzu: Read mouse wheel inputNarr the Reg2023-01-113-1/+10
* | | | | Merge pull request #9596 from liamwhite/mvkMorph2023-01-111-10/+25
|\ \ \ \ \
| * | | | | MoltenVK: restrict number of vertex attributes/bindings to 16TellowKrinkle2023-01-101-10/+25
* | | | | | Merge pull request #9582 from yuzu-emu/revert-9518-revert-9504-pg2liamwhite2023-01-1011-181/+322
|\ \ \ \ \ \
| * | | | | | Revert "Revert "k_page_group: synchronize""bunnei2023-01-0811-181/+322
* | | | | | | Merge pull request #9601 from liamwhite/it-never-endsliamwhite2023-01-102-2/+21
|\ \ \ \ \ \ \
| * | | | | | | qt: unlock during signal emissionLiam2023-01-102-2/+21
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9598 from liamwhite/indirectliamwhite2023-01-103-8/+15
|\ \ \ \ \ \ \
| * | | | | | | vulkan_common: fix indirect draw with countLiam2023-01-103-8/+15
| |/ / / / / /
* | | | | | | Merge pull request #9595 from liamwhite/per-gameliamwhite2023-01-101-2/+3
|\ \ \ \ \ \ \
| * | | | | | | qt: fix configuration weirdness on turboLiam2023-01-091-2/+3
* | | | | | | | Merge pull request #9565 from MonsterDruide1/tas-multiplayer-lengthsliamwhite2023-01-104-7/+38
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | TAS: Show all script lengths for multiplayerMonsterDruide12023-01-074-7/+38
* | | | | | | | macOS: Make Yuzu show up in the Launchpad Games folder (#9594)UltraHDR2023-01-091-0/+2
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #9589 from liamwhite/defaultMorph2023-01-091-1/+1
|\ \ \ \ \ \ \
| * | | | | | | renderer_vulkan: disable turbo by defaultLiam2023-01-081-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9581 from liamwhite/turbo2Morph2023-01-095-0/+40
|\ \ \ \ \ \ \
| * | | | | | | renderer_vulkan: pause turbo submissions on inactive queueLiam2023-01-075-0/+40
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #9530 from liamwhite/vk-feature-initMorph2023-01-093-1173/+664
|\ \ \ \ \ \ \
| * | | | | | | vulkan_device: refactor feature testingLiam2023-01-093-1173/+664
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9569 from liamwhite/shutdown-warsMorph2023-01-091-3/+7
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | qt: additional fixes for reentrant shutdownLiam2023-01-071-3/+7
* | | | | | | VideoCore: Fix OGL cache invalidation.Fernando Sahmkow2023-01-082-0/+6
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #9563 from german77/crash_not_allowedbunnei2023-01-074-19/+37
|\ \ \ \ \ \
| * | | | | | input_common: Create an update engineNarr the Reg2023-01-064-19/+37
* | | | | | | Avoid OOB array access reading passthrough attr maskBilly Laws2023-01-071-1/+1
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #9570 from liamwhite/less-clock-boostNarr the Reg2023-01-073-1/+15
|\ \ \ \ \ \
| * | | | | | renderer_vulkan: disable clock boost on unvalidated devicesLiam2023-01-073-1/+15
* | | | | | | vulkan_device: avoid attempt to access empty optionalLiam2023-01-071-2/+6
|/ / / / / /
* | / / / / opengl: Sanitize antialiasing configNarr the Reg2023-01-061-1/+7
| |/ / / / |/| | | |
* | | | | video_core/vulkan: Fixed loading of Vulkan driver pipeline cacheWollnashorn2023-01-061-1/+2
* | | | | Merge pull request #9535 from bylaws/masterFernando S2023-01-0616-91/+195
|\ \ \ \ \
| * | | | | Run clang-formatBilly Laws2023-01-056-24/+35
| * | | | | shader_recompiler: Fix shuffle partitioning for >64 invoc-per-subgroup GPUsBilly Laws2023-01-051-30/+28
| * | | | | Vulkan, OpenGL: Hook up geometry shader passthrough emulationBilly Laws2023-01-052-0/+2
| * | | | | shader_recompiler: Add support for lowering geometry passthroughBilly Laws2023-01-052-40/+67
| * | | | | Vulkan, OpenGL: Hook up storage buffer alignment codeBilly Laws2023-01-056-3/+21
| * | | | | shader_recompiler: Align SSBO offsets to meet host requirementsBilly Laws2023-01-054-6/+11
| * | | | | shader_recompiler: SPIRV: Only enable int64 feature when supportedBilly Laws2023-01-051-1/+1
| * | | | | shader_recompiler: Add comparison operators to descriptor typesBilly Laws2023-01-051-0/+12
| * | | | | Vulkan: Add a workaround for input_position on Adreno driversBilly Laws2023-01-055-11/+42
* | | | | | Merge pull request #9561 from liamwhite/update-dynarmicliamwhite2023-01-062-0/+8
|\ \ \ \ \ \
| * | | | | | externals: update dynarmic, xbyakLiam2023-01-062-0/+8
| |/ / / / /
* | | | | | Merge pull request #9558 from MonsterDruide1/network-timeout-noerrorliamwhite2023-01-061-1/+5
|\ \ \ \ \ \
| * | | | | | net: Silently translate ETIMEDOUT network errorMonsterDruide12023-01-051-1/+5
* | | | | | | Merge pull request #9552 from liamwhite/turboliamwhite2023-01-0615-2/+303
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | common: add setting for renderer clock workaroundLiam2023-01-058-1/+32
| * | | | | | vulkan: implement 'turbo mode' clock boosterLiam2023-01-058-2/+272
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #9559 from FernandoS27/cached-writesFernando S2023-01-0615-53/+233
|\ \ \ \ \ \
| * | | | | | BufferBase: Don't ignore GPU pages.Fernando Sahmkow2023-01-058-23/+22
| * | | | | | Fermi2D: sync cache flushesFernando Sahmkow2023-01-052-2/+5
| * | | | | | MemoryManager: use fastmem directly.Fernando Sahmkow2023-01-053-11/+34
| * | | | | | video_core: Cache GPU internal writes.Fernando Sahmkow2023-01-0510-30/+185
| |/ / / / /
* | | | | | MacroHLE: eliminate 2 rushed macros.Fernando Sahmkow2023-01-061-42/+0
* | | | | | Merge pull request #9528 from liamwhite/mvk-nulldescliamwhite2023-01-063-0/+19
|\ \ \ \ \ \
| * | | | | | renderer_vulkan: implement fallback path for null descriptorsLiam2023-01-053-0/+19
| |/ / / / /
* | | | | | Merge pull request #9536 from liamwhite/debug-utilsliamwhite2023-01-063-11/+10
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | vulkan_common: unify VK_EXT_debug_utils and selection of validation layerLiam2023-01-013-11/+10
* | | | | | video_core/vulkan: Vulkan driver pipelines now contain cache versionWollnashorn2023-01-052-16/+28
* | | | | | video_core/vulkan: Driver pipeline cache will now be deleted with the shader cacheWollnashorn2023-01-052-1/+20
* | | | | | config: Set the Vulkan driver pipeline cache option to be globalWollnashorn2023-01-052-0/+4
* | | | | | video_core/vulkan: Added check if Vulkan pipeline path has been setWollnashorn2023-01-051-1/+1
* | | | | | config: Better wording for VK pipeline cache option and enable by defaultWollnashorn2023-01-052-3/+3
* | | | | | yuzu-cmd: Removed `use_vulkan_driver_pipeline_cache` from default_ini.hWollnashorn2023-01-051-4/+0
* | | | | | video_core/vulkan: Added `VkPipelineCache` to store Vulkan pipelinesWollnashorn2023-01-0515-67/+253
| |_|/ / / |/| | | |
* | | | | Vulkan: Fix drivers that don't support dynamic_state_2 upFernando Sahmkow2023-01-052-8/+11
| |/ / / |/| | |
* | | | Merge pull request #9501 from FernandoS27/yfc-rel-2liamwhite2023-01-0579-573/+3008
|\ \ \ \ | |_|/ / |/| | |
| * | | yuzu-ui: Add setting for disabling macro HLEFernando Sahmkow2023-01-046-5/+26
| * | | Video_core: Address feedbackFernando Sahmkow2023-01-0420-170/+346
| * | | Texture Cache: Implement async texture downloads.Fernando Sahmkow2023-01-045-35/+91
| * | | Vulkan: Update blacklisting to latest driver versions.Fernando Sahmkow2023-01-041-5/+12
| * | | ShaderCompiler: Inline driver specific constants.Fernando Sahmkow2023-01-035-3/+39
| * | | Vulkan: rework stencil tracking.Fernando Sahmkow2023-01-034-36/+169
| * | | vulkan_common: blacklist radv from extended_dynamic_state2 on drivers before 22.3.1Liam2023-01-012-2/+14
| * | | video_core: fix buildLiam2023-01-014-3/+38
| * | | MacroHLE: Final cleanup and fixes.Fernando Sahmkow2023-01-0114-128/+94
| * | | Rasterizer: Setup skeleton for Host Conditional renderingFernando Sahmkow2023-01-016-10/+53
| * | | RasterizerMemory: Add filtering for flushing/invalidation operations.Fernando Sahmkow2023-01-0114-93/+186
| * | | Vulkan: Allow stagging buffer deferrals.Fernando Sahmkow2023-01-012-21/+56
| * | | MacroHLE: Add OpenGL SupportFernando Sahmkow2023-01-016-39/+107
| * | | Vulkan: Add other additional pipeline specsFernando Sahmkow2023-01-011-1/+17
| * | | Vulkan: Implement Dynamic State 3Fernando Sahmkow2023-01-0113-105/+313
| * | | Vulkan Implement Dynamic State 2 LogicOp and PatchVerticesFernando Sahmkow2023-01-0112-27/+75
| * | | Vulkan: Implement Dynamic States 2Fernando Sahmkow2023-01-0113-66/+315
| * | | DMAPusher: Improve collection of non executing methodsFernando Sahmkow2023-01-0113-2/+181
| * | | Revert Buffer cache changes and setup additional macros.Fernando Sahmkow2023-01-017-128/+179
| * | | MacroHLE: Reduce massive calculations on sizing estimation.Fernando Sahmkow2023-01-019-95/+238
| * | | MacroHLE: Add HLE replacement for base vertex and base instance.Fernando Sahmkow2023-01-0122-70/+265
| * | | MacroHLE: Add Index Buffer size estimation.Fernando Sahmkow2023-01-015-10/+74
| * | | MacroHLE: Refactor MacroHLE system.Fernando Sahmkow2023-01-0111-121/+420
| * | | MacroHLE: Implement DrawIndexedIndirect & DrawArraysIndirect.Fernando Sahmkow2023-01-0116-72/+252
| * | | MacroHLE: Add MultidrawIndirect HLE Macro.Fernando Sahmkow2023-01-0113-47/+169
* | | | Merge pull request #9518 from gidoly/revert-9504-pg2liamwhite2023-01-0411-322/+181
|\ \ \ \
| * | | | Revert "k_page_group: synchronize"gidoly2022-12-2911-322/+181
* | | | | TAS: Immediately switch stick to TAS on inputMonsterDruide12023-01-031-9/+11
* | | | | cmake: move find-modules to root cmake dirAlexandre Bouvier2023-01-023-5/+0
* | | | | Merge pull request #9540 from MonsterDruide1/tas-sanitized-recordliamwhite2023-01-021-5/+5
|\ \ \ \ \
| * | | | | TAS: Record sanitized instead of raw stick inputsMonsterDruide12023-01-011-5/+5
| | |/ / / | |/| | |
* | | | | service: nifm: Initialize request stategerman772023-01-021-0/+1
* | | | | service: nifm: Match documentation namesgerman772023-01-021-31/+56
|/ / / /
* | / / vfs: Replace cstr concat with char concatMerry2023-01-011-3/+3
| |/ / |/| |
* | | Merge pull request #9533 from merryhime/overcommitliamwhite2023-01-011-2/+17
|\ \ \
| * | | host_memory: Use transparent huge pages where availableMerry2023-01-011-0/+15
| * | | host_memory: Allocate virtual_base with MAP_NORESERVEMerry2023-01-011-2/+2
* | | | Merge pull request #9514 from ColinKinloch/en_gbliamwhite2023-01-012-1/+47
|\ \ \ \ | |/ / / |/| | |
| * | | settings: comment language blocklist columnsColin Kinloch2022-12-301-7/+13
| * | | settings: added regon/language warning bounds checkColin Kinloch2022-12-291-1/+1
| * | | settings: warn on invalid regon/language combinationsColin Kinloch2022-12-282-1/+41
* | | | core: hid: emulated_console: Avoid a crash if frontend does not configure touch_from_button_maps.bunnei2022-12-301-0/+5
* | | | Merge pull request #9515 from liamwhite/cmake-refactorbunnei2022-12-304-14/+49
|\ \ \ \
| * | | | cmake: make cubeb and SDL2 optionalLiam2022-12-281-6/+13
| * | | | cmake: make libusb optionalLiam2022-12-282-7/+32
| * | | | cmake: make room server optionalLiam2022-12-281-1/+4
| |/ / /
* | / / config: Save multiplayer settings only globallyWollnashorn2022-12-301-2/+0
| |/ / |/| |
* | | Merge pull request #9423 from vonchenplus/vulkan_quad_stripliamwhite2022-12-298-125/+245
|\ \ \
| * | | video_core: Implement other missing vulkan topologyFengChen2022-12-261-3/+16
| * | | video_core: Implement vulkan QuadStrip topologyFengChen2022-12-268-122/+229
* | | | Merge pull request #9504 from liamwhite/pg2bunnei2022-12-2811-181/+322
|\ \ \ \ | |_|/ / |/| | |
| * | | k_page_table: remove HACK_OpenPages/ClosePagesLiam2022-12-253-58/+54
| * | | k_page_group: synchronizeLiam2022-12-2511-125/+270
| | |/ | |/|
* | | Merge pull request #9490 from ameerj/texture-cache-preallocbunnei2022-12-274-22/+44
|\ \ \
| * | | texture_cache: Use Common::ScratchBuffer for swizzle buffersameerj2022-12-254-10/+12
| * | | texture_cache: Use pre-allocated buffer for texture downloadsameerj2022-12-253-9/+14
| * | | texture_cache: Use pre-allocated buffer for texture uploadsameerj2022-12-254-13/+28
| |/ /
* | | Merge pull request #9495 from german77/no_refreshbunnei2022-12-273-23/+11
|\ \ \
| * | | yuzu: Automatically refresh device listgerman772022-12-243-23/+11
* | | | tests: add missing headerAlexandre Bouvier2022-12-261-0/+1
* | | | TAS: Increase accuracy of Stick inputsMonsterDruide12022-12-251-0/+7
| |/ / |/| |
* | | Merge pull request #9500 from liamwhite/reentrant-shutdownliamwhite2022-12-252-5/+12
|\ \ \
| * | | qt: prevent reentrant shutdownLiam2022-12-242-5/+12
* | | | Merge pull request #9496 from liamwhite/shm3liamwhite2022-12-253-58/+62
|\ \ \ \
| * | | | kernel: workaround static shared memory initializationLiam2022-12-233-58/+62
| | |/ / | |/| |
* | | | Merge pull request #9487 from liamwhite/look-at-the-timeliamwhite2022-12-253-40/+65
|\ \ \ \
| * | | | time: add LockFreeAtomicTypeLiam2022-12-223-40/+65
| |/ / /
* | | | Merge pull request #9453 from ameerj/scratch-vectorFernando S2022-12-2514-56/+370
|\ \ \ \ | |_|/ / |/| | |
| * | | scratch_buffer: Explicitly defing resize and resize_destructive functionsameerj2022-12-207-19/+108
| * | | tests: Add ScratchBuffer testsameerj2022-12-203-5/+137
| * | | dma_pusher: Rework command_headers usageameerj2022-12-202-9/+16
| * | | buffer_cache: Use Common::ScratchBuffer for ImmediateBuffer usageameerj2022-12-201-7/+4
| * | | video_core: Add usages of ScratchBufferameerj2022-12-204-33/+21
| * | | common: Add ScratchBuffer classameerj2022-12-202-0/+75
| * | | common: add make_unique_for_overwriteameerj2022-12-202-0/+26
* | | | qt: fix 'Pause' menu item (#9497)liamwhite2022-12-241-1/+1
* | | | Disable automatically opening the console on windows yuzu-cmd builds (#9485)Chris Oboe2022-12-242-0/+16
* | | | Merge pull request #9476 from liamwhite/async-shutdownliamwhite2022-12-244-15/+65
|\ \ \ \
| * | | | qt: fix uninitialized memory usageLiam2022-12-241-1/+1
| * | | | qt: use main window as close overlay parentLiam2022-12-222-4/+4
| * | | | qt: continue event loop during game closeLiam2022-12-204-14/+64
| | |/ / | |/| |
* / | | qt: exit properly on guest-initiated closeLiam2022-12-222-1/+9
|/ / /
* | | Merge pull request #9463 from liamwhite/manager-eventsliamwhite2022-12-206-173/+65
|\ \ \
| * | | qt: use _exit instead of exit on SIGINTLiam2022-12-171-1/+1
| * | | EmuThread: refactorLiam2022-12-176-172/+64
* | | | Merge pull request #9480 from jbeich/vk-238liamwhite2022-12-201-0/+12
|\ \ \ \ | |_|/ / |/| | |
| * | | externals: update Vulkan-Headers to v1.3.238Jan Beich2022-12-191-0/+12
* | | | Merge pull request #9474 from liamwhite/timerMatías Locatti2022-12-1913-109/+290
|\ \ \ \ | |/ / / |/| | |
| * | | kernel: remove TimeManagerLiam2022-12-1911-117/+33
| * | | kernel: add KHardwareTimerLiam2022-12-186-6/+271
* | | | Merge pull request #9471 from german77/inputliamwhite2022-12-192-206/+83
|\ \ \ \
| * | | | input_common: Cleanup projectgerman772022-12-182-206/+83
* | | | | overlay_dialog: Avoid starting the input thread if non-interactiveMorph2022-12-191-1/+3
* | | | | overlay_dialog: Hide button dialog box when both buttons are hiddenMorph2022-12-191-0/+8
| |/ / / |/| | |
* | | | Merge pull request #9470 from german77/silenceIkillYouliamwhite2022-12-182-2/+2
|\ \ \ \
| * | | | service: nfc: Silence ListDevicesgerman772022-12-182-2/+2
| |/ / /
* | | | Merge pull request #9469 from Rubo3/patch-1liamwhite2022-12-181-1/+1
|\ \ \ \
| * | | | Use execlp instead of execl to avoid failureMarco Rubin2022-12-181-1/+1
| |/ / /
* | | | Merge pull request #9467 from german77/folderliamwhite2022-12-181-0/+3
|\ \ \ \
| * | | | yuzu: Remember last selected directorygerman772022-12-181-0/+3
| |/ / /
* | | | bootmanager: Use proper camera sizegerman772022-12-183-6/+13
* | | | bootmanager: Encapsulate all QCamera codegerman772022-12-182-5/+7
* | | | yuzu: fix device name settinggerman772022-12-181-3/+2
|/ / /
* | | Enable compiler optimizations and enforce x86-64-v2 on GCC/Clang (#9442)Matías Locatti2022-12-181-2/+2
* | | Merge pull request #9456 from german77/virtual_gamepadbunnei2022-12-187-0/+274
|\ \ \ | |/ / |/| |
| * | input_common: Add virtual gamepadgerman772022-12-177-0/+274
* | | Merge pull request #7450 from FernandoS27/ndc-vulkanliamwhite2022-12-178-7/+52
|\ \ \
| * | | Vulkan: Add support for VK_EXT_depth_clip_control.FernandoS272022-12-148-7/+52
* | | | Merge pull request #9461 from liamwhite/wanativeMai2022-12-171-1/+5
|\ \ \ \
| * | | | qt: avoid setting WA_DontCreateNativeAncestors on all platformsLiam2022-12-171-1/+5
| | |/ / | |/| |
* | | | Merge pull request #9454 from liamwhite/wayland-eglMai2022-12-172-3/+7
|\ \ \ \
| * | | | qt: handle wayland-egl platform nameLiam2022-12-162-3/+7
* | | | | Merge pull request #9451 from ameerj/camera-data-arrayliamwhite2022-12-174-9/+12
|\ \ \ \ \
| * | | | | camera: Use pre-allocated vector for camera dataameerj2022-12-174-9/+12
| |/ / / /
* | | | | Merge pull request #9452 from ameerj/hle-read-buffer-resreveliamwhite2022-12-171-8/+6
|\ \ \ \ \
| * | | | | hle_ipc: Refactor ReadBuffer to set buffer size upon initializationameerj2022-12-161-8/+6
| |/ / / /
* | | | | Merge pull request #9455 from Kelebek1/audio_signalliamwhite2022-12-175-7/+26
|\ \ \ \ \
| * | | | | Signal buffer event on audio in/out system stop, and force remove all registered audio buffersKelebek12022-12-165-7/+26
| |/ / / /
* | | | | Merge pull request #9457 from Kelebek1/silence_tfbliamwhite2022-12-171-2/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Remove unimplemented transform feedback geometry spam, it should be implementedKelebek12022-12-161-2/+1
| |/ / /
* | | | Merge pull request #6354 from ogniK5377/device-nameliamwhite2022-12-169-2/+42
|\ \ \ \
| * | | | Set: Allow setting device nicknameChloe Marcec2022-12-149-2/+42
| | |/ / | |/| |
* | | | Merge pull request #9450 from ameerj/hle-ipc-vector-reserveliamwhite2022-12-161-0/+8
|\ \ \ \
| * | | | hle_ipc: Reserve vectors before populatingameerj2022-12-161-0/+8
| | |/ / | |/| |
* | | | Merge pull request #9444 from german77/free_threadsliamwhite2022-12-163-80/+64
|\ \ \ \
| * | | | kernel: svc: Fix duplicated InfoType enumNarr the Reg2022-12-151-90/+47
| * | | | kernel: process: Implement GetFreeThreadCountNarr the Reg2022-12-153-1/+28
* | | | | Merge pull request #8605 from devsnek/graceful-shutdownliamwhite2022-12-163-7/+14
|\ \ \ \ \
| * | | | | emu_thread: properly force shutdown for unresponsive guest programsLiam2022-12-132-12/+5
| * | | | | let games gracefully exitGus Caplan2022-12-133-3/+17
* | | | | | Merge pull request #6769 from lat9nq/create-shortcut-2liamwhite2022-12-165-0/+210
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | main: Address review feedbacklat9nq2022-12-141-19/+33
| * | | | | yuzu qt: Create shortcuts on Linuxlat9nq2022-12-135-0/+196
| | |_|/ / | |/| | |
* | | | | Merge pull request #9431 from liamwhite/sixty-five-oh-twoNarr the Reg2022-12-161-1/+2
|\ \ \ \ \
| * | | | | vulkan_common: declare storageBuffer8BitAccessLiam2022-12-141-1/+2
| |/ / / /
* | | | | Merge pull request #9430 from liamwhite/capableMatías Locatti2022-12-161-0/+2
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | spirv_emit_context: declare GroupNonUniform capability for SubgroupLocalInvocationIdLiam2022-12-141-0/+2
| |/ / /
* | | | Merge pull request #7410 from Nefsen402/wayland-fixesliamwhite2022-12-1515-62/+121
|\ \ \ \
| * | | | gl_device: Use a more robust way to use strict context modeAlexander Orzechowski2022-12-136-8/+17
| * | | | OpenGL: Check for threading supportAlexander Orzechowski2022-12-131-0/+6
| * | | | wayland: Always use exclusive fullscreenAlexander Orzechowski2022-12-132-4/+10
| * | | | RenderWidget: Set WA_DontCreateNativeAncestorsAlexander Orzechowski2022-12-131-0/+1
| * | | | emu_window_sdl2: Respect hidpiAlexander Orzechowski2022-12-131-1/+1
| * | | | video_core/vulkan: Explicity check swapchain size when deciding to recreateAlexander Orzechowski2022-12-133-15/+28
| * | | | renderer_opengl: refactor context acquireLiam2022-12-136-38/+62
| |/ / /
* | | | Revert "hle: service: audio: Use default service thread."bunnei2022-12-143-12/+18
* | | | Merge pull request #6688 from yzct12345/valid-intel-maxliamwhite2022-12-145-2/+34
|\ \ \ \ | |/ / / |/| | |
| * | | Fix validation errors on less compatible Intel GPUyzct123452022-12-135-2/+34
| |/ /
* / / yuzu: Make unlimited frame rate non persistent between game bootsNarr the Reg2022-12-132-2/+3
|/ /
* | Merge pull request #9398 from liamwhite/failbunnei2022-12-125-21/+27
|\ \
| * | general: improve handling of system startup failureLiam2022-12-065-21/+27
* | | Merge pull request #9406 from vonchenplus/topologybunnei2022-12-124-32/+36
|\ \ \
| * | | video_core: Add vertex_array_instance_* sbubbed called warningFengChen2022-12-081-0/+5
| * | | video_core: The draw manager manages whether Clear is required.FengChen2022-12-083-10/+9
| * | | video_core: Adjust topology update logicFengChen2022-12-082-23/+23
* | | | input_common: Filter SDL GUIDNarr the Reg2022-12-121-0/+2
| |_|/ |/| |
* | | Merge pull request #9420 from liamwhite/anisoMai2022-12-121-1/+2
|\ \ \
| * | | video_core: fix off by one in anisotropic filtering amountLiam2022-12-111-1/+2
* | | | Merge pull request #9419 from liamwhite/no-glMai2022-12-111-1/+1
|\ \ \ \
| * | | | cmake: make OpenGL loader optionalLiam2022-12-101-1/+1
| |/ / /
* | | | Merge pull request #9415 from liamwhite/dcMai2022-12-114-102/+15
|\ \ \ \
| * | | | memory: correct semantics of data cache management operationsLiam2022-12-114-102/+15
* | | | | Merge pull request #9409 from liamwhite/smaa2Matías Locatti2022-12-1124-28/+13894
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | video_core: Integrate SMAALiam2022-12-0824-28/+13894
| | |/ / | |/| |
* | | | Merge pull request #9417 from liamwhite/debug-assertMai2022-12-101-2/+0
|\ \ \ \
| * | | | memory: remove DEBUG_ASSERT pointer testLiam2022-12-101-2/+0
| | |/ / | |/| |
* / | | audio_core: remove explicitly defaulted and implicitly deleted constructorsLiam2022-12-102-2/+0
|/ / /
* | | Merge pull request #9412 from Saalvage/fix/trace-log-compilationliamwhite2022-12-091-1/+1
|\ \ \
| * | | Fix compilation errorSalvage2022-12-091-1/+1
| |/ /
* / / Remove the lock entirely as per PR discussionSalvage2022-12-091-3/+0
|/ /
* | Merge pull request #9401 from vonchenplus/draw_managerFernando S2022-12-0812-267/+341
|\ \
| * | video_core: Implement maxwell3d draw manager and split draw logicFeng Chen2022-12-0812-267/+341
* | | Merge pull request #9365 from liamwhite/valMorph2022-12-072-1/+3
|\ \ \
| * | | vulkan_common: quiet some validation errorsLiam2022-12-012-1/+3
* | | | Merge pull request #9370 from liamwhite/break-unmappedmerry2022-12-069-6/+69
|\ \ \ \ | |_|_|/ |/| | |
| * | | core: add option to break on unmapped accessLiam2022-12-029-6/+69
| |/ /
* | | Merge pull request #9393 from liamwhite/more-vulkanFernando S2022-12-062-1/+9
|\ \ \
| * | | vulkan_common: further initialization tweaksLiam2022-12-062-1/+9
* | | | Merge pull request #9392 from lioncash/reporterliamwhite2022-12-062-25/+26
|\ \ \ \
| * | | | reporter: Pass by const reference where applicableLioncash2022-12-062-19/+20
| * | | | reporter: Eliminate undefined behavior in SaveErrorReportLioncash2022-12-062-6/+6
| |/ / /
* | | | Merge pull request #9390 from lioncash/keyboardliamwhite2022-12-0622-100/+89
|\ \ \ \
| * | | | applets/controller: Use aliases for callbacksLioncash2022-12-064-6/+8
| * | | | applets/error: Use aliases for callbacksLioncash2022-12-064-16/+18
| * | | | applets/mii_edit: Use aliases for callbacksLioncash2022-12-062-3/+5
| * | | | applets/profile_select: Use aliases for callbacksLioncash2022-12-064-8/+8
| * | | | applets/web_browser: Use aliases for callbacksLioncash2022-12-064-32/+27
| * | | | applets/software_keyboard: Use aliases for callbacksLioncash2022-12-064-35/+23
| |/ / /
* | | | Merge pull request #9389 from lioncash/emumoveliamwhite2022-12-064-16/+14
