summaryrefslogtreecommitdiffstats
Commit message (Expand)AuthorAgeFilesLines
* gitmodules: Replace taps with spacesunknown2019-03-291-2/+2
* common/zstd_compression: simplify decompression interfaceunknown2019-03-293-13/+11
* gl_shader_disk_cache: Fixup clang formatunknown2019-03-291-2/+3
* gl_shader_disk_cache: Use Zstandard for compressionunknown2019-03-291-6/+6
* common/zstd_compression: Add Zstandard wrapperunknown2019-03-293-0/+98
* common: Link libzstd_staticunknown2019-03-291-1/+1
* externals: Add libzstd_static to externals CMakeLists.txtunknown2019-03-291-0/+4
* externals: Add Zstandard v1.3.8unknown2019-03-292-0/+3
* Addressed feedbackunknown2019-03-291-1/+0
* core: Do not link LZ4 to core. Use common/data_compression for nso segment decompression instead.unknown2019-03-291-0/+1
* gl_shader_disk_cache: Use LZ4HC with compression level 9 instead of compression level 12 for less compression timeunknown2019-03-291-3/+3
* Addressed feedbackunknown2019-03-297-91/+145
* core: Do not link LZ4 to core. Use common/data_compression for nso segment decompression instead.unknown2019-03-292-11/+8
* gl_shader_disk_cache: Use better compression for transferable and precompiled shader disk chache filesunknown2019-03-293-10/+26
* data_compression: Move LZ4 compression from video_core/gl_shader_disk_cache to common/data_compressionunknown2019-03-295-39/+75
* Merge pull request #2266 from FernandoS27/arbitrationbunnei2019-03-296-14/+22
|\
| * Fix small bug that kept a thread as a condvar thread after being signalled.Fernando Sahmkow2019-03-202-6/+8
| * Add CondVar Thread State.Fernando Sahmkow2019-03-205-4/+10
| * Small fixes to address_arbiter to better match the IDB.Fernando Sahmkow2019-03-202-5/+5
* | Merge pull request #2265 from FernandoS27/multilevelqueuebunnei2019-03-298-19/+484
|\ \
| * | Fixes and corrections on formatting.Fernando Sahmkow2019-03-275-41/+30
| * | Fixes to multilevelqueue's iterator.Fernando Sahmkow2019-03-271-1/+5
| * | Use MultiLevelQueue instead of old ThreadQueueListFernando Sahmkow2019-03-273-31/+34
| * | Add MultiLevelQueue TestsFernando Sahmkow2019-03-272-0/+56
| * | Implement intrinsics CountTrailingZeroes and test it.Fernando Sahmkow2019-03-273-12/+76
| * | Implement a MultiLevelQueueFernando Sahmkow2019-03-273-0/+349
* | | Merge pull request #2284 from lioncash/heap-allocbunnei2019-03-283-59/+81
|\ \ \
| * | | kernel/vm_manager: Handle shrinking of the heap size within SetHeapSize()Lioncash2019-03-242-24/+46
| * | | kernel/vm_manager: Rename HeapAllocate to SetHeapSizeLioncash2019-03-243-4/+3
| * | | kernel/vm_manager: Handle case of identical calls to HeapAllocateLioncash2019-03-241-0/+5
| * | | kernel/vm_manager: Remove unused class variablesLioncash2019-03-241-3/+0
| * | | kernel/vm_manager: Remove unnecessary heap_used data memberLioncash2019-03-243-13/+2
| * | | kernel/vm_manager: Tidy up heap allocation codeLioncash2019-03-243-27/+37
* | | | Merge pull request #2296 from lioncash/overridebunnei2019-03-283-4/+4
|\ \ \ \
| * | | | video_core: Add missing override specifiersLioncash2019-03-273-4/+4
| | |/ / | |/| |
* | | | Merge pull request #2295 from lioncash/typobunnei2019-03-282-7/+8
|\ \ \ \ | |/ / / |/| | |
| * | | video_core/gpu: Amend typo in GPU member variable nameLioncash2019-03-272-7/+8
|/ / /
* | | Merge pull request #2285 from lioncash/unused-structbunnei2019-03-261-8/+0
|\ \ \
| * | | kernel/process: Remove unused AddressMapping structLioncash2019-03-241-8/+0
* | | | Merge pull request #2287 from lioncash/coretiming-cbbunnei2019-03-267-12/+12
|\ \ \ \
| * | | | core/core_timing: Make callback parameters consistentLioncash2019-03-247-12/+12
| |/ / /
* | | | Merge pull request #2286 from lioncash/fwdbunnei2019-03-261-3/+0
|\ \ \ \
| * | | | kernel/kernel: Remove unnecessary forward declarationLioncash2019-03-241-3/+0
| |/ / /
* | | | Merge pull request #2288 from lioncash/linkagebunnei2019-03-261-0/+2
|\ \ \ \ | |/ / / |/| | |
| * | | core/cheat_engine: Make MemoryReadImpl and MemoryWriteImpl internally linkedLioncash2019-03-241-0/+2
|/ / /
* | | Merge pull request #2232 from lioncash/transfer-memorybunnei2019-03-246-6/+282
|\ \ \ | |/ / |/| |
| * | core/hle/kernel/svc: Implement svcUnmapTransferMemoryLioncash2019-03-131-1/+48
| * | core/hle/kernel/svc: Implement svcMapTransferMemoryLioncash2019-03-131-1/+57
| * | core/hle/kernel: Split transfer memory handling out into its own classLioncash2019-03-136-4/+177
* | | Merge pull request #2221 from DarkLordZach/firmware-versionbunnei2019-03-237-3/+154
|\ \ \
| * | | set_sys: Move constants to anonymous namespaceZach Hilman2019-03-111-1/+1
| * | | set_sys: Use official nintendo version stringZach Hilman2019-03-114-19/+25
| * | | system_version: Correct sizes on VectorVfsFile constructionZach Hilman2019-03-111-4/+4
| * | | set_sys: Use correct error codes in GetFirmwareVersion*Zach Hilman2019-03-111-21/+41
| * | | set_sys: Implement GetFirmwareVersion(2) for libnx hosversionZach Hilman2019-03-106-3/+128
* | | | Merge pull request #2253 from lioncash/flagsbunnei2019-03-232-79/+70
|\ \ \ \
| * | | | CMakeLists: Move off of modifying CMAKE_*-related flagsLioncash2019-03-171-20/+12
| * | | | CMakeLists: Move compilation flags into the src directoryLioncash2019-03-172-79/+78
* | | | | Merge pull request #2280 from lioncash/nsobunnei2019-03-233-73/+92
|\ \ \ \ \
| * | | | | loader/nso: Place translation unit specific functions into an anonymous namespaceLioncash2019-03-221-20/+21
| * | | | | loader/nso: Clean up use of magic constantsLioncash2019-03-221-4/+6
| * | | | | file_sys/patch_manager: Deduplicate NSO headerLioncash2019-03-223-64/+65
| * | | | | loader/nso: Fix definition of the NSO header structLioncash2019-03-221-3/+15
| * | | | | file_sys/patch_manager: Remove two magic valuesLioncash2019-03-221-2/+5
* | | | | | Merge pull request #2279 from lioncash/cheat-globalbunnei2019-03-226-48/+57
|\ \ \ \ \ \
| * | | | | | file_sys/cheat_engine: Silence truncation and sign-conversion warningsLioncash2019-03-222-5/+6
| * | | | | | file_sys/cheat_engine: Remove use of global system accessorsLioncash2019-03-226-43/+51
| |/ / / / /
* | | | | | Merge pull request #2256 from bunnei/gpu-vmmbunnei2019-03-2228-257/+550
|\ \ \ \ \ \
| * | | | | | memory_manager: Cleanup FindFreeRegion.bunnei2019-03-212-12/+6
| * | | | | | memory_manager: Use Common::AlignUp in public interface as needed.bunnei2019-03-211-11/+22
| * | | | | | memory_manager: Bug fixes and further cleanup.bunnei2019-03-212-73/+72
| * | | | | | memory: Check that core is powered on before attempting to use GPU.bunnei2019-03-211-1/+1
| * | | | | | maxwell_dma: Check for valid source in destination before copy.bunnei2019-03-211-0/+10
| * | | | | | memory_manager: Add protections for invalid GPU addresses.bunnei2019-03-212-22/+43
| * | | | | | gl_rasterizer_cache: Check that backing memory is valid before creating a surface.bunnei2019-03-212-15/+12
| * | | | | | gpu: Rewrite virtual memory manager using PageTable.bunnei2019-03-2113-212/+481
| * | | | | | gpu: Move GPUVAddr definition to common_types.bunnei2019-03-2117-39/+31
* | | | | | | Merge pull request #2277 from bunnei/fix-smo-transitionsbunnei2019-03-223-8/+12
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Revert "Devirtualize Register/Unregister and use a wrapper instead."bunnei2019-03-223-8/+12
* | | | | | | Merge pull request #2234 from lioncash/mutexbunnei2019-03-225-29/+62
|\ \ \ \ \ \ \
| * | | | | | | core/hle/kernel/mutex: Remove usages of global system accessorsLioncash2019-03-151-11/+15
| * | | | | | | core/hle/kernel: Make Mutex a per-process class.Lioncash2019-03-155-18/+47
* | | | | | | | Merge pull request #2274 from lioncash/includebunnei2019-03-221-3/+0
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | core/memory: Remove unnecessary includesLioncash2019-03-211-3/+0
* | | | | | | | Merge pull request #2275 from lioncash/memflagsbunnei2019-03-224-22/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/vm_manager: Rename CodeStatic/CodeMutable to Code and CodeData respectivelyLioncash2019-03-214-22/+20
| * | | | | | | | kernel/vm_manager: Amend flag values for CodeMutableLioncash2019-03-211-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #2276 from lioncash/ambunnei2019-03-221-1/+15
|\ \ \ \ \ \ \ \
| * | | | | | | | service/am: Add function table for IDebugFunctionsLioncash2019-03-211-1/+15
| |/ / / / / / /
* | | | | | | | Merge pull request #1933 from DarkLordZach/cheat-enginebunnei2019-03-2210-0/+813
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | vm_manager: Remove cheat-specific ranges from VMManagerZach Hilman2019-03-0510-77/+56
| * | | | | | | core: Add support for registering and controlling ownership of CheatEngineZach Hilman2019-03-052-0/+13
| * | | | | | | cheat_engine: Add parser and interpreter for game cheatsZach Hilman2019-03-053-0/+715
| * | | | | | | loader/nso: Set main code region in VMManagerZach Hilman2019-03-053-2/+21
| * | | | | | | vm_manager: Add support for storing and getting main code regionZach Hilman2019-03-052-0/+28
| * | | | | | | patch_manager: Display cheats in game list add-onsZach Hilman2019-03-051-0/+2
| * | | | | | | patch_manager: Add support for loading cheats listsZach Hilman2019-03-052-0/+56
| * | | | | | | controllers/npad: Add accessor for current press stateZach Hilman2019-03-051-0/+1
* | | | | | | | Merge pull request #2260 from lioncash/sdlbunnei2019-03-213-12/+14
|\ \ \ \ \ \ \ \
| * | | | | | | | input_common/sdl: Correct return values within implementations of GetPollers()Lioncash2019-03-182-2/+6
| * | | | | | | | input_common/sdl: Use a type alias to shorten declaration of GetPollersLioncash2019-03-183-11/+9
* | | | | | | | | common/bit_util: Fix bad merge duplicating the copy constructorLioncash2019-03-211-2/+0
* | | | | | | | | Merge pull request #2090 from FearlessTobi/port-4599bunnei2019-03-2110-134/+337
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Make bitfield assignment operator publicfearlessTobi2019-02-131-6/+2
| * | | | | | | | | remove all occurance of specifying endianness inside BitFieldWeiyi Wang2019-02-066-96/+96
| * | | | | | | | | common/bitfield: make it endianness-awareWeiyi Wang2019-02-063-3/+100
| * | | | | | | | | common/swap: remove default value for swap type internal storageWeiyi Wang2019-02-061-1/+1
| * | | | | | | | | common/swap: use template and tag for LE/BE specificationWeiyi Wang2019-02-061-39/+91
| * | | | | | | | | common/swap: add swap template for enumWeiyi Wang2019-02-061-0/+52
* | | | | | | | | | Merge pull request #2262 from lioncash/enumbunnei2019-03-212-2/+15
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | file_sys/content_archive: Amend name of Data_Unknown5 enum entryLioncash2019-03-192-2/+15
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2273 from lioncash/guardbunnei2019-03-212-0/+9
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | common/uint128: Add missing header guardLioncash2019-03-211-0/+2
| * | | | | | | | | | common/uint128: Add missing top-file source textLioncash2019-03-212-0/+7
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2268 from lioncash/codesetbunnei2019-03-218-45/+111
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/process: Make MapSegment lambda reference parameter constLioncash2019-03-201-1/+1
| * | | | | | | | | kernel: Move CodeSet structure to its own source filesLioncash2019-03-208-44/+110
* | | | | | | | | | Merge pull request #2272 from lioncash/boostbunnei2019-03-211-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | common/CMakeLists: Amend boost dependencyLioncash2019-03-211-1/+1
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #2267 from FernandoS27/fix-2238bunnei2019-03-211-1/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Fix crash caused by 2238.Fernando Sahmkow2019-03-201-1/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2247 from lioncash/includebunnei2019-03-212-4/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | common/thread_queue_list: Remove unnecessary dependency on boostLioncash2019-03-162-4/+4
* | | | | | | | | | | Merge pull request #2224 from lioncash/opusbunnei2019-03-211-34/+48
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | hwopus: Leverage multistream API for decoding regular Opus packetsLioncash2019-03-111-34/+48
* | | | | | | | | | | | Merge pull request #2239 from FearlessTobi/port-4684bunnei2019-03-211-3/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | frontend: qt: fix a freeze where if you click on entry in the game list too fast, citra will hangliushuyu2019-03-151-3/+1
* | | | | | | | | | | | Merge pull request #2264 from lioncash/linkerbunnei2019-03-205-189/+4
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | loader: Remove Linker classLioncash2019-03-203-185/+0
| * | | | | | | | | | | | loader: Remove Linker inheritance from NRO and NSO loadersLioncash2019-03-202-4/+4
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2263 from FearlessTobi/port-4697bunnei2019-03-201-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | Fix getopt on systems where char is unsigned by defaultxperia642019-03-191-2/+2
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #2258 from lioncash/ambunnei2019-03-192-13/+73
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | service/am: Add basic implementation of ChangeMainAppletMasterVolumeLioncash2019-03-182-1/+29
| * | | | | | | | | | service/am: Unstub SetTransparentVolumeRate()Lioncash2019-03-182-1/+17
| * | | | | | | | | | service/am: Unstub SetExpectedMasterVolume()Lioncash2019-03-182-11/+27
* | | | | | | | | | | Merge pull request #2259 from lioncash/fspbunnei2019-03-182-1/+5
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | fsp_srv: Unstub SetCurrentProcessLioncash2019-03-182-1/+5
* | | | | | | | | | | | Merge pull request #2254 from lioncash/redundantbunnei2019-03-181-3/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | input_common/sdl_impl: Make lambda capture more specific in SDLState constructorLioncash2019-03-171-1/+1
| * | | | | | | | | | | input_common/sdl_impl: Remove unnecessary std::chrono::duration constructionLioncash2019-03-171-1/+1
| * | | | | | | | | | | input_common/sdl_impl: Remove unused variable in SDLState constructorLioncash2019-03-171-1/+0
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2238 from lioncash/threadbunnei2019-03-182-21/+41
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | kernel/thread: Expand documentation of nominal_priority and current_priorityLioncash2019-03-162-3/+11
| * | | | | | | | | | kernel/thread: Make bracing consistent within UpdatePriority()Lioncash2019-03-161-2/+4
| * | | | | | | | | | kernel/thread: Amend condition within UpdatePriority()Lioncash2019-03-161-3/+3
| * | | | | | | | | | kernel/thread: Maintain priority ordering of added mutex waiting threadsLioncash2019-03-161-14/+24
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2257 from MerryMage/boost-1.66Mat M2019-03-181-2/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | CMakeLists: Raise minimum Boost requirement to 1.66.0MerryMage2019-03-181-2/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #2252 from bunnei/move-page-tablebunnei2019-03-1716-171/+215
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / |/| | | | | | | | |
| * | | | | | | | | core: Move PageTable struct into Common.bunnei2019-03-1716-171/+215
* | | | | | | | | | Merge pull request #2251 from bunnei/skip-zero-flushbunnei2019-03-171-0/+6
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_rasterizer: Skip zero addr/sized regions on flush/invalidate.bunnei2019-03-171-0/+6
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2249 from lioncash/ipcbunnei2019-03-171-0/+30
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | ipc_helpers: Allow pushing and popping floating-point valuesLioncash2019-03-161-0/+30
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2246 from lioncash/opus-forkbunnei2019-03-171-0/+0
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | externals: Update opus to latest masterLioncash2019-03-161-0/+0
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2245 from lioncash/unused-defbunnei2019-03-171-6/+0
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/thread: Actually remove the definition of ExitCurrentThread()Lioncash2019-03-161-6/+0
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2244 from bunnei/gpu-mem-refactorbunnei2019-03-1720-189/+196
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | video_core: Refactor to use MemoryManager interface for all memory access.bunnei2019-03-1620-189/+196
* | | | | | | | | | Merge pull request #2243 from bunnei/mem-simplify-cachebunnei2019-03-173-68/+22
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | memory: Simplify rasterizer cache operations.bunnei2019-03-163-68/+22
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2129 from FernandoS27/cntpctbunnei2019-03-176-2/+69
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Corrections, documenting and fixes.Fernando Sahmkow2019-02-164-13/+14
| * | | | | | | | | Use u128 on Clock Cycles calculation.Fernando Sahmkow2019-02-165-27/+32
| * | | | | | | | | Implement 128 bits Unsigned Integer Multiplication and Division.Fernando Sahmkow2019-02-163-0/+50
| * | | | | | | | | Correct CNTPCT to use Clock Cycles instead of Cpu Cycles.Fernando Sahmkow2019-02-163-2/+13
* | | | | | | | | | Merge pull request #2241 from lioncash/compile-flagsbunnei2019-03-161-8/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | CMakeLists: Remove now-unnecessary GCC special-casingLioncash2019-03-161-8/+2
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2242 from lioncash/thread-fnbunnei2019-03-164-33/+31
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/thread: Move thread exiting logic from ExitCurrentThread to svcExitThreadLioncash2019-03-162-8/+7
| * | | | | | | | | kernel/thread: Migrate WaitCurrentThread_Sleep into the Thread interfaceLioncash2019-03-164-25/+24
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2237 from bunnei/cache-host-addrbunnei2019-03-1626-294/+394
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gpu: Use host address for caching instead of guest address.bunnei2019-03-1526-294/+394
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2048 from FearlessTobi/port-3924bunnei2019-03-162-203/+250
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | citra_qt: Settings (configuration) reworkzhupengfei2019-03-072-203/+250
* | | | | | | | | Merge pull request #2233 from ReinUsesLisp/morton-cleanupbunnei2019-03-154-187/+146
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | video_core/morton: Use enum to describe MortonCopyPixels128 modeReinUsesLisp2019-03-133-7/+10
| * | | | | | | | | video_core/morton: Remove unused parameter in MortonSwizzleReinUsesLisp2019-03-133-8/+7
| * | | | | | | | | video_core/morton: Remove clang-format off when it's not neededReinUsesLisp2019-03-131-133/+129
| * | | | | | | | | video_core/morton: Remove unused functionsReinUsesLisp2019-03-131-39/+0
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2229 from ReinUsesLisp/vk-sampler-cachebunnei2019-03-154-24/+168
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / |/| | | | | | | |
| * | | | | | | | vk_sampler_cache: Use operator== instead of memcmpMat M2019-03-131-1/+1
| * | | | | | | | vk_sampler_cache: Implement a sampler cacheReinUsesLisp2019-03-134-1/+140
| * | | | | | | | video_core/texture: Add a raw representation of TSCEntryReinUsesLisp2019-03-121-24/+29
* | | | | | | | | Merge pull request #2230 from lioncash/globalbunnei2019-03-152-8/+9
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel/process: Remove use of global system accessorsLioncash2019-03-132-8/+9
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2216 from ReinUsesLisp/rasterizer-systembunnei2019-03-142-29/+31
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer: Use system instance passed from argumentReinUsesLisp2019-03-112-29/+31
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2227 from lioncash/overridebunnei2019-03-132-5/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | renderer_opengl/gl_global_cache: Replace indexing for assignment with insert_or_assignLioncash2019-03-112-3/+3
| * | | | | | | | | renderer_opengl/gl_global_cache: Append missing override specifiersLioncash2019-03-111-2/+2
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2226 from lioncash/privatebunnei2019-03-134-14/+36
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel/server_port: Make data members privateLioncash2019-03-114-14/+36
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2223 from lioncash/errorbunnei2019-03-133-19/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | core/hle/result: Remove now-unnecessary manually defined copy assignment operatorLioncash2019-03-101-5/+0
| * | | | | | | | | core/hle/result: Amend error in comment description for ResultCodeLioncash2019-03-101-1/+1
| * | | | | | | | | core/hle/result: Remove now-unused constructor for ResultCodeLioncash2019-03-101-10/+0
| * | | | | | | | | core/hle/result: Relocate IPC error code to ipc_helpersLioncash2019-03-103-3/+4
| |/ / / / / / / /
* | | | | | | | | Merge pull request #2187 from FearlessTobi/port-sdl-thingsbunnei2019-03-139-691/+785
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | fixup! Joystick: Allow for background events; Add deadzone to SDLAnalogB3n302019-03-021-6/+17
| * | | | | | | | | input/sdl: lock map mutex after SDL callWeiyi Wang2019-03-021-11/+17
| * | | | | | | | | Input: Remove global variables from SDL InputJames Rowe2019-03-029-809/+206
| * | | | | | | | | Input: Copy current SDL.h/cpp files to implJames Rowe2019-03-022-0/+680
* | | | | | | | | | Merge pull request #2166 from lioncash/vi-init-servicebunnei2019-03-139-40/+146
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | service/vi: Unstub GetDisplayServiceLioncash2019-02-275-11/+49
| * | | | | | | | | | core/ipc_helper: Allow popping all signed value types with RequestParserLioncash2019-02-271-0/+15
| * | | | | | | | | | service/vi: Remove use of a module classLioncash2019-02-268-46/+99
* | | | | | | | | | | Merge pull request #2231 from ReinUsesLisp/fixup-biasbunnei2019-03-131-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | video_core/texture: Fix up sampler lod biasReinUsesLisp2019-03-131-1/+1
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #2211 from lioncash/arbiterbunnei2019-03-129-65/+81
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel: Make the address arbiter instance per-processLioncash2019-03-088-28/+35
| * | | | | | | | | | kernel/svc: Move address arbiter signaling behind a unified API functionLioncash2019-03-083-22/+26
| * | | | | | | | | | kernel/svc: Move address arbiter waiting behind a unified API functionLioncash2019-03-083-19/+24
* | | | | | | | | | | Merge pull request #2222 from lioncash/cstrbunnei2019-03-121-4/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | service/service: Remove unncessary calls to c_str()Lioncash2019-03-101-4/+3
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2215 from ReinUsesLisp/samplersbunnei2019-03-123-64/+72
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | gl_rasterizer: Encapsulate sampler queries into methodsReinUsesLisp2019-03-093-64/+72
* | | | | | | | | | Merge pull request #2207 from lioncash/hwopusbunnei2019-03-101-69/+107
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | service/audio/hwopus: Move decoder state to its own classLioncash2019-03-071-50/+85
| * | | | | | | | | | service/audio/hwopus: Provide a name for the second word of OpusPacketHeaderLioncash2019-03-071-2/+4
| * | | | | | | | | | service/audio/hwopus: Move Opus packet header out of the IHardwareOpusDecoderManagerLioncash2019-03-071-17/+17
| * | | | | | | | | | service/audio/hwopus: Enclose internals in an anonymous namespaceLioncash2019-03-071-2/+3
* | | | | | | | | | | Merge pull request #2193 from lioncash/globalbunnei2019-03-105-17/+23
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/scheduler: Pass in system instance in constructorLioncash2019-03-045-17/+23
| | |_|_|_|_|_|_|_|/ / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2147 from ReinUsesLisp/texture-cleanbunnei2019-03-109-527/+590
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | shader/decode: Remove extras from MetaTextureReinUsesLisp2019-02-264-40/+65
| * | | | | | | | | | | shader/decode: Split memory and texture instructions decodingReinUsesLisp2019-02-268-501/+539
* | | | | | | | | | | | Merge pull request #2143 from ReinUsesLisp/texviewbunnei2019-03-103-32/+42
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_rasterizer_cache: Create texture views for array discrepanciesReinUsesLisp2019-02-273-32/+42
* | | | | | | | | | | | | Merge pull request #2220 from lioncash/cubebbunnei2019-03-102-4/+4
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|_|/ |/| | | | | | | | | | | |
| * | | | | | | | | | | | audio_core/cubeb_sink: Convert _MSC_VER ifdefs to _WIN32Lioncash2019-03-102-4/+4
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2217 from ReinUsesLisp/rasterizer-loggerMat M2019-03-101-19/+13
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_rasterizer: Minor logger changesReinUsesLisp2019-03-091-19/+13
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2219 from Hexagon12/log-settingsMat M2019-03-101-0/+3
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | clang fixHexagon122019-03-091-1/+2
| * | | | | | | | | | | | Log 2 new setting valuesHexagon122019-03-091-0/+2
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2218 from ReinUsesLisp/cmd-castMat M2019-03-101-5/+6
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | yuzu_cmd/config: Replace C casts with static_castReinUsesLisp2019-03-091-4/+5
| * | | | | | | | | | | yuzu_cmd/config: Silent implicit cast warningReinUsesLisp2019-03-091-1/+1
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #2210 from lioncash/optionalbunnei2019-03-087-58/+56
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/hle_ipc: Convert std::shared_ptr IPC header instances to std::optionalLioncash2019-03-084-47/+47
| * | | | | | | | | | | travis: Bump macOS version to 10.14Lioncash2019-03-082-2/+2
| * | | | | | | | | | | common/bit_field: Make BitField trivially copyableLioncash2019-03-071-9/+7
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2209 from lioncash/reorderbunnei2019-03-081-5/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core/gpu_thread: Remove unimplemented WaitForIdle function prototypeLioncash2019-03-071-3/+0
| * | | | | | | | | | | video_core/gpu_thread: Amend constructor initializer list orderLioncash2019-03-071-2/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #2208 from lioncash/gpubunnei2019-03-083-3/+3
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core/gpu: Make GPU's destructor virtualLioncash2019-03-073-3/+3
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #2191 from ReinUsesLisp/maxwell-to-vkbunnei2019-03-084-3/+553
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | maxwell_to_vk: Initial implementationReinUsesLisp2019-03-044-3/+553
* | | | | | | | | | | | Merge pull request #2212 from ReinUsesLisp/dma-push-fixbunnei2019-03-081-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | dma_pusher: Store command_list_header by copyReinUsesLisp2019-03-081-1/+1
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2195 from lioncash/shared-globalbunnei2019-03-071-3/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | kernel/shared_memory: Get rid of the use of global accessor functions within Create()Lioncash2019-03-041-3/+2
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2196 from DarkLordZach/web-applet-escbunnei2019-03-072-0/+7
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | web_browser: Add shortcut to Enter key to exit appletZach Hilman2019-03-052-0/+7
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #2202 from lioncash/port-privbunnei2019-03-076-36/+78
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/server_session: Make data members privateLioncash2019-03-065-32/+73
| * | | | | | | | | | | kernel/client_session: Make data members privateLioncash2019-03-061-4/+5
* | | | | | | | | | | | Merge pull request #2205 from FearlessTobi/docked-undocked-hotkeybunnei2019-03-071-0/+8
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | yuzu: add a hotkey to switch between undocked and docked modefearlessTobi2019-03-061-0/+8
* | | | | | | | | | | | | Merge pull request #2206 from lioncash/audio-stopbunnei2019-03-071-1/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | service/audio/audout_u: Only actually stop the audio stream in StopAudioOut if the stream is playingLioncash2019-03-071-1/+3
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2055 from bunnei/gpu-threadbunnei2019-03-0726-52/+529
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gpu_thread: Fix deadlock with threading idle state check.bunnei2019-03-072-7/+11
| * | | | | | | | | | | | gpu_thread: (HACK) Ignore flush on FlushAndInvalidateRegion.bunnei2019-03-071-3/+1
| * | | | | | | | | | | | gpu: Always flush.bunnei2019-03-072-13/+6
| * | | | | | | | | | | | gpu: Refactor a/synchronous implementations into their own classes.bunnei2019-03-078-65/+162
| * | | | | | | | | | | | gpu: Move command processing to another thread.bunnei2019-03-079-15/+358
| * | | | | | | | | | | | bootmanager: Ensure that we have a context for shader loading.bunnei2019-03-071-4/+6
| * | | | | | | | | | | | gpu: Refactor command and swap buffers interface for asynch.bunnei2019-03-075-17/+26
| * | | | | | | | | | | | gpu: Refactor to take RendererBase instead of RasterizerInterface.bunnei2019-03-073-18/+23
| * | | | | | | | | | | | settings: Add new graphics setting for use_asynchronous_gpu_emulation.bunnei2019-03-077-0/+24
| * | | | | | | | | | | | core: Set is_powered_on before GPU is initialized.bunnei2019-03-071-1/+3
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #2149 from ReinUsesLisp/decoders-stylebunnei2019-03-078-150/+183
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_rasterizer_cache: Move format conversion to its own fileReinUsesLisp2019-02-277-136/+175
| * | | | | | | | | | | | decoders: Minor style changesReinUsesLisp2019-02-272-14/+8
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2197 from lioncash/includebunnei2019-03-076-8/+12
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | core/hle/ipc: Remove unnecessary includesLioncash2019-03-056-8/+12
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #2190 from lioncash/ogl-globalbunnei2019-03-077-26/+28
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | core/core: Remove the global telemetry accessor functionLioncash2019-03-041-4/+0
| * | | | | | | | | | | yuzu: Remove usage of the global telemetry accessorLioncash2019-03-042-3/+3
| * | | | | | | | | | | yuzu-cmd/yuzu: Replace direct usage of the global system telemetry accessor in main()Lioncash2019-03-041-1/+1
| * | | | | | | | | | | core/core: Replace direct usage of the global system telemetry accessor from Shutdown()Lioncash2019-03-041-7/+7
| * | | | | | | | | | | video_core/renderer_opengl: Replace direct usage of global system object accessorsLioncash2019-03-042-11/+17
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2199 from lioncash/arbiterbunnei2019-03-067-115/+187
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/address_arbiter: Pass in system instance to constructorLioncash2019-03-056-26/+45
| * | | | | | | | | | | kernel/address_arbiter: Minor tidying upLioncash2019-03-051-18/+18
| * | | | | | | | | | | kernel/address_arbiter: Convert the address arbiter into a classLioncash2019-03-055-82/+135
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2201 from lioncash/audio-retvalbunnei2019-03-061-0/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | hle/service/audio/audout_u: Correct lack of return in failure case of AppendAudioOutBufferImpl()Lioncash2019-03-061-0/+1
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #2204 from lioncash/wait-treebunnei2019-03-062-5/+6
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | yuzu/debugger/wait_tree: Remove use of global CurrentProcess accessorLioncash2019-03-062-5/+6
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2194 from lioncash/membunnei2019-03-063-30/+66
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | vm_manager: Use range helpers in HeapAlloc() and HeapFree()Lioncash2019-03-041-4/+2
| * | | | | | | | | | vm_manager: Provide address range checking functions for other memory regionsLioncash2019-03-042-4/+35
| * | | | | | | | | | svc: Migrate address range checking functions to VMManagerLioncash2019-03-043-23/+30
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2200 from lioncash/audiobunnei2019-03-064-10/+21
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | hle/service/audio: Extract audio error codes to a headerLioncash2019-03-054-10/+21
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2203 from lioncash/engines-includebunnei2019-03-0610-11/+11
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | video_core/engines: Remove unnecessary includesLioncash2019-03-0610-11/+11
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #2198 from lioncash/todobunnei2019-03-062-4/+0
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | video_core/surface: Remove obsolete TODO in PixelFormatFromRenderTargetFormat()Lioncash2019-03-051-2/+0
| * | | | | | | | | kernel/thread: Remove obsolete TODO in Create()Lioncash2019-03-051-2/+0
|/ / / / / / / / /
* | | | | | | | | Merge pull request #2185 from FearlessTobi/port-4630bunnei2019-03-051-6/+0
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | Memory: don't lock hle mutex in memory read/writeWeiyi Wang2019-03-021-6/+0
* | | | | | | | | Merge pull request #2165 from ReinUsesLisp/unbind-texbunnei2019-03-042-14/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer: Remove texture unbinding after dispatching a draw callReinUsesLisp2019-02-281-12/+0
| * | | | | | | | | gl_state: Fixup multibind bugReinUsesLisp2019-02-281-2/+2
* | | | | | | | | | Merge pull request #2188 from lioncash/log-staticbunnei2019-03-042-29/+25
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | logging/backend: Make time_origin a class variable instead of a local staticLioncash2019-03-021-2/+1
| * | | | | | | | | | logging/backend: Move CreateEntry into the Impl classLioncash2019-03-022-29/+26
* | | | | | | | | | | Merge pull request #2189 from lioncash/webbunnei2019-03-042-3/+0
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | web_service: Remove unnecessary inclusionsLioncash2019-03-022-3/+0
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #2154 from FearlessTobi/port-4647Mat M2019-03-021-1/+4
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | citra_qt/main: make SPEED_LIMIT_STEP static constexprfearlessTobi2019-03-021-1/+4
* | | | | | | | | | Merge pull request #2183 from ReinUsesLisp/vk-buffer-cache-clangMat M2019-03-021-3/+3
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | vk_buffer_cache: Fix clang-formatReinUsesLisp2019-03-021-3/+3
* | | | | | | | | | Merge pull request #2186 from honzapatCZ/patch-1James Rowe2019-03-021-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | Yuzu can render 3D.Nejcraft2019-03-021-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #2182 from bunnei/my-wasted-fridaybunnei2019-03-021-1/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | fuck git for ruining my day, I will learn but I will not forgivebunnei2019-03-021-1/+1
* | | | | | | | | Merge pull request #2178 from ReinUsesLisp/vk-buffer-cachebunnei2019-03-023-0/+205
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | vk_buffer_cache: Implement a buffer cacheReinUsesLisp2019-03-013-0/+205
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2173 from lioncash/capturebunnei2019-03-011-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu/compatdb: Remove unused lambda captureLioncash2019-02-271-1/+1
* | | | | | | | | Merge pull request #2180 from lioncash/audrenbunnei2019-03-011-1/+12
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service/audio: Provide an implementation of ExecuteAudioRendererRenderingLioncash2019-03-011-1/+12
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2181 from lioncash/audren2bunnei2019-03-012-7/+20
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | service/audio/audren_u: Implement OpenAudioRendererAutoLioncash2019-03-012-7/+20
|/ / / / / / / /
* | | | | | | | Merge pull request #2174 from lioncash/fwdbunnei2019-02-281-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | service/hid: Amend forward declaration of ServiceManagerLioncash2019-02-271-1/+1
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2152 from ReinUsesLisp/vk-stream-bufferbunnei2019-02-285-8/+172
|\ \ \ \ \ \ \ \
| * | | | | | | | vk_stream_buffer: Remove copy code pathReinUsesLisp2019-02-262-53/+18
| * | | | | | | | vk_stream_buffer: Implement a stream bufferReinUsesLisp2019-02-243-1/+200
| * | | | | | | | vk_resource_manager: Minor VKFenceWatch changesReinUsesLisp2019-02-242-7/+7
* | | | | | | | | Merge pull request #2121 from FernandoS27/texception2bunnei2019-02-284-16/+213
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Devirtualize Register/Unregister and use a wrapper instead.Fernando Sahmkow2019-02-283-12/+8
| * | | | | | | | | Corrections and redesign.Fernando Sahmkow2019-02-282-51/+51
| * | | | | | | | | Fix linux compile error.Fernando Sahmkow2019-02-281-1/+1
| * | | | | | | | | Remove NotifyFrameBuffer as we are doing a texception pass every drawcall.Fernando Sahmkow2019-02-282-25/+0
| * | | | | | | | | Remove certain optimizations that caused texception to fail in certain scenarios.Fernando Sahmkow2019-02-283-24/+1
| * | | | | | | | | Bug fixes and formattingFernando Sahmkow2019-02-282-3/+4
| * | | | | | | | | rasterizer_cache_gl: Implement Texception PassFernando Sahmkow2019-02-283-0/+51
| * | | | | | | | | rasterizer_cache_gl: Implement Partial Reinterpretation of Surfaces.Fernando Sahmkow2019-02-282-0/+100
| * | | | | | | | | rasterizer_cache: mark reinterpreted surfaces and add ability to reload marked surfaces on next use.Fernando Sahmkow2019-02-282-0/+78
| * | | | | | | | | rasterizer_cache_gl: Notify on framebuffer changeFernando Sahmkow2019-02-282-4/+23
| * | | | | | | | | rasterizer_cache: Expose FlushObject to Child classes and allow redefining of Register and UnregisterFernando Sahmkow2019-02-281-11/+11
* | | | | | | | | | Merge pull request #2172 from lioncash/reorderbunnei2019-02-282-3/+3
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | vk_memory_manager: Reorder constructor initializer list in terms of member declaration orderLioncash2019-02-271-1/+1
| * | | | | | | | | gl_rasterizer: Reorder constructor initializer list in terms of member declaration orderLioncash2019-02-271-2/+2
* | | | | | | | | | Merge pull request #2163 from ReinUsesLisp/bitset-dirtybunnei2019-02-284-52/+51
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | maxwell_3d: Use std::bitset to manage dirty flagsReinUsesLisp2019-02-264-52/+51
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | Speed up memory page mapping (#2141)Annomatg2019-02-271-6/+11
* | | | | | | | | | Merge pull request #2176 from lioncash/combunnei2019-02-272-0/+19
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | audio_core/cubeb_sink: Ensure COM is initialized on Windows prior to calling cubeb_initLioncash2019-02-272-0/+19
|/ / / / / / / / /
* | | | | | | | | Merge pull request #2169 from lioncash/namingbunnei2019-02-272-19/+21
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | audio_core/audio_renderer: Name previously unknown parameters of AudioRendererParameterLioncash2019-02-272-19/+21
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2170 from lioncash/emu-windowbunnei2019-02-272-2/+2
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | core/frontend/emu_window: Make ClipToTouchScreen a const member functionLioncash2019-02-272-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #2161 from lioncash/handle-tablebunnei2019-02-276-19/+63
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/handle_table: Make local variables as const where applicableLioncash2019-02-251-4/+5
| * | | | | | | | kernel/handle_table: Allow process capabilities to limit the handle table sizeLioncash2019-02-256-10/+54
| * | | | | | | | kernel/handle-table: In-class initialize data membersLioncash2019-02-252-3/+2
| * | | | | | | | kernel/handle_table: Resolve truncation warningsLioncash2019-02-251-2/+2
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #2168 from lioncash/cubebbunnei2019-02-271-0/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | externals: Update cubeb to 6f2420de8f155b10330cf973900ac7bdbfee589dLioncash2019-02-271-0/+0
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #2167 from lioncash/namespacebunnei2019-02-2723-81/+81
|\ \ \ \ \ \ \ \
| * | | | | | | | common/math_util: Move contents into the Common namespaceLioncash2019-02-2718-40/+40
| * | | | | | | | common/vector_math: Move Vec[x] types into the Common namespaceLioncash2019-02-276-38/+38
| * | | | | | | | common/quaternion: Move Quaternion into the Common namespaceLioncash2019-02-272-6/+6
| |/ / / / / / /
* | | | | | | | Merge pull request #2171 from lioncash/pragmabunnei2019-02-271-2/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | gl_shader_disk_cache: Remove #pragma once from cpp fileLioncash2019-02-271-2/+0
|/ / / / / / /
* | | | | | | Merge pull request #2164 from ReinUsesLisp/configure-blitbunnei2019-02-261-0/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | renderer_opengl: Update pixel format trackingReinUsesLisp2019-02-261-0/+1
|/ / / / / /
* | | | | | Merge pull request #2156 from FreddyFunk/patch-1bunnei2019-02-261-1/+1
|\ \ \ \ \ \
| * | | | | | file_sys/vfs_vector: Fix ignored offset on WriteFrederic L2019-02-251-1/+1
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2158 from lioncash/tablebunnei2019-02-261-0/+1
|\ \ \ \ \ \
| * | | | | | service/vi: Update IManagerDisplayService's function tableLioncash2019-02-251-0/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2160 from lioncash/audio-warnbunnei2019-02-262-6/+6
|\ \ \ \ \ \
| * | | | | | audio_core/cubeb_sink: Initialize CubebSinkStream's last_frame data memberLioncash2019-02-251-1/+1
| * | | | | | audio_core/cubeb_sink: Add override specifier to destructorLioncash2019-02-251-1/+1
| * | | | | | audio_core/cubeb_sink: Resolve variable shadowing warnings in SamplesInQueueLioncash2019-02-251-2/+2
| * | | | | | audio_core/codec: Resolve truncation warnings within DecodeADPCMLioncash2019-02-251-2/+2
| |/ / / / /
* | | | | | Merge pull request #2159 from lioncash/warnbunnei2019-02-251-5/+5
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | shader/track: Resolve variable shadowing warningsLioncash2019-02-251-5/+5
|/ / / / /
* | | | | Merge pull request #2118 from FernandoS27/ipa-improvebunnei2019-02-256-38/+74
|\ \ \ \ \
| * | | | | shader_decompiler: Improve Accuracy of Attribute Interpolation.Fernando Sahmkow2019-02-146-38/+74
* | | | | | Merge pull request #2119 from FernandoS27/fix-copybunnei2019-02-251-1/+5
|\ \ \ \ \ \
| * | | | | | rasterizer_cache_gl: Only do fast layered copy on the same format. AsFernando Sahmkow2019-02-131-1/+5
* | | | | | | Merge pull request #2155 from FearlessTobi/port-4655bunnei2019-02-251-3/+3
|\ \ \ \ \ \ \
| * | | | | | | Remove GCC version checkstgsm2019-02-241-3/+3
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2144 from lioncash/factorbunnei2019-02-257-67/+209
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | service/nvflinger: Store BufferQueue instances as regular data membersLioncash2019-02-227-36/+39
| * | | | | | service/vi/vi_layer: Convert Layer struct into a classLioncash2019-02-216-10/+43
| * | | | | | service/nvflinger: Move display specifics over to vi_displayLioncash2019-02-214-35/+141
* | | | | | | Merge pull request #2139 from degasus/dma_pusherbunnei2019-02-242-28/+34
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | video_core/dma_pusher: Simplyfy Step() logic.Markus Wick2019-02-192-81/+77
| * | | | | | video_core/dma_pusher: The full list of headers at once.Markus Wick2019-02-192-48/+58
* | | | | | | Merge pull request #2146 from ReinUsesLisp/vulkan-schedulerbunnei2019-02-243-1/+132
|\ \ \ \ \ \ \
| * | | | | | | vk_scheduler: Implement a schedulerReinUsesLisp2019-02-223-1/+132
* | | | | | | | Merge pull request #2150 from ReinUsesLisp/fixup-layer-swizzlebunnei2019-02-241-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_rasterizer_cache: Fixup parameter order in layered swizzleReinUsesLisp2019-02-241-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #2151 from ReinUsesLisp/fixup-vk-memory-managerbunnei2019-02-241-2/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | vk_memory_manager: Fixup commit interval allocationReinUsesLisp2019-02-241-2/+1
|/ / / / / / /
* | | | | | | Merge pull request #2138 from ReinUsesLisp/vulkan-memory-managerbunnei2019-02-224-0/+342
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | vk_memory_manager: Implement memory managerReinUsesLisp2019-02-194-0/+342
| |/ / / / /
* | | | | | Merge pull request #2125 from ReinUsesLisp/fixup-glstatebunnei2019-02-211-83/+61
|\ \ \ \ \ \
| * | | | | | gl_state: Synchronize gl_state even when state is disabledReinUsesLisp2019-02-151-83/+61
* | | | | | | Merge pull request #2130 from lioncash/system_enginebunnei2019-02-219-23/+49
|\ \ \ \ \ \ \
| * | | | | | | video_core: Remove usages of System::GetInstance() within the enginesLioncash2019-02-169-23/+49
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Fixes Unicode Key File Directories (#2120)Jungy2019-02-211-1/+2
* | | | | | | Merge pull request #2142 from lioncash/relocatebunnei2019-02-217-57/+123
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | service/nvflinger: Relocate definitions of Layer and Display to the vi serviceLioncash2019-02-207-57/+123
|/ / / / / /
* | | | | | Merge pull request #2122 from ReinUsesLisp/vulkan-resource-managerbunnei2019-02-193-1/+468
|\ \ \ \ \ \
| * | | | | | vk_resource_manager: Implement a command buffer pool with VKFencedPoolReinUsesLisp2019-02-142-1/+59
| * | | | | | vk_resource_manager: Add VKFencedPool interfaceReinUsesLisp2019-02-142-0/+83
| * | | | | | vk_resource_manager: Implement VKResourceManager and fence allocatorReinUsesLisp2019-02-142-0/+85
| * | | | | | vk_resource_manager: Implement VKFenceWatchReinUsesLisp2019-02-142-0/+68
| * | | | | | vk_resource_manager: Implement VKFenceReinUsesLisp2019-02-142-0/+131
| * | | | | | vk_resource_manager: Add VKResource interfaceReinUsesLisp2019-02-143-1/+43
* | | | | | | Merge pull request #2134 from lioncash/namingbunnei2019-02-172-2/+2
|\ \ \ \ \ \ \
| * | | | | | | audio_core/buffer: Make const and non-const getter for samples consistentLioncash2019-02-162-2/+2
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2133 from lioncash/arbiterbunnei2019-02-162-8/+4
|\ \ \ \ \ \ \
| * | | | | | | address_arbiter: Use nested namespaces where applicableLioncash2019-02-162-8/+4
| |/ / / / / /
* | | | | | | Merge pull request #2127 from FearlessTobi/fix-screenshot-srgbbunnei2019-02-161-1/+2
|\ \ \ \ \ \ \
| * | | | | | | renderer_opengl: respect the sRGB colorspace for the screenshot featurefearlessTobi2019-02-151-1/+2
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #2128 from FearlessTobi/port-4197bunnei2019-02-163-12/+26
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Adressed review commentsB3n302019-02-152-7/+9
| * | | | | | threadsafe_queue: Add WaitIfEmpty and use it in loggingB3n302019-02-153-14/+26
| |/ / / / /
* | | | | | Merge pull request #2123 from lioncash/coretiming-globalJames Rowe2019-02-1653-412/+548
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | core_timing: Convert core timing into a classLioncash2019-02-1653-412/+548
| |/ / / /
* | | | | Merge pull request #2112 from lioncash/shadowingbunnei2019-02-151-7/+13
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Remove unnecessary newlineLioncash2019-02-121-2/+0
| * | | | | gl_rasterizer_cache: Get rid of variable shadowingLioncash2019-02-121-6/+14
* | | | | | Merge pull request #2111 from ReinUsesLisp/fetch-fixbunnei2019-02-152-22/+35
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | gl_shader_decompiler: Re-implement TLDS lodReinUsesLisp2019-02-122-22/+35
* | | | | | Merge pull request #2113 from ReinUsesLisp/vulkan-basebunnei2019-02-149-0/+409
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | vk_device: Abstract device handling into a classReinUsesLisp2019-02-133-1/+351
| * | | | | renderer_vulkan: Add declarations fileReinUsesLisp2019-02-122-0/+52
| * | | | | logging: Add Vulkan backend logging class typeReinUsesLisp2019-02-122-0/+2
| * | | | | cmake: Add Vulkan optionReinUsesLisp2019-02-121-0/+2
| * | | | | gitmodules: Add Vulkan headers dependencyReinUsesLisp2019-02-122-0/+3
| |/ / / /
* | | | | Merge pull request #2115 from lioncash/localbunnei2019-02-141-3/+3
|\ \ \ \ \
| * | | | | core_timing: Make EmptyTimedCallback a local variableLioncash2019-02-131-3/+3
* | | | | | Merge pull request #2116 from lioncash/sizebunnei2019-02-142-21/+18
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | threadsafe_queue: Use std::size_t for representing sizeLioncash2019-02-131-7/+6
| * | | | | threadsafe_queue: Remove NeedSize template parameterLioncash2019-02-132-15/+13
| |/ / / /
* | | | | Merge pull request #2099 from greggameplayer/BGRA8-Framebuffer-Realbunnei2019-02-133-0/+4
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Implement BGRA8 framebuffer formatgreggameplayer2019-02-093-0/+4
| | |/ / | |/| |
* | | | Merge pull request #2114 from lioncash/globalbunnei2019-02-131-3/+3
|\ \ \ \
| * | | | renderer_opengl: Remove reference to global system instanceLioncash2019-02-131-3/+3
|/ / / /
* | | | Merge pull request #2110 from lioncash/namespacebunnei2019-02-1335-174/+172
|\ \ \ \
| * | | | core_timing: Rename CoreTiming namespace to Core::TimingLioncash2019-02-1235-174/+172
| |/ / /
* | | | Merge pull request #2104 from ReinUsesLisp/compute-assertbunnei2019-02-136-52/+59
|\ \ \ \ | |_|/ / |/| | |
| * | | kepler_compute: Fixup assert and rename enginesReinUsesLisp2019-02-106-52/+59
* | | | Merge pull request #2108 from FernandoS27/fix-ccbunnei2019-02-121-2/+2
|\ \ \ \
| * | | | Fix incorrect value for CC bit in IADDFernando Sahmkow2019-02-111-2/+2
| | |/ / | |/| |
* | | | Merge pull request #2109 from FernandoS27/fix-f2ibunnei2019-02-122-4/+4
|\ \ \ \
| * | | | Corrected F2I None mode to RoundEven.Fernando Sahmkow2019-02-112-4/+4
| |/ / /
* | | | Merge pull request #2068 from ReinUsesLisp/shader-cleanup-texturesbunnei2019-02-123-153/+123
|\ \ \ \ | |/ / / |/| | |
| * | | shader_ir: Remove F4 prefix to texture operationsReinUsesLisp2019-02-073-26/+25
| * | | shader_ir: Clean texture management codeReinUsesLisp2019-02-073-133/+104
| |/ /
* | | Merge pull request #1904 from bunnei/better-fermi-copybunnei2019-02-097-72/+206
|\ \ \
| * | | gl_rasterizer_cache: Mark surface copy destinations as modified.bunnei2019-02-072-4/+18
| * | | gl_rasterizer: Implement a more accurate fermi 2D copy.bunnei2019-02-077-68/+188
* | | | Merge pull request #2096 from FearlessTobi/patch-3bunnei2019-02-091-3/+3
|\ \ \ \
| * | | | nvdisp_disp0: change drawing message log level from Warning to TraceTobias2019-02-081-3/+3
| | |/ / | |/| |
* | | | Implement linear textures (#2089)Fernando Sahmkow2019-02-092-5/+39
* | | | Merge pull request #2097 from ReinUsesLisp/fixup-texviewbunnei2019-02-081-2/+2
|\ \ \ \ | |/ / / |/| | |
| * | | gl_rasterizer_cache: Fixup texture view parametersReinUsesLisp2019-02-081-2/+2
|/ / /
* | | Merge pull request #2083 from ReinUsesLisp/shader-ir-cbuf-trackingbunnei2019-02-0730-127/+141
|\ \ \ | |/ / |/| |
| * | shader/track: Search inside of conditional nodesReinUsesLisp2019-02-031-0/+11
| * | shader_ir: Rename BasicBlock to NodeBlockReinUsesLisp2019-02-0330-122/+120
| * | shader_ir: Pass decoded nodes as a whole instead of per basic blocksReinUsesLisp2019-02-0327-57/+62
* | | Merge pull request #2091 from FearlessTobi/port-4603bunnei2019-02-071-4/+10
|\ \ \
| * | | gdbstub: only let Execute breakpoints write/restore BKPT opcodes into target memoryDimitri ALBORA2019-02-061-4/+10
* | | | Merge pull request #2021 from ReinUsesLisp/disk-cachebunnei2019-02-0740-260/+1623
|\ \ \ \
| * | | | cmake: Fix title bar issueReinUsesLisp2019-02-072-9/+15
| * | | | gl_shader_disk_cache: Check LZ4 size limitFrederic L2019-02-071-0/+4
| * | | | gl_shader_disk_cache: Consider compressed size zero as an errorFrederic L2019-02-071-2/+2
| * | | | cmake: Use CMAKE_COMMAND instead of "cmake"Frederic L2019-02-071-1/+1
| * | | | gl_shader_disk_cache: Use unordered containersReinUsesLisp2019-02-074-56/+64
| * | | | gl_shader_cache: Fixup GLSL unique identifiersReinUsesLisp2019-02-072-3/+3
| * | | | cmake: Fixup application stringMichael2019-02-071-2/+2
| * | | | loading_screen: Unchunk progress barReinUsesLisp2019-02-071-1/+3
| * | | | gl_shader_cache: Link loading screen with disk shader cache loadReinUsesLisp2019-02-0710-12/+62
| * | | | gl_shader_cache: Set GL_PROGRAM_SEPARABLE to dumped shadersReinUsesLisp2019-02-071-0/+1
| * | | | gl_shader_disk_cache: Pass core system as argument and guard against games without title idsReinUsesLisp2019-02-0711-18/+58
| * | | | gl_shader_disk_cache: Guard reads and writes against failureReinUsesLisp2019-02-072-216/+339
| * | | | gl_shader_disk_cache: Address miscellaneous feedbackReinUsesLisp2019-02-075-43/+57
| * | | | gl_shader_disk_cache: Pass return values returning instead of by parametersReinUsesLisp2019-02-073-39/+37
| * | | | gl_shader_disk_cache: Compress program binaries using LZ4ReinUsesLisp2019-02-071-7/+28
| * | | | gl_shader_disk_cache: Compress GLSL code using LZ4ReinUsesLisp2019-02-072-6/+57
| * | | | gl_shader_disk_cache: Save GLSL and entries into the precompiled fileReinUsesLisp2019-02-079-135/+234
| * | | | settings: Hide shader cache behind a settingReinUsesLisp2019-02-078-0/+42
| * | | | gl_shader_disk_cache: Invalidate shader cache changes with CMake hashReinUsesLisp2019-02-076-59/+173
| * | | | gl_shader_cache: Refactor to support disk shader cacheReinUsesLisp2019-02-072-121/+388
| * | | | gl_shader_disk_cache: Add transferable cache invalidationReinUsesLisp2019-02-072-0/+8
| * | | | gl_shader_disk_cache: Add precompiled loadReinUsesLisp2019-02-072-0/+45
| * | | | gl_shader_disk_cache: Add precompiled saveReinUsesLisp2019-02-072-0/+57
| * | | | gl_shader_disk_cache: Add transferable loadReinUsesLisp2019-02-072-0/+56
| * | | | gl_shader_disk_cache: Add transferable storesReinUsesLisp2019-02-072-0/+194
| * | | | gl_shader_disk_cache: Add ShaderDiskCacheOpenGL class and helpersReinUsesLisp2019-02-072-0/+76
| * | | | gl_shader_disk_cache: Add file and move BaseBindings declarationReinUsesLisp2019-02-074-10/+58
| * | | | gl_shader_decompiler: Remove name entriesReinUsesLisp2019-02-072-28/+10
| * | | | gl_shader_util: Add parameter to handle retrievable programsReinUsesLisp2019-02-073-6/+10
| * | | | rasterizer_interface: Add disk cache entry for the rasterizerReinUsesLisp2019-02-076-0/+17
| * | | | file_util: Add shader directoryReinUsesLisp2019-02-073-0/+3
| * | | | shader_decode: Implement LDG and basic cbuf trackingReinUsesLisp2019-02-071-0/+33
|/ / / /
* | | | Merge pull request #2042 from ReinUsesLisp/nouveau-texbunnei2019-02-0711-79/+82
|\ \ \ \
| * | | | video_core: Assert on invalid GPU to CPU address queriesReinUsesLisp2019-02-038-47/+67
| * | | | maxwell_3d: Allow sampler handles with TSC id zeroReinUsesLisp2019-02-031-10/+6
| * | | | maxwell_3d: Allow texture handles with TIC id zeroReinUsesLisp2019-02-033-21/+7
| * | | | memory_manager: Check for reserved page statusReinUsesLisp2019-02-031-1/+2
| | |/ / | |/| |
* | | | Merge pull request #2071 from ReinUsesLisp/dsa-texturebunnei2019-02-078-216/+153
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_rasterizer_cache: Fixup test clauseReinUsesLisp2019-01-301-6/+5
| * | | gl_rasterizer_cache: Guard clause swizzle testingMat M2019-01-301-1/+3
| * | | gl_state: Remove texture target trackingReinUsesLisp2019-01-302-5/+0
| * | | gl_rasterizer_cache: Move swizzling to textures instead of stateReinUsesLisp2019-01-306-28/+35
| * | | gl_state: Use DSA and multi bind to update texture bindingsReinUsesLisp2019-01-301-8/+22
| * | | gl_rasterizer: Use DSA for texturesReinUsesLisp2019-01-305-185/+105
* | | | Merge pull request #2057 from FearlessTobi/port-4586bunnei2019-02-062-7/+15
|\ \ \ \
| * | | | Use QPixmap/QIcon for background color selection buttonxperia642019-01-262-7/+15
* | | | | Merge pull request #2086 from FearlessTobi/port-4583bunnei2019-02-061-6/+10
|\ \ \ \ \
| * | | | | Fix crash when no files are selectedxperia642019-02-051-6/+6
| * | | | | Add file extension to screenshot filename if not providedxperia642019-02-051-3/+7
| | |_|_|/ | |/| | |
* | | | | Merge pull request #2087 from lioncash/constbunnei2019-02-064-50/+136
|\ \ \ \ \
| * | | | | service/nvflinger,service/vi: Handle failure cases with exposed APILioncash2019-02-064-47/+133
| * | | | | service/nvflinger: Mark FindVsyncEvent() as a const member functionLioncash2019-02-052-2/+2
| * | | | | service/nvflinger: Rename GetVsyncEvent() to FindVsyncEvent()Lioncash2019-02-053-3/+3
| |/ / / /
* | | | | Merge pull request #2088 from jroweboy/hbunnei2019-02-061-1/+4
|\ \ \ \ \
| * | | | | QT: Fix the loading screen 'H' switch logo to not glitch outJames Rowe2019-02-061-1/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #2085 from ReinUsesLisp/cube-minus-onebunnei2019-02-051-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | video_core/texture: Fix BitField size for depth_minus_oneReinUsesLisp2019-02-051-1/+1
* | | | | Merge pull request #2081 from ReinUsesLisp/lmem-64bunnei2019-02-052-15/+46
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | shader_ir/memory: Add ST_L 64 and 128 bits storesReinUsesLisp2019-02-031-3/+11
| * | | | shader_ir/memory: Add LD_L 128 bits loadsReinUsesLisp2019-02-031-7/+19
| * | | | shader_bytecode: Rename BytesN enums to BitsNReinUsesLisp2019-02-032-7/+7
| * | | | shader_ir/memory: Add LD_L 64 bits loadsReinUsesLisp2019-02-031-6/+17
| | |_|/ | |/| |
* | | | Merge pull request #2082 from FernandoS27/txq-stlbunnei2019-02-052-6/+13
|\ \ \ \ | |/ / / |/| | |
| * | | Update src/video_core/engines/shader_bytecode.hMat M2019-02-041-1/+1
| * | | Fix TXQ not using the component mask.Fernando Sahmkow2019-02-032-6/+13
* | | | Merge pull request #2074 from ReinUsesLisp/shader-ir-unify-offsetbunnei2019-02-0117-25/+36
|\ \ \ \
| * | | | shader_ir: Unify constant buffer offset valuesReinUsesLisp2019-01-3017-25/+36
* | | | | Merge pull request #2073 from lioncash/opusbunnei2019-02-011-42/+75
|\ \ \ \ \
| * | | | | hwopus: Implement DecodeInterleavedLioncash2019-01-301-4/+35
| * | | | | hwopus: Deduplicate the decoding code within DecodeInterleavedOld and DecodeInterleavedWithPerfOldLioncash2019-01-301-19/+14
| * | | | | hwopus: Replace std::optional<std::reference_wrapper<u64>> with u64*Lioncash2019-01-301-9/+6
| * | | | | hwopus: Mark local variables as const where applicableLioncash2019-01-301-8/+16
| * | | | | hwopus: Fill in the rest of the unknown service function namesLioncash2019-01-301-9/+11
| |/ / / /
* | | | | Merge pull request #2067 from ReinUsesLisp/workaround-fbbunnei2019-02-012-14/+19
|\ \ \ \ \
| * | | | | gl_rasterizer: Workaround invalid zeta clearsReinUsesLisp2019-01-302-14/+19
* | | | | | Merge pull request #2078 from lioncash/timerbunnei2019-02-019-259/+0
|\ \ \ \ \ \
| * | | | | | kernel: Remove the Timer classLioncash2019-02-019-259/+0
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #2079 from ReinUsesLisp/remove-fillbunnei2019-02-015-17/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | rasterizer_interface: Remove unused AccelerateFill operationReinUsesLisp2019-02-013-11/+0
| * | | | | video_core: Remove unused Fill surface typeReinUsesLisp2019-02-012-6/+1
|/ / / / /
* | | | | Merge pull request #2072 from lioncash/servicebunnei2019-01-3112-153/+281
|\ \ \ \ \
| * | | | | service/ns: Update function tablesLioncash2019-01-301-14/+20
| * | | | | service/ncm: Update function tablesLioncash2019-01-301-4/+4
| * | | | | service/audio: Update function tablesLioncash2019-01-304-8/+23
| * | | | | service/am/applet_ae: Update function tablesLioncash2019-01-301-1/+2
| * | | | | service/fsp-srv: Update function tablesLioncash2019-01-302-17/+25
| * | | | | service/btm: Update function tablesLioncash2019-01-301-55/+97
| * | | | | service/btdrv: Update function tablesLioncash2019-01-301-46/+101
| * | | | | service/psc: Update function tablesLioncash2019-01-301-8/+9
| |/ / / /
* | | | | Merge pull request #2077 from lioncash/virtbunnei2019-01-315-15/+3
|\ \ \ \ \
