summaryrefslogtreecommitdiffstats
Commit message (Collapse)AuthorAgeFilesLines
* bktr: Add logging on successful patchZach Hilman2018-09-043-7/+24
|
* game_list: Use friendly game versionsZach Hilman2018-09-041-13/+32
| | | | Mainly, from control.nacp metadata instead of cnmt metadata
* bktr: Implement IVFC offset shiftingZach Hilman2018-09-048-8/+36
| | | | Fixes base game read errors
* bktr: Fix missing includes and optimize styleZach Hilman2018-09-0412-103/+109
|
* main: Make game updates installableZach Hilman2018-09-041-1/+5
|
* game_list: Display patch names and versions on listZach Hilman2018-09-042-0/+27
|
* loader: Add BKTR-specific error messages and codesZach Hilman2018-09-043-7/+28
|
* loader: Ignore patches on NRO and DRDZach Hilman2018-09-044-0/+11
|
* patch_manager: Add usages of patches to ExeFSZach Hilman2018-09-045-9/+41
|
* file_sys: Add class to manage game patchesZach Hilman2018-09-042-0/+132
| | | | Right now only includes Updates, but should eventually contain all of the other patches we need.
* file_sys: Add BKTR patching mechanismZach Hilman2018-09-042-0/+352
|
* content_archive: Add BKTR header parsing to NCAZach Hilman2018-09-042-19/+160
|
* registration: Add RegisteredCacheUnionZach Hilman2018-09-044-0/+164
| | | | Aggregates multiple caches into one interface
* game_list: Use RegisteredCacheUnion for installedZach Hilman2018-09-043-5/+3
| | | | Reduces code
* aes_util: Fix error involving reads of less than 0x10Zach Hilman2018-09-041-0/+14
| | | | Issues with block size are fixed by making all reads minimum length of 0x10
* Merge pull request #1178 from DarkLordZach/nspbunnei2018-09-0419-41/+650
|\ | | | | file_sys: Add Nintendo Submissions Package (NSP) file format
| * main: Only show DRD deprecation warning onceZach Hilman2018-09-047-6/+19
| |
| * control_metadata: Use alternate language names if AmericanEnglish isn't availableZach Hilman2018-09-042-4/+17
| |
| * card_image: Add program title ID getterZach Hilman2018-09-042-0/+6
| |
| * qt: Add deprecation warnings for DRD formatZach Hilman2018-09-041-0/+10
| |
| * registration: Fix NSP installation errorsZach Hilman2018-09-041-1/+1
| |
| * nsp: Comply with style and performance guidelinesZach Hilman2018-09-047-29/+48
| |
| * qt: Add UI support for NSP filesZach Hilman2018-09-043-2/+7
| |
| * registration: Add support for installing NSP filesZach Hilman2018-09-043-16/+34
| |
| * loader: Add AppLoader for NSP filesZach Hilman2018-09-042-0/+182
| |
| * card_image: Parse XCI secure partition with NSPZach Hilman2018-09-044-11/+38
| | | | | | | | Eliminated duplicate code and adds support for Rev1+ carts
| * file_sys: Add Nintendo Submission Package (NSP)Zach Hilman2018-09-042-0/+296
| |
| * drd: Load title ID from program metadataZach Hilman2018-09-041-3/+1
| | | | | | | | Previously only loaded from control metadata
| * loader: Add NSP file type and NSP-specific errorsZach Hilman2018-09-042-2/+14
| |
| * key_manager: Avoid autogeneration if key existsZach Hilman2018-09-041-3/+13
|/
* Merge pull request #1238 from lioncash/explicitbunnei2018-09-043-8/+8
|\ | | | | common/logging: Minor changes
| * common/logging: Amend documentation commentsLioncash2018-09-042-6/+6
| | | | | | | | | | | | | | Multi-line doc comments still need the '<' after the ///, otherwise it's treated as a regular comment and makes the original doc comment broken in viewers, IDEs, etc. While we're at it, also fix some typos in the comments.
| * common/logging/filter: Replace C-style case with C++ static_castLioncash2018-09-041-1/+1
| |
| * common/logging/filter: Make constructor explicitLioncash2018-09-041-1/+1
| | | | | | | | Implicit conversions aren't desirable here.
* | Merge pull request #1237 from degasus/optimizationsbunnei2018-09-044-7/+7
|\ \ | | | | | | Optimizations
| * | core: Use a raw pointer in GetGPUDebugContext.Markus Wick2018-09-042-3/+3
| | | | | | | | | | | | This helper is called very often. The memory ownership shall not be transfered, so just return the raw pointer.
| * | command_processor: Use std::array for bound_engines.Markus Wick2018-09-042-4/+4
| |/ | | | | | | | | subchannel is a 3 bit field. So there must not be more than 8 bound engines. And using a hashmap for up to 8 values is a bit overpowered.
* | Merge pull request #1223 from DarkLordZach/custom-nand-sd-dirsbunnei2018-09-046-0/+79
|\ \ | | | | | | file_sys: Allow for custom NAND/SD directories
| * | qt: Add message about not moving contents on dir changeZach Hilman2018-09-042-6/+23
| | |
| * | qt: Add UI options to change NAND/SD dirsZach Hilman2018-09-043-0/+36
| | |
| * | settings: Save and load NAND/SD dirs from configZach Hilman2018-09-043-0/+26
| | |
* | | Merge pull request #1232 from lioncash/copybunnei2018-09-041-1/+1
|\ \ \ | | | | | | | | gl_shader_decompiler: Use used_shaders member variable directly within GenerateDeclarations()
| * | | gl_shader_decompiler: Use used_shaders member variable directly within GenerateDeclarations()Lioncash2018-09-021-1/+1
| | | | | | | | | | | | | | | | | | | | Using the getter function intended for external code here makes an unnecessary copy of the already-accessible used_shaders vector.