|\ \ \ \
| * | | | emulated_controller: Remove unused parameter in GetMappedDevices()Lioncash2022-12-063-5/+3
| * | | | emulated_controller: Use std::move() in GetMappedDevices()Lioncash2022-12-061-6/+6
| * | | | emulated_console: Amend cast in SetTouch()Lioncash2022-12-061-1/+1
| * | | | emulated_console: std::move() ParamPackages and callbacks where applicableLioncash2022-12-061-4/+4
| |/ / /
* | | | Merge pull request #9386 from lioncash/initliamwhite2022-12-066-27/+25
|\ \ \ \
| * | | | kernel/k_shared_memory: Ensure device_memory is always initializedLioncash2022-12-051-1/+1
| * | | | kernel/k_memory_block: Ensure members are always initializedLioncash2022-12-052-22/+20
| * | | | kernel/physical_core: Ensure is_interrupted is always initializedLioncash2022-12-051-1/+1
| * | | | kernel/thread: Ensure stack_top and argument are always initializedLioncash2022-12-051-2/+2
| * | | | kernel/kernel: Ensure shutdown threads are always initializedLioncash2022-12-051-1/+1
* | | | | Merge pull request #9391 from abouvier/cmake-sdlliamwhite2022-12-064-22/+4
|\ \ \ \ \
| * | | | | cmake: use sdl2 imported targetAlexandre Bouvier2022-12-064-22/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #9387 from abouvier/cmake-libusbliamwhite2022-12-061-3/+1
|\ \ \ \ \
| * | | | | cmake: prefer system libusbAlexandre Bouvier2022-12-061-3/+1
* | | | | | configure_graphics: Make SPIRV backend string translatableLioncash2022-12-061-1/+1
|/ / / / /
* | | | | Merge pull request #9369 from german77/mifareliamwhite2022-12-0611-52/+629
|\ \ \ \ \
| * | | | | input_common: Allow mifare filesNarr the Reg2022-12-052-16/+29
| * | | | | service: nfc: Implement mifare serviceNarr the Reg2022-12-029-36/+600
| | |_|/ / | |/| | |
* | | | | Merge pull request #9360 from Kelebek1/R-E-S-P-E-C-Tliamwhite2022-12-061-29/+39
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Respect render mode overrideKelebek12022-11-301-29/+39
* | | | | Merge pull request #6833 from abouvier/unbundleliamwhite2022-12-059-27/+16
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | cmake: prefer system librariesAlexandre Bouvier2022-12-049-27/+16
* | | | | Vulkan: Implement Alpha coverageFernando Sahmkow2022-12-053-2/+6
| |_|_|/ |/| | |
* | | | Merge pull request #9381 from liamwhite/uninitMai2022-12-041-7/+7
|\ \ \ \
| * | | | service_thread: fix uninitialized memory usageLiam2022-12-041-7/+7
* | | | | Merge pull request #9232 from bunnei/audio-default-threadliamwhite2022-12-043-18/+12
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | hle: service: audio: Use default service thread.bunnei2022-11-123-18/+12
* | | | | Merge pull request #9273 from ameerj/per-game-profileliamwhite2022-12-0413-27/+587
|\ \ \ \ \
| * | | | | configure_input_player: Fix profile saving when using handheld controller typeameerj2022-11-291-1/+7
| * | | | | config: Custom profile detection fixesameerj2022-11-296-64/+108
| * | | | | configure_input_per_game: Allow configuring all 8 playersameerj2022-11-293-54/+113
| * | | | | Configuration: Add per-game input profilesameerj2022-11-2011-14/+465
* | | | | | Merge pull request #9372 from liamwhite/vk12liamwhite2022-12-0417-165/+209
|\ \ \ \ \ \
| * | | | | | vulkan_common: add feature test for shaderDrawParametersLiam2022-12-041-1/+13
| * | | | | | vulkan_common: clean up extension usageLiam2022-12-0412-102/+105
| * | | | | | vulkan_common: correct usage of timeline semaphore fallbacksLiam2022-12-041-2/+1
| * | | | | | vulkan_common: ensure all mandatory features are tested in feature reportLiam2022-12-041-1/+24
| * | | | | | vulkan_common: unsuffix 16-bit storage feature test structureLiam2022-12-041-2/+2
| * | | | | | vulkan_common: unsuffix timeline semaphore feature test structureLiam2022-12-041-2/+2
| * | | | | | vulkan_common: add logicOp to feature reportLiam2022-12-041-1/+2
| * | | | | | vulkan_common: promote host query reset usage to coreLiam2022-12-044-11/+12
| * | | | | | vulkan_common: promote descriptor update template usage to coreLiam2022-12-048-37/+36
| * | | | | | vulkan_common: promote timeline semaphore usage to coreLiam2022-12-043-9/+15
| | |_|/ / / | |/| | | |
* / | | | | yuzu-cmd: link SDL2 correctlyLiam2022-12-041-1/+1
|/ / / / /
* | | | | Merge pull request #9374 from liamwhite/externalsliamwhite2022-12-045-21/+23
|\ \ \ \ \
| * | | | | externals: update dynarmic, SDL2Liam2022-12-045-21/+23
* | | | | | Merge pull request #9344 from liamwhite/nullbunnei2022-12-0320-28/+383
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | video_core: add null backendLiam2022-11-2920-28/+383
* | | | | | Merge pull request #9300 from ameerj/pchliamwhite2022-12-0328-4/+157
|\ \ \ \ \ \
| * | | | | | CMake: Consolidate common PCH headersameerj2022-12-0114-84/+29
| * | | | | | string_util: Fix Mingw compile errorameerj2022-12-011-2/+2
| * | | | | | CMake: Disable PCH on MSVC + Buildcache configsameerj2022-11-301-4/+0
| * | | | | | CMake: Use precompiled headersameerj2022-11-3025-1/+214
| * | | | | | value.h: remove recursive includeameerj2022-11-301-1/+0
* | | | | | | Merge pull request #9289 from liamwhite/fruit-companyliamwhite2022-12-0378-37/+949
|\ \ \ \ \ \ \
| * | | | | | | general: fix compile for Apple ClangLiam2022-11-2378-37/+949
* | | | | | | | Merge pull request #9353 from vonchenplus/draw_indexedliamwhite2022-12-032-27/+22
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core: Fine tuning the index drawing judgment logicFeng Chen2022-12-012-27/+22
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9303 from liamwhite/new-vulkan-initMatías Locatti2022-12-0213-101/+191
|\ \ \ \ \ \ \ \
| * | | | | | | | Vulkan: update initializationLiam2022-11-2713-101/+191
* | | | | | | | | Merge pull request #9363 from liamwhite/gsMatías Locatti2022-12-029-6/+230
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | shader_recompiler: add gl_Layer translation GS for older hardwareLiam2022-12-019-6/+230
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9348 from Morph1984/when-the-network-is-downliamwhite2022-12-021-7/+34
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | |
| * | | | | | | | service: nifm: Update stubs for Submit/GetRequestState/GetResultMorph2022-11-291-7/+34
* | | | | | | | | Merge pull request #9320 from yuzu-emu/fix-audio-suspendFernando S2022-11-303-13/+14
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | |
| * | | | | | | | audio_core: sink_stream: Hold the suspend lock when process is stalled.bunnei2022-11-302-7/+9
| * | | | | | | | core: Use atomic instead of a lock to protect is_paused.bunnei2022-11-261-6/+5
* | | | | | | | | Merge pull request #9349 from lat9nq/cmake-322Morph2022-11-303-3/+15
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | CMake: Directly link to SDL2-static when appropriatelat9nq2022-11-293-3/+15
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9308 from lat9nq/from-scratchliamwhite2022-11-302-22/+64
|\ \ \ \ \ \ \ \
| * | | | | | | | startup_checks: Use fmt::print, fix exec error handlinglat9nq2022-11-241-21/+21
| * | | | | | | | startup_checks: Use Windows flow for *nixlat9nq2022-11-242-9/+51
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9322 from german77/pump_eventsliamwhite2022-11-306-10/+35
|\ \ \ \ \ \ \ \
| * | | | | | | | input_common: Pump sdl events from main threadgerman772022-11-276-10/+35
* | | | | | | | | Merge pull request #9352 from lioncash/vidcastliamwhite2022-11-3010-88/+60
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | maxwell_3d: Mark shifted value as unsignedLioncash2022-11-291-3/+3
| * | | | | | | | | engines: Remove unnecessary castsLioncash2022-11-2910-85/+57
* | | | | | | | | | host1x/syncpoint_manager: Eliminate unnecessary std::function constructionLioncash2022-11-291-4/+2
* | | | | | | | | | host1x/syncpoint_manager: Pass DeregisterAction() handle as const-refLioncash2022-11-292-6/+6
* | | | | | | | | | Merge pull request #9340 from lioncash/nvdrvliamwhite2022-11-291-26/+18
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | nvdrv: Simplify builder declarationsLioncash2022-11-281-26/+18
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #9347 from lioncash/vcastliamwhite2022-11-291-11/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core/surface: Eliminate casts in GetFormatType()Lioncash2022-11-291-11/+4
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #9346 from lioncash/vtableliamwhite2022-11-291-0/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | producer_listener: Add virtual destructor to IProducerListenerLioncash2022-11-291-0/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #9345 from lioncash/fenceliamwhite2022-11-296-16/+15
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | buffer_item_consumer: Pass fence by const-ref in ReleaseBuffer()Lioncash2022-11-293-4/+3
| * | | | | | | | | | buffer_queue_consumer: std::move std::shared_ptr in Connect()Lioncash2022-11-291-1/+1
| * | | | | | | | | | consumer_base: Pass shared_ptr by const referenceLioncash2022-11-292-6/+6
| * | | | | | | | | | consumer_base: Remove redundant virtualLioncash2022-11-291-5/+5
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #9343 from lioncash/boundsliamwhite2022-11-292-17/+31
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | syncpoint_manager: Mark IsSyncpointAllocated() as constLioncash2022-11-282-3/+3
| * | | | | | | | | syncpoint_manager: Reduce number of bounds checksLioncash2022-11-281-14/+28
| |/ / / / / / / /
* | | | | | | | | Merge pull request #9339 from lioncash/cacheheaderMorph2022-11-282-4/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common/cache_management: Amend header includesLioncash2022-11-282-4/+3
| |/ / / / / / / /
* | | | | | | | | Merge pull request #9338 from lioncash/propertiesMorph2022-11-282-2/+18
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | input_common/helpers: Mark analog property structs members as static constexprLioncash2022-11-282-2/+18
| |/ / / / / / / /
* | | | | | | | | Merge pull request #9337 from lioncash/pbrMorph2022-11-287-104/+112
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core/hid/emulated_controller: Use ranges version of transformLioncash2022-11-281-19/+15
| * | | | | | | | | common/input: Add helpers functions for creating input and output devicesLioncash2022-11-287-90/+102
| * | | | | | | | | common/input: Pass ParamPackage by const reference in CreateDeviceLioncash2022-11-281-3/+3
| |/ / / / / / / /
* / / / / / / / / yuzu/main: Merge variable declaration into ifdefLioncash2022-11-281-2/+1
|/ / / / / / / /
* | | | | | | | Merge pull request #9325 from german77/default_by_defaultliamwhite2022-11-281-1/+5
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | yuzu-cmd: Fix default config valuegerman772022-11-281-1/+5
* | | | | | | | Merge pull request #8829 from Docteh/qt6_0002liamwhite2022-11-279-14/+56
|\ \ \ \ \ \ \ \
| * | | | | | | | CMake: rework for Qt6 supportKyle Kienapfel2022-11-243-14/+30
| * | | | | | | | qt: Add Qt version to LogRuntimesKyle Kienapfel2022-11-181-0/+1
| * | | | | | | | Qt6: Disable IR Sensor when compiling with Qt6Kyle Kienapfel2022-11-186-0/+25
* | | | | | | | | Merge pull request #9317 from german77/input-crashliamwhite2022-11-273-0/+13
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu-cmd: Fix input callback crash on closegerman772022-11-273-0/+13
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9323 from german77/intructionsliamwhite2022-11-271-3/+26
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | yuzu-cmd: Update configuration file descriptiongerman772022-11-271-3/+26
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9276 from goldenx86/fsrSliderbunnei2022-11-278-1/+200
|\ \ \ \ \ \ \ \
| * | | | | | | | Sharpness instead of SharpeningMatías Locatti2022-11-261-3/+3
| * | | | | | | | configure_graphics: Implement custom FSR Sharpening settinglat9nq2022-11-262-61/+128
| * | | | | | | | settings: Reset FSR sharpening global state with the otherslat9nq2022-11-261-0/+1
| * | | | | | | | FSR Sharpening Slider part 1 - only a global sliderMatías Locatti2022-11-248-1/+132
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | crypto: use user-provided keys whenever possibleValeri2022-11-271-4/+4
* | | | | | | | OopsMatías Locatti2022-11-261-1/+1
* | | | | | | | Replace GLSL as the default OpenGL shader backendMatías Locatti2022-11-261-1/+1
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #9288 from vonchenplus/deferred_drawliamwhite2022-11-262-61/+63
|\ \ \ \ \ \ \
| * | | | | | | video_core: Optimize maxwell drawing trigger mechanismFengChen2022-11-222-61/+63
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9307 from Morph1984/not-used-correctlyliamwhite2022-11-261-3/+3
|\ \ \ \ \ \ \
| * | | | | | | maxwell_to_vk: Add R16_SINTMorph2022-11-241-1/+1
| * | | | | | | maxwell_to_vk: Fix format usage bitsMorph2022-11-241-2/+2
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9297 from Kelebek1/sink_oobliamwhite2022-11-251-6/+8
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | Use the maximum input index for samples buffer span size, not just the input countKelebek12022-11-221-6/+8
* | | | | | | Merge pull request #9304 from liamwhite/menu-rollbunnei2022-11-251-0/+9
|\ \ \ \ \ \ \
| * | | | | | | Qt: assign menuRole properties for actionsLiam2022-11-231-0/+9
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9305 from lioncash/requestbunnei2022-11-2513-72/+78
|\ \ \ \ \ \ \
| * | | | | | | service: Make use of buffer element count helpersLioncash2022-11-2312-47/+41
| * | | | | | | hle_ipc: Add helper functions for getting number of buffer elementsLioncash2022-11-231-0/+12
| * | | | | | | hle_ipc: Mark relevant member functions as [[nodiscard]]Lioncash2022-11-231-25/+25
| |/ / / / / /
* | | | | | | Merge pull request #9194 from FernandoS27/yfc-fermi2dliamwhite2022-11-2521-31/+1832
|\ \ \ \ \ \ \
| * | | | | | | Fermi2D: Cleanup and address feedback.Fernando Sahmkow2022-11-243-8/+150
| * | | | | | | GPU: Implement additional render target formats.Fernando Sahmkow2022-11-247-12/+126
| * | | | | | | MaxwellDMA: Implement BlockLinear to BlockLinear copies.Fernando Sahmkow2022-11-242-1/+69
| * | | | | | | Fermi2D: Implement Bilinear software filtering and address feedback.Fernando Sahmkow2022-11-247-116/+180
| * | | | | | | Fermi2D: Rework blit engine and add a software blitter.Fernando Sahmkow2022-11-2412-18/+1431
| |/ / / / / /
* / / / / / / GPU: Fix buffer cache issue, engine upload not inlining memory in multiline and pessismistic invalidation.Fernando Sahmkow2022-11-244-15/+9
|/ / / / / /
* | | | | | Merge pull request #9299 from lioncash/castliamwhite2022-11-222-15/+18
|\ \ \ \ \ \
| * | | | | | k_handle_table: Remove cast to void* in GetObjectForIpcLioncash2022-11-222-15/+18
| |/ / / / /
* | | | | | Merge pull request #9219 from german77/nfc_implbunnei2022-11-2212-84/+723
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Merge branch 'master' into nfc_implNarr the Reg2022-11-2084-190/+2159
| |\ \ \ \ \
| * | | | | | service: nfc: Implement nfc userNarr the Reg2022-11-1912-84/+723
* | | | | | | qt_amiibo_settings: Use WebClient only if ENABLE_WEB_SERVICE is enabledMorph2022-11-211-0/+4
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #9279 from liamwhite/this-would-have-never-happened-in-rustMorph2022-11-201-1/+1
|\ \ \ \ \ \
| * | | | | | dmnt:cht: fix copy-paste errorLiam2022-11-201-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9216 from vonchenplus/reimp_inline_index_bufferliamwhite2022-11-205-33/+31
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | video_core: Reimplement inline index buffer bindingFeng Chen2022-11-155-33/+31
* | | | | | Merge pull request #9238 from german77/cabinet_appletbunnei2022-11-2020-16/+1310
|\ \ \ \ \ \
| * | | | | | general: Address review commentsgerman772022-11-1414-190/+200
| * | | | | | service: am: Fix cabinet applet resultgerman772022-11-132-10/+22
| * | | | | | yuzu: Implement cabinet applet frontendgerman772022-11-136-1/+865
| * | | | | | service: am: Implement cabinet applet backendgerman772022-11-139-7/+362
| * | | | | | input_common: Add amiibo applet functionsgerman772022-11-133-1/+19
| * | | | | | service: nfc: fix tagprotocol and implement GetApplicationAreaIdgerman772022-11-134-8/+43
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9249 from goldenx86/available-vramMorph2022-11-201-0/+4
|\ \ \ \ \ \
| * | | | | | Update renderer_vulkan.cppMatías Locatti2022-11-161-0/+4
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #9254 from FernandoS27/auto-cpu-fixbunnei2022-11-191-1/+0
|\ \ \ \ \ \
| * | | | | | Dynarmic: Remove inaccurate NaN from Auto CPU settings.Fernando Sahmkow2022-11-171-1/+0
| |/ / / / /
* | | | | | Merge pull request #9191 from german77/touching_soulsliamwhite2022-11-197-52/+123
|\ \ \ \ \ \
| * | | | | | service: hid: Only overclock npad controllersgerman772022-11-192-6/+30
| * | | | | | core: hid: Implement true multitouch supportNarr the Reg2022-11-195-46/+93
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9260 from liamwhite/youre-in-big-trouble-nowFernando S2022-11-191-0/+1
|\ \ \ \ \ \
| * | | | | | spirv_emit_context: add missing flat decorationLiam2022-11-191-0/+1
* | | | | | | Merge pull request #9252 from liamwhite/radv-superioritybunnei2022-11-198-13/+27
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | maxwell3d: full HLE for multi-layer clearsLiam2022-11-178-24/+17
| * | | | | | maxwell3d: HLE multi-layer clear macroLiam2022-11-172-1/+22
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #9253 from vonchenplus/attr_layerliamwhite2022-11-195-0/+13
|\ \ \ \ \ \
| * | | | | | shader: Implement miss attribute layerFengChen2022-11-175-0/+13
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #9234 from liamwhite/data-cash-moneybunnei2022-11-187-8/+214
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | kernel: implement FlushProcessDataCacheLiam2022-11-124-8/+125
| * | | | | common: add cache management functionsLiam2022-11-123-0/+89
* | | | | | Merge pull request #9244 from liamwhite/lost-wakeupbunnei2022-11-184-12/+16
|\ \ \ \ \ \
| * | | | | | nvnflinger: fix lost wakeupLiam2022-11-154-12/+16
* | | | | | | Merge pull request #9229 from Docteh/achy_breaky_heartMorph2022-11-1823-6/+37
|\ \ \ \ \ \ \
| * | | | | | | Add break for default casesKyle Kienapfel2022-11-1424-6/+38
* | | | | | | | Merge pull request #9228 from HidroSaphire/patch-1liamwhite2022-11-181-0/+1
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | Add break statement in default caseEnrico Mancuso2022-11-111-0/+1
| |/ / / / / /
* | | | | | | configure_profile_manager: Cleanup reference/pointer usagelat9nq2022-11-162-8/+10
* | | | | | | configure_profile_manager: Remove profile picture borderlat9nq2022-11-161-0/+6
* | | | | | | configure_profile_manager: Use a custom dialog for deletionlat9nq2022-11-162-11/+81
* | | | | | | Merge pull request #9243 from german77/resultbunnei2022-11-151-1/+75
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | core: Update result moduleNarr the Reg2022-11-151-1/+75
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #9225 from liamwhite/debugger-instanceliamwhite2022-11-134-68/+248
|\ \ \ \ \ \
| * | | | | | gdbstub: add ams monitor commandsLiam2022-11-113-0/+155
| * | | | | | debugger: allow more than one connection attempt per sessionLiam2022-11-101-68/+93
* | | | | | | Ignore ARM for core countMatías Locatti2022-11-121-2/+1
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #9226 from Kelebek1/regs_regressionbunnei2022-11-126-5/+32
|\ \ \ \ \ \
| * | | | | | Fix regs regression with OpenGL two-sided stencil, and re-add data invalidation regKelebek12022-11-116-5/+32
* | | | | | | Merge pull request #9224 from liamwhite/services-arent-processesbunnei2022-11-122-29/+13
|\ \ \ \ \ \ \
| * | | | | | | service_thread: remove explicit KProcessLiam2022-11-102-29/+13
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9231 from goldenx86/corecountMai2022-11-123-3/+64
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | Add CPU core count to log filesMatías Locatti2022-11-123-3/+64
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #9204 from vonchenplus/dma_copy_1d_random_crashliamwhite2022-11-111-17/+20
|\ \ \ \ \ \
| * | | | | | video_core: Fix dma copy 1D random crashFengChen2022-11-101-17/+20
* | | | | | | Merge pull request #9133 from FearlessTobi/compat-improvementsliamwhite2022-11-115-71/+404
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | yuzu/main: Change to 8_GiB instead of magic numberTobias2022-11-111-1/+1
| * | | | | | yuzu/compatdb: Rework compatibility submission systemFearlessTobi2022-11-105-71/+404
* | | | | | | Merge pull request #9167 from vonchenplus/tessliamwhite2022-11-1118-6/+63
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | video_core: Fix few issues in Tess stageFengChen2022-11-0718-6/+63
* | | | | | | Merge pull request #9223 from goldenx86/threadcountbunnei2022-11-111-0/+2
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | Me likesMatías Locatti2022-11-101-1/+1
| * | | | | | Add CPU thread count to log filesMatías Locatti2022-11-101-0/+2
* | | | | | | ir/texture_pass: Use host_info instead of querying Settings::values (#9176)Morph2022-11-1112-16/+23
* | | | | | | Merge pull request #9198 from liamwhite/arm64bunnei2022-11-1111-24/+57
|\ \ \ \ \ \ \
| * | | | | | | Initial ARM64 supportLiam2022-11-0911-24/+57
* | | | | | | | Merge pull request #9180 from Docteh/remove_stuffMai2022-11-112-20/+33
|\ \ \ \ \ \ \ \
| * | | | | | | | UI: split up strings relating to content removalKyle Kienapfel2022-11-052-20/+33
* | | | | | | | | Merge pull request #9217 from HidroSaphire/patch-1Mai2022-11-111-0/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Add break statement in default casesEnrico Mancuso2022-11-091-0/+1
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9192 from german77/i_had_to_copy_each_one_againbunnei2022-11-101-217/+120
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | |
| * | | | | | | | yuzu: Change QtKeyToSwitchKey switch case to arraygerman772022-11-071-217/+120
* | | | | | | | | kernel/svc_types: refreshLiam2022-11-1019-137/+563
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | Merge pull request #9182 from liamwhite/services-are-processesbunnei2022-11-105-25/+56
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | service_thread: register service threads to the logical owner processLiam2022-11-045-20/+39
| * | | | | | | kernel: avoid racy behavior in global suspensionLiam2022-11-041-5/+17
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9215 from liamwhite/swordfightFernando S2022-11-092-3/+9
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | Ensure correctness of atomic store orderingLiam2022-11-092-3/+9
| | |_|_|_|/ | |/| | | |
* / | | | | service_thread: fix deletionLiam2022-11-074-39/+33
|/ / / / /
* | | / / video_core:Fix vmm kinds size errorFengChen2022-11-061-1/+1
| |_|/ / |/| | |
* | | | Merge pull request #9163 from vonchenplus/draw_errorFernando S2022-11-061-32/+25
|\ \ \ \
| * | | | video_core: Fix drawing trigger mechanism regressionFengChen2022-10-311-32/+25
* | | | | Merge pull request #9173 from bunnei/kern-update-15liamwhite2022-11-0538-737/+2786
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | core: hle: kernel: Address review comments.Liam2022-11-052-2/+2
| * | | | core: hle: kernel: k_page_table: Remove unnecessary casts.bunnei2022-11-041-17/+8
| * | | | core: hle: kernel: k_page_table: Manually open/close pages for IPC methods.bunnei2022-11-041-0/+18
| * | | | core: hle: kernel: k_page_table: Implement IPC memory methods.bunnei2022-11-043-3/+910
| * | | | core: hle: kernel: k_memory_manager: Refresh.bunnei2022-11-044-369/+460
| * | | | core: hle: kernel: Integrate system KSystemResource.bunnei2022-11-047-69/+209
| * | | | core: hle: kernel: k_dynamic_page_manager: Refresh.bunnei2022-11-041-17/+50