| * | | | | kernel/wait_object: Devirtualize functions related to manipulating the thread list directlyLioncash2019-01-301-3/+3
| * | | | | kernel/timer: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
| * | | | | kernel/readable_event: Remove unnecessary WakeupAllWaitingThreads() overrideLioncash2019-01-302-6/+0
* | | | | | Merge pull request #2075 from lioncash/findbunnei2019-01-313-23/+47
|\ \ \ \ \ \
| * | | | | | service/nvflinger: Make FindBufferQueueId() a const member functionLioncash2019-01-302-2/+26
| * | | | | | service/nvflinger: Rename Get prefix on function to FindLioncash2019-01-303-23/+23
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1818 from ccawley2011/patch-1Hexagon122019-01-301-0/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Add missing environment variables to travis-ci.envCameron Cawley2018-11-281-0/+2
* | | | | | Merge pull request #2076 from lioncash/encHexagon122019-01-301-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | video_core/dma_pusher: Silence C4828 warningsLioncash2019-01-301-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #1485 from FernandoS27/render-infobunnei2019-01-302-2/+57
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add more info into textures' object labelsFernandoS272018-12-092-2/+57
* | | | | Merge pull request #2070 from ReinUsesLisp/cubearray-viewbunnei2019-01-304-3/+28
|\ \ \ \ \
| * | | | | gl_shader_cache: Fix texture view for cubemaps as cubemap arraysReinUsesLisp2019-01-304-3/+28
| | |_|/ / | |/| | |
* | | | | Merge pull request #2069 from lioncash/vibunnei2019-01-302-21/+20
|\ \ \ \ \
| * | | | | nvflinger: Add the Null displayLioncash2019-01-301-1/+2
| * | | | | nvflinger: Change log message in OpenDisplay to be a debug log instead of a warningLioncash2019-01-301-1/+1
| * | | | | nvflinger: Remove unnecessary header inclusionsLioncash2019-01-301-2/+0
| * | | | | nvflinger: Mark locals const where applicableLioncash2019-01-301-11/+11
| * | | | | nvflinger: Use a std::array for the available displays instead of std::vectorLioncash2019-01-302-7/+7
| |/ / / /
* | | | | Merge pull request #1987 from ReinUsesLisp/explicit-shader-ldgbunnei2019-01-307-249/+194
|\ \ \ \ \
| * | | | | gl_shader_cache: Use explicit bindingsReinUsesLisp2019-01-307-249/+194
|/ / / / /
* | | | | Merge pull request #1960 from ReinUsesLisp/shader-ir-ldgbunnei2019-01-3013-14/+380
|\ \ \ \ \
| * | | | | gl_rasterizer: Implement global memory managementReinUsesLisp2019-01-306-4/+140
| * | | | | shader_decode: Implement LDG and basic cbuf trackingReinUsesLisp2019-01-307-10/+240
|/ / / / /
* / / / / video_core/GPU Implemented the GPU PFIFO puller semaphore operations. (#1908)Kevin2019-01-302-12/+242
|/ / / /
* | | | hle/ipc_helpers: Fix clang-format warningsLioncash2019-01-301-1/+0
* | | | hle/ipc_helpers: Allow pushing signed valuesLioncash2019-01-291-0/+22
* | | | Merge pull request #2063 from lioncash/pessimizingbunnei2019-01-292-6/+6
|\ \ \ \
| * | | | shader/shader_ir: Amend three comment typosLioncash2019-01-281-3/+3
| * | | | shader/shader_ir: Amend constructor initializer ordering for AbufNodeLioncash2019-01-281-2/+2
| * | | | shader/decode: Avoid a pessimizing std::move within DecodeRange()Lioncash2019-01-281-1/+1
* | | | | Merge pull request #2065 from lioncash/pmbunnei2019-01-292-3/+19
|\ \ \ \ \
| * | | | | service/pm: Implement SetMaintenanceBoot()Lioncash2019-01-281-1/+10
| * | | | | service/pm: Tidy up functionality related to SystemBootModeLioncash2019-01-282-2/+9
|/ / / / /
* | | | | Merge pull request #2064 from lioncash/vi-stubbunnei2019-01-281-2/+3
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | service/vi: Remove stubbed notifier from SetLayerVisibilityLioncash2019-01-281-2/+3
|/ / / /
* | | | Merge pull request #2060 from lioncash/exceptionbunnei2019-01-271-0/+4
|\ \ \ \
| * | | | kernel/svc: Log out uncaught C++ exceptions from svcBreakLioncash2019-01-271-0/+4
* | | | | Merge pull request #2058 from ReinUsesLisp/trunc-warningbunnei2019-01-271-3/+4
|\ \ \ \ \
| * | | | | video_core: Silent implicit conversion warningReinUsesLisp2019-01-261-3/+4
| |/ / / /
* | | | | Merge pull request #2059 from FearlessTobi/port-4601bunnei2019-01-271-1/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | dsp_interface: fix sound being played while volume is 0fearlessTobi2019-01-261-1/+1
|/ / / /
* | | | Merge pull request #1927 from ReinUsesLisp/shader-irbunnei2019-01-2639-3808/+5497
|\ \ \ \ | |_|_|/ |/| | |
| * | | shader_ir: Fixup clang buildReinUsesLisp2019-01-161-4/+6
| * | | gl_shader_decompiler: replace std::get<> with std::get_if<> for macOS compatibilityReinUsesLisp2019-01-151-44/+58
| * | | gl_shader_decompiler: Inline textureGather componentReinUsesLisp2019-01-151-15/+16
| * | | shader_decode: Fixup XMADReinUsesLisp2019-01-151-1/+1
| * | | shader_ir: Pass to decoder functions basic block's codeReinUsesLisp2019-01-1527-82/+83
| * | | shader_decode: Improve zero flag implementationReinUsesLisp2019-01-1515-75/+79
| * | | shader_ir: Remove composite primitives and use temporals insteadReinUsesLisp2019-01-154-241/+224
| * | | gl_shader_decompiler: Fixup AssignCompositeHalfReinUsesLisp2019-01-151-1/+1
| * | | shader_decode: Use proper primitive namesReinUsesLisp2019-01-154-25/+21
| * | | shader_decode: Use BitfieldExtract instead of shift + andReinUsesLisp2019-01-158-48/+37
| * | | shader_ir: Remove Ipa primitiveReinUsesLisp2019-01-153-13/+2
| * | | gl_shader_decompiler: Use rasterizer's UBO size limitReinUsesLisp2019-01-151-1/+3
| * | | gl_shader_gen: Fixup code formattingReinUsesLisp2019-01-152-18/+22
| * | | video_core: Rename glsl_decompiler to gl_shader_decompilerReinUsesLisp2019-01-157-7/+7
| * | | shader_ir: Remove RZ and use Register::ZeroIndex insteadReinUsesLisp2019-01-153-12/+16
| * | | shader_decode: Implement TEXS.F16ReinUsesLisp2019-01-153-15/+57
| * | | shader_decode: Fixup R2PReinUsesLisp2019-01-151-2/+3
| * | | glsl_decompiler: Fixup TLDSReinUsesLisp2019-01-151-1/+0
| * | | glsl_decompiler: Fixup geometry shadersReinUsesLisp2019-01-152-15/+17
| * | | shader_decode: Fixup WriteLogicOperation zero comparisonReinUsesLisp2019-01-151-1/+1
| * | | glsl_decompiler: Fixup permissive member function declarationsReinUsesLisp2019-01-151-133/+133
| * | | shader_decode: Fixup PSETReinUsesLisp2019-01-151-2/+3
| * | | shader_decode: Fixup clang-formatReinUsesLisp2019-01-152-2/+4
| * | | video_core: Implement IR based geometry shadersReinUsesLisp2019-01-154-10/+102
| * | | shader_decode: Implement VMAD and VSETPReinUsesLisp2019-01-155-2/+129
| * | | shader_decode: Implement HSET2ReinUsesLisp2019-01-153-1/+50
| * | | shader_decode: Rework HSETP2ReinUsesLisp2019-01-154-47/+57
| * | | shader_decode: Implement R2PReinUsesLisp2019-01-151-1/+28
| * | | shader_decode: Implement CSETPReinUsesLisp2019-01-151-14/+37
| * | | shader_decode: Implement PSETReinUsesLisp2019-01-151-1/+16
| * | | shader_decode: Implement HFMA2ReinUsesLisp2019-01-154-5/+60
| * | | glsl_decompiler: Remove HNegate inliningReinUsesLisp2019-01-151-10/+0
| * | | shader_decode: Implement POPCReinUsesLisp2019-01-154-1/+22
| * | | shader_decode: Implement TLDS (untested)ReinUsesLisp2019-01-153-10/+92
| * | | shader_decode: Update TLD4 reflecting #1862 changesReinUsesLisp2019-01-152-52/+52
| * | | shader_ir: Fixup TEX and TEXS and partially fix TLD4 decompilingReinUsesLisp2019-01-153-60/+72
| * | | shader_decode: Fixup FSETReinUsesLisp2019-01-151-2/+2
| * | | shader_decode: Implement IADD32IReinUsesLisp2019-01-151-0/+11
| * | | shader_decode: Fixup clang-formatReinUsesLisp2019-01-151-1/+1
| * | | video_core: Return safe values after an assert hitsReinUsesLisp2019-01-158-8/+19
| * | | shader_decode: Implement FFMAReinUsesLisp2019-01-151-1/+36
| * | | video_core: Address feedbackReinUsesLisp2019-01-154-13/+16
| * | | shader_ir: Fixup file inclusions and clang-formatReinUsesLisp2019-01-153-2/+2
| * | | shader_ir: Move comment node stringMat M2019-01-151-2/+2
| * | | shader_ir: Address feedback to avoid UB in bit castingReinUsesLisp2019-01-151-2/+4
| * | | shader_decode: Fixup clang-formatReinUsesLisp2019-01-152-3/+2
| * | | shader_decode: Implement LEAReinUsesLisp2019-01-151-0/+55
| * | | shader_decode: Implement IADD3ReinUsesLisp2019-01-151-0/+61
| * | | shader_decode: Implement LOP3ReinUsesLisp2019-01-152-0/+62
| * | | shader_decode: Implement ST_LReinUsesLisp2019-01-151-0/+17
| * | | shader_decode: Implement LD_LReinUsesLisp2019-01-151-0/+18
| * | | shader_decode: Implement HSETP2ReinUsesLisp2019-01-151-1/+37
| * | | shader_decode: Implement HADD2 and HMUL2ReinUsesLisp2019-01-151-1/+48
| * | | shader_decode: Implement HADD2_IMM and HMUL2_IMMReinUsesLisp2019-01-151-1/+28
| * | | shader_decode: Implement MOV_SYSReinUsesLisp2019-01-151-0/+27
| * | | shader_decode: Implement IMNMXReinUsesLisp2019-01-151-0/+16
| * | | shader_decode: Implement F2F_CReinUsesLisp2019-01-151-2/+10
| * | | shader_decode: Implement I2IReinUsesLisp2019-01-151-0/+26
| * | | shader_decode: Implement BRA internal flagReinUsesLisp2019-01-151-4/+8
| * | | shader_decode: Implement ISCADDReinUsesLisp2019-01-151-0/+15
| * | | shader_decode: Implement XMADReinUsesLisp2019-01-151-1/+85
| * | | shader_decode: Implement PBK and BRKReinUsesLisp2019-01-151-1/+22
| * | | shader_decode: Implement LOPReinUsesLisp2019-01-151-0/+15
| * | | shader_decode: Implement SELReinUsesLisp2019-01-151-0/+8
| * | | shader_decode: Implement IADDReinUsesLisp2019-01-151-1/+28
| * | | shader_decode: Implement ISETPReinUsesLisp2019-01-151-1/+30
| * | | shader_decode: Implement BFIReinUsesLisp2019-01-151-1/+22
| * | | shader_decode: Implement ISETReinUsesLisp2019-01-151-1/+27
| * | | shader_decode: Implement LD_CReinUsesLisp2019-01-151-0/+31
| * | | shader_decode: Implement SHLReinUsesLisp2019-01-151-0/+8
| * | | shader_decode: Implement SHRReinUsesLisp2019-01-151-1/+26
| * | | shader_decode: Implement LOP32IReinUsesLisp2019-01-152-1/+72
| * | | shader_decode: Implement BFEReinUsesLisp2019-01-151-1/+25
| * | | shader_decode: Implement FSETReinUsesLisp2019-01-151-1/+36
| * | | shader_decode: Implement F2IReinUsesLisp2019-01-151-0/+37
| * | | shader_decode: Implement I2FReinUsesLisp2019-01-151-0/+23
| * | | shader_decode: Implement F2FReinUsesLisp2019-01-151-1/+37
| * | | shader_decode: Stub DEPBARReinUsesLisp2019-01-151-0/+4
| * | | shader_decode: Implement SSY and SYNCReinUsesLisp2019-01-151-0/+19
| * | | shader_decode: Implement PSETPReinUsesLisp2019-01-151-1/+21
| * | | shader_decode: Implement TMMLReinUsesLisp2019-01-151-3/+45
| * | | shader_decode: Implement TEX and TXQReinUsesLisp2019-01-152-0/+223
| * | | shader_decode: Implement TEXS (F32)ReinUsesLisp2019-01-152-0/+217
| * | | shader_decode: Implement FSETPReinUsesLisp2019-01-151-1/+33
| * | | shader_decode: Partially implement BRAReinUsesLisp2019-01-151-0/+12
| * | | shader_decode: Implement IPAReinUsesLisp2019-01-151-0/+12
| * | | shader_decode: Implement EXITReinUsesLisp2019-01-151-1/+32
| * | | shader_decode: Implement ST_AReinUsesLisp2019-01-151-0/+30
| * | | shader_decode: Implement LD_AReinUsesLisp2019-01-151-1/+39
| * | | shader_decode: Implement FADD32IReinUsesLisp2019-01-151-0/+12
| * | | shader_decode: Implement FMUL32_IMMReinUsesLisp2019-01-151-0/+10
| * | | shader_decode: Implement MOV32_IMMReinUsesLisp2019-01-151-1/+9
| * | | shader_decode: Stub RRO_C, RRO_R and RRO_IMMReinUsesLisp2019-01-151-0/+9
| * | | shader_decode: Implement FMNMX_C, FMNMX_R and FMNMX_IMMReinUsesLisp2019-01-151-0/+18
| * | | shader_decode: Implement MUFUReinUsesLisp2019-01-151-0/+29
| * | | shader_decode: Implement FADD_C, FADD_R and FADD_IMMReinUsesLisp2019-01-151-0/+15
| * | | shader_decode: Implement FMUL_C, FMUL_R and FMUL_IMMReinUsesLisp2019-01-151-0/+42
| * | | shader_decode: Implement MOV_C and MOV_RReinUsesLisp2019-01-151-1/+23
| * | | video_core: Replace gl_shader_decompilerReinUsesLisp2019-01-158-4185/+57
| * | | glsl_decompiler: ImplementationReinUsesLisp2019-01-153-0/+1483
| * | | shader_ir: Add condition code helperReinUsesLisp2019-01-152-0/+13
| * | | shader_ir: Add predicate combiner helperReinUsesLisp2019-01-152-0/+15
| * | | shader_ir: Add comparison helpersReinUsesLisp2019-01-152-0/+106
| * | | shader_ir: Add half float helpersReinUsesLisp2019-01-152-0/+44
| * | | shader_ir: Add integer helpersReinUsesLisp2019-01-152-0/+40
| * | | shader_ir: Add float helpersReinUsesLisp2019-01-152-0/+24
| * | | shader_ir: Add settersReinUsesLisp2019-01-152-0/+24
| * | | shader_ir: Add local memory gettersReinUsesLisp2019-01-152-0/+7
| * | | shader_ir: Add internal flag gettersReinUsesLisp2019-01-152-0/+10
| * | | shader_ir: Add attribute gettersReinUsesLisp2019-01-152-0/+26
| * | | shader_ir: Add constant buffer gettersReinUsesLisp2019-01-152-0/+25
| * | | shader_ir: Add register getterReinUsesLisp2019-01-152-0/+9
| * | | shader_ir: Add immediate node constructorsReinUsesLisp2019-01-152-1/+34
| * | | shader_ir: Initial implementationReinUsesLisp2019-01-1530-0/+1573
| * | | shader_bytecode: Fixup encodingReinUsesLisp2019-01-151-1/+1
| * | | shader_header: Make local memory size getter constantReinUsesLisp2019-01-151-1/+1
* | | | Merge pull request #2054 from bunnei/scope-context-refactorbunnei2019-01-247-36/+54
|\ \ \ \
| * | | | frontend: Refactor ScopeAcquireWindowContext out of renderer_opengl.bunnei2019-01-247-36/+54
* | | | | Merge pull request #2049 from FearlessTobi/port-3928bunnei2019-01-245-0/+35
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | citra_qt: Log settings on launchzhupengfei2019-01-225-0/+35
|/ / / /
* | | | Merge pull request #2047 from FearlessTobi/patch-3bunnei2019-01-221-5/+16
|\ \ \ \
| * | | | ISSUE_TEMPLATE: changes to make it more expressive and prevent low-quality issuesTobias2019-01-221-5/+16
|/ / / /
* | | | Merge pull request #2043 from ReinUsesLisp/rt-separatebunnei2019-01-222-4/+6
|\ \ \ \
| * | | | maxwell_3d: Set rt_separate_frag_data to 1 by defaultReinUsesLisp2019-01-222-4/+6
|/ / / /
* | | | Merge pull request #2035 from lioncash/fwd-declbunnei2019-01-217-17/+14
|\ \ \ \
| * | | | yuzu/configuration/configure_input_player: Forward declare types where applicableLioncash2019-01-172-2/+7
| * | | | yuzu/configuration/configure_touchscreen_advanced: Remove unnecessary header inclusionsLioncash2019-01-171-2/+0
| * | | | yuzu/configuration/configure_per_general: Remove unused header inclusionsLioncash2019-01-172-4/+3
| * | | | yuzu/configuration/configure_debug: Remove unused header inclusionsLioncash2019-01-171-1/+0
| * | | | yuzu/configuration/configure_system: Remove unused header inclusionsLioncash2019-01-171-8/+4
| |/ / /
* | | | Merge pull request #2038 from jroweboy/loading-progress-barbunnei2019-01-215-57/+316
|\ \ \ \
| * | | | Change const char* to const char[]James Rowe2019-01-211-4/+4
| * | | | Fix mingw compile error and warningsJames Rowe2019-01-212-6/+6
| * | | | Add fade out effect to the loading screenJames Rowe2019-01-214-94/+158
| * | | | Set Minimum Size to the same as renderwindowJames Rowe2019-01-211-0/+1
| * | | | Remove blue box around loading screenJames Rowe2019-01-211-1/+0
| * | | | Change the background color of Stage Complete to yuzu blueJames Rowe2019-01-211-1/+1
| * | | | Rename step 1 and step 2 to be a little more descriptiveJames Rowe2019-01-212-8/+8
| * | | | Prevent estimated time from flashing after slow shader compilation startsJames Rowe2019-01-211-1/+1
| * | | | Move progress bar style into constexpr stringsJames Rowe2019-01-211-28/+32
| * | | | Hide progress bar on Prepare stepJames Rowe2019-01-201-7/+8
| * | | | QT: Upgrade the Loading Bar to look much betterJames Rowe2019-01-204-11/+201
|/ / / /
* | | | Merge pull request #2034 from jroweboy/loading-widgetbunnei2019-01-209-11/+262
|\ \ \ \
| * | | | Add a workaround if QMovie isn't availableJames Rowe2019-01-202-1/+20
| * | | | QT Frontend: Add a Loading screen with progressbarJames Rowe2019-01-209-11/+243
* | | | | Merge pull request #2008 from ReinUsesLisp/dirty-framebuffersbunnei2019-01-206-8/+78
|\ \ \ \ \
| * | | | | gl_rasterizer: Skip framebuffer configuration if rendertargets have not been changedReinUsesLisp2019-01-072-1/+31
| * | | | | gl_rasterizer_cache: Use dirty flags for the depth bufferReinUsesLisp2019-01-074-3/+23
| * | | | | gl_rasterizer_cache: Use dirty flags for color buffersReinUsesLisp2019-01-074-4/+24
* | | | | | Merge pull request #2002 from ReinUsesLisp/dsa-vao-bufferbunnei2019-01-209-103/+73
|\ \ \ \ \ \
| * | | | | | gl_rasterizer: Workaround Intel VAO DSA bugReinUsesLisp2019-01-093-7/+16
| * | | | | | gl_stream_buffer: Use DSA for buffer managementReinUsesLisp2019-01-063-17/+14
| * | | | | | gl_rasterizer: Use DSA for vertex array objectsReinUsesLisp2019-01-066-79/+53
| * | | | | | gl_state: Drop uniform buffer state trackingReinUsesLisp2019-01-063-10/+0
* | | | | | | Merge pull request #2032 from lioncash/webbunnei2019-01-201-6/+5
|\ \ \ \ \ \ \
| * | | | | | | yuzu/configuration/configure_web: Remove an unused lambda captureLioncash2019-01-171-5/+4
| * | | | | | | yuzu/configuration/configure_web: Use an ellipsis with 'Verifying' textLioncash2019-01-171-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2025 from DarkLordZach/loader-banner-logobunnei2019-01-2011-0/+77
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | loader: Propagate NCA logo section to ReadBanner and ReadLogoZach Hilman2019-01-159-0/+61
| * | | | | | content_archive: Add getter for logo section of NCAZach Hilman2019-01-152-0/+16
| |/ / / / /
* | | | | | Merge pull request #2031 from lioncash/privbunnei2019-01-197-26/+36
|\ \ \ \ \ \
| * | | | | | core/frontend/applets/web_browser: Include missing headersLioncash2019-01-171-2/+8
| * | | | | | core/frontend/applets/web_browser: Make OpenPage() non-constLioncash2019-01-177-20/+25
| * | | | | | yuzu/web_browser: std::move std::function instances in OpenPage()Lioncash2019-01-171-2/+2
| * | | | | | yuzu/web_browser: Make slot functions privateLioncash2019-01-171-2/+1
| |/ / / / /
* | | | | | Merge pull request #2033 from ReinUsesLisp/fixup-clip-warningbunnei2019-01-191-1/+1
|\ \ \ \ \ \
| * | | | | | gl_rasterizer: Silent unsafe mix warningReinUsesLisp2019-01-181-1/+1
| |/ / / / /
* | | | | | Merge pull request #2036 from lioncash/unused-classbunnei2019-01-191-23/+0
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | file_sys/directory: Remove unused DirectoryBackend classLioncash2019-01-181-23/+0
|/ / / / /
* | | | | Merge pull request #2020 from otaviopace/remove-spacesHexagon122019-01-141-2/+2
|\ \ \ \ \
| * | | | | audio_core: remove unnecessary spaces on commentsOtávio Pace2019-01-141-2/+2
|/ / / / /
* | | | | Merge pull request #1848 from FreddyFunk/QJsonArraybunnei2019-01-121-2/+2
|\ \ \ \ \
| * | | | | game_list: Remove a reference of a referenceFrederic Laing2018-12-031-2/+2
* | | | | | Merge pull request #1959 from DarkLordZach/custom-rtcbunnei2019-01-108-39/+120
|\ \ \ \ \ \
| * | | | | | settings: Fix comment structureZach Hilman2019-01-082-5/+7
| * | | | | | settings: Use std::chrono::seconds instead of s64 for RTCZach Hilman2019-01-086-17/+21
| * | | | | | time: Use custom RTC settings if applicable for gameZach Hilman2019-01-082-8/+12
| * | | | | | core: Set custom RTC differential on game bootZach Hilman2019-01-081-0/+7
| * | | | | | qt: Provide UI to edit custom RTC settingsZach Hilman2019-01-082-28/+66
| * | | | | | settings: Add custom RTC settingsZach Hilman2019-01-084-4/+30
* | | | | | | Merge pull request #1939 from DarkLordZach/web-appletbunnei2019-01-1030-591/+1381
|\ \ \ \ \ \ \
| * | | | | | | build: Copy web engine resources to correct locationZach Hilman2019-01-051-2/+1
| * | | | | | | build: Copy QtWebEngineProcess[d].exe to release dir on windowsZach Hilman2019-01-041-0/+1
| * | | | | | | Update Qt MSVC external to 5.12.0Zach Hilman2018-12-312-2/+2
| * | | | | | | travis: Use correct package for linux Qt5WebEngineZach Hilman2018-12-294-5/+4
| * | | | | | | web_browser: Add bounds checking to applet interfaceZach Hilman2018-12-2910-146/+160
| * | | | | | | cmake: Add USE_QT_WEB_ENGINE flag and update build systemZach Hilman2018-12-285-4/+37
| * | | | | | | main: Add main window integrations for QtWebBrowserAppletZach Hilman2018-12-283-0/+168
| * | | | | | | qt: Implement Qt frontend to web browserZach Hilman2018-12-282-0/+154
| * | | | | | | core: Add getter and setter for WebBrowserApplet frontendZach Hilman2018-12-284-2/+22
| * | | | | | | frontend: Add frontend responder for web browserZach Hilman2018-12-282-0/+52
| * | | | | | | applets: Implement LibAppletOff (Web) appletZach Hilman2018-12-284-0/+234
| * | | | | | | loader: Add accessor for Manual RomFSZach Hilman2018-12-285-0/+30
| * | | | | | | hid: Make Hid service accessible and add GetPressStateZach Hilman2018-12-284-459/+540
| * | | | | | | romfs: Add SingleDiscard extraction typeZach Hilman2018-12-282-2/+6
| * | | | | | | am: Add size parameter to am:IStorage loggingZach Hilman2018-12-281-4/+4
* | | | | | | | Merge pull request #2010 from ReinUsesLisp/gmembunnei2019-01-085-3/+96
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | gl_global_cache: Add dummy global cache managerReinUsesLisp2019-01-085-3/+96
|/ / / / / / /
* | | | | | | Merge pull request #1999 from ReinUsesLisp/dirty-shaderbunnei2019-01-075-2/+23
|\ \ \ \ \ \ \ | | |_|_|/ / / | |/| | | | |
| * | | | | | gl_shader_cache: Use dirty flags for shadersReinUsesLisp2019-01-075-2/+23
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1989 from lioncash/setbunnei2019-01-071-39/+58
|\ \ \ \ \ \
| * | | | | | service/vi: Correct scaling mode conversionsLioncash2019-01-051-15/+13
| * | | | | | service/vi: Factor out scaling mode conversions from the IPC function itselfLioncash2019-01-051-17/+21
| * | | | | | service/vi: Unstub IApplicationDisplayService' SetLayerScalingMode()Lioncash2019-01-051-21/+38
* | | | | | | Merge pull request #1992 from DarkLordZach/move-profile-manager-uibunnei2019-01-079-427/+565
|\ \ \ \ \ \ \
| * | | | | | | qt: Move profile manager to own UI tabZach Hilman2019-01-049-427/+565
| |/ / / / / /
* | | | | | | Merge pull request #1990 from ReinUsesLisp/copy-surface-stream-copybunnei2019-01-071-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | gl_rasterizer_cache: Use GL_STREAM_COPY for PBOsReinUsesLisp2019-01-051-1/+1
* | | | | | | Merge pull request #1988 from lioncash/resbunnei2019-01-051-12/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | service/vi: Correct reported dimensions from IApplicationDisplayService's GetDisplayResolution()Lioncash2019-01-051-12/+8
| |/ / / / /
* | | | | | Merge pull request #1981 from ogniK5377/open-app-area-createbunnei2019-01-051-4/+4
|\ \ \ \ \ \
| * | | | | | Return no application area when games try to open an application areaDavid Marcec2019-01-041-4/+4
* | | | | | | Merge pull request #1980 from ogniK5377/applet-msg-updatebunnei2019-01-051-1/+10
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Proper no message handling for AM::PopMessageDavid Marcec2019-01-041-1/+10
| |/ / / / /
* | | | | | Merge pull request #1984 from ogniK5377/remove-pulseMat M2019-01-044-9/+0
|\ \ \ \ \ \
| * | | | | | Removed pulse event typeDavid Marcec2019-01-044-9/+0
|/ / / / / /
* | | | | | Merge pull request #1975 from lioncash/vibunnei2019-01-041-4/+15
|\ \ \ \ \ \
| * | | | | | service/vi: Correct initial width and height valuesLioncash2019-01-021-2/+2
| * | | | | | service/vi: Document unknown DisplayInfo struct membersLioncash2019-01-021-2/+13
* | | | | | | Merge pull request #1979 from ogniK5377/30-fpsbunnei2019-01-041-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Fixed botw deadlock(and possibly 30 fps games rendering too fast? needs testing to confirm)David Marcec2019-01-031-1/+1
* | | | | | | Merge pull request #1724 from FearlessTobi/port-4412Hexagon122019-01-031-136/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | CONTRIBUTING.md: migrate to the wikiTobias2018-11-171-136/+1
* | | | | | | Merge pull request #1976 from lioncash/displaybunnei2019-01-031-4/+17
|\ \ \ \ \ \ \
| * | | | | | | service/vi: Implement OpenDefaultDisplay in terms of OpenDisplayLioncash2019-01-031-4/+17
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1978 from lioncash/enabledbunnei2019-01-031-1/+10
|\ \ \ \ \ \ \
| * | | | | | | service/vi: Implement SetDisplayEnabled()Lioncash2019-01-031-1/+10
* | | | | | | | Merge pull request #1942 from DarkLordZach/profile-select-game-bootbunnei2019-01-036-0/+32
|\ \ \ \ \ \ \ \
| * | | | | | | | qt: Add setting to prompt for user on game bootZach Hilman2018-12-256-0/+32
* | | | | | | | | Merge pull request #1941 from DarkLordZach/profile-select-save-databunnei2019-01-031-22/+16
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | qt: Use ProfileSelectionDialog when selecting user for save dataZach Hilman2018-12-251-22/+16
| |/ / / / / / /
* | | | | | | | Merge pull request #1977 from lioncash/vi-logbunnei2019-01-031-63/+74
|\ \ \ \ \ \ \ \
| * | | | | | | | service/vi: Log more information where applicableLioncash2019-01-031-63/+74
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1961 from ReinUsesLisp/tex-view-2dbunnei2019-01-023-14/+74
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_rasterizer_cache: Texture view if shader samples array but OGL is notReinUsesLisp2018-12-303-14/+74
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1944 from FearlessTobi/port-4187bunnei2019-01-023-59/+124
|\ \ \ \ \ \ \ \
| * | | | | | | | Qt/Configure: Use sidebar to divide tabs into smaller groupsspycrab2018-12-283-59/+124
| |/ / / / / / /
* | | | | | | | Merge pull request #1969 from lioncash/castbunnei2019-01-022-3/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu/configure_general: Silence truncation warnings in loadConfiguration()Lioncash2019-01-011-2/+2
| * | | | | | | | yuzu/config: Silence truncation warningsLioncash2019-01-011-1/+1
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1970 from lioncash/headerbunnei2019-01-0216-16/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | core/kernel: Remove unnecessary inclusionsLioncash2019-01-0116-16/+22
|/ / / / / / /
* | | | | | | Merge pull request #1966 from lioncash/backtracebunnei2018-12-312-7/+8
|\ \ \ \ \ \ \
| * | | | | | | arm_interface: Make include path relative for arm_interface.hLioncash2018-12-311-1/+1
| * | | | | | | arm_interface: Make LogBacktrace() a const member functionLioncash2018-12-312-2/+2
| * | | | | | | arm_interface: Mark variables as const where applicable in LogBacktrace()Lioncash2018-12-311-3/+4
| * | | | | | | arm_interface: Remove unnecessary semicolonLioncash2018-12-311-1/+1
* | | | | | | | Merge pull request #1967 from lioncash/threadbunnei2018-12-312-24/+30
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/svc: Correct misleading error message within CreateThread()Lioncash2018-12-311-2/+3
| * | | | | | | | kernel/svc: Sanitize core number and thread priorities in CreateThread()Lioncash2018-12-311-6/+17
| * | | | | | | | kernel/process: Rename GetAllowedProcessorMask() and GetAllowedThreadPriorityMask()Lioncash2018-12-312-11/+11
| * | | | | | | | kernel/svc: Simplify thread core ID sanitizing in CreateThreadLioncash2018-12-311-7/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1965 from lioncash/fmtbunnei2018-12-311-0/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | externals: Update fmt to 5.3.0Lioncash2018-12-301-0/+0
* | | | | | | | Merge pull request #1956 from lioncash/process-threadSebastian Valle2018-12-316-59/+53
|\ \ \ \ \ \ \ \
| * | | | | | | | kernel/process: Start the main thread using the specified ideal coreLioncash2018-12-281-2/+2
| * | | | | | | | kernel: Rename 'default' CPU core to 'ideal' coreLioncash2018-12-285-23/+23
| * | | | | | | | kernel/thread: Move process thread initialization into process.cppLioncash2018-12-283-36/+30
* | | | | | | | | Merge pull request #1847 from ogniK5377/backtrace-breakbunnei2018-12-306-1/+41
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Moved log backtrace to arm_interface.cpp. Added printing of error code to fatalDavid Marcec2018-12-294-18/+36
| * | | | | | | | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-198-47/+20
| * | | | | | | | | Moved backtrace to ArmInterfaceDavid Marcec2018-12-036-14/+39
| * | | | | | | | | Print backtrace on svcBreakDavid Marcec2018-12-033-0/+24
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1964 from lioncash/timebunnei2018-12-302-14/+18
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | service/time: Minor cleanup to GetClockSnapshot()Lioncash2018-12-301-7/+9
| * | | | | | | | service/time: Fill in some structures and remove padding where not necessaryLioncash2018-12-302-7/+9
* | | | | | | | | Merge pull request #1955 from bunnei/g8r8-fixbunnei2018-12-294-79/+46
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | gpu: Remove PixelFormat G8R8U and G8R8S, as they do not seem to exist.bunnei2018-12-284-79/+46
|/ / / / / / / /
* | | | | | | | Merge pull request #1958 from lioncash/audiobunnei2018-12-283-10/+6
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | audio_core: Convert LOG_CRITICAL + UNREACHABLE over to UNIMPLEMENTED/UNIMPLEMENTED_MSGLioncash2018-12-283-10/+6
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1954 from lioncash/npdmbunnei2018-12-281-3/+7
|\ \ \ \ \ \ \
| * | | | | | | file_sys/program_metadata: Print out more descriptive address space descriptionsLioncash2018-12-281-3/+7
| |/ / / / / /
* | | | | | | Merge pull request #1953 from lioncash/membunnei2018-12-284-49/+35
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | kernel/process: Remove most allocation functions from Process' interfaceLioncash2018-12-284-49/+35
|/ / / / / /
* | | | | | Merge pull request #1951 from Tinob/masterbunnei2018-12-271-2/+2
|\ \ \ \ \ \
| * | | | | | Add missing uintBitsToFloat to SetRegisterToHalfFloatRodolfo Bogado2018-12-271-2/+2
|/ / / / / /
* | | | | | Merge pull request #1928 from lioncash/capsbunnei2018-12-2714-125/+732
|\ \ \ \ \ \
| * | | | | | kernel/process: Hook up the process capability parser to the process itselfLioncash2018-12-217-122/+44
| * | | | | | kernel/process_capability: Handle debug capability flagsLioncash2018-12-212-1/+18
| * | | | | | kernel/process_capability: Handle handle table capability flagsLioncash2018-12-212-1/+11
| * | | | | | kernel/process_capability: Handle kernel version capability flagsLioncash2018-12-212-1/+18
| * | | | | | kernel/process_capability: Handle program capability flagsLioncash2018-12-213-2/+29
| * | | | | | kernel/process_capability: Handle interrupt capability flagsLioncash2018-12-211-1/+21
| * | | | | | kernel/process_capability: Handle syscall capability flagsLioncash2018-12-212-1/+29
| * | | | | | kernel/process_capability: Handle the priority mask and core mask flagsLioncash2018-12-212-1/+40
| * | | | | | kernel/process: Introduce process capability parsing skeletonLioncash2018-12-215-3/+468
| * | | | | | common: Add basic bit manipulation utility function to CommonLioncash2018-12-212-0/+62
* | | | | | | Merge pull request #1892 from Tinob/masterbunnei2018-12-271-113/+122
|\ \ \ \ \ \ \
| * | | | | | | Apply CC test to the final value to be stored in the registerRodolfo Bogado2018-12-261-9/+12
| * | | | | | | Includde saturation in the evaluation of the control codeRodolfo Bogado2018-12-221-3/+4
| * | | | | | | Handle RZ cases evaluating the expression instead of the register value.Rodolfo Bogado2018-12-221-14/+22
| * | | | | | | complete emulation of ZeroFlagRodolfo Bogado2018-12-221-100/+97
* | | | | | | | Merge pull request #1929 from bunnei/fix-hidbunnei2018-12-271-44/+163
|\ \ \ \ \ \ \ \
| * | | | | | | | hid: Fix SetNpadJoyHoldType and improve logging.bunnei2018-12-211-44/+163
* | | | | | | | | Merge pull request #1945 from bunnei/fix-hid-horizbunnei2018-12-271-46/+0
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | npad: Remove code to invert input in horizontal mode.bunnei2018-12-261-46/+0
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1949 from lioncash/unmapbunnei2018-12-271-0/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | kernel/vm_manager: Reset region attributes when unmapping a VMALioncash2018-12-271-0/+1
* | | | | | | | | | Merge pull request #1879 from DarkLordZach/am-save-data-sizebunnei2018-12-2715-32/+199
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | am: Implement GetSaveDataSize and ExtendSaveDataZach Hilman2018-12-276-8/+53
| * | | | | | | | | | filesystem: Populate save data sizes from control dataZach Hilman2018-12-272-0/+53
| * | | | | | | | | | savedata_factory: Partially implement IVFC save sizes using filesZach Hilman2018-12-272-0/+38
| * | | | | | | | | | loader: Add accessor for game control dataZach Hilman2018-12-275-9/+14
| * | | | | | | | | | control_metadata: Update NACP fields with latest Switchbrew dataZach Hilman2018-12-272-6/+29
| * | | | | | | | | | control_metadata: Use value member instead of unique_ptr to store structZach Hilman2018-12-272-10/+13
| * | | | | | | | | | vfs: Add reinterpret_casts to WriteArray and ObjectZach Hilman2018-12-271-2/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1946 from lioncash/declbunnei2018-12-271-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | renderer_opengl: Correct forward declaration of FramebufferLayoutLioncash2018-12-261-1/+1
* | | | | | | | | | | Merge pull request #1948 from lioncash/translatablebunnei2018-12-271-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | configure_per_general: Mark UI strings as translatable in the constructorLioncash2018-12-261-2/+2
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1947 from lioncash/initbunnei2018-12-271-12/+7
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | configure_input_simple: Make input profile array constexprLioncash2018-12-261-12/+7
|/ / / / / / / / /
* | | | | | | | | Fixed shader linking error due to TLDS (#1934)David2018-12-261-1/+1
* | | | | | | | | Merge pull request #1849 from encounter/svcSetThreadActivitybunnei2018-12-265-6/+77
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | debugger: Set paused thread colorLuke Street2018-12-041-1/+2
| * | | | | | | | | svc: Implement SetThreadActivity (thread suspension)Luke Street2018-12-045-6/+76
* | | | | | | | | | Merge pull request #1943 from ReinUsesLisp/fixup-texsbunnei2018-12-261-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | shader_bytecode: Fixup TEXS.F16 encodingReinUsesLisp2018-12-261-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1886 from FearlessTobi/port-4164bunnei2018-12-2315-43/+228
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | yuzu, video_core: Screenshot functionalityzhupengfei2018-12-1815-43/+228
| | |_|_|_|_|_|/ / | |/| | | | | | |
* | | | | | | | | Merge pull request #1930 from lioncash/commonbunnei2018-12-231-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | common/quaternion: Ensure that w is always initializedLioncash2018-12-211-1/+1
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1781 from DarkLordZach/applet-profile-selectbunnei2018-12-2313-0/+466
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | applets: Correct event ResetTypes from OneShot to StickyZach Hilman2018-12-035-14/+6
| * | | | | | | | | qt: Implement GUI dialog frontend for ProfileSelectorZach Hilman2018-12-036-0/+269
| * | | | | | | | | am: Use ProfileSelect appletZach Hilman2018-12-031-0/+4
| * | | | | | | | | applets: Implement ProfileSelect appletZach Hilman2018-12-032-0/+130
| * | | | | | | | | qt: Register to use Qt ProfileSelector instead of defaultZach Hilman2018-12-031-0/+2
| * | | | | | | | | core: Add getter/setter for ProfileSelector in SystemZach Hilman2018-12-032-0/+16
| * | | | | | | | | frontend: Add frontend applet for ProfileSelectZach Hilman2018-12-033-0/+48
| * | | | | | | | | software_keyboard: Signal state changed event upon constructionZach Hilman2018-12-031-1/+6
* | | | | | | | | | Merge pull request #1780 from DarkLordZach/controller-profilesbunnei2018-12-2312-66/+401
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | configure_input_simple: Properly signal docked mode changeZach Hilman2018-12-053-33/+31
| * | | | | | | | | configure_input: Add ConfigureInputSimple as default input UI configZach Hilman2018-12-058-1/+293
| * | | | | | | | | configure_input: Convert into QDialogZach Hilman2018-12-053-7/+47
| * | | | | | | | | configure: Use ConfigureInputSimple for Input tabZach Hilman2018-12-051-26/+26
| * | | | | | | | | ui_settings: Add UI setting for input profile indexZach Hilman2018-12-052-0/+5
* | | | | | | | | | Merge pull request #1921 from ogniK5377/no-unitbunnei2018-12-2114-3/+34
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | hopefully fix clang format issueDavid Marcec2018-12-191-0/+1
| * | | | | | | | | | Fixed uninitialized memory due to missing returns in canaryDavid Marcec2018-12-1914-3/+33
* | | | | | | | | | | Merge pull request #1920 from heapo/texture_format_selectionbunnei2018-12-211-1/+11
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Texture format fixes: Flag RGBA16UI as GL_RGBA_INTEGER format, and interpret R16U as Z16 when depth_compare is enabled.heapo2018-12-181-1/+11
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1925 from lioncash/pidbunnei2018-12-217-28/+59
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | kernel/svc: Handle thread handles within GetProcessIdLioncash2018-12-191-10/+23
| * | | | | | | | | | | kernel/kernel: Use correct initial PID for userland Process instancesLioncash2018-12-192-4/+14
| * | | | | | | | | | | kernel/svc: Correct output parameter for svcGetThreadIdLioncash2018-12-191-1/+1
| * | | | | | | | | | | kernel/thread: Make thread_id a 64-bit valueLioncash2018-12-194-7/+7
| * | | | | | | | | | | kernel/svc: Correct output parameter for svcGetProcessIdLioncash2018-12-192-2/+10
| * | | | | | | | | | | kernel/process: Make process_id a 64-bit valueLioncash2018-12-193-6/+6
* | | | | | | | | | | | Merge pull request #1914 from lioncash/idbunnei2018-12-211-2/+5
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | service/am: Unstub GetAppletResourceUserIdLioncash2018-12-181-2/+5
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1923 from ogniK5377/nfp-device-listbunnei2018-12-191-2/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Device handle should not be a random id, instead it's the current npad idDavid Marcec2018-12-191-2/+2
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1909 from heapo/shadow_sampling_fixesbunnei2018-12-191-16/+14
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Fix arrayed shadow sampler array slice/depth comparison ordering, as well as invalid GLSL LOD selection.heapo2018-12-171-16/+14
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1915 from lioncash/smbunnei2018-12-191-4/+5
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / |/| | | | | | | | | |
| * | | | | | | | | | service/sm: Improve debug log for RegisterServiceLioncash2018-12-191-4/+5
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1907 from lioncash/attributebunnei2018-12-193-14/+279
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | svc: Implement svcSetMemoryAttributeLioncash2018-12-191-5/+46
| * | | | | | | | | vm_manager: Add member function for setting memory attributes across an address rangeLioncash2018-12-192-0/+41
| * | | | | | | | | vm_manager: Add member function for checking a memory range adheres to certain attributes, permissions and statesLioncash2018-12-192-0/+100
| * | | | | | | | | vm_manager: Rename meminfo_state to stateLioncash2018-12-162-10/+9
| * | | | | | | | | vm_manager: Add backing functionality for memory attributesLioncash2018-12-162-1/+85
* | | | | | | | | | Merge pull request #1913 from MerryMage/default-fpcrbunnei2018-12-181-0/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/thread: Set default fpcrMerryMage2018-12-181-0/+3
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1918 from MerryMage/cntfrqbunnei2018-12-181-0/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | arm_dynarmic: Set CNTFRQ valueMerryMage2018-12-181-0/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1917 from ReinUsesLisp/fixup-halfbunnei2018-12-181-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | shader_bytecode: Fixup half float's operator B encodingReinUsesLisp2018-12-181-1/+1
* | | | | | | | | | | Merge pull request #1889 from DarkLordZach/swkbd-state-changedbunnei2018-12-183-6/+4
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | applets: Correct usage of SignalStateChanged eventZach Hilman2018-12-103-6/+4
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1903 from heapo/fmul_postfactorbunnei2018-12-182-5/+21
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Implement postfactor multiplication/division for fmul instructionsheapo2018-12-172-5/+21
* | | | | | | | | | Merge pull request #1905 from bunnei/ignore-empty-gpu-listsbunnei2018-12-151-0/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | nvhost_gpu: Skip empty GPU command lists.bunnei2018-12-151-0/+4
* | | | | | | | | | | Merge pull request #1901 from jschmer/ServiceLeakbunnei2018-12-152-10/+12
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Fix Service object leak on emulation stopJens Schmer2018-12-132-10/+12
* | | | | | | | | | | Merge pull request #1732 from DarkLordZach/yield-typesbunnei2018-12-155-9/+181
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | svc: Avoid incorrect fast yield conditionZach Hilman2018-12-051-6/+1
| * | | | | | | | | | scheduler: Avoid manual Reschedule callZach Hilman2018-12-042-11/+11
| * | | | | | | | | | scheduler: Only work steal higher priority threads from other coresZach Hilman2018-12-033-35/+24
| * | | | | | | | | | svc: Avoid performance-degrading unnecessary rescheduleZach Hilman2018-12-022-8/+6
| * | | | | | | | | | scheduler: Add explanations for YieldWith and WithoutLoadBalancingZach Hilman2018-11-226-79/+141
| * | | | | | | | | | svc: Implement yield types 0 and -1Zach Hilman2018-11-196-2/+130
* | | | | | | | | | | Merge pull request #1902 from lioncash/audiobunnei2018-12-157-36/+58
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | audio_core: Make g_sink_details internally linkedLioncash2018-12-137-36/+58
* | | | | | | | | | | Merge pull request #1899 from lioncash/statebunnei2018-12-147-84/+188
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | svc: Enable svcQueryProcessMemoryLioncash2018-12-122-1/+6
| * | | | | | | | | | | svc: Write out the complete MemoryInfo structure in QueryProcessMemoryLioncash2018-12-121-0/+3
| * | | | | | | | | | | svc: Handle memory writing explicitly within QueryProcessMemoryLioncash2018-12-122-26/+22
| * | | | | | | | | | | vm_manager: Correct ordering of last two struct members of MemoryInfoLioncash2018-12-121-2/+2
| * | | | | | | | | | | vm_manager: Amend the returned values for invalid memory queries in QueryMemory()Lioncash2018-12-122-4/+7
| * | | | | | | | | | | vm_manager: Migrate memory querying to the VMManager interfaceLioncash2018-12-124-18/+33
| * | | | | | | | | | | vm_manager: Migrate MemoryInfo and PageInfo to vm_manager.hLioncash2018-12-123-17/+16
| * | | | | | | | | | | vm_manager: Amend MemoryState enum membersLioncash2018-12-125-28/+111
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1871 from lioncash/movebunnei2018-12-142-2/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | yuzu/wait_tree: Pass QString by value and std::move in the initializer list for WaitTreeTextLioncash2018-12-062-2/+2
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1900 from lioncash/wrapperbunnei2018-12-141-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | svc_wrap: Correct register index for a wrapper specializationLioncash2018-12-121-1/+1
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1890 from jschmer/masterMat M2018-12-123-13/+12
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Fix Process object leak on emulation stopJens Schmer2018-12-123-13/+12
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1891 from DarkLordZach/istorage-getsizeMat M2018-12-121-2/+15
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | fsp_srv: Implement IStorage::GetSizeZach Hilman2018-12-101-2/+15
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1893 from lioncash/warnbunnei2018-12-121-3/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_shader_cache: Dehardcode constant in CalculateProgramSize()Lioncash2018-12-111-2/+2
| * | | | | | | | | | gl_shader_cache: Resolve truncation compiler warningLioncash2018-12-111-1/+1
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1895 from lioncash/uninitbunnei2018-12-121-4/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | patch_manager: Prevent use of a dangling pointer within PatchRomFSLioncash2018-12-111-4/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1877 from heapo/audio_interpbunnei2018-12-112-4/+8
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Avoid (expensive) audio interpolation when sample rates already matchheapo2018-12-062-4/+8
* | | | | | | | | | | Merge pull request #1888 from marcosvitali/glFrontFacingbunnei2018-12-111-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | gl_shader_decompiler: IPA FrontFacing: the right value when is the front face is 0xFFFFFFFF.Marcos Vitali2018-12-101-1/+1
* | | | | | | | | | | Merge pull request #1846 from lioncash/dirbunnei2018-12-111-2/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | file_sys/directory: Amend path buffer size for directory entriesLioncash2018-12-031-2/+2
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1819 from DarkLordZach/disable-addonsbunnei2018-12-1123-15/+691
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | qt: Add Properties menu to game list right-clickZach Hilman2018-12-049-22/+54
| * | | | | | | | | | | qt: Add UI to display game properties and disable add-onsZach Hilman2018-12-034-0/+501
| * | | | | | | | | | | loader: Add support for reading the name of game's developerZach Hilman2018-12-035-0/+26
| * | | | | | | | | | | aoc_u: Obey disabled add-ons list when listing DLCZach Hilman2018-12-031-0/+12
| * | | | | | | | | | | patch_manager: Obey disabled add-ons list when patching gameZach Hilman2018-12-032-11/+50
| * | | | | | | | | | | core: Make GetGameFileFromPath function externally accessibleZach Hilman2018-12-032-3/+9
| * | | | | | | | | | | config: Store and load disabled add-ons listZach Hilman2018-12-033-0/+55
| * | | | | | | | | | | settings: Store list of disabled add-ons per title IDZach Hilman2018-12-031-0/+5
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1887 from FearlessTobi/port-4476bunnei2018-12-111-8/+4
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | web_service: move telemetry condition from TelemetrySession constructor to destructorfearlessTobi2018-12-081-8/+4
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1883 from lioncash/log-fspbunnei2018-12-111-1/+10
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service/fsp_srv: Correct returned value in GetGlobalAccessLogMode()Lioncash2018-12-101-1/+10
* | | | | | | | | | | | Merge pull request #1885 from lioncash/data_idbunnei2018-12-111-1/+3
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | file_sys/save_data_factory: Update SaveDataSpaceId enumLioncash2018-12-081-1/+3
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1740 from FernandoS27/shader_propsbunnei2018-12-104-0/+57
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Implemented a shader unique identifier.Fernando Sahmkow2018-12-094-0/+57
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1872 from lioncash/proc-infoHexagon122018-12-101-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | kernel/process: Set ideal core from metadataLioncash2018-12-051-0/+1
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1880 from DarkLordZach/cache-storageHexagon122018-12-101-1/+7
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | savedata_factory: Add support for CacheStorageZach Hilman2018-12-071-0/+2
| * | | | | | | | | | | | savedata_factory: Delete TemporaryStorage on startupZach Hilman2018-12-071-1/+5
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1876 from lioncash/vmabunnei2018-12-105-28/+41
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | memory: Convert ASSERT into a DEBUG_ASSERT within GetPointerFromVMA()Lioncash2018-12-061-1/+1
| * | | | | | | | | | | | vm_manager: Make vma_map privateLioncash2018-12-065-28/+41
* | | | | | | | | | | | | Merge pull request #1862 from marcosvitali/tldsbunnei2018-12-101-106/+134
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | gl_shader_decompiler: TLDS/TLD4/TLD4S Reworked reflecting the source registers, bugs fixed and modularize.Marcos Vitali2018-12-071-106/+134
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1864 from lioncash/nrrbunnei2018-12-081-4/+5
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | service/ldr: Amend layout of the NRO headerLioncash2018-12-051-3/+3
| * | | | | | | | | | | | service/ldr: Corrent padding within the NRR header layoutLioncash2018-12-051-1/+2
* | | | | | | | | | | | | Merge pull request #1874 from lioncash/bindingsbunnei2018-12-082-19/+8
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | hle/service: Replace log + UNIMPLEMENTED with UNIMPLEMENTED_MSGLioncash2018-12-061-2/+1
| * | | | | | | | | | | | | hle/service: Remove unnecessary using declarationsLioncash2018-12-061-5/+1
| * | | | | | | | | | | | | hle/service, hle/sm: Compress usages of MakeResult()Lioncash2018-12-062-3/+3
| * | | | | | | | | | | | | hle/service, hle/sm: Use structured bindings where applicableLioncash2018-12-062-9/+3
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1882 from FearlessTobi/backport-4418-fixbunnei2018-12-081-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | Backport review comment from citra-emu/citra#4418Tobias2018-12-071-2/+2
| | |_|/ / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1873 from lioncash/constbunnei2018-12-0811-19/+25
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | yuzu/game_list_worker: Don't retrieve the file type twice in AddFstEntriesToGameList()Lioncash2018-12-051-5/+9
| * | | | | | | | | | | | yuzu/game_list_worker: Don't retrieve file type and file type strings twice in MakeGameListEntry()Lioncash2018-12-051-4/+6
| * | | | | | | | | | | | loaders: Make GetFileType() a const qualified member functionLioncash2018-12-0510-10/+10
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1868 from lioncash/configbunnei2018-12-061-43/+38
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | configuration/config: Use an intermediary variable for accessing playersLioncash2018-12-051-43/+38
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1875 from DarkLordZach/oss-ngword2bunnei2018-12-063-1/+41
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | system_archive: Implement open source NgWord2Zach Hilman2018-12-063-1/+41
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1861 from lioncash/resetbunnei2018-12-066-11/+101
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | kernel/svc: Correct behavior of svcResetSignal()Lioncash2018-12-051-4/+11
| * | | | | | | | | | | kernel/process: Make Process a WaitObjectLioncash2018-12-053-6/+68
| * | | | | | | | | | | kernel/readable_event: Add member function for enforcing a strict reset contractLioncash2018-12-052-1/+22
* | | | | | | | | | | | Merge pull request #1824 from ReinUsesLisp/fbcachebunnei2018-12-062-40/+82
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_rasterizer: Implement a framebuffer cacheReinUsesLisp2018-11-292-40/+82
* | | | | | | | | | | | | Merge pull request #1863 from ReinUsesLisp/texs-f16bunnei2018-12-062-18/+55
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | gl_shader_decompiler: Implement TEXS.F16ReinUsesLisp2018-12-052-13/+51
| * | | | | | | | | | | | gl_shader_decompiler: Fixup inverted ifReinUsesLisp2018-12-051-6/+5
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1867 from lioncash/allocbunnei2018-12-062-4/+3
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | ng_word: Deduplicate use of a constant valueLioncash2018-12-051-1/+1
| * | | | | | | | | | | | system_archive: Use a regular function pointer instead of std::function for file-scope system archive arrayLioncash2018-12-051-3/+2
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1866 from lioncash/cachebunnei2018-12-061-8/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | service/ldr: Deduplicate instruction cache clearing code in LoadNro()Lioncash2018-12-051-8/+2
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1870 from heapo/pagetable_shrink_to_fitMat M2018-12-061-0/+8
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Call shrink_to_fit after page-table vector resizing to cause crt to actually lower vector capacity. For 36-bit titles saves 800MB of commit.heapo2018-12-051-0/+8
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1859 from heapo/lut_array_codegenbunnei2018-12-051-275/+277
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Improve msvc codegen for hot-path array LUTsheapo2018-12-051-275/+277
* | | | | | | | | | Merge pull request #1704 from DarkLordZach/oss-sysarchivebunnei2018-12-058-1/+227
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | file_sys: Implement system archive synthesizer for NgWord (806)Zach Hilman2018-11-235-6/+61
| * | | | | | | | | | fsp_srv: Add support for using open source archive if not found in NANDZach Hilman2018-11-161-0/+10
| * | | | | | | | | | file_sys: Add framework for synthesizing open source archivesZach Hilman2018-11-163-0/+109
| * | | | | | | | | | vfs_vector: Add VFS backend for std::arrayZach Hilman2018-11-161-0/+52
* | | | | | | | | | | Merge pull request #1837 from lioncash/mapbunnei2018-12-051-59/+46
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | yuzu/game_list_worker: Move std::string construction after the termination check in callbacksLioncash2018-12-051-7/+7
| * | | | | | | | | | yuzu/game_list_worker: Deduplicate game list entry creationLioncash2018-12-021-47/+33
| * | | | | | | | | | yuzu/game_list_worker: Tidy up string handling in FillControlMap()Lioncash2018-12-021-6/+7
* | | | | | | | | | | Merge pull request #1838 from lioncash/dedupbunnei2018-12-051-27/+26
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | file_sys/registered_cache: Eliminate variable shadowingLioncash2018-12-021-27/+26
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1836 from lioncash/unusedbunnei2018-12-051-1/+0
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | crypto/key_manager: Remove unused variable in GetTicketblob()Lioncash2018-12-021-1/+0
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1860 from lioncash/eventbunnei2018-12-052-3/+58
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | kernel/svc: Remove unused header inclusionLioncash2018-12-041-1/+0
| * | | | | | | | | | kernel/svc: Implement svcSignalEvent()Lioncash2018-12-041-1/+16
| * | | | | | | | | | kernel/svc: Implement svcCreateEvent()Lioncash2018-12-042-1/+42
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1845 from lioncash/nrobunnei2018-12-045-19/+23
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | loader/nso: Remove dependency on the System classLioncash2018-12-033-8/+11
| * | | | | | | | | | loader/nro: Make the static LoadNro function internally linkedLioncash2018-12-032-7/+5
| * | | | | | | | | | loader/nro: Remove dependency on the System classLioncash2018-12-032-10/+13
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1853 from lioncash/eventbunnei2018-12-046-11/+20
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/object: Amend handle types to distinguish between readable and writable eventsLioncash2018-12-046-11/+20
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Rewrited TEX/TEXS (TEX Scalar). (#1826)Marcos2018-12-041-259/+177
* | | | | | | | | | Merge pull request #1857 from lioncash/res-infobunnei2018-12-045-11/+37
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/handle_table: Amend reference to CTR-OS in Create()Lioncash2018-12-041-2/+3
| * | | | | | | | | | kernel/svc: Implement the resource limit svcGetInfo optionLioncash2018-12-044-9/+34
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1854 from Subv/old_command_processorbunnei2018-12-042-142/+6
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | Removed unused file.Subv2018-12-041-142/+0
| * | | | | | | | | GPU: Don't try to route PFIFO methods (0-0x40) to the other engines.Subv2018-12-041-0/+6
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1852 from VPeruS/fix-format-stringMat M2018-12-041-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | [Kernel::CreateThread] Match format specifiers to LOG_TRACE's argumentsV.Kalyuzhny2018-12-041-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1840 from lioncash/infobunnei2018-12-041-50/+100
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | svc: Use the current process' handle table for retrieving the process instance to act uponLioncash2018-12-021-1/+2
| * | | | | | | | svc: Reorganize svcGetInfo, handle more error cases for existing implemented info categoriesLioncash2018-12-021-50/+99
| |/ / / / / / /
* | | | | | | | Merge pull request #1842 from lioncash/slotbunnei2018-12-039-14/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu/configuration: Make slots private where applicableLioncash2018-12-025-7/+2
| * | | | | | | | yuzu/configuration: Add missing override specifiers to configuration-related classesLioncash2018-12-027-7/+7
| * | | | | | | | yuzu/configuration/configure_input: Default destructor in the cpp fileLioncash2018-12-022-0/+3
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1835 from lioncash/cache-globalbunnei2018-12-038-40/+26
|\ \ \ \ \ \ \ \
| * | | | | | | | filesystem: De-globalize registered_cache_unionLioncash2018-12-028-40/+26
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1822 from ReinUsesLisp/glsl-scopebunnei2018-12-031-250/+213
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_decompiler: Remove texture temporal in TLD4ReinUsesLisp2018-11-291-3/+1
| * | | | | | | | gl_shader_decompiler: Flip negated if else statementReinUsesLisp2018-11-291-3/+3
| * | | | | | | | gl_shader_decompiler: Use GLSL scope on instructions unrelated to texturesReinUsesLisp2018-11-291-35/+10
| * | | | | | | | gl_shader_decompiler: Move texture code generation into lambdasReinUsesLisp2018-11-291-97/+78
| * | | | | | | | gl_shader_decompiler: Clean up texture instructionsReinUsesLisp2018-11-291-87/+56
| * | | | | | | | gl_shader_decompiler: Scope GLSL variables with a scoped objectReinUsesLisp2018-11-291-32/+72
* | | | | | | | | Merge pull request #1803 from DarkLordZach/k-able-eventbunnei2018-12-0337-247/+410
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hle_ipc: Refactor SleepClientThread to avoid ReadableEventZach Hilman2018-11-299-14/+14
| * | | | | | | | | kernel/event: Reference ReadableEvent from WritableEventZach Hilman2018-11-2932-317/+175
| * | | | | | | | | core: Port all current usages of Event to Readable/WritableEventZach Hilman2018-11-2929-164/+287
| * | | | | | | | | hle_ipc: Use event pair for SleepClientThreadZach Hilman2018-11-292-19/+22
| * | | | | | | | | kernel: Add named event tableZach Hilman2018-11-292-0/+30
| * | | | | | | | | kernel: Divide Event into ReadableEvent and WritableEventZach Hilman2018-11-296-61/+210
| * | | | | | | | | kernel/object: Add descriptions to ResetTypesZach Hilman2018-11-291-3/+3
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1833 from lioncash/cleanbunnei2018-12-035-5/+97
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | file_sys: Override missing mutating functions to be stubbed out for ReadOnlyVfsDirectory by defaultLioncash2018-12-012-0/+25
| * | | | | | | | | service/fsp_srv: Implement CleanDirectoryRecursivelyLioncash2018-12-015-5/+72
* | | | | | | | | | Merge pull request #1839 from lioncash/initbunnei2018-12-031-2/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | service/audio/audout_u: Amend constructor initialization list orderLioncash2018-12-021-2/+2
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1841 from ogniK5377/npad-mode-fixbunnei2018-12-031-2/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Fixed crash with SetNpadModeDavid Marcec2018-12-021-2/+3
| | |_|_|_|/ / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1843 from lioncash/tableSebastian Valle2018-12-032-6/+8
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | service/usb: Update function tableLioncash2018-12-021-1/+1
| * | | | | | | | | service/erpt: Update function tableLioncash2018-12-021-5/+7
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1827 from ReinUsesLisp/clip-and-shaderbunnei2018-12-025-13/+37
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer: Enable clip distances when set in register and in shaderReinUsesLisp2018-11-295-13/+37
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1825 from ReinUsesLisp/shader-pipeline-cachebunnei2018-12-021-4/+17