* | | | Merge pull request #1235 from lioncash/forward-declbunnei2018-09-0422-27/+64
|\ \ \ \ | | | | | | | | | | file_sys: Replace includes with forward declarations where applicable
| * | | | file_sys: Replace includes with forward declarations where applicableLioncash2018-09-0422-27/+64
| | |_|/ | |/| | | | | | | | | | | | | | Cuts down on include dependencies, resulting in less files that need to be rebuilt when certain things are changed.
* | | | Merge pull request #1236 from degasus/microprofilebunnei2018-09-044-5/+21
|\ \ \ \ | | | | | | | | | | Update microprofile scopes.
| * | | | Update microprofile scopes.Markus Wick2018-09-044-5/+21
| |/ / / | | | | | | | | | | | | | | | | | | | | Blame the subsystems which deserve the blame :) The updated list is not complete, just the ones I've spotted on random sampling the stack trace.
* | | | Merge pull request #1230 from lioncash/sslbunnei2018-09-042-37/+39
|\ \ \ \ | |/ / / |/| | | ssl: Move SSL class to cpp file
| * | | ssl: Move SSL class to cpp fileLioncash2018-09-022-37/+39
| | | | | | | | | | | | | | | | | | | | | | | | This isn't required to be visible to anything outside of the main source file, and will eliminate needing to rebuild anything else including the header if the SSL class needs to be changed in the future.
* | | | Merge pull request #1231 from lioncash/globalbunnei2018-09-045-19/+51
|\ \ \ \ | | | | | | | | | | service: Migrate global named port map to the KernelCore class
| * | | | service: Migrate global named port map to the KernelCore classLioncash2018-09-025-19/+51
| | |/ / | |/| | | | | | | | | | | | | | | | | | Now that we have a class representing the kernel in some capacity, we now have a place to put the named port map, so we move it over and get rid of another piece of global state within the core.
* | | | Merge pull request #1229 from lioncash/forward-declbunnei2018-09-0413-15/+45
|\ \ \ \ | |_|_|/ |/| | | vfs_real: Forward declare IOFile
| * | | vfs_real: Forward declare IOFileLioncash2018-09-0213-15/+45
| |/ / | | | | | | | | | | | | | | | Eliminates the need to rebuild some source files if the file_util header ever changes. This also uncovered some indirect inclusions, which have also been fixed.
* | | Merge pull request #1233 from lioncash/dynarmicMat M2018-09-031-0/+0
|\ \ \ | |/ / |/| | externals: Update dynarmic to 0435ac2
| * | externals: Update dynarmic to 0435ac2Lioncash2018-09-031-0/+0
|/ /
* | Merge pull request #1213 from DarkLordZach/octopath-fsbunnei2018-09-023-4/+33
|\ \ | | | | | | filesystem/maxwell_3d: Various changes to boot Project Octopath Traveller
| * | maxwell_3d: Use CoreTiming for query timestampZach Hilman2018-09-011-2/+3
| | |
| * | filesystem: Implement OpenReadOnlySaveDataFilesystemZach Hilman2018-09-012-1/+7
| | |
| * | filesystem: Add OpenFileSystemWithPatchZach Hilman2018-09-012-1/+23
| |/
* | Merge pull request #1215 from ogniK5377/texs-nodep-assertbunnei2018-09-022-0/+3
|\ \ | | | | | | Added assert for TEXS nodep
| * | Added assert for TEXS nodepDavid Marcec2018-09-012-0/+3
| |/
* | Merge pull request #1219 from jroweboy/less-artifactsbunnei2018-09-021-4/+0
|\ \ | | | | | | Build - Upload fewer artifacts
| * | Build - Upload fewer artifactsJames Rowe2018-09-011-4/+0
| |/ | | | | | | | | Appveyor has a limit on artifact retention, and we hit the limit all the time, so just lower the number of build artifacts to just the final zip
* | Merge pull request #1220 from FearlessTobi/extensions-qolbunnei2018-09-022-8/+10
|\ \ | | | | | | yuzu: Display the unsupported GL extensions in the popup
| * | citra_qt: Display the unsupported GL extensions in the popupfearlessTobi2018-09-012-8/+10
| |/
* | Merge pull request #1214 from ogniK5377/ipa-assertbunnei2018-09-022-6/+13
|\ \ | | | | | | Added better asserts to IPA, Renamed IPA modes to match mesa
| * | Added better asserts to IPA, Renamed IPA modes to match mesaDavid Marcec2018-09-012-6/+13
| |/ | | | | | | | | | | | | | | | | | | IpaMode is changed to IpaInterpMode IpaMode is suppose to be 2 bits not 3 Added IpaSampleMode Added Saturate Renamed modes based on https://github.com/mesa3d/mesa/blob/d27c7918916cdc8092959124955f887592e37d72/src/gallium/drivers/nouveau/codegen/nv50_ir_emit_gm107.cpp#L2530
* | Merge pull request #1216 from ogniK5377/ffma-assertbunnei2018-09-022-0/+9
|\ \ | | | | | | Added FFMA asserts and missing fields
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| | | | | | | | | | | | Saturate already implemented
| * | Changed tab5980_0 default from 0 -> 1David Marcec2018-09-011-2/+2
| | |
| * | Added FFMA assertsDavid Marcec2018-09-012-0/+11
| |/
* | Merge pull request #1218 from ogniK5377/fmul-assertbunnei2018-09-022-0/+13
|\ \ | | | | | | Added FMUL asserts
| * | Removed saturate assertDavid Marcec2018-09-012-2/+0
| | | | | | | | | | | | Unneeded as we already implement it
| * | Added FMUL assertsDavid Marcec2018-09-012-0/+15
| |/
* | Merge pull request #1228 from lioncash/constructbunnei2018-09-021-2/+5
|\ \ | |/ |/| filesystem: Move dir retrieval after path checking in DeleteFile()
| * filesystem: Move dir retrieval after path checking in DeleteFile()Lioncash2018-09-021-2/+5
|/ | | | | We don't need to do the lookup if the path is considered empty currently.