| * | | | core: hle: kernel: Add KSystemResource.bunnei2022-11-045-1/+173
| * | | | core: hle: kernel: k_handle_table: Refresh.bunnei2022-11-042-54/+87
| * | | | core: hle: kernel: k_memory_layout: Refresh.bunnei2022-11-043-12/+23
| * | | | core: hle: kernel: k_memory_region_type: Refresh.bunnei2022-11-041-49/+74
| * | | | core: hle: kernel: slab_helpers: Add KAutoObjectWithSlabHeap.bunnei2022-11-041-0/+78
| * | | | core: hle: kernel: k_dynamic_resource_manager: Add KBlockInfoManager, KBlockInfoSlabHeap.bunnei2022-11-041-0/+3
| * | | | core: hle: kernel: k_page_bitmap: Refresh.bunnei2022-11-041-88/+155
| * | | | core: hle: kernel: k_memory_block: Refresh.bunnei2022-11-042-48/+66
| * | | | core: hle: kernel: k_page_heap: Refresh.bunnei2022-11-042-17/+108
| * | | | core: hle: kernel: k_page_group: Add KPageBufferSlabHeap.bunnei2022-11-041-0/+86
| * | | | core: hle: kernel: k_system_control: Add SecureAppletMemorySize.bunnei2022-11-041-0/+4
| * | | | core: hle: kernel: k_page_buffer: Add KPageBufferSlabHeap.bunnei2022-11-041-3/+11
| * | | | core: hle: kernel: Add KPageTableManager.bunnei2022-11-042-0/+56
| * | | | core: hle: kernel: Add KPageTableSlabHeap.bunnei2022-11-042-0/+94
| * | | | core: hle: kernel: Add KEventInfo.bunnei2022-11-044-1/+102
| * | | | core: hle: kernel: Add KDebug.bunnei2022-11-042-0/+21
| * | | | core: hle: result: Fix code for compilers.bunnei2022-11-041-6/+7
* | | | | Merge pull request #9189 from vonchenplus/stupidMorph2022-11-051-4/+4
|\ \ \ \ \
| * | | | | video_core: Fix scaling graphical regressions for multiple gamesFengChen2022-11-051-4/+4
* | | | | | Merge pull request #9181 from jbeich/freebsd-qt-parityMai2022-11-043-17/+17
|\ \ \ \ \ \
| * | | | | | Qt: enable recent Linux features on more UnicesJan Beich2022-11-043-17/+17
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #9178 from jbeich/freebsd-includeMai2022-11-041-0/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | network: add missing header for SO_* on Unix after f80c7c4cd5c0Jan Beich2022-11-041-0/+4
| |/ / / /
* / / / / Update shader cache version. (#9175)gidoly2022-11-041-1/+1
|/ / / /
* | | | video_core: Fix SNORM texture buffer emulating error (#9001)Feng Chen2022-11-0423-52/+224
* | | | UI: Add options to hide extra columns (#9093)Piplup2022-11-045-1/+31
* | | | Merge pull request #8858 from vonchenplus/mipmapbunnei2022-11-0429-8/+259
|\ \ \ \
| * \ \ \ Merge branch 'master' into mipmapFeng Chen2022-09-20157-1773/+3064
| |\ \ \ \
| * | | | | video_core: Generate mipmap texture by drawingFengChen2022-09-2029-8/+259
* | | | | | Merge pull request #9135 from liamwhite/service-thread-eventbunnei2022-11-0422-335/+438
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | sm:: avoid excessive port recreationLiam2022-10-313-18/+24
| * | | | | kernel: fix single core for service threadsLiam2022-10-311-1/+2
| * | | | | kernel: fix port trackingLiam2022-10-315-49/+4
| * | | | | k_server_session: add SendReplyHLELiam2022-10-313-5/+6
| * | | | | service_thread: convert to map for session managementLiam2022-10-311-23/+21
| * | | | | kernel: invert session request handling flowLiam2022-10-3122-279/+421
* | | | | | Merge pull request #9154 from liamwhite/new-fbFernando S2022-11-042-1/+10
|\ \ \ \ \ \
| * | | | | | vk_blit_screen: recreate swapchain images on guest format changeLiam2022-10-302-1/+10
* | | | | | | Merge pull request #9097 from liamwhite/intel-spv-compilerMorph2022-11-044-14/+19
|\ \ \ \ \ \ \
| * | | | | | | video_core: don't build ASTC decoder shader unless requestedLiam2022-10-204-14/+19
* | | | | | | | core: hle: service: acc: Fix ListOpenContextStoredUsers/StoreOpenContext.bunnei2022-11-035-23/+42
* | | | | | | | remove unnecessary sepator in file menu (main.ui)Ludovic2022-11-021-1/+0
* | | | | | | | Merge pull request #9143 from K0bin/scheduler-emptyliamwhite2022-11-011-3/+1
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | vk_scheduler: Remove recorded_countsRobin Kertels2022-10-281-3/+1
* | | | | | | | Merge pull request #9159 from liamwhite/kborkbunnei2022-10-312-13/+27
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | |
| * | | | | | | kernel: more complete fix for KPort reference countingLiam2022-10-312-13/+27
* | | | | | | | Merge pull request #9155 from FernandoS27/goosfrababunnei2022-10-311-6/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Vulkan: Fix regression caused by limiting render area to width/height of rendef targets.Fernando Sahmkow2022-10-301-6/+6
| | |_|/ / / / | |/| | | | |
* / | | | | | k_thread: fix single coreLiam2022-10-301-2/+4
|/ / / / / /
* | | | | | Merge pull request #9151 from liamwhite/dram-sizeMorph2022-10-301-1/+8
|\ \ \ \ \ \
| * | | | | | kernel: reinitialize after dram layout changeLiam2022-10-301-1/+8
* | | | | | | Merge pull request #9091 from Docteh/what_compat_listliamwhite2022-10-305-0/+17
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | UI: Add option to hide the compatibility listKyle Kienapfel2022-10-195-0/+17
* | | | | | | Merge pull request #9149 from german77/volumbunnei2022-10-302-1/+13
|\ \ \ \ \ \ \
| * | | | | | | service: am: Stub SetRecordVolumeMutedgerman772022-10-302-1/+13
* | | | | | | | k_server_session: fix crashesLiam2022-10-302-2/+1
* | | | | | | | Merge pull request #9137 from liamwhite/hbmenubunnei2022-10-308-10/+45
|\ \ \ \ \ \ \ \
| * | | | | | | | nvnflinger: release queued handles immediately on disconnectionLiam2022-10-274-6/+17
| * | | | | | | | vi: implement CloseDisplayLiam2022-10-274-4/+28
* | | | | | | | | Merge pull request #9140 from vonchenplus/darw_index_bufferx_first_errorbunnei2022-10-302-61/+70
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | video_core: Fix drawing trigger mechanism regressionFengChen2022-10-272-61/+70
| |/ / / / / / /
* | | | | | | | Merge pull request #9127 from vonchenplus/vulkan_clearbunnei2022-10-281-8/+13
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | video_core: Catch vulkan clear op not all channel need clearFengChen2022-10-251-8/+13
* | | | | | | | Merge pull request #9138 from liamwhite/hbl-stacktraceliamwhite2022-10-282-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | arm_interface: curb infinite recursion in stacktrace generationLiam2022-10-272-2/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9115 from vonchenplus/game_name_by_languagebunnei2022-10-272-12/+37
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys: Priority display of game titles in the current languageFengChen2022-10-242-12/+37
* | | | | | | | | Merge pull request #9126 from vonchenplus/revert-8068-shader-if-falsebunnei2022-10-273-98/+9
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Revert "shader_recompiler/dead_code_elimination: Add DeadBranchElimination pass"Feng Chen2022-10-253-98/+9
* | | | | | | | | | Merge pull request #9134 from lioncash/initliamwhite2022-10-276-8/+8
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | audio_in/out_system: Pass Initialize members by value where applicableLioncash2022-10-266-8/+8
* | | | | | | | | | Merge pull request #9125 from liamwhite/dummy-schedulerbunnei2022-10-265-26/+76
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel: refactor dummy thread wakeupsLiam2022-10-255-26/+76
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | concepts: Use the std::contiguous_iterator conceptMorph2022-10-263-20/+10
* | | | | | | | | Merge pull request #9128 from abouvier/patch-1liamwhite2022-10-251-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | tests: fix for -WallAlexandre Bouvier2022-10-251-1/+1
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9113 from german77/peer_pressureliamwhite2022-10-258-12/+26
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core: hid: Add handheld to nfc devicesgerman772022-10-221-0/+1
| * | | | | | | | | service: nfp: Allow amiibos without keysNarr the Reg2022-10-223-1/+18
| * | | | | | | | | service: nfp: remove unnecessary includeNarr the Reg2022-10-225-11/+7
* | | | | | | | | | Merge pull request #9107 from german77/gidoly_rulesliamwhite2022-10-2510-57/+93
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | input_common: cache vibration testsgerman772022-10-2110-57/+93
| |/ / / / / / / /
* | | | | | | | | Merge pull request #9112 from vonchenplus/deferred_drawliamwhite2022-10-2510-232/+203
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ |/| | | | | | | |
| * | | | | | | | video_core: Implement maxwell inline_index methodFengChen2022-10-226-74/+130
| * | | | | | | | video_coare: Reimplementing the maxwell drawing trigger mechanismFengChen2022-10-2110-224/+139
| |/ / / / / / /
* | | | | | | | Merge pull request #9119 from liamwhite/shutdown-barrierliamwhite2022-10-256-7/+26
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | core: barrier service thread shutdownLiam2022-10-236-7/+26
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #8873 from vonchenplus/fix_legacy_location_errorbunnei2022-10-245-19/+35
|\ \ \ \ \ \ \
| * | | | | | | Address feedbackFengChen2022-10-171-6/+6
| * | | | | | | video_core: Fix legacy to generic location unpairedFengChen2022-09-205-15/+31
* | | | | | | | Merge pull request #9122 from liamwhite/burnt-chickenFernando S2022-10-242-4/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | nvdrv: fix container destruction orderLiam2022-10-242-4/+4
| | |/ / / / / / | |/| | | | | |
* | | | | | | | CMakeLists: Disable -Wbraced-scalar-init on ClangMorph2022-10-221-0/+1
* | | | | | | | yuzu: Resolve -Wpessimizing-moveMorph2022-10-221-1/+1
* | | | | | | | startup_checks: Resolve -Wstringop-truncationMorph2022-10-221-1/+2
* | | | | | | | startup_checks: Resolve -WformatMorph2022-10-221-7/+7
* | | | | | | | general: Resolve -Wunused-but-set-variableMorph2022-10-221-2/+2
* | | | | | | | general: Resolve -Wunused-lambda-capture and C5233Morph2022-10-224-29/+24
* | | | | | | | general: Resolve -Wclass-memaccessMorph2022-10-223-3/+3
* | | | | | | | ipc_helpers: Ignore GCC compiler warnings only on GCCMorph2022-10-221-2/+2
* | | | | | | | CMakeLists: Enforce C5233 on MSVCMorph2022-10-221-0/+1
* | | | | | | | CMakeLists: Disable C4100 and C4324Morph2022-10-224-17/+3
* | | | | | | | CMakeLists: Remove redundant warningsMorph2022-10-224-12/+0
* | | | | | | | decoders: Use 2's complement instead of unary -Morph2022-10-221-1/+1
* | | | | | | | CMakeLists: Treat MSVC warnings as errorsMorph2022-10-224-3/+2
* | | | | | | | general: Enforce C4800 everywhere except in video_coreMorph2022-10-2214-41/+57
* | | | | | | | CMakeLists: Remove all redundant warningsMorph2022-10-227-45/+4
* | | | | | | | CMakeLists: Consolidate all unused warnings into -WunusedMorph2022-10-221-3/+3
* | | | | | | | CMakeLists: Treat -Wall and -Wextra as errorsMorph2022-10-221-3/+3
|/ / / / / / /
* | | | | | | Merge pull request #9095 from FernandoS27/meat-good-vegetable-badFernando S2022-10-222-13/+9
|\ \ \ \ \ \ \
| * | | | | | | Maxwell3D/Puller: Fix regressions and syncing issues.Fernando Sahmkow2022-10-192-13/+9
* | | | | | | | Merge pull request #9106 from lioncash/copy-errliamwhite2022-10-211-2/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | hid/npad: Fix copy size in GetSupportedNpadIdTypesLioncash2022-10-211-2/+3
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9108 from Morph1984/r32-b24g8liamwhite2022-10-211-0/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | format_lookup_table: Implement R32_B24G8 with D32_FLOAT_S8_UINTMorph2022-10-211-0/+2
| |/ / / / / / /
* | | | | | | | k_session_request: Add missing override specifierLioncash2022-10-211-1/+1
* | | | | | | | k_session_request: Turn C-style array into std::arrayLioncash2022-10-211-1/+3
* | | | | | | | k_session_request: Simplify constructor initializationLioncash2022-10-211-14/+11
|/ / / / / / /
* | | | | | | Merge pull request #9078 from liamwhite/session-requestliamwhite2022-10-2117-200/+608
|\ \ \ \ \ \ \
| * | | | | | | kernel: remove most SessionRequestManager handling from KServerSessionLiam2022-10-196-138/+119
| * | | | | | | kernel: add KSessionRequestLiam2022-10-1913-62/+489
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9099 from Docteh/undockedliamwhite2022-10-211-1/+1
|\ \ \ \ \ \ \
| * | | | | | | Controller Applet had instance of Undocked, make HandheldKyle Kienapfel2022-10-201-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #9096 from Kelebek1/audio_15bunnei2022-10-205-33/+114
|\ \ \ \ \ \ \
| * | | | | | | Update audio_core for firmware 15.0.0Kelebek12022-10-195-33/+114
* | | | | | | | Merge pull request #9094 from lioncash/fixedliamwhite2022-10-202-115/+80
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | fixed_point: Mark default constructor as constexprLioncash2022-10-181-2/+2
| * | | | | | | fixed_point: Mark copy/move assignment operators and constructors as constexprLioncash2022-10-181-3/+6
| * | | | | | | fixed_point: Mark std::swap and move constructor as noexceptLioncash2022-10-181-2/+2
| * | | | | | | fixed_point: Mark relevant member function [[nodiscard]]Lioncash2022-10-181-14/+14
| * | | | | | | fixed_point: Make to_uint() non-constLioncash2022-10-181-2/+2
| * | | | | | | fixed_point: Use defaulted comparisonsLioncash2022-10-181-23/+1
| * | | | | | | fixed_point: Use variable templates and concepts where applicableLioncash2022-10-182-72/+56
| |/ / / / / /
* | | | | | | Merge pull request #9082 from Morph1984/futureliamwhite2022-10-193-13/+59
|\ \ \ \ \ \ \
| * | | | | | | savedata_factory: Detect future save data pathsMorph2022-10-173-13/+59
* | | | | | | | Merge pull request #9083 from liamwhite/take-a-chance-on-meliamwhite2022-10-191-10/+17
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel: fix slab heap ABALiam2022-10-171-10/+17
| |/ / / / / / /
* | | | | | | | Merge pull request #9071 from bunnei/mp-mmliamwhite2022-10-1941-1239/+2441
|\ \ \ \ \ \ \ \
| * | | | | | | | core: hle: kernel: Migrate ProcessState to enum class.bunnei2022-10-192-17/+17
| * | | | | | | | core: Initialize: Add missing braces.bunnei2022-10-191-2/+4
| * | | | | | | | core: core_timing: Re-initialize if single/multicore state changes.bunnei2022-10-193-14/+36
| * | | | | | | | core: core_timing: Remove unused IsHostTiming.bunnei2022-10-191-5/+0
| * | | | | | | | core: hle: kernel: Use result macros for new/changed code.bunnei2022-10-199-128/+110
| * | | | | | | | core: Partially persist emulation state across game boots.bunnei2022-10-198-58/+65
| * | | | | | | | core: hle: kernel: Fix InitializePreemption order.bunnei2022-10-191-1/+1
| * | | | | | | | core: hle: kernel: k_process: Improve management of page table & cleanup.bunnei2022-10-197-60/+92
| * | | | | | | | core: hle: kernel: k_interrupt_manager: HandleInterrupt should not depend on current process.bunnei2022-10-191-12/+9
| * | | | | | | | core: hle: kernel: Remove junk.bunnei2022-10-191-9/+0
| * | | | | | | | core: hle: kernel: k_page_table: Impl. LockForUn/MapDeviceAddressSpace, cleanup.bunnei2022-10-193-545/+624
| * | | | | | | | video_core: renderer_vulkan: vk_query_cache: Avoid shutdown crash in QueryPool::Reserve.bunnei2022-10-191-3/+4
| * | | | | | | | core: hle: kernel: Integration application memory block slab manager.bunnei2022-10-193-3/+44
| * | | | | | | | core: hle: kernel: k_page_table: Update, and integrate with new KMemoryBlockManager/SlabManager.bunnei2022-10-192-251/+393
| * | | | | | | | core: hle: kernel: k_memory_block: Update.bunnei2022-10-192-119/+391
| * | | | | | | | core: hle: kernel: k_memory_block_manager: Update.bunnei2022-10-192-174/+380
| * | | | | | | | core: hle: kernel: k_thread: Implement thread termination DPC.bunnei2022-10-195-1/+99
| * | | | | | | | core: hle: kernel: Add KDynamicResourceManager.bunnei2022-10-192-0/+59
| * | | | | | | | core: hle: kernel: Add KDynamicSlabHeap.bunnei2022-10-192-0/+123
| * | | | | | | | core: hle: kernel: Add KDynamicPageManager.bunnei2022-10-192-0/+137
| * | | | | | | | core: hle: kernel: k_process: Change Status -> State.bunnei2022-10-193-37/+27
| * | | | | | | | core: hle: kernel: svc_types: Add SystemThreadPriorityHighest and ProcessState.bunnei2022-10-191-0/+13
| * | | | | | | | core: device_memory: Templatize GetPointer(..).bunnei2022-10-199-19/+21
| * | | | | | | | core: hle: result: Add GetInnerValue and Includes methods.bunnei2022-10-191-0/+8
| * | | | | | | | core: hle: kernel: svc_common: Add WaitInfinite & cleanup.bunnei2022-10-191-2/+5
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9084 from vonchenplus/dma_copyFernando S2022-10-197-73/+415
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | video_core: implement 1D copies based on VMM 'kind'FengChen2022-10-172-56/+73
| * | | | | | | video_core: Implement memory manager page kindFengChen2022-10-175-17/+342
* | | | | | | | Merge pull request #9054 from Docteh/just_lz4bunnei2022-10-181-1/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | CMake: Try add library "LZ4::lz4_shared" if "lz4::lz4" is unavailableKyle Kienapfel2022-10-141-1/+5
| |/ / / / / / /
* | | | | | | | Merge pull request #9087 from Morph1984/oncebunnei2022-10-182-54/+45
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | fixed_point: Replace CONSTEXPR14 with constexprMorph2022-10-171-50/+42
| * | | | | | | general: Add missing pragma onceMorph2022-10-172-4/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #9079 from Morph1984/unknown-unkownsMorph2022-10-175-18/+18
|\ \ \ \ \ \ \
| * | | | | | | video_core: Fix spelling of "synchronize"Morph2022-10-162-5/+5
| * | | | | | | general: Fix spelling of "unknown"Morph2022-10-163-13/+13
| |/ / / / / /
* | | | | | | sdl2_sink: Inline variable init into if conditionlat9nq2022-10-171-2/+1
* | | | | | | sdl2_sink: Distinguish between capture and non-capture device nameslat9nq2022-10-161-1/+1
* | | | | | | sdl2_sink: Check for null string when loading SDL audio deviceslat9nq2022-10-161-1/+4
|/ / / / / /
* | | | | | fix a tiny spelling mistakeKyle Kienapfel2022-10-151-1/+1
* | | | | | Merge pull request #9061 from liamwhite/writable-eventliamwhite2022-10-1437-232/+151
|\ \ \ \ \ \
| * | | | | | kernel: remove KWritableEventLiam2022-10-1337-232/+151
* | | | | | | Merge pull request #9055 from liamwhite/hblliamwhite2022-10-1415-55/+572
|\ \ \ \ \ \ \
| * | | | | | | k_server_session: preliminary support for userspace server sessionsLiam2022-10-129-49/+346
| * | | | | | | Add implementation of svcCreateSessionLiam2022-10-122-1/+103
| * | | | | | | general: preliminary support for hblLiam2022-10-126-6/+124
* | | | | | | | audio_core: Revert sink name to sdl2Narr the Reg2022-10-141-2/+2
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #9067 from Morph1984/tess-cwliamwhite2022-10-143-6/+6
|\ \ \ \ \ \ \
| * | | | | | | renderer_(opengl/vulkan): Fix tessellation clockwise parameterMorph2022-10-133-6/+6
* | | | | | | | Merge pull request #9039 from Kelebek1/auto_backendliamwhite2022-10-147-32/+95
|\ \ \ \ \ \ \ \
| * | | | | | | | Choose the SDL audio backend when Cubeb reports too high of a latencyKelebek12022-10-097-32/+95
* | | | | | | | | Merge pull request #9032 from liamwhite/stub-friendsliamwhite2022-10-141-1/+12
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | IFriendService: stub CheckFriendListAvailabilityLiam2022-10-081-1/+12
* | | | | | | | | | Merge pull request #9065 from liamwhite/result-messMai2022-10-131-4/+3
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | result: enforce reference check specializationLiam2022-10-131-4/+3
* | | | | | | | | | settings: Update aspect_ratio rangeMorph2022-10-131-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #9034 from liamwhite/result-macrosbunnei2022-10-131-6/+114
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | kernel: add expanded result macrosLiam2022-10-081-6/+114
| |/ / / / / / /
* | | | | | | | Merge pull request #9027 from yuzu-emu/revert-8987-another-name-for-reinforcement-steelbunnei2022-10-132-60/+27
|\ \ \ \ \ \ \ \
| * | | | | | | | Revert "vulkan: automatically use larger staging buffer sizes when possible"liamwhite2022-10-072-60/+27
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9040 from liamwhite/woe-thirty-twobunnei2022-10-131-0/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | core_timing: use high-precision sleeps on non-Windows targetsLiam2022-10-091-0/+4
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9024 from liamwhite/async-screenshotbunnei2022-10-121-1/+7
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core: don't block rendering on screenshotsLiam2022-10-071-1/+7
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #9047 from german77/steam-aspectbunnei2022-10-123-0/+8
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu: Add 16:10 aspect ratioNarr the Reg2022-10-103-0/+8
* | | | | | | | | Merge pull request #9049 from liamwhite/monkeyhawkbunnei2022-10-121-1/+11
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | syncpoint_manager: ensure handle is removable before removingLiam2022-10-111-1/+11
| | |_|_|/ / / / | |/| | | | | |
* / | | | | | | Fix stencil func registers, make clip control equivalent to how it was before, but surely wrong.Kelebek12022-10-108-44/+51
|/ / / / / / /
* | | | | | | Merge pull request #9043 from german77/vector_dataliamwhite2022-10-093-6/+19
|\ \ \ \ \ \ \
| * | | | | | | input_common: have an unique vector in callback statusgerman772022-10-093-6/+19
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8766 from Kelebek1/regsFernando S2022-10-0929-2043/+3974
|\ \ \ \ \ \ \
| * | | | | | | Update 3D regsKelebek12022-10-0729-2043/+3974
| | |_|/ / / / | |/| | | | |
* | | | | | | fsp_srv: stub GetCacheStorageSizeLiam2022-10-082-1/+14
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #9016 from liamwhite/drunken-scheduleMai2022-10-081-2/+4
|\ \ \ \ \ \
| * | | | | | vk_scheduler: wait for command processing to completeLiam2022-10-041-2/+4
* | | | | | | Merge pull request #9030 from Morph1984/api-disableMai2022-10-081-3/+4
|\ \ \ \ \ \ \
| * | | | | | | configure_graphics: Fix graphics API selection when a game is runningMorph2022-10-071-3/+4
* | | | | | | | Merge pull request #8807 from Docteh/default_fontsliamwhite2022-10-071-0/+16
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Qt: work around Qt5's font choice for ChineseKyle Kienapfel2022-10-021-0/+16
* | | | | | | | nfp_types: silence -Wtype-limitsLiam2022-10-071-1/+1
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #6142 from lat9nq/prog_meta_ref_bind_addressbunnei2022-10-072-15/+51
|\ \ \ \ \ \ \
| * | | | | | | program_metadata: Unpack FileAccessHeader and FileAccessControllat9nq2022-02-132-15/+51
* | | | | | | | Merge pull request #8944 from Tachi107/patch-2bunnei2022-10-071-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | build(room): simplify yuzu-room installationAndrea Pappacoda2022-09-221-1/+1
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | vulkan_blitter: Fix pool allocation double free.Byte2022-10-063-25/+10
* | | | | | | | maxwell_dma: remove warnings from implemented functionalityLiam2022-10-061-2/+0
* | | | | | | | General: address feedbackFernando Sahmkow2022-10-0630-165/+167
* | | | | | | | state_tracker: workaround channel setup for homebrewLiam2022-10-065-4/+9
* | | | | | | | general: rework usages of UNREACHABLE macroLiam2022-10-063-27/+28
* | | | | | | | nvdisp: End system frame after requesting to swap buffersMorph2022-10-061-1/+1
* | | | | | | | address_space: Rename va_start to virt_startMorph2022-10-062-5/+5
* | | | | | | | address_space: Address feedbackMorph2022-10-063-195/+237
* | | | | | | | general: Format licenses as per SPDX guidelinesMorph2022-10-0638-121/+93
* | | | | | | | NvHostChannels: improve hack for supporting multiple channels.Fernando Sahmkow2022-10-062-2/+11
* | | | | | | | Address Feedback from bylaws.Fernando Sahmkow2022-10-063-7/+3
* | | | | | | | Nvflinger: correct duplication.Fernando Sahmkow2022-10-064-5/+5
* | | | | | | | Core: Fix get nvmap object random crashVonChenPlus2022-10-0612-35/+66