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_shader_manager: Update pipeline when programs have changedReinUsesLisp2018-11-291-4/+17
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1795 from ReinUsesLisp/vc-cleanupbunnei2018-12-025-32/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer: Signal UNIMPLEMENTED when rt_separate_frag_data is not zeroReinUsesLisp2018-11-291-1/+1
| * | | | | | | | | gl_rasterizer_cache: Use brackets for two-line single-expresion blocksReinUsesLisp2018-11-291-1/+2
| * | | | | | | | | gl_rasterizer: Remove unused struct declarationsReinUsesLisp2018-11-291-14/+0
| * | | | | | | | | gl_rasterizer: Remove extension booleansReinUsesLisp2018-11-294-16/+4
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1823 from bunnei/fix-surface-copybunnei2018-12-021-145/+5
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer_cache: Update AccurateCopySurface to flush complete source surface.bunnei2018-11-301-1/+4
| * | | | | | | | | gl_rasterizer_cache: Remove BlitSurface and replace with more accurate copy.bunnei2018-11-291-144/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1832 from Simek/remove-game-list-borderbunnei2018-12-021-0/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | remove border from GameListBartosz Kaszubowski2018-11-301-0/+1
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1830 from Subv/vi_ubbunnei2018-12-021-0/+2
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | Services/VI: Dereferencing an uninitialized std::optional is undefined behavior.Subv2018-11-301-0/+2
* | | | | | | | | Fix debug buildLioncash2018-12-012-5/+3
| |/ / / / / / / |/| | | | | | |
* | | | | | | | Merge pull request #1829 from lioncash/langbunnei2018-11-302-2/+20
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | service/set: Convert GetLanguageCode over to using PushEnum()Lioncash2018-11-301-1/+1
| * | | | | | | service/set: Implement MakeLanguageCodeLioncash2018-11-302-1/+19
|/ / / / / / /
* | / / / / / configure_input: Amend clang-format discrepanciesLioncash2018-11-301-1/+1
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #1768 from greggameplayer/patch-2bunnei2018-11-291-0/+4
|\ \ \ \ \ \
| * | | | | | correct clang-formatgreggameplayer2018-11-221-1/+1
| * | | | | | Automatically disable joycons dockedgreggameplayer2018-11-221-0/+4
* | | | | | | Merge pull request #1801 from ogniK5377/log-before-executebunnei2018-11-2951-390/+860
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | Added comment on Main memory size for more clarityDavid Marcec2018-11-271-0/+1
| * | | | | | Made svcSetHeapSize and svcCreateSharedMemory more readableDavid Marcec2018-11-271-4/+4
| * | | | | | Reworked svcs slightly, improved error messages in AM and fsp_srvDavid Marcec2018-11-273-20/+30
| * | | | | | Fixed hwopus compile errorDavid Marcec2018-11-261-1/+1
| * | | | | | Improved error messages in AM, HwOpus and NvMapDavid Marcec2018-11-263-26/+39
| * | | | | | Improved error messages for SVCsDavid Marcec2018-11-261-76/+170
| * | | | | | Changed logging to be "Log before execution", Added more error logging, all services should now log on some levelDavid Marcec2018-11-2651-374/+726
* | | | | | | Merge pull request #1808 from Tinob/masterbunnei2018-11-283-15/+31
|\ \ \ \ \ \ \
| * | | | | | | remove viewport_transform_enabled as it seems to be inactive when valid transforms are used.Rodolfo Bogado2018-11-271-12/+5
| * | | | | | | Add support for Clip Distance enabled registerRodolfo Bogado2018-11-273-3/+26
* | | | | | | | Merge pull request #1786 from Tinob/DepthClampbunnei2018-11-285-10/+58
|\ \ \ \ \ \ \ \
| * | | | | | | | Implement depth clampRodolfo Bogado2018-11-275-10/+58
| |/ / / / / / /
* | | | | | | | Merge pull request #1817 from DarkLordZach/npad-idx-fixbunnei2018-11-281-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | npad: Use NPadIdToIndex to prevent invalid array accessZach Hilman2018-11-281-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #1792 from bunnei/dma-pusherbunnei2018-11-2818-110/+365
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ |/| | | | | | |
| * | | | | | | dma_pushbuffer: Optimize to avoid loop and copy on Push.bunnei2018-11-283-13/+23
| * | | | | | | gpu: Move command list profiling to DmaPusher::DispatchCalls.bunnei2018-11-282-5/+5
| * | | | | | | gpu: Rewrite GPU command list processing with DmaPusher class.bunnei2018-11-2718-108/+353
* | | | | | | | Merge pull request #1735 from FernandoS27/tex-spacingbunnei2018-11-288-36/+55
|\ \ \ \ \ \ \ \
| * | | | | | | | Implemented Tile Width SpacingFernandoS272018-11-268-36/+55
* | | | | | | | | Merge pull request #1814 from lioncash/ptrbunnei2018-11-283-33/+31
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | file_sys/registered_cache: Remove unused <map> includeLioncash2018-11-271-1/+0
| * | | | | | | | | file_sys/registered_cache: Use regular const references instead of std::shared_ptr for InstallEntry()Lioncash2018-11-273-32/+31
* | | | | | | | | | Merge pull request #1811 from lioncash/inputbunnei2018-11-286-94/+72
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu/configure_input_player: Use std::size_t to represent the player index instead of u8Lioncash2018-11-272-3/+3
| * | | | | | | | | | yuzu/configure_input: Make CallConfigureDialog a non-member template functionLioncash2018-11-273-21/+20
| * | | | | | | | | | yuzu/configure_input_player: Use a lambda expression instead of std::bindLioncash2018-11-271-1/+1
| * | | | | | | | | | yuzu/configure_input_player: Amend constructor initializer list orderLioncash2018-11-271-4/+3
| * | | | | | | | | | yuzu/configure_input: Remove unused function MoveGridElementLioncash2018-11-271-7/+0
| * | | | | | | | | | yuzu/configure_input*: Move data members after function declarationsLioncash2018-11-272-41/+42
| * | | | | | | | | | yuzu/configure_input: Remove unnecessary includesLioncash2018-11-273-17/+3
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1815 from DarkLordZach/npad-pos-fixbunnei2018-11-271-3/+3
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | npad: Fix copy/paste error with LED position assignmentsZach Hilman2018-11-271-3/+3
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1802 from DarkLordZach/user-data-storagebunnei2018-11-273-17/+19
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | profile_manager: Save and load ProfileData from diskZach Hilman2018-11-263-17/+19
* | | | | | | | | | | Merge pull request #1812 from lioncash/nacpbunnei2018-11-271-7/+17
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | control_metadata: Correct typo in language name (Portugese -> Portuguese)Lioncash2018-11-271-7/+17
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1813 from ReinUsesLisp/fixup-clipbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_shader_decompiler: Fixup clip distance indexReinUsesLisp2018-11-271-1/+1
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #1810 from degasus/dirty_flagsbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | gl_rasterizer: Fixup for #1723.Markus Wick2018-11-271-1/+1
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1806 from ReinUsesLisp/morton-fixupbunnei2018-11-271-1/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | morton: Fixup compiler warningReinUsesLisp2018-11-271-1/+2
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1804 from lioncash/castbunnei2018-11-271-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | gdbstub: Silence value truncation warning within FpuWrite()Lioncash2018-11-271-1/+1
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1805 from lioncash/resourcebunnei2018-11-273-5/+130
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | svc: Implement svcSetResourceLimitLimitValue()Lioncash2018-11-271-1/+36
| * | | | | | | | svc: Implement svcGetResourceLimitCurrentValue()Lioncash2018-11-271-16/+49
| * | | | | | | | svc: Implement svcGetResourceLimitLimitValue()Lioncash2018-11-272-2/+33
| * | | | | | | | svc: Implement svcCreateResourceLimit()Lioncash2018-11-272-1/+27
| |/ / / / / / /
* | | | | | | | Merge pull request #1794 from Tinob/masterbunnei2018-11-272-8/+32
|\ \ \ \ \ \ \ \
| * | | | | | | | Limit the amount of viewports tested for state changes only to the usable onesRodolfo Bogado2018-11-251-2/+10
| * | | | | | | | Add support for viewport_transfom_enable registerRodolfo Bogado2018-11-242-6/+22
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1723 from degasus/dirty_flagsbunnei2018-11-279-6/+60
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_rasterizer: Skip VB upload if the state is clean.Markus Wick2018-11-179-6/+60
* | | | | | | | | GPU States: Implement Polygon Offset. This is used in SMO all the time. (#1784)Marcos2018-11-275-5/+107
* | | | | | | | | Merge pull request #1713 from FernandoS27/bra-ccbunnei2018-11-271-4/+14
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Implemented BRA CC conditional and FSET CC SettingFernandoS272018-11-241-4/+14
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1798 from ReinUsesLisp/y-directionbunnei2018-11-275-16/+26
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | gl_shader_decompiler: Implement S2R's Y_DIRECTIONReinUsesLisp2018-11-255-16/+26
| |/ / / / / / /
* | | | | | | | Merge pull request #1763 from ReinUsesLisp/bfibunnei2018-11-262-0/+23
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_decompiler: Implement BFI_IMM_RReinUsesLisp2018-11-212-0/+23
* | | | | | | | | Merge pull request #1793 from lioncash/refbunnei2018-11-262-2/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | service/sm: Take std::string by const reference in UnregisterServiceLioncash2018-11-242-2/+2
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1760 from ReinUsesLisp/r2pbunnei2018-11-262-0/+42
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_shader_decompiler: Implement R2P_IMMReinUsesLisp2018-11-212-0/+42
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1782 from FernandoS27/dcbunnei2018-11-261-116/+188
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Fix Texture OverlappingFernandoS272018-11-241-43/+70
| * | | | | | | | | Fix TEXS Instruction encodingsFernandoS272018-11-241-22/+48
| * | | | | | | | | Fix one encoding in TEX InstructionFernandoS272018-11-241-3/+3
| * | | | | | | | | Corrected inputs indexing in TEX instructionFernandoS272018-11-241-66/+85
* | | | | | | | | | Merge pull request #1783 from ReinUsesLisp/clip-distancesbunnei2018-11-263-21/+58
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_shader_decompiler: Implement clip distancesReinUsesLisp2018-11-233-21/+58
* | | | | | | | | | | Merge pull request #1796 from ReinUsesLisp/morton-movebunnei2018-11-266-345/+391
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / |/| | | | | | | | | |
| * | | | | | | | | | morton: Style changesReinUsesLisp2018-11-251-12/+12
| * | | | | | | | | | video_core: Move morton functions to their own fileReinUsesLisp2018-11-256-345/+391
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1800 from encounter/svcgetinfoMat M2018-11-251-1/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | svc: Return ERR_INVALID_ENUM_VALUE from svcGetInfoLuke Street2018-11-251-1/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1791 from bunnei/nvdrv-stubbunnei2018-11-252-2/+18
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | nvdrv: Implement/stub DumpGraphicsMemoryInfo and GetStatus.bunnei2018-11-242-2/+18
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1787 from bunnei/fix-gpu-mmbunnei2018-11-252-1/+9
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | memory_manager: Do not allow 0 to be a valid GPUVAddr.bunnei2018-11-232-1/+9
* | | | | | | | | | Merge pull request #1641 from DarkLordZach/sm-register-unregisterbunnei2018-11-242-2/+55
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | sm: Implement RegisterService and UnregisterServiceZach Hilman2018-11-042-2/+55
* | | | | | | | | | | Merge pull request #1731 from DarkLordZach/change-dir-crashbunnei2018-11-242-0/+6
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | filesystem: Clear registered union paths on factory creationZach Hilman2018-11-192-0/+6
| | |_|_|_|_|_|_|_|/ / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1725 from FernandoS27/gl43bunnei2018-11-2410-2216/+2710
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Removed pre 4.3 ARB extensionsFernandoS272018-11-217-48/+13
| * | | | | | | | | | | Update OpenGL's backend version from 3.3 to 4.3FernandoS272018-11-215-2168/+2697
* | | | | | | | | | | | Merge pull request #1785 from Tinob/masterbunnei2018-11-245-28/+95
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Add support for clear_flags registerRodolfo Bogado2018-11-245-28/+95
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1692 from Hedges/GDBCleanbunnei2018-11-242-38/+87
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | GDBStub improvements:Hedges2018-11-132-38/+87
* | | | | | | | | | | | | Merge pull request #1708 from ogniK5377/res-scalebunnei2018-11-243-60/+78
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | Removed hard coded values for width and heightDavid Marcec2018-11-191-2/+4
| * | | | | | | | | | | | | Report resolution scaling support for vi and amDavid Marcec2018-11-163-60/+76
* | | | | | | | | | | | | | Merge pull request #1747 from DarkLordZach/exefs-lfsbunnei2018-11-247-2/+65
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | patch_manager: Show LayeredExeFS patch in add-ons columnZach Hilman2018-11-212-4/+15
| * | | | | | | | | | | | | | patch_manager: Apply LayeredExeFS patchesZach Hilman2018-11-201-0/+25
| * | | | | | | | | | | | | | settings: Add option to dump ExeFS of games upon launchZach Hilman2018-11-207-0/+27
* | | | | | | | | | | | | | | Merge pull request #1769 from ReinUsesLisp/ccbunnei2018-11-242-70/+81
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | gl_shader_decompiler: Add a message for unimplemented cc generationReinUsesLisp2018-11-221-23/+46
| * | | | | | | | | | | | | | gl_shader_decompiler: Rename internal flag stringsReinUsesLisp2018-11-221-15/+20
| * | | | | | | | | | | | | | gl_shader_decompiler: Rename control codes to condition codesReinUsesLisp2018-11-222-67/+50
| | |_|_|_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #1744 from degasus/shader_cachebunnei2018-11-244-8/+24
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | shader_cache: Only lock covered instructions.Markus Wick2018-11-204-8/+24
| | |_|_|_|/ / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #1741 from lioncash/kbdbunnei2018-11-242-12/+11
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | yuzu/applets/software_keyboard: Override accept() and reject() instead of providing own differently named member functionsLioncash2018-11-202-8/+8
| * | | | | | | | | | | | | yuzu/applets/software_keyboard: std::move std::function instances where applicableLioncash2018-11-201-2/+2
| * | | | | | | | | | | | | yuzu/applets/software_keyboard: Make slots private functionsLioncash2018-11-201-2/+1
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #1770 from DarkLordZach/applet-stubbunnei2018-11-234-4/+102
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | am: Return StubApplet instead of nullptr when AppletId not foundZach Hilman2018-11-223-11/+11
| * | | | | | | | | | | | | applets: Add StubAppletZach Hilman2018-11-223-0/+98
| | |/ / / / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1777 from lioncash/core-mgrbunnei2018-11-234-97/+225
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | core: Relocate CPU core management to its own classLioncash2018-11-224-97/+225
* | | | | | | | | | | | | | Merge pull request #1773 from lioncash/threadbunnei2018-11-232-41/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | common/thread: Drop Hungarian notation on SetCurrentThreadName's parameterLioncash2018-11-221-7/+7
| * | | | | | | | | | | | | | common/thread: Make Barrier's 'count' member non-constLioncash2018-11-221-1/+1
| * | | | | | | | | | | | | | common/thread: Initialize class member variables where applicableLioncash2018-11-221-6/+4
| * | | | | | | | | | | | | | common/thread: Group non-member functions togetherLioncash2018-11-221-3/+2
| * | | | | | | | | | | | | | common/thread: Remove SleepCurrentThread()Lioncash2018-11-222-12/+0
| * | | | | | | | | | | | | | common/thread: Remove unused CurrentThreadId()Lioncash2018-11-222-12/+0
| | |/ / / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Added predicate comparison LessEqualWithNan (#1736)Hexagon122018-11-232-5/+13
* | | | | | | | | | | | | | Merge pull request #1756 from ReinUsesLisp/fix-texturesbunnei2018-11-231-60/+78
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | gl_shader_decompiler: Fix register overwriting on texture callsReinUsesLisp2018-11-221-60/+78
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #1766 from FernandoS27/fix-txqbunnei2018-11-231-2/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | Properly Implemented TXQ InstructionFernandoS272018-11-211-2/+12
| | |_|/ / / / / / / / / / / | |/| | | | | | | | | | | |
* | | | | | | | | | | | | | Merge pull request #1762 from bunnei/getgputimebunnei2018-11-232-0/+19
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | nvhost_ctrl_gpu: Implement IoctlGetGpuTime.bunnei2018-11-212-0/+19
* | | | | | | | | | | | | | | Merge pull request #1779 from DarkLordZach/debug-pad-unmappedMat M2018-11-221-2/+3
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|/ / / / / |/| | | | | | | | | | | | | |
| * | | | | | | | | | | | | | debug_pad: Avoid loading input for nonexistent buttons (Home and Screenshot)Zach Hilman2018-11-221-2/+3
|/ / / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #1775 from bunnei/blend-eqbunnei2018-11-222-0/+12
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | maxwell_3d: Implement alternate blend equations.bunnei2018-11-222-0/+12
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #1765 from bunnei/multi-audoutbunnei2018-11-222-9/+22
|\ \ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | | audout_u: Add support for multiple IAudioOut streams.bunnei2018-11-222-9/+22
| |/ / / / / / / / / / / / /
* | | | | | | | | | | | | | Merge pull request #1764 from bunnei/macrointerpreterbunnei2018-11-222-8/+25
|\ \ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / / / / |/| | | | | | | | | | | | |
| * | | | | | | | | | | | | macro_interpreter: Implement AddWithCarry and SubtractWithBorrow.bunnei2018-11-222-8/+25
| |/ / / / / / / / / / / /
* | | | | | | | | | | | | Merge pull request #1737 from FernandoS27/layer-copybunnei2018-11-222-2/+30
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | Implemented Fast Layered CopyFernandoS272018-11-202-2/+30
| | |_|_|_|_|_|/ / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1771 from lioncash/bit-setbunnei2018-11-222-245/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | common: Remove bit_set.hLioncash2018-11-222-245/+0
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1767 from lioncash/handlebunnei2018-11-222-12/+14
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | kernel/handle_table: Move private static functions into the cpp fileLioncash2018-11-222-7/+9
| * | | | | | | | | | | | kernel/handle_table: Restrict handle table size to 1024 entriesLioncash2018-11-221-5/+2
| * | | | | | | | | | | | kernel/handle_table: Default destructor in the cpp fileLioncash2018-11-222-0/+3
| | |_|_|_|_|_|_|/ / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1753 from FernandoS27/ufbtypebunnei2018-11-212-0/+8
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Use default values for unknown framebuffer pixel formatFernandoS272018-11-212-0/+8
| | |_|_|/ / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1752 from ReinUsesLisp/unimpl-decompilerbunnei2018-11-211-371/+258
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_shader_decompiler: Use UNIMPLEMENTED instead of LOG+UNREACHABLE when applicableReinUsesLisp2018-11-211-371/+258
* | | | | | | | | | | | | Merge pull request #1742 from lioncash/hle-swkbdbunnei2018-11-215-44/+63
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | am/applets: Make the applet data broker part of the applet itself.Lioncash2018-11-205-31/+36
| * | | | | | | | | | | | am/applets: Replace includes with forward declarations where applicableLioncash2018-11-202-2/+9
| * | | | | | | | | | | | am/applets: Relocate comments above the relevant data member in AppletDataBrokerLioncash2018-11-201-11/+18
| | |/ / / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1754 from ReinUsesLisp/zero-registerbunnei2018-11-211-2/+1
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_shader_decompiler: Remove UNREACHABLE when setting RZReinUsesLisp2018-11-211-2/+1
* | | | | | | | | | | | | Merge pull request #1758 from lioncash/rectbunnei2018-11-211-11/+5
|\ \ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | | common/math_util: Simplify std::make_signed usages to std::make_signed_tLioncash2018-11-211-2/+2
| * | | | | | | | | | | | | common/math_util: Make Rectangle's constructors constexprLioncash2018-11-211-2/+2
| * | | | | | | | | | | | | common/math_util: Remove unnecessary static from PILioncash2018-11-211-1/+1
| * | | | | | | | | | | | | common/math_util: Remove unused IntervalsIntersect() functionLioncash2018-11-211-6/+0
| | |_|_|/ / / / / / / / / | |/| | | | | | | | | | |
* | | | | | | | | | | | | Merge pull request #1759 from lioncash/unusedbunnei2018-11-216-286/+0
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | common: Remove dependency on xbyakLioncash2018-11-216-286/+0
|/ / / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1751 from bunnei/color-mask-fixbunnei2018-11-211-0/+9
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | maxwell_3d: Initialize rasterizer color mask registers as enabled.bunnei2018-11-211-0/+9
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1750 from lioncash/amendbunnei2018-11-211-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | am: Correct build failureLioncash2018-11-211-2/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1734 from lioncash/sharedbunnei2018-11-213-29/+45
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/shared_memory: Make Map() and Unmap() take the target process by reference rather than as a pointerLioncash2018-11-193-12/+12
| * | | | | | | | | | kernel/shared_memory: Add a const qualified member function overload for GetPointer()Lioncash2018-11-192-1/+12
| * | | | | | | | | | kernel/shared_memory: Use 64-bit types for offset and size in CreateForAppletLioncash2018-11-192-2/+2
| * | | | | | | | | | kernel/shared_memory: Make GetPointer() take a std::size_t instead of a u32Lioncash2018-11-192-2/+2
| * | | | | | | | | | kernel/shared_memory: Make data members privateLioncash2018-11-191-12/+17
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1733 from lioncash/ldrbunnei2018-11-211-29/+12
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | ldr: Clean up error codesLioncash2018-11-191-29/+12
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1746 from lioncash/randombunnei2018-11-212-1/+1
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/process: Move <random> include to the cpp fileLioncash2018-11-202-1/+1
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1748 from lioncash/assertbunnei2018-11-211-1/+4
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | common/assert: Add UNIMPLEMENTED_IF and UNIMPLEMENTED_IF_MSG for conditional assertionsLioncash2018-11-211-0/+3
| * | | | | | | | | | common/assert: Make the UNIMPLEMENTED macro properly assertLioncash2018-11-201-1/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1749 from lioncash/gc-infobunnei2018-11-211-1/+12
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | file_sys/card_image: Provide named members for the GamecardInfo structLioncash2018-11-211-1/+12
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1667 from DarkLordZach/swkbdbunnei2018-11-2019-106/+1133
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | software_keyboard: Fix erroneous extra PushNormalDataZach Hilman2018-11-191-3/+2
| * | | | | | | | | software_keyboard: Return correct result code on user cancel operationZach Hilman2018-11-193-5/+1
| * | | | | | | | | applet: Add AppletDataBroker to manage HLE to AM service interactionZach Hilman2018-11-195-104/+194
| * | | | | | | | | software_keyboard: Use correct offset for inital text stringZach Hilman2018-11-191-1/+2
| * | | | | | | | | software_keyboard: Check for UTF-8 config flagZach Hilman2018-11-192-9/+23
| * | | | | | | | | software_keyboard: Add max and current length display to dialogZach Hilman2018-11-182-1/+11
| * | | | | | | | | software_keyboard: Push all data over all channels on dialog completionZach Hilman2018-11-181-18/+26
| * | | | | | | | | applet: Use std::queue instead of std::vector for storage stackZach Hilman2018-11-185-18/+44
| * | | | | | | | | applet: Add operation completed callbackZach Hilman2018-11-188-9/+34
| * | | | | | | | | software_keyboard: Push buffer size to offset 0x4 in output dataZach Hilman2018-11-184-18/+39
| * | | | | | | | | software_keyboard: Make GetText asynchronousZach Hilman2018-11-189-29/+64
| * | | | | | | | | am: Allow applets to push multiple and different channels of dataZach Hilman2018-11-1810-64/+62
| * | | | | | | | | am: Implement ILibraryAppletAccessor IsCompleted and GetResultZach Hilman2018-11-182-4/+9
| * | | | | | | | | am: Implement text check software keyboard modeZach Hilman2018-11-186-14/+120
| * | | | | | | | | am: Deglobalize software keyboard appletZach Hilman2018-11-1817-100/+180
| * | | | | | | | | qt/main: Register Qt Software Keyboard frontend with AMZach Hilman2018-11-183-0/+6
| * | | | | | | | | am: Construct and use proper applets with ILibraryAppletAccessorZach Hilman2018-11-181-1/+26
| * | | | | | | | | qt/applets: Provide Qt frontend implementation of software keyboardZach Hilman2018-11-183-0/+171
| * | | | | | | | | am/applets: Add connector between frontend and AM applet classesZach Hilman2018-11-183-0/+130
| * | | | | | | | | frontend/applets: Add frontend software keyboard provider and defaultZach Hilman2018-11-183-0/+63
| * | | | | | | | | am/applets: Add Applet superclass to describe a generic appletZach Hilman2018-11-183-0/+77
| * | | | | | | | | am: Unstub ILibraryAppletAccessor::StartZach Hilman2018-11-181-5/+17
| * | | | | | | | | am: Implement PopInteractiveOutData and PushInteractiveInDataZach Hilman2018-11-181-14/+24
| * | | | | | | | | am: Convert storage stack to vectorZach Hilman2018-11-181-27/+59
| * | | | | | | | | am: Move AM::IStorage to headerZach Hilman2018-11-181-0/+16
| * | | | | | | | | am: Move IStorageAccessor to header and update backing bufferZach Hilman2018-11-182-64/+62
| * | | | | | | | | am: Implement CreateTransferMemoryStorageZach Hilman2018-11-182-0/+26
| * | | | | | | | | string_util: Implement buffer to UTF-16 string helper functionZach Hilman2018-11-182-0/+17
| * | | | | | | | | svc: Implement svcCreateTransferMemoryZach Hilman2018-11-181-3/+33
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1739 from lioncash/lmbunnei2018-11-201-1/+12
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | lm: Implement SetDestination by doing nothingLioncash2018-11-201-1/+12
* | | | | | | | | | Merge pull request #1738 from lioncash/res-limitbunnei2018-11-206-190/+81
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/resource_limit: Clean up interfaceLioncash2018-11-206-190/+81
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1634 from DarkLordZach/better-hid-2bunnei2018-11-1933-1321/+4618
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | configure_input: Use Joycons Docked instead of Connected as labelZach Hilman2018-11-191-1/+1
| * | | | | | | | configure_input_player: Set minimum width on controlsZach Hilman2018-11-192-23/+30
| * | | | | | | | configure_input: Properly update UI components on removal of playerZach Hilman2018-11-191-0/+2
| * | | | | | | | configure_input: Make None a controller option instead of checkboxZach Hilman2018-11-1911-152/+148
| * | | | | | | | hid: Use player-defined controller type as PREFERRED_CONTROLLERZach Hilman2018-11-1916-296/+234
| * | | | | | | | qt: Move controller button config to separate dialogZach Hilman2018-11-194-0/+1767
| * | | | | | | | qt: Add UI to configure touchscreen parametersZach Hilman2018-11-194-0/+281
| * | | | | | | | qt: Add UI to configure mouse buttonsZach Hilman2018-11-194-0/+542
| * | | | | | | | configure_input: Add support for multiplayer and controller typesZach Hilman2018-11-193-998/+525
| * | | | | | | | hid/npad: Update NPad to use player controller bindings and typeZach Hilman2018-11-192-55/+108
| * | | | | | | | hid/touchscreen: Update Touchscreen to use advanced parametersZach Hilman2018-11-191-6/+6
| * | | | | | | | hid: Add controller bindings for Mouse controllerZach Hilman2018-11-192-4/+30
| * | | | | | | | hid: Add keyboard bindings for Keyboard controllerZach Hilman2018-11-192-2/+24
| * | | | | | | | hid: Add controller bindings for DebugPad controllerZach Hilman2018-11-192-21/+43
| * | | | | | | | yuzu/config: Add (de-)serialization for multiplayerZach Hilman2018-11-192-21/+331
| * | | | | | | | yuzu_cmd/config: Add config deserialization for multiplayerZach Hilman2018-11-191-37/+254
| * | | | | | | | settings: Add settings for multiple players and controllersZach Hilman2018-11-191-3/+48
| * | | | | | | | settings: Add Native type for keyboardZach Hilman2018-11-191-0/+210
| * | | | | | | | settings: Add Native type for mouse buttonsZach Hilman2018-11-192-0/+34
| * | | | | | | | Added missing start/end touch attributes to touchscreenDavid Marcec2018-11-192-1/+18
| * | | | | | | | Added debugpad skeletonDavid Marcec2018-11-192-2/+55
| * | | | | | | | Added controller helper funcsDavid Marcec2018-11-192-0/+35
| * | | | | | | | Changed polling rate of hid and Right joycon rotationDavid Marcec2018-11-191-2/+2
| * | | | | | | | Left joycon rotation button remappingDavid Marcec2018-11-192-7/+21
| * | | | | | | | Added automatic npad switch based on supported stylesetsDavid Marcec2018-11-192-4/+124
| * | | | | | | | Added multi-input support and controller assignment at any portDavid Marcec2018-11-192-122/+181
|/ / / / / / / /
* | | | | | | | Merge pull request #1717 from FreddyFunk/swizzle-gobbunnei2018-11-191-37/+33
|\ \ \ \ \ \ \ \
| * | | | | | | | textures/decoders: Replace magic numbersFrederic Laing2018-11-171-37/+33
* | | | | | | | | Merge pull request #1693 from Tinob/masterbunnei2018-11-199-211/+315
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | drop support for non separate alpha as it seems to cause issues in some gamesRodolfo Bogado2018-11-183-61/+35
| * | | | | | | | | fix sampler configuration, thanks to Marcos for his investigationRodolfo Bogado2018-11-173-19/+57
| * | | | | | | | | small type fixRodolfo Bogado2018-11-171-6/+6
| * | | | | | | | | small fix for alphaToOne bit locationRodolfo Bogado2018-11-171-2/+2
| * | | | | | | | | fix for gcc compilationRodolfo Bogado2018-11-171-60/+61
| * | | | | | | | | add AlphaToCoverage and AlphaToOneRodolfo Bogado2018-11-175-1/+39
| * | | | | | | | | add support for fragment_color_clampRodolfo Bogado2018-11-175-1/+24
| * | | | | | | | | add missing MirrorOnceBorder support where supportedRodolfo Bogado2018-11-171-0/+6
| * | | | | | | | | set border color not depending on the wrap modeRodolfo Bogado2018-11-171-9/+9
| * | | | | | | | | set default value for point size registerRodolfo Bogado2018-11-172-5/+4
| * | | | | | | | | fix viewport and scissor behaviorRodolfo Bogado2018-11-176-64/+89
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1555 from ccawley2011/clang-format-dockerbunnei2018-11-193-5/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | travis: Use pre-built image for clang-format targetCameron Cawley2018-10-243-5/+2
* | | | | | | | | | Merge pull request #1619 from janisozaur/patch-12bunnei2018-11-191-2/+6
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Handle missing git info when buildingMichał Janiszewski2018-10-291-2/+6
* | | | | | | | | | | Eliminated unnessessary memory allocation and copy (#1702)Frederic L2018-11-193-9/+20
* | | | | | | | | | | Merge pull request #1640 from DarkLordZach/game-list-reloadbunnei2018-11-195-1/+28
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | game_list: Only reload game list after relevant settings changedZach Hilman2018-11-045-1/+28
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1620 from DarkLordZach/ldr-robunnei2018-11-197-23/+405
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | ldr_ro: Add error check for memory allocation failureZach Hilman2018-11-184-13/+27
| * | | | | | | | | | | ldr_ro: Implement UnloadNro (command 1)Zach Hilman2018-11-151-22/+85
| * | | | | | | | | | | ldr_ro: Fully Implement LoadNro (command 0)Zach Hilman2018-11-151-11/+110
| * | | | | | | | | | | ldr_ro: Implement UnloadNrr (command 3)Zach Hilman2018-11-151-2/+84
| * | | | | | | | | | | ldr_ro: Fully implement LoadNrr (command 2)Zach Hilman2018-11-151-0/+112
| * | | | | | | | | | | process: Make MirrorMemory take state to map new memory asZach Hilman2018-11-152-3/+7
| * | | | | | | | | | | pl_u: Resize buffers in shared font data getter to what game requestsZach Hilman2018-11-151-0/+8
* | | | | | | | | | | | Merge pull request #1718 from ogniK5377/lets-go-softlockbunnei2018-11-193-1/+18
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Implemented CalculateStandardUserSystemClockDifferenceByUserDavid Marcec2018-11-173-1/+18
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Correctly sets default system language for yuzu-CLI (#1727)Schplee2018-11-191-0/+2
* | | | | | | | | | | | Merge pull request #1730 from ReinUsesLisp/fix-intelbunnei2018-11-191-2/+0
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_rasterizer: Remove default clip distanceReinUsesLisp2018-11-191-2/+0
* | | | | | | | | | | | | Merge pull request #1671 from DarkLordZach/vi-disconnectbunnei2018-11-191-0/+22
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | vi: Implement TransactParcel for Disconnect and DetachBufferZach Hilman2018-11-171-0/+22
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1728 from FearlessTobi/reset-signalMat M2018-11-181-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | svc: ResetSignal is not stubbedTobias2018-11-181-1/+1
| | |_|_|_|_|_|_|_|_|/ | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1722 from MysticExile/enable-applictation-crash-reportHexagon122018-11-172-10/+18
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | |
| * | | | | | | | | | Stubbed am:EnableApplicationCrashReportMysticExile2018-11-172-10/+18
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1678 from FearlessTobi/amiibo-hotkeysbunnei2018-11-171-1/+9
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | yuzu: Add hotkey for Amiibo loadingfearlessTobi2018-11-131-1/+9
* | | | | | | | | | | Merge pull request #1705 from Jcw87/mingw-jpegbunnei2018-11-172-9/+11
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Remove whitespaceJcw872018-11-161-1/+1
| * | | | | | | | | | | Include imageformat dependencies with releases (appveyor)Jcw872018-11-161-9/+10
| * | | | | | | | | | | Include imageformat dependencies with releasesJcw872018-11-161-0/+1
| | |_|_|_|_|_|_|/ / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1711 from ogniK5377/bluetooth-lets-gobunnei2018-11-172-1/+145
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Added various bluetooth based cmds for palmaDavid Marcec2018-11-162-1/+145
* | | | | | | | | | | | Merge pull request #1719 from bunnei/hwopus-fixbunnei2018-11-171-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | hwopus: DecodeInterleavedWithPerformance: Fix ordering of output parameters.bunnei2018-11-171-1/+1
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1714 from lioncash/kern-errbunnei2018-11-172-62/+32
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | kernel/errors: Clean up error codesLioncash2018-11-162-62/+32
* | | | | | | | | | | | Merge pull request #1712 from FearlessTobi/port-4426bunnei2018-11-161-9/+10
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | Common/Bitfield: store value as unsigned typeWeiyi Wang2018-11-161-9/+10
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1638 from FreddyFunk/SetMemoryPermission-StubbedMat M2018-11-162-1/+48
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Implement SetMemoryPermissionFrederic Laing2018-11-061-3/+39
| * | | | | | | | | | | Stubbed SetMemoryPermissionFrederic Laing2018-11-032-1/+12
| | |_|_|_|/ / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1700 from FreddyFunk/cleanupbunnei2018-11-161-3/+3
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_rasterizer_chache: Minor cleanupFrederic Laing2018-11-151-3/+3
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1701 from FreddyFunk/decodersbunnei2018-11-161-16/+16
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | textures/decoders: Minor cleanupFrederic Laing2018-11-151-16/+16
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1632 from DarkLordZach/keys-manager-optimizationsbunnei2018-11-1616-133/+200
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | game_list: Make add-ons column optionalZach Hilman2018-11-026-119/+166
| * | | | | | | | | | | filesystem: Cache RegisteredCacheUnion instead of constructing on demandZach Hilman2018-11-022-4/+11
| * | | | | | | | | | | file_sys: Use common KeyManager in NCA container typesZach Hilman2018-11-026-7/+18
| * | | | | | | | | | | content_archive: Add optional KeyManager parameter to constructorZach Hilman2018-11-022-3/+5
* | | | | | | | | | | | Merge pull request #1676 from lioncash/warnbunnei2018-11-162-3/+4
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | gl_state: Amend compilation warningsLioncash2018-11-132-3/+4
| | |_|_|_|_|_|_|_|_|/ / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1706 from lioncash/file-errbunnei2018-11-164-33/+16
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | file_sys/errors: Remove currently unused filesystem error codesLioncash2018-11-161-10/+0
| * | | | | | | | | | | | file_sys/errors: Get rid of the ErrCodes namespaceLioncash2018-11-161-17/+5
| * | | | | | | | | | | | file_sys/errors: Extract FS-related error codes to file_sys/errors.hLioncash2018-11-164-14/+19
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1710 from ogniK5377/palma-lets-gobunnei2018-11-161-2/+14
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | Added SetIsPalmaAllConnectable, SetPalmaBoostModeDavid Marcec2018-11-161-2/+14
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #1709 from ogniK5377/docked-mode-crashHexagon122018-11-161-0/+3
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Fixed switching operation modes when not running a gameDavid Marcec2018-11-161-0/+3
|/ / / / / / / / / /
* | | | | | | | | | Fixed priority switching edge case for handheld (#1675)David2018-11-161-12/+46
* | | | | | | | | | Merge pull request #1699 from DarkLordZach/deterministic-rng-3bunnei2018-11-161-1/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | csrng: Use random integer distribution instead of raw engineZach Hilman2018-11-161-1/+2
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1687 from lioncash/deduplicationbunnei2018-11-152-37/+13
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | kernel/thread: Deduplicate scheduler switching codeLioncash2018-11-142-37/+13
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1618 from DarkLordZach/dump-nsobunnei2018-11-1512-8/+75
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | patch_manager: Add support for dumping decompressed NSOsZach Hilman2018-10-292-1/+14
| * | | | | | | | | | settings: Add setting to control NSO dumpingZach Hilman2018-10-296-1/+28
| * | | | | | | | | | bis_factory: Add getter for mod dump root for a title IDZach Hilman2018-10-294-6/+33
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1691 from lioncash/audrenbunnei2018-11-151-3/+3
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | service/audren_u: Forward RequestUpdateAuto through the same function as RequestUpdateLioncash2018-11-141-3/+3
* | | | | | | | | | Merge pull request #1637 from FernandoS27/cachebunnei2018-11-151-18/+17
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Improved GPU Caches lookup SpeedFernandoS272018-11-111-18/+17
* | | | | | | | | | | Merge pull request #1697 from lioncash/accbunnei2018-11-152-15/+23
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | profile_manager: Replace iterative loop with a ranged-for loop in ParseUserSaveFile()Lioncash2018-11-141-4/+5
| * | | | | | | | | | | profile_manager: Move UUID Format function definitions into the cpp fileLioncash2018-11-142-11/+18
* | | | | | | | | | | | Merge pull request #1696 from lioncash/acc-condbunnei2018-11-151-2/+4
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | service/acc: Correct error case within TrySelectUserWithoutInteraction()Lioncash2018-11-141-2/+4
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1695 from lioncash/trbunnei2018-11-151-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | yuzu/configure_system: Mark the entropy mask string as nontranslatableLioncash2018-11-141-1/+1
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1690 from lioncash/nfpbunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | nfp: Correct erroneous sizeof expression within GetTagInfo()Lioncash2018-11-141-1/+1
| | |_|_|_|/ / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1689 from lioncash/breakbunnei2018-11-141-0/+1
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | hid/npad: Add missing break in switch statement within Controller_NPad::OnUpdate()Lioncash2018-11-141-0/+1
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1688 from lioncash/unusedbunnei2018-11-141-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | service: Mark MakeFunctionString with the [[maybe_unused]] attribute.Lioncash2018-11-141-2/+2
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1684 from lioncash/commonbunnei2018-11-142-88/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | string_util: Remove ArrayToString()Lioncash2018-11-142-21/+0
| * | | | | | | | | | | string_util: Remove TryParse()Lioncash2018-11-142-54/+3
| * | | | | | | | | | | string_util: Remove ThousandSeparate()Lioncash2018-11-131-14/+0
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1679 from DarkLordZach/deterministic-rng-2bunnei2018-11-146-8/+33
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | svc: Use proper random entropy generation algorithmZach Hilman2018-11-136-8/+33
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1662 from FreddyFunk/CopySurface-Optimizationbunnei2018-11-141-10/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | gl_rasterizer_cache: Remove unnecessary memory allocation and copy in CopySurfaceFrederic Laing2018-11-081-10/+7
* | | | | | | | | | | Merge pull request #1686 from DarkLordZach/move-open-yuzu-folderbunnei2018-11-141-1/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | qt: Move Open yuzu Folder action from Help to FileZach Hilman2018-11-131-1/+2
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1685 from lioncash/basebunnei2018-11-141-1/+0
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | video_core/renderer_base: Remove GL include from the renderer base class filesLioncash2018-11-131-1/+0
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1677 from FreddyFunk/skip-vao-binding-cleanupbunnei2018-11-141-4/+2
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_rasterizer: Minor cleanupFrederic L2018-11-131-4/+2
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1680 from lioncash/membunnei2018-11-144-86/+98
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | vm_manager: Unstub GetTotalHeapUsage()Lioncash2018-11-131-2/+1
| * | | | | | | | | | | kernel/process: Migrate heap-related memory management out of the process class and into the vm managerLioncash2018-11-134-84/+97
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1682 from lioncash/audiobunnei2018-11-141-2/+23
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | hle/audren_u: Implement Get/SetRenderingTimeLimitLioncash2018-11-131-2/+23
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1683 from lioncash/typobunnei2018-11-141-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | audio_core/audio_renderer: Fix typo in AuxInfo member nameLioncash2018-11-131-1/+1
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1608 from DarkLordZach/save-data-readerbunnei2018-11-1410-16/+260
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | ns: Implement command 400: GetApplicationControlDataZach Hilman2018-10-294-17/+75
| * | | | | | | | | | fsp_srv: Implement ISaveDataInfoReaderZach Hilman2018-10-291-0/+144
| * | | | | | | | | | fsp_srv: Implement command 61: OpenSaveDataInfoReaderBySaveDataSpaceIdZach Hilman2018-10-292-1/+13
| * | | | | | | | | | savedata_factory: Expose accessors for SaveDataSpaceZach Hilman2018-10-294-14/+32
| * | | | | | | | | | loader/nro: Call RegisterRomFS from LoadZach Hilman2018-10-291-0/+5
| * | | | | | | | | | control_metadata: Add GetRawBytes function to NACPZach Hilman2018-10-292-0/+7
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1628 from greggameplayer/Texture2DArraybunnei2018-11-131-0/+1
|\ \ \ \ \ \ \ \ \ \
| * \ \ \ \ \ \ \ \ \ Merge branch 'master' into Texture2DArraygreggameplayer2018-11-0623-195/+392
| |\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | correct syntaxgreggameplayer2018-11-021-4/+3
| * | | | | | | | | | | Merge branch 'master' into Texture2DArraygreggameplayer2018-11-0227-1066/+1477
| |\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Implement SurfaceTarget Texture2DArraygreggameplayer2018-10-311-0/+1
| | |_|_|_|_|_|/ / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1670 from DarkLordZach/deterministic-rngbunnei2018-11-139-103/+187
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | svc: Return random seed for svcGetInfo RandomEntropyZach Hilman2018-11-132-4/+8
| * | | | | | | | | | | | settings: Add config option to set RNG seedZach Hilman2018-11-126-100/+171
| * | | | | | | | | | | | csrng: Use std::mt19937 engine for random number generationZach Hilman2018-11-122-2/+11
| | |_|_|_|_|_|_|_|_|_|/ | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1665 from ogniK5377/GetClockSnapshotbunnei2018-11-133-21/+132
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Added maybe_unusedDavid Marcec2018-11-102-2/+7
| * | | | | | | | | | | | Added ToPosixTime & ToPosixTimeWithMyRuleDavid Marcec2018-11-101-2/+41
| * | | | | | | | | | | | Added consts and staticDavid Marcec2018-11-101-6/+6
| * | | | | | | | | | | | Implement GetClockSnapshotDavid Marcec2018-11-093-21/+88
* | | | | | | | | | | | | Implement ASTC_2D_10X8 & ASTC_2D_10X8_SRGB (#1666)greggameplayer2018-11-134-71/+101
* | | | | | | | | | | | | Merge pull request #1650 from FreddyFunk/castbunnei2018-11-131-1/+2
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|_|_|_|/ / |/| | | | | | | | | | | |
| * | | | | | | | | | | | yuzu/main: Fix compiler warningFrederic Laing2018-11-061-1/+2
* | | | | | | | | | | | | Merge pull request #1674 from FearlessTobi/fullscreen-fixJames Rowe2018-11-121-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / / / |/| | | | | | | | | | | |
| * | | | | | | | | | | | yuzu: Add a missing "!" to fix the stuck-in-fullscreen bugTobias2018-11-121-1/+1
| | |_|_|_|_|/ / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1660 from Tinob/masterbunnei2018-11-129-88/+138
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | Use core extensions when available to set max anisotropic filtering levelRodolfo Bogado2018-11-111-2/+7
| * | | | | | | | | | | | Improve state management by splitting some of the states id separated function to avoid a full apply overheadRodolfo Bogado2018-11-116-39/+40
| * | | | | | | | | | | | Try to fix problems with stencil test in some games, relax translation to opengl enums to avoid crashing and only generate logs of the errors.Rodolfo Bogado2018-11-114-37/+61
| * | | | | | | | | | | | set sampler max lod, min lod, lod bias and max anisotropyRodolfo Bogado2018-11-113-13/+33
| | |_|_|_|_|_|_|/ / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1652 from FreddyFunk/static-castbunnei2018-11-112-3/+3
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | configure_system: Fix compiler warningFrederic Laing2018-11-062-3/+3
| | |_|/ / / / / / / / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1664 from FreddyFunk/cast2bunnei2018-11-111-2/+2
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | gl_rasterizer: Fix compiler warningsFrederic Laing2018-11-081-2/+2
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1669 from ReinUsesLisp/fixup-gsbunnei2018-11-114-15/+24
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_shader_decompiler: Guard out of bound geometry shader input readsReinUsesLisp2018-11-104-15/+24
| | |_|_|/ / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1663 from lioncash/rasterbunnei2018-11-119-10/+25
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | rasterizer_cache: Remove reliance on the System singletonLioncash2018-11-089-10/+25
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1648 from FernandoS27/texs-3-arraybunnei2018-11-111-7/+11
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Correct issue where texturelod could not be applied to 2darrayshadowFernandoS272018-11-081-1/+5
| * | | | | | | | | | | Implement 3 coordinate array in TEXS instructionFernandoS272018-11-071-6/+6
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1654 from degasus/dirty_flagsbunnei2018-11-114-7/+37
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | gl_rasterizer: Skip VAO binding if the state is clean.Markus Wick2018-11-063-2/+21
| * | | | | | | | | | | gl_rasterizer: Split VAO and VB setup functions.Markus Wick2018-11-062-5/+16
| | |_|_|_|_|_|/ / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1656 from ogniK5377/message-queueJames Rowe2018-11-108-36/+170
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Renamed CheckIfOperationChanged to OnDockedModeChangedDavid Marcec2018-11-082-21/+23
| * | | | | | | | | | | FixupsDavid Marcec2018-11-073-12/+17
| * | | | | | | | | | | Ability to switch between docked and undocked mode in-gameDavid Marcec2018-11-077-36/+163
| |/ / / / / / / / / /
* | | | | | | | | | | Merge pull request #1661 from lioncash/dtorJames Rowe2018-11-103-0/+10
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | rasterizer_cache: Add missing virtual destructor to RasterizerCacheObjectLioncash2018-11-083-0/+10
|/ / / / / / / / / /
* | | | | | | | | | gl_resource_manager: Amend clang-format discrepanciesLioncash2018-11-081-4/+2
* | | | | | | | | | Merge pull request #1658 from ogniK5377/holdtype-stylebunnei2018-11-081-0/+2
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Updated npad styles on holdtype switchesDavid Marcec2018-11-071-0/+2
| | |/ / / / / / / / | |/| | | | | | | |
* | | | | | | | | | svcBreak now dumps information from the debug buffer passed (#1646)David2018-11-081-0/+28
* | | | | | | | | | Merge pull request #1655 from ogniK5377/shantaebunnei2018-11-085-3/+26
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | fixed spelling errorDavid Marcec2018-11-071-1/+1
| * | | | | | | | | Added missing logDavid Marcec2018-11-071-0/+1
| * | | | | | | | | Implement acc:TrySelectUserWithoutInteractionDavid Marcec2018-11-075-3/+25
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1630 from bunnei/fix-mapbufferexbunnei2018-11-072-31/+52
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | memory_manager: Do not MapBufferEx over already in use memory.bunnei2018-11-012-31/+52
* | | | | | | | | | Merge pull request #1635 from Tinob/masterbunnei2018-11-076-153/+338
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Add support to color mask to avoid issues in blending caused by wrong values in the alpha channel in some render targets.Rodolfo Bogado2018-11-055-25/+79
| * | | | | | | | | | Implement multi-target viewports and blendingRodolfo Bogado2018-11-056-128/+259
* | | | | | | | | | | Merge pull request #1653 from degasus/profilerbunnei2018-11-074-6/+53
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | gl_rasterizer_cache: Add profiles for Copy and Blit.Markus Wick2018-11-061-2/+6
| * | | | | | | | | | gl_resource_manager: Profile creation and deletion.Markus Wick2018-11-061-0/+42
| * | | | | | | | | | gl_stream_buffer: Profile orphaning of stream buffer.Markus Wick2018-11-061-0/+5
| * | | | | | | | | | microprofile: Drop ReleaseActiveBuffer scope.Markus Wick2018-11-061-4/+0
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1649 from degasus/split_resource_managerbunnei2018-11-065-114/+167
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | gl_resource_manager: Split implementations in .cpp file.Markus Wick2018-11-065-114/+167
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1616 from FernandoS27/cube-arraybunnei2018-11-054-0/+20
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Implement Cube ArraysFernandoS272018-11-014-0/+20
* | | | | | | | | | Merge pull request #1633 from ogniK5377/reload-inputbunnei2018-11-052-0/+5
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Fixed HID crash when launching more than 1 game & signaled syleset change eventDavid Marcec2018-11-022-0/+5
| | |_|_|_|_|/ / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1441 from CarlKenner/DebuggerLogbunnei2018-11-054-2/+29
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | logging: Add DebuggerBackend for logging to Visual StudioCarl Kenner2018-10-074-2/+29
* | | | | | | | | | | Merge pull request #1639 from DarkLordZach/open-yuzu-folderbunnei2018-11-053-0/+13
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | qt: Add help option to open yuzu folderZach Hilman2018-11-033-0/+13
| | |_|_|_|_|_|_|/ / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1625 from FernandoS27/astcbunnei2018-11-059-75/+154
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Fix ASTC Decompressor to support depth parameterFernandoS272018-11-027-65/+131
| * | | | | | | | | | Fix ASTC formatsFernandoS272018-11-014-12/+21
| * | | | | | | | | | Implemented ASTC 5x5FernandoS272018-11-011-1/+5
* | | | | | | | | | | Merge pull request #1645 from dharmin/masterMat M2018-11-051-1/+1
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Fix quickstart linkDharmin K Shah2018-11-041-1/+1
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1643 from FreddyFunk/typoMat M2018-11-051-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Fix typo in BufferTransformFlagsFrederic Laing2018-11-041-2/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1636 from ogniK5377/hwopus-bad-assertbunnei2018-11-031-1/+1
|\ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / |/| | | | | | | | |
| * | | | | | | | | Fixed incorrect hwopus assertDavid Marcec2018-11-021-1/+1
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1615 from lioncash/inputbunnei2018-11-025-25/+113
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | configure_system: Contrain profile usernames to 32 charactersLioncash2018-10-315-25/+113
* | | | | | | | | Merge pull request #1623 from Tinob/masterbunnei2018-11-013-105/+158
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | Improve OpenGL state handlingRodolfo Bogado2018-10-313-105/+158
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1527 from FernandoS27/assert-flowbunnei2018-11-012-2/+27
|\ \ \ \ \ \ \ \
| * | | | | | | | Assert Control Flow Instructions using Control CodesFernandoS272018-10-292-3/+28
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1622 from bunnei/fix-macrosbunnei2018-11-014-27/+55
|\ \ \ \ \ \ \ \
| * | | | | | | | maxwell_3d: Restructure macro upload to use a single macro code memory.bunnei2018-11-014-27/+55
|/ / / / / / / /
* | | | | | | | Merge pull request #1604 from FearlessTobi/port-4369bunnei2018-11-017-7/+65
|\ \ \ \ \ \ \ \
| * | | | | | | | compatdb: Use a seperate endpoint for testcase submissionfearlessTobi2018-10-287-7/+65
* | | | | | | | | Merge pull request #1528 from FernandoS27/assert-control-codesbunnei2018-11-012-1/+103
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / |/| | | | | | | |
| * | | | | | | | Assert Control Codes GenerationFernandoS272018-10-302-1/+103
* | | | | | | | | Merge pull request #1614 from ReinUsesLisp/surface-paramsbunnei2018-11-016-898/+954
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | video_core: Move surface declarations out of gl_rasterizer_cacheReinUsesLisp2018-10-306-898/+954
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1626 from lioncash/tablebunnei2018-11-011-3/+3
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | service/usb: Update IPdSession's function tableLioncash2018-10-301-3/+3
|/ / / / / / / /
* | | | | | | | Merge pull request #1624 from lioncash/boostbunnei2018-10-303-4/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | general: Remove unused boost inclusions where applicableLioncash2018-10-303-4/+0
* | | | | | | | | Merge pull request #1595 from FreddyFunk/castbunnei2018-10-301-1/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | configure_system: Fix compiler warningFrederic Laing2018-10-281-1/+1
* | | | | | | | | global: Use std::optional instead of boost::optional (#1578)Frederic L2018-10-3049-266/+274
* | | | | | | | | Merge pull request #1621 from lioncash/ipcbunnei2018-10-303-6/+9
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | hle_ipc: Add member function for querying the existence of a domain headerLioncash2018-10-303-3/+6
| * | | | | | | | | hle_ipc: Make GetDomainMessageHeader return a regular pointerLioncash2018-10-302-3/+3
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1611 from lioncash/constbunnei2018-10-304-13/+52
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | core: Make System references const where applicableLioncash2018-10-282-3/+3
| * | | | | | | | core: Add missing const variants of getters for the System classLioncash2018-10-282-10/+49
| |/ / / / / / /
* | | | | | | | Merge pull request #1580 from FernandoS27/mm-implbunnei2018-10-306-109/+254
|\ \ \ \ \ \ \ \
| * | | | | | | | Fixed black textures, pixelation and we no longer require to auto-generate mipmapsFernandoS272018-10-291-14/+2
| * | | | | | | | Fixed mipmap block autosizing algorithmFernandoS272018-10-293-13/+25
| * | | | | | | | Fixed Invalid Image size and Mipmap calculationFernandoS272018-10-291-4/+7
| * | | | | | | | Fixed Block Resizing algorithm and Clang FormatFernandoS272018-10-293-12/+19
| * | | | | | | | Implement Mip FilterFernandoS272018-10-294-10/+33
| * | | | | | | | Zero out memory region of recreated surface before flushingFernandoS272018-10-291-0/+2
| * | | | | | | | Implement MipmapsFernandoS272018-10-282-101/+211
| |/ / / / / / /
* | | | | | | | Merge pull request #1617 from FearlessTobi/fix-stretch-delaybunnei2018-10-301-3/+3
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / |/| | | | | | |
| * | | | | | | time_stretch: Switch to values of CitrafearlessTobi2018-10-291-3/+3
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1613 from ReinUsesLisp/gl-utilsbunnei2018-10-296-30/+61
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | video_core: Move OpenGL specific utils to its rendererReinUsesLisp2018-10-296-30/+61
| |/ / / / /
* | | | | | Merge pull request #1610 from slashiee/dxt1-alphabunnei2018-10-291-2/+2
|\ \ \ \ \ \
| * | | | | | Enable alpha channel for DXT1 texture formatMichael2018-10-281-2/+2
| |/ / / / /
* | | | | | Merge pull request #1612 from Tinob/masterbunnei2018-10-291-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | renderer_opengl: Correct bpp value for ASTC_2D_8X5_SRGBRodolfo Bogado2018-10-291-1/+1
|/ / / / /
* | | | | Merge pull request #1607 from FearlessTobi/patch-3bunnei2018-10-281-1/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Correct bpp value for ASTC_2D_8X5Tobias2018-10-281-1/+1
|/ / / /
* | | | Merge pull request #1601 from FernandoS27/shader-precisionbunnei2018-10-281-20/+35
|\ \ \ \
| * | | | Refactor precise usage and add FMNMX, MUFU, FMUL32 and FADD332FernandoS272018-10-282-74/+37
| * | | | Improved Shader accuracy on Vertex and Geometry Shaders with FFMA, FMUL and FADDFernandoS272018-10-282-6/+58
| |/ / /
* | | | Merge pull request #1606 from FearlessTobi/revert-1581-macosx-target-versionbunnei2018-10-281-1/+1
|\ \ \ \
| * | | | Revert "Update MACOSX_DEPLOYMENT_TARGET to 10.14"Tobias2018-10-281-1/+1
|/ / / /
* | | | Merge pull request #1593 from lioncash/svcbunnei2018-10-286-35/+128
|\ \ \ \
| * | | | svc: Localize the GetInfo enum class to the function itselfLioncash2018-10-262-32/+31
| * | | | svc: Implement svcGetInfo command 0xF0000002Lioncash2018-10-266-4/+98
* | | | | Merge pull request #1581 from FreddyFunk/macosx-target-versionbunnei2018-10-281-1/+1
|\ \ \ \ \
| * | | | | Update MACOSX_DEPLOYMENT_TARGET to 10.14Frederic L2018-10-251-1/+1