* Merge pull request #1196 from FearlessTobi/ccache-consistencybunnei2018-09-014-16/+6
|\ | | | | .travis: Use Citras ccache for builds instead of yuzus
| * travis: use Citras ccachefearlessTobi2018-08-314-16/+6
| |
* | Merge pull request #1212 from lioncash/forward-declbunnei2018-09-0129-66/+185
|\ \ | |/ |/| core/core: Replace includes with forward declarations where applicable
| * core/core: Replace includes with forward declarations where applicableLioncash2018-08-3129-66/+185
|/ | | | | | | | | | | The follow-up to e2457418dae19b889b2ad85255bb95d4cd0e4bff, which replaces most of the includes in the core header with forward declarations. This makes it so that if any of the headers the core header was previously including change, then no one will need to rebuild the bulk of the core, due to core.h being quite a prevalent inclusion. This should make turnaround for changes much faster for developers.
* Merge pull request #1205 from bunnei/improve-rasterizer-cache-2bunnei2018-08-3111-297/+227
|\ | | | | Various fixes and improvements to rasterizer cache 2: Electric Boogaloo
| * gl_rasterizer_cache: Use accurate framebuffer setting for accurate copies.bunnei2018-08-312-73/+54
| |
| * gl_rasterizer_cache: Also use reserve cache for RecreateSurface.bunnei2018-08-312-24/+18
| |
| * rasterizer_cache: Use boost::interval_map for a more accurate cache.bunnei2018-08-311-33/+45
| |
| * gl_renderer: Cache textures, framebuffers, and shaders based on CPU address.bunnei2018-08-3111-138/+70
| |
| * gl_rasterizer: Fix issues with the rasterizer cache.bunnei2018-08-314-46/+57
|/ | | | | - Use a single cached page map. - Fix calculation of ending page.
* Implement BC6H_UF16 & BC6H_SF16 (#1092)greggameplayer2018-08-313-31/+55
| | | | | | | | | * Implement BC6H_UF16 & BC6H_SF16 Require by ARMS * correct coding style * correct coding style part 2
* Merge pull request #1204 from lioncash/pimplbunnei2018-08-315-279/+387
|\ | | | | core: Make the main System class use the PImpl idiom
| * core: Make the main System class use the PImpl idiomLioncash2018-08-315-279/+387
| | | | | | | | | | | | | | | | | | | | | | | | | | core.h is kind of a massive header in terms what it includes within itself. It includes VFS utilities, kernel headers, file_sys header, ARM-related headers, etc. This means that changing anything in the headers included by core.h essentially requires you to rebuild almost all of core. Instead, we can modify the System class to use the PImpl idiom, which allows us to move all of those headers to the cpp file and forward declare the bulk of the types that would otherwise be included, reducing compile times. This change specifically only performs the PImpl portion.
* | Merge pull request #1207 from degasus/hotfixbunnei2018-08-311-1/+1
|\ \ | | | | | | Report correct shader size.
| * | Report correct shader size.Markus Wick2018-08-311-1/+1
| | | | | | | | | | | | | | | Seems like this was an oversee in regards to 1fd979f50a9f4c21fa8cafba7268d959e3076924 It changed GLShader::ProgramCode to a std::vector, so sizeof is wrong.
* | | Merge pull request #1208 from Hexagon12/pred-comp-14bunnei2018-08-312-3/+4
|\ \ \ | |/ / |/| | Add predicate comparison 14 (GreaterEqualWithNan)
| * | Added predicate comparison GreaterEqualWithNanHexagon122018-08-312-3/+4
|/ /
* | Merge pull request #1195 from FearlessTobi/port-gamelist-compatbunnei2018-08-3113-7/+196
|\ \ | | | | | | yuzu: Show game compatibility in the game list (PR ported from Citra)
| * | Show game compatibility within yuzufearlessTobi2018-08-2913-7/+196
| | |
* | | gl_shader_decompiler: Implement POPC (#1203)Laku2018-08-312-0/+19
| | | | | | | | | | | | | | | | | | * Implement POPC * implement invert
* | | Merge pull request #1200 from bunnei/improve-ipabunnei2018-08-302-1/+39
|\ \ \ | |_|/ |/| | gl_shader_decompiler: Improve IPA for Pass mode with Position attribute.