* | | | | | | | General: Fix clang format.Fernando Sahmkow2022-10-067-18/+14
* | | | | | | | Common: Fix variable shadowing.Fernando Sahmkow2022-10-061-5/+5
* | | | | | | | Vulkan Swapchain: Overall improvements.Fernando Sahmkow2022-10-063-6/+17
* | | | | | | | NvDec: Fix regressions.Fernando Sahmkow2022-10-066-5/+31
* | | | | | | | Vulkan Texture Cache: Limit render area to the max width/height of the targets.Fernando Sahmkow2022-10-064-9/+29
* | | | | | | | ImageBase: Basic fixes.Fernando Sahmkow2022-10-061-8/+5
* | | | | | | | General: Fix compilation for GCCLiam White2022-10-0616-42/+56
* | | | | | | | VideoCore: Implement formats needed for N64 emulation.Fernando Sahmkow2022-10-066-10/+10
* | | | | | | | Buffer Cache: Deduce vertex array limit from memory layout when limit is the highest possible.Fernando Sahmkow2022-10-063-4/+12
* | | | | | | | VideoCore: Add option to dump the macros.Fernando Sahmkow2022-10-061-0/+1
* | | | | | | | NVDRV: Further improvements.Fernando Sahmkow2022-10-0616-159/+278
* | | | | | | | Buffer Cache: Basic fixes.Fernando Sahmkow2022-10-061-15/+22
* | | | | | | | Decoders: Improve overall speed.Fernando Sahmkow2022-10-061-4/+11
* | | | | | | | DMA & InlineToMemory Engines Rework.bunnei2022-10-0621-242/+323
* | | | | | | | Maxwell3D: Add small_index_2Fernando Sahmkow2022-10-061-0/+2
* | | | | | | | Memory Manager: ensure safety of GPU to CPU address.Fernando Sahmkow2022-10-061-0/+3
* | | | | | | | MemoryManager: Fix errors popping out.Fernando Sahmkow2022-10-063-4/+18
* | | | | | | | Shader Decompiler: implement better tracking for Vulkan samplers.Fernando Sahmkow2022-10-061-9/+59
* | | | | | | | Shader Decompiler: Check for shift when deriving composite samplers.Fernando Sahmkow2022-10-066-11/+46
* | | | | | | | Shader Decompiler: Fix dangerous behavior of invalid iterator insertion.Fernando Sahmkow2022-10-061-3/+3
* | | | | | | | MemoryManager: Finish up the initial implementation.Fernando Sahmkow2022-10-062-50/+138
* | | | | | | | OpenGL: Fix TickWorkFernando Sahmkow2022-10-061-0/+4
* | | | | | | | VideoCore: Refactor fencing system.Fernando Sahmkow2022-10-0620-167/+154
* | | | | | | | MemoryManager: initial multi paging system implementation.Fernando Sahmkow2022-10-066-209/+343
* | | | | | | | Vulkan: Fix Scissor on ClearsFernando Sahmkow2022-10-061-1/+8
* | | | | | | | NVDRV: Further refactors and eliminate old code.Fernando Sahmkow2022-10-0618-242/+12
* | | | | | | | NVDRV: Refactor Host1xFernando Sahmkow2022-10-0633-173/+201
* | | | | | | | VideoCore: Refactor syncing.Fernando Sahmkow2022-10-0644-252/+648
* | | | | | | | Texture Cache: Fix GC and GPU Modified on Joins.Fernando Sahmkow2022-10-061-3/+5
* | | | | | | | Texture cache: Fix the remaining issues with memory mnagement and unmapping.Fernando Sahmkow2022-10-0612-16/+63
* | | | | | | | Texture cache: Fix dangling references on multichannel.Fernando Sahmkow2022-10-063-27/+36
* | | | | | | | Refactor VideoCore to use AS sepparate from Channel.Fernando Sahmkow2022-10-0610-152/+171
* | | | | | | | General: Rebase fixes.Fernando Sahmkow2022-10-061-7/+6
* | | | | | | | VideoCore: Extra Fixes.Fernando Sahmkow2022-10-063-3/+5
* | | | | | | | NVDRV: Remake ASGPUFernando Sahmkow2022-10-068-239/+882
* | | | | | | | NVDRV: Update copyright notices.Fernando Sahmkow2022-10-064-7/+13
* | | | | | | | MemoryManager: Temporary Fix for NVDEC.Fernando Sahmkow2022-10-061-1/+1
* | | | | | | | NvHostCtrl: Fix merge of nvflinger.Fernando Sahmkow2022-10-061-1/+2
* | | | | | | | VideoCore: Update MemoryManagerFernando Sahmkow2022-10-064-167/+86
* | | | | | | | Common: implement MultiLevelPageTable.Fernando Sahmkow2022-10-064-0/+171
* | | | | | | | VideoCore: Fix channels with disk pipeline/shader cache.Fernando Sahmkow2022-10-0611-71/+87
* | | | | | | | OpenGl: Implement Channels.Fernando Sahmkow2022-10-069-118/+186
* | | | | | | | NVHOST_CTRl: Implement missing method and fix some stuffs.Fernando Sahmkow2022-10-064-6/+35
* | | | | | | | VideoCore: implement channels on gpu caches.Fernando Sahmkow2022-10-0650-809/+1461
* | | | | | | | NVASGPU: Fix Remap.Fernando Sahmkow2022-10-061-0/+8
* | | | | | | | NVDRV: Fix clearing when destroying.Fernando Sahmkow2022-10-063-14/+9
* | | | | | | | NVMAP: Fix the Free return parameters.Fernando Sahmkow2022-10-063-15/+18
* | | | | | | | NVDRV: Fix Open/Close and make sure each device is correctly created.Fernando Sahmkow2022-10-0614-199/+291
* | | | | | | | NVDRV: Implement new NvMapFernando Sahmkow2022-10-0618-277/+307
* | | | | | | | NVDRV: Refactor and add new NvMap.Fernando Sahmkow2022-10-0620-45/+558
* | | | | | | | NVDRV: Cleanup.Fernando Sahmkow2022-10-064-32/+40
* | | | | | | | NVDRV: Implement QueryEvent.Fernando Sahmkow2022-10-0610-40/+133
* | | | | | | | NvHost: Remake Ctrl Implementation.Fernando Sahmkow2022-10-067-170/+312
* | | | | | | | NvHost: Try a different approach to blocking.Fernando Sahmkow2022-10-062-10/+7
* | | | | | | | NvHost: Fix some regressions and correct signaling on timeout.Fernando Sahmkow2022-10-061-25/+19
* | | | | | | | Texture Cache: Add ASTC 10x5 Format.Fernando Sahmkow2022-10-066-0/+23
* | | | | | | | Merge pull request #9013 from liamwhite/spinning-a-yarnbunnei2022-10-0619-23/+23
|\ \ \ \ \ \ \ \
| * | | | | | | | common: remove "yuzu:" prefix from thread namesLiam2022-10-0419-23/+23
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #9015 from german77/amiibo-rewritebunnei2022-10-056-42/+112
|\ \ \ \ \ \ \ \
| * | | | | | | | service: nfp: Fix errors to pass unit testingNarr the Reg2022-10-046-42/+112
| |/ / / / / / /
* | | | | | | | Show error from cpp-httplib when we don't have a response to read (report errors while connecting to API) (#8999)Kyle Kienapfel2022-10-051-1/+2
* | | | | | | | Merge pull request #8987 from liamwhite/another-name-for-reinforcement-steelFernando S2022-10-052-27/+60
|\ \ \ \ \ \ \ \
| * | | | | | | | vulkan: automatically use larger staging buffer sizes when possibleLiam2022-09-252-27/+60
* | | | | | | | | Merge pull request #9011 from liamwhite/frog-emoji-momentFernando S2022-10-051-4/+21
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | shader_recompiler: add extended LDC to GLASM backendLiam2022-10-021-4/+21
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #9005 from liamwhite/micro-fitbunnei2022-10-051-11/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | macro_jit_x64: cancel exit for taken branchLiam2022-10-011-11/+5
* | | | | | | | | | Merge pull request #9010 from liamwhite/buttwisebunnei2022-10-051-37/+9
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | macro_jit_x64: fix miscompilation of bit extraction operationsLiam2022-10-021-37/+9
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8955 from german77/amiibo-rewritebunnei2022-10-0229-1333/+2303
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service: mii: Copy only valid name bytesgerman772022-10-021-3/+18
| * | | | | | | | | service: nfp: Implement mount target and open application area errors, minor fixesNarr the Reg2022-10-025-19/+124
| * | | | | | | | | nfp: Multiple fixes against HWgerman772022-10-029-62/+163
| * | | | | | | | | service: nfp: address commentsgerman772022-10-029-26/+29
| * | | | | | | | | service: nfp: Rewrite and implement applet callsgerman772022-10-0213-1263/+1542
| * | | | | | | | | core: hid: Add nfc support to emulated controllergerman772022-10-024-3/+123
| * | | | | | | | | yuzu: Use virtual amiibo driver instead of nfp servicegerman772022-10-021-25/+26
| * | | | | | | | | input_common: Enable virtual amiibo drivergerman772022-10-024-0/+102
| * | | | | | | | | input_common: Create virtual amiibo drivergerman772022-10-026-0/+244
* | | | | | | | | | Merge pull request #8992 from Morph1984/vi-vsync-eventbunnei2022-10-026-29/+66
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | service: vi: Retrieve vsync event once per displayMorph2022-09-265-14/+42
| * | | | | | | | | | service: vi: Move VI results into its own fileMorph2022-09-262-16/+25
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #6598 from FernandoS27/falklands-are-britishliamwhite2022-10-021-1/+62
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | |
| * | | | | | | | | MacroHLE: Add MultidrawIndirect HLE Macro.Fernando Sahmkow2022-10-021-1/+62
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8876 from FearlessTobi/multiplayer-part3bunnei2022-10-0130-184/+1307
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Address some review commentsFearlessTobi2022-09-207-52/+38
| * | | | | | | | | dedicated_room: fix token padding ...liushuyu2022-09-111-2/+12
| * | | | | | | | | fix black iconNarr the Reg2022-09-111-0/+2
| * | | | | | | | | yuzu: Multiple room UI improvementsgerman772022-09-1018-59/+176
| * | | | | | | | | ldn: Initial implementationFearlessTobi2022-09-0915-124/+1132
* | | | | | | | | | Merge pull request #9008 from ZwipZwapZapony/controller.colors_state.rightNarr the Reg2022-10-011-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Fix "controller.colors_state.right" being "left"Zwip-Zwap Zapony2022-10-011-1/+1
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8874 from vonchenplus/align_index_buffer_sizebunnei2022-10-011-1/+1
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Align index buffe size when vertex_buffer_unified_memory enableFengChen2022-09-101-1/+1
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #8910 from vonchenplus/astc_decode_errorbunnei2022-10-012-2/+2
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | video_core: Modify astc texture decode error fill valueFengChen2022-09-152-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #8934 from german77/palma_releasebunnei2022-09-297-33/+842
|\ \ \ \ \ \ \ \
| * | | | | | | | service: hid: Partially implement palma controllerNarr the Reg2022-09-257-33/+842
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8940 from german77/silencebunnei2022-09-284-8/+8
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu: Silence some clang warningsNarr the Reg2022-09-214-8/+8
| |/ / / / / / /
* | | | / / / / core/loader: Return nullptr if file is nullptrMerry2022-09-251-0/+4
| |_|_|/ / / / |/| | | | | |
* | | | | | | Merge pull request #8920 from abouvier/cmake-gitbunnei2022-09-251-27/+2
|\ \ \ \ \ \ \
| * | | | | | | cmake: fix git detectionAlexandre Bouvier2022-09-181-27/+2
* | | | | | | | Merge pull request #8941 from Kelebek1/single_core_sucksbunnei2022-09-241-2/+7
|\ \ \ \ \ \ \ \
| * | | | | | | | Do not try to pause core timing from the audio thread when using single-coreKelebek12022-09-221-2/+7
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8945 from Tachi107/typosMorph2022-09-245-6/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | chore: fix some typosAndrea Pappacoda2022-09-235-6/+6
| |/ / / / / / /
* | | | | | | | Merge pull request #8948 from german77/orderMorph2022-09-241-0/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu: sort input profiles by nameNarr the Reg2022-09-231-0/+2
* | | | | | | | | Merge pull request #8930 from lat9nq/disable-vulkan-checkMorph2022-09-247-45/+66
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | yuzu qt: Add option to disable startup Vulkan checklat9nq2022-09-197-45/+66
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #8943 from lioncash/netifaceMorph2022-09-232-6/+17
|\ \ \ \ \ \ \ \
| * | | | | | | | sockets: Make fd member variable protectedLioncash2022-09-222-6/+17
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8939 from lioncash/renderMorph2022-09-232-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | audio_renderer: Make GetCommandBuffer() take a u32Lioncash2022-09-212-2/+2
| |/ / / / / / /
* | | | | | | | audio_manager: Forward declare result typeLioncash2022-09-212-1/+3
* | | | | | | | audio_manager: Remove redundant cast in ThreadFunc()Lioncash2022-09-211-3/+5
* | | | | | | | audio_manager: move std::functions in SetOutManager/SetInManagerLioncash2022-09-211-2/+2
* | | | | | | | audio_manager: Remove unused forward declarationsLioncash2022-09-212-10/+0
* | | | | | | | audio_manager: Remove unused sessions_started member variableLioncash2022-09-211-2/+0
* | | | | | | | audio_manager: Remove dependence on system stateLioncash2022-09-213-10/+4
|/ / / / / / /
* | | | | | | Merge pull request #8849 from Morph1984/parallel-astcbunnei2022-09-191-21/+35
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | astc: Enable parallel CPU astc decodingMorph2022-09-161-21/+35
* | | | | | | Merge pull request #8915 from vonchenplus/opus_multi_streambunnei2022-09-182-1/+38
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | core: implement HwOpus GetWorkBufferSizeForMultiStreamExFengChen2022-09-162-1/+38
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8827 from german77/amiibo_releasebunnei2022-09-1712-302/+1370
|\ \ \ \ \ \
| * | | | | | core: nfp: Remove magic numbersgerman772022-09-073-105/+103
| * | | | | | core: nfp: Workaround for lack of multiple nfp interfacesgerman772022-09-071-1/+3
| * | | | | | core: nfp: Correct date and amiibo nameNarr the Reg2022-09-074-18/+36
| * | | | | | core: nfp: Implement Convert and RecreateApplicationArea, accuracy fixesNarr the Reg2022-09-0710-257/+356
| * | | | | | core: nfp: Implement amiibo encryptiongerman772022-09-077-276/+1227
* | | | | | | Merge pull request #8650 from Kelebek1/vsyncbunnei2022-09-174-33/+71
|\ \ \ \ \ \ \
| * | | | | | | core_timing: Sleep in discrete intervals, yield during spinMorph2022-08-021-12/+13
| * | | | | | | Add missing looping event schedule signalKelebek12022-08-021-5/+9
| * | | | | | | Make coretiming waiting more accurateKelebek12022-08-022-11/+31
| * | | | | | | Rework multi-core vsyncKelebek12022-08-022-17/+30
* | | | | | | | Merge pull request #8914 from lioncash/audio-constbunnei2022-09-1725-82/+87
|\ \ \ \ \ \ \ \
| * | | | | | | | audio_renderer: Pass command buffer by const referenceLioncash2022-09-164-4/+4
| * | | | | | | | sink_stream: Mark GetQueueSize as constLioncash2022-09-161-1/+1
| * | | | | | | | node_states: Mark relevant member functions as constLioncash2022-09-161-2/+2
| * | | | | | | | i3dl2/reverb: Mark relevant member functions as constLioncash2022-09-162-4/+4
| * | | | | | | | behavior_info: Mark CopyErrorInfo as constLioncash2022-09-164-6/+6
| * | | | | | | | audio_device: Mark GetDeviceVolume as constLioncash2022-09-162-2/+2
| * | | | | | | | audio_render_manager: Mark several functions as constLioncash2022-09-162-6/+6
| * | | | | | | | audio_in: Mark several functions as constLioncash2022-09-164-18/+18
| * | | | | | | | audio_out: Mark several functions as constLioncash2022-09-164-16/+17
| * | | | | | | | audio_buffers: Pass by const-ref in AppendBuffersLioncash2022-09-163-13/+17
| * | | | | | | | device_session: Convert for loop into ranged for in AppendBuffersLioncash2022-09-161-5/+5
| * | | | | | | | device_session: Pass arguments by const-ref in relevant functionsLioncash2022-09-163-7/+7
* | | | | | | | | Merge pull request #8906 from Docteh/fix_iconsbunnei2022-09-171-8/+13
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | UI: move icons from default into colorful theme.Kyle Kienapfel2022-09-161-8/+13
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8869 from SachinVin/cmakeMorph2022-09-161-6/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core/CMakeLists.txt: Remove duplicate files.SachinVin2022-09-081-6/+0
* | | | | | | | | | Merge pull request #8649 from lat9nq/common-position-independentMorph2022-09-161-3/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | common: Use PROJECT_SOURCE_DIR to find CMakeModuleslat9nq2022-08-021-3/+3
* | | | | | | | | | | Merge pull request #8682 from lat9nq/dumpyMorph2022-09-1618-91/+386
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | mini_dump: Address review feedbacklat9nq2022-09-054-63/+71
| * | | | | | | | | | | vcpkg,cmake: Use vcpkg for dbghelplat9nq2022-09-051-1/+1
| * | | | | | | | | | | mini_dump: Check for debugger before spawning a childlat9nq2022-09-052-63/+37
| * | | | | | | | | | | mini_dump: Cleanup and add commentslat9nq2022-09-053-43/+87
| * | | | | | | | | | | yuzu: Use a debugger to generate minidumpslat9nq2022-09-0518-91/+360
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8911 from lioncash/cexpr-stringMorph2022-09-166-27/+40
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | audio_device: Mark member functions as const where applicableLioncash2022-09-153-10/+10
| * | | | | | | | | | audio_device: Make AudioDeviceName constructor constexprLioncash2022-09-155-17/+30
* | | | | | | | | | | Merge pull request #8878 from Kelebek1/remove_pausebunnei2022-09-1515-144/+29
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Remove pause callbacks from coretimingKelebek12022-09-1315-144/+29
* | | | | | | | | | | | Merge pull request #8901 from lioncash/docsliamwhite2022-09-1528-112/+105
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | audio_core: Amend documentation tagsLioncash2022-09-1528-112/+105
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #8909 from Docteh/taslinkyNarr the Reg2022-09-151-0/+3
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | UI: Fix link to TAS help pageKyle Kienapfel2022-09-151-0/+3
* | | | | | | | | | | | | Merge pull request #8904 from liushuyu/fix-xbyak-linkageMai2022-09-151-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | common: do not link to xbyak on non-amd64 architecturesliushuyu2022-09-141-1/+2
| |/ / / / / / / / / / /
* | | | | | | | | | | | compressor: Simplify memset in InitializeCompressorEffectLioncash2022-09-131-1/+1
* | | | | | | | | | | | compressor: Mark params parameters as constLioncash2022-09-131-3/+3
* | | | | | | | | | | | compressor: Remove unneeded casts in ApplyCompressorEffectLioncash2022-09-131-2/+1
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #8880 from german77/slow-movingMai2022-09-131-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
| * | | | | | | | | | input_common: Increase mapping timer from 2.5 seconds to 4 secondsgerman772022-09-111-1/+1
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Remove a pragma once from a cpp fileKelebek12022-09-121-2/+0
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #8842 from Kelebek1/AudOutbunnei2022-09-1024-832/+574
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | Don't stall with nvdecKelebek12022-09-044-2/+35
| * | | | | | | | Rework audio output, connecting AudioOut into coretiming to fix desync during heavy loads.Kelebek12022-09-0223-842/+551
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Merge pull request #8863 from german77/triggersbunnei2022-09-101-0/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | core: hid: Fix GC triggers overwritting ZL and ZR buttonsNarr the Reg2022-09-051-0/+15
* | | | | | | | | Merge pull request #8864 from german77/toggle_analogbunnei2022-09-104-7/+23
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | yuzu: input: fix invert symbol on axis and order options alphabeticallyNarr the Reg2022-09-061-13/+14
| * | | | | | | | input_common: Add support for analog toggleNarr the Reg2022-09-064-0/+15
| |/ / / / / / /
* | | | | | | | Merge pull request #8819 from liamwhite/cash-moneylat9nq2022-09-099-1/+32
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core: add option for pessimistic flushingLiam2022-08-259-1/+32
* | | | | | | | | CMake: explicitly link mbedcrypto for yuzu-roomKyle Kienapfel2022-09-081-1/+1
| |_|_|_|_|_|/ / |/| | | | | | |
* | | | | | | | Merge pull request #8837 from Morph1984/invalidatebunnei2022-09-064-12/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | style: General style changes to match with the rest of the codebaseMorph2022-08-312-10/+7
| * | | | | | | | (shader/pipeline)_cache: Raise shader/pipeline cache versionMorph2022-08-312-2/+2
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8847 from german77/stopbunnei2022-09-051-4/+7
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | input_common: sdl: Always check for motion on reconnectNarr the Reg2022-09-041-4/+7
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8855 from german77/plsliamwhite2022-09-046-26/+27
|\ \ \ \ \ \ \
| * | | | | | | core: ns: Implement pl:s serviceNarr the Reg2022-09-036-26/+27
| |/ / / / / /
* | | | | | | Qt: Make General->Debug scrollableKyle Kienapfel2022-09-033-4/+9
* | | | | | | Merge pull request #8822 from FearlessTobi/multiplayer-fixesbunnei2022-09-0228-49/+182
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Address review commentsFearlessTobi2022-09-0211-27/+26
| * | | | | | core/ldn_types: Minor corrections and additionsFearlessTobi2022-08-271-1/+16
| * | | | | | yuzu/chat_room: Make font size biggerFearlessTobi2022-08-271-0/+4
| * | | | | | dedicated_room: Correctly handle token decodingFearlessTobi2022-08-271-0/+12
| * | | | | | yuzu/multiplayer: Warn when game is running or no network interface is selectedFearlessTobi2022-08-2711-19/+81
| * | | | | | core/socket_proxy: Correct broadcast behaviorFearlessTobi2022-08-271-1/+7
| * | | | | | yuzu: Display current game version in multiplayer roomFearlessTobi2022-08-276-11/+38
| * | | | | | network: Use lower timeout for enet_host_serviceFearlessTobi2022-08-272-2/+2
| * | | | | | core/bsd: Correctly unbind methods in destructorFearlessTobi2022-08-271-1/+5
| * | | | | | core/acc: Make CheckAvailability use LOG_DEBUGFearlessTobi2022-08-271-1/+1
| * | | | | | yuzu_room: Remove dependency on coreFearlessTobi2022-08-2711-9/+13
* | | | | | | Merge pull request #8843 from Kelebek1/SILENCE_WENCHMai2022-09-021-1/+1
|\ \ \ \ \ \ \
| * | | | | | | Silence std::aligned_storage warnings as it's deprecated in C++23,Kelebek12022-09-011-1/+1
| | |/ / / / / | |/| | | | |
* / | | | | | Demote services from warning/info to debug to reduce log spam:Kelebek12022-09-015-16/+16
|/ / / / / /
* | | | | | Merge pull request #8752 from vonchenplus/rectangle_textureFernando S2022-08-3114-15/+62
|\ \ \ \ \ \
| * | | | | | video_code: support rectangle textureFengChen2022-08-2514-15/+62
* | | | | | | Merge pull request #8809 from german77/finally_is_fixedbunnei2022-08-281-1/+8
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | video_core: vulkan: rasterizer: Workaround on viewport swizzle on AMDNarr the Reg2022-08-241-1/+8
* | | | | | | Merge pull request #8566 from german77/galaxybunnei2022-08-272-1/+35
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | core: hid: Add fallback for dualjoycon and pro controllersgerman772022-07-112-1/+35
* | | | | | | Merge pull request #8812 from Kelebek1/autobunnei2022-08-241-6/+21
|\ \ \ \ \ \ \
| * | | | | | | Implement AudRenU:RequestUpdateAuto, and use C descriptors when B reports as empty.Kelebek12022-08-241-6/+21
* | | | | | | | Merge pull request #8804 from vonchenplus/speed_up_idirectory_servicesbunnei2022-08-231-1/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | core:filesystem: speed up IDirectory servicevonchenplus2022-08-231-1/+2
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | yuzu: Force camera output to be saved on a buffer (#8805)Narr the Reg2022-08-232-2/+38
* | | | | | | | hid: core: Add missing function table namesgerman772022-08-221-0/+6
|/ / / / / / /
* | | | | | | Merge pull request #8799 from liamwhite/where-did-the-padding-goliamwhite2022-08-212-3/+3
|\ \ \ \ \ \ \
| * | | | | | | core/file_sys: fix alignment of BuildIdLiam2022-08-212-3/+3
* | | | | | | | Merge pull request #8660 from Tachi107/findmodules-pkg-configliamwhite2022-08-211-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | build(externals): rename Findopus to FindOpusAndrea Pappacoda2022-08-011-1/+1
* | | | | | | | | Merge pull request #8784 from Docteh/nosnekliamwhite2022-08-2117-119/+116
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | code: dodge PAGE_SIZE #defineKyle Kienapfel2022-08-2017-119/+116