* | | | | | file_sys/patch_manager: Remove unnecessary if-statements (#1586)Frederic L2018-10-281-7/+6
* | | | | | Merge pull request #1598 from DeeJayBro/delete-directorybunnei2018-10-281-2/+26
|\ \ \ \ \ \
| * | | | | | service/filesystem: Add DirectoryDelete & DirectoryDeleteRecursivelyDeeJayBro2018-10-271-2/+26
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1600 from DarkLordZach/nsp-secondary-loader-fixbunnei2018-10-281-17/+20
|\ \ \ \ \ \
| * | | | | | loader/nsp: Move secondary loader initialization to constructorZach Hilman2018-10-271-17/+20
| |/ / / / /
* | | | | | Merge pull request #1582 from Tinob/masterbunnei2018-10-288-40/+197
|\ \ \ \ \ \
| * | | | | | Implement sRGB Support, including workarounds for nvidia driver issues and QT sRGB supportRodolfo Bogado2018-10-288-40/+197
|/ / / / / /
* | | | | | Merge pull request #1602 from DarkLordZach/key-derivation-isxdigitbunnei2018-10-281-1/+1
|\ \ \ \ \ \
| * | | | | | key_manager: Use isxdigit instead of isdigit when reading key fileZach Hilman2018-10-281-1/+1
| |/ / / / /
* | | | | | Merge pull request #1597 from lioncash/errorbunnei2018-10-281-51/+70
|\ \ \ \ \ \
| * | | | | | configure_system: Make GetIcon() return the scaled 64x64 iconLioncash2018-10-271-14/+7
| * | | | | | configure_system: Move entry formatting for the user account list entries to its own functionLioncash2018-10-271-18/+22
| * | | | | | configure_system: Display errors to the user if file operations fail when setting user imagesLioncash2018-10-271-24/+46
| |/ / / / /
* | | | | | Merge pull request #1594 from FreddyFunk/static-castbunnei2018-10-281-2/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | gl_rasterizer_cache: Fix compiler warningFrederic Laing2018-10-271-2/+2
| |/ / / /
* | | | | Merge pull request #1596 from FearlessTobi/port-4367bunnei2018-10-271-1/+2
|\ \ \ \ \
| * | | | | cubeb_sink: ignore null-name device when selectingWeiyi Wang2018-10-271-1/+2
| |/ / / /
* | | | | Merge pull request #1592 from bunnei/prim-restartbunnei2018-10-275-1/+40
|\ \ \ \ \
| * | | | | gl_rasterizer: Implement primitive restart.bunnei2018-10-265-1/+40
| |/ / / /
* | | | | Merge pull request #1599 from FernandoS27/stalematebunnei2018-10-271-0/+62
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Implement Default Block Height for each formatFernandoS272018-10-271-0/+62
|/ / / /
* | | | Merge pull request #1533 from FernandoS27/lmembunnei2018-10-263-1/+138
|\ \ \ \
| * | | | Implemented LD_L and ST_LFernandoS272018-10-243-12/+112
| * | | | Implement Shader Local MemoryFernandoS272018-10-241-0/+37
* | | | | Merge pull request #1430 from DarkLordZach/remove-promote-dirbunnei2018-10-2617-95/+1
|\ \ \ \ \
| * | | | | vfs: Remove InterpretAsDirectory and related functionsZach Hilman2018-10-1917-95/+1
* | | | | | Merge pull request #1591 from bunnei/depth-rangebunnei2018-10-266-14/+41
|\ \ \ \ \ \
| * | | | | | maxwell_3d: Add code for initializing register defaults.bunnei2018-10-262-1/+21
| * | | | | | gl_rasterizer: Implement depth range.bunnei2018-10-264-13/+20
* | | | | | | Merge pull request #1569 from lioncash/amiibobunnei2018-10-263-17/+40
|\ \ \ \ \ \ \
| * | | | | | | yuzu/main: Notify user of loading errors with Amiibo dataLioncash2018-10-243-17/+40
* | | | | | | | Merge pull request #1587 from lioncash/privatebunnei2018-10-262-45/+46
|\ \ \ \ \ \ \ \
| * | | | | | | | configure_system: Make the file selector text translatableLioncash2018-10-251-1/+1
| * | | | | | | | configure_system: Make GetAccountUsername() an internal functionLioncash2018-10-252-25/+28
| * | | | | | | | configure_system: Default initialize member variablesLioncash2018-10-251-4/+5
| * | | | | | | | configure_system: Simplify UUID generation call in AddUser()Lioncash2018-10-251-2/+1
| * | | | | | | | configure_system: Amend function casingLioncash2018-10-252-6/+6
| * | | | | | | | configure_system: Add missing override specifier on the destructorLioncash2018-10-251-1/+1
| * | | | | | | | configure_system: Make public slots privateLioncash2018-10-251-7/+5
* | | | | | | | | Merge pull request #1557 from bunnei/ldr_robunnei2018-10-266-9/+101
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | ldr: Partially implement LoadNro.bunnei2018-10-261-3/+49
| * | | | | | | | process: LoadModule should clear JIT instruction cache.bunnei2018-10-261-0/+6
| * | | | | | | | Kernel/Memory: Added a function to first a suitable guest address at which to allocate a region of a given size.bunnei2018-10-262-0/+28
| * | | | | | | | nro: Make LoadNro method accessible outside of apploader code.bunnei2018-10-262-6/+18
|/ / / / / / / /
* | | | | | | | Merge pull request #1583 from DarkLordZach/rle-sizeMat M2018-10-251-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | ips_layer: Use rle_size instead of data_size in RLE patch applicationZach Hilman2018-10-251-1/+1
* | | | | | | | Merge pull request #1584 from FearlessTobi/patch-3James Rowe2018-10-251-0/+0
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Delete gitTobias2018-10-251-0/+0
|/ / / / / / /
* | | | | | | Merge pull request #1579 from lioncash/usbbunnei2018-10-251-21/+22
|\ \ \ \ \ \ \
| * | | | | | | service/usb: Update service function tablesLioncash2018-10-251-21/+22
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1576 from lioncash/acc-warnbunnei2018-10-251-25/+27
|\ \ \ \ \ \ \
| * | | | | | | service/acc: Move fallback image to file scopeLioncash2018-10-251-14/+13
| * | | | | | | service/acc: Silence compiler warningsLioncash2018-10-251-5/+8
| * | | | | | | service/acc: Early return in failure case in LoadImage()Lioncash2018-10-251-8/+8
| |/ / / / / /
* | | | | | | Merge pull request #1577 from lioncash/errbunnei2018-10-255-34/+16
|\ \ \ \ \ \ \
| * | | | | | | kernel/errors: Remove now-unused, unnecessary, error codesLioncash2018-10-242-13/+0
| * | | | | | | kernel/shared_memory: Return ERR_INVALID_MEMORY_PERMISSIONS instead of ERR_INVALID_COMBINATIONLioncash2018-10-241-4/+3
| * | | | | | | kernel/server_port: Simplify emptiness check within ShouldWait()Lioncash2018-10-241-1/+1
| * | | | | | | kernel/server_port: Change error case return value in Accept() to ERR_NOT_FOUNDLioncash2018-10-242-3/+1
| * | | | | | | kernel/error: Remove leftover 3DS error codesLioncash2018-10-241-5/+0
| * | | | | | | kernel/svc: Amend returned error code for invalid priorities in CreateThreadLioncash2018-10-241-1/+1
| * | | | | | | kernel/svc: Move and correct returned error code for invalid thread priorities in SetThreadPriority()Lioncash2018-10-241-5/+6
| * | | | | | | kernel/error: Add error code for invalid pointersLioncash2018-10-241-1/+1
| * | | | | | | kernel/error: Add error code for closed sessionsLioncash2018-10-241-1/+3
| |/ / / / / /
* | | | | | | Merge pull request #1524 from FernandoS27/layers-fixbunnei2018-10-253-72/+109
|\ \ \ \ \ \ \
| * | | | | | | Fixed Layered Textures Loading and CubemapsFernandoS272018-10-233-72/+109
* | | | | | | | Merge pull request #1575 from lioncash/qstringbunnei2018-10-251-4/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | game_list_worker: Use QString's formatting instead of fmt in FormatPatchNameVersions()Lioncash2018-10-241-4/+9
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1570 from lioncash/optionalbunnei2018-10-255-48/+53
|\ \ \ \ \ \ \ \
| * | | | | | | | profile_manager: Use std::optional instead of boost::optionalLioncash2018-10-245-48/+53
| |/ / / / / / /
* | | | | | | | Merge pull request #1558 from lioncash/ptrbunnei2018-10-252-13/+14
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | yuzu/configuration/config: Use a std::unique_ptr for qt_config instead of a raw pointerLioncash2018-10-242-8/+8
| * | | | | | | yuzu/configuration/config: Reorganize member variable and function layoutLioncash2018-10-241-6/+7
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1565 from lioncash/audiobunnei2018-10-242-3/+1
|\ \ \ \ \ \ \
| * | | | | | | time_stretch: Remove unused m_channel_count member variableLioncash2018-10-242-3/+1
| |/ / / / / /
* | | | | | | Merge pull request #1554 from FernandoS27/pointsizebunnei2018-10-243-5/+28
|\ \ \ \ \ \ \
| * | | | | | | Implement PointSizeFernandoS272018-10-233-5/+28
* | | | | | | | Merge pull request #1571 from lioncash/debug-translatebunnei2018-10-242-15/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | graphic_breakpoints: Correct translation of strings in BreakpointModel's data() functionLioncash2018-10-242-15/+20
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1564 from lioncash/npadbunnei2018-10-241-2/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | npad: Remove unused controller variable from OnInit()Lioncash2018-10-241-2/+3
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1568 from lioncash/dirbunnei2018-10-241-4/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | game_list: Use QFileInfo instead of common's file functionsLioncash2018-10-241-4/+3
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1567 from lioncash/translatebunnei2018-10-241-5/+5
|\ \ \ \ \ \ \ \
| * | | | | | | | game_list: Make game list column headers translatableLioncash2018-10-241-5/+5
| |/ / / / / / /
* | | | | | | | Merge pull request #1566 from lioncash/strbunnei2018-10-241-4/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | bootmanager: Use QStringLiteral instead of std::string to represent the window titleLioncash2018-10-241-4/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #1563 from lioncash/framebunnei2018-10-241-4/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | perf_stats: Remove unused variable within DoFrameLimiting()Lioncash2018-10-241-4/+0
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1562 from lioncash/aocbunnei2018-10-241-3/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | aoc_u: Make use of previously-unused CheckAOCTitleIDMatchesBase() functionLioncash2018-10-241-3/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #1560 from lioncash/unusedbunnei2018-10-242-2/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | decoders: Remove unused variable within SwizzledData()Lioncash2018-10-241-1/+0
| * | | | | | | | maxwell_3d: Remove unused variable within ProcessQueryGet()Lioncash2018-10-241-1/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #1561 from lioncash/fsbunnei2018-10-242-3/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | vfs: Handle failure of file reading within VfsRawCopy()Lioncash2018-10-241-2/+6
| * | | | | | | | key_manager: Remove unused variable in DeriveBase()Lioncash2018-10-241-1/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #1559 from lioncash/logbunnei2018-10-242-0/+5
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | logging/backend: Add missing services to the log filtersLioncash2018-10-242-0/+5
| |/ / / / / /
* | | | | | | Merge pull request #1468 from DarkLordZach/profile-manager-uiMat M2018-10-2411-118/+742
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | configure_system: Clear current username before overwritingZach Hilman2018-10-242-5/+15
| * | | | | | profile_manager: Create save data if it doesn't exist on useZach Hilman2018-10-244-18/+42
| * | | | | | acc: Fix account UUID duplication errorZach Hilman2018-10-248-80/+106
| * | | | | | configure_system: Clear selection after user deleteZach Hilman2018-10-242-12/+18
| * | | | | | profile_manager: Load user icons, names, and UUIDs from system saveZach Hilman2018-10-2411-133/+308
| * | | | | | acc: Load user images from config dirZach Hilman2018-10-241-9/+45
| * | | | | | qt: Allow user to select emu user on open save dataZach Hilman2018-10-241-3/+24
| * | | | | | qt: Add Profile Manager UI to system settingsZach Hilman2018-10-243-76/+350
| * | | | | | am: Pass current user UUID to launch parametersZach Hilman2018-10-241-7/+9
| * | | | | | profile_manager: Load users from emulator settingsZach Hilman2018-10-242-5/+7
| * | | | | | settings: Add users and current_user settings and remove usernameZach Hilman2018-10-243-6/+54
* | | | | | | Merge pull request #1551 from ogniK5377/improved-svcbreakbunnei2018-10-241-5/+51
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Added assertion failed, reworked logging levelsDavid Marcec2018-10-231-16/+24
| * | | | | | Added break types to svcBreakDavid Marcec2018-10-231-4/+42
* | | | | | | Added Amiibo support (#1390)David2018-10-2412-80/+386
* | | | | | | Merge pull request #1515 from DarkLordZach/dlc-lfsbunnei2018-10-246-16/+97
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | qt: Add support for dumping a DLC Data RomFSZach Hilman2018-10-184-11/+73
| * | | | | | registered_cache: Deduplicate results of ListEntry and ListEntryFilterZach Hilman2018-10-172-2/+16
| * | | | | | fsp_srv: Apply patches to Data storage in OpenDataStorageByDataIdZach Hilman2018-10-171-1/+5
| * | | | | | patch_manager: Add support for using LayeredFS with DataZach Hilman2018-10-171-2/+3
* | | | | | | Merge pull request #1542 from lioncash/projectbunnei2018-10-243-24/+24
|\ \ \ \ \ \ \
| * | | | | | | CMakeLists: Use PROJECT_SOURCE_DIR instead of CMAKE_SOURCE_DIRLioncash2018-10-203-24/+24
* | | | | | | | Merge pull request #1553 from lioncash/membunnei2018-10-244-204/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | CMakeLists: Remove EMU_ARCH_BITS definitionLioncash2018-10-231-4/+0
| * | | | | | | | common: Remove memory_util.cpp/.hLioncash2018-10-233-200/+0
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1540 from lioncash/handlebunnei2018-10-249-100/+97
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | kernel/process: Make the handle table per-processLioncash2018-10-209-100/+97
| |/ / / / / /
* | | | | | | Merge pull request #1552 from FearlessTobi/port-4336bunnei2018-10-232-6/+9
|\ \ \ \ \ \ \
| * | | | | | | cmake: mingw also needs _FILE_OFFSET_BITS=64Weiyi Wang2018-10-231-1/+1
| * | | | | | | only redefine 64 bit file operation for MSVCWeiyi Wang2018-10-231-5/+8
* | | | | | | | Merge pull request #1519 from ReinUsesLisp/vsetpbunnei2018-10-232-75/+108
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_decompiler: Implement VSETPReinUsesLisp2018-10-232-0/+26
| * | | | | | | | gl_shader_decompiler: Abstract VMAD into a video subsetReinUsesLisp2018-10-232-75/+82
* | | | | | | | | Merge pull request #1539 from lioncash/dmabunnei2018-10-233-19/+10
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | engines/maxwell_*: Use nested namespace specifiers where applicableLioncash2018-10-203-12/+6
| * | | | | | | | | maxwell_dma: Make variables const where applicable within HandleCopy()Lioncash2018-10-201-3/+3
| * | | | | | | | | maxwell_dma: Make FlushAndInvalidate's size parameter a u64Lioncash2018-10-201-1/+1
| * | | | | | | | | maxwell_dma: Remove unused variables in HandleCopy()Lioncash2018-10-201-3/+0
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1470 from FernandoS27/alpha_testingbunnei2018-10-237-20/+87
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | Assert that multiple render targets are not set while alpha testingFernandoS272018-10-223-3/+17
| * | | | | | | | Use standard UBO and fix/stylize the codeFernandoS272018-10-228-91/+51
| * | | | | | | | Cache uniform locations and restructure the implementationFernandoS272018-10-223-33/+29
| * | | | | | | | Remove SyncAlphaTest and clang formatFernandoS272018-10-224-8/+9
| * | | | | | | | Added Alpha FuncFernandoS272018-10-222-3/+43
| * | | | | | | | Implemented Alpha TestingFernandoS272018-10-226-3/+59
* | | | | | | | | Merge pull request #1512 from ReinUsesLisp/brkbunnei2018-10-232-22/+43
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | gl_shader_decompiler: Implement PBK and BRKReinUsesLisp2018-10-182-22/+43
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1550 from FernandoS27/fmul32bunnei2018-10-232-3/+8
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | Added Saturation to FMUL32IFernandoS272018-10-232-3/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1543 from lioncash/targetbunnei2018-10-231-1/+1
|\ \ \ \ \ \ \
| * | | | | | | CMakeLists: Use target_compile_definitions instead of add_definitions to define YUZU_ENABLE_COMPATIBILITY_REPORTINGLioncash2018-10-201-1/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1537 from lioncash/shaderbunnei2018-10-231-6/+7
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Allow std::move to function in SetPredicateLioncash2018-10-201-1/+1
| * | | | | | | gl_shader_decompiler: Get rid of variable shadowing warningsLioncash2018-10-201-2/+2
| * | | | | | | gl_shader_decompiler: Fix a few comment typosLioncash2018-10-201-3/+4
| |/ / / / / /
* | | | | | | Merge pull request #1545 from DarkLordZach/psmbunnei2018-10-225-0/+91
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | psm: Stub GetChargerTypeZach Hilman2018-10-222-24/+27
| * | | | | | psm: Stub GetBatteryChargePercentageZach Hilman2018-10-212-1/+14
| * | | | | | service: Add skeleton for psm serviceZach Hilman2018-10-215-0/+75
| |/ / / / /
* | | | | | Merge pull request #1541 from lioncash/definebunnei2018-10-221-1/+1
|\ \ \ \ \ \
| * | | | | | web_service/CMakeLists: Make the CPPHTTPLIB_OPENSSL_SUPPORT constrained to the web_service library onlyLioncash2018-10-201-1/+1
| |/ / / / /
* | | | | | Merge pull request #1538 from lioncash/querybunnei2018-10-221-1/+1
|\ \ \ \ \ \
| * | | | | | svc: Fix vma boundary check in svcQueryMemoryLioncash2018-10-201-1/+1
| |/ / / / /
* | | | | | Merge pull request #1547 from FernandoS27/fix-fsetbunnei2018-10-222-30/+12
|\ \ \ \ \ \
| * | | | | | Fixed FSETP and FSETFernandoS272018-10-222-30/+12
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1546 from lioncash/svc-againbunnei2018-10-2213-53/+255
|\ \ \ \ \ \
| * | | | | | service: Add the basic skeleton for the NPNS servicesLioncash2018-10-214-2/+109
| * | | | | | hid: Update service function table for hidbusLioncash2018-10-211-0/+1
| * | | | | | am: Add the basic skeleton for the tcap serviceLioncash2018-10-214-0/+44
| * | | | | | am: Update service function tablesLioncash2018-10-214-15/+60
| * | | | | | prepo: Update service function table.Lioncash2018-10-211-8/+13
| * | | | | | lbl: Update service function table namesLioncash2018-10-211-28/+28
| |/ / / / /
* | | | | | Merge pull request #1548 from FernandoS27/fix-vaobunnei2018-10-221-2/+14
|\ \ \ \ \ \
| * | | | | | Fixed VAOs Float types only returning GL_FLOAT in cases that they had to return GL_HALF_FLOATFernandoS272018-10-221-2/+14
| |/ / / / /
* | | | | | Merge pull request #1544 from DarkLordZach/reinitialize-keys-toolsbunnei2018-10-221-1/+7
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | qt: Move Reinitialize Keys to Tools menuZach Hilman2018-10-211-1/+7
| |/ / / /
* | | | | Merge pull request #1531 from ogniK5377/hid-fixesbunnei2018-10-212-4/+189
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Added auto controller switching to supported controllers and single joycon button rotationDavid Marcec2018-10-202-4/+189
* | | | | Merge pull request #1535 from ReinUsesLisp/fixup-positionbunnei2018-10-203-13/+9
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | gl_shader_decompiler: Move position varying declaration back to gl_shader_genReinUsesLisp2018-10-203-13/+9
|/ / / /
* | | | Merge pull request #1501 from ReinUsesLisp/half-floatbunnei2018-10-202-0/+458
|\ \ \ \
| * | | | gl_shader_decompiler: Implement HSET2_RReinUsesLisp2018-10-152-0/+62
| * | | | gl_shader_decompiler: Implement HSETP2_RReinUsesLisp2018-10-152-0/+65
| * | | | gl_shader_decompiler: Implement HFMA2 instructionsReinUsesLisp2018-10-152-0/+85
| * | | | gl_shader_decompiler: Implement HADD2_IMM and HMUL2_IMMReinUsesLisp2018-10-152-0/+73
| * | | | gl_shader_decompiler: Implement non-immediate HADD2 and HMUL2 instructionsReinUsesLisp2018-10-152-0/+75
| * | | | gl_shader_decompiler: Setup base for half float unpacking and settingReinUsesLisp2018-10-152-0/+98
* | | | | Merge pull request #1520 from lioncash/sanbunnei2018-10-203-3/+50
|\ \ \ \ \
| * | | | | svc: Add missing sanitizing checks for MapSharedMemory/UnmapSharedMemoryLioncash2018-10-183-3/+50
* | | | | | Merge pull request #1517 from bunnei/dmabunnei2018-10-209-23/+144
|\ \ \ \ \ \
| * | | | | | GPU: Improved implementation of maxwell DMA (Subv).bunnei2018-10-193-17/+66
| * | | | | | decoders: Introduce functions for un/swizzling subrects.bunnei2018-10-192-0/+49
| * | | | | | GPU: Invalidate destination address of kepler_memory writes.bunnei2018-10-193-3/+17
| * | | | | | fermi_2d: Add support for more accurate surface copies.bunnei2018-10-192-3/+12
* | | | | | | Merge pull request #1526 from lioncash/svc-idbunnei2018-10-208-53/+163
|\ \ \ \ \ \ \
| * | | | | | | es: Update service function tablesLioncash2018-10-191-7/+11
| * | | | | | | audio: Update service function tablesLioncash2018-10-191-17/+20
| * | | | | | | omm: Update service function tablesLioncash2018-10-191-16/+18
| * | | | | | | nifm: Update service function tablesLioncash2018-10-191-0/+1
| * | | | | | | hid: Update service function tablesLioncash2018-10-191-6/+45
| * | | | | | | nim: Add the basic skeleton of the nim:eca serviceLioncash2018-10-191-0/+17
| * | | | | | | ns: Update service function tableLioncash2018-10-191-6/+49
| * | | | | | | set_cal: Update service function tableLioncash2018-10-191-1/+2
| |/ / / / / /
* | | | | | | Merge pull request #1530 from DarkLordZach/aoc-8bunnei2018-10-202-1/+16
|\ \ \ \ \ \ \
| * | | | | | | aoc_u: Stub GetAddOnContentListChangedEventZach Hilman2018-10-202-1/+16
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1516 from lioncash/hidbunnei2018-10-2018-19/+33
|\ \ \ \ \ \ \
| * | | | | | | hid/controller: Remove unused header inclusionsLioncash2018-10-189-9/+0
| * | | | | | | hid/controller/npad: Remove unused dump_idx member variableLioncash2018-10-181-1/+0
| * | | | | | | hid/controller/npad: Remove unnecessary semicolon from the closing brace of LedPattern's constructorLioncash2018-10-181-1/+1
| * | | | | | | hid/controller/npad: Remove #pragma once from the cpp fileLioncash2018-10-181-2/+0
| * | | | | | | hid/controller/npad: Move npad_id_list into the cpp fileLioncash2018-10-182-2/+10
| * | | | | | | hid/controller/npad: Remove unnecessary const from void return typeLioncash2018-10-182-2/+2
| * | | | | | | hid/controller: Default the destructors of all controller types in the cpp fileLioncash2018-10-1816-0/+16
| * | | | | | | controller_base: Default the base class constructor and destructor in the cpp fileLioncash2018-10-182-2/+4
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1529 from DarkLordZach/key-derivation-crashMat M2018-10-201-1/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | crypto: Use compressed sizes in offset calculation for KIP decompressionZach Hilman2018-10-201-1/+2
|/ / / / / /
* | | | | | Merge pull request #1525 from ogniK5377/block-homebunnei2018-10-192-4/+36
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Stubbed home blockingDavid Marcec2018-10-192-4/+36
|/ / / / /
* | | | | Merge pull request #1523 from lioncash/lockbunnei2018-10-192-9/+27
|\ \ \ \ \
| * | | | | svc: Check for word alignment of addresses within svcArbitrateLock/svcArbitrateUnlockLioncash2018-10-181-0/+8
| * | | | | common: Add function for checking word alignment to alignment.hLioncash2018-10-181-0/+6
| * | | | | common: Move Is4KBAligned() to alignment.hLioncash2018-10-182-9/+13
* | | | | | Merge pull request #1511 from lioncash/contentbunnei2018-10-192-258/+292
|\ \ \ \ \ \
| * | | | | | content_archive: Simpify assignment of bktr_base_romfs in the constructorLioncash2018-10-161-2/+1
| * | | | | | content_archive: Make IsValidNCA() an internally linked functionLioncash2018-10-162-3/+1
| * | | | | | content_archive: Simplify rights ID checkLioncash2018-10-161-2/+2
| * | | | | | content_archive: Split loading into separate functionsLioncash2018-10-162-253/+290
| * | | | | | content_archive: Pass and take NCASectionHeader instance by referenceLioncash2018-10-162-3/+3
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1521 from ogniK5377/imp-mmubunnei2018-10-191-8/+42
|\ \ \ \ \ \
| * | | | | | Used better names for mm:u and fixed bad stubDavid Marcec2018-10-181-8/+42
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1522 from lioncash/corebunnei2018-10-191-2/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | core: Remove unnecessary assert in ArmInterface()Lioncash2018-10-181-2/+1
|/ / / / /
* | | | | Merge pull request #1510 from lioncash/xcibunnei2018-10-183-7/+8
|\ \ \ \ \
| * | | | | XCI: Add function for checking the existence of the program NCALioncash2018-10-163-7/+8
| | |/ / / | |/| | |
* | | | | Merge pull request #1505 from FernandoS27/tex-3dbunnei2018-10-184-2/+13
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Clang format and other fixesFernandoS272018-10-181-16/+0
| * | | | Implement Reinterpret Surface, to accurately blit 3D texturesFernandoS272018-10-181-2/+4
| * | | | Implement GetInRange in the Rasterizer CacheFernandoS272018-10-181-0/+16
| * | | | Implement 3D TexturesFernandoS272018-10-184-1/+10
* | | | | Merge pull request #1444 from ogniK5377/better-hidbunnei2018-10-1822-648/+1720
|\ \ \ \ \
| * | | | | Using dual joycons as the default controllerDavid Marcec2018-10-173-77/+59
| * | | | | WipDavid Marcec2018-10-122-3/+23
| * | | | | Dynamically decide handheld variant based on supported npad id priorityDavid Marcec2018-10-113-19/+62
| * | | | | Added BeginPermitVibrationSession and EndPermitVibrationSessionDavid Marcec2018-10-103-2/+26
| * | | | | Added GetLedPattern and HandheldVariantDavid Marcec2018-10-103-6/+63
| * | | | | Kirby expects handheld controllers to be at position 8David Marcec2018-10-101-2/+8
| * | | | | Added the ability to "disconnect" individual npadsDavid Marcec2018-10-103-16/+40
| * | | | | Removed unneeded forward declarationsDavid Marcec2018-10-102-13/+2
| * | | | | Addressed changes for better hidDavid Marcec2018-10-1019-167/+238
| * | | | | "Better Hid" rework part 1David Marcec2018-10-1022-644/+1500
* | | | | | Merge pull request #1489 from FernandoS27/fix-tldsbunnei2018-10-181-1/+5
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Fix TLDSFernandoS272018-10-141-1/+5
| | |_|/ / | |/| | |
* | | | | Merge pull request #1497 from bunnei/flush-framebuffersbunnei2018-10-1815-188/+429
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Remove unnecessary block_depth=1 on Flush.bunnei2018-10-181-1/+0
| * | | | | gl_rasterizer_cache: Remove unnecessary temporary buffer with unswizzle.bunnei2018-10-181-5/+2
| * | | | | gl_rasterizer_cache: Use AccurateCopySurface for use_accurate_gpu_emulation.bunnei2018-10-162-2/+18
| * | | | | config: Rename use_accurate_framebuffers -> use_accurate_gpu_emulation.bunnei2018-10-1610-20/+20
| * | | | | rasterizer_cache: Refactor to support in-order flushing.bunnei2018-10-166-63/+116
| * | | | | gl_rasterizer_cache: Refactor to only call GetRegionEnd on surface creation.bunnei2018-10-162-16/+23
| * | | | | gl_rasterizer_cache: Only flush when use_accurate_framebuffers is enabled.bunnei2018-10-162-2/+13
| * | | | | gl_rasterizer_cache: Separate guest and host surface size managment.bunnei2018-10-162-92/+94
| * | | | | gl_rasterizer_cache: Rename GetGLBytesPerPixel to GetBytesPerPixel.bunnei2018-10-162-17/+18
| * | | | | gl_rasterizer_cache: Remove unused FlushSurface method.bunnei2018-10-162-7/+0
| * | | | | gl_rasterizer: Implement flushing.bunnei2018-10-161-1/+25
| * | | | | gl_rasterizer_cache: Remove usage of Memory::Read/Write functions.bunnei2018-10-161-13/+8
| * | | | | gl_rasterizer_cache: Clamp cached surface size to mapped GPU region size.bunnei2018-10-162-19/+37
| * | | | | memory_manager: Add a method for querying the end of a mapped GPU region.bunnei2018-10-162-0/+11
| * | | | | rasterizer_cache: Reintroduce method for flushing.bunnei2018-10-163-0/+23
| * | | | | gl_rasterizer_cache: Reintroduce code for handling swizzle and flush to guest RAM.bunnei2018-10-162-28/+119
| | |_|/ / | |/| | |
* | | | | Merge pull request #1498 from lioncash/aslrbunnei2018-10-184-28/+44
|\ \ \ \ \
| * | | | | svc: Clarify enum values for AddressSpaceBaseAddr and AddressSpaceSize in svcGetInfo()Lioncash2018-10-154-28/+44
* | | | | | Merge pull request #1496 from FernandoS27/tex-arraybunnei2018-10-181-14/+55
|\ \ \ \ \ \
| * | | | | | Implement Arrays on Tex InstructionFernandoS272018-10-141-14/+55
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1509 from DarkLordZach/device-save-databunnei2018-10-181-1/+12
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | savedata_factory: Add TemporaryStorage SaveDataSpaceIdZach Hilman2018-10-161-1/+4
| * | | | | savedata_factory: Add support for DeviceSaveDataZach Hilman2018-10-161-0/+8
* | | | | | Merge pull request #1443 from DarkLordZach/lower-loader-logs-1bunnei2018-10-162-3/+9
|\ \ \ \ \ \
| * | | | | | patch_manager: Move non-Program RomFS patch log to DebugZach Hilman2018-10-131-2/+8
| * | | | | | content_archive: Move get key log to Trace levelZach Hilman2018-10-131-1/+1
* | | | | | | Implement VI ConvertScalingMode (#1475)David2018-10-161-1/+49
* | | | | | | Merge pull request #1502 from lioncash/uniquebunnei2018-10-1612-60/+76
|\ \ \ \ \ \ \
| * | | | | | | core_cpu: Make Cpu scheduler instances unique_ptrs instead of shared_ptrsLioncash2018-10-1510-31/+50
| * | | | | | | core: Make the live Cpu instances unique_ptrs instead of shared_ptrsLioncash2018-10-151-9/+9
| * | | | | | | core: Make the exclusive monitor a unique_ptr instead of a shared_ptrLioncash2018-10-155-15/+13
| * | | | | | | core: Make CPUBarrier a unique_ptr instead of a shared_ptrLioncash2018-10-153-11/+10
* | | | | | | | Merge pull request #1508 from lioncash/unique-regbunnei2018-10-1612-51/+53
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys/registered_cache: Use unique_ptr and regular pointers instead of shared_ptrs where applicableLioncash2018-10-1612-51/+53
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1507 from FearlessTobi/port-4327bunnei2018-10-161-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | travis: Ignore binary files when checking for trailing whitespaceCameron Cawley2018-10-161-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1473 from lioncash/cmakebunnei2018-10-167-199/+214
|\ \ \ \ \ \ \
| * | | | | | | core/CMakeLists: Make all web_service-related libraries privateLioncash2018-10-111-1/+1
| * | | | | | | web_backend: Make Client use the PImpl idiomLioncash2018-10-115-142/+154
| * | | | | | | telemetry_json: Use the PImpl idiom to avoid unnecessary dependency exposureLioncash2018-10-112-49/+55
| * | | | | | | telemetry_json: Add missing override specifier to the destructor of TelemetryJsonLioncash2018-10-111-1/+1
| * | | | | | | telemetry_json: Take std::string parameters by valueLioncash2018-10-112-3/+2
| * | | | | | | telemetry_json: Remove unnecessary includesLioncash2018-10-112-3/+1
| * | | | | | | core/CMakeLists: Use target_compile_definitions instead of add_definitions for specifying ENABLE_WEB_SERVICELioncash2018-10-111-1/+1
* | | | | | | | Merge pull request #1487 from lioncash/maybe-unusedbunnei2018-10-161-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | yuzu/main: Apply the [[maybe_unused]] attribute to the parameter of SetDiscordEnabled()Lioncash2018-10-131-1/+1
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1504 from lioncash/constantbunnei2018-10-161-3/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | file_sys/control_metadata: Get rid of magic constantsLioncash2018-10-161-3/+6
|/ / / / / / / /
* | | | | | | | Merge pull request #1494 from DarkLordZach/aoc-signature-fixesbunnei2018-10-163-3/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | aoc: Read DLC base title ID from RegisteredCacheZach Hilman2018-10-153-2/+18
| * | | | | | | | aoc: Return size in ListAddOnContentZach Hilman2018-10-141-1/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #1499 from lioncash/nrobunnei2018-10-157-28/+39
|\ \ \ \ \ \ \ \
| * | | | | | | | nso: Return an optional address from LoadModuleLioncash2018-10-155-16/+29
| * | | | | | | | nso: Make LoadModule take a VfsFile by const referenceLioncash2018-10-153-11/+9
| * | | | | | | | nro: Make LoadNro take a VfsFile by const referenceLioncash2018-10-152-6/+6
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1500 from DarkLordZach/key-derivation-6.0.0bunnei2018-10-152-4/+8
|\ \ \ \ \ \ \ \
| * | | | | | | | crypto: Various crypto fixes for quickstart guideZach Hilman2018-10-152-4/+8
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1503 from ReinUsesLisp/misc-vcbunnei2018-10-153-7/+6
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | shader_bytecode: Add Control Code enum 0xfReinUsesLisp2018-10-151-1/+1
| * | | | | | | gl_shader_decompiler: Fixup style inconsistenciesReinUsesLisp2018-10-151-5/+3
| * | | | | | | gl_rasterizer: Silence implicit cast warning in glBindBufferRangeReinUsesLisp2018-10-151-1/+2
|/ / / / / / /
* | | | | | | Merge pull request #1486 from lioncash/filebunnei2018-10-144-63/+72
|\ \ \ \ \ \ \
| * | | | | | | partition_data_manager: Reserve and insert data within output vector in DecryptPackage2()Lioncash2018-10-131-20/+16
| * | | | | | | partition_data_manager: Remove unused std::map instance within DecryptPackage2()Lioncash2018-10-131-2/+0
| * | | | | | | partition_data_manager: Take package2_keys by const referenceLioncash2018-10-132-2/+3
| * | | | | | | partition_data_manager: Move IV data to where it's needed in DecryptPackage2()Lioncash2018-10-131-3/+1
| * | | | | | | partition_data_manager: Remove commented out codeLioncash2018-10-131-2/+0
| * | | | | | | key_manager/partition_data_manager: Silence truncation compiler warningsLioncash2018-10-134-10/+15
| * | | | | | | partition_data_manager: Dehardcode array boundsLioncash2018-10-132-7/+12
| * | | | | | | partition_data_manager: Take VirtualFile by const reference in constructorLioncash2018-10-132-2/+2
| * | | | | | | partition_data_manager: Amend constructor initializer list orderLioncash2018-10-131-2/+3
| * | | | | | | partition_data_manager: Remove unused includesLioncash2018-10-132-4/+1
| * | | | | | | key_manager: Use std::vector's insert() instead of std::copy with a back_inserterLioncash2018-10-131-2/+2
| * | | | | | | key_manager: Brace long conditional bodyLioncash2018-10-131-1/+2
| * | | | | | | key_manager: Don't assume file seeks and reads will always succeedLioncash2018-10-131-7/+17
| * | | | | | | key_manager: Remove unnecessary seek in DeriveSDSeed()Lioncash2018-10-131-1/+0
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1490 from lioncash/bootbunnei2018-10-141-14/+12
|\ \ \ \ \ \ \
| * | | | | | | yuzu/main: Simplify OnMenuLoadFile()Lioncash2018-10-131-14/+12
| |/ / / / / /
* | | | | | | Merge pull request #1488 from Hexagon12/astc-typesbunnei2018-10-143-6/+32
|\ \ \ \ \ \ \
| * | | | | | | Added ASTC 5x4; 8x5Hexagon122018-10-133-6/+32
* | | | | | | | Merge pull request #1491 from lioncash/referencebunnei2018-10-147-20/+19
|\ \ \ \ \ \ \ \
| * | | | | | | | filesystem: Make CreateFactories() and InstallInterface() take a VfsFilesystem instance by referenceLioncash2018-10-137-20/+19
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1480 from FernandoS27/neue-swizzlebunnei2018-10-148-107/+176
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | Shorten the implementation of 3D swizzle to only 3 functionsFernandoS272018-10-141-70/+27
| * | | | | | | Fix a Crash on Zelda BotW and Splatoon 2, and simplified LoadGLBufferFernandoS272018-10-132-19/+2
| * | | | | | | Propagate depth and depth_block on modules using decodersFernandoS272018-10-138-54/+67
| * | | | | | | Remove old Swizzle algorithms and use 3d SwizzleFernandoS272018-10-131-93/+69
| * | | | | | | Implement Precise 3D SwizzleFernandoS272018-10-131-3/+71
| * | | | | | | Implement Fast 3D SwizzleFernandoS272018-10-131-2/+74
| |/ / / / / /
* | | | | | | Merge pull request #1492 from lioncash/procbunnei2018-10-143-4/+50
|\ \ \ \ \ \ \
| * | | | | | | svc: Implement svcGetProcessInfoLioncash2018-10-133-4/+50
| |/ / / / / /
* | | | | | | Merge pull request #1495 from ogniK5377/break-stopbunnei2018-10-141-0/+6
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Stop all threads on svcBreakDavid Marcec2018-10-141-0/+6
|/ / / / / /
* | | | | | Merge pull request #1409 from DarkLordZach/key-derivationbunnei2018-10-1311-74/+1663
|\ \ \ \ \ \
| * | | | | | partition_data_manager: Rename system files for hekateZach Hilman2018-10-076-195/+247
| * | | | | | qt: Add rederive keyset menu optionZach Hilman2018-10-073-49/+89
| * | | | | | qt: Add key derivation progress bar on initial setupZach Hilman2018-10-071-0/+52
| * | | | | | crypto: Add PartitionDataManagerZach Hilman2018-10-073-0/+692
| * | | | | | key_manager: Add support for loading keys from partition dataZach Hilman2018-10-072-0/+88
| * | | | | | key_manager: Add ETicket key derivationZach Hilman2018-10-073-2/+277
| * | | | | | key_manager: Add base key derivationZach Hilman2018-10-072-4/+220
| * | | | | | key_manager: Add BIS key getterZach Hilman2018-10-072-2/+19
| * | | | | | key_manager: Add support for more keysZach Hilman2018-10-072-3/+99
| * | | | | | key_manager: Add keyblob supportZach Hilman2018-10-072-0/+14
| * | | | | | key_manager: Add support for crypto revisions past 04Zach Hilman2018-10-071-43/+63
| * | | | | | key_manager: Add support for comments in keyfilesZach Hilman2018-10-071-0/+3
| * | | | | | vfs: Move forward declarations to separate fileZach Hilman2018-10-072-9/+22
| * | | | | | key_manager: Add support for console-specific keyfileZach Hilman2018-10-072-3/+13
| * | | | | | key_manager: Rename KEK to KekZach Hilman2018-10-072-8/+9
| * | | | | | externals/mbedtls: Enable CMAC moduleZach Hilman2018-10-071-0/+0
* | | | | | | Merge pull request #1483 from lioncash/codesetbunnei2018-10-137-83/+45
|\ \ \ \ \ \ \
| * | | | | | | kernel/process: Make CodeSet a regular non-inherited objectLioncash2018-10-127-83/+45
* | | | | | | | Merge pull request #1484 from FernandoS27/calculate-sizebunnei2018-10-132-0/+22
|\ \ \ \ \ \ \ \
| * | | | | | | | Implemented helper function to correctly calculate a texture's sizeFernandoS272018-10-122-0/+22
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1481 from lioncash/typobunnei2018-10-131-3/+3
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | svc: Fix typos in sanitizing checks for MapMemory/UnmapMemoryLioncash2018-10-121-3/+3
| |/ / / / / /
* | | | | | | Merge pull request #1467 from ogniK5377/svcbreak-type-fixbunnei2018-10-122-28/+36
|\ \ \ \ \ \ \
| * | | | | | | Changed all casts in svc_wrap.h to be static_cast insteadDavid Marcec2018-10-101-25/+28
| * | | | | | | Use a better name than "dont_kill_application"David Marcec2018-10-101-2/+2
| * | | | | | | Fixed incorrect types for svcBreakDavid Marcec2018-10-102-3/+8
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1478 from ogniK5377/remap-invalidhandle-remapbunnei2018-10-121-3/+10
|\ \ \ \ \ \ \
| * | | | | | | Returned an error before processing other remapsDavid Marcec2018-10-121-6/+2
| * | | | | | | Passing an invalid nmap handle to Remap should throw an errorDavid Marcec2018-10-111-3/+14
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1482 from lioncash/initbunnei2018-10-121-4/+1
|\ \ \ \ \ \ \
| * | | | | | | thread: Remove unnecessary memset from ResetThreadContext()Lioncash2018-10-121-4/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1479 from ogniK5377/nmap-revampedbunnei2018-10-121-12/+60
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Made the minimum alignment more clearDavid Marcec2018-10-121-2/+3
| * | | | | | Added error codes for nvmapDavid Marcec2018-10-111-12/+59
| |/ / / / /
* | | | | | Merge pull request #1474 from ogniK5377/hwopus-decodeinterleavedwithperformancebunnei2018-10-111-3/+34
|\ \ \ \ \ \
| * | | | | | HwOpus, Implemented DecodeInterleavedWithPerformanceDavid Marcec2018-10-111-3/+34
| |/ / / / /
* | | | | | Merge pull request #1472 from lioncash/sanbunnei2018-10-112-12/+81
|\ \ \ \ \ \
| * | | | | | svc: Add missing address range sanitizing checks to MapMemory/UnmapMemoryLioncash2018-10-112-12/+81
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1476 from bunnei/fix-unmap-flushbunnei2018-10-111-3/+4
|\ \ \ \ \ \
| * | | | | | nvhost_as_gpu: Flush CPU VAddr on UnmapBuffer.bunnei2018-10-111-3/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1477 from ReinUsesLisp/vmadbunnei2018-10-112-0/+118
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_decompiler: Implement VMADReinUsesLisp2018-10-112-0/+118
|/ / / / /
* | | | | Merge pull request #1458 from FernandoS27/fix-render-target-block-settingsbunnei2018-10-115-18/+81
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add memory Layout to Render Targets and Depth BuffersFernandoS272018-10-103-21/+33
| * | | | Fixed block height settings for RenderTargets and Depth Buffers, and added block width and block depthFernandoS272018-10-105-12/+63
* | | | | Merge pull request #1460 from FernandoS27/scissor_testbunnei2018-10-103-1/+36
|\ \ \ \ \
| * | | | | Implement Scissor TestFernandoS272018-10-091-4/+9
| * | | | | Assert Scissor testsFernandoS272018-10-093-1/+31
| |/ / / /
* | | | | Merge pull request #1425 from ReinUsesLisp/geometry-shadersbunnei2018-10-1011-120/+543
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Move position varying location from 15 to 0 and apply an offsetReinUsesLisp2018-10-071-6/+10
| * | | | | gl_shader_decompiler: Implement geometry shadersReinUsesLisp2018-10-0710-107/+522
| * | | | | video_core: Allow LabelGLObject to use extra info on any objectReinUsesLisp2018-10-071-10/+14
| | |_|/ / | |/| | |
* | | | | Merge pull request #1469 from lioncash/ptrbunnei2018-10-1010-39/+41
|\ \ \ \ \
| * | | | | kernel/thread: Use a regular pointer for the owner/current processLioncash2018-10-1010-39/+41
|/ / / / /
* | | | | Merge pull request #1461 from lioncash/warnbunnei2018-10-101-3/+3
|\ \ \ \ \
| * | | | | ips_layer: Silence truncation and conversion warningsLioncash2018-10-091-3/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #1464 from lioncash/uniquebunnei2018-10-107-21/+18
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | patch_manager: Return a std::unique_ptr from ParseControlNCA() and GetControlMetadata() instead of a std::shared_ptrLioncash2018-10-097-21/+18
| |/ / /
* | | | Merge pull request #1466 from lioncash/unusedbunnei2018-10-101-7/+3
|\ \ \ \
| * | | | gl_shader_decompiler: Remove unused variables in TMML's implementationLioncash2018-10-091-7/+3
| |/ / /
* | | | Merge pull request #1463 from FearlessTobi/port-4310bunnei2018-10-104-10/+131
|\ \ \ \
| * | | | implemented touch in Qt and SDLNeatNit2018-10-094-10/+131
| |/ / /
* | | | Merge pull request #1459 from ogniK5377/breakbunnei2018-10-091-5/+20
|\ \ \ \
| * | | | Added bitfield instead of manually checking if the bit is setDavid Marcec2018-10-091-4/+12
| * | | | Actual kill execution when the bit isn't set, not the other way aroundDavid Marcec2018-10-091-1/+1
| * | | | svcBreak, Signalling to the debugger should not kill executionDavid Marcec2018-10-091-5/+12
* | | | | Merge pull request #1465 from lioncash/telemetrybunnei2018-10-092-7/+9
|\ \ \ \ \
| * | | | | telemetry_session: Remove doxygen comment for a non-existent parameterLioncash2018-10-091-1/+0
| * | | | | telemetry_session: Add missing includesLioncash2018-10-092-2/+5
| * | | | | telemetry_session: Remove unimplemented FinalizeAsyncJob prototypeLioncash2018-10-091-2/+0
| * | | | | telemetry_session: Use a std::array in GenerateTelemetryId()Lioncash2018-10-091-2/+4
| | |/ / / | |/| | |
* | | | | Merge pull request #1462 from lioncash/movebunnei2018-10-092-20/+60
|\ \ \ \ \
| * | | | | ips_layer: Avoid constructing std::vector instances where not necessaryLioncash2018-10-091-6/+25
| * | | | | ips_layer: Remove unnecessary explicit std::pair constructor in std::arrayLioncash2018-10-091-5/+13
| * | | | | ips_layer: Add missing includesLioncash2018-10-092-7/+17
| * | | | | ips_layer: std::move data within PatchIPS() and Apply()Lioncash2018-10-091-2/+5
| |/ / / /
* | | | | Merge pull request #1455 from ogniK5377/smo-softlockfixbunnei2018-10-092-15/+123
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | EffectOutStatus padding is now in hexDavid Marcec2018-10-091-1/+1
| * | | | Fixups for softlockDavid Marcec2018-10-072-6/+7
| * | | | Fixed missing returnDavid Marcec2018-10-071-1/+1
| * | | | Fixed smo softlockDavid Marcec2018-10-072-13/+120
* | | | | Merge pull request #1423 from DarkLordZach/romfs-file-extsbunnei2018-10-085-10/+38
|\ \ \ \ \
| * | | | | patch_manager: Avoid romfs_ext requirement for patchingZach Hilman2018-10-041-4/+1
| * | | | | fsmitm_romfsbuild: Extract stubs and IPS to romfs_ext dirZach Hilman2018-10-045-21/+38
| * | | | | fsmitm_romfsbuild: Add support for stubbing and IPS patches in LFSZach Hilman2018-10-041-0/+14
* | | | | | Merge pull request #1424 from DarkLordZach/ips-witchbunnei2018-10-086-23/+323
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | ips_layer: Fix inaccuracies with comments and flagsZach Hilman2018-10-043-16/+51
| * | | | | ips_layer: Deduplicate resource usageZach Hilman2018-10-045-33/+39
| * | | | | ips_layer: Add support for escape sequences and midline commentsZach Hilman2018-10-043-8/+41
| * | | | | patch_manager: Add support for IPSwitch format patchesZach Hilman2018-10-041-22/+56
| * | | | | ips_layer: Add IPSwitchCompiler to process IPSwitch formatZach Hilman2018-10-042-0/+168
| * | | | | hex_util: Add HexVectorToString and HexStringToVectorZach Hilman2018-10-042-0/+24
| |/ / / /
* | | | | Merge pull request #1456 from ogniK5377/aoc-u-fixupsbunnei2018-10-081-5/+5
|\ \ \ \ \
| * | | | | Fixed assertion due to CountAddOnContentDavid Marcec2018-10-071-5/+5
| | |_|/ / | |/| | |
* | | | | Merge pull request #1457 from ogniK5377/unmap-bufferbunnei2018-10-081-1/+6
|\ \ \ \ \
| * | | | | Unmapping an unmapped buffer should succeedDavid Marcec2018-10-081-1/+6
| |/ / / /
* | | | | Merge pull request #1419 from DarkLordZach/homebrew-argsbunnei2018-10-0810-11/+84
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | nso/nro: Use default allocation size for arg_dataZach Hilman2018-10-074-14/+20
| * | | | cmd: Support passing game arguments from command lineZach Hilman2018-10-074-10/+14
| * | | | qt: Add UI option to configure argumentsZach Hilman2018-10-073-0/+27
| * | | | settings: Add program_args string settingZach Hilman2018-10-071-0/+1
| * | | | nso/nro: Add NSO arguments structure to data sectionZach Hilman2018-10-074-3/+38
|/ / / /
* | | | Merge pull request #1396 from DarkLordZach/packed-updatesbunnei2018-10-0716-21/+143
|\ \ \ \
| * | | | romfs_factory: Extract packed update setter to new functionZach Hilman2018-10-0510-9/+38
| * | | | patch_manager: Add support for NSP packed updatesZach Hilman2018-10-052-3/+10
| * | | | game_list: Add XCI update versioning to game listZach Hilman2018-10-051-4/+8
| * | | | patch_manager: Add support for packed updatesZach Hilman2018-10-054-5/+18
| * | | | loader: Add getter for packed updateZach Hilman2018-10-056-3/+58
| * | | | loader: Add ReadRomFSIVFCOffset to NSP, XCI, and NAX loadersZach Hilman2018-10-056-6/+20
| |/ / /
* | | | Merge pull request #1446 from bunnei/fast_fermi_copybunnei2018-10-0710-40/+121
|\ \ \ \
| * | | | yuzu/yuzu_cmd: Add checks for required extension ARB_copy_image.bunnei2018-10-062-0/+4
| * | | | fermi_2d: Implement simple copies with AccelerateSurfaceCopy.bunnei2018-10-063-24/+36
| * | | | gl_rasterizer: Add rasterizer cache code to handle accerated fermi copies.bunnei2018-10-065-16/+60
| * | | | gl_rasterizer_cache: Implement a simpler surface copy using glCopyImageSubData.bunnei2018-10-061-0/+21
* | | | | Merge pull request #1437 from FernandoS27/tex-mode2bunnei2018-10-076-69/+265
|\ \ \ \ \
| * | | | | Implemented Depth Compare and Shadow SamplersFernandoS272018-10-066-65/+224
| * | | | | Implemented Texture Processing Modes in TEXS and TLDSFernandoS272018-10-031-5/+42
* | | | | | Merge pull request #1453 from FearlessTobi/port-4311bunnei2018-10-071-1/+1
|\ \ \ \ \ \
| * | | | | | Remove "#" in the version numberfearlessTobi2018-10-061-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1451 from FearlessTobi/port-4140bunnei2018-10-075-19/+119
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | citra_qt/configuration: misc input tab improvementszhupengfei2018-10-065-19/+119
| |/ / / /
* | | | | Merge pull request #1450 from FearlessTobi/port-4312Mat M2018-10-071-0/+0
|\ \ \ \ \
| * | | | | Update fmt to 5.2.1Weiyi Wang2018-10-061-0/+0
| |/ / / /
* | | | | Merge pull request #1448 from ogniK5377/frontend-accessbunnei2018-10-074-0/+26
|\ \ \ \ \
| * | | | | Added forward define for ServerPortDavid Marcec2018-10-062-4/+6
| * | | | | Ported #4296 from citraDavid Marcec2018-10-063-1/+25
* | | | | | Merge pull request #1454 from ReinUsesLisp/fixup-drawMat M2018-10-071-0/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | gl_rasterizer: Fixup undefined behaviour in SetupDrawReinUsesLisp2018-10-071-0/+1
* | | | | | Merge pull request #1452 from FearlessTobi/port-4313Mat M2018-10-061-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | CONTRIBUTING.md - remove note about casting numeric typesNeatNit2018-10-061-1/+1
|/ / / / /
* | | | | Merge pull request #1449 from lioncash/linkbunnei2018-10-062-2/+2
|\ \ \ \ \
| * | | | | qt: Update telemetry linksLioncash2018-10-062-2/+2
|/ / / / /
* | | | | Merge pull request #1332 from FearlessTobi/port-web-backendbunnei2018-10-0655-40/+21635
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Review comments - part 5fearlessTobi2018-10-024-8/+7
| * | | | Review comments -part 4fearlessTobi2018-10-024-9/+7
| * | | | Review comments - part 3fearlessTobi2018-10-027-26/+8
| * | | | web_backend: protect jwt cache with a mutexWeiyi Wang2018-10-022-1/+4
| * | | | Address more review commentsfearlessTobi2018-10-022-5/+5
| * | | | Address a bunch of review commentsfearlessTobi2018-10-0211-19/+27
| * | | | Port web_service from CitrafearlessTobi2018-10-0245-39/+1575
| * | | | Add submodulesfearlessTobi2018-10-0211-0/+20069
| | |/ / | |/| |
* | | | Merge pull request #1447 from lioncash/mutexbunnei2018-10-061-1/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | kernel/mutex: Amend behavior of TransferMutexOwnership()Lioncash2018-10-061-1/+1
|/ / /
* | | Merge pull request #1440 from lioncash/arraybunnei2018-10-063-5/+10
|\ \ \
| * | | ui_settings: Place definition of the theme array within the cpp fileLioncash2018-10-043-5/+10
* | | | Merge pull request #1438 from ReinUsesLisp/quadsbunnei2018-10-068-46/+236
|\ \ \ \
| * | | | gl_rasterizer: Implement quads topologyReinUsesLisp2018-10-048-46/+236
* | | | | Merge pull request #1445 from lioncash/schedbunnei2018-10-062-4/+4
|\ \ \ \ \
| * | | | | thread: Make the scheduler pointer a regular pointerbalika0112018-10-052-4/+4
|/ / / / /
* | | | | Merge pull request #1439 from lioncash/threadbunnei2018-10-0515-227/+418
|\ \ \ \ \
| * | | | | kernel/thread: Make all instance variables privateLioncash2018-10-0415-227/+418
| | |/ / / | |/| | |
* | | | | Merge pull request #1442 from lioncash/formatbunnei2018-10-051-1/+1
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | text_formatter: Avoid unnecessary string temporary creation in PrintMessage()Lioncash2018-10-051-1/+1
| |/ / /
* | | | Merge pull request #1415 from DarkLordZach/ipsbunnei2018-10-049-40/+258
|\ \ \ \
| * | | | nso: Optimize loading of IPS patchesZach Hilman2018-10-025-51/+43
| * | | | deconstructed_rom_directory: Force NSO loader to patch NSOsZach Hilman2018-10-011-1/+3
| * | | | nso: Add framework to support patching of uncompressed NSOsZach Hilman2018-10-012-2/+17
| * | | | patch_manager: Add PatchNSO functionZach Hilman2018-10-013-0/+104
| * | | | patch_manager: Use strings for patch type instead of enumZach Hilman2018-10-013-33/+36
| * | | | file_sys: Implement function to apply IPS patchesZach Hilman2018-10-012-0/+103
| * | | | nso: Replace NSOHeader padding bytes with build IDZach Hilman2018-10-011-2/+1
| | |_|/ | |/| |
* | | | Merge pull request #1434 from DarkLordZach/dlc-edge-casebunnei2018-10-041-1/+1
|\ \ \ \
| * | | | aoc_u: Fix edge case with DLC that causes breaksZach Hilman2018-10-031-1/+1
| |/ / /
* | | | Merge pull request #1428 from lioncash/qtbunnei2018-10-041-21/+23
|\ \ \ \
| * | | | configure_graphics: Make functions internally linked where applicableLioncash2018-10-031-21/+23
| | |/ / | |/| |
* | | | Merge pull request #1431 from lioncash/audiobunnei2018-10-042-16/+34
|\ \ \ \
| * | | | configure_audio: Move combo box index setting to their own functionsLioncash2018-10-032-11/+25
| * | | | configure_audio: Use QString::fromStdString() for converting audio device namesLioncash2018-10-031-3/+3
| * | | | configure_audio: Add disambiguation comment for the volume percentage stringLioncash2018-10-032-4/+8
| |/ / /
* | | | Merge pull request #1433 from lioncash/fsbunnei2018-10-041-0/+2
|\ \ \ \
| * | | | services/fsp_srv: Amend service function tableLioncash2018-10-031-0/+2
| |/ / /
* | | | Merge pull request #1429 from lioncash/translatebunnei2018-10-041-3/+3
|\ \ \ \
| * | | | configure_input: Make analog mapping strings translatableLioncash2018-10-031-3/+3
| |/ / /
* | | | Merge pull request #1436 from lioncash/viewbunnei2018-10-042-73/+101
|\ \ \ \
| * | | | submission_package: Avoid dangling std::string_view within SetTicketKeys()Lioncash2018-10-031-2/+5
| * | | | submission_package: Correct location of null check within SetTicketKeys()Lioncash2018-10-031-3/+6
| * | | | submission_package: Use std::string's rfind() when looking for the extension in InitializeExeFSAndRomFS()Lioncash2018-10-031-1/+1
| * | | | submission_package: Ensure the 'extracted' member variable is always initializedLioncash2018-10-032-3/+1
| * | | | submission_package: Move ExeFS and RomFS initialization to its own functionLioncash2018-10-032-10/+18
| * | | | submission_package: Move NCA reading code to its own functionLioncash2018-10-032-43/+48
| * | | | submission_package: Move ticket key setting to its own functionLioncash2018-10-031-21/+28
| * | | | submission_package: Invert conditionals within NSP's constructor to reduce nestingLioncash2018-10-031-45/+49
| |/ / /
* | | | Merge pull request #1432 from lioncash/lblbunnei2018-10-041-19/+19
|\ \ \ \
| * | | | service/lbl: Update service function tableLioncash2018-10-031-19/+19
| | |/ / | |/| |
* | | | Merge pull request #1426 from FearlessTobi/port-4253bunnei2018-10-044-158/+7
|\ \ \ \
| * | | | string_util: unify UTF8<->UTF16 conversion to codecvtWeiyi Wang2018-10-022-117/+6
| * | | | string_util: remove TString conversion for windowsWeiyi Wang2018-10-022-19/+1
| * | | | string_util: remove ShiftJIS/CP1252 conversion functionWeiyi Wang2018-10-022-22/+0
| |/ / /
* | | | Merge pull request #1435 from lioncash/xcibunnei2018-10-041-1/+3
|\ \ \ \ | |/ / / |/| | |
| * | | card_image: Ensure program_nca_status is always initializedLioncash2018-10-031-1/+3
| |/ /
* | | Merge pull request #1407 from DarkLordZach/dlcbunnei2018-10-015-34/+145
|\ \ \ | |_|/ |/| |
| * | aoc_u: Extract AccumulateAOCTitleIDs to separate functionZach Hilman2018-10-012-21/+28
| * | aoc_u: Implement GetAddOnContentBaseIdZach Hilman2018-10-013-5/+8
| * | aoc_u: Implement Count, List and Prepare AddOnContentZach Hilman2018-10-012-3/+78
| * | romfs_factory: Read from all locations with StorageId NoneZach Hilman2018-10-011-26/+25
| * | patch_manager: Add DLC recognition to PatchManagerZach Hilman2018-10-012-0/+27
* | | Merge pull request #1422 from ReinUsesLisp/fixup-pointsbunnei2018-10-011-1/+4
|\ \ \ | |_|/ |/| |
| * | gl_rasterizer: Fixup unassigned point sizesReinUsesLisp2018-10-011-1/+4
|/ /
* | Merge pull request #1330 from raven02/tldsbunnei2018-10-011-7/+15
|\ \
| * | Fix trailing whitespaceraven022018-09-301-1/+4
| * | Merge branch 'master' into tldsraven022018-09-19164-1068/+1657
| |\ \
| * | | Add 1D sampler for TLDS - TexelFetch (Mario Rabbids)raven022018-09-171-7/+12
* | | | Merge pull request #1420 from MerryMage/dynarmicbunnei2018-10-011-0/+0
|\ \ \ \
| * | | | externals: Update dynarmic to 4e6848dMerryMage2018-09-301-0/+0
* | | | | Merge pull request #1322 from bunnei/tex-cubemapbunnei2018-10-015-129/+355
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Fixes to how we do render to cubemap.bunnei2018-09-302-32/+5
| * | | | | gl_rasterizer_cache: Add check for array rendering to cubemap texture.bunnei2018-09-301-0/+8
| * | | | | gl_rasterizer_cache: Implement render to cubemap.bunnei2018-09-303-119/+218
| * | | | | gl_shader_decompiler: TEXS: Implement TextureType::TextureCube.bunnei2018-09-301-0/+8
| * | | | | gl_rasterizer_cache: Add support for SurfaceTarget::TextureCubemap.bunnei2018-09-302-1/+36
| * | | | | gl_rasterizer_cache: Implement LoadGLBuffer for Texture2DArray.bunnei2018-09-301-0/+8
| * | | | | gl_rasterizer_cache: Update BlitTextures to support non-Texture2D ColorTexture surfaces.bunnei2018-09-301-23/+88
| * | | | | gl_rasterizer_cache: Track texture target and depth in the cache.bunnei2018-09-301-2/+3
| * | | | | gl_rasterizer_cache: Workaround for Texture2D -> Texture2DArray scenario.bunnei2018-09-303-6/+21
| * | | | | gl_rasterizer_cache: Keep track of surface 2D size separately from total size.bunnei2018-09-302-32/+46
| |/ / / /
* | | | | Merge pull request #1403 from DarkLordZach/install-sysnandbunnei2018-10-011-4/+14
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | qt: Install System TitleTypes to System NANDZach Hilman2018-09-271-4/+14
* | | | | Merge pull request #1338 from raven02/service_vibunnei2018-09-301-1/+19
|\ \ \ \ \
| * | | | | Implement ISystemDisplayService::GetDisplayModeraven022018-09-301-1/+19
* | | | | | Merge pull request #1417 from lioncash/contextbunnei2018-09-3022-82/+183
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | kernel/svc: Implement svcGetThreadContext()Lioncash2018-09-303-2/+37
| * | | | | kernel/process: Add a data member to determine if a process is 64-bit or not.Lioncash2018-09-302-0/+11
| * | | | | kernel/process: Make data member variables privateLioncash2018-09-3018-75/+120
| * | | | | arm_interface: Add missing fpsr/tpidr members to the ThreadContext structLioncash2018-09-303-5/+15
* | | | | | Merge pull request #1418 from FearlessTobi/port-4269Merry2018-09-301-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | OSX: Set MACOSX_DEPLOYMENT_TARGET to 10.13B3n302018-09-301-1/+1
* | | | | | Merge pull request #1414 from lioncash/refbunnei2018-09-2918-42/+28
|\ \ \ \ \ \
| * | | | | | loader: Make the Load() function take a process as a regular reference, not a SharedPtrLioncash2018-09-2918-42/+28
|/ / / / / /
* | | | | | Merge pull request #1388 from FearlessTobi/port-4258bunnei2018-09-291-0/+4
|\ \ \ \ \ \
| * | | | | | Meta: Add gitattributes fileJames Rowe2018-09-221-0/+4
* | | | | | | Merge pull request #1412 from lioncash/movebunnei2018-09-292-3/+2
|\ \ \ \ \ \ \
| * | | | | | | kernel/object: Remove unnecessary std::move from DynamicObjectCast()Lioncash2018-09-282-3/+2
* | | | | | | | Merge pull request #1411 from ReinUsesLisp/point-sizebunnei2018-09-295-1/+27
|\ \ \ \ \ \ \ \
| * | | | | | | | video_core: Implement point_size and add point state syncReinUsesLisp2018-09-285-1/+27
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1406 from ReinUsesLisp/multibind-samplersbunnei2018-09-295-8/+25
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_state: Pack sampler bindings into a single ARB_multi_bindReinUsesLisp2018-09-285-8/+25
* | | | | | | | | Merge pull request #1395 from lioncash/vmbunnei2018-09-2918-160/+418
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | memory: Dehardcode the use of fixed memory range constantsLioncash2018-09-2511-75/+60
| * | | | | | | | svc: Report correct memory-related values within some of the cases in svcGetInfo()Lioncash2018-09-253-28/+41
| * | | | | | | | memory: Dehardcode the use of a 36-bit address spaceLioncash2018-09-256-22/+61
| * | | | | | | | process/vm_manager: Amend API to allow reading parameters from NPDM metadataLioncash2018-09-2410-38/+259
* | | | | | | | | Merge pull request #1360 from FearlessTobi/port-3979bunnei2018-09-273-35/+51
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | game_list: move SearchField to game_list_p.h and fix untranslated textzhupengfei2018-09-213-35/+51
* | | | | | | | | | Merge pull request #1394 from lioncash/streambunnei2018-09-275-12/+12
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | stream: Preserve enum class type in GetState()Lioncash2018-09-245-12/+12
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1389 from PhiBabin/valgrindMat M2018-09-271-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | FPCR register was uninitialized at start upPhilippe Babin2018-09-231-1/+1
* | | | | | | | | | Merge pull request #1397 from spycrab/cmake_binbunnei2018-09-271-2/+0
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | CMake: Remove superfluous CMAKE_RUNTIME_OUTPUT_DIRECTORY assignmentspycrab2018-09-251-2/+0