| * | gl_shader_decompiler: Improve IPA for Pass mode with Position attribute.bunnei2018-08-292-1/+39
| | |
* | | Merge pull request #1198 from lioncash/kernelbunnei2018-08-3054-442/+671
|\ \ \ | | | | | | | | kernel: Eliminate kernel global state
| * | | kernel: Eliminate kernel global stateLioncash2018-08-2954-442/+671
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | As means to pave the way for getting rid of global state within core, This eliminates kernel global state by removing all globals. Instead this introduces a KernelCore class which acts as a kernel instance. This instance lives in the System class, which keeps its lifetime contained to the lifetime of the System class. This also forces the kernel types to actually interact with the main kernel instance itself instead of having transient kernel state placed all over several translation units, keeping everything together. It also has a nice consequence of making dependencies much more explicit. This also makes our initialization a tad bit more correct. Previously we were creating a kernel process before the actual kernel was initialized, which doesn't really make much sense. The KernelCore class itself follows the PImpl idiom, which allows keeping all the implementation details sealed away from everything else, which forces the use of the exposed API and allows us to avoid any unnecessary inclusions within the main kernel header.
* | | Merge pull request #1202 from FearlessTobi/port-3825bunnei2018-08-302-1/+13
|\ \ \ | | | | | | | | Port #3825 from Citra: "travis: share environment variables with Docker"
| * | | Remove Citra specific variablefearlessTobi2018-08-291-3/+0
| | | |
| * | | travis: share env variables with Dockerliushuyu2018-08-292-1/+16
| |/ /
* | | Merge pull request #1172 from tech4me/impl_iadd3bunnei2018-08-302-1/+84
|\ \ \ | |/ / |/| | Shaders: Implemented IADD3
| * | Shaders: Implemented IADD3tech4me2018-08-292-1/+84
|/ /
* | Merge pull request #1193 from lioncash/privbunnei2018-08-287-26/+40
|\ \ | | | | | | gpu: Make memory_manager private
| * | gpu: Make memory_manager privateLioncash2018-08-287-26/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the class interface consistent and provides accessors for obtaining a reference to the memory manager instance. Given we also return references, this makes our more flimsy uses of const apparent, given const doesn't propagate through pointers in the way one would typically expect. This makes our mutable state more apparent in some places.
* | | Merge pull request #1192 from lioncash/unusedbunnei2018-08-281-2/+0
|\ \ \ | | | | | | | | gl_rasterizer: Remove unused variables
| * | | gl_rasterizer: Remove unused variablesLioncash2018-08-281-2/+0
| |/ /
* | | Merge pull request #1191 from lioncash/noexceptbunnei2018-08-281-1/+1
|\ \ \ | | | | | | | | hle/result: Make ResultVal's move constructor as noexcept
| * | | hle/result: Make ResultVal's move constructor as noexceptLioncash2018-08-281-1/+1
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many containers within the standard library provide different behaviors based on whether or not a move constructor/assignment operator can be guaranteed not to throw or not. Notably, implementations will generally use std::move_if_noexcept (or an internal implementation of it) to provide strong exception guarantees. If a move constructor potentially throws (in other words, is not noexcept), then certain behaviors will create copies, rather than moving the values. For example, consider std::vector. When a std::vector calls resize(), there are two ways the elements can be relocated to the new block of memory (if a reallocation happens), by copy, or by moving the existing elements into the new block of memory. If a type does not have a guarantee that it will not throw in the move constructor, a copy will happen. However, if it can be guaranteed that the move constructor won't throw, then the elements will be moved. This just allows ResultVal to be moved instead of copied all the time if ever used in conjunction with containers for whatever reason.
* | | Merge pull request #1194 from lioncash/allocbunnei2018-08-281-2/+1
|\ \ \ | |_|/ |/| | gl_shader_cache: Remove unused program_code vector in GetShaderAddress()
| * | gl_shader_cache: Remove unused program_code vector in GetShaderAddress()Lioncash2018-08-281-2/+1
| |/ | | | | | | | | | | | | | | Given std::vector is a type with a non-trivial destructor, this variable cannot be optimized away by the compiler, even if unused. Because of that, something that was intended to be fairly lightweight, was actually allocating 32KB and deallocating it at the end of the function.
* | Merge pull request #1190 from FearlessTobi/im-so-retardedbunnei2018-08-282-1/+2
|\ \ | |/ |/| yuzu: Fix two stupid errors made in #1141
| * Fix two stupid errors made in #1141fearlessTobi2018-08-282-1/+2
|/
* Merge pull request #1165 from bunnei/shader-cachebunnei2018-08-2812-417/+387
|\ | | | | renderer_opengl: Implement a new shader cache.
| * renderer_opengl: Implement a new shader cache.bunnei2018-08-289-285/+250
| |
| * gl_rasterizer_cache: Update to use RasterizerCache base class.bunnei2018-08-283-132/+20
| |
| * video_core: Add RasterizerCache class for common cache management code.bunnei2018-08-282-0/+117
| |
* | Merge pull request #1189 from FearlessTobi/fix-stick-directionsbunnei2018-08-281-2/+2
|\ \ | | | | | | yuzu: Fix input UI direction order for the right stick
| * | yuzu: Fix stick UI direction orderfearlessTobi2018-08-281-2/+2
|/ /
* | Merge pull request #1177 from lioncash/errbunnei2018-08-284-12/+15
|\ \ | |/ |/| kernel/error: Amend several error codes
| * kernel/error: Amend error code for ERR_MAX_CONNECTIONS_REACHEDLioncash2018-08-251-2/+4
| | | | | | | | | | | | We can make this error code an alias of the resource limit exceeded error code, allowing us to get rid of the lingering 3DS error code of the same type.