* | | | | | | | | Merge pull request #8790 from liamwhite/too-many-ways-to-name-a-byte-stringbunnei2022-08-212-11/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core/file_sys: fix BuildId paddingLiam2022-08-192-11/+7
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8783 from german77/looongliamwhite2022-08-211-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu: Allow longer controller profile namesNarr the Reg2022-08-191-1/+1
* | | | | | | | | | Merge pull request #8797 from Docteh/filteringliamwhite2022-08-213-7/+37
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Qt: Retranslate GameList header and Filter lineKyle Kienapfel2022-08-203-7/+37
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8795 from vonchenplus/support_framebuffer_crop_rect_top_not_zeroliamwhite2022-08-212-12/+25
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core: support framebuffer crop rect top not zerovonchenplus2022-08-202-12/+25
* | | | | | | | | | | core: implement clkrst servicevonchenplus2022-08-202-0/+184
|/ / / / / / / / / /
* | | / / / / / / / video_core: implement R16G16B16X16 texture formatLiam2022-08-191-1/+1
| |_|/ / / / / / / |/| | | | | | | |
* | | | | | | | | common: remove unneeded x86-specific headerliushuyu2022-08-161-1/+0
|/ / / / / / / /
* | | | | | | | core/socket_proxy: Final nitsFearlessTobi2022-08-151-8/+7
* | | | | | | | core: network: Address review commentsgerman772022-08-155-32/+31
* | | | | | | | yuzu: Fix crash on shutdownFearlessTobi2022-08-152-6/+4
* | | | | | | | internal_network: Fix mingw compilationFearlessTobi2022-08-151-4/+5
* | | | | | | | core, yuzu: Address first part of review commentsFearlessTobi2022-08-159-71/+70
* | | | | | | | core/socket_proxy: Fix compilationFearlessTobi2022-08-151-1/+1
* | | | | | | | Make copyright headers SPDX-compliantFearlessTobi2022-08-156-12/+14
* | | | | | | | core, network: Add ability to proxy socket packetsFearlessTobi2022-08-1528-526/+1028
* | | | | | | | web_service: Correct jwt issuer stringFearlessTobi2022-08-151-1/+3
* | | | | | | | dedicated_room: Initial implementationFearlessTobi2022-08-154-0/+418
* | | | | | | | Merge pull request #8739 from merryhime/swizzle_tablebunnei2022-08-142-15/+48
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | video_core/textures/decoders: Avoid SWIZZLE_TABLEMerry2022-08-092-15/+48
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8756 from Kelebek1/volbunnei2022-08-136-11/+12
|\ \ \ \ \ \ \
| * | | | | | | Do some log memes to help perceived volumeKelebek12022-08-122-2/+5
| * | | | | | | Allow audio volume up to 200%Kelebek12022-08-124-9/+7
* | | | | | | | Merge pull request #8755 from Morph1984/delimit-ipsbunnei2022-08-121-1/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | ips_layer: Delimit parsed hex value stringMorph2022-08-121-1/+2
* | | | | | | | | Merge pull request #8741 from Docteh/abootMai2022-08-122-2/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Qt: tweak ui filesKyle K2022-08-092-2/+3
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8745 from merryhime/null-fastmem-arenaliamwhite2022-08-122-7/+11
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | arm_dynarmic: Fix nullptr fastmem arenasMerry2022-08-092-7/+11
| |/ / / / / / /
* | | | | | | | Merge pull request #8647 from Docteh/default_darkliamwhite2022-08-124-14/+77
|\ \ \ \ \ \ \ \
| * | | | | | | | review pass on CheckDarkMode functionKyle Kienapfel2022-08-122-4/+4
| * | | | | | | | Linux: handle dark system themes nicelyKyle K2022-08-054-14/+77
* | | | | | | | | Merge pull request #8731 from FearlessTobi/better-ldnliamwhite2022-08-126-57/+711
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | core: ldn: Address review comments part 2german772022-08-122-334/+297
| * | | | | | | | core: ldn: Address review commentsNarr the Reg2022-08-084-56/+46
| * | | | | | | | ldn: Add better stubs and more data typesFearlessTobi2022-08-076-72/+773
* | | | | | | | | Merge pull request #8735 from djrobx/add_vsyncliamwhite2022-08-102-3/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Make vsync setting work for VulkanDJRobX2022-08-082-3/+4
* | | | | | | | | | Merge pull request #8722 from german77/ds4_goes_brrrbunnei2022-08-101-0/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | hid: core: Delay the stop vibration command when testingNarr the Reg2022-08-061-0/+4
* | | | | | | | | | | Merge pull request #8724 from german77/no_alphabunnei2022-08-104-25/+97
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | hid: core: Properly emulate controller color and battery levelNarr the Reg2022-08-084-25/+97
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #8729 from merryhime/cp15-barriersbunnei2022-08-102-4/+29
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | arm_dynarmic_cp15: Implement CP15DMB/CP15DSB/CP15ISBMerry2022-08-072-4/+29
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8499 from Docteh/pluralsbunnei2022-08-103-6/+14
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Translate english pluralsKyle Kienapfel2022-07-303-6/+14
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8715 from Docteh/suzhoubunnei2022-08-091-0/+9
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | Qt5 work around for suzhou numeralsKyle Kienapfel2022-08-041-0/+9
* | | | | | | | | | | core/arm: fix build errorLiam2022-08-082-2/+10
| |_|_|_|/ / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #8637 from liamwhite/bad-interruptsbunnei2022-08-0813-152/+64
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel: unlayer CPU interrupt handlingLiam2022-07-2513-152/+64
* | | | | | | | | | | Merge pull request #8240 from liamwhite/count-cyclesMorph2022-08-082-8/+22
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core/arm: increase minimum_run_cyclesLiam2022-06-222-2/+2
| * | | | | | | | | | | core/arm: re-enable cycle countingmerry2022-06-222-6/+20
* | | | | | | | | | | | yuzu: Fix fmt 9.0.0 issueslat9nq2022-08-072-3/+4
| |_|_|_|/ / / / / / / |/| | | | | | | | | |
* | | | | | | | | | | Merge pull request #8658 from liamwhite/plgpbunnei2022-08-071-9/+7
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core: differentiate between tiled and untiled framebuffer sizes for unaccelerated copiesLiam2022-07-281-9/+7
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8700 from liamwhite/xc3-vk-crashbunnei2022-08-061-0/+12
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | vk_texture_cache: return VK_NULL_HANDLE for views of null imagesLiam2022-08-021-0/+12
| | |_|_|_|_|_|_|_|/ / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8667 from Kelebek1/xc3liamwhite2022-08-061-2/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
| * | | | | | | | | | Add missed shader defines. Fixes Xenoblade Chronicles 3 booting with Vulkan.Kelebek12022-07-291-2/+3
* | | | | | | | | | | Controller bugfixes in profile select (#8716)Steve2022-08-053-5/+10
| |_|_|_|_|_|_|/ / / |/| | | | | | | | |
* | | | | | | | | | renderer_vulkan: add format fallbacks for R16G16B16_SFLOAT, R16G16B16_SSCALED, R8G8B8_SSCALEDLiam2022-08-035-273/+337
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | core/loader: remove ELF loaderLiam2022-08-015-313/+0
| |_|_|_|/ / / / |/| | | | | | |
* | | | | | | | Merge pull request #8678 from liamwhite/stop-waitingbunnei2022-07-312-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core: stop waiting for shader compilation on user cancelLiam2022-07-302-2/+2
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #8622 from liamwhite/progressbunnei2022-07-311-0/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | qt: reset progress bar after shader compilationLiam2022-07-241-0/+4
* | | | | | | | | Properly write out the command buffer when serving close requestNikita Strygin2022-07-311-2/+5
* | | | | | | | | Merge pull request #8684 from liamwhite/delete-shaderMorph2022-07-311-0/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | renderer_opengl: delete shader source after linkingLiam2022-07-301-0/+1
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8664 from liamwhite/monkey-compiler-v12-1Morph2022-07-301-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common: move forwarded value into SPSCQueueLiam2022-07-291-1/+1
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | audio_core: fix -Wuninitialized when compiling with ASanLiam2022-07-301-4/+4
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #8656 from german77/audio-stepbunnei2022-07-291-2/+16
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu: Add incremental steps to volume hotkeysNarr the Reg2022-07-271-2/+16
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8657 from Kelebek1/depopliamwhite2022-07-282-2/+2
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Avoid depop out of boundsKelebek12022-07-282-2/+2
* | | | | | | | Revert Coretiming PRs 8531 and 7454 (#8591)Maide2022-07-285-118/+69
* | | | | | | | implement pause on system suspend (#8585)snek2022-07-282-1/+43
|/ / / / / / /
* | | | | | | Merge pull request #8542 from Morph1984/gpu-use-old-qliamwhite2022-07-272-4/+3
|\ \ \ \ \ \ \
| * | | | | | | gpu_thread: Use the previous MPSCQueue implementationMorph2022-07-062-4/+3
* | | | | | | | Merge pull request #8636 from german77/irs_cluster_releaseliamwhite2022-07-276-7/+323
|\ \ \ \ \ \ \ \
| * | | | | | | | Address commentsNarr the Reg2022-07-252-17/+18
| * | | | | | | | fix compiler errorsgerman772022-07-242-12/+14
| * | | | | | | | service: irs: Implement clustering processorgerman772022-07-246-7/+320
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8633 from Morph1984/optional-keysliamwhite2022-07-275-4/+81
|\ \ \ \ \ \ \ \
| * | | | | | | | qt_software_keyboard: Fix infinite loop when moving between buttonsMorph2022-07-241-0/+14
| * | | | | | | | applet/swkbd: Implement optional symbol keysMorph2022-07-245-4/+67
* | | | | | | | | Merge pull request #8592 from devsnek/sig-handlerssnek2022-07-272-0/+71
* | | | | | | | | chore: make yuzu REUSE compliantAndrea Pappacoda2022-07-27180-487/+390
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | network: Address review commentsFearlessTobi2022-07-255-199/+203
* | | | | | | | network, yuzu: Make copyright headers SPDX-compliantFearlessTobi2022-07-2537-111/+74
* | | | | | | | network, yuzu: Improve variable naming and style consistencyFearlessTobi2022-07-2514-47/+53
* | | | | | | | yuzu_cmd: Fix compilationFearlessTobi2022-07-252-13/+1
* | | | | | | | network: Move global state into a seperate classFearlessTobi2022-07-2521-96/+150
* | | | | | | | common: multiplayer: Use GameInfo typegerman772022-07-2511-62/+60
* | | | | | | | Address second part of review commentsFearlessTobi2022-07-259-103/+92
* | | | | | | | Address first part of review commentsFearlessTobi2022-07-2514-133/+231
* | | | | | | | Fix compilation on linux gccFearlessTobi2022-07-256-31/+32
* | | | | | | | web_service: Fix -Wmissing-field-initializersFearlessTobi2022-07-251-1/+1
* | | | | | | | core: Fix -Wunused-variableFearlessTobi2022-07-251-1/+3
* | | | | | | | common, core: fix -Wmissing-field-initializersFearlessTobi2022-07-252-5/+5
* | | | | | | | yuzu: Hide multiplayer button and room statusFearlessTobi2022-07-252-16/+3
* | | | | | | | yuzu: Add ui files for multiplayer roomsFearlessTobi2022-07-2567-49/+4499
* | | | | | | | network: Add initial files and enet dependencyFearlessTobi2022-07-2512-0/+2890
* | | | | | | | Merge pull request #8564 from lat9nq/dinner-forkbunnei2022-07-2512-124/+181
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | startup_checks: Use WaitForSingleObject and more cleanuplat9nq2022-07-121-6/+9
| * | | | | | | startup_checks: Use GetEnvironmentVariableAlat9nq2022-07-111-4/+3
| * | | | | | | startup_checks: Clean uplat9nq2022-07-101-9/+6
| * | | | | | | startup_checks: Implement unix side codelat9nq2022-07-102-17/+48
| * | | | | | | yuzu: Simplify broken Vulkan handlinglat9nq2022-07-109-115/+65
| * | | | | | | yuzu: Check Vulkan on startup with a childlat9nq2022-07-103-1/+78
| * | | | | | | yuzu: Rename check_vulkan to startup_checkslat9nq2022-07-104-3/+3
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #8549 from liamwhite/kscheduler-scMorph2022-07-2513-602/+605
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | kernel: Ensure all uses of disable_count are balancedLiam2022-07-153-10/+21
| * | | | | | kernel: be more careful about initialization path for HLE threadsLiam2022-07-152-1/+8
| * | | | | | kernel: fix single-core preemption pointsLiam2022-07-156-40/+28
| * | | | | | kernel: fix issues with single core modeLiam2022-07-159-189/+225
| * | | | | | kernel: use KScheduler from mesosphereLiam2022-07-1512-602/+563
* | | | | | | yuzu: Add webcam support and rebase to latest masterNarr the Reg2022-07-248-16/+43
* | | | | | | service: irs: Move to IRS namespace and minor fixesgerman772022-07-2419-76/+70
* | | | | | | service: irs: Split processors and implement ImageTransferProcessorgerman772022-07-2418-291/+1091
* | | | | | | core: hid: Add cammera supportgerman772022-07-246-3/+423
* | | | | | | yuzu: Hook qt camera to camera drivergerman772022-07-2413-1/+481
* | | | | | | input_common: Add camera drivergerman772022-07-2411-5/+298
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #8545 from Kelebek1/Audioliamwhite2022-07-23269-8436/+33703
|\ \ \ \ \ \
| * | | | | | Project AndioKelebek12022-07-22269-8436/+33703
* | | | | | | Merge pull request #8611 from liamwhite/fix-flatpak-crashbunnei2022-07-231-5/+8
|\ \ \ \ \ \ \
| * | | | | | | video_core: use correct byte size for framebufferLiam2022-07-191-5/+8
* | | | | | | | ci,CMake: Drop Conan support for vcpkglat9nq2022-07-231-2/+3
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #8598 from Link4565/recv-dontwaitbunnei2022-07-221-1/+19
|\ \ \ \ \ \ \
| * | | | | | | Enable the use of MSG_DONTWAIT flag on RecvImplLink45652022-07-161-1/+19
* | | | | | | | Update configure_input.uiMatías Locatti2022-07-191-1/+1
* | | | | | | | implement resume messageGus Caplan2022-07-184-0/+23
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #8569 from merryhime/watchpointsmerry2022-07-174-8/+3
|\ \ \ \ \ \ \
| * | | | | | | dynarmic: Abort watchpoints ASAPMerry2022-07-154-8/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #8508 from yuzu-emu/mc-speed-limitbunnei2022-07-1710-130/+20
|\ \ \ \ \ \ \
| * | | | | | | hle: service: nvflinger: Fix implicit conversion.bunnei2022-07-171-1/+4
| * | | | | | | yuzu: settings: Remove framerate cap and merge unlocked framerate setting.bunnei2022-07-1710-135/+15
| * | | | | | | hle: service: nvflinger: Factor speed limit into frame time calculation.bunnei2022-07-171-1/+8
* | | | | | | | Merge pull request #8544 from german77/14dot0bunnei2022-07-178-29/+45
|\ \ \ \ \ \ \ \
| * | | | | | | | service: fatal: Add function tablegerman772022-07-141-1/+7
| * | | | | | | | service: btdrv,bcat,btm: Update service tables to 14.0.0german772022-07-143-4/+13
| * | | | | | | | service am: Update service tables to 14.0.0german772022-07-141-0/+3
| * | | | | | | | service: ac: Replace intances of ProfileData with UserDatagerman772022-07-143-24/+22
* | | | | | | | | Merge pull request #8543 from BreadFish64/use_tsc_from_capsbunnei2022-07-173-1/+22
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | guard against div-by-zeroMarshall Mohror2022-07-061-2/+5
| * | | | | | | | common/x64: Use TSC clock rate from CPUID when availableMarshall Mohror2022-07-063-1/+19
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #8593 from merryhime/ranged-setting-Tbunnei2022-07-176-58/+59
|\ \ \ \ \ \ \ \
| * | | | | | | | common/setting: Make ranged a property of the typemerry2022-07-156-58/+59
* | | | | | | | | Merge pull request #8594 from liamwhite/skip-wpbunnei2022-07-162-6/+6
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core/arm: skip watchpoint checks when reading instructionsLiam2022-07-162-6/+6
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8511 from german77/hbmenubunnei2022-07-1611-85/+224
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | service: nifm: Stub GetInternetConnectionStatusgerman772022-06-291-1/+41
| * | | | | | | | service: ptm: Rewrite PSM and add TSgerman772022-06-2910-84/+183
* | | | | | | | | Merge pull request #8560 from liamwhite/bitfield-may-aliasbunnei2022-07-161-0/+9
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | common: fix bitfield aliasing on GCC/ClangLiam2022-07-101-0/+9
* | | | | | | | | Merge pull request #8587 from merryhime/padding-unusedMorph2022-07-151-4/+6
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common_funcs: Mark padding as [[maybe_unused]]Merry2022-07-151-4/+6
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8588 from merryhime/IBinder-vdestructMorph2022-07-151-0/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | nvflinger: Polymorphic destructor requried for abstract class IBinderMerry2022-07-151-0/+1
| |/ / / / / / / /
* / / / / / / / / KCodeMemory: Mark virtual methods as overrideMerry2022-07-151-3/+3
|/ / / / / / / /
* | | | | | | | Merge pull request #8536 from Morph1984/fix-webapplet-inputliamwhite2022-07-151-2/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | qt_web_browser: Fix button inputs with QtWebEngineMorph2022-07-061-2/+6
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8510 from german77/vibrationliamwhite2022-07-153-3/+12
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | input_common: sdl: lower vibration frequency and use it's own unique threadgerman772022-06-293-3/+12
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8559 from liamwhite/waiter-listbunnei2022-07-111-3/+9
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | kernel: fix usage of waiter_list in FinalizeLiam2022-07-101-3/+9
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #8528 from Morph1984/astc10x6Fernando S2022-07-107-1/+16
|\ \ \ \ \ \
| * | | | | | renderer_(gl/vk): Implement ASTC_10x6_UNORMMorph2022-07-067-1/+16
| | |_|/ / / | |/| | | |
* | | | | | PRKelebek12022-07-105-11/+9
* | | | | | Rework CoreTimingKelebek12022-07-1013-82/+154
* | | | | | Merge pull request #8531 from FernandoS27/core-timing-fix-regliamwhite2022-07-102-12/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Core timing: use only one thread.Fernando Sahmkow2022-07-022-12/+2
* | | | | | Merge pull request #8501 from liamwhite/backtrace-againMai2022-07-085-15/+51
|\ \ \ \ \ \
| * | | | | | core/arm: better support for backtrace generationLiam2022-06-255-15/+51
* | | | | | | Merge pull request #8502 from liamwhite/end-waitliamwhite2022-07-072-4/+5
|\ \ \ \ \ \ \
| * | | | | | | kernel: clean up waiting implementationLiam2022-06-252-4/+5
| |/ / / / / /
* | | | | | | Merge pull request #8492 from german77/no_more_errorsFernando S2022-07-075-40/+76
|\ \ \ \ \ \ \
| * | | | | | | service: hid: Correct some mistakes and add more validationsNarr the Reg2022-06-295-40/+76
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #8522 from lat9nq/consolidate-settingsMorph2022-07-078-320/+232
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | settings: Consolidate RangedSetting's with regular oneslat9nq2022-06-308-320/+232
| |/ / / / /
* | | | | | Merge pull request #8486 from liushuyu/github-actions-verifyMorph2022-07-061-1/+7
|\ \ \ \ \ \
| * | | | | | CI: fix cachingliushuyu2022-07-051-1/+7
* | | | | | | Merge pull request #8532 from liamwhite/fiber-supplementsliamwhite2022-07-069-170/+79
|\ \ \ \ \ \ \
| * | | | | | | common/fiber: make fibers easier to useLiam2022-07-029-170/+79
* | | | | | | | Merge pull request #8477 from Docteh/less_globalMorph2022-07-051-3/+3
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | tweak API usage in qt_web_browser.cppKyle Kienapfel2022-06-221-3/+3
* | | | | | | | Merge pull request #8521 from lat9nq/gdbstub-in-boundsMorph2022-07-051-2/+6
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | gdbstub_arch: Directly access SP registerlat9nq2022-06-301-2/+6
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8523 from liamwhite/sc-oopsieFernando S2022-07-012-1/+8
|\ \ \ \ \ \ \
| * | | | | | | cpu_manager: properly check idle on return from preemptionLiam2022-06-302-1/+8
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8490 from liamwhite/read-code-stopMorph2022-07-014-24/+64
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | dynarmic: Stop ReadCode callbacks to unmapped addressesLiam2022-06-224-24/+64
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #7454 from FernandoS27/new-core-timingFernando S2022-06-308-73/+133
|\ \ \ \ \ \
| * | | | | | Adress Feedback.Fernando Sahmkow2022-06-303-19/+29
| * | | | | | Native clock: Use atomic ops as before.Fernando Sahmkow2022-06-282-24/+29
| * | | | | | Native Clock: remove inaccuracy mask.Fernando Sahmkow2022-06-282-6/+1
| * | | | | | Address feedback.Fernando Sahmkow2022-06-281-13/+13
| * | | | | | Core: Protect each event from race conditions within it.Fernando Sahmkow2022-06-282-0/+2
| * | | | | | Core: Fix tests.Fernando Sahmkow2022-06-283-2/+5
| * | | | | | Core: add missing include.Fernando Sahmkow2022-06-281-0/+1
| * | | | | | Core/Common: Corrections to core timing and add critical priority.Fernando Sahmkow2022-06-283-5/+11
| * | | | | | Core: Reimplement Core Timing.Fernando Sahmkow2022-06-283-55/+93
| * | | | | | Common: improve native clock.Fernando Sahmkow2022-06-283-29/+29
* | | | | | | Revert "vulkan_device: Block AMDVLK's VK_KHR_push_descriptor"lat9nq2022-06-291-11/+0
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #8512 from german77/nnResultMorph2022-06-29177-1450/+1404
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | video_core: Replace VKUpdateDescriptorQueue with UpdateDescriptorQueuegerman772022-06-2714-33/+33
| * | | | | video_core: Replace VKSwapchain with Swapchaingerman772022-06-275-25/+23
| * | | | | video_core: Replace VKQueryCache with QueryCachegerman772022-06-276-28/+27
| * | | | | video_core: Replace VKScheduler with Schedulergerman772022-06-2735-111/+110
| * | | | | video_core: Replace VKBlitScreen with BlitScreengerman772022-06-273-51/+51
| * | | | | video_core: Replace VKFenceManager with FenceManagergerman772022-06-273-15/+14
| * | | | | core: kernel: Replace instances of KPageLinkedList with KPageGroupgerman772022-06-2711-64/+63
| * | | | | core: Replace all instances of ResultCode with Resultgerman772022-06-27140-1176/+1136
* | | | | | Merge pull request #8504 from comex/mesosphere-current-processbunnei2022-06-271-0/+24
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Re-add missing `case` and braces, and trim whitespacecomex2022-06-261-1/+3
| * | | | | Update src/core/hle/kernel/svc.cppcomex2022-06-261-6/+14
| * | | | | Support InfoType_MesosphereCurrentProcesscomex2022-06-261-0/+14
* | | | | | Merge pull request #8475 from liamwhite/x18bunnei2022-06-2613-52/+69
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | kernel: make current thread pointer thread localLiam2022-06-2313-52/+69
| | |_|/ / | |/| | |
* / | | | gdbstub: fix register pokesLiam2022-06-251-0/+1
|/ / / /
* | | | Merge pull request #8491 from Morph1984/extra-assertbunnei2022-06-221-1/+0
|\ \ \ \
| * | | | KPageTable: Remove extraneous assertMorph2022-06-221-1/+0
| |/ / /
* | | | Merge pull request #8483 from liamwhite/fire-emblem-three-semaphoresbunnei2022-06-223-0/+22
|\ \ \ \ | |/ / / |/| | |
| * | | kernel: wait for threads to stop on pauseLiam2022-06-183-0/+22
* | | | Merge pull request #8432 from liamwhite/watchpointbunnei2022-06-2218-54/+510
|\ \ \ \
| * | | | core/debugger: memory breakpoint supportLiam2022-06-1618-54/+510
* | | | | Merge pull request #8468 from liamwhite/dispatch-trackingbunnei2022-06-224-14/+7
|\ \ \ \ \
| * | | | | kernel: fix some uses of disable_countLiam2022-06-164-14/+7
| |/ / / /
* | / / / service: am: Stub PerformSystemButtonPressingIfInFocusNarr the Reg2022-06-202-1/+24
| |/ / / |/| | |
* | | | core: fix initialization in single core, sync GPU modeLiam2022-06-174-0/+13
* | | | Merge pull request #8472 from german77/taceMorph2022-06-161-3/+3
|\ \ \ \