* | | | | | | | | | | Merge pull request #1377 from FernandoS27/faster-swizzlebunnei2018-09-271-51/+66
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Reverse stride align restriction on FastSwizzle due to lost performanceFernandoS272018-09-211-3/+2
| * | | | | | | | | | | Join both Swizzle methods within one interface functionFernandoS272018-09-211-11/+19
| * | | | | | | | | | | Standarized Legacy Swizzle to look alike FastSwizzle and use a Swizzling Table insteadFernandoS272018-09-211-42/+38
| * | | | | | | | | | | Remove same output bpp restriction on FastSwizzleFernandoS272018-09-211-4/+5
| * | | | | | | | | | | Improved Legacy Swizzler to be better documented and work betterFernandoS272018-09-211-15/+21
| * | | | | | | | | | | Improved fast swizzle and removed restrictions to itFernandoS272018-09-211-7/+12
* | | | | | | | | | | | Merge pull request #1404 from lioncash/vfsbunnei2018-09-271-14/+13
|\ \ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | fsmitm_romfsbuild: std::move std::vector instances in Build()Lioncash2018-09-261-2/+2
| * | | | | | | | | | | fsmitm_romfsbuild: Replace manual value aligning with Common::AlignUp()Lioncash2018-09-261-12/+11
|/ / / / / / / / / / /
* | | | | | | | | | | Merge pull request #1399 from lioncash/schedbunnei2018-09-264-14/+14
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | core_cpu: Make arm_interface instances a std::unique_ptrLioncash2018-09-252-4/+4
| * | | | | | | | | | | kernel/scheduler: Take ARM_Interface instance by reference in the constructorLioncash2018-09-253-10/+10
| | |_|/ / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1400 from lioncash/headerbunnei2018-09-265-1/+7
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | service: Add missing headers inclusions where applicableLioncash2018-09-255-1/+7
* | | | | | | | | | | | Merge pull request #1402 from ReinUsesLisp/assertsbunnei2018-09-265-3/+92
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | video_core: Add asserts for CS, TFB and alpha testingReinUsesLisp2018-09-265-3/+92
| | |_|_|_|_|_|_|_|/ / / | |/| | | | | | | | | |
* | | | | | | | | | | | Merge pull request #1401 from lioncash/vfsbunnei2018-09-2615-175/+172
|\ \ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | | patch_manager: Invert conditionals within ApplyLayeredFS()Lioncash2018-09-261-27/+30
| * | | | | | | | | | | | vfs_vector: Amend initializer list order in VectorVfsFile's constructor initializer listLioncash2018-09-261-1/+1
| * | | | | | | | | | | | fsmitm_romfsbuild: Avoid type truncation warningsLioncash2018-09-261-7/+10
| * | | | | | | | | | | | fsmitm_romfsbuild: Remove unnecessary constructors and initializers for RomFSBuildFileContext and RomFSBuildDirectoryContextLioncash2018-09-261-5/+3
| * | | | | | | | | | | | fsmitm_romfsbuild: Remove unnecessary loops in Build()Lioncash2018-09-261-6/+0
| * | | | | | | | | | | | fsmitm_romfsbuild: Make auto variable into a std::size_t variable within Build()Lioncash2018-09-261-1/+1
| * | | | | | | | | | | | yuzu/main: Resolve precedence bug within CalculateRomFSEntrySize()Lioncash2018-09-261-1/+1
| * | | | | | | | | | | | yuzu/main: Move functions stored into static std::function instances out of OnGameListDumpRomFS()Lioncash2018-09-261-42/+42
| * | | | | | | | | | | | vfs/etc: Append std:: to size_t usagesLioncash2018-09-267-29/+30
| * | | | | | | | | | | | vfs_concat/vfs_layered: Remove friend declarations from ConcatenatedVfsFileLioncash2018-09-268-61/+59
| * | | | | | | | | | | | vfs_static: Remove template byte parameter from StaticVfsFileLioncash2018-09-254-42/+42
| |/ / / / / / / / / / /
* | | | | | | | | | | | Merge pull request #1398 from lioncash/macosbunnei2018-09-261-1/+1
|\ \ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / / |/| | | | | | | | | | |
| * | | | | | | | | | | travis: Make macOS builds utilize Xcode 10Lioncash2018-09-251-1/+1
| | |/ / / / / / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1365 from DarkLordZach/lfsbunnei2018-09-2531-36/+1203
|\ \ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | fsmitm: Cleanup and modernize fsmitm portZach Hilman2018-09-2422-378/+378
| * | | | | | | | | | qt: Add UI elements for LayeredFS and related toolsZach Hilman2018-09-226-5/+162
| * | | | | | | | | | romfs: Implement CreateRomFSZach Hilman2018-09-222-4/+25
| * | | | | | | | | | file_sys: Port Atmosphere-NX fs_mitm implementationZach Hilman2018-09-222-0/+474
| * | | | | | | | | | filesystem: Add LayeredFS VFS directory getterZach Hilman2018-09-222-1/+14
| * | | | | | | | | | bis_factory: Add mod directory VFS getterZach Hilman2018-09-223-3/+18
| * | | | | | | | | | patch_manager: Add LayeredFS mods supportZach Hilman2018-09-222-1/+44
| * | | | | | | | | | vfs_concat: Rewrite and fix ConcatenatedVfsFileZach Hilman2018-09-222-14/+59
| * | | | | | | | | | vfs_layered: Add LayeredVfsDirectoryZach Hilman2018-09-222-0/+178
| * | | | | | | | | | vfs_vector: Add VectorVfsFileZach Hilman2018-09-222-0/+75
| * | | | | | | | | | vfs_static: Add StaticVfsFileZach Hilman2018-09-222-0/+78
| * | | | | | | | | | vfs: Add and rewite VfsRawCopy functionsZach Hilman2018-09-222-6/+36
| * | | | | | | | | | vfs: Add GetEntries methodZach Hilman2018-09-224-0/+32
| * | | | | | | | | | common_paths: Add Load and Dump dirsZach Hilman2018-09-223-0/+6
* | | | | | | | | | | Merge pull request #1393 from tech4me/svcbunnei2018-09-251-7/+7
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | svc: Updated svc namestech4me2018-09-241-7/+7
* | | | | | | | | | | Implemented fatal:u properly (#1347)David2018-09-243-4/+140
* | | | | | | | | | | Stubbed IRS (#1349)David2018-09-244-18/+169
* | | | | | | | | | | Merge pull request #1354 from ogniK5377/ssl-versionbunnei2018-09-241-3/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|_|/ / / / / / |/| | | | | | | | | |
| * | | | | | | | | | Corrected SSL::SetInterfaceVersionDavid Marcec2018-09-191-3/+3
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Added glObjectLabels for renderdoc for textures and shader programs (#1384)David2018-09-234-0/+48
* | | | | | | | | | Merge pull request #1387 from FearlessTobi/port-4245bunnei2018-09-231-8/+0
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | common/thread: remove YieldCPU()Weiyi Wang2018-09-221-8/+0
| | |_|_|_|_|_|/ / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1385 from FearlessTobi/port-4214bunnei2018-09-231-2/+6
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | Port citra-emu/citra#4214: "Set citra-qt project as default StartUp Project in Visual Studio"fearlessTobi2018-09-221-2/+6
* | | | | | | | | | | Merge pull request #1391 from ogniK5377/GetAudioRendererStatebunnei2018-09-235-1/+21
|\ \ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | | Added audren:u#GetAudioRendererStateDavid Marcec2018-09-235-1/+21
| | |_|_|_|_|/ / / / / | |/| | | | | | | | |
* | | | | | | | | | | Merge pull request #1392 from greggameplayer/correct-BC6Hbunnei2018-09-231-2/+2
|\ \ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / / |/| | | | | | | | | |
| * | | | | | | | | | correct BC6Hgreggameplayer2018-09-231-2/+2
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1378 from lioncash/threadbunnei2018-09-235-100/+145
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | svc: Move most process termination code to its own function within ProcessLioncash2018-09-213-32/+56
| * | | | | | | | | thread/process: Move TLS slot marking/freeing to the process classLioncash2018-09-214-68/+89
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1386 from jroweboy/oopsJames Rowe2018-09-221-0/+10
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | Build: Reintroduce Appveyor deployJames Rowe2018-09-221-0/+10
|/ / / / / / / /
* | | | | | | | Merge pull request #1380 from lioncash/constbunnei2018-09-221-8/+19
|\ \ \ \ \ \ \ \
| * | | | | | | | shader_bytecode: Lay out the Ipa-related enums betterLioncash2018-09-211-2/+12
| * | | | | | | | shader_bytecode: Make operator== and operator!= of IpaMode const qualifiedLioncash2018-09-211-6/+7
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1382 from lioncash/incbunnei2018-09-222-4/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_state: Remove unused type aliasLioncash2018-09-222-4/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1376 from Subv/timestretch_tracebunnei2018-09-221-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Logging: Change the TimeStretch::Process log from debug to trace level.Subv2018-09-211-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1381 from valentinvanelslande/patch-1bunnei2018-09-221-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Update config.cppValentin Vanelslande2018-09-211-1/+1
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1383 from DarkLordZach/game-list-interpolationJames Rowe2018-09-221-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | game_list: Add Qt SmoothTransformation to picture scalingZach Hilman2018-09-221-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1379 from lioncash/bitwisebunnei2018-09-211-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | gl_stream_buffer: Fix use of bitwise OR instead of logical OR in Map()Lioncash2018-09-211-1/+1
| |/ / / / /
* | | | | | Added support for uncompressed NSOs (#1374)David2018-09-211-3/+12
* | | | | | Merge pull request #1225 from tech4me/travis-windowsJames Rowe2018-09-2112-16/+273
|\ \ \ \ \ \
| * | | | | | Update MinGWCross.cmake to lowercasetech4me2018-09-191-40/+40
| * | | | | | travis: running mingw build on travis citech4me2018-09-1912-16/+273
* | | | | | | Merge pull request #1337 from DarkLordZach/create-fs-cmdbunnei2018-09-211-1/+3
|\ \ \ \ \ \ \
| * | | | | | | yuzu-cmd: Add call to CreateFactoriesZach Hilman2018-09-191-1/+3
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1372 from lioncash/threadbunnei2018-09-213-5/+5
|\ \ \ \ \ \ \
| * | | | | | | kernel/thread: Use owner_process when setting the page table in SetupMainThread()Lioncash2018-09-213-5/+5
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1371 from lioncash/fwd-armbunnei2018-09-215-1/+11
|\ \ \ \ \ \ \
| * | | | | | | arm_interface: Replace kernel vm_manager include with a forward declarationLioncash2018-09-215-1/+11
| |/ / / / / /
* | | | | | | Merge pull request #1375 from Subv/gl_clearbunnei2018-09-211-1/+1
|\ \ \ \ \ \ \
| * | | | | | | RasterizerGL: Use the correct framebuffer when clearing via the CLEAR_BUFFERS register.Subv2018-09-211-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #1364 from lioncash/contentbunnei2018-09-2125-1/+45
|\ \ \ \ \ \ \
| * | | | | | | file-sys: Default heavy-weight class destructors in the cpp fileLioncash2018-09-2025-1/+45
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1367 from lioncash/pluralbunnei2018-09-211-9/+1
|\ \ \ \ \ \ \
| * | | | | | | game_list: Handle plurals within setFilterResult() betterLioncash2018-09-201-9/+1
| |/ / / / / /
* | | | | | | Merge pull request #1368 from ogniK5377/nifm-fixbunnei2018-09-211-1/+7
|\ \ \ \ \ \ \
| * | | | | | | Fixed submitDavid Marcec2018-09-201-2/+1
| * | | | | | | Added IRequest::SubmitDavid Marcec2018-09-201-1/+8
* | | | | | | | Merge pull request #1352 from lioncash/sharingbunnei2018-09-211-3/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | ring_buffer: Use std::atomic_size_t in a static assertLioncash2018-09-191-1/+1
| * | | | | | | | ring_buffer: Use std::hardware_destructive_interference_size to determine alignment size for avoiding false sharingLioncash2018-09-191-2/+10
| | |_|_|_|_|/ / | |/| | | | | |
* | | | | | | | Merge pull request #1373 from ogniK5377/revert-nifmbunnei2018-09-211-1/+1
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | Revert GetRequestStateDavid Marcec2018-09-211-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1370 from Hedges/GDBCleanMat M2018-09-201-1/+1
|\ \ \ \ \ \ \
| * | | | | | | Correct endianness of BKPTJarek Syrylak2018-09-201-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1362 from MerryMage/dynarmicMat M2018-09-202-0/+12
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | arm_dynarmic: Halt when BRK encounteredMerryMage2018-09-201-0/+1
| * | | | | | arm_dynarmic: Support BKPT instructionMerryMage2018-09-191-0/+11
| * | | | | | externals: Update dynarmic to 171d116MerryMage2018-09-191-0/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1358 from DarkLordZach/temp-storagebunnei2018-09-201-4/+7
|\ \ \ \ \ \
| * | | | | | savedata_factory: Add TemporaryStorage SaveDataTypeZach Hilman2018-09-191-4/+7
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1363 from lioncash/controlbunnei2018-09-202-14/+17
|\ \ \ \ \ \
| * | | | | | control_metadata: Remove unnecessary else within GetLanguageEntry()Lioncash2018-09-201-8/+8
| * | | | | | control_metadata: Move language name array definition to the cpp fileLioncash2018-09-202-6/+9
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1361 from lioncash/naxbunnei2018-09-204-19/+26
|\ \ \ \ \ \
| * | | | | | xts_archive: Remove unused variables from CalculateHMAC256()Lioncash2018-09-191-3/+0
| * | | | | | xts_archive: Make AsNCA() return a std::unique_ptr instead of a std::shared_ptrLioncash2018-09-192-3/+3
| * | | | | | nax: Avoid re-parsing NAX data with GetFileType()Lioncash2018-09-192-13/+19
| * | | | | | nax: Avoid unnecessary calls to AsNCA() in IdentifyType()Lioncash2018-09-191-4/+8
| * | | | | | xts_archive: Ensure NAX's type member is always initializedLioncash2018-09-191-1/+1
| * | | | | | xts_archive: Amend initializer order of NAX's constructorLioncash2018-09-191-2/+2
| |/ / / / /
* | | | | | Merge pull request #1366 from ogniK5377/splat-fixbunnei2018-09-201-3/+99
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Removed unneeded event clearDavid Marcec2018-09-201-1/+0
| * | | | | Implemented NTC & IEnsureNetworkClockAvailabilityServiceDavid Marcec2018-09-201-3/+100
|/ / / / /
* | | | | Reworked incorrect nifm stubs (#1355)David2018-09-191-3/+10
* | | | | Merge pull request #1356 from degasus/hotfixbunnei2018-09-191-6/+7
|\ \ \ \ \
| * | | | | gl_rasterizer: Fix StartAddress handling with indexed draw calls.Markus Wick2018-09-191-6/+7
| | |/ / / | |/| | |
* | | | | Merge pull request #1359 from ogniK5377/nesbunnei2018-09-193-7/+12
|\ \ \ \ \
| * | | | | Fixed GetAccountId stub, Added error code for OpenDirectory and added ActivateNpadWithRevisionDavid Marcec2018-09-193-7/+12
| |/ / / /
* | | | | Merge pull request #1353 from ogniK5377/remove-MakeBuilderbunnei2018-09-197-34/+26
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Removed MakeBuilder as it's not needed anymoreDavid Marcec2018-09-191-7/+0
| * | | | Removed the use of rp.MakeBuilderDavid Marcec2018-09-196-27/+26
|/ / / /
* | | | Merge pull request #1348 from ogniK5377/GetImageSizebunnei2018-09-191-1/+9
|\ \ \ \
| * | | | Implemented GetImageSizeDavid Marcec2018-09-181-1/+9
* | | | | Merge pull request #1319 from lioncash/audiobunnei2018-09-195-43/+59
|\ \ \ \ \
| * | | | | time_stretch: Remove unused <array> includeLioncash2018-09-171-1/+0
| * | | | | stream: Replace includes with forward declarations where applicableLioncash2018-09-172-3/+7
| * | | | | audio_renderer: Replace includes with forward declarations where applicableLioncash2018-09-172-39/+52
* | | | | | Merge pull request #1351 from ogniK5377/GetDefaultDisplayResolutionbunnei2018-09-192-1/+18
|\ \ \ \ \ \
| * | | | | | Implemented GetDefaultDisplayResolutionDavid Marcec2018-09-182-1/+18
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1341 from lioncash/dependencybunnei2018-09-192-2/+6
|\ \ \ \ \ \
| * | | | | | core/core_cpu: Replace exclusive monitor include with forward declarationLioncash2018-09-182-2/+6
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1346 from lioncash/svcbunnei2018-09-191-37/+36
|\ \ \ \ \ \
| * | | | | | svc_wrap: Convert the PARAM macro into a functionLioncash2018-09-181-37/+36
| |/ / / / /
* | | | | | Merge pull request #1350 from ogniK5377/Six-Axis-Stubbunnei2018-09-191-4/+28
|\ \ \ \ \ \
| * | | | | | Added ActivateGestureDavid Marcec2018-09-181-1/+7
| * | | | | | Added StopSixAxisSensorDavid Marcec2018-09-181-1/+7
| * | | | | | Stubbed ActivateConsoleSixAxisSensor & StartConsoleSixAxisSensorDavid Marcec2018-09-181-2/+14
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1342 from lioncash/truncbunnei2018-09-191-4/+4
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Avoid truncation warnings within LD_A and ST_A codeLioncash2018-09-181-4/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1279 from FernandoS27/csetpbunnei2018-09-192-21/+133
|\ \ \ \ \ \
| * | | | | | Implemented Internal FlagsFernandoS272018-09-181-13/+35
| * | | | | | Implemented I2I.CC on the NEU control code, used by SMOFernandoS272018-09-172-14/+18
| * | | | | | Implemented CSETPFernandoS272018-09-172-14/+49
| * | | | | | Implemented Control CodesFernandoS272018-09-172-0/+51
| |/ / / / /
* | | | | | Merge pull request #1299 from FernandoS27/texture-sanatizebunnei2018-09-192-3/+192
|\ \ \ \ \ \
| * | | | | | Added asserts for texture misc modes to texture instructionsFernandoS272018-09-171-2/+45
| * | | | | | Added texture misc modes to texture instructionsFernandoS272018-09-171-1/+147
| |/ / / / /
* | | | | | Invalid default value of username in yuzu_cmd (#1334)Philippe Babin2018-09-193-3/+8
* | | | | | Merge pull request #1343 from lioncash/mutexbunnei2018-09-182-2/+10
|\ \ \ \ \ \
| * | | | | | kernel/mutex: Replace ResultCode construction for invalid addresses with the named variantLioncash2018-09-181-2/+2
| * | | | | | kernel/svc: Handle error cases for svcArbitrateLock() and svcArbitrateUnlock()Lioncash2018-09-181-0/+8
| |/ / / / /
* | | | | | Merge pull request #1344 from lioncash/armbunnei2018-09-187-99/+86
|\ \ \ \ \ \
| * | | | | | arm_interface: Remove ARM11-isms from the CPU interfaceLioncash2018-09-187-99/+86
| |/ / / / /
* | | | | | Merge pull request #1345 from lioncash/writebunnei2018-09-181-2/+2
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | arm_dynarmic: Correct ExclusiveWrite128()'s operationLioncash2018-09-181-2/+2
| |/ / / /
* | | | | Merge pull request #1290 from FernandoS27/shader-headerbunnei2018-09-183-24/+111
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Replace old FragmentHeader for the new HeaderFernandoS272018-09-112-31/+18
| * | | | Implemented (Partialy) Shader HeaderFernandoS272018-09-113-2/+102
* | | | | Merge pull request #1311 from FernandoS27/fast-swizzlebunnei2018-09-171-2/+49
|\ \ \ \ \
| * | | | | Optimized Texture SwizzlingFernandoS272018-09-141-2/+49
* | | | | | Merge pull request #1312 from lioncash/fwdbunnei2018-09-173-7/+9
|\ \ \ \ \ \
| * | | | | | service/vi: Replace includes with forward declarations where applicableLioncash2018-09-133-7/+9
* | | | | | | Merge pull request #1313 from lioncash/errorbunnei2018-09-171-1/+2
|\ \ \ \ \ \ \
| * | | | | | | kernel/errors: Amend error code for ERR_NOT_FOUNDLioncash2018-09-131-1/+2
| |/ / / / / /
* | | | | | | Merge pull request #1314 from lioncash/castbunnei2018-09-171-2/+2
|\ \ \ \ \ \ \
| * | | | | | | audio_core/time_stretch: Silence truncation warnings in Process()Lioncash2018-09-141-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #1316 from lioncash/shadowbunnei2018-09-171-2/+0
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Get rid of variable shadowing within LEA instructionsLioncash2018-09-141-2/+0
| |/ / / / / /
* | | | | | | Merge pull request #1318 from lioncash/errors-smbunnei2018-09-172-8/+6
|\ \ \ \ \ \ \
| * | | | | | | services/sm: Amend error code constantsLioncash2018-09-142-8/+6
| |/ / / / / /
* | | | | | | Merge pull request #1321 from lioncash/audio-shadowbunnei2018-09-171-4/+4
|\ \ \ \ \ \ \
| * | | | | | | cubeb_sink: Get rid of variable shadowing within CubebSink's constructorLioncash2018-09-141-4/+4
| |/ / / / / /
* | | | | | | Merge pull request #1315 from lioncash/sizebunnei2018-09-172-19/+74
|\ \ \ \ \ \ \
| * | | | | | | kernel/svc: Sanitize creation of shared memory via svcCreateSharedMemory()Lioncash2018-09-141-2/+18
| * | | | | | | kernel/svc: Sanitize addresses, permissions, and sizes within svcMapSharedMemory() and svcUnmapSharedMemory()Lioncash2018-09-141-17/+25
| * | | | | | | kernel/svc: Sanitize addresses and sizes within svcMapMemory() and svcUnmapMemory()Lioncash2018-09-141-0/+23
| * | | | | | | kernel/svc: Sanitize heap sizes within svcSetHeapSize()Lioncash2018-09-142-0/+8
| |/ / / / / /
* | | | | | | Merge pull request #1320 from lioncash/namebunnei2018-09-171-1/+1
|\ \ \ \ \ \ \
| * | | | | | | cubeb_sink: Correct context name in ListCubebSinkDevices()Lioncash2018-09-141-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #1328 from FearlessTobi/port-4192bunnei2018-09-171-1/+1
|\ \ \ \ \ \ \
| * | | | | | | Port # #4192 from Citra: "svc: change unknown to thread in CreateThread"Valentin Vanelslande2018-09-151-1/+1
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1327 from FearlessTobi/port-4171bunnei2018-09-172-16/+0
|\ \ \ \ \ \ \
| * | | | | | | Tests: Remove glad test OS X work-aroundYuri Kunde Schlesner2018-09-152-16/+0
| |/ / / / / /
* | | | | | | Merge pull request #1326 from FearlessTobi/port-4182bunnei2018-09-17146-751/+780
|\ \ \ \ \ \ \
| * | | | | | | Port #4182 from Citra: "Prefix all size_t with std::"fearlessTobi2018-09-15146-751/+780
| |/ / / / / /
* | | | | | | Merge pull request #1329 from raven02/bgr5a1ubunnei2018-09-172-0/+4
|\ \ \ \ \ \ \
| * | | | | | | Implement RenderTargetFormat::BGR5A1_UNORM (Pokken Tournament DX)raven022018-09-152-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #1335 from lioncash/copybunnei2018-09-171-5/+5
|\ \ \ \ \ \ \
| * | | | | | | game_list_p: Amend typo in GameListItemCompat's constructor parameterLioncash2018-09-171-4/+4
| * | | | | | | game_list_p: Take map iterator contents by const referenceLioncash2018-09-171-1/+1
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1336 from lioncash/antialiasbunnei2018-09-171-1/+2
|\ \ \ \ \ \ \
| * | | | | | | yuzu/util: Antialias game list compatibility pixmapsLioncash2018-09-171-1/+2
| |/ / / / / /
* | | | | | | Merge pull request #1331 from raven02/astc_8_8bunnei2018-09-173-6/+20
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | Implement ASTC_2D_8X8 (Bayonetta 2)raven022018-09-163-6/+20
|/ / / / / /
* | | | | | Merge pull request #1273 from Subv/ld_sizesbunnei2018-09-152-7/+58
|\ \ \ \ \ \
| * | | | | | Shaders: Implemented multiple-word loads and stores to and from attribute memory.Subv2018-09-152-7/+58
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1271 from Subv/kepler_enginebunnei2018-09-156-0/+146
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | GPU: Basic implementation of the Kepler Inline Memory engine (p2mf).Subv2018-09-126-0/+146
* | | | | | Merge pull request #1310 from lioncash/kernel-nsbunnei2018-09-145-38/+39
|\ \ \ \ \ \
| * | | | | | kernel/thread: Include thread-related enums within the kernel namespaceLioncash2018-09-135-38/+39
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1309 from lioncash/nestedbunnei2018-09-143-12/+6
|\ \ \ \ \ \
| * | | | | | service: Use nested namespace specifiers where applicableLioncash2018-09-133-12/+6
| |/ / / / /
* | | | | | Merge pull request #1307 from lioncash/plbunnei2018-09-141-2/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | services/pl_u: Add missing Korean font to the fallback case for shared fontsLioncash2018-09-131-2/+4
* | | | | | Merge pull request #1308 from valentinvanelslande/ipcJames Rowe2018-09-131-1/+1
|\ \ \ \ \ \
| * | | | | | ipc: minor fixValentin Vanelslande2018-09-131-1/+1
|/ / / / / /
* / / / / / Use ARB_multi_bind for uniform buffers (#1287)ReinUsesLisp2018-09-134-3/+27
|/ / / / /
* | | | | Merge pull request #1298 from lioncash/viewbunnei2018-09-132-2/+4
|\ \ \ \ \
| * | | | | audio_core/sink_details: Change std::string parameter into std::string_viewLioncash2018-09-122-2/+4
| | |_|/ / | |/| | |
* | | | | Merge pull request #1302 from lioncash/configbunnei2018-09-132-36/+74
|\ \ \ \ \
| * | | | | yuzu/configure_gamelist: Make combo box strings translatableLioncash2018-09-122-21/+47
| * | | | | yuzu/configure_gamelist: Use std::array instead of std::vector for translatable stringsLioncash2018-09-121-6/+9
| * | | | | yuzu/configure_gamelist: Move combo box initializtion to their own functionsLioncash2018-09-122-23/+32
* | | | | | Merge pull request #1163 from FearlessTobi/add-audio-stretchingbunnei2018-09-1321-49/+462
|\ \ \ \ \ \
| * | | | | | audio_core: Flush stream when not playing anythingMerryMage2018-09-126-0/+23
| * | | | | | cubeb_sink: Downsample arbitrary number of channelsMerryMage2018-09-091-10/+9
| * | | | | | cubeb_sink: Perform audio stretchingMerryMage2018-09-083-24/+26
| * | | | | | audio_core: Add audio stretcherMerryMage2018-09-083-0/+101
| * | | | | | cubeb_sink: Hold last available value instead of writing zerosMerryMage2018-09-081-5/+15
| * | | | | | cubeb_sink: Use RingBufferMerryMage2018-09-081-40/+26
| * | | | | | common: Implement a ring bufferMerryMage2018-09-084-0/+243
| * | | | | | Add audio stretching supportfearlessTobi2018-09-0815-0/+49
* | | | | | | Merge pull request #1306 from bunnei/fix-b5g6r5ubunnei2018-09-131-1/+1
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | gl_rasterizer_cache: B5G6R5U should use GL_RGB8 as an internal format.bunnei2018-09-131-1/+1
|/ / / / / /
* | | | | | Merge pull request #1297 from lioncash/plbunnei2018-09-122-66/+88
|\ \ \ \ \ \
| * | | | | | pl_u: Eliminate mutable file-scope stateLioncash2018-09-122-66/+88
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1263 from FernandoS27/tex-modebunnei2018-09-122-1/+43
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | Implemented Texture Processing ModesFernandoS272018-09-122-1/+43
| |/ / / /
* | | | | Merge pull request #1303 from lioncash/errorbunnei2018-09-123-9/+11
|\ \ \ \ \
| * | | | | svc: Return ERR_INVALID_PROCESSOR_ID in CreateThread() if an invalid processor ID is givenLioncash2018-09-121-2/+2
| * | | | | kernel/errors: Correct error codes for invalid thread priority and invalid processor IDLioncash2018-09-123-7/+9
* | | | | | Merge pull request #1304 from lioncash/strbunnei2018-09-122-3/+7
|\ \ \ \ \ \
| * | | | | | svc: Do nothing if svcOutputDebugString() is given a length of zeroLioncash2018-09-121-0/+4
| * | | | | | svc: Correct parameter type for OutputDebugString()Lioncash2018-09-122-3/+3
| |/ / / / /
* | | | | | Merge pull request #1305 from FreddyFunk/cmake_yuzu_as_vs_startup_projectbunnei2018-09-121-0/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Update CMakeLists.txtFrederic Laing2018-09-121-0/+3
|/ / / / /
* | | | | Merge pull request #1296 from lioncash/prepobunnei2018-09-122-39/+40
|\ \ \ \ \
| * | | | | service/prepo: Move class into the cpp fileLioncash2018-09-122-39/+40
| |/ / / /
* | | | | Merge pull request #1301 from lioncash/qtbunnei2018-09-121-4/+4
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | game_list: Resolve variable shadowing within LoadCompatibilityList()Lioncash2018-09-121-3/+3
| * | | | game_list: Use QJsonValueRef() within LoadCompatibilityList()Lioncash2018-09-121-2/+2
| |/ / /
* | | | Merge pull request #1300 from lioncash/audiobunnei2018-09-127-17/+34
|\ \ \ \
| * | | | service/audio: Replace includes with forward declarations where applicableLioncash2018-09-127-17/+34
| |/ / /
* | | | Merge pull request #1278 from tech4me/bg-color-fixbunnei2018-09-126-0/+46
|\ \ \ \
| * | | | Port Citra #4047 & #4052: add change background color supporttech4me2018-09-096-0/+46
* | | | | Merge pull request #1295 from bunnei/accurate-copiesbunnei2018-09-122-18/+12
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Always blit on recreate, regardless of format.bunnei2018-09-121-6/+10
| * | | | | gl_shader_cache: Remove cache_width/cache_height.bunnei2018-09-122-12/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #1294 from degasus/optimizationsbunnei2018-09-123-11/+12
|\ \ \ \ \
| * | | | | gl_rasterizer: Use ARB_texture_storage.Markus Wick2018-09-113-11/+12
| |/ / / /
* | | | | Merge pull request #1289 from FernandoS27/lea_psetbunnei2018-09-122-0/+155
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Implemented LEA and PSETFernandoS272018-09-111-0/+91
| * | | | Implemented encodings for LEA and PSETFernandoS272018-09-111-0/+64
|/ / / /
* | | | Merge pull request #1291 from lioncash/defaultbunnei2018-09-11148-45/+291
|\ \ \ \
| * | | | hle/service: Default constructors and destructors in the cpp file where applicableLioncash2018-09-11148-45/+291
* | | | | Merge pull request #1292 from ogniK5377/renderdoc-fixbunnei2018-09-112-2/+9
|\ \ \ \ \
| * | | | | Fixed renderdoc input/output textures not working due to render targetsDavid Marcec2018-09-112-2/+9
| |/ / / /
* | | | | Merge pull request #1293 from lioncash/fontbunnei2018-09-1120-111667/+111727
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | externals: Place font data within cpp filesLioncash2018-09-1120-111667/+111727
|/ / / /
* | | | Use open-source shared fonts if no dumped file is available (#1269)Tobias2018-09-1111-2/+111695
* | | | Port #4141 from citra: Joystick hotplug support (#1275)Tobias2018-09-117-101/+339
* | | | Merge pull request #1286 from bunnei/multi-clearbunnei2018-09-112-50/+66
|\ \ \ \
| * | | | gl_rasterizer: Implement clear for non-zero render targets.bunnei2018-09-102-50/+66
* | | | | Merge pull request #1285 from bunnei/depth-fixbunnei2018-09-111-6/+22
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Only use depth for applicable texture formats.bunnei2018-09-101-6/+22
| |/ / / /
* | | | | Merge pull request #1284 from bunnei/bgra8_srgbbunnei2018-09-113-0/+4
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Implement RenderTargetFormat::BGRA8_SRGB.bunnei2018-09-103-0/+4
| |/ / / /
* | | | | Merge pull request #1288 from MysticExile/remove-multicoreJames Rowe2018-09-112-10/+0
|\ \ \ \ \
| * | | | | Remove multicore configure_general.uiMysticExile2018-09-101-7/+0
| * | | | | remove multicore in configure_general.cppMysticExile2018-09-101-3/+0
| |/ / / /
* | | | | Merge pull request #1264 from degasus/optimizationsbunnei2018-09-119-124/+121
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | video_core: Refactor command_processor.Markus Wick2018-09-102-44/+42
| * | | | video_core: Move command buffer loop.Markus Wick2018-09-105-77/+84
| * | | | rasterizer: Drop unused handler.Markus Wick2018-09-104-8/+0
|/ / / /
* | | | Merge pull request #1281 from bunnei/multi-rtbunnei2018-09-105-132/+95
|\ \ \ \
| * | | | gl_rasterizer: Implement multiple color attachments.bunnei2018-09-105-132/+95
|/ / / /
* | | | Merge pull request #1258 from tgsm/fix-sdl-loggingbunnei2018-09-101-2/+3
|\ \ \ \
| * | | | yuzu-cmd: fix SDL loggingtgsm2018-09-081-2/+3
* | | | | Merge pull request #1282 from lioncash/compatbunnei2018-09-1010-33/+56
|\ \ \ \ \
| * | | | | game_list: Make CompatibilityList parameter of NavigateToGamedbEntryRequested() a const referenceLioncash2018-09-103-3/+5
| * | | | | yuzu: Move compatibility list specifics to their own source filesLioncash2018-09-1010-33/+54
* | | | | | Merge pull request #1276 from FearlessTobi/fix-stupid-stubbunnei2018-09-102-4/+6
|\ \ \ \ \ \
| * | | | | | hid: Implement ReloadInputDevicesfearlessTobi2018-09-092-4/+6
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1283 from lioncash/unusedbunnei2018-09-101-2/+0
|\ \ \ \ \ \
| * | | | | | service: Remove unused g_kernel_named_ports variableLioncash2018-09-101-2/+0
* | | | | | | Merge pull request #1268 from FernandoS27/tmmlbunnei2018-09-102-5/+67
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Implemented TMMLFernandoS272018-09-102-5/+67
* | | | | | | Merge pull request #1272 from Subv/dma_2dbunnei2018-09-101-2/+10
|\ \ \ \ \ \ \
| * | | | | | | GPU/DMA: Partially implemented the 'enable_2d' bit in the DMA engine.Subv2018-09-081-2/+10
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1280 from zero334/improvementsbunnei2018-09-105-89/+101
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | video_core: fixed arithmetic overflow warnings & improved code stylePatrick Elsässer2018-09-095-89/+101
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1261 from FernandoS27/txqbunnei2018-09-102-2/+37
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Implemented TXQ dimension query type, used by SMO.FernandoS272018-09-092-1/+36
| * | | | | Change name of TEXQ to TXQ, in order to match NVIDIA's namingFernandoS272018-09-091-2/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #1277 from jroweboy/update-xbyakMat M2018-09-091-0/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Externals: Update xbyakJames Rowe2018-09-091-0/+0
|/ / / /
* | | | Merge pull request #1256 from bunnei/tex-target-supportbunnei2018-09-0811-229/+422
|\ \ \ \
| * | | | gl_rasterizer_cache: Improve accuracy of RecreateSurface for non-2D textures.bunnei2018-09-082-27/+45
| * | | | maxwell_3d: Remove assert that no longer applies.bunnei2018-09-081-4/+0
| * | | | gl_rasterizer_cache: Partially implement several non-2D texture types.bunnei2018-09-081-30/+111
| * | | | gl_shader_decompiler: Partially implement several non-2D texture types (Subv).bunnei2018-09-082-32/+143
| * | | | gl_rasterizer: Implement texture wrap mode p.bunnei2018-09-082-2/+8
| * | | | gl_rasterizer_cache: Track texture depth.bunnei2018-09-083-4/+15
| * | | | gl_rasterizer_cache: Remove impl. of FlushGLBuffer.bunnei2018-09-081-34/+1
| * | | | gl_rasterizer_cache: Keep track of texture type per surface.bunnei2018-09-083-32/+84
| * | | | gl_rasterizer_cache: Remove unused DownloadGLTexture.bunnei2018-09-082-51/+0
| * | | | gl_state: Keep track of texture target.bunnei2018-09-085-26/+28
* | | | | Merge pull request #1265 from zhaowenlan1779/patch-1bunnei2018-09-081-2/+2
|\ \ \ \ \
| * | | | | yuzu: fix title bar displayPengfei Zhu2018-09-081-2/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #1267 from MerryMage/audio_outbunnei2018-09-082-7/+7
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | audio_renderer: Rename AudioOut instance to audio_outMerryMage2018-09-082-7/+7
|/ / / /
* | | | Merge pull request #1246 from degasus/instanced_renderingbunnei2018-09-083-21/+29
|\ \ \ \
| * | | | gl_rasterizer: Use baseInstance instead of moving the buffer points.bunnei2018-09-083-21/+29
| | |/ / | |/| |
* | | | Merge pull request #1259 from lioncash/relocatebunnei2018-09-085-286/+324
|\ \ \ \ | |/ / / |/| | |
| * | | yuzu: Move GameListWorker to its own source filesLioncash2018-09-075-286/+324
* | | | video_core: Arithmetic overflow warning fix for gl_rasterizer (#1262)Patrick Elsässer2018-09-081-12/+14
| |/ / |/| |
* | | Merge pull request #1257 from lioncash/processbunnei2018-09-084-5/+34
|\ \ \
| * | | core: Migrate current_process pointer to the kernelLioncash2018-09-074-5/+34
* | | | Merge pull request #1260 from MerryMage/dynarmicbunnei2018-09-081-0/+0
|\ \ \ \ | |_|/ / |/| | |
| * | | externals: Update dynarmic to 9594465MerryMage2018-09-071-0/+0
|/ / /
* | | Merge pull request #1201 from CaptV0rt3x/titlebarbunnei2018-09-076-10/+30
|\ \ \ | |/ / |/| |
| * | For SDL FrontendCaptV0rt3x2018-09-071-2/+2
| * | Better Title Bar DisplayCaptV0rt3x2018-09-075-8/+28
|/ /
* | Merge pull request #1250 from lioncash/file-sysbunnei2018-09-074-4/+16
|\ \
| * | file_sys/nca_patch: Amend constructor initializer list orderLioncash2018-09-061-2/+2
| * | file_sys/nca_patch: Remove unnecessary includesLioncash2018-09-062-2/+9
| * | file_sys/patch_manager: Add missing includesLioncash2018-09-062-0/+5
* | | Merge pull request #1249 from FearlessTobi/disable-vsyncbunnei2018-09-072-0/+2
|\ \ \
| * | | frontend: Set swap interval to 0fearlessTobi2018-09-062-0/+2
* | | | Merge pull request #1251 from lioncash/core-incbunnei2018-09-075-2/+5
|\ \ \ \
| * | | | core/core: Remove unnecessary sm/controller includeLioncash2018-09-065-2/+5
| | |/ / | |/| |
* | | | Merge pull request #1252 from lioncash/headerbunnei2018-09-071-0/+1
|\ \ \ \
| * | | | video_core/CMakeLists: Add missing gl_buffer_cache.hLioncash2018-09-061-0/+1
| |/ / /
* | | | Merge pull request #1253 from lioncash/explicitbunnei2018-09-072-8/+10
|\ \ \ \
| * | | | gl_buffer_cache: Default initialize member variablesLioncash2018-09-061-3/+3
| * | | | gl_buffer_cache: Make GetHandle() a const member functionLioncash2018-09-062-2/+2
| * | | | gl_buffer_cache: Remove unnecessary includesLioncash2018-09-062-2/+4
| * | | | gl_buffer_cache: Make constructor explicitLioncash2018-09-061-1/+1
| |/ / /
* | | | Merge pull request #1255 from bunnei/minor-optbunnei2018-09-071-4/+2
|\ \ \ \
| * | | | gl_rasterizer: Call state.Apply only once on SetupShaders.bunnei2018-09-061-4/+2
| |/ / /
* | | | Merge pull request #1254 from bunnei/ipa-saturatebunnei2018-09-071-1/+5
|\ \ \ \ | |/ / / |/| | |
| * | | gl_shader_decompiler: Implement saturate mode for IPA.bunnei2018-09-061-1/+5
|/ / /
* | | Merge pull request #1248 from degasus/shader_fixbunnei2018-09-061-0/+1
|\ \ \ | |/ / |/| |
| * | gl_shader_gen: Initialize position.Markus Wick2018-09-061-0/+1
|/ /
* | Merge pull request #1243 from degasus/VAO_cachebunnei2018-09-063-53/+60
|\ \
| * | gl_rasterizer: Implement a VAO cache.Markus Wick2018-09-053-53/+60
* | | Merge pull request #1244 from FernandoS27/ipabunnei2018-09-062-47/+98
|\ \ \
| * | | Implemented IPA ProperlyFernandoS272018-09-062-47/+98
* | | | Merge pull request #1242 from lioncash/file-sysbunnei2018-09-062-8/+17
|\ \ \ \
| * | | | file_sys/submission_package: Correct constructor initialization list orderLioncash2018-09-051-2/+2
| * | | | file_sys/submission_package: Replace includes with forward declarations where applicableLioncash2018-09-052-6/+15
| | |/ / | |/| |
* | | | Merge pull request #1179 from DarkLordZach/bktrbunnei2018-09-0632-101/+1132
|\ \ \ \
| * | | | bktr: Fix bucket overlap errorZach Hilman2018-09-048-9/+11
| * | | | drd: Parse title ID from program metadataZach Hilman2018-09-042-4/+29
| * | | | patch_manager: Centralize Control-type NCA parsingZach Hilman2018-09-046-80/+89
| * | | | nsp: Fix error masking issue with XCI filesZach Hilman2018-09-043-6/+13
| * | | | game_list: Fix version display on non-NAND titlesZach Hilman2018-09-044-30/+52
| * | | | bktr: Add logging on successful patchZach Hilman2018-09-043-7/+24
| * | | | game_list: Use friendly game versionsZach Hilman2018-09-041-13/+32
| * | | | bktr: Implement IVFC offset shiftingZach Hilman2018-09-048-8/+36
| * | | | bktr: Fix missing includes and optimize styleZach Hilman2018-09-0412-103/+109
| * | | | main: Make game updates installableZach Hilman2018-09-041-1/+5
| * | | | game_list: Display patch names and versions on listZach Hilman2018-09-042-0/+27
| * | | | loader: Add BKTR-specific error messages and codesZach Hilman2018-09-043-7/+28
| * | | | loader: Ignore patches on NRO and DRDZach Hilman2018-09-044-0/+11
| * | | | patch_manager: Add usages of patches to ExeFSZach Hilman2018-09-045-9/+41
| * | | | file_sys: Add class to manage game patchesZach Hilman2018-09-042-0/+132
| * | | | file_sys: Add BKTR patching mechanismZach Hilman2018-09-042-0/+352
| * | | | content_archive: Add BKTR header parsing to NCAZach Hilman2018-09-042-19/+160
| * | | | registration: Add RegisteredCacheUnionZach Hilman2018-09-044-0/+164
| * | | | game_list: Use RegisteredCacheUnion for installedZach Hilman2018-09-043-5/+3
| * | | | aes_util: Fix error involving reads of less than 0x10Zach Hilman2018-09-041-0/+14
* | | | | Merge pull request #1245 from degasus/optimizationsbunnei2018-09-051-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | gl_rasterizer: Skip TODO log.Markus Wick2018-09-051-1/+1
|/ / / /
* | | | Merge pull request #1217 from degasus/vbo_cache2bunnei2018-09-055-86/+182
|\ \ \ \ | |_|/ / |/| | |
| * | | renderer_opengl: Implement a buffer cache.Markus Wick2018-09-055-86/+182
|/ / /
* | | Merge pull request #1240 from degasus/optimizationsbunnei2018-09-054-15/+23
|\ \ \ | |/ / |/| |
| * | gl_shader_cache: Use an u32 for the binding point cache.Markus Wick2018-09-044-15/+23
* | | Merge pull request #1178 from DarkLordZach/nspbunnei2018-09-0419-41/+650
|\ \ \ | |/ / |/| |
| * | main: Only show DRD deprecation warning onceZach Hilman2018-09-047-6/+19
| * | control_metadata: Use alternate language names if AmericanEnglish isn't availableZach Hilman2018-09-042-4/+17
| * | card_image: Add program title ID getterZach Hilman2018-09-042-0/+6
| * | qt: Add deprecation warnings for DRD formatZach Hilman2018-09-041-0/+10
| * | registration: Fix NSP installation errorsZach Hilman2018-09-041-1/+1
| * | nsp: Comply with style and performance guidelinesZach Hilman2018-09-047-29/+48
| * | qt: Add UI support for NSP filesZach Hilman2018-09-043-2/+7
| * | registration: Add support for installing NSP filesZach Hilman2018-09-043-16/+34
| * | loader: Add AppLoader for NSP filesZach Hilman2018-09-042-0/+182
| * | card_image: Parse XCI secure partition with NSPZach Hilman2018-09-044-11/+38
| * | file_sys: Add Nintendo Submission Package (NSP)Zach Hilman2018-09-042-0/+296
| * | drd: Load title ID from program metadataZach Hilman2018-09-041-3/+1
| * | loader: Add NSP file type and NSP-specific errorsZach Hilman2018-09-042-2/+14
| * | key_manager: Avoid autogeneration if key existsZach Hilman2018-09-041-3/+13
|/ /
* | Merge pull request #1238 from lioncash/explicitbunnei2018-09-043-8/+8
|\ \
| * | common/logging: Amend documentation commentsLioncash2018-09-042-6/+6
| * | common/logging/filter: Replace C-style case with C++ static_castLioncash2018-09-041-1/+1
| * | common/logging/filter: Make constructor explicitLioncash2018-09-041-1/+1
* | | Merge pull request #1237 from degasus/optimizationsbunnei2018-09-044-7/+7
|\ \ \
| * | | core: Use a raw pointer in GetGPUDebugContext.Markus Wick2018-09-042-3/+3
| * | | command_processor: Use std::array for bound_engines.Markus Wick2018-09-042-4/+4
| |/ /
* | | Merge pull request #1223 from DarkLordZach/custom-nand-sd-dirsbunnei2018-09-046-0/+79
|\ \ \
| * | | qt: Add message about not moving contents on dir changeZach Hilman2018-09-042-6/+23
| * | | qt: Add UI options to change NAND/SD dirsZach Hilman2018-09-043-0/+36
| * | | settings: Save and load NAND/SD dirs from configZach Hilman2018-09-043-0/+26
* | | | Merge pull request #1232 from lioncash/copybunnei2018-09-041-1/+1
|\ \ \ \
| * | | | gl_shader_decompiler: Use used_shaders member variable directly within GenerateDeclarations()Lioncash2018-09-021-1/+1
* | | | | Merge pull request #1235 from lioncash/forward-declbunnei2018-09-0422-27/+64
|\ \ \ \ \
| * | | | | file_sys: Replace includes with forward declarations where applicableLioncash2018-09-0422-27/+64
| | |_|/ / | |/| | |
* | | | | Merge pull request #1236 from degasus/microprofilebunnei2018-09-044-5/+21
|\ \ \ \ \
| * | | | | Update microprofile scopes.Markus Wick2018-09-044-5/+21
| |/ / / /
* | | | | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
| | |_|/ | |/| |
* | | | Merge pull request #1231 from lioncash/globalbunnei2018-09-045-19/+51
|\ \ \ \
| * | | | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
| | |/ / | |/| |
* | | | Merge pull request #1229 from lioncash/forward-declbunnei2018-09-0413-15/+45
|\ \ \ \ | |_|_|/ |/| | |
| * | | vfs_real: Forward declare IOFileLioncash2018-09-0213-15/+45
| |/ /
* | | Merge pull request #1233 from lioncash/dynarmicMat M2018-09-031-0/+0
|\ \ \ | |/ / |/| |
| * | externals: Update dynarmic to 0435ac2Lioncash2018-09-031-0/+0
|/ /
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-023-4/+33
|\ \
| * | maxwell_3d: Use CoreTiming for query timestampZach Hilman2018-09-011-2/+3
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* | Merge pull request #1215 from ogniK5377/texs-nodep-assertbunnei2018-09-022-0/+3
|\ \
| * | Added assert for TEXS nodepDavid Marcec2018-09-012-0/+3
| |/
* | Merge pull request #1219 from jroweboy/less-artifactsbunnei2018-09-021-4/+0
|\ \
| * | Build - Upload fewer artifactsJames Rowe2018-09-011-4/+0
| |/
* | Merge pull request #1220 from FearlessTobi/extensions-qolbunnei2018-09-022-8/+10
|\ \
| * | citra_qt: Display the unsupported GL extensions in the popupfearlessTobi2018-09-012-8/+10
| |/
* | Merge pull request #1214 from ogniK5377/ipa-assertbunnei2018-09-022-6/+13
|\ \
| * | Added better asserts to IPA, Renamed IPA modes to match mesaDavid Marcec2018-09-012-6/+13
| |/
* | Merge pull request #1216 from ogniK5377/ffma-assertbunnei2018-09-022-0/+9
|\ \
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| * | Changed tab5980_0 default from 0 -> 1David Marcec2018-09-011-2/+2
| * | Added FFMA assertsDavid Marcec2018-09-012-0/+11
| |/
* | Merge pull request #1218 from ogniK5377/fmul-assertbunnei2018-09-022-0/+13
|\ \
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| * | Added FMUL assertsDavid Marcec2018-09-012-0/+15
| |/
* | Merge pull request #1228 from lioncash/constructbunnei2018-09-021-2/+5
|\ \ | |/ |/|
| * filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/
* Merge pull request #1196 from FearlessTobi/ccache-consistencybunnei2018-09-014-16/+6
|\
| * travis: use Citras ccachefearlessTobi2018-08-314-16/+6
* | Merge pull request #1212 from lioncash/forward-declbunnei2018-09-0129-66/+185
|\ \ | |/ |/|
| * core/core: Replace includes with forward declarations where applicableLioncash2018-08-3129-66/+185
|/
* Merge pull request #1205 from bunnei/improve-rasterizer-cache-2bunnei2018-08-3111-297/+227
|\
| * gl_rasterizer_cache: Use accurate framebuffer setting for accurate copies.bunnei2018-08-312-73/+54
| * gl_rasterizer_cache: Also use reserve cache for RecreateSurface.bunnei2018-08-312-24/+18
| * rasterizer_cache: Use boost::interval_map for a more accurate cache.bunnei2018-08-311-33/+45
| * gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-3111-138/+70
| * gl_rasterizer: Fix issues with the rasterizer cache.bunnei2018-08-314-46/+57
|/
* Implement BC6H_UF16 & BC6H_SF16 (#1092)greggameplayer2018-08-313-31/+55
* Merge pull request #1204 from lioncash/pimplbunnei2018-08-315-279/+387
|\
| * core: Make the main System class use the PImpl idiomLioncash2018-08-315-279/+387
* | Merge pull request #1207 from degasus/hotfixbunnei2018-08-311-1/+1
|\ \
| * | Report correct shader size.Markus Wick2018-08-311-1/+1
* | | Merge pull request #1208 from Hexagon12/pred-comp-14bunnei2018-08-312-3/+4
|\ \ \ | |/ / |/| |
| * | Added predicate comparison GreaterEqualWithNanHexagon122018-08-312-3/+4
|/ /
* | Merge pull request #1195 from FearlessTobi/port-gamelist-compatbunnei2018-08-3113-7/+196
|\ \
| * | Show game compatibility within yuzufearlessTobi2018-08-2913-7/+196
* | | gl_shader_decompiler: Implement POPC (#1203)Laku2018-08-312-0/+19
* | | Merge pull request #1200 from bunnei/improve-ipabunnei2018-08-302-1/+39
|\ \ \ | |_|/ |/| |
| * | gl_shader_decompiler: Improve IPA for Pass mode with Position attribute.bunnei2018-08-292-1/+39
* | | Merge pull request #1198 from lioncash/kernelbunnei2018-08-3054-442/+671
|\ \ \
| * | | kernel: Eliminate kernel global stateLioncash2018-08-2954-442/+671
| |/ /
* | | Merge pull request #1202 from FearlessTobi/port-3825bunnei2018-08-302-1/+13
|\ \ \
| * | | Remove Citra specific variablefearlessTobi2018-08-291-3/+0
| * | | travis: share env variables with Dockerliushuyu2018-08-292-1/+16
| |/ /
* | | Merge pull request #1172 from tech4me/impl_iadd3bunnei2018-08-302-1/+84
|\ \ \ | |/ / |/| |
| * | Shaders: Implemented IADD3tech4me2018-08-292-1/+84
|/ /
* | Merge pull request #1193 from lioncash/privbunnei2018-08-287-26/+40
|\ \
| * | gpu: Make memory_manager privateLioncash2018-08-287-26/+40
* | | Merge pull request #1192 from lioncash/unusedbunnei2018-08-281-2/+0
|\ \ \
| * | | gl_rasterizer: Remove unused variablesLioncash2018-08-281-2/+0
| |/ /
* | | Merge pull request #1191 from lioncash/noexceptbunnei2018-08-281-1/+1
|\ \ \
| * | | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
| |/ /
* | | Merge pull request #1194 from lioncash/allocbunnei2018-08-281-2/+1
|\ \ \ | |_|/ |/| |
| * | gl_shader_cache: Remove unused program_code vector in GetShaderAddress()Lioncash2018-08-281-2/+1
| |/
* | Merge pull request #1190 from FearlessTobi/im-so-retardedbunnei2018-08-282-1/+2
|\ \ | |/ |/|
| * Fix two stupid errors made in #1141fearlessTobi2018-08-282-1/+2
|/
* Merge pull request #1165 from bunnei/shader-cachebunnei2018-08-2812-417/+387
|\
| * renderer_opengl: Implement a new shader cache.bunnei2018-08-289-285/+250
| * gl_rasterizer_cache: Update to use RasterizerCache base class.bunnei2018-08-283-132/+20
| * video_core: Add RasterizerCache class for common cache management code.bunnei2018-08-282-0/+117
* | Merge pull request #1189 from FearlessTobi/fix-stick-directionsbunnei2018-08-281-2/+2
|\ \
| * | yuzu: Fix stick UI direction orderfearlessTobi2018-08-281-2/+2
|/ /
* | Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\ \ | |/ |/|
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
* | Merge pull request #1169 from Lakumakkara/selbunnei2018-08-281-1/+1
|\ \
| * | fix SEL_IMM bitstringLaku2018-08-241-1/+1
* | | Merge pull request #1188 from lioncash/unusedbunnei2018-08-281-1/+0
|\ \ \
| * | | vfs_real: Remove unused variable in CreateDirectoryRelative()Lioncash2018-08-271-1/+0
* | | | Merge pull request #1170 from lioncash/retbunnei2018-08-281-1/+1
|\ \ \ \
| * | | | file_util: Correct return value in early exit of ReadFileToString()Lioncash2018-08-241-1/+1
* | | | | Merge pull request #1175 from lioncash/nsbunnei2018-08-2813-12/+42
|\ \ \ \ \
| * | | | | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-2513-12/+42
| |/ / / /
* | | | | Merge pull request #1187 from lioncash/shadowbunnei2018-08-281-3/+3
|\ \ \ \ \
| * | | | | registered_cache: Get rid of variable shadowing in ProcessFiles()Lioncash2018-08-271-3/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #1128 from DarkLordZach/malformed-hex-crashbunnei2018-08-271-5/+17
|\ \ \ \ \
| * | | | | hex_util: Replace logic_errors with LOG_CRITICALZach Hilman2018-08-231-5/+17
* | | | | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \ \ \ \
| * | | | | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
* | | | | | | Merge pull request #1174 from lioncash/debugbunnei2018-08-275-27/+7
|\ \ \ \ \ \ \
| * | | | | | | debug_utils: Remove unused includesLioncash2018-08-255-24/+4
| * | | | | | | debug_utils: Make BreakpointObserver class' constructor explicitLioncash2018-08-251-1/+1
| * | | | | | | debug_utils: Initialize active_breakpoint member of DebugContextLioncash2018-08-251-2/+2
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \ \ \ \
| * | | | | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| * | | | | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
* | | | | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1171 from lioncash/truebunnei2018-08-271-7/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | core: Remove always true conditionals in Load()Lioncash2018-08-241-7/+4
| |/ / / / / / /
* | | | | | | | Merge pull request #1180 from tech4me/languagecode_fixbunnei2018-08-272-8/+45
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
|/ / / / / / /
* | | | | | | Merge pull request #1173 from lioncash/batchbunnei2018-08-251-4/+4
|\ \ \ \ \ \ \
| * | | | | | | maxwell3d: Move FinishedPrimitiveBatch event after AcceleratedDrawBatch()Lioncash2018-08-251-4/+4
| |/ / / / / /
* | | | | | | Merge pull request #1167 from lioncash/assertbunnei2018-08-251-1/+2
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | gl_rasterizer: Correct assertion condition in SyncLogicOpState()Lioncash2018-08-241-1/+2
| |/ / / / /
* | | | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ / / /
* | | | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-2531-97/+821
|\ \ \ \ \
| * | | | | file_sys/crypto: Fix missing/unnecessary includesZach Hilman2018-08-259-5/+10
| * | | | | xci: Ignore NCA files with updates in secureZach Hilman2018-08-241-0/+3
| * | | | | content_archive: Add update title detectionZach Hilman2018-08-242-0/+11
| * | | | | key_manager: Eliminate indexed for loopZach Hilman2018-08-231-6/+13
| * | | | | key_manager: Create keys dir if it dosen't existZach Hilman2018-08-232-0/+2
| * | | | | file_sys: Cut down on includes and copiesZach Hilman2018-08-237-19/+30
| * | | | | crypto: Eliminate magic constantsZach Hilman2018-08-234-32/+38
| * | | | | key_manager: Add support for autogenerated keysZach Hilman2018-08-232-3/+45
| * | | | | key_manager: Add support for KEK and SD seed derivationZach Hilman2018-08-232-5/+135
| * | | | | key_manager: Switch to boost flat_map for keysZach Hilman2018-08-232-32/+14
| * | | | | game_list: Add SD registration loading to game listZach Hilman2018-08-232-12/+12
| * | | | | file_sys: Implement NAX containersZach Hilman2018-08-233-0/+238
| * | | | | registration: Add GetEntryUnparsed methodsZach Hilman2018-08-232-0/+15
| * | | | | sdmc_factory: Add SDMC RegisteredCache getterZach Hilman2018-08-232-1/+14
| * | | | | qt: Make default row data title name and title idZach Hilman2018-08-231-2/+2
| * | | | | vfs: Add GetOrCreateDirectoryRelative methodZach Hilman2018-08-233-9/+13
| * | | | | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-233-10/+12
| * | | | | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| * | | | | loader: Add new NAX-specific errors and messagesZach Hilman2018-08-232-1/+27
| * | | | | nax: Add AppLoader_NAX and update loader to support itZach Hilman2018-08-234-2/+121
| * | | | | xts_encryption_layer: Implement XTSEncryptionLayerZach Hilman2018-08-233-1/+81
| * | | | | aes_util: Make XTSTranscode stricter about sizesZach Hilman2018-08-231-5/+2
| * | | | | ctr_encryption_layer: Fix bug when transcoding small dataZach Hilman2018-08-231-5/+3
| * | | | | xci: Fix error masking issueZach Hilman2018-08-233-5/+17
* | | | | | Merge pull request #1065 from DarkLordZach/window-titleZach Hilman2018-08-242-0/+18
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | qt: Add filename and title id to window title while runningZach Hilman2018-08-232-0/+18
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1164 from tech4me/decode_iadd3bunnei2018-08-241-0/+6
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | Shaders: Added decodings for IADD3 instructionstech4me2018-08-231-0/+6
| |/ / /
* | | | Port #4013 from Citra: "Init logging sooner so we dont miss some logs on startup" (#1142)Tobias2018-08-241-11/+11
* | | | Added GetBootMode (#1107)David2018-08-244-3/+25
|/ / /
* | | Merge pull request #1160 from bunnei/surface-reservebunnei2018-08-232-17/+91
|\ \ \
| * | | gl_rasterizer_cache: Blit when possible on RecreateSurface.bunnei2018-08-231-5/+12
| * | | gl_rasterizer_cache: Reserve surfaces that have already been created for later use.bunnei2018-08-232-3/+61
| * | | gl_rasterizer_cache: Remove assert for RecreateSurface type.bunnei2018-08-231-1/+0
| * | | gl_rasterizer_cache: Implement compressed texture copies.bunnei2018-08-231-8/+18
| |/ /
* | | Merge pull request #1153 from bunnei/stencil-clearbunnei2018-08-236-69/+188
|\ \ \ | |/ / |/| |
| * | gl_rasterizer: Implement stencil test.bunnei2018-08-233-4/+58
| * | gl_rasterizer: Implement partial color clear and stencil clear.bunnei2018-08-231-12/+42
| * | maxwell_3d: Update to include additional stencil registers.bunnei2018-08-231-20/+50
| * | gl_state: Update to handle stencil front/back face separately.bunnei2018-08-232-33/+38
|/ /
* | Merge pull request #1157 from lioncash/vecbunnei2018-08-232-11/+16
|\ \
| * | gl_shader_gen: Make ShaderSetup's constructor explicitLioncash2018-08-221-1/+1
| * | gl_shader_gen: Use a std::vector to represent program code instead of std::arrayLioncash2018-08-222-11/+16
* | | Merge pull request #1156 from Lakumakkara/lop3bunnei2018-08-232-0/+60
|\ \ \ | |_|/ |/| |
| * | more fixesLaku2018-08-221-6/+7
| * | fixesLaku2018-08-221-6/+12
| * | remove debug loggingLaku2018-08-221-2/+0
| * | implement lop3Laku2018-08-222-0/+55
* | | Swap "Plus" with "Minus" on the controller GUI (#1150)literalmente-game2018-08-231-8/+8
* | | Merge pull request #1159 from lioncash/fmtJames Rowe2018-08-231-0/+0
|\ \ \
| * | | externals: Update fmt to 6201052Lioncash2018-08-221-0/+0
| | |/ | |/|
* | | Merge pull request #1137 from lioncash/namespacebunnei2018-08-2321-23/+70
|\ \ \
| * | | renderer_opengl: Namespace OpenGL codeLioncash2018-08-2221-23/+70
| | |/ | |/|
* | | Merge pull request #1158 from lioncash/boostJames Rowe2018-08-221-0/+0
|\ \ \ | |_|/ |/| |
| * | externals/boost: Update to 1.68.0Lioncash2018-08-221-0/+0
|/ /
* | Merge pull request #1155 from tech4me/icon-fixbunnei2018-08-221-1/+1
|\ \ | |/ |/|
| * config: Fixed icon size get set to 0tech4me2018-08-221-1/+1
|/
* Merge pull request #1136 from tech4me/masterbunnei2018-08-226-11/+45
|\
| * qt/main: Port part of citra(#3411), open savedata workstech4me2018-08-216-11/+45
* | Merge pull request #840 from FearlessTobi/port-3353bunnei2018-08-2210-25/+94
|\ \
| * | Port #3353 from CitrafearlessTobi2018-08-2110-25/+94
* | | Merge pull request #1154 from OatmealDome/topology-linesbunnei2018-08-221-0/+2
|\ \ \
| * | | maxwell_to_gl: Implement PrimitiveTopology::LinesOatmealDome2018-08-221-0/+2
* | | | Merge pull request #1141 from FearlessTobi/port-3902bunnei2018-08-222-0/+18
|\ \ \ \
| * | | | Port #3902 from Citra: "Add restart hotkey & menu option"fearlessTobi2018-08-212-0/+18
| | |_|/ | |/| |
* | | | Merge pull request #1124 from Subv/logic_opsbunnei2018-08-226-7/+108
|\ \ \ \ | |_|/ / |/| | |
| * | | GPU: Implemented the logic op functionality of the GPU.Subv2018-08-213-0/+61
| * | | GLState: Allow enabling/disabling GL_COLOR_LOGIC_OP independently from blending.Subv2018-08-212-6/+19
| * | | GPU: Added registers for the logicop functionality.Subv2018-08-211-1/+28
| | |/ | |/|
* | | Merge pull request #1147 from lioncash/warnbunnei2018-08-221-1/+1
|\ \ \
| * | | logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instanceLioncash2018-08-211-1/+1
* | | | Merge pull request #1151 from bunnei/revert-4a2ee191bunnei2018-08-222-153/+31
|\ \ \ \
| * | | | Revert "Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions."bunnei2018-08-222-153/+31
* | | | | Merge pull request #1152 from ogniK5377/plu-includebunnei2018-08-221-0/+1
|\ \ \ \ \
| * | | | | Added missing include for pl:uDavid Marcec2018-08-221-0/+1
|/ / / / /
* / / / / PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
|/ / / /
* | | | Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-225-4/+7
|\ \ \ \
| * | | | vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-215-4/+7
| |/ / /
* | | | Merge pull request #1146 from lioncash/ambunnei2018-08-221-3/+4
|\ \ \ \
| * | | | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
| |/ / /
* | | | Merge pull request #1148 from lioncash/audio-warnbunnei2018-08-211-1/+1
|\ \ \ \
| * | | | audio_core/filter: Add explicit cast to assignment in Process()Lioncash2018-08-211-1/+1
| |/ / /
* | | | Merge pull request #1149 from lioncash/parenbunnei2018-08-211-1/+1
|\ \ \ \ | |/ / / |/| | |
| * | | shader_bytecode: Parenthesize conditional expression within GetTextureType()Lioncash2018-08-211-1/+1
|/ / /
* | | Merge pull request #1143 from lioncash/incbunnei2018-08-212-1/+1
|\ \ \
| * | | sdmc_factory: Remove unnecessary core includeLioncash2018-08-212-1/+1
| | |/ | |/|
* | | Merge pull request #1139 from lioncash/bitfieldbunnei2018-08-211-2/+1
|\ \ \
| * | | bit_field: Convert ToBool() into explicit operator boolLioncash2018-08-211-2/+1
| |/ /
* | | Merge pull request #1140 from FearlessTobi/port-4056bunnei2018-08-212-0/+14
|\ \ \
| * | | Port #4056 from Citra: "Add Clear Recent Files menu action"fearlessTobi2018-08-212-0/+14
| |/ /
* | | Merge pull request #1144 from MerryMage/MAX_LAG_TIME_USMat M2018-08-211-1/+1
|\ \ \ | |/ / |/| |
| * | perf_stats: Change MAX_LAG_TIME_US to an appropriate valueMerryMage2018-08-211-1/+1
|/ /
* | Merge pull request #1123 from lioncash/screenbunnei2018-08-217-30/+25
|\ \
| * | rasterizer_interface: Remove ScreenInfo from AccelerateDraw()'s signatureLioncash2018-08-215-17/+14
| * | renderer_base: Make creation of the rasterizer, the responsibility of the renderers themselvesLioncash2018-08-214-14/+12
| |/
* | Merge pull request #1129 from lioncash/headerbunnei2018-08-2111-8/+40
|\ \
| * | service/filesystem: Use forward declarations where applicableLioncash2018-08-219-5/+28
| * | romfs_factory: Remove unnecessary includes and use forward declarations where applicableLioncash2018-08-213-3/+12
* | | Merge pull request #1132 from Subv/gl_FragDepthbunnei2018-08-211-1/+6
|\ \ \
| * | | Shaders: Implement depth writing in fragment shaders.Subv2018-08-211-1/+6
* | | | Merge pull request #1134 from lioncash/logbunnei2018-08-211-1/+1
|\ \ \ \
| * | | | renderer_opengl: Use LOG_DEBUG for GL_DEBUG_SEVERITY_NOTIFICATION and GL_DEBUG_SEVERITY_LOW logsLioncash2018-08-211-1/+1
* | | | | Merge pull request #1121 from Subv/tex_reinterpretbunnei2018-08-214-16/+70