| * kernel/error: Amend error code for ERR_PORT_NAME_TOO_LONGLioncash2018-08-251-2/+1
| | | | | | | | | | We can treat this as an alias of TooLarge for documentation purposes. This also lets us get rid of another lingering 3DS-related error code.
| * kernel/error: Add error code for the handle table being fullLioncash2018-08-253-4/+4
| | | | | | | | | | This replaces the lingering 3DS constant with the proper one, and utilizes it within HandleTable's Create() member function.
| * kernel/error: Add error code for invalid memory permissionsLioncash2018-08-252-3/+4
| |
| * kernel/error: Correct kernel error code for invalid combinationLioncash2018-08-251-1/+2
| |
* | Merge pull request #1169 from Lakumakkara/selbunnei2018-08-281-1/+1
|\ \ | | | | | | shader_bytecode: fix SEL_IMM bitstring
| * | fix SEL_IMM bitstringLaku2018-08-241-1/+1
| | |
* | | Merge pull request #1188 from lioncash/unusedbunnei2018-08-281-1/+0
|\ \ \ | | | | | | | | vfs_real: Remove unused variable in CreateDirectoryRelative()
| * | | vfs_real: Remove unused variable in CreateDirectoryRelative()Lioncash2018-08-271-1/+0
| | | |
* | | | Merge pull request #1170 from lioncash/retbunnei2018-08-281-1/+1
|\ \ \ \ | | | | | | | | | | file_util: Correct return value in early exit of ReadFileToString()
| * | | | file_util: Correct return value in early exit of ReadFileToString()Lioncash2018-08-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | While still essentially being zero, we should be returning a numeric value here, not a boolean typed value.
* | | | | Merge pull request #1175 from lioncash/nsbunnei2018-08-2813-12/+42
|\ \ \ \ \ | | | | | | | | | | | | core: Namespace all code in the arm subdirectory under the Core namespace
| * | | | | core: Namespace all code in the arm subdirectory under the Core namespaceLioncash2018-08-2513-12/+42
| |/ / / / | | | | | | | | | | | | | | | Gets all of these types and interfaces out of the global namespace.
* | | | | Merge pull request #1187 from lioncash/shadowbunnei2018-08-281-3/+3
|\ \ \ \ \ | | | | | | | | | | | | registered_cache: Get rid of variable shadowing in ProcessFiles()
| * | | | | registered_cache: Get rid of variable shadowing in ProcessFiles()Lioncash2018-08-271-3/+3
| | |/ / / | |/| | | | | | | | | | | | | Prevents compiler warnings.
* | | | | Merge pull request #1128 from DarkLordZach/malformed-hex-crashbunnei2018-08-271-5/+17
|\ \ \ \ \ | | | | | | | | | | | | hex_util: Replace logic_errors with LOG_CRITICAL
| * | | | | hex_util: Replace logic_errors with LOG_CRITICALZach Hilman2018-08-231-5/+17
| | | | | | | | | | | | | | | | | | | | | | | | Makes it so malformed hex strings do not crash the entire program.
* | | | | | Merge pull request #1176 from lioncash/infobunnei2018-08-271-2/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Return process title ID if queried in GetInfo()
| * | | | | | svc: Return process title ID if queried in GetInfo()Lioncash2018-08-251-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have the variable itself set up to perform this task, so we can just return its value from the currently executing process instead of always stubbing it to zero.
* | | | | | | Merge pull request #1174 from lioncash/debugbunnei2018-08-275-27/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | debug_utils: Minor individual interface changes
| * | | | | | | debug_utils: Remove unused includesLioncash2018-08-255-24/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Quite a bit of these aren't necessary directly within the debug_utils header and can be removed or included where actually necessary.
| * | | | | | | debug_utils: Make BreakpointObserver class' constructor explicitLioncash2018-08-251-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids implicit conversions.
| * | | | | | | debug_utils: Initialize active_breakpoint member of DebugContextLioncash2018-08-251-2/+2
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Ensures that all class members are initialized.
* | | | | | | Merge pull request #1162 from ogniK5377/ttf-plubunnei2018-08-271-5/+51
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | PL:U Added SharedFonts loading via TTF
| * | | | | | | Addressed plu TTF changesDavid Marcec2018-08-231-6/+7
| | | | | | | |
| * | | | | | | Added SharedFonts loading via TTFDavid Marcec2018-08-231-5/+50
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | By having the following TTF files in your yuzu sysdata directory. You can load sharedfonts via TTF files. FontStandard.ttf FontChineseSimplified.ttf FontExtendedChineseSimplified.ttf FontChineseTraditional.ttf FontKorean.ttf FontNintendoExtended.ttf FontNintendoExtended2.ttf
* | | | | | | | Merge pull request #1168 from lioncash/headerbunnei2018-08-272-1/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hid: Move core include to cpp file
| * | | | | | | | hid: Move core include to cpp fileLioncash2018-08-242-1/+4
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't required to be in the header. Instead, directly include what this header needs and move it to the cpp file where it belongs.