| * | | | common: param_package: Demote DEBUG to TRACE for gettersNarr the Reg2022-06-161-3/+3
* | | | | Make yuzu-cmd respect log_filter settingNikita Strygin2022-06-161-0/+6
* | | | | Implement ExitProcess svcNikita Strygin2022-06-161-1/+2
| |/ / / |/| | |
* | | | Merge pull request #8457 from liamwhite/kprocess-suspendFernando S2022-06-1612-212/+199
|\ \ \ \
| * | | | kernel: implement KProcess suspensionLiam2022-06-1412-212/+199
| |/ / /
* | | | Merge pull request #8460 from Morph1984/bounded-qliamwhite2022-06-162-87/+74
|\ \ \ \
| * | | | bounded_threadsafe_queue: Use constexpr capacity and maskMorph2022-06-152-87/+74
* | | | | Merge pull request #8317 from german77/notifabunnei2022-06-152-8/+172
|\ \ \ \ \
| * | | | | service: notifa: Implement most part of this servicegerman772022-05-092-8/+172
* | | | | | Merge pull request #8464 from liamwhite/break-debugMai2022-06-151-0/+7
|\ \ \ \ \ \
| * | | | | | kernel: notify debugger on break SVCLiam2022-06-151-0/+7
| | |_|/ / / | |/| | | |
* | | | | | vk_compute_pass: Explicitly cast to VkAccessFlagsMorph2022-06-151-25/+26
* | | | | | Merge pull request #8383 from Morph1984/shadow-of-the-pastMai2022-06-1535-153/+139
|\ \ \ \ \ \
| * | | | | | main: Eliminate variable shadowingMorph2022-06-141-3/+2
| * | | | | | wait_tree: Eliminate variable shadowingMorph2022-06-142-12/+12
| * | | | | | configure_ringcon: Eliminate variable shadowingMorph2022-06-141-4/+4
| * | | | | | configure_touch_from_button: Eliminate variable shadowingMorph2022-06-142-3/+3
| * | | | | | configure_per_game: Eliminate variable shadowingMorph2022-06-142-4/+4
| * | | | | | configure_input_player: Eliminate variable shadowingMorph2022-06-141-39/+39
| * | | | | | configure_dialog: Eliminate variable shadowingMorph2022-06-142-5/+4
| * | | | | | bootmanager: Eliminate variable shadowingMorph2022-06-141-1/+1
| * | | | | | game_list: Eliminate variable shadowingMorph2022-06-145-19/+19
| * | | | | | yuzu_cmd: Eliminate variable shadowingMorph2022-06-145-7/+7
| * | | | | | audio_core: Remove -Werror=unused-parameterMorph2022-06-141-1/+0
| * | | | | | CMakeLists: Make variable shadowing a compile-time errorMorph2022-06-146-16/+5
| * | | | | | common: Eliminate variable shadowingMorph2022-06-141-2/+2
| * | | | | | yuzu: Eliminate variable shadowingMorph2022-06-1410-25/+25
| * | | | | | web_service: Eliminate variable shadowingMorph2022-06-142-12/+12
* | | | | | | core: centralize profile scope for DynarmicLiam2022-06-153-7/+2
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #8461 from Morph1984/msvc-narrow-convMorph2022-06-141-1/+1
|\ \ \ \ \ \
| * | | | | | vk_compute_pass: Use VK_ACCESS_NONEMorph2022-06-141-1/+1
* | | | | | | Merge pull request #8434 from german77/uuidMorph2022-06-142-33/+38
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | input_common: Replace usage of string guid to common uuidNarr the Reg2022-06-072-33/+38
* | | | | | | Merge pull request #8439 from liamwhite/monkey-compilerMai2022-06-1479-213/+216
|\ \ \ \ \ \ \
| * | | | | | | kernel: fix passthrough of local captures in lambdaLiam2022-06-141-1/+3
| * | | | | | | common/assert: rework ASSERT handling to avoid std::function usageLiam2022-06-142-35/+20
| * | | | | | | general: fix compilation on MinGW GCC 12Liam2022-06-142-6/+5
| * | | | | | | common/assert: add unlikelyLiam2022-06-141-1/+1
| * | | | | | | general: fix compilation on GCC 12Liam2022-06-142-2/+2
| * | | | | | | kernel: ensure class token lambda exit is unreachableLiam2022-06-141-0/+1
| * | | | | | | kernel: fix inconsistency in AutoObjectTraits macro definitionsLiam2022-06-141-4/+7
| * | | | | | | common: Don't test ASSERT conditions inlineLiam2022-06-142-32/+36
| * | | | | | | common: Change semantics of UNREACHABLE to unconditionally crashLiam2022-06-1472-173/+182
| | |_|_|/ / / | |/| | | | |
* / | | | | | vk_compute_pass: Silence Wextra warningMorph2022-06-141-1/+1
|/ / / / / /
* | | | | | Merge pull request #8458 from lat9nq/no-constexpr-flow-blockliamwhite2022-06-141-6/+0
|\ \ \ \ \ \
| * | | | | | structured_control_flow: Remove constexpr Flow::Blocklat9nq2022-06-141-6/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8388 from liamwhite/simpler-pausebunnei2022-06-143-95/+36
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | CpuManager: simplify pausingLiam2022-06-093-95/+36
* | | | | | Merge pull request #8446 from liamwhite/cmd-gdbMorph2022-06-1312-8/+96
|\ \ \ \ \ \
| * | | | | | yuzu-cmd: ignore bogus timeous from SDLLiam2022-06-101-1/+9
| * | | | | | core/debugger: fix a number of shutdown deadlocksLiam2022-06-109-7/+72
| * | | | | | core/debugger: support operation in yuzu-cmdLiam2022-06-103-0/+15
| |/ / / / /
* | | | | | Merge pull request #8454 from liamwhite/inaddr-anyMorph2022-06-131-1/+1
|\ \ \ \ \ \
| * | | | | | core/debugger: allow remote connectionsLiam2022-06-121-1/+1
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #8443 from liamwhite/code-membunnei2022-06-133-26/+118
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | kernel: fix KCodeMemory initializationLiam2022-06-093-26/+118
| |/ / / /
* | | | | gdbstub_arch: Add missing virtual destructorLioncash2022-06-121-0/+1
* | | | | Merge pull request #8353 from Docteh/msvc_report_runtimeMai M2022-06-112-0/+30
|\ \ \ \ \
| * | | | | log the MSVC runtime version when running on MSVC buildKyle Kienapfel2022-06-112-0/+30
* | | | | | Merge pull request #8427 from Docteh/deprecate_qdesktopMai M2022-06-111-3/+15
|\ \ \ \ \ \
| * | | | | | deprecate usage of QDesktopWidget for going fullscreenKyle Kienapfel2022-06-061-3/+15
* | | | | | | Merge pull request #8449 from Docteh/translate_placeholderMai M2022-06-112-1/+16
|\ \ \ \ \ \ \
| * | | | | | | UI: retranslate the game list placeholderKyle Kienapfel2022-06-112-1/+16
| |/ / / / / /
* | | | | | | Merge pull request #8413 from behunin/bounded-queuebunnei2022-06-113-4/+185
|\ \ \ \ \ \ \
| * | | | | | | gpu_thread: Move to bounded queueLevi Behunin2022-06-033-4/+185
* | | | | | | | Merge pull request #8393 from lat9nq/default-vulkanbunnei2022-06-1112-48/+184
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | configure_graphics: Remove unused includelat9nq2022-06-041-1/+0
| * | | | | | | main: Insert warning text on broken Vulkanlat9nq2022-05-301-1/+6
| * | | | | | | main: Save config on broken Vulkan detectlat9nq2022-05-301-0/+2
| * | | | | | | yuzu-qt: Make has_broken_vulkan only for crasheslat9nq2022-05-305-11/+17
| * | | | | | | vulkan_library: Add debug logginglat9nq2022-05-301-0/+4
| * | | | | | | yuzu-qt: Attempt to workaround broken Vulkan installationslat9nq2022-05-309-46/+166
| * | | | | | | default_ini: Reflect new renderer backend default settinglat9nq2022-05-301-1/+1
| * | | | | | | settings: Set Vulkan to the default renderer backendlat9nq2022-05-301-1/+1
* | | | | | | | Merge pull request #8405 from Docteh/dock_undockMai M2022-06-112-5/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | ui: Status bars dock button becomes dock/undock buttonKyle Kienapfel2022-06-022-5/+11
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8333 from Docteh/translate_hotkeysMai M2022-06-112-26/+40
|\ \ \ \ \ \ \ \
| * | | | | | | | UI: Translate hotkey labels in configurationKyle K2022-05-192-26/+40
* | | | | | | | | Merge pull request #8318 from Docteh/cmake-qt56-entryMai M2022-06-1110-35/+25
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | motion touch ui: move remaining connection out of .ui fileKyle K2022-05-302-18/+3
| * | | | | | | | | Update some files with Qt 5.15.2 best practices in mindKyle K2022-05-298-17/+22
* | | | | | | | | | service: hid: Fix gesture regressionNarr the Reg2022-06-102-4/+3
| |_|_|_|_|/ / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #8428 from bunnei/nvflinger-fix-timingbunnei2022-06-083-31/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hle: service: nvflinger: buffer_queue_consumer: Always free released buffers.bunnei2022-06-063-31/+3
* | | | | | | | | | core/debugger: fix asio write usageLiam2022-06-071-2/+2
* | | | | | | | | | core/debugger: fix crash due to incorrect lambda captureLiam2022-06-071-8/+9
* | | | | | | | | | Merge pull request #8367 from Docteh/say_win11bunnei2022-06-061-1/+26
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Logging: Report Post Windows 10 2004 versions, like Windows 11Kyle K2022-05-291-1/+26
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8426 from liamwhite/elfbunnei2022-06-065-263/+371
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | common: consolidate ELF structure definitionsLiam2022-06-055-263/+371
* | | | | | | | | | Merge pull request #8419 from liamwhite/library-listMai M2022-06-061-22/+28
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / |/| | | | | | | | |
| * | | | | | | | | gdbstub: add missing library list commandLiam2022-06-041-22/+28
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8395 from german77/ir_stubbunnei2022-06-042-21/+460
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service: hid: Improve stub of IRSNarr the Reg2022-05-312-21/+460
* | | | | | | | | | Maxwell3D: Fix 3D semaphore counter type 0 handlingBilly Laws2022-06-022-3/+3
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #8410 from liamwhite/thread-namesMai M2022-06-024-14/+172
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | |
| * | | | | | | | core/debugger: Support reading guest thread namesLiam2022-06-024-14/+172
* | | | | | | | | Merge pull request #8409 from liamwhite/tdesc-fixMai M2022-06-022-10/+87
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | gdbstub: fix target descriptionsLiam2022-06-022-10/+87
* | | | | | | | | Merge pull request #8402 from liamwhite/better-stepMorph2022-06-0215-122/+247
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | core/debugger: Improved stepping mechanism and misc fixesLiam2022-06-0115-122/+247
* | | | | | | | | Merge pull request #8400 from Docteh/fullscreen_glitchbunnei2022-06-011-0/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | fix UI opening fullscreen after certain crashesKyle Kienapfel2022-06-011-0/+4
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8404 from Morph1984/virtualliamwhite2022-06-013-2/+6
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core/debugger: Define defaulted virtual destructorsMorph2022-06-013-2/+6
| | |/ / / / / / / | |/| | | | | | |
* / | | | | | | | gdbstub: Explicitly cast return type to u8Morph2022-06-011-2/+2
|/ / / / / / / /
* | / / / / / / core/debugger: Implement new GDB stub debuggerLiam2022-06-0127-42/+1500
| |/ / / / / / |/| | | | | |
* | | | | | | Merge pull request #8368 from german77/seventimesbunnei2022-05-306-368/+643
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | service: hid: Implement ResetIsSixAxisSensorDeviceNewlyAssignedgerman772022-05-275-6/+125
| * | | | | | service: hid: Implement LoadSixAxisSensorCalibrationParameter and GetSixAxisSensorIcInformationgerman772022-05-275-3/+136
| * | | | | | service: hid: Implement EnableSixAxisSensorUnalteredPassthrough and IsSixAxisSensorUnalteredPassthroughEnabledgerman772022-05-274-2/+88
| * | | | | | service: hid: Add error handling to sixaxis functionsgerman772022-05-273-31/+55
| * | | | | | service: hid: Refractor sixaxis functionsgerman772022-05-272-185/+88
| * | | | | | service: hid: Implement MergeSingleJoyAsDualJoy according to REgerman772022-05-274-65/+57
| * | | | | | service: hid: Add error handling to setNpadAssignment and variantsgerman772022-05-273-23/+27
| * | | | | | service: hid: Quick RE fixes and commentsgerman772022-05-274-54/+68
* | | | | | | Merge pull request #8332 from Morph1984/reduce_exec_sizebunnei2022-05-294-19/+18
|\ \ \ \ \ \ \
| * | | | | | | time_zone_manager: Use s8 for month length tablesMorph2022-05-131-4/+3
| * | | | | | | video_core/surface: Use u8 for PixelFormat block tablesMorph2022-05-131-3/+3
| * | | | | | | codecs/vp9: Use u8 for norm and map lutsMorph2022-05-131-4/+4
| * | | | | | | command_generator: Use u8 for tap index lutMorph2022-05-131-8/+8
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #8339 from Docteh/about_iconbunnei2022-05-292-3/+19
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | about dialog: Fix the logo in a multiplatform wayKyle K2022-05-162-3/+19
| |/ / / / /
* | | | | | Merge pull request #8385 from lat9nq/just-subsys-winMai M2022-05-281-1/+1
|\ \ \ \ \ \
| * | | | | | yuzu-qt: Call -Wl,--subsystem,windows directlylat9nq2022-05-281-1/+1
* | | | | | | Merge pull request #8374 from german77/asnycvibrationsbunnei2022-05-284-7/+63
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | input_common: Make vibration request asyncNarr the Reg2022-05-234-7/+63
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #8372 from german77/touchbunnei2022-05-278-92/+140
|\ \ \ \ \ \
| * | | | | | input_common: touch: Rewrite touch driver to support multiple touch pointsgerman772022-05-238-92/+140
| |/ / / / /
* | | | | | path_util: Resolve `-Wpointer-bool-conversion` warninglat9nq2022-05-271-3/+1
* | | | | | Merge pull request #8379 from lat9nq/amd-push-desc-workaroundbunnei2022-05-251-0/+11
|\ \ \ \ \ \
| * | | | | | vulkan_device: Block AMDVLK's VK_KHR_push_descriptorlat9nq2022-05-251-0/+11
| |/ / / / /
* | | | | | Merge pull request #8369 from lat9nq/amd-wmel-workaroundbunnei2022-05-251-1/+6
|\ \ \ \ \ \
| * | | | | | vulkan_device: Workaround extension buglat9nq2022-05-251-1/+6
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #8311 from asLody/fix-stencil-facesbunnei2022-05-251-2/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | vk_rasterizer: fix stencil test when two faces are disabledLody2022-05-061-2/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #8342 from lat9nq/clang-latest-stdc++liamwhite2022-05-214-16/+25
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | qt_software_keyboard: Address review feedbacklat9nq2022-05-161-14/+14
| * | | | main: Use Common::U16StringFromBufferlat9nq2022-05-161-2/+4
| * | | | qt_software_keyboard: Use Common::U16StringFromBufferlat9nq2022-05-161-14/+15
| * | | | string_util: Add U16StringFromBufferlat9nq2022-05-162-0/+6
* | | | | video_core: Support new VkResultAlexandre Bouvier2022-05-171-0/+2
|/ / / /
* | / / general: Avoid ambiguous format_to compilation errorsLioncash2022-05-143-3/+3
| |/ / |/| |
* | | Merge pull request #8308 from german77/disablesixMorph2022-05-112-52/+47
|\ \ \
| * | | service: hid: Fix motion refresh rateNarr the Reg2022-05-062-2/+6
| * | | service: hid: Disable correctly motion inputgerman772022-05-061-50/+41
| |/ /
* | | Merge pull request #8314 from liamwhite/gl-flip-2Morph2022-05-111-4/+3
|\ \ \
| * | | OpenGL: implement face flips according to NDCLiam2022-05-071-4/+3
| |/ /
* | | Merge pull request #8313 from liamwhite/dma-bppMorph2022-05-111-3/+6
|\ \ \
| * | | maxwell_dma: use fallback if remapping is enabledLiam2022-05-111-3/+6
| * | | maxwell_dma: fix bytes per pixelLiam2022-05-071-3/+3
| |/ /
* | | video_core/macro: clear code on upload address assignmentLiam2022-05-103-0/+10
* | | VideoCore: Add option to dump the macros.Fernando Sahmkow2022-05-094-0/+44
* | | video_core/macro_jit_x64: warn on invalid parameter accessLiam2022-05-081-3/+21
|/ /
* | hle/result: Update std::expected replacement messageMorph2022-05-031-1/+1
* | hle/result: Add ResultRange overload in ResultValMorph2022-05-031-1/+3
* | Merge pull request #8272 from german77/stick_rangebunnei2022-05-034-9/+30
|\ \
| * | yuzu: Config allow to delete single axis directions when buttons are mapped to a stickNarr the Reg2022-04-272-3/+24
| * | yuzu: config: Set default range to 95%Narr the Reg2022-04-273-6/+6
* | | hle/result: Implement ResultRangeMorph2022-05-031-0/+42
* | | ui: retranslate the network tabKyle K2022-05-022-2/+11
* | | ui: let system locale control format of Custom RTCKyle K2022-05-011-3/+0
* | | Merge pull request #8274 from german77/firmwareMorph2022-04-292-1/+21
|\ \ \
| * | | service: hid: Stub IsFirmwareUpdateNeededForNotificationgerman772022-04-272-1/+21
| |/ /
* | | Merge pull request #8280 from Tachi107/spdx-fixupMai M2022-04-2933-357/+90
|\ \ \
| * | | chore: add missing SPDX tagsAndrea Pappacoda2022-04-2833-357/+90
* | | | Merge pull request #8282 from liamwhite/gcc-12Mai M2022-04-293-4/+4
|\ \ \ \ | |/ / / |/| | |
| * | | GCC 12 fixesLiam2022-04-283-4/+4
* | | | Merge pull request #8267 from Morph1984/swapbuffersbunnei2022-04-281-0/+5
|\ \ \ \
| * | | | renderer_vulkan: Update screen info if the framebuffer size has changedMorph2022-04-261-0/+5
| | |/ / | |/| |
* | | | Merge pull request #8236 from Docteh/sort_translationsMai M2022-04-281-6/+67
|\ \ \ \
| * | | | Changes to language order in General -> UI -> Interface LanguageKyle K2022-04-271-6/+67
* | | | | Merge pull request #8229 from german77/reinterpret2bunnei2022-04-2722-386/+429
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service: hid: Ensure all structs are initializedNarr the Reg2022-04-2416-104/+105
| * | | | service: hid: Access shared memory directlyNarr the Reg2022-04-2321-305/+347
| |/ / /
* | | | Merge pull request #8261 from liamwhite/jit-cleanupMai M2022-04-253-132/+225
|\ \ \ \ | |_|/ / |/| | |
| * | | service: jit: document and clean upLiam2022-04-253-132/+225
| |/ /
* | | Merge pull request #8260 from Morph1984/c4146Mai M2022-04-251-1/+1
|\ \ \
| * | | kernel: svc: Replace -1ULL with 0xFFFFFFFFFFFFFFFFMorph2022-04-241-1/+1
| |/ /
* / / Remove unused PrepareReschedule functionMerry2022-04-247-20/+0
|/ /
* | Merge pull request #8249 from german77/queuedMorph2022-04-231-3/+5
|\ \
| * | hotkeys: Trigger actions on a separate threadNarr the Reg2022-04-231-3/+5
* | | general: Convert source file copyright comments over to SPDXMorph2022-04-231366-4208/+2745
* | | Merge pull request #7976 from BytesGalore/masterbunnei2022-04-231-1/+2
|\ \ \
| * \ \ Merge branch 'yuzu-emu:master' into masterBytesGalore2022-03-061-2/+2
| |\ \ \
| * | | | loader: log the type of mismatching file-extensionBytesGalore2022-03-031-1/+2
* | | | | Merge pull request #7978 from german77/sidewaybunnei2022-04-2210-0/+127
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | input_common: Map sticks correctly when mapped sidewaysNarr the Reg2022-03-2210-0/+127
* | | | | Merge pull request #8222 from german77/sixaxis_testbunnei2022-04-226-99/+363
|\ \ \ \ \
| * | | | | service: hid: Improve accuracy of sixaxis functionsNarr the Reg2022-04-186-99/+363
* | | | | | Merge pull request #8192 from german77/screenshotMai M2022-04-213-0/+13
|\ \ \ \ \ \
| * | | | | | bootmanager: Don't create another screenshot request if previous one is not done yetgerman772022-04-183-0/+13
| |/ / / / /
* | | | | | Merge pull request #8232 from liamwhite/backtraceMai M2022-04-216-90/+98
|\ \ \ \ \ \
| * | | | | | core/arm: separate backtrace collectionLiam2022-04-216-90/+98
* | | | | | | Merge pull request #8231 from german77/warningMai M2022-04-211-0/+9
|\ \ \ \ \ \ \
| * | | | | | | input_common: Ignore boost uninitialized local variableNarr the Reg2022-04-211-0/+9
* | | | | | | | Merge pull request #8224 from Docteh/hihi1bunnei2022-04-201-1/+19
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | ui: translate hat directionsKyle K2022-04-191-1/+19
| | |/ / / / / | |/| | | | |
* | | | | | | Prevent the mouse cursor from leaving the window when mouse panning is enabledPurple2022-04-192-2/+41
| |/ / / / / |/| | | | |
* | | | | | yuzu: mention GPLv3.0+ in about dialogAndrea Pappacoda2022-04-181-1/+1
|/ / / / /
* | | | | Merge pull request #8204 from Docteh/translate_gameslistMai M2022-04-173-3/+6
|\ \ \ \ \
| * | | | | ui: Fix Game Compatibility list translationsKyle K2022-04-173-3/+6
* | | | | | Merge pull request #6558 from german77/ringcon2Fernando S2022-04-1629-28/+2608
|\ \ \ \ \ \
| * | | | | | yuzu: Call ignore event after ensuring it's initializedNarr the Reg2022-04-162-2/+2
| * | | | | | yuzu: Add custom ringcon configurationgerman772022-04-1619-65/+992
| * | | | | | hidbus: Implement hidbus and ringcongerman772022-04-1614-26/+1679
* | | | | | | Merge pull request #8188 from merryhime/jit-race-page-table-changedbunnei2022-04-164-57/+84
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | dynarmic: Fix race when switching page tablesmerry2022-04-104-57/+84
* | | | | | | Merge pull request #8205 from liamwhite/n64-miscFernando S2022-04-1611-9/+127
|\ \ \ \ \ \ \
| * | | | | | | video_core: implement formats for N64 emulationFernando Sahmkow2022-04-148-7/+102
| * | | | | | | buffer_cache: cap vertex buffer sizesLiam2022-04-141-1/+14
| * | | | | | | maxwell3d: add small_index_2 registerLiam2022-04-142-1/+11
* | | | | | | | Merge pull request #8172 from bunnei/kernel-mutexFernando S2022-04-1612-89/+46
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | core: hle: kernel: k_thread: Rework dummy thread waiting.bunnei2022-04-122-28/+21
| * | | | | | | core: hle: service: Allocate a service thread.bunnei2022-04-121-1/+2
| * | | | | | | hle: kernel: k_spin_lock: Remove unused ThreadPause.bunnei2022-04-121-28/+0
| * | | | | | | hle: kernel: Use std::mutex instead of spin locks for most kernel locking.bunnei2022-04-1210-32/+23
* | | | | | | | Merge pull request #8190 from Docteh/palswapbunnei2022-04-143-0/+18
|\ \ \ \ \ \ \ \
| * | | | | | | | ui: Touching QPalette::Text broke dark -> light UI. don't doKyle K2022-04-121-2/+0
| * | | | | | | | ui: Set Link Color when setting themeKyle K2022-04-113-0/+20
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #8027 from lat9nq/cmd-fullscreen-sizebunnei2022-04-141-6/+7
|\ \ \ \ \ \ \ \
| * | | | | | | | emu_window_sdl2: Set window size to display dimensions for exclusive fullscreenlat9nq2022-03-151-6/+7
* | | | | | | | | Merge pull request #8202 from merryhime/fix-single-coreFernando S2022-04-132-2/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | dynarmic: Fix single core modemerry2022-04-132-2/+2
| | |_|_|/ / / / / | |/| | | | | | |
* / | | | | | | | service: jit: Implement the JIT serviceLiam2022-04-135-9/+784
|/ / / / / / / /
* | | | | | | | Merge pull request #8165 from bunnei/ensure-session-port-cleanupbunnei2022-04-128-25/+53
|\ \ \ \ \ \ \ \
| * | | | | | | | hle: kernel: Unify and integrate reference tracking for KServerPort/KServerSession.bunnei2022-04-086-13/+46
| * | | | | | | | hle: kernel: k_server_port: Release ref-counted host emulation members on Destroy.bunnei2022-04-081-0/+3
| * | | | | | | | hle: kernel: k_auto_object: Move unregister with kernel to after Destroy.bunnei2022-04-081-3/+2
| * | | | | | | | hle: service: sm: Remove manual tracking of KServerPorts.bunnei2022-04-082-8/+1
| * | | | | | | | hle: kernel: hle_ipc: HasSessionRequestHandler: Check if domain handler is expired rather than locking.bunnei2022-04-081-1/+1
* | | | | | | | | Merge pull request #8178 from tech-ticks/skyline-icache-fixbunnei2022-04-124-15/+34
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | hle: kernel: Invalidate entire icache in UnmapProcessMemory and UnmapCodeMemory (fixes #8174)tech-ticks2022-04-094-15/+34
* | | | | | | | | Merge pull request #8157 from lat9nq/kernel-racesbunnei2022-04-127-13/+15
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | k_system_control: Fix data racelat9nq2022-04-061-3/+3
| * | | | | | | | | k_auto_object: Fix data racelat9nq2022-04-041-1/+1
| * | | | | | | | | k_thread: Fix data racelat9nq2022-04-042-3/+4
| * | | | | | | | | k_process: Fix data racelat9nq2022-04-041-1/+1
| * | | | | | | | | kernel: Fix current_process racelat9nq2022-04-041-4/+4
| * | | | | | | | | k_scheduler_lock: Fix data racelat9nq2022-04-041-1/+2
* | | | | | | | | | service: sfdnsres: add missing includes for some BSDs after 82d46a974ad4Jan Beich2022-04-121-0/+4
* | | | | | | | | | Merge pull request #8180 from liamwhite/symbolsFernando S2022-04-114-129/+231
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | core: extract symbol readingLiam2022-04-094-129/+231
* | | | | | | | | | | Merge pull request #8171 from tech-ticks/skyline-improvementsFernando S2022-04-107-30/+245