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Rasterizer: Reinterpret the raw texture bytes instead of blitting (and thus doing format conversion) to a new texture when a game requests an old texture address with a different format.Subv2018-08-201-3/+49
| * | | | Rasterizer: Don't attempt to copy over the old texture's data when doing a format reinterpretation if we're only going to clear the framebuffer.Subv2018-08-204-13/+21
| | |_|/ | |/| |
* | | | Merge pull request #1133 from lioncash/guardbunnei2018-08-211-0/+2
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_stream_buffer: Add missing header guardLioncash2018-08-211-0/+2
* | | | Merge pull request #1126 from lioncash/telembunnei2018-08-211-4/+4
|\ \ \ \
| * | | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()Lioncash2018-08-211-4/+4
* | | | | Merge pull request #1131 from bunnei/impl-tex3d-texcubebunnei2018-08-212-2/+21
|\ \ \ \ \
| * | | | | shader_bytecode: Replace some UNIMPLEMENTED logs.bunnei2018-08-211-2/+6
| * | | | | gl_shader_decompiler: Implement Texture3D for TEXS.bunnei2018-08-211-0/+7
| * | | | | gl_shader_decompiler: Implement TextureCube for TEX.bunnei2018-08-211-0/+8
* | | | | | Merge pull request #1106 from Subv/multiple_rendertargetsbunnei2018-08-212-6/+45
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Shaders: Write all the enabled color outputs when a fragment shader exits.Subv2018-08-212-6/+45
* | | | | | Merge pull request #1130 from Subv/tex_2dbunnei2018-08-211-6/+15
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | Shaders: Fixed the coords in TEX with Texture2D.Subv2018-08-211-1/+1
| * | | | | Shaders: Log and crash when using an unimplemented texture type in a texture sampling instruction.Subv2018-08-211-5/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ \ \ \
| * | | | | acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| * | | | | acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| * | | | | acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| * | | | | acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| * | | | | profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| * | | | | profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| * | | | | profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| * | | | | profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| * | | | | profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| * | | | | profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| * | | | | profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| * | | | | profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| * | | | | profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #1125 from bunnei/update-dynarmicbunnei2018-08-211-0/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | externals: Update dynarmic to a42f301c.bunnei2018-08-211-0/+0
| | |/ / | |/| |
* | | | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-218-20/+100
|\ \ \ \
| * | | | registration: Add Data_Unknown5 NCAContentTypeZach Hilman2018-08-203-2/+3
| * | | | filesystem: Add support for loading of system archivesZach Hilman2018-08-197-20/+99
* | | | | Merge pull request #1127 from yuzu-emu/revert-838-port-3616James Rowe2018-08-211-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | Revert "Port #3616 from Citra: "appveyor: set jobs to 4 for mingw""Zach Hilman2018-08-211-1/+1
|/ / / /
* | | | Merge pull request #1064 from lioncash/telemetrybunnei2018-08-213-62/+84
|\ \ \ \ | |_|/ / |/| | |
| * | | common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-153-62/+84
* | | | Merge pull request #1104 from Subv/instanced_arraysbunnei2018-08-202-4/+30
|\ \ \ \
| * | | | GLRasterizer: Implemented instanced vertex arrays.Subv2018-08-182-4/+30
| | |_|/ | |/| |
* | | | Merge pull request #1115 from Subv/texs_maskbunnei2018-08-201-18/+18
|\ \ \ \
| * | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-201-18/+18
* | | | | Merge pull request #1112 from Subv/sampler_typesbunnei2018-08-203-33/+250
|\ \ \ \ \
| * | | | | Shader: Implemented the TLD4 and TLD4S opcodes using GLSL's textureGather.Subv2018-08-191-0/+51
| * | | | | Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions.Subv2018-08-192-29/+127
| * | | | | Shader: Added bitfields for the texture type of the various sampling instructions.Subv2018-08-191-1/+65
| * | | | | Shaders: Added decodings for TLD4 and TLD4SSubv2018-08-191-3/+7
* | | | | | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ \ \ \ \
| * | | | | | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2013-74/+440
|\ \ \ \ \ \
| * | | | | | Better UUID randomnessDavid Marcec2018-08-111-2/+7
| * | | | | | Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| * | | | | | Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| * | | | | | Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| * | | | | | Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| * | | | | | fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| * | | | | | Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| * | | | | | Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| * | | | | | Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| * | | | | | If statement style changeDavid Marcec2018-08-111-11/+19
| * | | | | | Second round of account changesDavid Marcec2018-08-113-18/+21
| * | | | | | First round of account changesDavid Marcec2018-08-113-49/+55
| * | | | | | Rebase with dynarmic masterDavid Marcec2018-08-111-0/+0
| * | | | | | Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| * | | | | | Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1179-635/+1570
| |\ \ \ \ \ \
| * | | | | | | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| * | | | | | | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| * | | | | | | Open first user addedDavid Marcec2018-08-081-1/+3
| * | | | | | | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| * | | | | | | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| * | | | | | | began initial implementation of "ProfileManager"David Marcec2018-08-085-44/+202
| * | | | | | | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
* | | | | | | | Merge pull request #1120 from ogniK5377/rgba8-uintbunnei2018-08-204-45/+58
|\ \ \ \ \ \ \ \
| * | | | | | | | Implemented RGBA8_UINTDavid Marcec2018-08-204-45/+58
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1119 from lioncash/uninitbunnei2018-08-201-2/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | game_list: Avoid uninitialized variables when retrieving program IDLioncash2018-08-201-2/+2
|/ / / / / / /
* | | | | | | Merge pull request #1089 from Subv/neg_bitsbunnei2018-08-192-16/+38
|\ \ \ \ \ \ \
| * | | | | | | Shaders: Corrected the 'abs' and 'neg' bit usage in the float arithmetic instructions.Subv2018-08-182-16/+38
* | | | | | | | Merge pull request #1105 from Subv/convert_negbunnei2018-08-191-2/+0
|\ \ \ \ \ \ \ \
| * | | | | | | | Shader: Remove an unneeded assert, the negate bit is implemented for conversion instructions.Subv2018-08-181-2/+0
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1113 from Subv/texs_maskbunnei2018-08-191-6/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-191-6/+11
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1102 from ogniK5377/mirror-clamp-edgebunnei2018-08-193-0/+6
|\ \ \ \ \ \ \ \
| * | | | | | | | Added check to see if ARB_texture_mirror_clamp_to_edge is supportedDavid Marcec2018-08-192-0/+4
| * | | | | | | | Added WrapMode MirrorOnceClampToEdgeDavid Marcec2018-08-181-0/+2
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1101 from Subv/ssy_stackbunnei2018-08-191-3/+36
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | Shaders: Implemented a stack for the SSY/SYNC instructions.Subv2018-08-181-3/+36
| |/ / / / / /
* | | | | | | Merge pull request #1109 from Subv/ldg_decodebunnei2018-08-191-0/+4
|\ \ \ \ \ \ \
| * | | | | | | Shaders: Added decodings for the LDG and STG instructions.Subv2018-08-191-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #1108 from Subv/front_facingbunnei2018-08-192-0/+7
|\ \ \ \ \ \ \
| * | | | | | | Shaders: Implemented the gl_FrontFacing input attribute (attr 63).Subv2018-08-192-0/+7
| |/ / / / / /
* | | | | | | Merge pull request #1103 from Subv/lop_predbunnei2018-08-192-11/+39
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | |
| * | | | | | Shader: Implemented the predicate and mode arguments of LOP.Subv2018-08-182-11/+39
| |/ / / / /
* | | | | | Merge pull request #838 from FearlessTobi/port-3616James Rowe2018-08-181-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Port #3616 from CitrafearlessTobi2018-07-261-1/+1
* | | | | | Merge pull request #1100 from ogniK5377/missing-predbunnei2018-08-182-5/+8
|\ \ \ \ \ \
| * | | | | | Added predcondition GreaterThanWithNanDavid Marcec2018-08-182-5/+8
|/ / / / / /
* | | | | | Merge pull request #1096 from bunnei/supported-blitsbunnei2018-08-181-2/+0
|\ \ \ \ \ \
| * | | | | | gl_rasterizer_cache: Remove asserts for supported blits.bunnei2018-08-171-2/+0
* | | | | | | Merge pull request #1097 from bunnei/gl-criticalbunnei2018-08-171-1/+1
|\ \ \ \ \ \ \
| * | | | | | | renderer_opengl: Treat OpenGL errors as critical.bunnei2018-08-171-1/+1
| |/ / / / / /
* | | | | | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
* | | | | | | Merge pull request #1090 from lioncash/ctor-assignbunnei2018-08-171-0/+6
|\ \ \ \ \ \ \
| * | | | | | | core: Delete System copy/move constructors and assignment operatorsLioncash2018-08-161-0/+6
* | | | | | | | Merge pull request #1091 from lioncash/warningbunnei2018-08-171-78/+83
|\ \ \ \ \ \ \ \
| * | | | | | | | qt/main: Unindent code in OnMenuInstallToNAND()Lioncash2018-08-161-70/+70
| * | | | | | | | qt/main: Make installation dialog text within OnMenuInstallToNAND() translatableLioncash2018-08-161-14/+15
| * | | | | | | | qt/main: Get rid of compilation warningsLioncash2018-08-161-4/+8
| |/ / / / / / /
* | | | | | | | Merge pull request #1093 from greggameplayer/GetDefaultDisplayResolutionChangeEventbunnei2018-08-172-1/+13
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | correct coding stylegreggameplayer2018-08-161-1/+1
| * | | | | | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
* | | | | | | | Merge pull request #1019 from Subv/vertex_divisorbunnei2018-08-177-5/+28
|\ \ \ \ \ \ \ \
| * | | | | | | | Rasterizer: Implemented instanced rendering.Subv2018-08-157-5/+28
* | | | | | | | | Merge pull request #1087 from MerryMage/dynarmicbunnei2018-08-172-0/+3
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | dynarmic: Update to 550d662MerryMage2018-08-162-0/+3
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1084 from bunnei/depthbunnei2018-08-172-16/+26
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | |
| * | | | | | | | gl_rasterizer_cache: Treat Depth formats differently from DepthStencil.bunnei2018-08-162-16/+26
* | | | | | | | | Merge pull request #1085 from lioncash/namespacebunnei2018-08-164-12/+22
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | common: Namespace hex_util.h/.cppLioncash2018-08-164-12/+22
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1075 from lioncash/includebunnei2018-08-164-35/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | loader/nca: Remove unnecessary includes and member variablesLioncash2018-08-152-20/+11
| * | | | | | | loader/xci: Remove unnecessary includes and member variablesLioncash2018-08-152-15/+11
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-1634-80/+1437
|\ \ \ \ \ \ \
| * | | | | | | registration: Various style and documentation improvementsZach Hilman2018-08-123-18/+22
| * | | | | | | registration: Add support for force overwrite of installedZach Hilman2018-08-124-53/+106
| * | | | | | | game_list: Split game list scans to multiple functionsZach Hilman2018-08-122-9/+16
| * | | | | | | vfs_real: Add CreateFullPath to Create* operationsZach Hilman2018-08-122-13/+6
| * | | | | | | control_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-2/+1
| * | | | | | | romfs: Remove cyclic shared_ptr leak in romfs codeZach Hilman2018-08-123-8/+8
| * | | | | | | registration: Update documentation and styleZach Hilman2018-08-125-42/+69
| * | | | | | | nca_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-3/+2
| * | | | | | | bis_factory: Create NAND dirs if they don't existZach Hilman2018-08-121-2/+9
| * | | | | | | qt: Use custom RawCopy with progress bar for installsZach Hilman2018-08-121-2/+28
| * | | | | | | registration: Take RawCopy function as parameterZach Hilman2018-08-122-10/+15
| * | | | | | | game_list: Populate control data from installed NANDZach Hilman2018-08-122-31/+35
| * | | | | | | registered_cache: Fix missing reading from yuzu_metaZach Hilman2018-08-121-7/+16
| * | | | | | | file_sys: Comply to style guidelinesZach Hilman2018-08-128-47/+60
| * | | | | | | qt: Add 'Install to NAND' option to menuZach Hilman2018-08-125-1/+99
| * | | | | | | game_list: Modify game list to scan installed titlesZach Hilman2018-08-121-0/+45
| * | | | | | | file_sys: Add RegisteredCacheZach Hilman2018-08-122-0/+543
| * | | | | | | file_sys: Add support for parsing NCA metadata (CNMT)Zach Hilman2018-08-123-0/+238
| * | | | | | | card_image: Add accessor for all NCAs in XCIZach Hilman2018-08-122-0/+5
| * | | | | | | vfs_real: Add CreateFullPath to CreateFileZach Hilman2018-08-121-3/+6
| * | | | | | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
| * | | | | | | bis_factory: Add partial implementation of BISFactoryZach Hilman2018-08-122-0/+54
| * | | | | | | loader: Join 0* files in directory if filename is 00Zach Hilman2018-08-121-1/+33
| * | | | | | | loader: Recognize filename '00' as NCAZach Hilman2018-08-121-0/+2
| * | | | | | | vfs: Add ConcatenatedVfsFileZach Hilman2018-08-122-0/+134
| * | | | | | | crypto: Remove hex utilities from key_managerZach Hilman2018-08-122-36/+2
| * | | | | | | file_util: Add getter for NAND registration directoryZach Hilman2018-08-122-0/+8
| * | | | | | | common: Move hex string processing to separate fileZach Hilman2018-08-123-0/+64
* | | | | | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| * | | | | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
* | | | | | | | Merge pull request #1079 from lioncash/fmtbunnei2018-08-165-14/+18
|\ \ \ \ \ \ \ \
| * | | | | | | | loader: Make ResultStatus directly compatible with fmtLioncash2018-08-155-14/+18
| |/ / / / / / /
* | | | | | | | Merge pull request #1051 from B3n30/UnscheduleEventThreadsafebunnei2018-08-163-1/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | Core::CoreTiming: add UnscheduleEventThreadsafeB3n302018-08-133-1/+12
* | | | | | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1083 from Subv/conv_negbunnei2018-08-161-13/+53
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Shader/Conversion: Implemented the negate bit in F2F and I2I instructions.Subv2018-08-151-4/+12
| * | | | | | | | | Shader/I2F: Implemented the negate I2F_C instruction variant.Subv2018-08-151-7/+23
| * | | | | | | | | Shader/F2I: Implemented the negate bit in the I2F instructionSubv2018-08-151-0/+4
| * | | | | | | | | Shader/F2I: Implemented the F2I_C instruction variant.Subv2018-08-151-2/+10
| * | | | | | | | | Shader/F2I: Implemented the negate bit in the F2I instruction.Subv2018-08-151-0/+4
* | | | | | | | | | Merge pull request #1081 from lioncash/convertbunnei2018-08-153-3/+8
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/server_session: Add IsSession() member functionLioncash2018-08-153-3/+8
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1077 from bunnei/rgba16ubunnei2018-08-151-1/+9
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_rasterizer_cache: Add RGBA16U to PixelFormatFromTextureFormat.bunnei2018-08-151-1/+9
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1076 from bunnei/format-cleanupbunnei2018-08-152-41/+71
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | gl_rasterizer_cache: Cleanup some PixelFormat names and logging.bunnei2018-08-152-41/+71
|/ / / / / / / /
* | | | | | | | Merge pull request #1069 from bunnei/vtx-szbunnei2018-08-151-5/+20
|\ \ \ \ \ \ \ \
| * | | | | | | | maxwell_to_gl: Properly handle UnsignedInt/SignedInt sizes.bunnei2018-08-151-5/+20
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1070 from bunnei/cbuf-szbunnei2018-08-151-3/+3
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_rasterizer: Fix upload size for constant buffers.bunnei2018-08-151-3/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #1071 from bunnei/fix-ldcbunnei2018-08-151-13/+22
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_decompiler: Several fixes for indirect constant buffer loads.bunnei2018-08-151-13/+22
| |/ / / / / / /
* | | | | | | | Merge pull request #1068 from bunnei/g8r8sbunnei2018-08-152-34/+49
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | gl_rasterizer_cache: Implement G8R8S format.bunnei2018-08-152-34/+49
| |/ / / / / /
* | | | | | | Merge pull request #1067 from lioncash/initbunnei2018-08-151-3/+3
|\ \ \ \ \ \ \
| * | | | | | | emu_window: Ensure WindowConfig members are always initializedLioncash2018-08-151-3/+3
| |/ / / / / /
* | | | | | | Merge pull request #1073 from lioncash/3dsbunnei2018-08-156-17/+0
|\ \ \ \ \ \ \
| * | | | | | | loader: Remove address mapping remnants from citraLioncash2018-08-156-17/+0
| |/ / / / / /
* | | | | | | Merge pull request #1072 from lioncash/svcbunnei2018-08-151-2/+5
|\ \ \ \ \ \ \
| * | | | | | | kernel/svc: Log svcBreak parametersLioncash2018-08-151-2/+5
| |/ / / / / /
* | | | | | | Merge pull request #1063 from lioncash/inlinebunnei2018-08-152-15/+11
|\ \ \ \ \ \ \
| * | | | | | | common/xbyak_abi: Mark defined functions in header as inlineLioncash2018-08-151-7/+7
| * | | | | | | common/xbyak: Use nested namespace specifiers where applicableLioncash2018-08-152-8/+4
| |/ / / / / /
* | | | | | | Merge pull request #1074 from greggameplayer/Z16_UNORMbunnei2018-08-151-0/+2
|\ \ \ \ \ \ \
| * | | | | | | Implement Z16_UNORM in PixelFormatFromTextureFormat functiongreggameplayer2018-08-151-0/+2
|/ / / / / / /
* | | | | | | Merge pull request #1054 from zhaowenlan1779/misc-fixupbunnei2018-08-151-1/+1
|\ \ \ \ \ \ \
| * | | | | | | common/misc: use windows.hZhu PengFei2018-08-131-1/+1
* | | | | | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ \ \ \ \
| * | | | | | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| * | | | | | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
* | | | | | | | | Merge pull request #1066 from lioncash/aarch64bunnei2018-08-151-0/+2
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | CMakeLists: Add architecture detection for AArch64Lioncash2018-08-151-0/+2
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1062 from lioncash/unusedbunnei2018-08-153-141/+0
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | common: Remove unused old breakpoint source filesLioncash2018-08-153-141/+0
|/ / / / / / / /
* | | | | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1058 from greggameplayer/BC7U_Fixbunnei2018-08-141-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | Fix BC7Ugreggameplayer2018-08-141-1/+1
* | | | | | | | | Merge pull request #1050 from bunnei/rgba16-unormbunnei2018-08-144-37/+48
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UNORM.bunnei2018-08-144-37/+48
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1060 from lioncash/logJames Rowe2018-08-141-2/+3
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | |
| * | | | | | | | logging/backend: Use const reference to refer to log filterLioncash2018-08-141-2/+3
|/ / / / / / / /
* | | | | | | | Merge pull request #1046 from ogniK5377/missing-channelsMat M2018-08-146-0/+148
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| * | | | | | | Added missing channel devicesDavid Marcec2018-08-135-0/+144
* | | | | | | | Merge pull request #1052 from ogniK5377/xenobunnei2018-08-134-7/+45
|\ \ \ \ \ \ \ \
| * | | | | | | | Implement RG32UI and R32UIDavid Marcec2018-08-134-7/+45
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1033 from MerryMage/interpbunnei2018-08-137-3/+267
|\ \ \ \ \ \ \ \
| * | | | | | | | audio_renderer: samples_remaining counts frames, not samplesMerryMage2018-08-131-1/+1
| * | | | | | | | audio_core: InterpolateMerryMage2018-08-135-0/+121
| * | | | | | | | audio_core: Implement low-pass filterMerryMage2018-08-133-2/+145
* | | | | | | | | Merge pull request #1053 from MerryMage/rm-IsExecutingbunnei2018-08-131-3/+1
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | arm_dynarmic: Remove IsExecuting check from PrepareRescheduleMerryMage2018-08-131-3/+1
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1049 from bunnei/vtx-size-8Mat M2018-08-131-0/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8.bunnei2018-08-131-0/+1
* | | | | | | | | Merge pull request #1032 from lioncash/sanitizebunnei2018-08-131-10/+10
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()Lioncash2018-08-121-10/+10
* | | | | | | | | | Merge pull request #1031 from lioncash/verbositybunnei2018-08-132-7/+7
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | card_image: Use type aliases to shorten definitionsLioncash2018-08-122-6/+6
| * | | | | | | | | | card_image: Simplify return statement of GetSubdirectories()Lioncash2018-08-121-1/+1
| |/ / / / / / / / /
* | | | | | | | | | Merge pull request #1048 from lioncash/atomicbunnei2018-08-132-8/+9
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | |
| * | | | | | | | | kernel/object: Tighten object against data racesLioncash2018-08-132-8/+9
* | | | | | | | | | Merge pull request #1047 from bunnei/rgba16-uintbunnei2018-08-134-34/+45
|\ \ \ \ \ \ \ \ \ \
| * | | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UINT.bunnei2018-08-134-34/+45
|/ / / / / / / / / /
* | | | | | | | | | Merge pull request #1045 from bunnei/rg8-unormbunnei2018-08-134-26/+61
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | |
| * | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RG8_UNORM.bunnei2018-08-134-26/+61
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1044 from bunnei/linestripbunnei2018-08-131-0/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | maxwell_to_gl: Implement PrimitiveTopology::LineStrip.bunnei2018-08-131-0/+2
|/ / / / / / / /
* | | | | | | | Merge pull request #1043 from Subv/timingbunnei2018-08-133-2/+11
|\ \ \ \ \ \ \ \
| * | | | | | | | CPU/Timing: Use an approximated amortized amount of ticks when advancing timing.Subv2018-08-132-1/+11
| * | | | | | | | Kernel/SVC: Don't reschedule the current core when creating a new thread.Subv2018-08-131-1/+0
* | | | | | | | | Merge pull request #1036 from lioncash/threadbunnei2018-08-133-7/+7
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | scheduler: Make HaveReadyThreads() a const member functionLioncash2018-08-122-2/+2
| * | | | | | | | | thread_queue_list: Make contains() and get_first() const member functionsLioncash2018-08-121-4/+4
| * | | | | | | | | thread_queue_list: Convert typedef to a type aliasLioncash2018-08-121-1/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1042 from Subv/racesbunnei2018-08-134-5/+13
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Core/HLE: Make the 'reschedule_pending' flag atomic.Subv2018-08-131-1/+1
| * | | | | | | | | CPU/HLE: Lock the HLE mutex before performing a reschedule.Subv2018-08-131-0/+3
| * | | | | | | | | Kernel/Threads: Lock the HLE mutex when executing the wakeup callback.Subv2018-08-131-0/+5
| * | | | | | | | | Kernel/Thread: Always use the threadsafe option when scheduling wakeups.Subv2018-08-132-4/+4
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1041 from Subv/duplicated_mutexbunnei2018-08-132-2/+22
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.Subv2018-08-122-2/+22
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1040 from bunnei/xmadbunnei2018-08-132-4/+120
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | gl_shader_decompiler: Implement XMAD instruction.bunnei2018-08-132-4/+120
* | | | | | | | | | Merge pull request #1039 from lioncash/typebunnei2018-08-134-11/+17
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | |
| * | | | | | | | | vfs: Make VfsFilesystem constructor explicitLioncash2018-08-121-1/+1
| * | | | | | | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-124-10/+16
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1025 from ogniK5377/bad-castbunnei2018-08-124-4/+4
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | made ResultStatus a u16David Marcec2018-08-123-3/+3
| * | | | | | | | | Fixed invalid cast in loaderDavid Marcec2018-08-121-1/+1
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1038 from MerryMage/lock-cubebbunnei2018-08-121-0/+6
|\ \ \ \ \ \ \ \ \
| * | | | | | | | | cubeb_sink: Protect queue with a mutexMerryMage2018-08-121-0/+6
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | |
| * | | | | | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-123-6/+42
|\ \ \ \ \ \ \ \
| * | | | | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-122-5/+3
| * | | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-123-6/+44
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1034 from lioncash/hidbunnei2018-08-121-5/+12
|\ \ \ \ \ \ \ \
| * | | | | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
| * | | | | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| | |_|/ / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1030 from bunnei/sdl2-2.0.8bunnei2018-08-121-1/+1
|\ \ \ \ \ \ \ \
| * | | | | | | | externals: Update to SDL2-2.0.8.bunnei2018-08-121-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1006 from degasus/stream_bufferbunnei2018-08-126-303/+176
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | gl_rasterizer: Use a shared helper to upload from CPU memory.Markus Wick2018-08-122-28/+33
| * | | | | | | gl_state: Don't track constant buffer mappings.Markus Wick2018-08-123-41/+3
| * | | | | | | gl_rasterizer: Use the stream buffer for constant buffers.Markus Wick2018-08-124-29/+32
| * | | | | | | gl_rasterizer: Use the streaming buffer itself for the constant buffer.Markus Wick2018-08-122-33/+15
| * | | | | | | gl_rasterizer: Use a helper for aligning the buffer.Markus Wick2018-08-122-15/+22
| * | | | | | | Update the stream_buffer helper from Citra.Markus Wick2018-08-124-184/+98
|/ / / / / / /
* | | | | | | Merge pull request #1029 from bunnei/fix-out-attribbunnei2018-08-121-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_decompiler: Fix SetOutputAttributeToRegister empty check.bunnei2018-08-121-2/+2
|/ / / / / /
* | | | | | Merge pull request #922 from lioncash/cmakebunnei2018-08-121-6/+6
|\ \ \ \ \ \
| * | | | | | CMakeLists: lowercase find_library usageLioncash2018-08-121-1/+1
| * | | | | | CMakeLists: Change MSVC14 variable to MSVC_VERSIONLioncash2018-08-121-5/+5
* | | | | | | Merge pull request #1026 from ogniK5377/retro-city-rampagebunnei2018-08-121-1/+8
|\ \ \ \ \ \ \
| * | | | | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1027 from bunnei/fix-kilbunnei2018-08-121-0/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_decompiler: Fix GLSL compiler error with KIL instruction.bunnei2018-08-121-0/+8
|/ / / / / /
* | | | | | Merge pull request #1022 from bunnei/fix-splatbunnei2018-08-122-2/+103
|\ \ \ \ \ \
| * | | | | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| * | | | | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| * | | | | | server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
* | | | | | | Merge pull request #1020 from lioncash/namespacebunnei2018-08-1214-22/+44
|\ \ \ \ \ \ \
| * | | | | | | core: Namespace EmuWindowLioncash2018-08-1214-22/+44
| |/ / / / / /
* | | | | | | Merge pull request #1021 from lioncash/warnbunnei2018-08-121-1/+1
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Silence implicit truncation warning in SetupShaders()Lioncash2018-08-121-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #1024 from Subv/blend_glbunnei2018-08-122-0/+40
|\ \ \ \ \ \ \
| * | | | | | | GPU/Maxwell3D: Implemented an alternative set of blend factors.Subv2018-08-122-0/+40
| |/ / / / / /
* | | | | | | Merge pull request #1023 from Subv/invalid_attribsbunnei2018-08-122-1/+11
|\ \ \ \ \ \ \
| * | | | | | | RasterizerGL: Ignore invalid/unset vertex attributes.Subv2018-08-122-1/+11
| |/ / / / / /
* / / / / / / Implement R8_UINT RenderTargetFormat & PixelFormat (#1014)greggameplayer2018-08-124-55/+74
|/ / / / / /
* | | | | | Merge pull request #1010 from bunnei/unk-vert-attrib-shaderbunnei2018-08-122-10/+11
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Improve handling of unknown input/output attributes.bunnei2018-08-122-10/+11
* | | | | | | Merge pull request #1009 from bunnei/rg8-rgba8-snormbunnei2018-08-124-64/+93
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Implement render target format RG8_SNORM.bunnei2018-08-124-8/+18
| * | | | | | | gl_rasterizer: Implement render target format RGBA8_SNORM.bunnei2018-08-124-64/+83
| |/ / / / / /
* | | | | | | Merge pull request #970 from DarkLordZach/loader-errorsbunnei2018-08-1217-179/+248
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | game_list: Reorder error checksZach Hilman2018-08-101-2/+1
| * | | | | | loader: Add more descriptive errorsZach Hilman2018-08-1017-179/+249
* | | | | | | Merge pull request #1018 from Subv/ssy_syncbunnei2018-08-122-8/+38
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | GPU/Shader: Don't predicate instructions that don't have a predicate field (SSY).Subv2018-08-112-2/+13
| * | | | | | GPU/Shaders: Implemented SSY and SYNC as a way to modify control flow during shader execution.Subv2018-08-111-6/+25
* | | | | | | Merge pull request #1016 from lioncash/videobunnei2018-08-118-35/+44
|\ \ \ \ \ \ \
| * | | | | | | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-118-30/+44
| * | | | | | | renderer_base: Remove unused kFramebuffer enumerationLioncash2018-08-111-3/+0
| * | | | | | | video_core: Remove unused Renderer enumerationLioncash2018-08-111-2/+0
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1003 from lioncash/varbunnei2018-08-112-4/+2
|\ \ \ \ \ \ \
| * | | | | | | video_core: Use variable template variants of type_traits interfaces where applicableLioncash2018-08-102-4/+2
* | | | | | | | Implement R16S & R16UI & R16I RenderTargetFormats & PixelFormats and more (R16_UNORM needed by Fate Extella) (#848)greggameplayer2018-08-114-19/+92
| |_|/ / / / / |/| | | | | |
* | | | | | | Merge pull request #1015 from lioncash/gamelistJames Rowe2018-08-111-13/+12
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | qt/game_list: Resolve truncation warning within GameListItemPath's constructorLioncash2018-08-111-4/+4
| * | | | | | gt/game_list: Use std::array in GameListItemPath's data() functionLioncash2018-08-111-7/+8
| * | | | | | qt/game_list: Remove redundant base class constructor from initializer listLioncash2018-08-111-3/+1
|/ / / / / /
* | | | | | Merge pull request #1007 from MerryMage/dynarmicbunnei2018-08-101-0/+0
|\ \ \ \ \ \
| * | | | | | dynarmic: Update to 0118ee0MerryMage2018-08-101-0/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1011 from bunnei/misc-vtx-fmtbunnei2018-08-101-0/+3
|\ \ \ \ \ \
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-101-0/+1
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_32_32_32.bunnei2018-08-101-0/+2
|/ / / / / /
* | | | | | Merge pull request #1004 from lioncash/unusedbunnei2018-08-103-8/+6
|\ \ \ \ \ \
| * | | | | | gl_rasterizer_cache: Remove unused viewport parameter of GetFramebufferSurfaces()Lioncash2018-08-103-8/+6
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1008 from yuzu-emu/revert-697-disable-depth-cullbunnei2018-08-101-3/+1
|\ \ \ \ \ \
| * | | | | | Revert "gl_state: Temporarily disable culling and depth test."bunnei2018-08-101-3/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1002 from bunnei/refactor-tex-fmtbunnei2018-08-105-181/+31
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | textures: Refactor out for Texture/Depth FormatFromPixelFormat.bunnei2018-08-105-181/+31
|/ / / / /
* | | | | Merge pull request #995 from bunnei/gl-buff-boundsbunnei2018-08-101-10/+12
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | gl_rasterizer_cache: Add bounds checking for gl_buffer copies.bunnei2018-08-101-10/+12
* | | | | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \ \ \ \
| * | | | | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| * | | | | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
* | | | | | Merge pull request #989 from lioncash/logbunnei2018-08-102-0/+16
|\ \ \ \ \ \
| * | | | | | common/logging: Add missing service log categoriesLioncash2018-08-082-0/+16
* | | | | | | Merge pull request #990 from lioncash/entrybunnei2018-08-102-9/+12
|\ \ \ \ \ \ \
| * | | | | | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-092-8/+10
| * | | | | | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
| |/ / / / / /
* | | | | | | Merge pull request #1001 from lioncash/reservebunnei2018-08-101-0/+2
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Reserve element memory beforehand in BuildRegisterList()Lioncash2018-08-091-0/+2
* | | | | | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-1021-129/+602
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | vfs: Fix documentationZach Hilman2018-08-092-2/+4
| * | | | | | | vfs: Fix typo in VfsFilesystem docsZach Hilman2018-08-092-4/+5
| * | | | | | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-094-24/+37
| * | | | | | | loader: Remove unused IdentifyFile overloadZach Hilman2018-08-092-12/+0
| * | | | | | | vfs: Use RealVfsFilesystem for fs-operations in RealVfsDirectoryZach Hilman2018-08-091-2/+10
| * | | | | | | file_sys: Add missing include in savedata_factoryZach Hilman2018-08-091-0/+1
| * | | | | | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-0912-22/+52
| * | | | | | | vfs: Add unreachable assert to file permissions converterZach Hilman2018-08-091-1/+3
| * | | | | | | vfs: Add RealVfsFilesystem implementationZach Hilman2018-08-092-81/+290
| * | | | | | | file_util: Add platform-specific slash option to SanitizePathZach Hilman2018-08-092-5/+16
| * | | | | | | vfs: Add VfsFilesystem interface and default implementationZach Hilman2018-08-092-3/+211
| * | | | | | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
* | | | | | | | Merge pull request #991 from bunnei/ignore-macbunnei2018-08-101-4/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | maxwell_3d: Ignore macros that have not been uploaded yet.bunnei2018-08-091-4/+9
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Implement SNORM for BC5/DXN2 (#998)Khangaroo2018-08-102-38/+55
* | | | | | | | Merge pull request #999 from lioncash/mapbunnei2018-08-101-2/+4
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | |
| * | | | | | | gl_rasterizer_cache: Avoid iterator invalidation issues within InvalidateRegion()Lioncash2018-08-091-2/+4
|/ / / / / / /
* | | | | | | Merge pull request #992 from bunnei/declr-predbunnei2018-08-091-4/+5
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Declare predicates on use.bunnei2018-08-091-4/+5
| |/ / / / / /
* | | | | | | Merge pull request #994 from lioncash/constbunnei2018-08-091-7/+9
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer_cache: Invert conditional in LoadGLBuffer()Lioncash2018-08-091-5/+5
| * | | | | | | gl_rasterizer_cache: Use std::vector::assign in LoadGLBuffer() for the non-tiled caseLioncash2018-08-091-4/+6
| * | | | | | | gl_rasterizer_cache: Make pointer const in LoadGLBuffer()Lioncash2018-08-091-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #993 from bunnei/smo-vtx-ptsbunnei2018-08-091-0/+3
|\ \ \ \ \ \ \
| * | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_16_16_16_16.bunnei2018-08-091-0/+1
| * | | | | | | maxwell_to_gl: Implement PrimitiveTopology::Points.bunnei2018-08-091-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #984 from bunnei/rt-nonebunnei2018-08-091-0/+5
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer: Do not render when no render target is configured.bunnei2018-08-091-0/+5
* | | | | | | | Implement BC5/DXN2 (#996)Khangaroo2018-08-093-33/+45
* | | | | | | | Merge pull request #988 from lioncash/colorbunnei2018-08-091-19/+31
|\ \ \ \ \ \ \ \
| * | | | | | | | common/color: Remove unnecessary const qualifiers on return typesLioncash2018-08-081-7/+7
| * | | | | | | | common/color: Get rid of undefined behaviorLioncash2018-08-081-12/+24
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #977 from bunnei/bgr565bunnei2018-08-092-0/+4
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_rasterizer_cached: Implement RenderTargetFormat::B5G6R5_UNORM.bunnei2018-08-082-0/+4
* | | | | | | | | Merge pull request #987 from lioncash/vecbunnei2018-08-091-3/+3
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | |
| * | | | | | | | vector_math: Use variable template version of is_signed in Vec classesLioncash2018-08-081-3/+3
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #982 from bunnei/stub-unk-63bunnei2018-08-092-0/+9
|\ \ \ \ \ \ \ \
| * | | | | | | | gl_shader_decompiler: Stub input attribute Unknown_63.bunnei2018-08-082-0/+9
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | |
| * | | | | | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #976 from bunnei/shader-immbunnei2018-08-092-11/+6
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Let OpenGL interpret floats.bunnei2018-08-082-11/+6
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #981 from bunnei/cbuf-corruptbunnei2018-08-094-3/+12
|\ \ \ \ \ \ \
| * | | | | | | maxwell_3d: Use correct const buffer size and check bounds.bunnei2018-08-084-3/+12
| |/ / / / / /
* | | | | | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | |
| * | | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
| |/ / / / /
* | | | | | Merge pull request #985 from bunnei/rt-r11g11b10bunnei2018-08-091-0/+1
|\ \ \ \ \ \
| * | | | | | gpu: Add R11G11B10_FLOAT to RenderTargetBytesPerPixel.bunnei2018-08-081-0/+1
| |/ / / / /
* | | | | | Merge pull request #979 from bunnei/vtx88bunnei2018-08-091-0/+1
|\ \ \ \ \ \
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-081-0/+1
| |/ / / / /
* | | | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ \ \
| * | | | | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ / / / /
* | | | | | Merge pull request #980 from bunnei/fix-logsbunnei2018-08-082-2/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | renderer_opengl: Use trace log in a few places.bunnei2018-08-082-2/+2
| |/ / / /
* | | | | Merge pull request #966 from lioncash/modernizebunnei2018-08-085-11/+11
|\ \ \ \ \
| * | | | | common: Convert type traits templates over to variable template versions where applicableLioncash2018-08-085-11/+11
* | | | | | Merge pull request #850 from DarkLordZach/icon-metabunnei2018-08-0825-21/+491
|\ \ \ \ \ \
| * | | | | | configure_gamelist: Use explicit QVariant constructorZach Hilman2018-08-071-2/+4
| * | | | | | loader: Add icon and title support to XCIZach Hilman2018-08-077-5/+46
| * | | | | | Fix missing qjpeg DLLZach Hilman2018-08-072-0/+7
| * | | | | | Use const where applicableZach Hilman2018-08-074-7/+7
| * | | | | | Avoid parsing RomFS to directory in NCAZach Hilman2018-08-0718-19/+439
* | | | | | | Merge pull request #968 from lioncash/vecbunnei2018-08-081-180/+182
|\ \ \ \ \ \ \
| * | | | | | | vector_math: Remove unimplemented function prototypesLioncash2018-08-081-23/+0
| * | | | | | | vector_math: Make functions constexpr where applicableLioncash2018-08-081-154/+179
| * | | | | | | vector_math: Convert typedefs to type aliasesLioncash2018-08-081-3/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #969 from lioncash/lz4bunnei2018-08-081-1/+1
|\ \ \ \ \ \ \
| * | | | | | | externals/CMakeLists: Add EXCLUDE_FROM_ALL to lz4's add_subdirectory() commandLioncash2018-08-081-1/+1
* | | | | | | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #972 from lioncash/catchbunnei2018-08-085-4/+4
|\ \ \ \ \ \ \
| * | | | | | | externals: Update catch to 2.3.0Lioncash2018-08-085-4/+4
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-083-126/+0
|\ \ \ \ \ \ \
| * | | | | | | hle: Remove unused romfs.cpp/.hLioncash2018-08-083-126/+0
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ \ \ \ \ \
| * | | | | | | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
* | | | | | | | Merge pull request #983 from mailwl/hid-fixMat M2018-08-081-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ / / / / / /
* | | | | | | acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
* | | | | | | Merge pull request #967 from lioncash/signbunnei2018-08-081-4/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | file_util: Avoid sign-conversions in WriteArray() and ReadArray()Lioncash2018-08-071-4/+8
* | | | | | | Merge pull request #971 from DarkLordZach/mbedtls-2.12.0bunnei2018-08-081-0/+0
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | externals/mbedtls: Update to mbedtls v2.12.0Zach Hilman2018-08-081-0/+0
|/ / / / / /
* | | | | | Merge pull request #964 from Hexagon12/lower-logsbunnei2018-08-081-4/+4
|\ \ \ \ \ \
| * | | | | | Lowered down the logging for methodsHexagon122018-08-071-4/+4
* | | | | | | Fixed the sRGB pixel format (#963)Hexagon122018-08-081-1/+2
| |_|/ / / / |/| | | | |
* | | | | | Merge pull request #920 from DarkLordZach/titlekeybunnei2018-08-072-7/+39
|\ \ \ \ \ \
| * | | | | | content_archive: Add support for titlekey cryptographyZach Hilman2018-08-042-7/+39
* | | | | | | Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ \ \ \ \ \ \
| * | | | | | | nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ \ \ \ \ \
| * | | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ \ \ \ \ \
| * | | | | | | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ / / / / /
* | | | | | | Merge pull request #950 from lioncash/hotkeybunnei2018-08-078-119/+159
|\ \ \ \ \ \ \
| * | | | | | | qt/hotkey: Get rid of global hotkey map instanceLioncash2018-08-078-119/+159
| |/ / / / / /
* | | | | | | Merge pull request #948 from hcorion/fix-mbedtls-installing-filesbunnei2018-08-072-2/+2
|\ \ \ \ \ \ \
| * | | | | | | Make mbedtls and cubeb not install headers and librariesZion Nimchuk2018-08-072-2/+2
* | | | | | | | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ \ \ \ \ \ \
| * | | | | | | | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| * | | | | | | | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #959 from KAMiKAZOW/cubeb-compilationbunnei2018-08-071-2/+2
|\ \ \ \ \ \ \ \
| * | | | | | | | Make building cubeb optionalKAMiKAZOW2018-08-071-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | |
| * | | | | | | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| * | | | | | | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/ / / / / /
* | | | | | | Merge pull request #952 from lioncash/usbbunnei2018-08-076-0/+259
|\ \ \ \ \ \ \
| * | | | | | | service: Add usb servicesLioncash2018-08-076-0/+259
| |/ / / / / /
* | | | | | | Merge pull request #949 from lioncash/privbunnei2018-08-073-7/+21
|\ \ \ \ \ \ \
| * | | | | | | client_port: Make all data members privateLioncash2018-08-073-7/+21
| |/ / / / / /
* | | | | | | Merge pull request #951 from lioncash/gladbunnei2018-08-072-3190/+3218
|\ \ \ \ \ \ \
| * | | | | | | externals: Update glad to 0.1.26Lioncash2018-08-072-3190/+3218
| |/ / / / / /
* | | | | | | Merge pull request #961 from DarkLordZach/nca-as-drd-scopebunnei2018-08-071-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | loader: Fix scope error in DeconstructedRomDirectoryZach Hilman2018-08-071-1/+1
|/ / / / / /
* | | | | | Merge pull request #931 from DarkLordZach/nca-as-drdbunnei2018-08-074-37/+24
|\ \ \ \ \ \
| * | | | | | loader: Make AppLoader_NCA rely on directory loading codeZach Hilman2018-08-064-37/+24
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #947 from lioncash/encodingbunnei2018-08-071-13/+17
|\ \ \ \ \ \
| * | | | | | game_list: Remove unnecessary conversion to std::string in ValidateEntry()Lioncash2018-08-061-8/+10
| * | | | | | game_list: Use QString::fromStdString() where applicable instead of c_str()Lioncash2018-08-061-5/+7
* | | | | | | GDBStub works with both Unicorn and Dynarmic now (#941)Hedges2018-08-075-9/+26
* | | | | | | Merge pull request #943 from lioncash/declbunnei2018-08-071-7/+7
|\ \ \ \ \ \ \
| * | | | | | | game_list: Join declarations and assignments in onTextChanged()Lioncash2018-08-061-7/+7
| |/ / / / / /
* | | | | | | Merge pull request #946 from lioncash/compressbunnei2018-08-071-10/+8
|\ \ \ \ \ \ \
| * | | | | | | qt/main: Avoid sign conversions in UpdateRecentFiles()Lioncash2018-08-061-4/+6
| * | | | | | | qt/main: Collapse if statement in UpdateRecentFiles()Lioncash2018-08-061-6/+2
| |/ / / / / /
* | | | | | | Merge pull request #944 from lioncash/menubunnei2018-08-071-2/+8
|\ \ \ \ \ \ \
| * | | | | | | qt: Don't show error dialog when canceling the Load Folder dialogLioncash2018-08-061-2/+8
| |/ / / / / /
* | | | | | | Merge pull request #942 from lioncash/defaultbunnei2018-08-0714-24/+26
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | qt/game_list_p: Remove redundant base class constructor invocationsLioncash2018-08-061-1/+2
| * | | | | | qt: Add missing override specifiers where applicableLioncash2018-08-065-7/+9
| * | | | | | qt: Default destructors where applicableLioncash2018-08-069-16/+15
| |/ / / / /
* | | | | | Merge pull request #940 from lioncash/privatebunnei2018-08-072-5/+9
|\ \ \ \ \ \
| * | | | | | kernel/event: Make data members privateLioncash2018-08-062-5/+9
| |/ / / / /
* | | | | | Merge pull request #936 from bunnei/avoid-copiesbunnei2018-08-073-6/+21
|\ \ \ \ \ \
| * | | | | | maxwell_3d: Remove outdated assert.bunnei2018-08-061-2/+0
| * | | | | | gl_rasterizer_cache: Avoid superfluous surface copies.bunnei2018-08-062-4/+21
* | | | | | | Merge pull request #934 from lioncash/chronobunnei2018-08-074-16/+16
|\ \ \ \ \ \ \
| * | | | | | | perf_stats: Correct literal used for MAX_LAG_TIME_USLioncash2018-08-061-2/+2
| * | | | | | | core_timing: Make GetGlobalTimeUs() return std::chrono::microsecondsLioncash2018-08-064-14/+14
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #945 from lioncash/existJames Rowe2018-08-061-8/+6
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | qt/main: Better file-existence checking within OnMenuRecentFile() and UpdateUITheme()Lioncash2018-08-061-8/+6
|/ / / / / /
* | | | | | Merge pull request #933 from lioncash/memorybunnei2018-08-061-12/+11
|\ \ \ \ \ \
| * | | | | | memory: Make prototype parameter names match their definitionsLioncash2018-08-061-5/+5
| * | | | | | memory: Correct prototype of ZeroBlockLioncash2018-08-061-1/+1
| * | | | | | memory: Remove unnecessary const qualifiers in prototypesLioncash2018-08-061-9/+8
| |/ / / / /
* | | | | | Merge pull request #937 from mailwl/audout-fixMat M2018-08-061-2/+0
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
|/ / / / /
* | | | | Merge pull request #932 from lioncash/funcbunnei2018-08-062-9/+9
|\ \ \ \ \
| * | | | | core_timing: Convert typedef into a type aliasLioncash2018-08-061-4/+4
| * | | | | core_timing: Use transparent functors where applicableLioncash2018-08-061-5/+5
| |/ / / /
* | | | | Merge pull request #929 from lioncash/addrbunnei2018-08-062-83/+89
|\ \ \ \ \
| * | | | | gdbstub: Use type alias for breakpoint mapsLioncash2018-08-051-37/+42
| * | | | | gdbstub: Move all file-static variables into the GDBStub namespaceLioncash2018-08-051-35/+36
| * | | | | gdbstub: Replace PAddr alias with VAddrLioncash2018-08-052-14/+14
* | | | | | Merge pull request #930 from lioncash/threadbunnei2018-08-061-15/+15
|\ \ \ \ \ \
| * | | | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()Lioncash2018-08-051-15/+15
| |/ / / / /
* | | | | | Merge pull request #925 from bunnei/audrenbunnei2018-08-0619-294/+652
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | audio_core: Implement audren_u audio playback.bunnei2018-08-055-218/+451
| * | | | | audio_core: Use s16 where possible for audio samples.bunnei2018-08-059-36/+27
| * | | | | audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-055-11/+126
| * | | | | cubeb_sink: Support variable sample_rate and num_channels.bunnei2018-08-041-15/+25
| * | | | | audio_core: Sinks need unique names as well.bunnei2018-08-045-9/+14
| * | | | | audio_core: Streams need unique names for CoreTiming.bunnei2018-08-045-10/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #927 from bunnei/fix-texsbunnei2018-08-051-2/+5
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Fix TEXS mask and dest.bunnei2018-08-051-2/+5
* | | | | | Merge pull request #912 from lioncash/global-varbunnei2018-08-0519-80/+110
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-045-11/+15
| * | | | | video_core: Eliminate the g_renderer global variableLioncash2018-08-0419-74/+100
* | | | | | Merge pull request #928 from MerryMage/dynarmicMat M2018-08-051-0/+0
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | externals: Update dynarmic to 4f96c63MerryMage2018-08-051-0/+0
|/ / / / /
* | | | | Merge pull request #926 from ogniK5377/vertex-attrib-formatbunnei2018-08-051-2/+8
|\ \ \ \ \
| * | | | | added braces for conditionsDavid Marcec2018-08-051-2/+3
| * | | | | fix the attrib format for intsDavid Marcec2018-08-051-2/+7
| | |/ / / | |/| | |
* | | | | Merge pull request #924 from lioncash/arpbunnei2018-08-056-0/+97
|\ \ \ \ \
| * | | | | service: Add arp servicesLioncash2018-08-056-0/+97
| |/ / / /
* | | | | Merge pull request #921 from lioncash/viewbunnei2018-08-055-35/+35
|\ \ \ \ \
| * | | | | aes_util: Add static assertion to Transcode() and XTSTranscode() to ensure well-defined behaviorLioncash2018-08-041-0/+4
| * | | | | aes_util: Make CalculateNintendoTweak() an internally linked functionLioncash2018-08-042-12/+10
| * | | | | aes_util: Make Transcode() a const member functionLioncash2018-08-042-8/+9
| * | | | | core/crypto: Remove unnecessary includesLioncash2018-08-044-5/+5
| * | | | | key_manager: Use regular std::string instead of std::string_viewLioncash2018-08-042-10/+7
| |/ / / /
* | | | | Merge pull request #923 from lioncash/pragmabunnei2018-08-055-10/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/ / / /
* | | | Merge pull request #849 from DarkLordZach/xcibunnei2018-08-0439-80/+1404
|\ \ \ \
| * | | | Add missing parameter to files.push_back()Zach Hilman2018-08-011-5/+5
| * | | | Fix merge conflicts with opus and update docsZach Hilman2018-08-015-11/+13
| * | | | Use more descriptive error codes and messagesZach Hilman2018-08-019-34/+101
| * | | | Use static const instead of const staticZach Hilman2018-08-011-2/+2
| * | | | Use ErrorEncrypted where applicable and fix no keys crashZach Hilman2018-08-014-17/+37
| * | | | Add missing includes and use const where applicableZach Hilman2018-08-0111-24/+40
| * | | | Allow key loading from %YUZU_DIR%/keys in addition to ~/.switchZach Hilman2018-08-015-7/+23
| * | | | Use SHGetKnownFolderPath instead of SHGetFolderPathAZach Hilman2018-08-011-3/+4
| * | | | Make XCI comply to review and style guidelinesZach Hilman2018-08-0116-482/+223
| * | | | Extract mbedtls to cpp fileZach Hilman2018-08-015-87/+127
| * | | | Add missing string.h includeZach Hilman2018-08-011-0/+1
| * | | | Update mbedtls and fix compile errorZach Hilman2018-08-012-0/+1
| * | | | Remove files that are not usedZach Hilman2018-08-0136-43/+1462
* | | | | Merge pull request #919 from lioncash/signbunnei2018-08-041-8/+9
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | gl_shader_manager: Invert conditional in SetShaderUniformBlockBinding()Lioncash2018-08-041-7/+9
| * | | | gl_shader_manager: Amend sign differences in an assertion comparison in SetShaderUniformBlockBinding()Lioncash2018-08-041-3/+2
* | | | | Merge pull request #911 from lioncash/prototypebunnei2018-08-041-3/+0
|\ \ \ \ \
| * | | | | video_core: Remove unimplemented Start() function prototypeLioncash2018-08-031-3/+0
* | | | | | Merge pull request #913 from lioncash/unused-funcbunnei2018-08-041-16/+0
|\ \ \ \ \ \
| * | | | | | memory: Remove unused GetSpecialHandlers() functionLioncash2018-08-031-16/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #914 from lioncash/codesetbunnei2018-08-045-20/+41
|\ \ \ \ \ \
| * | | | | | kernel/process: Use std::array where applicableLioncash2018-08-031-1/+2
| * | | | | | kernel/process: Use accessors instead of class members for referencing segment arrayLioncash2018-08-035-20/+40
| |/ / / / /
* | | | | | Merge pull request #917 from lioncash/crashbunnei2018-08-043-13/+38
|\ \ \ \ \ \
| * | | | | | kernel/thread: Fix potential crashes introduced in 26de4bb521b1ace7af76eff4f6956cb23ac0d58cLioncash2018-08-043-13/+38
| |/ / / / /
* | | | | | Merge pull request #910 from lioncash/unusedbunnei2018-08-031-2/+0
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_decompiler: Remove unused variable in GenerateDeclarations()Lioncash2018-08-031-2/+0
| |/ / / /
* | | | | Merge pull request #908 from lioncash/memorybunnei2018-08-0316-559/+29
|\ \ \ \ \
| * | | | | core/memory: Get rid of 3DS leftoversLioncash2018-08-0316-559/+29
* | | | | | Merge pull request #909 from lioncash/constbunnei2018-08-031-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | gl_shader_manager: Make ProgramManager's GetCurrentProgramStage() a const member functionLioncash2018-08-031-1/+1
|/ / / / /
* | | | | Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-039-8/+95
* | | | | Merge pull request #895 from lioncash/sinkbunnei2018-08-031-5/+8
|\ \ \ \ \
| * | | | | sink_details: Deduplicate long std::function repetitionLioncash2018-08-021-4/+6
| * | | | | sink_details: std::move std::function instancesLioncash2018-08-021-1/+2
* | | | | | Merge pull request #898 from lioncash/migbunnei2018-08-036-0/+55
|\ \ \ \ \ \
| * | | | | | service: Add migration servicesLioncash2018-08-026-0/+55
* | | | | | | Merge pull request #900 from lioncash/initbunnei2018-08-031-5/+5
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | math_util: Always initialize members of RectangleLioncash2018-08-021-5/+5
| |/ / / / /
* | | | | | Merge pull request #892 from lioncash/globalbunnei2018-08-0313-64/+54
|\ \ \ \ \ \
| * | | | | | video_core: Make global EmuWindow instance part of the base renderer classLioncash2018-08-0213-64/+54
* | | | | | | Merge pull request #894 from lioncash/objectbunnei2018-08-0344-156/+186
|\ \ \ \ \ \ \
| * | | | | | | kernel: Move object class to its own source filesLioncash2018-08-0244-156/+186
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #904 from lioncash/staticbunnei2018-08-031-8/+6
|\ \ \ \ \ \ \
| * | | | | | | kernel/thread: Make GetFreeThreadLocalSlot()'s loop indices size_tLioncash2018-08-021-8/+5
| * | | | | | | kernel/thread: Make GetFreeThreadLocalSlot() reference parameter a const referenceLioncash2018-08-021-1/+2
| * | | | | | | kernel/thread: Make GetFreeThreadLocalSlot() internally linkedLioncash2018-08-021-1/+1
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #906 from lioncash/overridebunnei2018-08-033-19/+8
|\ \ \ \ \ \ \
| * | | | | | | input_common: Use std::move where applicableLioncash2018-08-032-5/+6
| * | | | | | | input_common: Add missing override specifiersLioncash2018-08-033-14/+2
| |/ / / / / /
* | | | | | | Merge pull request #907 from lioncash/slotbunnei2018-08-037-46/+49
|\ \ \ \ \ \ \
| * | | | | | | yuzu: Use Qt 5 signal/slots where applicableLioncash2018-08-037-46/+49
| |/ / / / / /
* | | | | | | Merge pull request #905 from lioncash/vmabunnei2018-08-033-23/+23
|\ \ \ \ \ \ \
| * | | | | | | kernel/vm_manager: Convert loop into std::any_of()Lioncash2018-08-021-4/+4
| * | | | | | | kernel/vm_manager: Use const where applicableLioncash2018-08-023-19/+19
| * | | | | | | kernel/vm_manager: Use the VAddr type alias in CarveVMA()Lioncash2018-08-021-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #903 from lioncash/copybunnei2018-08-031-3/+6
|\ \ \ \ \ \ \
| * | | | | | | vfs_vector: Remove unused variable in FindAndRemoveVectorElement()Lioncash2018-08-021-2/+2
| * | | | | | | vfs_vector: Avoid unnecessary copies where applicableLioncash2018-08-021-2/+5
| |/ / / / / /
* | | | | | | Merge pull request #901 from lioncash/refbunnei2018-08-031-2/+2
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_manager: Take ShaderSetup instances by const reference in UseProgrammableVertexShader() and UseProgrammableFragmentShader()Lioncash2018-08-021-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #899 from lioncash/unusedbunnei2018-08-027-334/+0
|\ \ \ \ \ \ \
| * | | | | | | hw: Remove unused filesLioncash2018-08-027-334/+0
| |/ / / / / /
* | | | | | | Merge pull request #902 from lioncash/arraybunnei2018-08-021-2/+3
|\ \ \ \ \ \ \
| * | | | | | | gl_state: Make texture_units a std::arrayLioncash2018-08-021-2/+3
| |/ / / / / /
* | | | | | | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \ \ \ \ \ \
| * | | | | | | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
| | |_|/ / / / | |/| | | | |
* | | | | | | Implement RGB32F PixelFormat (#886) (used by Go Vacation)greggameplayer2018-08-023-9/+23
* | | | | | | Merge pull request #893 from lioncash/pscbunnei2018-08-026-1/+99
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | logging/log: Remove incorrect description in PCV doc commentLioncash2018-08-021-1/+1
| * | | | | | service: Add psc servicesLioncash2018-08-026-0/+98
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #896 from lioncash/audio-outbunnei2018-08-022-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | audio_out: Use Buffer::Tag alias in GetTagsAndReleaseBuffers()'s prototypeLioncash2018-08-022-2/+2
|/ / / / /
* | | | | Merge pull request #888 from lioncash/capsbunnei2018-08-026-0/+173
|\ \ \ \ \
| * | | | | service: Add capture servicesLioncash2018-08-016-0/+173
| |/ / / /
* | | | | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \ \ \ \
| * | | | | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/ / / /
* | | | | Merge pull request #889 from lioncash/fspbunnei2018-08-026-0/+89
|\ \ \ \ \
| * | | | | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-016-0/+89
| |/ / / /
* | | | | Merge pull request #887 from lioncash/pcvbunnei2018-08-028-0/+183
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | service: Add bpc and pcv servicesLioncash2018-08-018-0/+183
|/ / / /
* | | | Merge pull request #885 from greggameplayer/R32-Floatbunnei2018-08-013-0/+5
|\ \ \ \
| * | | | Implement R32_FLOAT RenderTargetFormatUnknown2018-08-013-0/+5
|/ / / /
* | | | Merge pull request #882 from lioncash/unusedbunnei2018-08-011-6/+0
|\ \ \ \ | |/ / / |/| | |
| * | | kernel/thread: Remove unimplemented function prototypeLioncash2018-08-011-6/+0
* | | | Merge pull request #871 from bunnei/audio-configbunnei2018-08-0112-21/+330
|\ \ \ \ | |/ / / |/| | |
| * | | audio_core: Add configuration settings.bunnei2018-08-0112-21/+330
* | | | Merge pull request #877 from lioncash/removebunnei2018-08-016-104/+0
|\ \ \ \
| * | | | kernel: Remove unused object_address_table.cpp/.hLioncash2018-07-316-104/+0
* | | | | Merge pull request #880 from lioncash/audiobunnei2018-08-0114-2/+289
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service/audio: Add missing servicesLioncash2018-08-0114-2/+289
* | | | | Merge pull request #876 from lioncash/includebunnei2018-08-0123-28/+47
|\ \ \ \ \
| * | | | | kernel: Remove unnecessary includesLioncash2018-07-3123-28/+47
| | |/ / / | |/| | |
* | | | | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
* | | | | Merge pull request #864 from FearlessTobi/port-3973bunnei2018-07-311-2/+30
|\ \ \ \ \
| * | | | | remove polymorphism issueB3n302018-07-291-2/+30
* | | | | | Merge pull request #869 from Subv/ubsanbunnei2018-07-314-8/+23
|\ \ \ \ \ \
| * | | | | | MacroInterpreter: Avoid left shifting negative values.Subv2018-07-312-2/+6
| * | | | | | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| * | | | | | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #875 from lioncash/fgmbunnei2018-07-316-0/+96
|\ \ \ \ \ \
| * | | | | | service: Add fgm servicesLioncash2018-07-316-0/+96
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #874 from lioncash/ambunnei2018-07-318-0/+156
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | |
| * | | | | service/am: Add missing am servicesLioncash2018-07-318-0/+156
| |/ / / /
* | | | | Merge pull request #870 from lioncash/initbunnei2018-07-311-9/+7
|\ \ \ \ \
| * | | | | arm_dynarmic: Make SetTlsAddress() prototype and definition consistentLioncash2018-07-311-1/+1
| * | | | | arm_dynarmic: Remove unnecessary qualifying of ThreadContextLioncash2018-07-311-3/+3
| * | | | | arm_dynarmic: Correct initializer list orderLioncash2018-07-311-5/+3
| |/ / / /
* | | | | Merge pull request #872 from lioncash/pciebunnei2018-07-316-0/+85
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | service: Add the pcie serviceLioncash2018-07-316-0/+85
|/ / / /
* | | | Merge pull request #855 from bunnei/cubebbunnei2018-07-3121-39/+473