* | | | | | | | Merge pull request #1171 from lioncash/truebunnei2018-08-271-7/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: Remove always true conditionals in Load()
| * | | | | | | | core: Remove always true conditionals in Load()Lioncash2018-08-241-7/+4
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These conditions are always true, since the outer conditional already checks for these conditions.
* | | | | | | | Merge pull request #1180 from tech4me/languagecode_fixbunnei2018-08-272-8/+45
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | set: Fixed GetAvailableLanguageCodes() to follow the max_entries
| * | | | | | | set: Fixed GetAvailableLanguageCodes() to follow the max_entriestech4me2018-08-262-8/+45
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rightnow, in games use GetAvailableLanguageCodes(), there is a WriteBuffer() with size larger than the buffer_size. (Core Critical core\hle\kernel\hle_ipc.cpp:WriteBuffer:296: size (0000000000000088) is greater than buffer_size (0000000000000078)) 0x88 = 17(languages) * 8 0x78 = 15(languages) * 8 GetAvailableLanguageCodes() can only support 15 languages. After firmware 4.0.0 there are 17 supported language instead of 15, to enable this GetAvailableLanguageCodes2() need to be used. So GetAvailableLanguageCodes() will be caped at 15 languages. Reference: http://switchbrew.org/index.php/Settings_services
* | | | | | | Merge pull request #1173 from lioncash/batchbunnei2018-08-251-4/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell3d: Move FinishedPrimitiveBatch event after AcceleratedDrawBatch()
| * | | | | | | maxwell3d: Move FinishedPrimitiveBatch event after AcceleratedDrawBatch()Lioncash2018-08-251-4/+4
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | The start and finish events should likely not be right after one another like this, otherwise the batch will appear to complete immediately
* | | | | | | Merge pull request #1167 from lioncash/assertbunnei2018-08-251-1/+2
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | gl_rasterizer: Correct assertion condition in SyncLogicOpState()
| * | | | | | gl_rasterizer: Correct assertion condition in SyncLogicOpState()Lioncash2018-08-241-1/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Previously the assert would always be hit, since it was the equivalent of: array == nullptr, which is never true.
* | | | | | Merge pull request #1166 from lioncash/typoSebastian Valle2018-08-251-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | filesystem: Fix typo in log message
| * | | | | filesystem: Fix typo in log messageLioncash2018-08-241-1/+1
| |/ / / /
* | | | | Merge pull request #1094 from DarkLordZach/nax0Mat M2018-08-2531-97/+821
|\ \ \ \ \ | | | | | | | | | | | | file_sys: Add support for NAX archives
| * | | | | file_sys/crypto: Fix missing/unnecessary includesZach Hilman2018-08-259-5/+10
| | | | | |
| * | | | | xci: Ignore NCA files with updates in secureZach Hilman2018-08-241-0/+3
| | | | | |
| * | | | | content_archive: Add update title detectionZach Hilman2018-08-242-0/+11
| | | | | | | | | | | | | | | | | | | | | | | | This is needed because the title IDs of update NCAs will not use the update title ID. The only sure way to tell is to look for a partition with BKTR crypto.
| * | | | | key_manager: Eliminate indexed for loopZach Hilman2018-08-231-6/+13
| | | | | |
| * | | | | key_manager: Create keys dir if it dosen't existZach Hilman2018-08-232-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | On call to WriteKeyToFile, so that the autogenerated file can be written.
| * | | | | file_sys: Cut down on includes and copiesZach Hilman2018-08-237-19/+30
| | | | | |
| * | | | | crypto: Eliminate magic constantsZach Hilman2018-08-234-32/+38
| | | | | |
| * | | | | key_manager: Add support for autogenerated keysZach Hilman2018-08-232-3/+45
| | | | | | | | | | | | | | | | | | | | | | | | Stored in a separate file than manual keys.
| * | | | | key_manager: Add support for KEK and SD seed derivationZach Hilman2018-08-232-5/+135
| | | | | |
| * | | | | key_manager: Switch to boost flat_map for keysZach Hilman2018-08-232-32/+14
| | | | | | | | | | | | | | | | | | | | | | | | Should make key gets marginally faster.
| * | | | | game_list: Add SD registration loading to game listZach Hilman2018-08-232-12/+12
| | | | | |
| * | | | | file_sys: Implement NAX containersZach Hilman2018-08-233-0/+238
| | | | | |
| * | | | | registration: Add GetEntryUnparsed methodsZach Hilman2018-08-232-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | Returns the file before calling parser on it.
| * | | | | sdmc_factory: Add SDMC RegisteredCache getterZach Hilman2018-08-232-1/+14
| | | | | |
| * | | | | qt: Make default row data title name and title idZach Hilman2018-08-231-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | Helps with installed games by making the title not a hexadecimal id string, instead the name.
| * | | | | vfs: Add GetOrCreateDirectoryRelative methodZach Hilman2018-08-233-9/+13
| | | | | |
| * | | | | filesystem: Add CreateFactories methods to fsZach Hilman2018-08-233-10/+12
| | | | | | | | | | | | | | | | | | | | | | | | Allows frontend to create registration caches for use before a game has booted.