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | service: sfdnsres: Implement DNS address resolutiontech-ticks2022-04-082-5/+197
| * | | | | | | | | | service: bsd: Add keepalive socket optiontech-ticks2022-04-074-0/+10
| * | | | | | | | | | patch_manager: Apply layered exefs patches from 'atmosphere' SD directorytech-ticks2022-04-071-25/+38
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8149 from liamwhite/front-facebunnei2022-04-091-1/+8
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | OpenGL: propagate face flip conditionLiam2022-04-041-4/+10
| * | | | | | | | | OpenGL: flip front faces if Z scale is invertedLiam2022-04-041-2/+3
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8138 from german77/data-no-racebunnei2022-04-086-176/+256
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | core: hid: Fix double lock on softlock and forced updatesNarr the Reg2022-04-081-2/+12
| * | | | | | | | core: hid: Replace lock_guard with scoped_lockNarr the Reg2022-04-073-44/+44
| * | | | | | | | core: hid: Reduce the amount of dataracesgerman772022-04-076-176/+246
* | | | | | | | | Merge pull request #8169 from merryhime/scoped_lockbunnei2022-04-0829-105/+105
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core/hle: Standardize scoped_lock initializersMerry2022-04-075-23/+23
| * | | | | | | | | yuzu/util: Replace lock_guard with scoped_lockMerry2022-04-071-1/+1
| * | | | | | | | | web_service: Replace lock_guard with scoped_lockMerry2022-04-071-2/+2
| * | | | | | | | | video_core: Replace lock_guard with scoped_lockMerry2022-04-0711-18/+18
| * | | | | | | | | input_common: Replace lock_guard with scoped_lockMerry2022-04-072-29/+29
| * | | | | | | | | core: Replace lock_guard with scoped_lockMerry2022-04-072-14/+14
| * | | | | | | | | core/hle: Replace lock_guard with scoped_lockMerry2022-04-074-13/+13
| * | | | | | | | | common: Replace lock_guard with scoped_lockMerry2022-04-073-5/+5
* | | | | | | | | | CMakeLists: Enforce C4505 and C5245Morph2022-04-081-0/+2
* | | | | | | | | | Merge pull request #8167 from Tachi107/patch-1merry2022-04-071-2/+0
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | fix: remove #pragma once in .cpp fileAndrea Pappacoda2022-04-071-2/+0
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8161 from liamwhite/gl-s8d24Fernando S2022-04-076-4/+58
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | OpenGL: fix S8D24 to ABGR8 conversionsLiam2022-04-076-4/+58
* | | | | | | | | | Merge pull request #8152 from liamwhite/gl-cropFernando S2022-04-073-1/+10
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | OpenGL: fix croppingLiam2022-04-043-1/+10
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8150 from liamwhite/vk-cropFernando S2022-04-071-2/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Vulkan: crop to screen dimensions if crop not explicitly requestedLiam2022-04-041-2/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #8148 from merryhime/interruptsFernando S2022-04-076-45/+42
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | arm_dynarmic: Use HaltReason for svc calls and reschedulesmerry2022-04-034-27/+19
| * | | | | | | | | | dynarmic: Better interruptsmerry2022-04-036-22/+27
* | | | | | | | | | | Merge pull request #8143 from merryhime/rdtscFernando S2022-04-071-14/+35
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | native_clock: Internal linkage for FencedRDTSCMerry2022-04-031-2/+4
| * | | | | | | | | | | native_clock: Use lfence with rdtscmerry2022-04-031-14/+33
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8133 from liamwhite/gl-spv-cbufFernando S2022-04-076-25/+51
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | shader_recompiler: Decrease indirect cbuf limit to match hardwareLiam2022-04-041-1/+1
| * | | | | | | | | | shader_compiler: support const buffer indirect addressing in GLSLLiam2022-04-014-9/+38
| * | | | | | | | | | shader_recompiler: support const buffer indirect addressing on OpenGL SPIR-VLiam2022-04-013-17/+14
* | | | | | | | | | | Merge pull request #8164 from liamwhite/jit-stubbunnei2022-04-078-1/+88
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service: jit: stub JIT serviceLiam2022-04-078-1/+88
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8122 from bunnei/improve-thread-usagebunnei2022-04-0613-27/+74
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | hle: service: nvdrv: Create a service thread where appropriate.Morph2022-04-021-1/+1
| * | | | | | | | | | hle: service: vi: Create a service thread where appropriate.bunnei2022-04-021-1/+2
| * | | | | | | | | | hle: service: bsd: Create a service thread where appropriate.bunnei2022-04-021-1/+2
| * | | | | | | | | | hle: service: filesystem: Create a service thread where appropriate.bunnei2022-04-021-5/+8
| * | | | | | | | | | hle: service: audio: Create a service thread where appropriate.bunnei2022-04-022-4/+6
| * | | | | | | | | | hle: service: Add option for service interfaces to create or use the default thread.bunnei2022-04-025-11/+29
| * | | | | | | | | | hle: kernel: Create a default thread for services that do not need their own host thread.bunnei2022-04-022-4/+26
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | service: hid: Partially revert #8123german772022-04-061-0/+4
* | | | | | | | | | Merge pull request #8137 from bunnei/improve-nvflinger-2bunnei2022-04-069-91/+99
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | hle: service: nvflinger: buffer_queue_producer: Cleanup & fixes.bunnei2022-04-022-61/+42
| * | | | | | | | | hle: service: nvflinger: consumer_base: Cleanup & fixes.bunnei2022-04-022-15/+17
| * | | | | | | | | hle: service: nvflinger: buffer_queue_producer: Cleanup & add GetReleasedBuffers.bunnei2022-04-022-10/+38
| * | | | | | | | | hle: service: nvflinger: buffer_queue_core: Cleanup & fixes.bunnei2022-04-022-3/+0
| * | | | | | | | | hle: service: nvflinger: Use correct logger namespace.bunnei2022-04-021-2/+2
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8100 from Morph1984/registered-crashbunnei2022-04-061-2/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | registered_cache: Prevent nullptr dereference when accumulating filesMorph2022-03-271-2/+4
* | | | | | | | | | Merge pull request #8159 from merryhime/pstMai M2022-04-052-0/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | dynarmic: Print stack trace on unrecognised instruction or other exceptionmerry2022-04-052-0/+4
* | | | | | | | | | | build: remove -fconceptsAndrea Pappacoda2022-04-051-6/+0
|/ / / / / / / / / /
* | | | | | | | | | Revert "texture_cache/util: Remove unneeded ReadBlockUnsafe"bunnei2022-04-051-0/+1
* | | | | | | | | | texture_cache/util: Remove unneeded ReadBlockUnsafeameerj2022-04-041-1/+0
* | | | | | | | | | Merge pull request #8089 from merryhime/paranoiabunnei2022-04-044-45/+63
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | configure_cpu: More descriptive text for Paranoid optionmerry2022-03-261-1/+1
| * | | | | | | | | configuration: Add Paranoid CPU accuracy levelmerry2022-03-264-45/+63
* | | | | | | | | | Merge pull request #8105 from merryhime/atomicload128bunnei2022-04-032-4/+96
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | native_clock: Use writeback from CAS to avoid double-loadingmerry2022-04-021-4/+6
| * | | | | | | | | | atomic_ops: Implement AtomicCompareAndSwap with writebackmerry2022-04-021-0/+73
| * | | | | | | | | | native_clock: Use AtomicLoad128Merry2022-04-021-2/+2
| * | | | | | | | | | atomic_ops: Implement AtomicLoad128Merry2022-04-021-0/+17
* | | | | | | | | | | Merge pull request #8135 from Morph1984/websession-hackbunnei2022-04-031-0/+8
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | applets/web: Keep foreground (websession) web applet openMorph2022-04-021-0/+8
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8123 from german77/bombslingerbunnei2022-04-033-66/+69
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | service: npad: Default initialize shared memorygerman772022-04-031-48/+48
| * | | | | | | | | | service: hid: Remove inaccurate behavior on initializationgerman772022-03-313-18/+21
* | | | | | | | | | | Merge pull request #8134 from Tachi107/remove-time-stretchermerry2022-04-026-137/+3
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | audio_core: remove time stretcherAndrea Pappacoda2022-04-016-137/+3
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8141 from merryhime/configure-hotkeys-columnsMorph2022-04-021-3/+4
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | configure_hotkeys: Make first column stretch and not last columnmerry2022-04-021-3/+4
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #8140 from merryhime/per-game-addon-columnsMorph2022-04-021-1/+5
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | configure_per_game_addons: Set tree view minimum section size to 150pxmerry2022-04-021-0/+1
| * | | | | | | | | | | configure_per_game_addons: Stretch first column and not lastmerry2022-04-021-1/+4
| |/ / / / / / / / / /
* / / / / / / / / / / fix: typosAndrea Pappacoda2022-04-025-10/+10
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #8128 from FernandoS27/gc-fixesFernando S2022-04-012-3/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | GPU Garbage Collection: Fix regressions.Fernando Sahmkow2022-04-012-3/+1
* | | | | | | | | | | Merge pull request #8079 from lat9nq/applet-typoMai M2022-04-011-2/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | configure_debug: Fix typolat9nq2022-03-241-2/+2
* | | | | | | | | | | | Merge pull request #8097 from Tachi107/build-cleanup-installMai M2022-04-012-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | build: cleanup installation of yuzu and yuzu-cmdAndrea Pappacoda2022-03-272-2/+2
* | | | | | | | | | | | | Merge pull request #8066 from ameerj/gpu-decode-fixesFernando S2022-04-011-14/+21
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | codec: Plug GPU decoder memory leakameerj2022-03-221-0/+2
| * | | | | | | | | | | | codec: Disable HW_FRAMES method check on Windowsameerj2022-03-221-14/+19
* | | | | | | | | | | | | Merge pull request #8116 from ameerj/nvhost_ctrl_bad_paramFernando S2022-04-011-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | nvhost_ctrl: Only mark EventState::Busy as BadParameterameerj2022-03-291-1/+1
* | | | | | | | | | | | | | Merge pull request #8076 from ameerj/nv-vk-msaa-scalebunnei2022-03-313-7/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | Vulkan: Use 3D helpers for MSAA scaling on NV drivers 510+ameerj2022-03-243-7/+8
* | | | | | | | | | | | | | | Merge pull request #8120 from german77/signalbunnei2022-03-311-0/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | service: hid: Signal event on AcquireNpadStyleSetUpdateEventHandleNarr the Reg2022-03-311-0/+4
* | | | | | | | | | | | | | | | Merge pull request #8090 from bunnei/fix-skylinebunnei2022-03-315-54/+241
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | | | |
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Fix implementations of LockForCodeMemory & UnlockForCodeMemory.bunnei2022-03-261-48/+12
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Implement LockMemoryAndOpen & UnlockMemory.bunnei2022-03-262-0/+124
| * | | | | | | | | | | | | | | hle: kernel: svc: MapProcessMemory: Fix usage of KPageLinkedList to use physical address space.bunnei2022-03-261-2/+5
| * | | | | | | | | | | | | | | hle: kernel: svc: CreateCodeMemory: Remove log of 'out' host pointer.bunnei2022-03-261-2/+2
| * | | | | | | | | | | | | | | hle: kernel: k_code_memory: Fix usage of KPageLinkedList to use physical address space.bunnei2022-03-261-1/+2
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Implement MakeAndOpenPageGroup & MakePageGroup.bunnei2022-03-262-0/+83
| * | | | | | | | | | | | | | | hle: kernel: k_page_table: Add IsHeapPhysicalAddress method.bunnei2022-03-261-0/+8
| * | | | | | | | | | | | | | | hle: kernel: k_page_linked_list: Add Empty method.bunnei2022-03-261-0/+4
| * | | | | | | | | | | | | | | hle: kernel: svc: UnmapProcessCodeMemory: Fix inverted alignment check.bunnei2022-03-261-1/+1
| | |_|_|_|_|_|_|/ / / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #8107 from german77/fullscreenbunnei2022-03-301-3/+10
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | | yuzu: Only override fullscreen setting if gamepath or argument is providedgerman772022-03-291-3/+10
| | |_|_|_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | | | |
* | | | | | | | | | | | | | | Merge pull request #8109 from lat9nq/god-whyMorph2022-03-291-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | yuzu_cmd: Start the logging backendlat9nq2022-03-291-0/+1
| | |_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | |
* / | | | | | | | | | | | | gl_rasterizer: Avoid scenario locking already owned mutexameerj2022-03-291-3/+3
|/ / / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #8098 from merryhime/ic-ivaubunnei2022-03-291-2/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | arm_dynarmic_64: Invalidate on all coresmerry2022-03-271-2/+4
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #8095 from bylaws/masterMai M2022-03-273-0/+4
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | Include <bit> header when std::count{r,l}_zero is usedBilly Laws2022-03-223-0/+4
* | | | | | | | | | | | Merge pull request #8088 from bunnei/fixup-nvflingerFernando S2022-03-279-547/+136
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | hle: service: nvflinger: buffer_queue: Remove AutoLock and fix free buffer tracking.bunnei2022-03-265-181/+130
| * | | | | | | | | | | | hle: service: nvflinger: buffer_queue_consumer: Use scoped_lock instead of unique_lock.bunnei2022-03-261-2/+2
| * | | | | | | | | | | | hle: service: nvflinger: consumer_base: Use scoped_lock instead of unique_lock.bunnei2022-03-261-4/+4
| * | | | | | | | | | | | hle: service: nvflinger: Remove unused BufferQueue.bunnei2022-03-262-360/+0
* | | | | | | | | | | | | Revert "Memory GPU <-> CPU: reduce infighting in the texture cache by adding CPU Cached memory."bunnei2022-03-266-65/+4
| |_|/ / / / / / / / / / |/| | | | | | | | | | |
* | | | | | | | | | | | Merge pull request #8041 from Morph1984/inline-swkbdbunnei2022-03-263-166/+415
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | applets/swkbd: Split software keyboard initializationMorph2022-03-222-160/+349
| * | | | | | | | | | | applets/swkbd: Add new inline software keyboard typesMorph2022-03-221-6/+66
| |/ / / / / / / / / /
* | | | | | | | | | | Memory: Don't protect reads on Normal accuracy.Fernando Sahmkow2022-03-251-1/+1
* | | | | | | | | | | Texture Cache: Add Cached CPU system.Fernando Sahmkow2022-03-255-3/+64
* | | | | | | | | | | Merge pull request #7720 from FernandoS27/yfc-gcbunnei2022-03-2520-43/+259
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | GC: Address Feedback.Fernando Sahmkow2022-03-257-29/+37
| * | | | | | | | | | | Garbage Collection: Final tuning.Fernando Sahmkow2022-03-256-24/+36
| * | | | | | | | | | | Buffer Cache: Tune to the levels of the new GC.Fernando Sahmkow2022-03-256-6/+78
| * | | | | | | | | | | Garbage Collection: Redesign the algorithm to do a better use of memory.Fernando Sahmkow2022-03-2513-32/+156
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #8050 from bunnei/nvflinger-rewriteFernando S2022-03-2560-796/+2984
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | hle: nvflinger: ConsumerBase: Mark ctor as explicit.bunnei2022-03-251-1/+1
| * | | | | | | | | | | hle: vi: NativeWindow: Fix trivially copyable issues.bunnei2022-03-251-4/+4
| * | | | | | | | | | | hle: nvdrv: nvdata: buffer_queue_producer: Minor cleanup.bunnei2022-03-251-11/+11
| * | | | | | | | | | | hle: nvdrv: nvdata: Cleanup NvFence static assert.bunnei2022-03-251-1/+1
| * | | | | | | | | | | hle: nvflinger: Remove unused unordered_map include.bunnei2022-03-251-1/+0
| * | | | | | | | | | | hle: nvflinger: buffer_queue_consumer: AcquireBuffer: Fix typo.bunnei2022-03-251-1/+1
| * | | | | | | | | | | hle: nvflinger: Merge Rect with Common::Rectangle.bunnei2022-03-256-90/+54
| * | | | | | | | | | | hle: nvflinger: buffer_queue_core: Declare default dtor.bunnei2022-03-252-0/+3
| * | | | | | | | | | | hle: nvflinger: buffer_queue_producer: DequeueBuffer: Remove unnecessary lock.bunnei2022-03-251-3/+1
| * | | | | | | | | | | hle: nvflinger: consumer_base: StillTracking: Should be const.bunnei2022-03-252-2/+3
| * | | | | | | | | | | hle: nvflinger: graphic_buffer_producer: Remove unnecessary pragma pack.bunnei2022-03-251-2/+0
| * | | | | | | | | | | hle: nvflinger: parcel: Reserve token size.bunnei2022-03-251-1/+2
| * | | | | | | | | | | hle: nvflinger: buffer_queue_core: StillTracking: Take const reference.bunnei2022-03-254-7/+7
| * | | | | | | | | | | hle: nvflinger: buffer_queue_core: Cleanup locking.bunnei2022-03-251-2/+2
| * | | | | | | | | | | hle: nvflinger: Use std::chrono for present_ns.bunnei2022-03-257-25/+30
| * | | | | | | | | | | hle: nvflinger: Migrate android namespace -> Service::android.bunnei2022-03-2535-79/+76
| * | | | | | | | | | | hle: nvflinger: BufferQueueProducer: Handle SetPreallocatedBuffer with empty buffer.bunnei2022-03-251-7/+10
| * | | | | | | | | | | hle: vi: Integrate new NVFlinger and HosBinderDriverServer service.bunnei2022-03-2517-723/+286
| * | | | | | | | | | | hle: nvflinger: Add implementation for HosBinderDriverServer service.bunnei2022-03-253-0/+75
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferQueueProducer class.bunnei2022-03-253-2/+1021
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferQueueCore class.bunnei2022-03-253-0/+235
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferQueueConsumer class.bunnei2022-03-253-0/+263
| * | | | | | | | | | | hle: nvflinger: Add implementation for QueueBufferInput and QueueBufferOutput structs.bunnei2022-03-253-0/+100
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferItemConsumer class.bunnei2022-03-253-0/+87
| * | | | | | | | | | | hle: nvflinger: Add implementation for ConsumerBase class.bunnei2022-03-253-0/+190
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferSlot class.bunnei2022-03-252-0/+40
| * | | | | | | | | | | hle: nvflinger: Add implementation for BufferItem class.bunnei2022-03-252-0/+47
| * | | | | | | | | | | hle: nvflinger: Move implementation for Parcel to its own header.bunnei2022-03-252-0/+172
| * | | | | | | | | | | hle: nvflinger: Add android buffer queue definitions to its own header.bunnei2022-03-252-0/+22
| * | | | | | | | | | | hle: nvflinger: Add IBinder interface.bunnei2022-03-252-0/+43
| * | | | | | | | | | | hle: nvflinger: Add IConsumerListener interface.bunnei2022-03-252-0/+27
| * | | | | | | | | | | hle: nvflinger: Add ProducerListener interface.bunnei2022-03-252-0/+17
| * | | | | | | | | | | hle: nvflinger: Add android window enumerations to its own header.bunnei2022-03-252-0/+54
| * | | | | | | | | | | hle: nvflinger: Add android Status flags to its own header.bunnei2022-03-251-0/+28
| * | | | | | | | | | | hle: nvflinger: Move BufferTransformFlags to its own header.bunnei2022-03-254-18/+29
| * | | | | | | | | | | hle: nvdrv: Rename Fence to NvFence to avoid naming conflicts.bunnei2022-03-254-17/+13
| * | | | | | | | | | | hle: nvflinger: Move PixelFormat to its own header.bunnei2022-03-2511-33/+50
| * | | | | | | | | | | hle: nvflinger: Add implementation for GraphicBuffer class.bunnei2022-03-252-0/+101
| * | | | | | | | | | | hle: nvflinger: Add implementation for Fence class.bunnei2022-03-252-0/+34
| * | | | | | | | | | | hle: nvflinger: Add implementation for Rect class.bunnei2022-03-252-0/+76
| * | | | | | | | | | | common: logging: Add a logger for NVFlinger.bunnei2022-03-252-0/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #8068 from ameerj/shader-if-falseFernando S2022-03-253-9/+98
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | dead_code_elimination_pass: Remove unreachable Phi argumentsameerj2022-03-233-0/+36
| * | | | | | | | | | shader_recompiler/dead_code_elimination: Add DeadBranchElimination passameerj2022-03-221-9/+62
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8074 from liamwhite/cached-wordsFernando S2022-03-241-1/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | buffer_cache: reset cached write bits after flushing invalidationsLiam2022-03-241-1/+2
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8035 from lat9nq/disable-web-appletbunnei2022-03-246-50/+65
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | yuzu qt: Save disable_web_applet settinglat9nq2022-03-184-3/+6
| * | | | | | | | | main: Update Disable Web Applet warninglat9nq2022-03-171-3/+2
| * | | | | | | | | configure_debug: Add option to set disable_web_appletlat9nq2022-03-172-42/+57
| * | | | | | | | | yuzu: Move disable_web_applet to UISettingslat9nq2022-03-173-5/+3
* | | | | | | | | | Add include to fix compilingShoegzer2022-03-231-0/+1
* | | | | | | | | | Merge pull request #8031 from Morph1984/cleanup-mii-pleasebunnei2022-03-2319-574/+644
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | applets/mii: Remove unused includeMorph2022-03-221-1/+0
| * | | | | | | | | | applets/mii: Remove frontend parametersMorph2022-03-222-17/+4
| * | | | | | | | | | applets/mii: Cleanup MiiEdit applet implementationMorph2022-03-222-44/+85
| * | | | | | | | | | applets/mii: Cleanup MiiEdit applet typesMorph2022-03-221-23/+44
| * | | | | | | | | | applets/mii: Move MiiEdit applet types into its own fileMorph2022-03-224-54/+70
| * | | | | | | | | | service: Move mii enums and structs into its own fileMorph2022-03-227-308/+312
| * | | | | | | | | | applets: Rename Mii to MiiEditMorph2022-03-228-47/+49
| | |_|/ / / / / / / | |/| | | | | | | |
* / | | | | | | | | Revert "dynarmic: Reduce size of code caches"bunnei2022-03-232-4/+4
|/ / / / / / / / /
* | / / / / / / / qt_web_browser: Add missing includesameerj2022-03-221-0/+3
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #8038 from liamwhite/exit-register-detectionAmeer J2022-03-222-0/+9
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | Address review commentsLiam2022-03-181-1/+1
| * | | | | | | shader_recompiler/EXIT: skip render targets with no outputsLiam2022-03-182-0/+8
| * | | | | | | shader_recompiler/EXIT: increment output register on failed enable testLiam2022-03-181-0/+1
* | | | | | | | Merge pull request #8048 from ameerj/include-purgebunnei2022-03-22271-452/+44
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | general: Fix clang/gcc build errorsameerj2022-03-2012-4/+17
| * | | | | | | yuzu_cmd: Reduce unused includesameerj2022-03-205-9/+0
| * | | | | | | yuzu: Reduce unused includesameerj2022-03-2045-104/+5
| * | | | | | | web_service: Reduce unused includesameerj2022-03-201-1/+0
| * | | | | | | input_common: Reduce unused includesameerj2022-03-204-4/+0
| * | | | | | | shader_recompiler: Reduce unused includesameerj2022-03-2069-106/+7
| * | | | | | | common: Reduce unused includesameerj2022-03-1930-32/+8
| * | | | | | | video_core: Reduce unused includesameerj2022-03-1975-139/+12
| * | | | | | | common: Reduce unused includesameerj2022-03-198-12/+0
| * | | | | | | core: Reduce unused includesameerj2022-03-1938-54/+8
* | | | | | | | Merge pull request #7812 from FernandoS27/made-straight-from-the-nutbunnei2022-03-201-6/+14
|\ \ \ \ \ \ \ \
| * | | | | | | | BufferCache: Find direction of the stream buffer increase.Fernando Sahmkow2022-03-201-6/+14
* | | | | | | | | Merge pull request #8036 from ameerj/starbit-nvFernando S2022-03-201-5/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vk_texture_cache: Do not reinterpret DepthStencil source imagesameerj2022-03-181-5/+0
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #7840 from lioncash/bitorbunnei2022-03-201-15/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | texture_cache: Ensure has_blacklisted is always initializedLioncash2022-02-021-1/+1