|\ \ \ \
| * | | | audio_core: Implement Sink and SinkStream interfaces with cubeb.bunnei2018-07-3110-6/+269
| * | | | audio_core: Add interfaces for Sink and SinkStream.bunnei2018-07-316-0/+163
| * | | | audio_core: Misc. improvements to stream/buffer/audio_out.bunnei2018-07-315-20/+32
| * | | | audio_core: Move to audout_u impl.bunnei2018-07-314-13/+6
| * | | | externals: Add cubeb for audio output.bunnei2018-07-312-0/+3
* | | | | Port #3758 from Citra (#852): Add missing std::string import in text_formatterTobias2018-07-311-0/+1
|/ / / /
* | | | Implemented various hwopus functions (#853)David2018-07-316-6/+139
* | | | Merge pull request #861 from FearlessTobi/port-3972bunnei2018-07-302-81/+31
|\ \ \ \
| * | | | Port #3972 from Citra: "common/timer: use std::chrono, avoid platform-dependent code"zhupengfei2018-07-292-81/+31
| | |/ / | |/| |
* | | | Merge pull request #862 from FearlessTobi/port-3997bunnei2018-07-301-3/+5
|\ \ \ \
| * | | | common/string_utils: replace boost::transform with std counterpartzhupengfei2018-07-291-3/+5
| |/ / /
* | | | Merge pull request #867 from MerryMage/dynarmicMat M2018-07-301-0/+0
|\ \ \ \
| * | | | externals: Update dynarmic to 73d3efcMerryMage2018-07-301-0/+0
|/ / / /
* | | | Merge pull request #859 from FearlessTobi/port-3837bunnei2018-07-302-3/+4
|\ \ \ \
| * | | | Port #3837 from Citra: "Add build date in about dialog"fearlessTobi2018-07-292-3/+4
| |/ / /
* | | | Port #3769 from Citra: "Update Dark theme to latest version"Tobias2018-07-303-321/+471
* | | | Merge pull request #858 from lioncash/castbunnei2018-07-301-3/+2
|\ \ \ \
| * | | | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()Lioncash2018-07-291-3/+2
| |/ / /
* | | | Merge pull request #860 from FearlessTobi/port-3911bunnei2018-07-305-6/+3
|\ \ \ \
| * | | | Port #3911 from Citra: "Optimize settings application"fearlessTobi2018-07-295-6/+3
| |/ / /
* | | | Merge pull request #863 from FearlessTobi/port-3913bunnei2018-07-301-1/+0
|\ \ \ \
| * | | | Port #3913 from Citra: "citra_qt: Remove obsolete application attribute"fearlessTobi2018-07-291-1/+0
| |/ / /
* | | | Merge pull request #865 from FearlessTobi/port-3732bunnei2018-07-302-4/+2
|\ \ \ \
| * | | | Port #3732 from Citra: "common: Fix compilation on ARM"Cameron Cawley2018-07-292-4/+2
| |/ / /
* | | | Merge pull request #857 from lioncash/wlanbunnei2018-07-306-1/+194
|\ \ \ \
| * | | | service: Add wlan servicesLioncash2018-07-296-1/+194
| |/ / /
* | | | Merge pull request #856 from lioncash/btmbunnei2018-07-306-0/+142
|\ \ \ \
| * | | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| * | | | service: Add btm servicesLioncash2018-07-296-0/+108
| |/ / /
* / / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ / /
* | | Merge pull request #847 from lioncash/ncmbunnei2018-07-286-0/+80
|\ \ \
| * | | service: Add ncm servicesLioncash2018-07-276-0/+80
* | | | Merge pull request #846 from lioncash/miibunnei2018-07-286-0/+128
|\ \ \ \
| * | | | service: Add mii servicesLioncash2018-07-276-0/+128
| | |_|/ | |/| |
* | | | Merge pull request #842 from bunnei/audio-corebunnei2018-07-2812-94/+459
|\ \ \ \
| * | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| * | | | core: Add AudioCore to global state.bunnei2018-07-282-0/+9
| * | | | audio_core: Add initial code for keeping track of audout state.bunnei2018-07-288-1/+336
| | |/ / | |/| |
* | | | Merge pull request #696 from DarkLordZach/romfsbunnei2018-07-2812-20/+351
|\ \ \ \ | |/ / / |/| | |
| * | | RomFS ExtractionZach Hilman2018-07-2812-20/+351
|/ / /
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-276-0/+243
|\ \ \
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| * | | service: Add nfc servicesLioncash2018-07-276-0/+204
| |/ /
* | | Merge pull request #839 from FearlessTobi/actually-port-3594bunnei2018-07-271-0/+16
|\ \ \
| * | | Port #3594 from CitrafearlessTobi2018-07-261-0/+16
| | |/ | |/|
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-276-0/+111
|\ \ \
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-273-3/+37
| * | | service: Add the lbl serviceLioncash2018-07-274-0/+77
| | |/ | |/|
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-274-1/+93
|\ \ \ | |/ / |/| |
| * | service: Add the btdrv serviceLioncash2018-07-274-1/+93
* | | Merge pull request #837 from lioncash/privbunnei2018-07-272-8/+20
|\ \ \
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-262-8/+20
* | | | Merge pull request #833 from lioncash/irsbunnei2018-07-276-0/+352
|\ \ \ \ | |_|/ / |/| | |
| * | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
| * | | service/hid: Add the xcd:sys serviceLioncash2018-07-264-0/+57
| * | | service/hid: Add irs servicesLioncash2018-07-264-0/+75
|/ / /
* | | Merge pull request #836 from FearlessTobi/port-3594bunnei2018-07-262-0/+4
|\ \ \
| * | | Port #3665 from CitrafearlessTobi2018-07-262-0/+4
| | |/ | |/|
* | | Merge pull request #835 from FearlessTobi/port-minor-prsbunnei2018-07-262-2/+2
|\ \ \
| * | | Port #3702 from CitrafearlessTobi2018-07-261-1/+1
| * | | Port #3641 from CitrafearlessTobi2018-07-261-1/+1
| |/ /
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-264-0/+50
|\ \ \
| * | | service: Add the grc:c serviceLioncash2018-07-264-0/+50
| | |/ | |/|
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-264-0/+143
|\ \ \
| * | | service: Add the nim servicesLioncash2018-07-264-0/+143
| |/ /
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-266-0/+164
|\ \ \
| * | | service: Add ldn servicesLioncash2018-07-266-0/+164
| |/ /
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-266-0/+95
|\ \ \
| * | | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-264-0/+66
| * | | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/ /
* | | Merge pull request #808 from lioncash/mem-dedupbunnei2018-07-261-14/+22
|\ \ \
| * | | video_core/memory_manager: Replace a loop with std::array's fill() function in PageSlot()Lioncash2018-07-241-3/+1
| * | | video_core/memory_manager: Avoid repeated unnecessary page slot lookupsLioncash2018-07-241-11/+21
* | | | Merge pull request #829 from Subv/r16f_rtbunnei2018-07-262-1/+4
|\ \ \ \ | |_|_|/ |/| | |
| * | | GPU: Allow using R16F as a render target format.Subv2018-07-262-1/+4
|/ / /
* | | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ \
| * | | lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| * | | lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| * | | lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
* | | | Merge pull request #825 from greggameplayer/R16_G16bunnei2018-07-264-19/+100
|\ \ \ \ | |_|_|/ |/| | |
| * | | Implement R16_G16Unknown2018-07-264-19/+100
* | | | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-264-0/+101
|\ \ \ \
| * | | | service: Add ldr servicesLioncash2018-07-264-0/+101
* | | | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-266-0/+143
|\ \ \ \ \
| * | | | | service: Add eupld servicesLioncash2018-07-264-0/+72
| * | | | | service: Add the erpt servicesLioncash2018-07-264-0/+71
| | |_|/ / | |/| | |
* | | | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-269-141/+30
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service/nifm: Deduplicate interface codeLioncash2018-07-259-141/+30
* | | | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \ \ \
| * | | | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| * | | | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ / / /
* | | | | Merge pull request #822 from lioncash/pmbunnei2018-07-264-0/+90
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | service: Add pm servicesLioncash2018-07-254-0/+90
| |/ / /
* | | | Merge pull request #820 from lioncash/esMat M2018-07-264-0/+77
|\ \ \ \
| * | | | service: Add the es serviceLioncash2018-07-254-0/+77
| |/ / /
* | | | Merge pull request #821 from lioncash/waitMat M2018-07-261-0/+4
|\ \ \ \ | |_|/ / |/| | |
| * | | wait_tree: Add missing switch case for WaitTreeThread::GetText()Lioncash2018-07-251-0/+4
| |/ /
* | | Merge pull request #819 from Subv/srgbbunnei2018-07-252-9/+17
|\ \ \ | |/ / |/| |
| * | GPU: Use the right texture format for sRGBA framebuffers.Subv2018-07-252-9/+17
* | | Merge pull request #801 from lioncash/timeMat M2018-07-256-64/+16
|\ \ \
| * | | time: Add the time:a serviceLioncash2018-07-253-10/+11
| * | | time: Simplify interface creationLioncash2018-07-246-64/+15
* | | | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \ \ \
| * | | | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
| | |_|/ | |/| |
* | | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-2512-114/+146
|\ \ \ \
| * | | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-2412-105/+137
| * | | | CMakeLists: Sort filenamesMerryMage2018-07-241-9/+9
* | | | | Merge pull request #802 from lioncash/unreachbunnei2018-07-251-0/+3
|\ \ \ \ \
| * | | | | wait_tree: Silence warning about all code paths not returning a valueLioncash2018-07-241-0/+3
| | |_|/ / | |/| | |
* | | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \ \
| * | | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| * | | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| |/ / / /
* | | | | Merge pull request #813 from Subv/z24_s8_texbunnei2018-07-251-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | GPU: Allow the use of Z24S8 as a texture format.Subv2018-07-251-0/+4
|/ / / /
* | | | Merge pull request #816 from Subv/z32_s8bunnei2018-07-254-1/+16
|\ \ \ \
| * | | | GPU: Implemented the Z32_S8_X24 depth buffer format.Subv2018-07-254-1/+16
* | | | | Merge pull request #815 from Subv/z32f_texbunnei2018-07-251-0/+4
|\ \ \ \ \
| * | | | | GPU: Allow using Z32 as a texture format.Subv2018-07-251-0/+4
| |/ / / /
* | | | | Merge pull request #814 from Subv/rt_r8bunnei2018-07-252-0/+4
|\ \ \ \ \
| * | | | | GPU: Allow the usage of R8 as a render target format.Subv2018-07-252-0/+4
| |/ / / /
* | | | | Merge pull request #818 from MerryMage/dynarmicbunnei2018-07-251-0/+0
|\ \ \ \ \
| * | | | | externals: Update dynarmic to 98e2380MerryMage2018-07-251-0/+0
|/ / / / /
* | | | | Merge pull request #809 from lioncash/rasterizerbunnei2018-07-252-16/+13
|\ \ \ \ \
| * | | | | gl_rasterizer: Replace magic number with GL_INVALID_INDEX in SetupConstBuffers()Lioncash2018-07-241-3/+5
| * | | | | gl_rasterizer: Use std::string_view instead of std::string when checking for extensionsLioncash2018-07-241-1/+3
| * | | | | gl_rasterizer: Use in-class member initializers where applicableLioncash2018-07-242-12/+5
| | |_|_|/ | |/| | |
* | | | | Merge pull request #811 from Subv/code_address_assertbunnei2018-07-251-8/+0
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | GPU: Remove the assert that required the CODE_ADDRESS to be 0.Subv2018-07-241-8/+0
| |/ / /
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-256-48/+15
|\ \ \ \
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| * | | | friend: Deduplicate interfacesLioncash2018-07-246-48/+11
| |/ / /
* | | | Merge pull request #810 from Subv/r16bunnei2018-07-253-5/+32
|\ \ \ \
| * | | | GPU: Implemented the R16 and R16F texture formats.Subv2018-07-243-5/+32
| |/ / /
* | | | Merge pull request #805 from lioncash/signbunnei2018-07-241-4/+7
|\ \ \ \
| * | | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
| |/ / /
* | | | Merge pull request #807 from lioncash/unusedbunnei2018-07-241-29/+0
|\ \ \ \ | |/ / / |/| | |
| * | | deconstructed_rom_directory: Remove unused FindRomFS() functionLioncash2018-07-241-29/+0
|/ / /
* | | Merge pull request #798 from lioncash/constbunnei2018-07-242-3/+3
|\ \ \
| * | | arm_dynarmic: Make MakeJit() a const member functionLioncash2018-07-242-3/+3
| |/ /
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-245-5/+5
|\ \ \
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-245-5/+5
| |/ /
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ /
* | | Merge pull request #799 from Subv/tex_r32fbunnei2018-07-243-6/+19
|\ \ \
| * | | GPU: Implement texture format R32F.Subv2018-07-243-6/+19
* | | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ \
| * | | | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
* | | | | Merge pull request #796 from bunnei/gl-uintbunnei2018-07-241-0/+3
|\ \ \ \ \
| * | | | | maxwell_to_gl: Implement VertexAttribute::Type::UnsignedInt.bunnei2018-07-241-0/+3
* | | | | | Merge pull request #789 from bunnei/tex-wrap-borderbunnei2018-07-244-11/+13
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | gl_rasterizer: Implement texture border color.bunnei2018-07-243-11/+11
| * | | | | maxwell_to_gl: Implement Texture::WrapMode::Border.bunnei2018-07-241-0/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \ \ \
| * | | | | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| * | | | | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| | |_|/ / | |/| | |
* | | | | Merge pull request #785 from lioncash/fsbunnei2018-07-241-3/+3
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | partition_filesystem: Use std::move where applicableLioncash2018-07-241-3/+3
* | | | | Merge pull request #791 from bunnei/rg32f-rgba32f-bgra8bunnei2018-07-245-12/+70
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RG32_FLOAT.bunnei2018-07-245-7/+25
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RGBA32_FLOAT.bunnei2018-07-242-10/+34
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat BGRA8_UNORM.bunnei2018-07-244-8/+22
| * | | | gl_rasterizer_cache: Add missing log statements.bunnei2018-07-241-0/+2
* | | | | Merge pull request #792 from lioncash/retvalbunnei2018-07-241-2/+2
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | gl_shader_decompiler: Correct return value of WriteTexsInstruction()Lioncash2018-07-241-2/+2
| | |_|/ | |/| |
* | | | Merge pull request #790 from bunnei/shader-print-instrbunnei2018-07-241-1/+2
|\ \ \ \
| * | | | gl_shader_decompiler: Print instruction value in shader comments.bunnei2018-07-241-1/+2
| | |/ / | |/| |
* | | | Merge pull request #788 from bunnei/shader-check-zerobunnei2018-07-241-0/+6
|\ \ \ \
| * | | | gl_shader_decompiler: Check if SetRegister result is ZeroIndex.bunnei2018-07-241-0/+6
| |/ / /
* | / / VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-245-37/+75
| |/ / |/| |
* | | Merge pull request #787 from bunnei/tldsbunnei2018-07-241-29/+43
|\ \ \
| * | | gl_shader_decompiler: Implement shader instruction TLDS.bunnei2018-07-241-29/+43
* | | | Merge pull request #786 from lioncash/exclusivebunnei2018-07-243-22/+18
|\ \ \ \
| * | | | exclusive_monitor: Use consistent type alias for u64Lioncash2018-07-243-22/+18
| | |_|/ | |/| |
* | | | Merge pull request #784 from lioncash/loaderbunnei2018-07-241-1/+1
|\ \ \ \
| * | | | loader: Remove unnecessary constructor call in IdentifyFile()Lioncash2018-07-231-1/+1
| |/ / /
* | | | Merge pull request #783 from lioncash/linkerbunnei2018-07-242-7/+4
|\ \ \ \
| * | | | linker: Remove unused parameter from WriteRelocations()Lioncash2018-07-232-7/+4
| |/ / /
* | | | Merge pull request #782 from lioncash/filebunnei2018-07-242-14/+33
|\ \ \ \ | |_|/ / |/| | |
| * | | nro: Replace inclusion with a forward declarationLioncash2018-07-232-1/+8
| * | | nro: Make bracing consistentLioncash2018-07-231-10/+24
| * | | nro: Make constructor explicitLioncash2018-07-231-1/+1
| * | | nro: Remove unused forward declarationLioncash2018-07-231-2/+0
| |/ /
* | | Merge pull request #781 from lioncash/declbunnei2018-07-241-5/+5
|\ \ \
| * | | gl_shader_decompiler: Simplify GetCommonDeclarations()Lioncash2018-07-231-5/+5
| | |/ | |/|
* | | Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ \ \
| * | | vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| * | | vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
| |/ /
* | | Merge pull request #779 from lioncash/sharedbunnei2018-07-248-263/+0
|\ \ \ | |_|/ |/| |
| * | hle: Remove config_mem.h/.cppLioncash2018-07-236-102/+0
| * | hle: Remove shared_page.h/.cppLioncash2018-07-236-161/+0
| |/
* | Merge pull request #695 from DarkLordZach/nro-assetbunnei2018-07-235-1/+215
|\ \
| * | NRO Assets and NACP file formatZach Hilman2018-07-235-1/+215
* | | Merge pull request #778 from lioncash/logbunnei2018-07-231-0/+2
|\ \ \ | |_|/ |/| |
| * | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
|/ /
* | Merge pull request #775 from lioncash/strbunnei2018-07-232-30/+32
|\ \
| * | string_util: Get rid of separate resize() in CPToUTF16(), UTF16ToUTF8(), CodeToUTF8() and UTF8ToUTF16()Lioncash2018-07-221-20/+22
| * | string_util: Use emplace_back() in SplitString() instead of push_back()Lioncash2018-07-221-2/+3
| * | string_util: Remove unnecessary std::string instance in TabsToSpaces()Lioncash2018-07-222-8/+7
* | | Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\ \ \ | |_|/ |/| |
| * | set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| * | set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
| |/
* | Merge pull request #769 from bunnei/shader-mask-fixesbunnei2018-07-231-5/+9
|\ \
| * | shader_bytecode: Implement other TEXS masks.bunnei2018-07-221-5/+9
* | | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ \ | |_|/ |/| |
| * | Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
* | | Merge pull request #773 from Subv/gl_ext_checkbunnei2018-07-222-2/+24
|\ \ \
| * | | Frontend: Check for more required OpenGL extensions during startup.Subv2018-07-222-2/+24
| |/ /
* | | Merge pull request #768 from lioncash/string-viewbunnei2018-07-2210-133/+213
|\ \ \
| * | | vfs: Correct file_p variable usage within InterpretAsDirectory()Lioncash2018-07-221-2/+5
| * | | file_util, vfs: Use std::string_view where applicableLioncash2018-07-2210-131/+208
* | | | Merge pull request #770 from lioncash/constructbunnei2018-07-221-4/+8
|\ \ \ \ | |_|/ / |/| | |
| * | | gl_shader_decompiler: Remove redundant Subroutine construction in AddSubroutine()Lioncash2018-07-221-4/+8
| | |/ | |/|
* | | Merge pull request #638 from MerryMage/mpMat M2018-07-229-13/+160
|\ \ \
| * | | Implement exclusive monitorMerryMage2018-07-229-13/+160
| |/ /
* | | Merge pull request #772 from MerryMage/dynarmicSebastian Valle2018-07-221-0/+0
|\ \ \ | |/ / |/| |
| * | externals: Update dynarmic to fc6b73bdMerryMage2018-07-221-0/+0
|/ /
* | Merge pull request #765 from lioncash/filebunnei2018-07-221-24/+14
|\ \
| * | file_util: Remove goto usages from Copy()Lioncash2018-07-221-24/+14
* | | Merge pull request #767 from bunnei/shader-cleanupbunnei2018-07-221-78/+15
|\ \ \
| * | | gl_shader_decompiler: Remove unused state tracking and minor cleanup.bunnei2018-07-221-78/+15
* | | | Merge pull request #766 from bunnei/shader-selbunnei2018-07-222-0/+20
|\ \ \ \ | |_|_|/ |/| | |
| * | | gl_shader_decompiler: Implement SEL instruction.bunnei2018-07-222-0/+20
| |/ /
* | | Merge pull request #764 from lioncash/movebunnei2018-07-225-19/+19
|\ \ \ | |/ / |/| |
| * | file_util: Use a u64 to represent number of entriesLioncash2018-07-225-18/+18
| * | file_util: std::move FST entries in ScanDirectoryTree()Lioncash2018-07-221-1/+1
| |/
* | Merge pull request #761 from bunnei/improve-raster-cachebunnei2018-07-224-72/+157
|\ \ | |/ |/|
| * gl_rasterizer_cache: Blit surfaces on recreation instead of flush and load.bunnei2018-07-222-2/+86
| * gl_rasterizer_cache: Use GPUVAddr as cache key, not parameter set.bunnei2018-07-223-57/+46
| * gl_rasterizer_cache: Use zeta_width and zeta_height registers for depth buffer.bunnei2018-07-222-11/+11
| * gl_rasterizer: Use zeta_enable register to enable depth buffer.bunnei2018-07-221-2/+2
| * maxwell_3d: Add depth buffer enable, width, and height registers.bunnei2018-07-221-2/+14
|/
* Merge pull request #759 from lioncash/redundantbunnei2018-07-221-2/+1
|\
| * file_util: Remove explicit type from std::min() in GetPathWithoutTop()Lioncash2018-07-211-1/+1
| * file_util: Remove redundant duplicate return in GetPathWithoutTop()Lioncash2018-07-211-1/+0
* | Merge pull request #748 from lioncash/namespacebunnei2018-07-2211-48/+24
|\ \
| * | video_core: Use nested namespaces where applicableLioncash2018-07-2111-48/+24
* | | Merge pull request #758 from lioncash/syncbunnei2018-07-222-86/+0
|\ \ \
| * | | common: Remove synchronized_wrapper.hLioncash2018-07-212-86/+0
* | | | Merge pull request #760 from lioncash/pathbunnei2018-07-2211-73/+85
|\ \ \ \
| * | | | file_util: Use an enum class for GetUserPath()Lioncash2018-07-2111-73/+85
| | |_|/ | |/| |
* | | | Merge pull request #762 from Subv/ioctl2bunnei2018-07-223-6/+34
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/ / /
* | | Merge pull request #754 from lioncash/partbunnei2018-07-212-8/+20
|\ \ \
| * | | vfs_real: Remove redundant copying of std::vector instances in GetFiles() and GetSubdirectories()Lioncash2018-07-211-2/+3
| * | | partition_filesystem, vfs_real: Add missing standard includesLioncash2018-07-212-0/+4
| * | | partition_filesystem, vfs_real: Use std::move in ReplaceFileWithSubdirectory() where applicableLioncash2018-07-212-2/+3
| * | | partition_filesystem, vfs_real: Use std::distance() instead of subtractionLioncash2018-07-212-4/+10
* | | | Merge pull request #750 from lioncash/ctxbunnei2018-07-213-9/+0
|\ \ \ \
| * | | | arm_interface: Remove unused tls_address member of ThreadContextLioncash2018-07-213-9/+0
* | | | | Merge pull request #756 from lioncash/dynarmicbunnei2018-07-211-0/+0
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | externals: Update dynarmic to 7ea1241Lioncash2018-07-211-0/+0
* | | | | Merge pull request #746 from lioncash/testsbunnei2018-07-212-4/+12
|\ \ \ \ \
| * | | | | arm_test_common: Get rid of truncation warningsLioncash2018-07-201-2/+5
| * | | | | arm_test_common: Make file static variable a member variable of the testing environmentLioncash2018-07-202-2/+5
| * | | | | arm_test_common: Add missing header guardLioncash2018-07-201-0/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #747 from lioncash/unimplementedbunnei2018-07-212-3/+3
|\ \ \ \ \
| * | | | | gl_shader_manager: Replace unimplemented function prototypeLioncash2018-07-212-3/+3
| |/ / / /
* | | | | Merge pull request #755 from lioncash/ctorbunnei2018-07-211-8/+8
|\ \ \ \ \
| * | | | | file_sys/errors: Remove redundant object constructor callsLioncash2018-07-211-8/+8
| | |_|_|/ | |/| | |
* | | | | Merge pull request #749 from lioncash/consistencybunnei2018-07-214-14/+17
|\ \ \ \ \
| * | | | | gpu: Rename Get3DEngine() to Maxwell3D()Lioncash2018-07-214-14/+17
| | |_|_|/ | |/| | |
* | | | | Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-218-0/+39
|\ \ \ \ \
| * | | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-218-0/+39
* | | | | | Merge pull request #753 from lioncash/constbunnei2018-07-214-21/+15
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | vfs_offset: Simplify TrimToFit()Lioncash2018-07-211-1/+2
| * | | | | vfs: Make WriteBytes() overload taking a std::vector pass the std::vector by const referenceLioncash2018-07-214-4/+4
| * | | | | vfs: Use variable template variants of std::is_trivially_copyableLioncash2018-07-211-13/+6
| * | | | | vfs: Amend constness on pointers in WriteBytes() and WriteArrays() member functions to be const qualifiedLioncash2018-07-211-3/+3
| | |_|/ / | |/| | |
* | | | | Merge pull request #752 from Subv/vfs_loadbunnei2018-07-211-5/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Loader: Only print the module names and addresses if they actually exist.Subv2018-07-211-5/+2
| |/ / /
* | | | Merge pull request #743 from lioncash/viewbunnei2018-07-214-57/+56
|\ \ \ \
| * | | | logging/filter: Use std::string_view in ParseFilterString()Lioncash2018-07-202-41/+40
| * | | | logging/backend: Add missing standard includesLioncash2018-07-202-4/+3
| * | | | logging/backend: Use std::string_view in RemoveBackend() and GetBackend()Lioncash2018-07-202-12/+13
| | |_|/ | |/| |
* | | | Merge pull request #745 from lioncash/packagebunnei2018-07-212-9/+12
|\ \ \ \ | |_|_|/ |/| | |
| * | | param_package: Take std::string by value in string-based Set() functionLioncash2018-07-202-4/+6
| * | | param_package: Use std::unordered_map's insert_or_assign instead of map indexingLioncash2018-07-201-3/+3
| * | | param_package: Get rid of file-static std::string constructionLioncash2018-07-201-3/+4
| |/ /
* | | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \ \
| * | | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
| |/ /
* | | Merge pull request #741 from lioncash/enumbunnei2018-07-211-0/+19
|\ \ \ | |/ / |/| |
| * | ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ /
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/
* | Merge pull request #739 from lioncash/gladbunnei2018-07-203-925/+993
|\ \
| * | externals: Update glad to version 0.1.25Lioncash2018-07-203-925/+993
* | | Merge pull request #738 from lioncash/signbunnei2018-07-201-16/+20
|\ \ \
| * | | gl_state: Make references const where applicable in Apply()Lioncash2018-07-201-2/+3
| * | | gl_state: Get rid of mismatched sign conversionsLioncash2018-07-201-14/+17
| |/ /
* | | Merge pull request #737 from lioncash/movebunnei2018-07-204-5/+9
|\ \ \
| * | | loader/{nca, nro}: std::move VirtualFile in the constructors where applicableLioncash2018-07-202-2/+4
| * | | vfs_offset: std::move file and name parameters of OffsetVfsFileLioncash2018-07-202-3/+5
| |/ /
* | | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ \
| * | | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| * | | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| |/ /
* | | Merge pull request #735 from lioncash/video-unusedbunnei2018-07-201-2/+0
|\ \ \
| * | | maxwell_3d: Remove unused variable within GetStageTextures()Lioncash2018-07-201-2/+0
| |/ /
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-2010-93/+92
|\ \ \
| * | | thread: Convert ThreadStatus into an enum classLioncash2018-07-2010-93/+92
| |/ /
* | | Merge pull request #733 from lioncash/dirsbunnei2018-07-201-1/+1
|\ \ \
| * | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()Lioncash2018-07-201-1/+1
| |/ /
* | | Merge pull request #732 from lioncash/unusedbunnei2018-07-201-17/+6
|\ \ \
| * | | nso: Silence implicit sign conversion warningsLioncash2018-07-201-4/+6
| * | | nso: Remove unused function ReadSegment()Lioncash2018-07-201-13/+0
| |/ /
* | | Merge pull request #731 from lioncash/shadowbunnei2018-07-201-6/+4
|\ \ \ | |_|/ |/| |
| * | gl_shader_decompiler: Eliminate variable and declaration shadowingLioncash2018-07-201-6/+4
| |/
* | Merge pull request #730 from lioncash/stringbunnei2018-07-201-2/+2
|\ \
| * | gl_shader_decompiler: Remove unnecessary const from return valuesLioncash2018-07-201-2/+2
| |/
* | Merge pull request #729 from lioncash/simplifybunnei2018-07-201-3/+3
|\ \ | |/ |/|
| * pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ /
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/|
* | | Merge pull request #723 from lioncash/gdbbunnei2018-07-201-7/+7
|\ \ \
| * | | gdbstub: Get rid of a few signed/unsigned comparisonsLioncash2018-07-191-7/+7
* | | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ \
| * | | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| * | | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| |/ / /
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
* | | | | Merge pull request #719 from lioncash/docsbunnei2018-07-202-5/+5
|\ \ \ \ \
| * | | | | loader: Amend Doxygen commentsLioncash2018-07-192-5/+5
| |/ / / /
* | | | | Merge pull request #718 from lioncash/readbunnei2018-07-201-4/+6
|\ \ \ \ \
| * | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic valueLioncash2018-07-191-4/+6
* | | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \ \
| * | | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / / /
* | | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ \
| * | | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / /
* | | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / /
* | | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
* | | | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \ \ \
| * | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
* | | | | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| * | | | | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| * | | | | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| * | | | | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| * | | | | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| * | | | | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ / / /
* | | | | Merge pull request #713 from lioncash/filesysbunnei2018-07-191-3/+3
|\ \ \ \ \
| * | | | | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| * | | | | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| * | | | | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
| |/ / / /
* | | | | Merge pull request #711 from lioncash/swapbunnei2018-07-191-50/+50
|\ \ \ \ \
| * | | | | common/swap: Remove unnecessary const on return value of swap()Lioncash2018-07-191-1/+1
| * | | | | common/swap: Use static_cast where applicableLioncash2018-07-191-16/+16
| * | | | | common/swap: Use using aliases where applicableLioncash2018-07-191-33/+33
| |/ / / /
* | | | | Merge pull request #710 from lioncash/unusedbunnei2018-07-191-38/+0
|\ \ \ \ \
| * | | | | common/common_funcs: Remove unused rotation functionsLioncash2018-07-191-38/+0
| |/ / / /
* | | | | Merge pull request #694 from lioncash/warnbunnei2018-07-192-6/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | |
| * | | | loader/nro: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| * | | | loader/nso: Remove unnecessary vector resizesLioncash2018-07-191-4/+2
| * | | | loader/nso: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
* | | | | Merge pull request #709 from lioncash/thread-localbunnei2018-07-192-12/+8
|\ \ \ \ \
| * | | | | common/misc: Deduplicate code in GetLastErrorMsg()Lioncash2018-07-192-12/+8
| | |/ / / | |/| | |
* | | | | Merge pull request #708 from lioncash/xbyakbunnei2018-07-191-0/+0
|\ \ \ \ \
| * | | | | externals: Update Xbyak to 5.65Lioncash2018-07-191-0/+0
| |/ / / /
* | | | | Merge pull request #707 from lioncash/catchbunnei2018-07-191-0/+0
|\ \ \ \ \
| * | | | | externals: Update catch to v2.2.3Lioncash2018-07-191-0/+0
| |/ / / /
* | | | | Merge pull request #705 from lioncash/string-refbunnei2018-07-192-2/+2
|\ \ \ \ \
| * | | | | file_util: return string by const reference for GetExeDirectory()Lioncash2018-07-192-2/+2
* | | | | | Merge pull request #704 from lioncash/stringbunnei2018-07-192-15/+0
|\ \ \ \ \ \
| * | | | | | string_util: Remove AsciiToHex()Lioncash2018-07-192-15/+0
* | | | | | | Merge pull request #703 from lioncash/constbunnei2018-07-192-2/+2
|\ \ \ \ \ \ \
| * | | | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member functionLioncash2018-07-192-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #702 from lioncash/initializebunnei2018-07-192-24/+15
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | |
| * | | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initializedLioncash2018-07-192-24/+15
| |/ / / / /
* | | | | | Merge pull request #701 from lioncash/movingbunnei2018-07-192-2/+10
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | content_archive: Make IsDirectoryExeFS() take a shared_ptr as a const referenceLioncash2018-07-191-1/+1
| * | | | | content_archive: Add missing standard includesLioncash2018-07-191-0/+5
| * | | | | content_archive: std::move VirtualFile in NCA's constructorLioncash2018-07-191-1/+4
| |/ / / /
* | | | | Merge pull request #699 from lioncash/vfsbunnei2018-07-191-6/+6
|\ \ \ \ \
| * | | | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()Lioncash2018-07-191-6/+6
| |/ / / /
* | | | | Merge pull request #697 from bunnei/disable-depth-cullbunnei2018-07-191-1/+3
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | gl_state: Temporarily disable culling and depth test.bunnei2018-07-191-1/+3
| | |_|/ | |/| |
* | | | Merge pull request #700 from bunnei/update-dynarmicbunnei2018-07-191-0/+0
|\ \ \ \ | |_|_|/ |/| | |
| * | | externals: Update dynarmic to 5a91c94.bunnei2018-07-191-0/+0
| |/ /
* | | Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\ \ \
| * | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
* | | | Merge pull request #690 from lioncash/movebunnei2018-07-199-16/+26
|\ \ \ \ | |_|_|/ |/| | |
| * | | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-199-16/+26
* | | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \ \
| * | | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ / | |/| |
* | | | Merge pull request #686 from lioncash/fmtbunnei2018-07-192-1/+1
|\ \ \ \ | |_|_|/ |/| | |
| * | | externals: update fmt to version 5.1.0Lioncash2018-07-182-1/+1
| | |/ | |/|
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| |/ /
* | | Merge pull request #693 from lioncash/unusedbunnei2018-07-191-7/+0
|\ \ \
| * | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()Lioncash2018-07-191-7/+0
| | |/ | |/|
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-196-22/+26
|\ \ \
| * | | core: Make System's default constructor privateLioncash2018-07-192-0/+4
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-195-22/+22
| | |/ | |/|
* | | Merge pull request #680 from bunnei/fix-swizzbunnei2018-07-191-1/+4
|\ \ \
| * | | decoders: Fix calc of swizzle image_width_in_gobs.bunnei2018-07-191-1/+4
* | | | Merge pull request #685 from lioncash/buildbunnei2018-07-190-0/+0
|\ \ \ \
| * | | | hle/filesystem: Amend trace log in OpenSaveData() to compile in debug modeLioncash2018-07-181-1/+1
| | |/ / | |/| |
* | | | Merge pull request #684 from lioncash/nonmemberbunnei2018-07-192-2/+1
|\ \ \ \ | |_|/ / |/| | |
| * | | game_list: Make ContainsAllWords an internally linked non-member functionLioncash2018-07-182-2/+1
| |/ /
* | / Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-1954-1959/+1926
| |/ |/|
* | Merge pull request #683 from DarkLordZach/touchbunnei2018-07-181-4/+24
|\ \ | |/ |/|
| * Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
| * Single touch supportZach Hilman2018-07-181-4/+19
|/
* Merge pull request #681 from lioncash/constbunnei2018-07-182-5/+7
|\
| * game_list: Upper-case containsAllWords to ContainsAllWords()Lioncash2018-07-182-3/+3
| * game_list: Make containsAllWords a const member functionLioncash2018-07-182-4/+6
* | Merge pull request #682 from lioncash/telemetrybunnei2018-07-181-20/+7
|\ \
| * | telemetry: Remove unnecessary Field constructorLioncash2018-07-181-4/+1
| * | telemetry: Make operator== and operator!= const member functions of FieldLioncash2018-07-181-2/+2
| * | telemetry: Default copy/move constructors and assignment operatorsLioncash2018-07-181-14/+4
| |/
* | Merge pull request #679 from lioncash/ctorbunnei2018-07-181-4/+1
|\ \
| * | game_list: Remove unnecessary QString initialization in KeyReleaseEaterLioncash2018-07-181-4/+1
| |/
* | Merge pull request #678 from lioncash/astcbunnei2018-07-181-78/+60
|\ \
| * | astc: Initialize vector size directly in DecompressLioncash2018-07-181-2/+1
| * | astc: Mark functions as internally linked where applicableLioncash2018-07-181-17/+20
| * | astc: const-correctness changes where applicableLioncash2018-07-181-14/+13
| * | astc: Delete Bits' copy contstructor and assignment operatorLioncash2018-07-181-8/+6
| * | astc: In-class initialize member variables where appropriateLioncash2018-07-181-39/+22
| |/
* | Merge pull request #677 from bunnei/crop-fbbunnei2018-07-1812-20/+52
|\ \ | |/ |/|
| * settings: Turn docked mode off by default.bunnei2018-07-183-3/+3
| * vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
| * vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
| * vi: Partially implement buffer crop parameters.bunnei2018-07-189-14/+46
|/
* Merge pull request #675 from Subv/stencilbunnei2018-07-181-2/+25
|\
| * GPU: Added register definitions for the stencil parameters.Subv2018-07-171-2/+25
* | General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-1716-212/+256
* | Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-176-0/+11
|\ \
| * | scheduler: Clear exclusive state when switching contextsMerryMage2018-07-166-0/+11
* | | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \ \ | |_|/ |/| |
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* | Merge pull request #673 from bunnei/fix-buffer-queue-evtbunnei2018-07-176-32/+21
|\ \ | |/ |/|
| * nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* Merge pull request #669 from lioncash/dynarmicbunnei2018-07-161-0/+0
|\
| * externals: Update dynarmic to dfdec79Lioncash2018-07-151-0/+0
|/
* Merge pull request #668 from jroweboy/controller-lagbunnei2018-07-151-3/+3
|\
| * HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
* | Merge pull request #664 from jroweboy/logging-stuffbunnei2018-07-153-4/+17
|\ \ | |/ |/|
| * Logging: Dump all logs in the queue on close in debug modeJames Rowe2018-07-153-1/+12
| * Logging: Don't lock the queue for the duration of the writeJames Rowe2018-07-141-3/+5
* | Merge pull request #666 from bunnei/g8r8bunnei2018-07-153-9/+40
|\ \
| * | gl_rasterizer_cache: Implement texture format G8R8.bunnei2018-07-153-9/+40
|/ /
* | Merge pull request #665 from bunnei/fix-z24-s8bunnei2018-07-151-1/+2
|\ \
| * | gl_rasterizer_cache: Fix incorrect offset in ConvertS8Z24ToZ24S8.bunnei2018-07-151-1/+2
* | | Merge pull request #659 from bunnei/depth16bunnei2018-07-153-1/+15
|\ \ \ | |/ / |/| |
| * | gl_rasterizer_cache: Implement depth format Z16_UNORM.bunnei2018-07-153-1/+15
|/ /
* | Merge pull request #598 from bunnei/makedonecurrentbunnei2018-07-156-2/+39
|\ \
| * | OpenGL: Use MakeCurrent/DoneCurrent for multithreaded rendering.bunnei2018-07-146-2/+39
* | | Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\ \ \
| * | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
* | | | Merge pull request #662 from Subv/delete_filebunnei2018-07-141-2/+4
|\ \ \ \
| * | | | FileSys: Append the requested path to the filesystem base path in DeleteFile.Subv2018-07-141-2/+4
| |/ / /
* | | | Merge pull request #661 from ogniK5377/assert-nitbunnei2018-07-141-2/+2
|\ \ \ \ | |/ / / |/| | |
| * | | No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/ / /
* | | Merge pull request #660 from Subv/depth_writebunnei2018-07-141-3/+8
|\ \ \ | |/ / |/| |
| * | GPU: Always enable the depth write when clearing the depth buffer.Subv2018-07-141-3/+8
|/ /
* | Merge pull request #657 from bunnei/dual-vsbunnei2018-07-137-89/+149
|\ \
| * | gl_rasterizer: Fix check for if a shader stage is enabled.bunnei2018-07-133-35/+11
| * | gl_shader_gen: Implement dual vertex shader mode.bunnei2018-07-135-55/+139
* | | More improvements to GDBStub (#653)Hedges2018-07-138-50/+173
|/ /
* | Merge pull request #656 from ogniK5377/audren-mem-initbunnei2018-07-131-3/+3
|\ \
| * | We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
| * | initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
* | | Merge pull request #655 from bunnei/pred-lt-nanbunnei2018-07-132-5/+7
|\ \ \
| * | | gl_shader_decompiler: Implement PredCondition::LessThanWithNan.bunnei2018-07-132-5/+7
| |/ /
* | | Merge pull request #654 from bunnei/cond-exitbunnei2018-07-132-8/+34
|\ \ \ | |/ / |/| |
| * | gl_shader_decompiler: Use FlowCondition field in EXIT instruction.bunnei2018-07-132-8/+34
|/ /
* | Merge pull request #652 from Subv/fadd32iSebastian Valle2018-07-132-0/+32
|\ \
| * | GPU: Implement the FADD32I shader instruction.Subv2018-07-122-0/+32
* | | Merge pull request #651 from Subv/ffma_decodebunnei2018-07-121-1/+1
|\ \ \
| * | | GPU: Corrected the decoding of FFMA for immediate operands.Subv2018-07-121-1/+1
| |/ /
* | | Port #3335 and #3373 from Citra: "Small SDL fixes" and "Print the actual error preventing SDL from working" (#637)Tobias2018-07-122-6/+4
* | | Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\ \ \
| * | | Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
* | | | Merge pull request #649 from ogniK5377/audout-autobunnei2018-07-122-14/+14
|\ \ \ \
| * | | | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
| |/ / /
* | | | Merge pull request #650 from jroweboy/logging-stuffbunnei2018-07-123-4/+8
|\ \ \ \ | |/ / / |/| | / | | |/ | |/|
| * | yuzu - Fix duplicate logsJames Rowe2018-07-122-2/+7
| * | yuzu-cmd Apply the filter string from settingsJames Rowe2018-07-121-2/+1
|/ /
* | Merge pull request #559 from Subv/mount_savedatabunnei2018-07-122-2/+12
|\ \
| * | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-192-2/+12
* | | Merge pull request #585 from janisozaur/patch-11bunnei2018-07-121-3/+3
|\ \ \
| * | | Improve directory creation in WindowsCopyFiles.cmakeMichał Janiszewski2018-06-241-3/+3
* | | | Merge pull request #646 from bunnei/fix-hid-smobunnei2018-07-111-7/+5
|\ \ \ \
| * | | | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
|/ / / /
* | | | Merge pull request #644 from ogniK5377/getconfig-errbunnei2018-07-111-17/+2
|\ \ \ \
| * | | | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
* | | | | Merge pull request #633 from FearlessTobi/port-definesbunnei2018-07-103-7/+7
|\ \ \ \ \
| * | | | | Port #3579 from CitrafearlessTobi2018-07-073-7/+7
* | | | | | Merge pull request #642 from bunnei/create-save-dirbunnei2018-07-101-0/+9
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | savedata_factory: Always create a save directory for games.bunnei2018-07-081-0/+9
* | | | | | Merge pull request #636 from FearlessTobi/add-gitignorebunnei2018-07-101-0/+1
|\ \ \ \ \ \
| * | | | | | Port #3513 (partly) from CitrafearlessTobi2018-07-071-0/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #635 from FearlessTobi/port-crashfixbunnei2018-07-101-1/+1
|\ \ \ \ \ \
| * | | | | | Port #3474 from CitrafearlessTobi2018-07-071-1/+1
| |/ / / / /
* | | | | | Merge pull request #634 from FearlessTobi/port-viewport-fixbunnei2018-07-101-6/+7
|\ \ \ \ \ \
| * | | | | | Port #3505 from CItrafearlessTobi2018-07-071-6/+7
| |/ / / / /
* | | | | | Merge pull request #640 from bunnei/flip-tris-viewportbunnei2018-07-091-1/+4
|\ \ \ \ \ \
| * | | | | | gl_rasterizer: Flip triangles when regs.viewport_transform[0].scale_y is negative.bunnei2018-07-081-1/+4
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #641 from bunnei/nvhost-ctrl-fixbunnei2018-07-091-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
|/ / / / /
* | | | | Merge pull request #625 from Subv/imnmxbunnei2018-07-082-3/+31
|\ \ \ \ \
| * | | | | GPU: Implemented the IMNMX shader instruction.Subv2018-07-042-3/+31
* | | | | | Merge pull request #627 from Subv/bc7ubunnei2018-07-083-7/+21
|\ \ \ \ \ \
| * | | | | | GPU: Implemented the BC7U texture format.Subv2018-07-073-7/+21
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #639 from bunnei/revert-vfsbunnei2018-07-0845-1784/+1676
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | Revert "Virtual Filesystem (#597)"bunnei2018-07-0845-1784/+1676
|/ / / / /
* | | | | Merge pull request #632 from FearlessTobi/add-discord-linkbunnei2018-07-071-1/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Port #3466 from CitraTobias2018-07-071-1/+1
* | | | | Merge pull request #631 from lioncash/dynarmicbunnei2018-07-071-0/+0
|\ \ \ \ \
| * | | | | externals: Update dynarmic to f7d11baa1Lioncash2018-07-071-0/+0
|/ / / / /
* | | | | Merge pull request #630 from FearlessTobi/remove-citra-referencesbunnei2018-07-063-3/+3
|\ \ \ \ \
| * | | | | Remove some references to CitrafearlessTobi2018-07-063-3/+3
| |/ / / /
* / / / / Virtual Filesystem (#597)Zach Hilman2018-07-0645-1676/+1784
|/ / / /
* | | | Merge pull request #629 from Subv/depth_testbunnei2018-07-052-9/+29
|\ \ \ \
| * | | | GPU: Allow using the old NV04 values for the depth test function.Subv2018-07-052-9/+29
* | | | | Merge pull request #626 from Subv/shader_syncbunnei2018-07-052-0/+12
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | GPU: Stub the shader SYNC and DEPBAR instructions.Subv2018-07-042-0/+12
| |/ / /
* | | | Merge pull request #624 from Subv/f2f_roundbunnei2018-07-051-0/+3
|\ \ \ \
| * | | | GPU: Implemented the F2F 'round' rounding mode.Subv2018-07-041-0/+3
| |/ / /
* | | | Merge pull request #623 from Subv/vertex_typesbunnei2018-07-051-0/+8
|\ \ \ \
| * | | | GPU: Implement the Size_16_16 and Size_10_10_10_2 vertex attribute types.Subv2018-07-041-0/+8
| |/ / /
* | | | Merge pull request #622 from Subv/unused_texbunnei2018-07-052-2/+5
|\ \ \ \
| * | | | GPU: Ignore textures that the GLSL compiler deemed unused when binding textures to the shaders.Subv2018-07-041-1/+4
| * | | | GPU: Corrected the decoding for the TEX shader instruction.Subv2018-07-041-1/+1
| |/ / /
* | | | Merge pull request #621 from Subv/psetp_bunnei2018-07-052-0/+43
|\ \ \ \
| * | | | GPU: Implemented the PSETP shader instruction.Subv2018-07-042-0/+43
| |/ / /
* | | | Merge pull request #620 from Subv/depth_z32fbunnei2018-07-053-2/+15
|\ \ \ \
| * | | | GPU: Implemented the 32 bit float depth buffer format.Subv2018-07-043-2/+15
| |/ / /
* | | | Merge pull request #619 from Subv/flip_cullbunnei2018-07-042-3/+29
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Flip the triangle front face winding if the GPU is configured to not flip the triangles.Subv2018-07-042-3/+29
|/ / /
* | | Merge pull request #618 from Subv/clear_used_buffersbunnei2018-07-044-17/+48
|\ \ \
| * | | GPU: Only configure the used framebuffers during clear.Subv2018-07-044-17/+48
|/ / /
* | | Merge pull request #609 from Subv/clear_buffersbunnei2018-07-045-16/+105
|\ \ \
| * | | GPU: Factor out the framebuffer configuration code for both Clear and Draw commands.Subv2018-07-032-72/+39
| * | | GPU: Support clears that don't clear the color buffer.Subv2018-07-032-6/+17
| * | | GPU: Bind and clear the render target when the CLEAR_BUFFERS register is written to.Subv2018-07-034-0/+86
| * | | GPU: Added registers for the CLEAR_BUFFERS and CLEAR_COLOR methods.Subv2018-07-031-2/+27
* | | | Merge pull request #616 from bunnei/s8z24bunnei2018-07-043-11/+83
|\ \ \ \
| * | | | gl_rasterizer_cache: Implement PixelFormat S8Z24.bunnei2018-07-033-11/+83
* | | | | Merge pull request #613 from jroweboy/qt-stylebunnei2018-07-032-0/+7
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Add qt windowsvistastyle dll to the buildJames Rowe2018-07-032-0/+7
|/ / / /
* | | | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
* | | | Merge pull request #607 from jroweboy/loggingbunnei2018-07-03116-887/+1261
|\ \ \ \
| * | | | Fix build and address review feedbackbunnei2018-07-032-4/+5
| * | | | Add configurable logging backendsJames Rowe2018-07-0314-22/+408
| * | | | Update clang formatJames Rowe2018-07-0337-154/+141
| * | | | Rename logging macro back to LOG_*James Rowe2018-07-03105-730/+730
| |/ / /
* | | | Merge pull request #612 from bunnei/fix-cullbunnei2018-07-031-2/+5
|\ \ \ \
| * | | | gl_rasterizer: Only set cull mode and front face if enabled.bunnei2018-07-031-2/+5
| |/ / /
* | | | Merge pull request #611 from Subv/enabled_depth_testbunnei2018-07-032-9/+13
|\ \ \ \
| * | | | GPU: Use only the least significant 3 bits when reading the depth test func.Subv2018-07-031-9/+9
| * | | | GPU: Don't try to parse the depth test function if the depth test is disabled.Subv2018-07-031-0/+4
| |/ / /
* | | | Merge pull request #610 from Subv/mufu_8bunnei2018-07-032-0/+5
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Implemented MUFU suboperation 8, sqrt.Subv2018-07-032-0/+5
* | | | Merge pull request #608 from Subv/depthbunnei2018-07-039-32/+246
|\ \ \ \
| * | | | GPU: Set up the culling configuration on each draw.Subv2018-07-031-6/+8
| * | | | GPU: Set up the depth test state on every draw.Subv2018-07-022-0/+14
| * | | | MaxwellToGL: Added conversion functions for depth test and cull mode.Subv2018-07-021-0/+50
| * | | | GPU: Added registers for depth test and cull mode.Subv2018-07-021-3/+51
| * | | | GPU: Implemented the Z24S8 depth format and load the depth framebuffer.Subv2018-07-027-24/+124
| |/ / /
* | | | Merge pull request #606 from Subv/base_vertexSebastian Valle2018-07-022-8/+15
|\ \ \ \
| * | | | GPU: Implement offsetted rendering when using non-indexed drawing.Subv2018-07-021-1/+1
| * | | | GPU: Fixed the index offset rendering, and implemented the base vertex functionality.Subv2018-07-021-6/+8
| * | | | GPU: Added register definitions for the vertex buffer base element.Subv2018-07-021-1/+6
| |/ / /
* | | | Merge pull request #603 from Subv/nvmap_freeSebastian Valle2018-07-023-4/+16
|\ \ \ \
| * | | | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
| * | | | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
* | | | | Merge pull request #605 from Subv/dma_copySebastian Valle2018-07-021-1/+5
|\ \ \ \ \
| * | | | | GPU: Directly copy the pixels when performing a same-layout DMA.Subv2018-07-021-1/+5
| |/ / / /
* | | | | Merge pull request #604 from Subv/invalid_texturesbunnei2018-07-023-3/+12
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | GPU: Ignore disabled textures and textures with an invalid address.Subv2018-07-022-1/+10
| * | | | GPU: Allow GpuToCpuAddress to return boost::none for unmapped addresses.Subv2018-07-021-2/+2
| |/ / /
* | | | Merge pull request #602 from Subv/mufu_subopbunnei2018-07-012-6/+1
|\ \ \ \
| * | | | GPU: Corrected the size of the MUFU subop field, and removed incorrect "min" operation.Subv2018-06-302-6/+1
| |/ / /
* | | | Merge pull request #601 from Subv/rgba32_uibunnei2018-07-014-25/+48
|\ \ \ \
| * | | | GPU: Implemented the RGBA32_UINT rendertarget format.Subv2018-06-304-9/+28
| * | | | GLCache: Specify the component type along the texture type in the format tuple.Subv2018-06-301-17/+21
| |/ / /
* | | | Merge pull request #600 from bunnei/pred-not-eq-nanbunnei2018-07-012-17/+24
|\ \ \ \ | |/ / / |/| | |
| * | | gl_shader_decompiler: Implement predicate NotEqualWithNan.bunnei2018-06-302-17/+24
|/ / /
* | | Merge pull request #595 from bunnei/raster-cachebunnei2018-06-2915-1454/+425
|\ \ \
| * | | gl_rasterizer_cache: Only dereference color_surface/depth_surface if valid.bunnei2018-06-291-2/+6
| * | | gl_rasterizer_cache: Implement caching for texture and framebuffer surfaces.bunnei2018-06-273-16/+168
| * | | gl_rasterizer_cache: Various fixes for ASTC handling.bunnei2018-06-272-35/+39
| * | | gl_rasterizer_cache: Use SurfaceParams as a key for surface caching.bunnei2018-06-272-43/+72
| * | | maxwell_3d: Add a struct for RenderTargetConfig.bunnei2018-06-271-17/+19
| * | | settings: Add a configuration for use_accurate_framebuffers.bunnei2018-06-277-0/+21
| * | | gl_rasterizer: Implement AccelerateDisplay to forward textures to framebuffers.bunnei2018-06-276-8/+62
| * | | gl_rasterizer_cache: Cache size_in_bytes as a const per surface.bunnei2018-06-272-9/+13
| * | | gl_rasterizer_cache: Refactor to make SurfaceParams members const.bunnei2018-06-272-52/+37
| * | | gl_rasterizer_cache: Remove Citra's rasterizer cache, always load/flush surfaces.bunnei2018-06-274-1494/+210
* | | | Merge pull request #588 from mailwl/hwopusbunnei2018-06-284-0/+53
|\ \ \ \
| * | | | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-254-0/+53
| | |/ / | |/| |
* | | | gl_shader_decompiler: Add a return path for unknown instructions.bunnei2018-06-271-0/+1
| |/ / |/| |
* | | Merge pull request #594 from bunnei/max-constbuffbunnei2018-06-272-1/+7
|\ \ \
| * | | gl_rasterizer: Workaround for when exceeding max UBO size.bunnei2018-06-272-1/+7
|/ / /
* | | Merge pull request #593 from bunnei/fix-swizzlebunnei2018-06-275-12/+20
|\ \ \
| * | | gl_state: Fix state management for texture swizzle.bunnei2018-06-265-12/+20
* | | | Merge pull request #592 from bunnei/cleanup-gl-statebunnei2018-06-272-94/+0
|\ \ \ \
| * | | | gl_state: Remove unused state management from 3DS.bunnei2018-06-262-94/+0
| |/ / /
* | | | Merge pull request #591 from bunnei/fix-rgb565bunnei2018-06-271-1/+1
|\ \ \ \ | |/ / / |/| | |
| * | | gl_rasterizer_cache: Fix inverted B5G6R5 format.bunnei2018-06-261-1/+1
|/ / /
* | | Merge pull request #590 from bunnei/rm-ssbo-checkbunnei2018-06-261-2/+0
|\ \ \
| * | | yuzu: Remove SSBOs check from Qt frontend.bunnei2018-06-261-2/+0
|/ / /
* | | Merge pull request #554 from Subv/constbuffer_ubobunnei2018-06-264-18/+39
|\ \ \
| * | | Rasterizer: Use UBOs instead of SSBOs for uploading const buffers.Subv2018-06-104-18/+39
* | | | Merge pull request #589 from mailwl/fix-crashbunnei2018-06-261-2/+4
|\ \ \ \
| * | | | Fix crash at exitmailwl2018-06-251-2/+4
| | |/ / | |/| |
* / | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ / /
* | | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
* | | Revert "Use Ninja for MSVC AppVeyor builds" (#584)bunnei2018-06-236-17/+9
* | | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
* | | Merge pull request #526 from janisozaur/appveyor-ninjabunnei2018-06-226-9/+17
|\ \ \
| * | | Use Ninja for MSVC AppVeyor buildsMichał Janiszewski2018-06-055-8/+16
| * | | Drop /std:c++latest from MSVC command lineMichał Janiszewski2018-06-051-1/+1
* | | | Merge pull request #579 from SciresM/masterbunnei2018-06-2212-9/+312
|\ \ \ \
| * | | | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-224-17/+27
| * | | | Add additional missing format.Michael Scire2018-06-222-21/+27
| * | | | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| * | | | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| * | | | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-213-1/+7
| * | | | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| * | | | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-215-11/+111
| * | | | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-215-6/+71
| * | | | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
* | | | | Merge pull request #581 from mailwl/empty-buf-skipbunnei2018-06-221-0/+5
|\ \ \ \ \
| * | | | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
|/ / / / /
* | | | | Merge pull request #577 from mailwl/audren-updatebunnei2018-06-222-49/+60
|\ \ \ \ \
| * | | | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
| |/ / / /
* / / / / Add support for decrypted NCA files (#567)Zach Hilman2018-06-2110-16/+453
|/ / / /
* | | | Merge pull request #576 from Subv/warnings1bunnei2018-06-2012-22/+24
|\ \ \ \
| * | | | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-2012-22/+24
|/ / / /
* | | | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
* | | | Merge pull request #574 from Subv/shader_abs_negbunnei2018-06-191-7/+14
|\ \ \ \
| * | | | GPU: Perform negation after absolute value in the float shader instructions.Subv2018-06-191-7/+14
* | | | | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \ \ \ \
| * | | | | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| * | | | | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| * | | | | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
* | | | | | Merge pull request #573 from Subv/shader_immbunnei2018-06-192-14/+18
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | GPU: Don't mark uniform buffers and registers as used for instructions which don't have them.Subv2018-06-192-14/+18
|/ / / / /
* | | | | Merge pull request #570 from bunnei/astcbunnei2018-06-196-1/+1709
|\ \ \ \ \
| * | | | | gl_rasterizer: Implement texture format ASTC_2D_4X4.bunnei2018-06-186-1/+1709
* | | | | | Merge pull request #562 from DarkLordZach/extracted-ncas-uibunnei2018-06-184-3/+50
|\ \ \ \ \ \
| * | | | | | Bug fixes, testing, and review changesZach Hilman2018-06-142-7/+20
| * | | | | | Add 'Load Folder' menu optionZach Hilman2018-06-143-0/+17
| * | | | | | Add support for main files in file pickerZach Hilman2018-06-141-0/+2
| * | | | | | Recognize main files in game listZach Hilman2018-06-141-2/+17
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ \ \ \
| * | | | | | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
* | | | | | | Merge pull request #571 from Armada651/loose-blendbunnei2018-06-181-1/+1
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | |
| * | | | | | gl_rasterizer: Get loose on independent blending.Jules Blok2018-06-181-1/+1
* | | | | | | Merge pull request #569 from bunnei/fix-cachebunnei2018-06-181-26/+8
|\ \ \ \ \ \ \
| * | | | | | | gl_rasterizer_cache: Loosen things up a bit.bunnei2018-06-181-26/+8
|/ / / / / / /
* | | | | | | Merge pull request #568 from bunnei/lopbunnei2018-06-172-63/+84
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_decompiler: Implement LOP instructions.bunnei2018-06-172-6/+42
| * | | | | | gl_shader_decompiler: Refactor LOP32I instruction a bit in support of LOP.bunnei2018-06-172-57/+42
|/ / / / / /
* | | | | | Merge pull request #565 from bunnei/shader_conversionsbunnei2018-06-162-14/+43
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Implement integer size conversions for I2I/I2F/F2I.bunnei2018-06-162-14/+43
|/ / / / / /
* | | | | | Merge pull request #564 from bunnei/lop32i_passbbunnei2018-06-161-6/+12
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Implement LOP32I LogicOperation PassB.bunnei2018-06-161-6/+12
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #566 from bunnei/set_pos_wbunnei2018-06-161-0/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_gen: Set position.w to 1.bunnei2018-06-161-0/+4
|/ / / / /
* | | | | Merge pull request #560 from Subv/crash_widgetbunnei2018-06-136-292/+0
|\ \ \ \ \
| * | | | | Qt: Removed the Registers widget.Subv2018-06-136-292/+0
| | |_|_|/ | |/| | |
* | | | | Merge pull request #556 from Subv/dma_enginebunnei2018-06-127-1/+237
|\ \ \ \ \
| * | | | | GPU: Partially implemented the Maxwell DMA engine.Subv2018-06-127-1/+237
* | | | | | Merge pull request #558 from Subv/iadd32ibunnei2018-06-122-2/+31
|\ \ \ \ \ \
| * | | | | | GPU: Implemented the iadd32i shader instruction.Subv2018-06-122-2/+31
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #557 from shinyquagsire23/libnx-hid-fixbunnei2018-06-122-2/+3
|\ \ \ \ \ \
| * | | | | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ / / / /
* | | | | | Merge pull request #552 from bunnei/sat-fmulbunnei2018-06-122-39/+32
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_decompiler: Implement saturate for float instructions.bunnei2018-06-122-39/+32
|/ / / / /
* | | | | Merge pull request #555 from Subv/gpu_sysregsbunnei2018-06-111-1/+1
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | GPU: Convert the gl_InstanceId and gl_VertexID variables to floats when reading from them.Subv2018-06-101-1/+1
|/ / / /
* | | | Merge pull request #553 from Subv/isetbunnei2018-06-102-2/+53
|\ \ \ \ | |_|_|/ |/| | |
| * | | GPU: Implement the iset family of shader instructions.Subv2018-06-092-2/+46
| * | | GPU: Added decodings for the ISET family of instructions.Subv2018-06-091-0/+7
|/ / /
* | | Merge pull request #550 from Subv/ssybunnei2018-06-092-0/+7
|\ \ \
| * | | GPU: Stub the SSY shader instruction.Subv2018-06-092-0/+7
* | | | Merge pull request #551 from bunnei/shrbunnei2018-06-092-0/+17
|\ \ \ \
| * | | | gl_shader_decompiler: Implement SHR instruction.bunnei2018-06-092-0/+17
| |/ / /
* | | | Merge pull request #549 from bunnei/iaddbunnei2018-06-092-19/+55
|\ \ \ \ | |/ / / |/| | |
| * | | gl_shader_decompiler: Implement IADD instruction.bunnei2018-06-092-11/+37
| * | | gl_shader_decompiler: Add missing asserts for saturate_a instructions.bunnei2018-06-092-8/+18
|/ / /
* | | Merge pull request #505 from janisozaur/ccache-travisbunnei2018-06-095-7/+17
|\ \ \
| * | | Cache ccache on TravisMichał Janiszewski2018-06-071-0/+4
| * | | Add ccache support for macOS on TravisMichał Janiszewski2018-06-072-1/+5
| * | | Add ccache support for Linux on TravisMichał Janiszewski2018-06-072-2/+8
| * | | Install cmake from repositories for UbuntuMichał Janiszewski2018-06-071-5/+1
* | | | Merge pull request #533 from mailwl/array-to-bufferbunnei2018-06-093-22/+15
|\ \ \ \
| * | | | Common/string_util: add StringFromBuffer functionmailwl2018-06-073-22/+15
* | | | | Merge pull request #548 from Subv/blendbunnei2018-06-093-47/+47
|\ \ \ \ \
| * | | | | GPU: Synchronize the blend state on every draw call.Subv2018-06-092-16/+20
| * | | | | GPU: Added registers for normal and independent blending.Subv2018-06-092-31/+27
|/ / / / /
* | | | | Merge pull request #547 from Subv/compressed_alignmentbunnei2018-06-081-2/+7
|\ \ \ \ \
| * | | | | GLCache: Align compressed texture sizes to their compression ratio, and then align that compressed size to the block height for tiled textures.Subv2018-06-081-2/+7
| | |/ / / | |/| | |
* | | | | Merge pull request #546 from Subv/flush_ubo_bufferbunnei2018-06-081-0/+3
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | Rasterizer: Flush the written region when writing shader uniform data before copying it to the uniform buffers.Subv2018-06-081-0/+3
|/ / / /
* | | | Merge pull request #478 from janisozaur/patch-1bunnei2018-06-071-3/+3
|\ \ \ \
| * | | | Use Ninja for Travis buildsMichał Janiszewski2018-05-281-3/+3
* | | | | Merge pull request #543 from Subv/uniformsbunnei2018-06-071-3/+4
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | GLRenderer: Write the shader stage configuration UBO data *before* copying it to the GPU.Subv2018-06-071-3/+4
* | | | | Merge pull request #522 from mailwl/mm-ubunnei2018-06-076-0/+85
|\ \ \ \ \