| * | | | | filesystem: Add logging to registration gettersZach Hilman2018-08-231-4/+25
| | | | | |
| * | | | | loader: Add new NAX-specific errors and messagesZach Hilman2018-08-232-1/+27
| | | | | |
| * | | | | nax: Add AppLoader_NAX and update loader to support itZach Hilman2018-08-234-2/+121
| | | | | |
| * | | | | xts_encryption_layer: Implement XTSEncryptionLayerZach Hilman2018-08-233-1/+81
| | | | | |
| * | | | | aes_util: Make XTSTranscode stricter about sizesZach Hilman2018-08-231-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | XTS with Nintendo Tweak will fail mysteriously if the sector size is not 0x4000. Upgrade the critical log to an assert to prevent undefined behavior.
| * | | | | ctr_encryption_layer: Fix bug when transcoding small dataZach Hilman2018-08-231-5/+3
| | | | | | | | | | | | | | | | | | | | | | | | Fixes a bug where data lengths of less than size 0x10 will fail or have misleading return values.
| * | | | | xci: Fix error masking issueZach Hilman2018-08-233-5/+17
| | | | | | | | | | | | | | | | | | | | | | | | Prevents NCA-related errors from being masked into MissingProgramNCA or MissingKeyFile
* | | | | | Merge pull request #1065 from DarkLordZach/window-titleZach Hilman2018-08-242-0/+18
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | qt: Add filename and title id to window title while running
| * | | | | qt: Add filename and title id to window title while runningZach Hilman2018-08-232-0/+18
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1164 from tech4me/decode_iadd3bunnei2018-08-241-0/+6
|\ \ \ \ \ | |_|_|/ / |/| | | | Shaders: Added decodings for IADD3 instructions
| * | | | Shaders: Added decodings for IADD3 instructionstech4me2018-08-231-0/+6
| |/ / /
* | | | Port #4013 from Citra: "Init logging sooner so we dont miss some logs on startup" (#1142)Tobias2018-08-241-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | * Port #4013 from Citra: "Init logging sooner so we dont miss some logs on startup" * Fix compilation
* | | | Added GetBootMode (#1107)David2018-08-244-3/+25
|/ / / | | | | | | | | | | | | | | | | | | | | | * Added GetBootMode Used by homebrew * Added enum for GetBootMode
* | | Merge pull request #1160 from bunnei/surface-reservebunnei2018-08-232-17/+91
|\ \ \ | | | | | | | | gl_rasterizer_cache: Several improvements
| * | | gl_rasterizer_cache: Blit when possible on RecreateSurface.bunnei2018-08-231-5/+12
| | | |
| * | | gl_rasterizer_cache: Reserve surfaces that have already been created for later use.bunnei2018-08-232-3/+61
| | | |
| * | | gl_rasterizer_cache: Remove assert for RecreateSurface type.bunnei2018-08-231-1/+0
| | | |
| * | | gl_rasterizer_cache: Implement compressed texture copies.bunnei2018-08-231-8/+18
| |/ /
* | | Merge pull request #1153 from bunnei/stencil-clearbunnei2018-08-236-69/+188
|\ \ \ | |/ / |/| | gl_rasterizer: Implement partial color clear, stencil clear, and stencil test.
| * | gl_rasterizer: Implement stencil test.bunnei2018-08-233-4/+58
| | | | | | | | | | | | - Used by Splatoon 2.
| * | gl_rasterizer: Implement partial color clear and stencil clear.bunnei2018-08-231-12/+42
| | |
| * | maxwell_3d: Update to include additional stencil registers.bunnei2018-08-231-20/+50
| | |
| * | gl_state: Update to handle stencil front/back face separately.bunnei2018-08-232-33/+38
|/ /
* | Merge pull request #1157 from lioncash/vecbunnei2018-08-232-11/+16
|\ \ | | | | | | gl_shader_gen: Use a std::vector to represent program code instead of std::array
| * | gl_shader_gen: Make ShaderSetup's constructor explicitLioncash2018-08-221-1/+1
| | | | | | | | | | | | Prevents implicit conversions.
| * | gl_shader_gen: Use a std::vector to represent program code instead of std::arrayLioncash2018-08-222-11/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While convenient as a std::array, it's also quite a large set of data as well (32KB). It being an array also means data cannot be std::moved. Any situation where the code is being set or relocated means that a full copy of that 32KB data must be done. If we use a std::vector we do need to allocate on the heap, however, it does allow us to std::move the data we have within the std::vector into another std::vector instance, eliminating the need to always copy the program data (as std::move in this case would just transfer the pointers and bare necessities over to the new vector instance).
* | | Merge pull request #1156 from Lakumakkara/lop3bunnei2018-08-232-0/+60
|\ \ \ | |_|/ |/| | gl_shader_decompiler: Implement LOP3
| * | more fixesLaku2018-08-221-6/+7
| | |
| * | fixesLaku2018-08-221-6/+12
| | |
| * | remove debug loggingLaku2018-08-221-2/+0
| | |
| * | implement lop3Laku2018-08-222-0/+55
| | |
* | | Swap "Plus" with "Minus" on the controller GUI (#1150)literalmente-game2018-08-231-8/+8
| | | | | | | | | | | | | | | * Swap "Plus" with "Minus" on the controller GUI Major fix /s
* | | Merge pull request #1159 from lioncash/fmtJames Rowe2018-08-231-0/+0
|\ \ \ | | | | | | | | externals: Update fmt to 6201052
| * | | externals: Update fmt to 6201052Lioncash2018-08-221-0/+0
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, we'd get warnings like: " c:\projects\yuzu\externals\fmt\include\fmt\format.h(2868): warning C4127: conditional expression is constant [C:\projects\yuzu\msvc_build\externals\dynarmic\src\dynarmic.vcxproj] " spamming the build output when compiling on Windows. This updates fmt to include the upstreamed fix that silences this warning.