| * | | | | | | | | texture_cache: Remove dead code within SynchronizeAliasesLioncash2022-02-021-13/+1
| * | | | | | | | | texture_cache: Amend unintended bitwise OR in SynchronizeAliasesLioncash2022-02-021-1/+1
* | | | | | | | | | Merge pull request #8040 from Morph1984/handle-tablebunnei2022-03-202-30/+12
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | KHandleTable: Optimize table entry layoutMorph2022-03-182-30/+12
* | | | | | | | | | | Merge pull request #8025 from lat9nq/cmd-specify-configbunnei2022-03-193-10/+27
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | yuzu_cmd: Allow user to specify config file locationlat9nq2022-03-153-10/+27
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #8028 from v1993/patch-9bunnei2022-03-191-2/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | bsd: Allow inexact match for address length in AcceptImplValeri2022-03-151-2/+2
| |/ / / / / / / / /
* | | | / / / / / / general: Reduce core.h includesameerj2022-03-188-12/+23
| |_|_|/ / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #8024 from liamwhite/const-indexingFernando S2022-03-186-65/+163
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Address review commentsLiam2022-03-174-52/+36
| * | | | | | | | | shader_recompiler: Use functions for indirect const buffer accessesLiam2022-03-175-39/+94
| * | | | | | | | | Address review commentsLiam2022-03-171-16/+15
| * | | | | | | | | shader_recompiler: Implement LDC.IS address modeLiam2022-03-161-2/+12
| * | | | | | | | | shader: add support for const buffer indirect addressingLiam2022-03-152-18/+68
| |/ / / / / / / /
* | | | | | | | | Merge pull request #8030 from liamwhite/s8d24-conversionFernando S2022-03-185-2/+41
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | Address review commentsLiam2022-03-162-2/+2
| * | | | | | | | Vulkan: convert S8D24 <-> ABGR8Liam2022-03-165-2/+41
| |/ / / / / / /
* | | | | | | | Merge pull request #7964 from german77/miiiibunnei2022-03-178-5/+272
|\ \ \ \ \ \ \ \
| * | | | | | | | applet: mii: Simple implementation of mii appletgerman772022-03-018-5/+272
* | | | | | | | | Merge pull request #8013 from bunnei/kernel-slab-rework-v2Fernando S2022-03-1632-849/+1271
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core: hle: kernel: init_slab_setup: Move CalculateSlabHeapGapSize to global namespace.bunnei2022-03-151-6/+6
| * | | | | | | | | core: hle: kernel: Allocate dummy threads on host thread storage.bunnei2022-03-152-8/+6
| * | | | | | | | | core: hle: kernel: Downgrade dangling objects warning to debug.bunnei2022-03-151-2/+2
| * | | | | | | | | core: hle: kernel: Make object list container global and ensure it is reset on each emulation session.bunnei2022-03-151-7/+9
| * | | | | | | | | core: hle: kernel: Remove server session tracking.bunnei2022-03-154-37/+1
| * | | | | | | | | core: hle: kernel: k_process: Remove handle table finalize, reset page table.bunnei2022-03-151-3/+3
| * | | | | | | | | core: hle: kernel: k_process: Implement thread local storage accurately.bunnei2022-03-153-111/+99
| * | | | | | | | | core: hle: kernel: k_page_table: Add implementations of MapPages, UnmapPages, and FindFreeArea for TLS.bunnei2022-03-152-2/+141
| * | | | | | | | | core: hle: kernel: k_slab_heap: Refresh to use guest allocations.bunnei2022-03-152-125/+107
| * | | | | | | | | core: hle: kernel: Update init_slab_heap, use device memory, and add KThreadLocalPage and KPageBuffer.bunnei2022-03-154-55/+92
| * | | | | | | | | core: hle: kernel: k_page_buffer: Add KThreadLocalPage primitive.bunnei2022-03-153-0/+179
| * | | | | | | | | core: hle: kernel: k_page_buffer: Add KPageBuffer primitive.bunnei2022-03-152-0/+35
| * | | | | | | | | core: hle: kernel: k_thread: Ensure host Fiber is freed.bunnei2022-03-151-0/+3
| * | | | | | | | | core: hle: kernel: k_server_session: Ensure SessionRequestManager is freed.bunnei2022-03-151-0/+3
| * | | | | | | | | core: hle: service: kernel_helpers: Use system resource limit.bunnei2022-03-151-10/+1
| * | | | | | | | | core: hle: service: sm: Fix KPort reference count.bunnei2022-03-151-0/+2
| * | | | | | | | | core: hle: kernel: k_thread: Update to reflect tree changes.bunnei2022-03-151-3/+3
| * | | | | | | | | core: hle: kernel: Use weak_ptr where possible for SessionRequestHandler and SessionRequestManager.bunnei2022-03-157-14/+25
| * | | | | | | | | core: hle: kernel: k_memory_layout: Update kernel slab memory sizes.bunnei2022-03-151-3/+3
| * | | | | | | | | core: hle: kernel: svc_types: Add ThreadLocalRegionSize.bunnei2022-03-151-0/+2
| * | | | | | | | | core: hle: kernel: k_condition_variable: Update to reflect tree changes.bunnei2022-03-151-1/+1
| * | | | | | | | | core: hle: kernel: k_address_arbiter: Update to reflect tree changes.bunnei2022-03-151-3/+3
| * | | | | | | | | common: tree: Various updates.bunnei2022-03-151-284/+341
| * | | | | | | | | common: intrusive_red_black_tree: Various updates.bunnei2022-03-151-181/+210
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8023 from ameerj/kirby-pop-inFernando S2022-03-162-70/+12
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | maxwell_3d: Implement a safer CB data uploadameerj2022-03-152-70/+12
* | | | | | | | | default_ini: List use_extended_memory_layout in default config filelat9nq2022-03-151-1/+5
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #8008 from ameerj/rescale-offsets-arrayFernando S2022-03-151-2/+27
|\ \ \ \ \ \ \ \
| * | | | | | | | rescaling_pass: Fix rescaling Color2DArray ImageFetch offsetsameerj2022-03-121-2/+27
* | | | | | | | | Merge pull request #8000 from liamwhite/hagiFernando S2022-03-153-3/+77
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Maxwell3D: Link to override constant definition in nouveaubyte[]2022-03-141-0/+2
| * | | | | | | | | Maxwell3D: restore original topology when topology overrides are disabledbyte[]2022-03-141-0/+2
| * | | | | | | | | Maxwell3D: Use override constants from nouveauLiam2022-03-142-2/+37
| * | | | | | | | | Maxwell3D: Restrict topology override effect to after the register is setLiam2022-03-122-1/+5
| * | | | | | | | | Maxwell3D: mark index buffers as dirty after updating countsLiam2022-03-111-0/+2
| * | | | | | | | | TextureCacheRuntime: allow converting D24S8 to ABGR8Liam2022-03-111-1/+2
| * | | | | | | | | Maxwell3D: read small-index draw and primitive topology override registersLiam2022-03-112-2/+30
* | | | | | | | | | Merge pull request #8015 from FernandoS27/fix-global-membunnei2022-03-152-3/+4
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | Shader decompiler: do constant propgation before texture pass.Fernando Sahmkow2022-03-131-2/+2
| * | | | | | | | | Shader decompiler: Fix storage tracking in deko3d.Fernando Sahmkow2022-03-131-1/+2
* | | | | | | | | | Merge pull request #8016 from merryhime/kill-mem-useFernando S2022-03-142-4/+4
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | dynarmic: Reduce size of code cachesMerry2022-03-132-4/+4
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #8007 from ameerj/vs-2022-errorsbunnei2022-03-132-2/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | emit_spirv, vk_compute_pass: Resolve VS2022 compiler errorsameerj2022-03-122-2/+3
| |/ / / / / / / /
* / / / / / / / / config: Write dynarmic exclusive memory configsameerj2022-03-121-0/+2
|/ / / / / / / /
* | | | | | | | cpu_detect: Add additional x86 flags and telemetryWunkolo2022-03-114-29/+86
* | | | | | | | common/telemetry: Update `AddField` name type to `string_view`Wunkolo2022-03-111-3/+4
|/ / / / / / /
* | | | | | | backend: Ensure backend_thread is destructed before message_queueMerry2022-03-101-1/+1
* | | | | | | cpu_detect: Revert `__cpuid{ex}` array-type argumentWunkolo2022-03-101-6/+6
* | | | | | | cpu_detect: Add missing `lzcnt` detectionWunkolo2022-03-091-0/+1
* | | | | | | cpu_detect: Refactor cpu/manufacturer identificationWunkolo2022-03-092-24/+38
* | | | | | | cpu_detect: Update array-types to `span` and `array`Wunkolo2022-03-091-11/+13
* | | | | | | cpu_detect: Utilize `Bit<N>` utility functionWunkolo2022-03-091-32/+20
* | | | | | | cpu_detect: Compact capability fieldsWunkolo2022-03-091-20/+21
* | | | | | | bit_util: Add `bit` utility functionWunkolo2022-03-091-0/+7
* | | | | | | hle: service: ldr: Use deterministic addresses when mapping NROs.bunnei2022-03-092-24/+62
* | | | | | | Merge pull request #7986 from lat9nq/vk-callbackbunnei2022-03-083-2/+14
|\ \ \ \ \ \ \
| * | | | | | | video_core: Cancel Scoped's exit call on GPU failurelat9nq2022-03-081-0/+1
| * | | | | | | emu_window: Create a way to Cancel the exit of a Scopedlat9nq2022-03-081-1/+10
| * | | | | | | core: Don't shutdown a null GPUlat9nq2022-03-071-1/+3
* | | | | | | | shader_recompiler/LOP3: Use brute force python results within switch/case.Markus Wick2022-03-082-52/+620
* | | | | | | | hle: kernel: KPageTable: Improve implementations of MapCodeMemory and UnmapCodeMemory.bunnei2022-03-082-47/+116
* | | | | | | | Merge pull request #7930 from asLody/dma-semaphoreFernando S2022-03-072-1/+21
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | MaxwellDMA: Implement semaphore operationsLody2022-03-072-1/+21
* | | | | | | | gl_graphics_pipeline: Improve shader builder synchronization using fences (#7969)Ameer J2022-03-062-21/+32
| |_|_|_|_|/ / |/| | | | | |
* | | | | | | Merge pull request #7973 from Morph1984/debug-crashFernando S2022-03-061-2/+2
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | host_memory: Fix fastmem crashes in debug buildsMorph2022-03-031-2/+2
* | | | | | | Merge pull request #7935 from Wunkolo/logging-join-fixbunnei2022-03-031-13/+5
|\ \ \ \ \ \ \
| * | | | | | | logging: Convert `backend_thread` into an `std::jthread`Wunkolo2022-02-281-13/+5
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #7956 from bunnei/improve-mem-managerbunnei2022-03-0315-376/+848
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | hle: kernel: Re-create memory layout at initialization.bunnei2022-02-281-41/+43
| * | | | | | hle: kernel: Remove unused pool locals.bunnei2022-02-281-2/+0
| * | | | | | hle: kernel: k_memory_manager: Rework for latest kernel behavior.bunnei2022-02-286-173/+548
| * | | | | | hle: kernel: k_page_heap: GetPhysicalAddr can be const.bunnei2022-02-271-2/+1
| * | | | | | hle: kernel: k_page_heap: Remove superfluous consexpr.bunnei2022-02-272-4/+4
| * | | | | | hle: kernel: k_page_heap: Various updates and improvements.bunnei2022-02-272-155/+192
| * | | | | | hle: kernel: Add initial_process.h header.bunnei2022-02-272-0/+24
| * | | | | | hle: kernel: board: nx: Add k_memory_layout.h header.bunnei2022-02-272-0/+14
| * | | | | | hle: kernel: k_system_control: Add GetRealMemorySize and update GetKernelPhysicalBaseAddress.bunnei2022-02-272-1/+12
| * | | | | | hle: kernel: k_memory_layout: Add GetPhysicalLinearRegion.bunnei2022-02-271-0/+4
| * | | | | | hle: kernel: k_memory_region_types: Update for new regions.bunnei2022-02-271-1/+9
| |/ / / / /
* | | | | | Merge pull request #7959 from merryhime/cmpxchgFernando S2022-03-0116-7/+113
|\ \ \ \ \ \
| * | | | | | dynarmic: Inline exclusive memory accessesmerry2022-02-2716-7/+113
| |/ / / / /
* / / / / / gl_fence_manager: Minor optimization to signal queryingameerj2022-02-271-2/+1
|/ / / / /
* | | | | Merge pull request #7932 from bunnei/extended-mem-layoutbunnei2022-02-2621-55/+91
|\ \ \ \ \
| * | | | | hle: kernel: KSystemControl: Use 6GB memory layout when "use_extended_memory_layout" setting is enabled.bunnei2022-02-211-20/+4
| * | | | | core: device_memory: Use memory size reported by KSystemControl.bunnei2022-02-213-7/+5
| * | | | | settings: Add a new "use_extended_memory_layout" setting.bunnei2022-02-217-0/+22
| * | | | | core: hle: kernel: Remove resource limit hack for PhysicalMemory.bunnei2022-02-211-7/+0
| * | | | | core: hle: kernel: KProcess: Pass in KResourceLimit on process creation.bunnei2022-02-214-9/+30
| * | | | | core: hle: kernel: KEvent: Pass in owner KProcess on event creation.bunnei2022-02-214-12/+8
| * | | | | core: hle: kernel: KResourceLimit: Add a helper function for creating a KResourceLimit for a process.bunnei2022-02-212-0/+22
* | | | | | Merge pull request #7953 from ameerj/radv-rdna2-crashbunnei2022-02-261-4/+21
|\ \ \ \ \ \
| * | | | | | vulkan_device: Blacklist RADV on RDNA2 from VK_EXT_vertex_input_dynamic_stateAmeer J2022-02-261-4/+21
* | | | | | | Merge pull request #7948 from Morph1984/11-11-10-floatMai M2022-02-262-0/+4
|\ \ \ \ \ \ \
| * | | | | | | maxwell_to_(gl/vk): Add 11_11_10 float vertex formatMorph2022-02-252-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #7939 from asLody/fb-format-gbra8bunnei2022-02-251-0/+2
|\ \ \ \ \ \ \
| * | | | | | | vk_blit_screen: Add missing format bgra8Lody2022-02-241-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #7927 from german77/amiibobunnei2022-02-251-0/+10
|\ \ \ \ \ \ \
| * | | | | | | yuzu: Remove amiibos on drag and dropgerman772022-02-201-0/+10
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #7859 from german77/battery_againbunnei2022-02-246-34/+27
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | input_common: Remove battery duplicated struct and update every button pressgerman772022-02-076-34/+27
* | | | | | | service: am: Update enum names to match documentationNarr the Reg2022-02-224-16/+51
* | | | | | | Merge pull request #7913 from voidanix/anv-fixbunnei2022-02-213-2/+21
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | vulkan_device: fix missing format in ANVvoidanix2022-02-213-2/+21
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #7919 from bunnei/phys-mem-updatesbunnei2022-02-213-131/+506
|\ \ \ \ \ \
| * | | | | | fixup! core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-193-38/+18
| * | | | | | core: hle: kernel: KPageTable: Improve Un/MapPhysicalMemory.bunnei2022-02-193-113/+508
* | | | | | | Merge pull request #7920 from bunnei/fix-unmap-pagesbunnei2022-02-211-3/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | core: hle: kernel: KPageTable: Fix UnmapPages.bunnei2022-02-191-3/+2
| |/ / / / /
* | | | | | Merge pull request #7867 from german77/amiibobunnei2022-02-197-254/+949
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | nfp: Allow files without password datagerman772022-02-132-9/+24
| * | | | | nfp: Separate nfc tag from amiibo dataNarr the Reg2022-02-103-44/+76
| * | | | | nfp: Address compiler issuesgerman772022-02-092-27/+27
| * | | | | nfp: Validate amiibo filesNarr the Reg2022-02-082-41/+145
| * | | | | yuzu: Allow to open and remove the amiibogerman772022-02-083-5/+24
| * | | | | nfp: Improve implementationgerman772022-02-084-189/+672
| * | | | | nfp: Move IUser class to header and add missing enum and structsgerman772022-02-072-257/+299
| * | | | | nfp: Sort functions by command numbergerman772022-02-071-79/+79
| |/ / / /
* | | | | Merge pull request #7900 from german77/enterbunnei2022-02-182-0/+6
|\ \ \ \ \
| * | | | | yuzu: config: Fix mapping issues with the enter keyNarr the Reg2022-02-152-0/+6
* | | | | | common: Add NullVisitor default constructorWunkolo2022-02-171-0/+3
* | | | | | Merge pull request #7866 from xerpi/svc-OutputDebugString32-CreateCodeMemory32-ControlCodeMemory32Mai M2022-02-172-4/+40
|\ \ \ \ \ \
| * | | | | | kernel: svc: Add OutputDebugString32, CreateCodeMemory32, ControlCodeMemory32Sergi Granell2022-02-152-4/+40
| |/ / / / /
* | | | | | Merge pull request #7878 from german77/mnppbunnei2022-02-176-0/+71
|\ \ \ \ \ \
| * | | | | | service/mnpp: Stub mnpp_appNarr the Reg2022-02-116-0/+71
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #7899 from Kelebek1/testMorph2022-02-161-9/+9
|\ \ \ \ \ \
| * | | | | | Dump patched exefs rather than baseKelebek12022-02-151-9/+9
* | | | | | | Merge pull request #7877 from lat9nq/upd_revbunnei2022-02-151-1/+3
|\ \ \ \ \ \ \
| * | | | | | | audio_core: Update current process revisionlat9nq2022-02-111-1/+3
* | | | | | | | Merge pull request #7891 from Morph1984/buffer_to_string_viewbunnei2022-02-152-0/+26
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | common: fs_util: Add buffer to string view utility functionsMorph2022-02-142-0/+26
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #7871 from german77/svc2bunnei2022-02-151-77/+77
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | svc: Set unique names for function tablesNarr the Reg2022-02-091-77/+77
| | |_|/ / / | |/| | | |
* | | | | | debugger: console: Set console output codepage to UTF-8Morph2022-02-141-0/+1
| |/ / / / |/| | | |
* | | | | hid: Stub IsUsbFullKeyControllerEnabledlat9nq2022-02-122-1/+12
* | | | | Merge pull request #7852 from Morph1984/new-uuidbunnei2022-02-1131-193/+370
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | common: uuid: Use sizeof(u64) instead of 8 in Hash()Morph2022-02-101-5/+5
| * | | | common: uuid: Return an invalid UUID if conversion from string failsMorph2022-02-051-14/+39
| * | | | general: Rename NewUUID to UUID, and remove the previous UUID implMorph2022-02-0541-598/+415
| * | | | profile: Migrate to the new UUID implementationMorph2022-02-0514-127/+131
| * | | | common: uuid: Add AsU128()Morph2022-02-052-0/+9
| * | | | hle: ipc_helpers: Ignore -Wclass-memaccessMorph2022-02-051-0/+8
| * | | | service: Migrate to the new UUID implementationMorph2022-02-059-45/+36
| * | | | input/hid: Migrate to the new UUID implementationMorph2022-02-0516-56/+57
| * | | | common: Implement NewUUIDMorph2022-02-053-0/+322
* | | | | Merge pull request #7861 from german77/user_featuresbunnei2022-02-107-62/+95
|\ \ \ \ \
| * | | | | yuzu: Mute audio when in backgroundgerman772022-02-076-4/+27
| * | | | | yuzu: Add docked, GPU accuracy and adapting filter hotkeysgerman772022-02-074-58/+68
| | |/ / / | |/| | |
* | | | | Merge pull request #7860 from german77/no-more-driftbunnei2022-02-103-4/+30
|\ \ \ \ \
| * | | | | yuzu: Add auto center on right clickgerman772022-02-073-4/+30
| |/ / / /
* | | | | hle: kernel: KCodeMemory: Remove unused QueryMemory.bunnei2022-02-091-1/+0
* | | | | hle: kernel: KCodeMemory: Correct m_page_group number of pages.bunnei2022-02-091-2/+3
|/ / / /
* | | | Merge pull request #7847 from tech-ticks/masterMorph2022-02-062-1/+46
|\ \ \ \
| * | | | service: pm: Implement AtmosphereGetProcessInfotech-ticks2022-02-042-1/+46
* | | | | Merge pull request #7851 from lat9nq/cmd-add-motionMorph2022-02-061-8/+28
|\ \ \ \ \
| * | | | | config: Support motion inputslat9nq2022-02-051-8/+28
* | | | | | Merge pull request #7849 from Morph1984/qt-frameless-windowbunnei2022-02-051-0/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | main: Always remove the frameless window flag when restoring UI stateMorph2022-02-041-0/+2
* | | | | | Merge pull request #7842 from german77/vibration_testbunnei2022-02-055-8/+95
|\ \ \ \ \ \
| * | | | | | yuzu: config: Vibrate the controller while configuring vibration strengthNarr the Reg2022-02-025-8/+95
* | | | | | | Merge pull request #7839 from german77/batterybunnei2022-02-054-39/+59
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | yuzu: ui: Improve battery symbolsNarr the Reg2022-02-024-39/+59
| |/ / / / /
* | | / / / input_common: Remove unused core includeMorph2022-02-041-1/+0
| |_|/ / / |/| | | |
* | | | | Merge pull request #7811 from german77/analog-modbunnei2022-02-031-4/+26
|\ \ \ \ \
| * | | | | input_common: Use attributes for analog range modifiersgerman772022-01-311-4/+26
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7814 from FernandoS27/another-bug-in-my-schedulebunnei2022-02-032-4/+6
|\ \ \ \ \
| * | | | | Vulkan: Fix Scheduler Chunks when their FuncType is 0.Fernando Sahmkow2022-01-312-4/+6
| |/ / / /
* | | | | Merge pull request #7835 from bunnei/page-table-lockbunnei2022-02-032-34/+46
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | hle: kernel: KPageTable: Migrate locks to KScopedLightLock.bunnei2022-02-022-34/+46
* | | | | Merge pull request #7838 from lioncash/noncopyMorph2022-02-0220-150/+228
|\ \ \ \ \
| * | | | | common_types: Remove NonCopyable structLioncash2022-02-021-10/+0
| * | | | | general: Replace NonCopyable struct with equivalentsLioncash2022-02-0212-129/+219
| * | | | | general: Move deleted copy/move constructor/assignment operators to public interfaceLioncash2022-02-027-11/+9
| | |_|_|/ | |/| | |
* | | | | Merge pull request #7834 from german77/repeatbunnei2022-02-021-0/+1
|\ \ \ \ \
| * | | | | yuzu: Disable auto repeat on hotkeys againNarr the Reg2022-02-021-0/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #7806 from ameerj/atomic64-fallbacksbunnei2022-02-0211-3/+582
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | emit_glsl_atomic: Implement 32x2 fallback atomic opsameerj2022-01-301-9/+55
| * | | | lower_int64_to_int32: Add 64-bit atomic fallbacksameerj2022-01-303-11/+76
| * | | | shaders: Add U64->U32x2 Atomic fallback functionsameerj2022-01-309-1/+469
| |/ / /
* | | | Merge pull request #7807 from german77/moar-buttonsbunnei2022-02-024-3/+22
|\ \ \ \ | |_|_|/ |/| | |
| * | | input_common: Add home and hard touch press buttons to UDP controllersgerman772022-01-304-3/+22
| |/ /
* | | Merge pull request #7833 from lioncash/file-sysMorph2022-02-023-8/+18
|\ \ \
| * | | configure_filesystem: Add missing changeEvent() overrideLioncash2022-02-022-0/+10
| * | | configure_filesystem: Normalize member function casingLioncash2022-02-023-8/+8
| | |/ | |/|
* | | Merge pull request #7792 from german77/translatebunnei2022-02-021-16/+16
|\ \ \ | |/ / |/| |
| * | hotkeys: Don't translate hotkey buttonsgerman772022-01-281-16/+16
* | | Merge pull request #7809 from Morph1984/clock-constantsbunnei2022-02-023-11/+19
|\ \ \
| * | | common: wall_clock: Check precision against the emulated CPU and CNTFRQMorph2022-01-302-8/+12
| * | | common: wall_clock: Utilize constants for ms, us, and ns ratiosMorph2022-01-303-5/+9
| | |/ | |/|
* | | Merge pull request #7831 from lioncash/motionMorph2022-02-011-18/+20
|\ \ \
| * | | configure_motion_touch: Use functor versions of invokeMethodLioncash2022-02-011-18/+20
* | | | configure_input_player: Eliminate variable shadowingLioncash2022-02-011-4/+5
* | | | configure_input_player: std::move input setters in HandleClickLioncash2022-02-011-1/+1
* | | | configure_input_player: Avoid unnecessary ParamPackage copiesLioncash2022-02-011-6/+6
|/ / /
* | | yuzu/game_list: Use non-deprecated version of QString's split() functionLioncash2022-02-011-1/+1
* | | Merge pull request #7825 from lioncash/nodisc2Morph2022-02-011-3/+2
|\ \ \
| * | | common/file: Remove [[nodiscard]] from Open()Lioncash2022-02-011-3/+2
| |/ /
* | | Merge pull request #7824 from lioncash/scacheMorph2022-02-012-4/+3
|\ \ \
| * | | video_core/shader_cache: Remove unused algorithm includeLioncash2022-02-011-1/+0
| * | | video_core/shader_cache: Take std::span in RemoveShadersFromStorage()Lioncash2022-02-012-3/+3
| |/ /
* | | Merge pull request #7821 from german77/espada_agudabunnei2022-02-011-1/+1
|\ \ \
| * | | svc: Add 32 bit SynchronizePreemptionStateNarr the Reg2022-02-011-1/+1
| |/ /
* | | Rasterizer: Refactor inlineToMemory.Fernando Sahmkow2022-02-019-15/+16
* | | GPU: Improve syncing.Fernando Sahmkow2022-01-291-3/+10
* | | Rasterizer: Implement Inline2Memory Acceleration.Fernando Sahmkow2022-01-2914-6/+122
* | | Inline2Memory: Flush before writting buffer.Fernando Sahmkow2022-01-292-2/+3
|/ /
* | Merge pull request #7791 from german77/wall_clockMorph2022-01-291-1/+3
|\ \
| * | wall_clock: use standard wall clock if rtsc frequency is too lowgerman772022-01-281-1/+3
| |/
* | spirv_atomic: Define U32x2 storage buffers for 64-bit storage atomicsameerj2022-01-292-3/+3
* | Merge pull request #7784 from german77/ds5Morph2022-01-291-2/+3
|\ \
| * | input_common: Add DS5 to HD rumble listNarr the Reg2022-01-271-2/+3
* | | Merge pull request #7787 from bunnei/scheduler-deadlock-fixMorph2022-01-292-23/+24
|\ \ \