| * | | | | Remove unused header filesmailwl2018-06-061-2/+0
| * | | | | Small fixesmailwl2018-06-052-6/+8
| * | | | | Service/MM: add service and stub some functionsmailwl2018-06-056-0/+85
* | | | | | Merge pull request #542 from bunnei/bfe_immbunnei2018-06-072-7/+44
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Implement BFE_IMM instruction.bunnei2018-06-072-7/+44
* | | | | | | Merge pull request #541 from Subv/blittexturesbunnei2018-06-071-56/+9
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | GLCache: Use the full uncompressed size when blitting from one texture to another.Subv2018-06-071-3/+6
| * | | | | | GLCache: Simplify the logic to copy from one texture to another in BlitTextures.Subv2018-06-071-53/+3
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #539 from bunnei/f2f-roundingbunnei2018-06-072-10/+35
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: F2F: Implement rounding modes.bunnei2018-06-072-10/+35
* | | | | | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| * | | | | | Correct function resultsmailwl2018-06-041-4/+16
| * | | | | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
* | | | | | | Merge pull request #537 from bunnei/misc-shaderbunnei2018-06-072-8/+24
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Remove some attribute stuff that has nothing to do with TEX/TEXS.bunnei2018-06-071-8/+4
| * | | | | | | shader_bytecode: Add instruction decodings for BFE, IMNMX, and XMAD.bunnei2018-06-071-0/+20
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #535 from Subv/gpu_swizzlebunnei2018-06-076-0/+65
|\ \ \ \ \ \ \
| * | | | | | | GPU: Support changing the texture swizzles for Maxwell textures.Subv2018-06-073-0/+45
| * | | | | | | GLState: Support changing the GL_TEXTURE_SWIZZLE parameter of each texture unit.Subv2018-06-073-0/+20
| |/ / / / / /
* | | | | | | Merge pull request #536 from bunnei/isetp_immbunnei2018-06-071-8/+9
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_decompiler: Implement ISETP_IMM instruction.bunnei2018-06-071-8/+9
|/ / / / / /
* | | | | | Merge pull request #534 from Subv/multitexturingbunnei2018-06-079-69/+172
|\ \ \ \ \ \
| * | | | | | GPU: Implement sampling multiple textures in the generated glsl shaders.Subv2018-06-069-69/+172
* | | | | | | Merge pull request #532 from bunnei/ld_cbunnei2018-06-074-28/+110
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | gl_shader_decompiler: Implement LD_C instruction.bunnei2018-06-072-0/+43
| * | | | | | gl_shader_gen: Add uniform handling for indirect const buffer access.bunnei2018-06-073-4/+40
| * | | | | | gl_shader_decompiler: Refactor uniform handling to allow different decodings.bunnei2018-06-062-26/+29
|/ / / / / /
* | | | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
* | | | | | Merge pull request #529 from bunnei/am-nifm-stubsSebastian Valle2018-06-063-2/+23
|\ \ \ \ \ \
| * | | | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| * | | | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
* | | | | | | Merge pull request #531 from bunnei/fix-shlSebastian Valle2018-06-061-1/+1
|\ \ \ \ \ \ \
| * | | | | | | gl_shader_decompiler: Fix un/signed mismatch with SHL.bunnei2018-06-061-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #530 from bunnei/wrap-mirrorSebastian Valle2018-06-061-0/+2
|\ \ \ \ \ \ \
| * | | | | | | maxwell_to_gl: Implement WrapMode Mirror.bunnei2018-06-061-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #527 from Subv/rgba32f_texcopybunnei2018-06-062-0/+5
|\ \ \ \ \ \ \
| * | | | | | | GPU: Allow the usage of RGBA16_FLOAT in the texture copy engine.Subv2018-06-061-0/+2
| * | | | | | | GPU: Allow the usage of RGBA32_FLOAT in the texture copy engine.Subv2018-06-062-0/+3
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #528 from Subv/rg11b10fbunnei2018-06-064-12/+31
|\ \ \ \ \ \ \
| * | | | | | | GPU: Implemented the R11FG11FB10F texture and rendertarget formats.Subv2018-06-064-11/+30
| * | | | | | | GPU: Fixed the compression factor for RGBA16F textures.Subv2018-06-061-1/+1
| |/ / / / / /
* | / / / / / GDB Stub Improvements (#508)Hedges2018-06-064-27/+194
| |/ / / / / |/| | | | |
* | | | | | Merge pull request #516 from Subv/f2i_rbunnei2018-06-062-7/+64
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | |
| * | | | | GPU: Implemented the F2I_R shader instruction.Subv2018-06-052-7/+64
* | | | | | Merge pull request #523 from yuzu-emu/revert-507-3616James Rowe2018-06-051-1/+1
|\ \ \ \ \ \
| * | | | | | Revert "Port citra #3616"bunnei2018-06-051-1/+1
|/ / / / / /
* | | | | | Merge pull request #521 from Subv/brabunnei2018-06-051-4/+5
|\ \ \ \ \ \
| * | | | | | GPU: Corrected the branch targets for the shader bra instruction.Subv2018-06-051-4/+5
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #520 from bunnei/shader-shlbunnei2018-06-052-15/+48
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | gl_shader_decompiler: Fix typo with ISCADD instruction.bunnei2018-06-051-1/+1
| * | | | | gl_shader_decompiler: Implement SHL instruction.bunnei2018-06-052-14/+47
* | | | | | Merge pull request #518 from Subv/incomplete_shadersbunnei2018-06-051-5/+16
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | GPU: Implement predicated exit instructions in the shader programs.Subv2018-06-051-4/+6
| * | | | | GPU: Take into account predicated exits when performing shader control flow analysis.Subv2018-06-051-1/+10
* | | | | | Merge pull request #519 from bunnei/pred-not-equalbunnei2018-06-051-3/+3
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Implement PredCondition::NotEqual.bunnei2018-06-051-3/+3
|/ / / / / /
* | | | | | Merge pull request #517 from Subv/iscaddbunnei2018-06-052-0/+47
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | GPU: Implement the ISCADD shader instructions.Subv2018-06-052-0/+40
| * | | | | GPU: Added decodings for the ISCADD instructions.Subv2018-06-051-0/+7
|/ / / / /
* | | | | Merge pull request #514 from Subv/lop32ibunnei2018-06-052-1/+58
|\ \ \ \ \
| * | | | | GPU: Implemented the LOP32I instruction.Subv2018-06-042-1/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #510 from Subv/isetpbunnei2018-06-052-6/+63
|\ \ \ \ \
| * | | | | GPU: Use explicit types when retrieving the uniform values for fsetp/fset and isetp instead of the type of an invalid output register.Subv2018-06-041-9/+18
| * | | | | GPU: Implemented the ISETP_R and ISETP_C shader instructions.Subv2018-06-042-0/+48
* | | | | | Merge pull request #512 from Subv/fsetbunnei2018-06-052-4/+19
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | |
| * | | | | GPU: Use the bf bit in FSET to determine whether to write 0xFFFFFFFF or 1.0f.Subv2018-06-042-2/+7
| * | | | | GPU: Corrected the I2F_R implementation.Subv2018-06-041-2/+12
| | |/ / / | |/| | |
* | | | | Merge pull request #501 from Subv/shader_brabunnei2018-06-052-1/+45
|\ \ \ \ \
| * | | | | GPU: Partially implemented the shader BRA instruction.Subv2018-06-042-1/+43
| * | | | | GPU: Added decoding for the BRA instruction.Subv2018-06-041-0/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #515 from Subv/viewport_fixbunnei2018-06-052-14/+30
|\ \ \ \ \
| * | | | | GPU: Calculate the correct viewport dimensions based on the scale and translate registers.Subv2018-06-042-14/+30
| | |/ / / | |/| | |
* | | | | Merge pull request #490 from BreadFish64/extension-checkbunnei2018-06-044-0/+53
|\ \ \ \ \
| * | | | | sdl: add check for GL extension supportBreadFish642018-06-042-0/+26
| * | | | | qt: add check for GL extension supportBreadFish642018-06-042-0/+27
* | | | | | Merge pull request #513 from Subv/cache_alignmentbunnei2018-06-041-1/+2
|\ \ \ \ \ \
| * | | | | | GLCache: Corrected a mismatch between storing compressed sizes and verifying the uncompressed alignment in GetSurface.Subv2018-06-041-1/+2
| | |/ / / / | |/| | | |
* | | | | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
* | | | | | Merge pull request #502 from bunnei/more-am-stuffbunnei2018-06-041-4/+28
|\ \ \ \ \ \
| * | | | | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
| * | | | | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
| * | | | | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
| |/ / / / /
* | | | | | Merge pull request #507 from valentinvanelslande/3616James Rowe2018-06-041-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Port citra #3616Valentin Vanelslande2018-06-041-1/+1
|/ / / / /
* | | | | Merge pull request #499 from bunnei/am-stuffbunnei2018-06-042-66/+105
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
| * | | | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
| * | | | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
| * | | | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
* | | | | Merge pull request #500 from Subv/long_queriesbunnei2018-06-041-9/+24
|\ \ \ \ \
| * | | | | GPU: Partial implementation of long GPU queries.Subv2018-06-041-9/+24
* | | | | | Merge pull request #498 from bunnei/texs-maskbunnei2018-06-042-9/+26
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | gl_shader_decompiler: Implement TEXS component mask.bunnei2018-06-032-9/+26
|/ / / / /
* | | | | Merge pull request #494 from bunnei/shader-texbunnei2018-06-032-2/+58
|\ \ \ \ \
| * | | | | gl_shader_decompiler: Implement TEX instruction.bunnei2018-06-012-1/+36
| * | | | | gl_shader_decompiler: Support multi-destination for TEXS.bunnei2018-06-012-2/+23
* | | | | | Merge pull request #495 from bunnei/improve-rrobunnei2018-06-032-9/+18
|\ \ \ \ \ \
| * | | | | | gl_shader_decompiler: Implement RRO as a register move.bunnei2018-06-032-9/+18
| |/ / / / /
* | | | | | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-034-0/+74
|\ \ \ \ \ \
| * | | | | | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-304-0/+74
* | | | | | | Merge pull request #496 from Subv/waitprocesswidekey_timeoutbunnei2018-06-031-2/+5
|\ \ \ \ \ \ \
| * | | | | | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #497 from Subv/dxn1bunnei2018-06-033-3/+16
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | GPU: Implemented the DXN1 (BC4) texture format.Subv2018-06-023-3/+16
|/ / / / / /
* | | | | | Merge pull request #492 from mailwl/timebunnei2018-06-012-14/+72
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
|/ / / / /
* | | | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \ \ \
| * | | | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| * | | | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| * | | | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
* | | | | | Merge pull request #491 from bunnei/rgba16fbunnei2018-06-013-7/+24
|\ \ \ \ \ \
| * | | | | | gl_rasterizer_cache: Assert that component type is UNorm or format is RGBA16F.bunnei2018-05-311-1/+2
| * | | | | | gl_rasterizer_cache: Implement PixelFormat RGBA16F.bunnei2018-05-313-6/+22
|/ / / / / /
* | | | | | Merge pull request #489 from Subv/vertexidbunnei2018-05-302-1/+11
|\ \ \ \ \ \
| * | | | | | Shaders: Implemented reading the gl_InstanceID and gl_VertexID variables in the vertex shader.Subv2018-05-302-1/+11
| |/ / / / /
* | | / / / add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
| |_|/ / / |/| | | |
* | | | | Merge pull request #483 from bunnei/sonicSebastian Valle2018-05-305-10/+35
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | gl_shader_decompiler: F2F_R instruction: Implement abs.bunnei2018-05-301-1/+7
| * | | | gl_shader_decompiler: Partially implement F2F_R instruction.bunnei2018-05-302-4/+9
| * | | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
| * | | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
| * | | | gl_rasterize_cache: Invert order of tex format RGB565.bunnei2018-05-301-1/+1
| |/ / /
* | | | Merge pull request #482 from Subv/r8bunnei2018-05-303-5/+18
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Implemented the R8 texture format (0x1D)Subv2018-05-303-5/+18
|/ / /
* | | Merge pull request #480 from mailwl/bcatbunnei2018-05-308-0/+120
|\ \ \
| * | | Service/BCAT: add module and servicesmailwl2018-05-288-0/+120
| |/ /
* / / add all the known TextureFormat (#474)greggameplayer2018-05-291-2/+71
|/ /
* | Merge pull request #472 from bunnei/greater-equalbunnei2018-05-271-4/+3
|\ \
| * | gl_shader_decompiler: Implement GetPredicateComparison GreaterEqual.bunnei2018-05-261-4/+3
* | | Merge pull request #476 from Subv/a1bgr5bunnei2018-05-274-5/+21
|\ \ \
| * | | GPU: Implemented the A1B5G5R5 texture format (0x14)Subv2018-05-274-5/+21
| |/ /
* | | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \ \
| * | | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
| |/ /
* | | Merge pull request #473 from bunnei/get-display-versionbunnei2018-05-272-1/+10
|\ \ \
| * | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
| |/ /
* | | Merge pull request #471 from bunnei/fmnmxSebastian Valle2018-05-272-4/+10
|\ \ \ | |/ / |/| |
| * | shader_bytecode: Implement other variants of FMNMX.bunnei2018-05-262-4/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
* | | Merge pull request #468 from Subv/compound_predsbunnei2018-05-261-46/+66
|\ \ \
| * | | Shader: Implemented compound predicates in fset.Subv2018-05-251-28/+12
| * | | Shader: Implemented compound predicates in fsetp.Subv2018-05-251-19/+55
| |/ /
* | | Merge pull request #469 from Subv/channel_rebindbunnei2018-05-261-1/+0
|\ \ \
| * | | GPU: Allow command lists to rebind a channel to another engine in the middle of the command list.Subv2018-05-251-1/+0
| |/ /
* / / Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ /
* | Merge pull request #464 from bunnei/fix-msvcbunnei2018-05-241-14/+12
|\ \
| * | yuzu_cmd: Fix project for latest msvc.bunnei2018-05-241-14/+12
|/ /
* | Merge pull request #462 from ogniK5377/hid-fixbunnei2018-05-241-1/+1
|\ \
| * | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
|/ /
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #461 from lioncash/dynarmicbunnei2018-05-231-0/+0
|\ \ \
| * | | externals: Update dynarmicLioncash2018-05-231-0/+0
|/ / /
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| |
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-216-1/+118
|\ \ \
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-204-0/+70
| |/ /
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ /
* | | Merge pull request #458 from Subv/fmnmxbunnei2018-05-212-6/+26
|\ \ \
| * | | Shaders: Implemented the FMNMX shader instruction.Subv2018-05-212-6/+26
| |/ /
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #453 from Subv/thread_callstackSebastian Valle2018-05-212-0/+37
|\ \ \
| * | | Qt/WaitTree: Display the callstack for each thread in the wait tree widget.Subv2018-05-192-0/+37
| |/ /
* | | Merge pull request #452 from Subv/psetpSebastian Valle2018-05-211-0/+3
|\ \ \
| * | | ShadersDecompiler: Added decoding for the PSETP instruction.Subv2018-05-191-0/+3
| |/ /
* | | Merge pull request #451 from Subv/gl_array_sizeSebastian Valle2018-05-212-13/+3
|\ \ \
| * | | GLRenderer: Remove unused hw_vao_enabled_attributes variable.Subv2018-05-192-4/+0
| * | | GLRenderer: Remove unused vertex buffer and increase the size of the stream buffer to 128 MB.Subv2018-05-192-9/+3
| |/ /
* | | Merge pull request #450 from Subv/shader_link_errorSebastian Valle2018-05-201-0/+27
|\ \ \
| * | | GLRenderer: Log the shader source code when program linking fails.Subv2018-05-191-0/+27
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
* | | Merge pull request #442 from Hexagon12/nfp-service-namesSebastian Valle2018-05-201-24/+24
|\ \ \ | |/ / |/| |
| * | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-1124-189/+613
|\ \
| * | core: Add several missing docstrings.bunnei2018-05-111-0/+8
| * | thread: Rename mask to affinity_masks.bunnei2018-05-114-5/+6
| * | core: Run all CPU cores separately, even in single-thread mode.bunnei2018-05-112-13/+23
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| * | wait_tree: Add ideal core and affinity mask.bunnei2018-05-111-0/+2
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-114-3/+10
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| * | wait_tree: Show all threads on all schedulers.bunnei2018-05-111-6/+14
| * | core: Add a configuration setting for use_multi_core.bunnei2018-05-1110-17/+56
| * | core: Support session close with multicore.bunnei2018-05-114-16/+47
| * | core: Implement multicore support.bunnei2018-05-1113-78/+113
| * | core: Create a thread for each CPU core, keep in lock-step with a barrier.bunnei2018-05-114-18/+94
| * | core: Move common CPU core things to its own class.bunnei2018-05-115-58/+135
* | | Merge pull request #439 from ogniK5377/GetTPCMasksbunnei2018-05-112-4/+8
|\ \ \ | |/ / |/| |
| * | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-073-68/+224
* | Merge pull request #434 from lioncash/vdtorbunnei2018-05-033-1/+13
|\ \
| * | memory_hook: Default virtual destructor in the cpp fileLioncash2018-05-033-1/+13
* | | Merge pull request #433 from lioncash/loggingbunnei2018-05-032-48/+55
|\ \ \ | |/ / |/| |
| * | core_timing: Don't include the log header in core timing's headerLioncash2018-05-032-48/+55
|/ /
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0229-104/+105
|\ \
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0229-104/+105
* | | Merge pull request #430 from lioncash/vecbunnei2018-05-021-9/+9
|\ \ \
| * | | vector_math: Ensure members are always initializedLioncash2018-05-021-9/+9
| |/ /
* | | Merge pull request #427 from bunnei/domain-inputsbunnei2018-05-024-0/+23
|\ \ \ | |/ / |/| |
| * | ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ /
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ /
* | Merge pull request #425 from lioncash/namespacebunnei2018-04-309-14/+18
|\ \
| * | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-309-14/+18
|/ /
* | Merge pull request #424 from lioncash/stringbunnei2018-04-308-99/+19
|\ \
| * | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-308-99/+19
* | | Merge pull request #422 from bunnei/shader-movbunnei2018-04-304-0/+30
|\ \ \
| * | | maxwell_3d: Reset vertex counts after drawing.bunnei2018-04-291-0/+10
| * | | gl_shader_decompiler: Implement MOV_R.bunnei2018-04-291-1/+2
| * | | maxwell_to_gl: Implement type SignedNorm, Size_8_8_8_8.bunnei2018-04-291-0/+12
| * | | shader_bytecode: Add decoding for FMNMX instruction.bunnei2018-04-291-0/+2
| * | | gl_shader_decompiler: Implement MOV_C.bunnei2018-04-291-0/+5
* | | | Merge pull request #423 from lioncash/filebunnei2018-04-302-8/+12
|\ \ \ \ | |_|/ / |/| | |
| * | | file_util: Make move constructor/assignment operator and related functions noexceptLioncash2018-04-302-6/+6
| * | | file_util: Add static assertions to ReadBytes() and WriteBytes()Lioncash2018-04-301-2/+6
|/ / /
* | | Merge pull request #421 from Subv/sh_pred3bunnei2018-04-291-0/+7
|\ \ \ | |/ / |/| |
| * | Shaders: Implemented predicate condition 3 (LessEqual) in the fset and fsetp instructions.Subv2018-04-291-0/+7
|/ /
* | Merge pull request #416 from bunnei/shader-ints-p3bunnei2018-04-292-114/+206
|\ \
| * | gl_shader_decompiler: Partially implement I2I_R, and I2F_R.bunnei2018-04-292-8/+34
| * | gl_shader_decompiler: More cleanups, etc. with how we handle register types.bunnei2018-04-291-44/+120
| * | GLSLRegister: Simplify register declarations, etc.bunnei2018-04-291-63/+31
| * | shader_bytecode: Add decodings for i2i instructions.bunnei2018-04-291-3/+20
| * | gl_shader_decompiler: Implement MOV32_IMM instruction.bunnei2018-04-292-2/+7
* | | Merge pull request #417 from bunnei/lang-codesbunnei2018-04-293-8/+49
|\ \ \
| * | | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
| * | | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
| |/ /
* | | Merge pull request #418 from bunnei/copy-block-heightSebastian Valle2018-04-292-2/+7
|\ \ \ | |/ / |/| |
| * | fermi_2d: Fix surface copy block height.bunnei2018-04-292-2/+7
|/ /
* | Merge pull request #414 from lioncash/cruftbunnei2018-04-281-8/+0
|\ \
| * | file_util: Remove compiler version checks around is_trivially_copyable()Lioncash2018-04-281-8/+0
* | | Merge pull request #413 from lioncash/dynarmicbunnei2018-04-281-0/+0
|\ \ \ | |/ / |/| |
| * | externals: Update dynarmicLioncash2018-04-281-0/+0
* | | Merge pull request #412 from lioncash/logbunnei2018-04-282-54/+1
|\ \ \ | |/ / |/| |
| * | log: Remove old logging macros and functionsLioncash2018-04-272-54/+1
* | | Merge pull request #411 from lioncash/travisMat M2018-04-281-1/+1
|\ \ \ | |/ / |/| |
| * | travis: Use Xcode 9.3 instead of 9.2Lioncash2018-04-271-1/+1
* | | Merge pull request #408 from bunnei/shader-ints-p2bunnei2018-04-271-154/+262
|\ \ \
| * | | gl_shader_decompiler: Add GLSLRegisterManager class to track register state.bunnei2018-04-271-154/+262
| |/ /
* | | Merge pull request #410 from lioncash/genericbunnei2018-04-274-12/+11
|\ \ \ | |/ / |/| |
| * | renderer_opengl: Replace usages of LOG_GENERIC with fmt-capable equivalentsLioncash2018-04-271-6/+7
| * | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
|/ /
* | Merge pull request #409 from lioncash/assertbunnei2018-04-2717-39/+39
|\ \
| * | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-2717-39/+39
|/ /
* | Merge pull request #380 from ogniK5377/service-implbunnei2018-04-2713-13/+140
|\ \
| * | Switched to NGLOG_WARNINGDavid Marcec2018-04-274-5/+5
| * | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-26110-2244/+1811
| |\ \
| * | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-263-13/+3
| * | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-2310-25/+64
| * | | lioncash proposed changesDavid2018-04-221-2/+2
| * | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2211-11/+109
* | | | Merge pull request #406 from lioncash/frontendbunnei2018-04-275-27/+26
|\ \ \ \
| * | | | frontends: Move logging macros over to new fmt-capable onesLioncash2018-04-275-27/+26
* | | | | Merge pull request #407 from lioncash/commonbunnei2018-04-274-67/+67
|\ \ \ \ \
| * | | | | common: Move logging macros over to new fmt-capable macros where applicableLioncash2018-04-274-67/+67
| |/ / / /
* | | | | Merge pull request #405 from lioncash/inputbunnei2018-04-271-3/+3
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | input_common: Move old logging macros over to fmt-capable onesLioncash2018-04-271-3/+3
|/ / / /
* | | | Merge pull request #402 from lioncash/corebunnei2018-04-276-28/+28
|\ \ \ \
| * | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalentsLioncash2018-04-266-28/+28
* | | | | Merge pull request #399 from bunnei/shader-intsbunnei2018-04-272-9/+120
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | gl_shader_decompiler: Boilerplate for handling integer instructions.bunnei2018-04-262-6/+111
| * | | | gl_shader_decompiler: Move color output to EXIT instruction.bunnei2018-04-261-6/+12
| |/ / /
* | | | Merge pull request #403 from lioncash/commonbunnei2018-04-263-792/+0
|\ \ \ \ | |/ / / |/| | |
| * | | common: Remove chunk_file.h and linear_disk_cache.hLioncash2018-04-263-792/+0
|/ / /
* | | Merge pull request #401 from lioncash/gdbstubbunnei2018-04-261-38/+37
|\ \ \
| * | | core/gdbstub: Move logging macros to new fmt-compatible onesLioncash2018-04-261-38/+37
|/ / /
* | | Merge pull request #400 from lioncash/hwbunnei2018-04-262-8/+10
|\ \ \
| * | | core/hw: Move logging macros over to fmt-capable onesLioncash2018-04-262-8/+10
|/ / /
* | | Merge pull request #396 from Subv/shader_opsbunnei2018-04-262-9/+89
|\ \ \
| * | | Shaders: Added bit decodings for the I2I instruction.Subv2018-04-251-0/+6
| * | | Shaders: Implemented the FSET instruction.Subv2018-04-251-0/+53
| * | | Shaders: Added decodings for the FSET instructions.Subv2018-04-252-9/+30
* | | | Merge pull request #398 from lioncash/kernelbunnei2018-04-2611-107/+110
|\ \ \ \
| * | | | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| * | | | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
* | | | | Merge pull request #387 from Subv/maxwell_2dbunnei2018-04-2610-52/+203
|\ \ \ \ \
| * | | | | GPU: Partially implemented the Fermi2D surface copy operation.Subv2018-04-252-0/+59
| * | | | | Memory: Added a missing shortcut for Memory::CopyBlock for the current process.Subv2018-04-251-0/+4
| * | | | | GPU: Make the Textures::CopySwizzledData function accessible from the outside of the file.Subv2018-04-252-3/+6
| * | | | | GPU: Added a function to retrieve the bytes per pixel of the render target formats.Subv2018-04-252-0/+15
| * | | | | GPU: Added surface copy registers to Fermi2DSubv2018-04-251-1/+57
| * | | | | GPU: Added boilerplate code for the Fermi2D engineSubv2018-04-253-3/+34
| * | | | | GPU: Reduce the number of registers of Maxwell3D to 0xE00.Subv2018-04-252-5/+5
| * | | | | GPU: Move the Maxwell3D macro uploading code to the inside of the Maxwell3D processor.Subv2018-04-254-40/+23
| * | | | | GPU: Corrected the upper bound of the PFIFO method ids in the command processor.Subv2018-04-251-1/+1
* | | | | | Merge pull request #395 from lioncash/file-sysbunnei2018-04-268-68/+59
|\ \ \ \ \ \ | |_|/ / / / |/| | | | |
| * | | | | file-sys: convert a StringFromFormat call into fmt::format in GetFullPath()Lioncash2018-04-251-4/+1
| * | | | | file-sys: Move logging macros over to the new fmt-capable onesLioncash2018-04-258-64/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #390 from mailwl/pctl-modulebunnei2018-04-257-39/+71
|\ \ \ \ \
| * | | | | Service/PCTL: convert to module, add services, stubmailwl2018-04-257-39/+71
| |/ / / /
* | | | | Merge pull request #397 from lioncash/corebunnei2018-04-251-24/+26
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | core/memory: Amend address widths in assertsLioncash2018-04-251-2/+2
| * | | | core/memory: Move logging macros over to new fmt-capable onesLioncash2018-04-251-22/+24
| |/ / /
* | | | Merge pull request #394 from lioncash/video-corebunnei2018-04-255-18/+20
|\ \ \ \ | |/ / / |/| | |
| * | | video-core: Move logging macros over to new fmt-capable onesLioncash2018-04-255-18/+20
|/ / /
* | | Merge pull request #388 from bunnei/refactor-rasterizer-cachebunnei2018-04-2514-175/+334
|\ \ \
| * | | renderer_opengl: Use correct byte order for framebuffer pixel format ABGR8.bunnei2018-04-251-2/+1
| * | | gl_rasterizer_cache: Use CHAR_BIT for bpp conversions instead of 8.bunnei2018-04-252-4/+4
| * | | gl_rasterizer_cache: Use GPU PAGE_BITS/SIZE, not CPU.bunnei2018-04-251-5/+5
| * | | gl_rasterizer_cache: Use new logger.bunnei2018-04-251-4/+4
| * | | gl_rasterizer_cache: Add a function for finding framebuffer GPU address.bunnei2018-04-253-0/+31
| * | | gl_rasterizer_cache: Handle compressed texture sizes.bunnei2018-04-252-24/+65
| * | | gl_rasterizer_cache: Update to be based on GPU addresses, not CPU addresses.bunnei2018-04-2510-67/+122
| * | | memory_manager: Add implement CpuToGpuAddress.bunnei2018-04-242-0/+27
| * | | memory_manager: Make GpuToCpuAddress return an optional.bunnei2018-04-247-28/+37
| * | | memory_manager: Use GPUVAdddr, not PAddr, for GPU addresses.bunnei2018-04-247-60/+57
* | | | Merge pull request #393 from lioncash/loaderbunnei2018-04-255-26/+25
|\ \ \ \ | |/ / / |/| | |
| * | | loader: Move old logging macros over to new fmt-capable onesLioncash2018-04-255-26/+25
|/ / /
* | | Merge pull request #386 from Subv/gpu_querybunnei2018-04-242-2/+53
|\ \ \
| * | | GPU: Added asserts to our code for handling the QUERY_GET GPU command.Subv2018-04-242-2/+53
* | | | Merge pull request #392 from lioncash/logbunnei2018-04-2438-297/+298
|\ \ \ \
| * | | | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| * | | | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| * | | | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| * | | | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| * | | | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| * | | | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| * | | | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| * | | | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| * | | | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| * | | | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| * | | | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| * | | | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| * | | | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| * | | | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| * | | | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| * | | | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| * | | | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| * | | | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| * | | | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| * | | | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| * | | | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
* | | | | Merge pull request #391 from lioncash/videobunnei2018-04-241-1/+2
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | renderer_opengl: Silence a -Wdangling-else warning in DrawScreenTriangles()Lioncash2018-04-241-1/+2
|/ / / /
* | | | Merge pull request #389 from mailwl/fs-renamefilebunnei2018-04-246-8/+36
|\ \ \ \
| * | | | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-246-8/+36
|/ / / /
* | | | Merge pull request #379 from Subv/multi_buffersbunnei2018-04-243-43/+89
|\ \ \ \
| * | | | GPU: Support multiple enabled vertex arrays.Subv2018-04-233-43/+89
| |/ / /
* | | | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2316-525/+285
|\ \ \ \
| * | | | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| * | | | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-213-3/+3
| * | | | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-215-90/+55
| * | | | Kernel: Remove unused ConditionVariable class.Subv2018-04-216-150/+0
| * | | | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| * | | | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| * | | | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
* | | | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
|\ \ \ \ \
| * | | | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| * | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | |/ / / | |/| | |
* | | | | Merge pull request #385 from Subv/unimpl_ioctlsbunnei2018-04-235-5/+5
|\ \ \ \ \
| * | | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
| |/ / / /
* | | | | Merge pull request #383 from Subv/gpu_mmubunnei2018-04-232-34/+25
|\ \ \ \ \
| * | | | | GPU: Make the GPU virtual memory manager use 16 page bits and 10 page table bits.Subv2018-04-232-34/+25
| |/ / / /
* | | | | Merge pull request #382 from Subv/a2rgb10_rtbunnei2018-04-232-0/+4
|\ \ \ \ \ | |_|_|/ / |/| | | |
| * | | | GPU: Implement the RGB10_A2 RenderTarget format, it will use the same format as the A2BGR10 texture format.Subv2018-04-232-0/+4
|/ / / /
* | | | Merge pull request #378 from Subv/a2bgr10bunnei2018-04-224-6/+18
|\ \ \ \ | |/ / / |/| | |
| * | | GPU: Implement the A2BGR10 texture format.Subv2018-04-224-6/+18
|/ / /
* | | Merge pull request #377 from adityaruplaha/sdl2-fullscreenbunnei2018-04-213-4/+40
|\ \ \
| * | | SDL2: Implement fullscreen. (Original PR: citra-emu/citra#3607)adityaruplaha2018-04-213-4/+40
* | | | Merge pull request #376 from bunnei/shader-decoderbunnei2018-04-212-210/+249
|\ \ \ \
| * | | | gl_shader_decompiler: Skip RRO instruction.bunnei2018-04-211-0/+4
| * | | | gl_shader_decompiler: Cleanup error logging.bunnei2018-04-211-14/+6
| * | | | shader_bytecode: Add several more instruction decodings.bunnei2018-04-211-5/+52
| * | | | shader_bytecode: Decode instructions based on bit strings.bunnei2018-04-212-205/+201
* | | | | Merge pull request #375 from lioncash/headerbunnei2018-04-214-11/+0
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | opengl: Remove unnecessary header inclusionsLioncash2018-04-214-11/+0
* | | | | Merge pull request #369 from Subv/shader_instr2bunnei2018-04-212-4/+179
|\ \ \ \ \
| * | | | | ShaderGen: Implemented the KIL instruction, which is equivalent to 'discard'.Subv2018-04-211-1/+7
| * | | | | ShaderGen: Implemented predicated instruction execution.Subv2018-04-212-1/+40
| * | | | | ShaderGen: Implemented the fsetp instruction.Subv2018-04-212-3/+112
| * | | | | ShaderGen: Register id 255 is special and is hardcoded to return 0 (SR_ZERO).Subv2018-04-202-0/+5
| * | | | | ShaderGen: Ignore the 'sched' instruction when generating shaders.Subv2018-04-201-0/+16
| | |_|/ / | |/| | |
* | | | | Merge pull request #374 from lioncash/noexceptbunnei2018-04-211-20/+19
|\ \ \ \ \
| * | | | | gl_resource_manager: Add missing noexcept specifiers to move constructors and assignment operatorsLioncash2018-04-211-20/+19
| | |/ / / | |/| | |
* | | | | Merge pull request #373 from lioncash/enum2bunnei2018-04-211-4/+9
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Make MatchFlags an enum classLioncash2018-04-211-4/+9
| |/ / / /
* | | | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \ \ \
| * | | | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
| |/ / / /
* | | | | Merge pull request #371 from lioncash/globalbunnei2018-04-216-38/+66
|\ \ \ \ \ | |/ / / / |/| | | |
| * | | | core: Relocate g_service_manager to the System classLioncash2018-04-216-38/+66
|/ / / /
* | | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ \ | |/ / / |/| | |
| * | | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
* | | | Merge pull request #367 from lioncash/clampbunnei2018-04-205-24/+22
|\ \ \ \
| * | | | math_util: Remove the Clamp() functionLioncash2018-04-205-24/+22
* | | | | Merge pull request #361 from lioncash/commonbunnei2018-04-201-18/+12
|\ \ \ \ \
| * | | | | common_types: Convert typedefs to using aliasesLioncash2018-04-201-12/+12
| * | | | | common_types: Remove unnecessary check for whether or not__func__ is definedLioncash2018-04-201-6/+0
| |/ / / /
* | | | | Merge pull request #368 from lioncash/dynarmicbunnei2018-04-201-0/+0
|\ \ \ \ \
| * | | | | externals: Update dynarmic to HEADLioncash2018-04-201-0/+0
* | | | | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \ \ \ \
| * | | | | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #364 from lioncash/thread-localbunnei2018-04-201-19/+0
|\ \ \ \ \ \
| * | | | | | common/thread: Remove unnecessary feature checking for thread_localLioncash2018-04-201-19/+0
| |/ / / / /
* | | | | | Merge pull request #362 from lioncash/snprintfbunnei2018-04-201-5/+0
|\ \ \ \ \ \
| * | | | | | common_funcs: Remove check for VS versions that we don't even supportLioncash2018-04-201-5/+0
| |/ / / / /
* | | | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-203-5/+4
|\ \ \ \ \ \
| * | | | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-203-5/+4
| |/ / / / /
* | | | | | Merge pull request #366 from lioncash/vecbunnei2018-04-201-30/+0
|\ \ \ \ \ \
| * | | | | | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]Lioncash2018-04-201-30/+0
* | | | | | | Merge pull request #365 from lioncash/codeblockbunnei2018-04-202-86/+0
|\ \ \ \ \ \ \
| * | | | | | | common: Remove code_block.hLioncash2018-04-202-86/+0
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #357 from lioncash/guardbunnei2018-04-202-0/+4
|\ \ \ \ \ \ \
| * | | | | | | renderer_opengl: Add missing header guardsLioncash2018-04-202-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #358 from lioncash/explicitbunnei2018-04-202-4/+3
|\ \ \ \ \ \ \
| * | | | | | | disk_filesystem: Remove unused total_entries_in_directory member from Disk_DirectoryLioncash2018-04-201-1/+0
| * | | | | | | disk_filesystem: Remove redundant initializer in Disk_Directory's constructorLioncash2018-04-201-1/+1
| * | | | | | | disk_filesystem: Make constructors explicit where applicableLioncash2018-04-201-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #359 from lioncash/redundantbunnei2018-04-201-9/+5
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / / / / /
* | | | | | Merge pull request #356 from lioncash/shaderbunnei2018-04-201-12/+30
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | glsl_shader_decompiler: Use std::string_view instead of std::string for AddLine()Lioncash2018-04-201-1/+2
| * | | | | glsl_shader_decompiler: Add AddNewLine() function to ShaderWriterLioncash2018-04-201-6/+12
| * | | | | glsl_shader_decompiler: Add char overload for ShaderWriter's AddLine()Lioncash2018-04-201-4/+11
| * | | | | glsl_shader_decompiler: Append indentation without constructing a separate std::stringLioncash2018-04-201-1/+5
* | | | | | Merge pull request #355 from Subv/shader_instrbunnei2018-04-202-11/+39
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | ShaderGen: Implemented the fmul32i shader instruction.Subv2018-04-192-9/+30
| * | | | | ShaderGen: Fixed a case where the TEXS instruction would use the same registers for the input and the output.Subv2018-04-191-2/+9
* | | | | | Merge pull request #348 from jlachniet/patch-1James Rowe2018-04-191-1/+1
|\ \ \ \ \ \
| * | | | | | Technically, yuzu can boot commercial gamesjlachniet2018-04-181-1/+1
* | | | | | | Implement Pull #3528 from citra: use nvidia graphics automatically on laptops with optimus (with AMD support) (#271)N00byKing2018-04-192-0/+18
* | | | | | | Merge pull request #352 from bunnei/fix-microprofileJames Rowe2018-04-191-0/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | |
| * | | | | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
| |/ / / / /
* | | | | | Merge pull request #353 from Subv/compressed_formatsbunnei2018-04-193-28/+35
|\ \ \ \ \ \
| * | | | | | GPU: Add support for the DXT23 and DXT45 compressed texture formats.Subv2018-04-193-28/+35
|/ / / / / /
* | | | | | Merge pull request #351 from Subv/tex_formatsbunnei2018-04-194-8/+28
|\ \ \ \ \ \
| * | | | | | GPU: Implemented the B5G6R5 format.Subv2018-04-194-8/+28
* | | | | | | gl_shader_gen: Support vertical/horizontal viewport flipping. (#347)bunnei2018-04-184-5/+29
|/ / / / / /
* | | | | | Merge pull request #350 from Subv/tex_componentsbunnei2018-04-183-43/+90
|\ \ \ \ \ \
| * | | | | | GLCache: Added boilerplate code to make supporting configurable texture component types.Subv2018-04-183-9/+69
| * | | | | | GLCache: Unify texture and framebuffer formats when converting to OpenGL.Subv2018-04-182-26/+13
| * | | | | | GPU: Texture format 8 and framebuffer format 0xD5 are actually ABGR8.Subv2018-04-182-10/+10
|/ / / / / /
* | | | | | Merge pull request #349 from Subv/texturingbunnei2018-04-187-53/+97
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | GPU: Pitch textures are now supported, don't assert when encountering them.Subv2018-04-181-2/+3
| * | | | | GLCache: Take into account the texture's block height when caching and unswizzling.Subv2018-04-183-43/+43
| * | | | | GLCache: Added a function to convert cached PixelFormats back to texture formats.Subv2018-04-181-0/+12
| * | | | | GPU: Allow using a configurable block height when unswizzling textures.Subv2018-04-184-7/+23
| * | | | | GPU/TIC: Added the pitch and block height fields to the TIC structure.Subv2018-04-181-1/+16
|/ / / / /
* | | | | Merge pull request #346 from bunnei/misc-gpu-improvementsbunnei2018-04-184-2/+11
|\ \ \ \ \
| * | | | | gl_rasterizer_cache: Add missing LOG statements.bunnei2018-04-181-0/+3
| * | | | | texture: Add missing formats.bunnei2018-04-181-1/+3
| * | | | | gpu: Add several framebuffer formats to RenderTargetFormat.bunnei2018-04-181-0/+3
| * | | | | maxwell3d: Allow Texture2DNoMipmap as Texture2D.bunnei2018-04-181-1/+2
* | | | | | Merge pull request #344 from bunnei/shader-decompiler-p2bunnei2018-04-184-73/+180
|\ \ \ \ \ \
| * | | | | | shader_bytecode: Make ctor's constexpr and explicit.bunnei2018-04-181-7/+7
| * | | | | | bit_field: Remove is_pod check, add is_trivially_copyable_v.bunnei2018-04-181-6/+1
| * | | | | | gl_shader_decompiler: Fix warnings with MarkAsUsed.bunnei2018-04-171-1/+2
| * | | | | | gl_shader_decompiler: Cleanup logging, updating to NGLOG_*.bunnei2018-04-171-24/+22
| * | | | | | gl_shader_decompiler: Implement several MUFU subops and abs_d.bunnei2018-04-171-7/+21
| * | | | | | gl_shader_decompiler: Fix swizzle in GetRegister.bunnei2018-04-171-1/+1
| * | | | | | gl_shader_decompiler: Implement FMUL/FADD/FFMA immediate instructions.bunnei2018-04-172-12/+53
| * | | | | | gl_shader_decompiler: Allow vertex position to be used in fragment shader.bunnei2018-04-172-16/+18
| * | | | | | gl_shader_decompiler: Implement IPA instruction.bunnei2018-04-171-0/+11
| * | | | | | gl_shader_decompiler: Add support for TEXS instruction.bunnei2018-04-172-12/+43
| * | | | | | gl_shader_decompiler: Use fragment output color for GPR 0-3.bunnei2018-04-171-0/+5
| * | | | | | gl_shader_decompiler: Partially implement MUFU.bunnei2018-04-171-2/+11
| |/ / / / /
* | | | | | Merge pull request #345 from bunnei/blendingbunnei2018-04-186-7/+140
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | renderer_opengl: Implement BlendEquation and BlendFunc.bunnei2018-04-186-7/+140
|/ / / / /
* | | | | Merge pull request #341 from shinyquagsire23/pfs-hfs-implbunnei2018-04-173-0/+214
|\ \ \ \ \ | |_|/ / / |/| | | |
| * | | | file_sys: Use NGLOGshinyquagsire232018-04-171-5/+5
| * | | | file_sys: tweaksshinyquagsire232018-04-162-6/+7
| * | | | file_sys: Add HFS/PFS helper componentshinyquagsire232018-04-163-0/+213
| |/ / /
* | | | Merge pull request #343 from Subv/tex_wrap_4bunnei2018-04-171-0/+7
|\ \ \ \
| * | | | MaxwellToGL: Implemented tex wrap mode 1 (Wrap, GL_REPEAT).Subv2018-04-171-0/+2
| * | | | MaxwellToGL: Added a TODO and partial implementation of maxwell wrap mode 4 (Clamp, GL_CLAMP).Subv2018-04-171-0/+5
| |/ / /
* | | | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
* | | | Merge pull request #342 from bunnei/indexed-vertsbunnei2018-04-175-28/+98
|\ \ \ \ | |/ / / |/| | |
| * | | gl_rendering: Use NGLOG* for changed code.bunnei2018-04-172-10/+11
| * | | gl_rasterizer: Implement indexed vertex mode.bunnei2018-04-175-23/+92
|/ / /
* | | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \ \
| * | | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
* | | | Merge pull request #337 from Subv/used_buffersbunnei2018-04-155-12/+59
|\ \ \ \
| * | | | GPU: Use the same buffer names in the generated GLSL and the buffer uploading code.Subv2018-04-154-17/+24
| * | | | GPU: Don't use explicit binding points when uploading the constbuffers to opengl.Subv2018-04-153-7/+47
* | | | | Merge pull request #335 from bunnei/delete-filebunnei2018-04-156-9/+27
|\ \ \ \ \
| * | | | | fsp_srv: Implement DeleteFile.bunnei2018-04-156-9/+27
| | |/ / / | |/| | |
* | | | | Merge pull request #334 from Subv/used_buffersbunnei2018-04-153-28/+39
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / /
| * | | GPU: Don't use GetPointer when uploading the constbuffer data to the GPU.Subv2018-04-151-3/+4
| * | | GPU: Use the buffer hints from the shader decompiler to upload only the necessary const buffers for each shader stage.Subv2018-04-153-31/+41
|/ / /
* | | Merge pull request #333 from bunnei/const-buff-hintsbunnei2018-04-155-31/+146
|\ \ \
| * | | shaders: Expose hints about used const buffers.bunnei2018-04-155-31/+146
|/ / /
* | | Merge pull request #328 from Subv/constbuffersbunnei2018-04-158-16/+104
|\ \ \
| * | | GPU: Upload the entirety of each constbuffer for each shader stage as SSBOs.Subv2018-04-154-14/+48
| * | | GPU: Allow configuring ssbos in the opengl state manager.Subv2018-04-154-0/+30
| * | | GPU: Added a function to determine whether a shader stage is enabled or not.Subv2018-04-153-3/+27
|/ / /
* | | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \ \
| * | | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
| |/ /
* | | Merge pull request #327 from adityaruplaha/fullscreen-fixbunnei2018-04-151-2/+4
|\ \ \
| * | | Fix the stuck in fullscreen bug (Original PR: citra-emu/citra#3611)adityaruplaha2018-04-141-2/+4
| |/ /
* | | Merge pull request #331 from bunnei/fsp-flushbunnei2018-04-151-1/+9
|\ \ \
| * | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
| |/ /
* | | Merge pull request #329 from bunnei/shader-gen-part-1bunnei2018-04-1526-642/+1872
|\ \ \ | |/ / |/| |
| * | shaders: Add NumTextureSamplers const, remove unused #pragma.bunnei2018-04-154-4/+5
| * | shaders: Address PR review feedback.bunnei2018-04-142-7/+9
| * | gl_shader_decompiler: Cleanup log statements.bunnei2018-04-141-15/+15
| * | shaders: Fix GCC and clang build issues.bunnei2018-04-143-5/+5
| * | gl_shader_decompiler: Implement negate, abs, etc. and lots of cleanup.bunnei2018-04-142-40/+96
| * | shader_bytecode: Add FSETP and KIL to GetInfo.bunnei2018-04-141-0/+3
| * | shader_bytecode: Add SubOp decoding.bunnei2018-04-141-0/+10
| * | gl_shader_decompiler: Add shader stage hint.bunnei2018-04-142-5/+12
| * | renderer_opengl: Fix Morton copy byteswap, etc.bunnei2018-04-142-6/+6
| * | gl_shader_manager: Implement SetShaderSamplerBindings.bunnei2018-04-141-0/+8
| * | gl_rasterizer: Generate shaders and upload uniforms.bunnei2018-04-142-32/+77
| * | gl_shader_decompiler: Basic impl. for very simple vertex shaders.bunnei2018-04-142-16/+311
| * | gl_shader_manager: Cleanup and consolidate uniform handling.bunnei2018-04-142-26/+24
| * | maxwell_3d: Make memory_manager public.bunnei2018-04-141-2/+1
| * | maxwell_3d: Fix shader_config decodings.bunnei2018-04-141-6/+3
| * | gl_rasterizer: Use shader program manager, remove test shader.bunnei2018-04-142-196/+31
| * | renderer_opengl: Add gl_shader_manager class.bunnei2018-04-143-0/+209
| * | maxwell_to_gl: Add a few types, etc.bunnei2018-04-141-0/+10
| * | gl_shader_gen: Add hashable setup/config structs.bunnei2018-04-142-29/+50
| * | gl_shader_util: Add missing includes.bunnei2018-04-141-0/+2
| * | common: Port cityhash code from Citra.bunnei2018-04-145-147/+502
| * | renderer_opengl: Use OGLProgram instead of OGLShader.bunnei2018-04-146-6/+6
| * | gl_shader_util: Grab latest upstream.bunnei2018-04-142-149/+74
| * | gl_resource_manager: Grab latest upstream.bunnei2018-04-141-30/+86
| * | gl_shader_decompiler: Add skeleton code from Citra for shader analysis.bunnei2018-04-142-44/+142
| * | shader_bytecode: Add initial module for shader decoding.bunnei2018-04-142-0/+298
| * | bit_field: Make all methods constexpr.bunnei2018-04-141-5/+5
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
* | | Merge pull request #325 from Hexagon12/ipc-value-fixbunnei2018-04-131-1/+1
|\ \ \
| * | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
| |/ /
| * | Merge pull request #1 from yuzu-emu/masterHexagon122018-04-1334-193/+853
| |\ \ | |/ / |/| |
* | | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \ \
| * | | Various fixes and clangHexagon122018-04-116-115/+108
| * | | Decimal changeHexagon122018-04-101-4/+4
| * | | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| * | | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| * | | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| * | | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| * | | Updated hid with more service names.Hexagon122018-04-101-0/+50
| * | | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| * | | Updated the unknown nameHexagon122018-04-101-1/+1
| * | | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| * | | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| * | | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| * | | Updated audren with more service names.Hexagon122018-04-101-10/+14
| * | | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| * | | Updated audout with more service names.Hexagon122018-04-101-13/+16
| * | | Updated audin with more service names.Hexagon122018-04-101-9/+16
| * | | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| * | | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| * | | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| * | | Updated AM with more service names.Hexagon122018-04-101-2/+82
| |/ /
* | | Merge pull request #320 from mailwl/ssl-updatebunnei2018-04-122-1/+98
|\ \ \
| * | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
|/ / /
* | | Merge pull request #318 from mailwl/accountbunnei2018-04-1011-127/+342
|\ \ \ | |/ / |/| |
| * | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1011-127/+342
|/ /
* | Merge pull request #314 from jroweboy/tegra-progress-3bbunnei2018-04-089-173/+274
|\ \
| * | Fix clang format issuesJames Rowe2018-04-071-1/+1
| * | GPU: Assert when finding a texture with a format type other than UNORM.Subv2018-04-072-4/+16
| * | GL: Set up the textures used for each draw call.Subv2018-04-072-2/+39
| * | GL: Bind the textures to the shaders used for drawing.Subv2018-04-071-2/+11
| * | GLCache: Specialize the MortonCopy function for the DXT1 texture format.Subv2018-04-071-1/+15
| * | GLCache: Implemented GetTextureSurface.Subv2018-04-071-3/+28
| * | GLCache: Support uploading compressed textures to the GPU.Subv2018-04-071-5/+17
| * | GL: Remove remaining references to 3DS-specific pixel formatsSubv2018-04-071-83/+22
| * | RasterizerCache: Remove 3DS-specific pixel formats.Subv2018-04-072-71/+32
| * | GL: Create the sampler objects when starting up the GL rasterizer.Subv2018-04-071-0/+6
| * | GL: Ported the SamplerInfo struct from citra.Subv2018-04-072-1/+59
| * | GL: Rename PicaTexture to MaxwellTexture.Subv2018-04-072-2/+2
| * | GL: Added functions to convert Maxwell tex filters and wrap modes to OpenGL.Subv2018-04-071-0/+23
| * | Textures: Added a helper function to know if a texture is blocklinear or pitch.Subv2018-04-071-0/+5
* | | Merge pull request #315 from jroweboy/spelling-fixbunnei2018-04-072-3/+3
|\ \ \
| * | | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
| |/ /
* | | Merge pull request #316 from jroweboy/dontcrashbunnei2018-04-071-2/+1
|\ \ \ | |/ / |/| |
| * | Prevent crash from uninitialized telemetryJames Rowe2018-04-071-2/+1
|/ /
* | Merge pull request #310 from N00byKing/patch-1bunnei2018-04-065-10/+10
|\ \
| * | rasterizer_interface.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| * | default_ini.h: Update from citra to yuzuN00byKing2018-04-041-1/+1
| * | gl_rasterizer_cache.cpp: Update from citra to yuzuN00byKing2018-04-041-1/+1
| * | gl_rasterizer_cache.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| * | renderer_opengl.h: Update from citra to yuzuN00byKing2018-04-041-2/+2
* | | core, main.h: Abort on 32Bit ROMs (#309)N00byKing2018-04-065-1/+17
* | | Merge pull request #312 from jroweboy/update-fmtlibbunnei2018-04-063-5/+8
|\ \ \ | |/ / |/| |
| * | Update fmtlib to fix msvc warningsJames Rowe2018-04-063-5/+8
|/ /
* | Merge pull request #308 from bunnei/misc-fixes-2bunnei2018-04-0412-18/+108
|\ \
| * | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
| * | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
| * | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
| * | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
| * | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
| * | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
| * | service: Add friend:u interface.bunnei2018-04-034-0/+41
|/ /
* | Merge pull request #306 from daniellimws/new-fmt-macrosbunnei2018-04-032-5/+11
|\ \
| * | logging: Change FmtLogMessage to use variadic template instead of FMT_VARIADICDaniel Lim Wee Soong2018-04-032-5/+11
|/ /
* | Merge pull request #262 from daniellimws/fmtlib-macrosbunnei2018-04-0311-68/+112
|\ \
| * | Remove dependency chronoDaniel Lim Wee Soong2018-03-221-1/+0
| * | Change "yuzu starting..." to be logged with the new macroDaniel Lim Wee Soong2018-03-221-1/+1
| * | Logging: Create logging macros based on fmtlibDaniel Lim Wee Soong2018-03-2210-67/+112
* | | Merge pull request #267 from N00byKing/patch-1bunnei2018-04-032-14/+14
|\ \ \
| * | | yuzu.cpp: Update Link from citra to yuzuN00byKing2018-03-261-1/+1
| * | | main.cpp: Replace Citra with yuzu Wiki LinksN00byKing2018-03-251-4/+4
| * | | main.cpp: Update Dialog from citra to yuzuN00byKing2018-03-251-11/+11
* | | | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-034-10/+10
|\ \ \ \
| * | | | telemetry.h: Reword comment from citra to yuzuN00byKing2018-03-271-1/+1
| * | | | telemetry_session.h: Reword Documentation Comment from citra to yuzuN00byKing2018-03-271-2/+2
| * | | | Remove Links to citra ServicesN00byKing2018-03-271-2/+2
| * | | | Change Telemetry Names to yuzuN00byKing2018-03-272-5/+5
* | | | | Merge pull request #304 from daniellimws/fix-openbsdbunnei2018-04-034-7/+20
|\ \ \ \ \
| * | | | | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-023-6/+7
| * | | | | common: fix swap functions on Bitrig and OpenBSDDaniel Lim Wee Soong2018-04-021-1/+13
* | | | | | Merge pull request #305 from N00byKing/patch-2James Rowe2018-04-031-1/+1
|\ \ \ \ \ \
| * | | | | | deconstructed_rom_directory.cpp: Fix TypoN00byKing2018-04-031-1/+1
|/ / / / / /
* | | | | | Merge pull request #66 from RiverCityRansomware/qtUpdatebunnei2018-04-021-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Update qtRiver City Ransomware2018-01-171-1/+1
* | | | | | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \ \ \ \ \
| * | | | | | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
* | | | | | | Merge pull request #296 from bunnei/misc-mem-fsp-fixesbunnei2018-04-0210-16/+49
|\ \ \ \ \ \ \
| * | | | | | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
| * | | | | | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
| * | | | | | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
| * | | | | | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-312-4/+24
| * | | | | | | memory: Fix stack region.bunnei2018-03-316-10/+12
| |/ / / / / /
* | | | | | | Merge pull request #288 from Subv/macro_interpreterbunnei2018-04-025-121/+444
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | GPU: Use the MacroInterpreter class to execute the GPU macros instead of HLEing them.Subv2018-04-012-121/+13
| * | | | | | GPU: Implemented a gpu macro interpreter.Subv2018-04-015-0/+431
* | | | | | | Merge pull request #293 from N00byKing/drkthmbunnei2018-03-3157-5/+1428
|\ \ \ \ \ \ \
| * | | | | | | Port citra-emu/citra#3610 to yuzuN00byKing2018-03-302-3/+7
| * | | | | | | Remove whitespacesN00byKing2018-03-301-1/+1
| * | | | | | | Add Dark theme, Icon themingN00byKing2018-03-3057-5/+1424
* | | | | | | | Merge pull request #292 from bunnei/botw-progressbunnei2018-03-3011-11/+163
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | |
| * | | | | | | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
| * | | | | | | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
| * | | | | | | service: Add NFP module interface.bunnei2018-03-308-0/+101
|/ / / / / / /
* | | | | | | Merge pull request #290 from MerryMage/dfix-20180329bunnei2018-03-291-0/+0
|\ \ \ \ \ \ \
| * | | | | | | dynarmic: Update to 9cc12d8MerryMage2018-03-291-0/+0
* | | | | | | | Merge pull request #289 from lioncash/self-assignbunnei2018-03-291-0/+3
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | |
| * | | | | | | result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
|/ / / / / / /
* | | | | | | Merge pull request #286 from N00byKing/citratoyuzuagainbunnei2018-03-281-5/+2
|\ \ \ \ \ \ \
| * | | | | | | main.h: Add pragma once, remove ifndefN00byKing2018-03-271-5/+2
* | | | | | | | Merge pull request #285 from MerryMage/dfix-20180327bunnei2018-03-271-0/+0
|\ \ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | |
| * | | | | | | dynarmic: Update to 12a1020MerryMage2018-03-271-0/+0
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #284 from bunnei/docked-configbunnei2018-03-279-61/+88
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | settings: Remove unused CpuCore class.bunnei2018-03-271-5/+0
| * | | | | | config: Use simplified checkbox (from Citra) for CPU JIT.bunnei2018-03-278-46/+33
| * | | | | | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-277-14/+14
| * | | | | | configure_general: Cleanup naming.bunnei2018-03-271-14/+14
| * | | | | | qt: Add config option for is_docked.bunnei2018-03-272-0/+23
| * | | | | | config: Add setting for whether the system is docked or not.bunnei2018-03-275-2/+24
* | | | | | | Merge pull request #282 from N00byKing/patch-2bunnei2018-03-274-4/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | |
| * | | | | | log.h: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| * | | | | | file_util.h: Update Comment from citra to yuzuN00byKing2018-03-261-1/+1
| * | | | | | cpu_detect.cpp: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| * | | | | | pre-commit: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| |/ / / / /
* | | | | | Merge pull request #279 from bunnei/tegra-progress-3bunnei2018-03-2720-446/+913
|\ \ \ \ \ \
| * | | | | | renderer_opengl: Use better naming for DrawScreens and DrawSingleScreen.bunnei2018-03-272-8/+8
| * | | | | | graphics_surface: Remove superfluous cast.bunnei2018-03-271-2/+1
| * | | | | | gl_rasterizer: Move code to bind framebuffer surfaces before draw to its own function.bunnei2018-03-272-22/+31
| * | | | | | gl_rasterizer: Add a SyncViewport method.bunnei2018-03-273-18/+30
| * | | | | | gl_rasterizer: Move PrimitiveTopology check to MaxwellToGL.bunnei2018-03-272-11/+12
| * | | | | | graphics_surface: Fix merge conflicts.bunnei2018-03-272-3/+4
| * | | | | | gl_rasterizer: Use ReadBlock instead of GetPointer for SetupVertexArray.bunnei2018-03-271-1/+1
| * | | | | | gl_rasterizer: Normalize vertex array data as appropriate.bunnei2018-03-272-1/+5
| * | | | | | memory: Fix cast for ReadBlock/WriteBlock/ZeroBlock/CopyBlock.bunnei2018-03-271-4/+8
| * | | | | | maxwel_to_gl: Fix string formatting in log statements.bunnei2018-03-271-2/+2
| * | | | | | rasterizer: Rename DrawTriangles to DrawArrays.bunnei2018-03-273-5/+5
| * | | | | | gl_rasterizer: Use passthrough shader for SetupVertexShader.bunnei2018-03-271-1/+2
| * | | | | | renderer_opengl: Logging, etc. cleanup.bunnei2018-03-276-33/+34
| * | | | | | renderer_opengl: Remove framebuffer RasterizerFlushVirtualRegion hack.bunnei2018-03-271-5/+0
| * | | | | | gl_rasterizer_cache: Implement UpdatePagesCachedCount.bunnei2018-03-272-8/+37
| * | | | | | memory: Add RasterizerMarkRegionCached code and cleanup.bunnei2018-03-272-200/+195
| * | | | | | gl_rasterizer: Implement SetupVertexArray.bunnei2018-03-271-20/+38
| * | | | | | gl_rasterizer_cache: Fix an ASSERT_MSG.bunnei2018-03-271-1/+1
| * | | | | | maxwell_to_gl: Add module and function for decoding VertexType.bunnei2018-03-272-0/+41
| * | | | | | maxwell_3d: Use names that match envytools for VertexType.bunnei2018-03-271-8/+8
| * | | | | | maxwell_3d: Add VertexAttribute struct and cleanup.bunnei2018-03-271-121/+160
| * | | | | | gl_rasterizer: Use 32 texture units instead of 3.bunnei2018-03-273-2/+3
| * | | | | | gl_rasterizer: Implement DrawTriangles.bunnei2018-03-271-1/+194
| * | | | | | Maxwell3D: Call AccelerateDrawBatch on DrawArrays.bunnei2018-03-271-1/+8
| * | | | | | gl_rasterizer: Implement AnalyzeVertexArray.bunnei2018-03-272-1/+56
| * | | | | | gl_rasterizer_cache: MortonCopy Switch-style.bunnei2018-03-271-72/+32
| * | | | | | gl_rasterizer_cache: Implement GetFramebufferSurfaces.bunnei2018-03-272-4/+104
| * | | | | | maxwell: Add RenderTargetFormat enum.bunnei2018-03-272-4/+5
| * | | | | | renderer_opengl: Only draw the screen if a framebuffer is specified.bunnei2018-03-271-6/+7
|/ / / / / /
* | | | | | Merge pull request #283 from Subv/tscbunnei2018-03-273-25/+147
|\ \ \ \ \ \
| * | | | | | GPU: Load the sampler info (TSC) when retrieving active textures.Subv2018-03-262-21/+67
| * | | | | | GPU: Added the TSC structure. It contains information about the sampler.Subv2018-03-261-0/+50
| * | | | | | GPU: Added more fields to the TIC structure.Subv2018-03-261-4/+30
| |/ / / / /
* | | | | | Merge pull request #102 from N00byKing/masterbunnei2018-03-272-15/+47
|\ \ \ \ \ \ | |/ / / / / |/| | | | |
| * | | | | Implement Citra pull 3043N00byKing2018-02-242-15/+47
* | | | | | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \ \ \ \ \
| * | | | | | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| * | | | | | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| * | | | | | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
* | | | | | | Merge pull request #273 from Subv/texturesbunnei2018-03-2521-10/+1464
|\ \ \ \ \ \ \
| * | | | | | | GPU: Make the debug_context variable a member of the frontend instead of a global.Subv2018-03-257-19/+40
| * | | | | | | GPU: Added a function to retrieve the active textures for a shader stage.Subv2018-03-242-50/+59
| * | | | | | | Frontend: Updated the surface view debug widget to work with Maxwell surfaces.Subv2018-03-243-19/+38
| * | | | | | | Frontend: Allow opening the Surface View widget in the Qt frontend.Subv2018-03-242-0/+8
| * | | | | | | GPU: Implement the Incoming/FinishedPrimitiveBatch debug breakpoints.Subv2018-03-241-0/+7
| * | | | | | | GPU: Implement the MaxwellCommandLoaded/Processed debug breakpoints.Subv2018-03-241-0/+10
| * | | | | | | Frontend: Ported the GPU breakpoints and surface viewer widgets from citra.Subv2018-03-2415-4/+1155
| * | | | | | | GPU: Added a method to unswizzle a texture without decoding it.Subv2018-03-244-5/+95