* | | Merge pull request #1137 from lioncash/namespacebunnei2018-08-2321-23/+70
|\ \ \ | | | | | | | | renderer_opengl: Namespace OpenGL code
| * | | renderer_opengl: Namespace OpenGL codeLioncash2018-08-2221-23/+70
| | |/ | |/| | | | | | | | | | | | | | | | Namespaces all OpenGL code under the OpenGL namespace. Prevents polluting the global namespace and allows clear distinction between other renderers' code in the future.
* | | Merge pull request #1158 from lioncash/boostJames Rowe2018-08-221-0/+0
|\ \ \ | |_|/ |/| | externals/boost: Update to 1.68.0
| * | externals/boost: Update to 1.68.0Lioncash2018-08-221-0/+0
|/ / | | | | | | | | | | | | | | | | | | | | | | This updates the submodule to use 1.68.0. Notably, it gets rid of the silly "Info: Boost.Config is older than your compiler version - probably nothing bad will happen - but you may wish to look for an update Boost version. Define BOOST_CONFIG_SUPPRESS_OUTDATED_MESSAGE to suppress this message." message that spams the output of the build process on Windows.
* | Merge pull request #1155 from tech4me/icon-fixbunnei2018-08-221-1/+1
|\ \ | |/ |/| config: Fixed icon size get set to 0
| * config: Fixed icon size get set to 0tech4me2018-08-221-1/+1
|/
* Merge pull request #1136 from tech4me/masterbunnei2018-08-226-11/+45
|\ | | | | qt/main: Port part of citra(#3411), open savedata works
| * qt/main: Port part of citra(#3411), open savedata workstech4me2018-08-216-11/+45
| |
* | Merge pull request #840 from FearlessTobi/port-3353bunnei2018-08-2210-25/+94
|\ \ | | | | | | Port #3353 from Citra: "citra-qt: Add customizable speed limit target "
| * | Port #3353 from CitrafearlessTobi2018-08-2110-25/+94
| | |
* | | Merge pull request #1154 from OatmealDome/topology-linesbunnei2018-08-221-0/+2
|\ \ \ | | | | | | | | maxwell_to_gl: Implement PrimitiveTopology::Lines
| * | | maxwell_to_gl: Implement PrimitiveTopology::LinesOatmealDome2018-08-221-0/+2
| | | | | | | | | | | | Used by Splatoon 2's debug menu.
* | | | Merge pull request #1141 from FearlessTobi/port-3902bunnei2018-08-222-0/+18
|\ \ \ \ | | | | | | | | | | Port #3902 from Citra: "Add restart hotkey & menu option"
| * | | | Port #3902 from Citra: "Add restart hotkey & menu option"fearlessTobi2018-08-212-0/+18
| | |_|/ | |/| |
* | | | Merge pull request #1124 from Subv/logic_opsbunnei2018-08-226-7/+108
|\ \ \ \ | |_|/ / |/| | | GPU: Implemented logic ops.
| * | | GPU: Implemented the logic op functionality of the GPU.Subv2018-08-213-0/+61
| | | | | | | | | | | | | | | | This will ASSERT if blending is enabled at the same time as logic ops.
| * | | GLState: Allow enabling/disabling GL_COLOR_LOGIC_OP independently from blending.Subv2018-08-212-6/+19
| | | |
| * | | GPU: Added registers for the logicop functionality.Subv2018-08-211-1/+28
| | |/ | |/|
* | | Merge pull request #1147 from lioncash/warnbunnei2018-08-221-1/+1
|\ \ \ | | | | | | | | logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instance
| * | | logging/text_formatter: Use empty braces for initializing CONSOLE_SCREEN_BUFFER_INFO instanceLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The previous form of initializing done here is a C-ism, an empty set of braces is sufficient for initializing (and doesn't potentially cause missing brace warnings, given the first member of the struct is a COORD struct).
* | | | Merge pull request #1151 from bunnei/revert-4a2ee191bunnei2018-08-222-153/+31
|\ \ \ \ | | | | | | | | | | Revert "Shader: Use the right sampler type in the TEX, TEXS and TLDS …"
| * | | | Revert "Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions."bunnei2018-08-222-153/+31
| | | | | | | | | | | | | | | | | | | | | | | | | - This reverts commit 3ef4b3d4b445960576f10d1ba6521580d03e3da8. - This commit had broken a lot of games. We really should do a full implementation of this in one change.
* | | | | Merge pull request #1152 from ogniK5377/plu-includebunnei2018-08-221-0/+1
|\ \ \ \ \ | | | | | | | | | | | | Added missing include for pl:u
| * | | | | Added missing include for pl:uDavid Marcec2018-08-221-0/+1
|/ / / / / | | | | | | | | | | | | | | | Should fix any compile errors
* / / / / PL:U Added BFTTF loading(Loading from System NAND dumps) (#1088)David2018-08-221-25/+140
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added bfttf loading We can now load system bfttf fonts from system archives AND shared memory dumps. This allows people who have installed their system nand dumps to yuzu to automatically get shared font support. We also now don't hard code the offsets or the sizes of the shared fonts and it's all calculated for us now. * Addressed plu fixups * Style changes for plu * Fixed logic error for plu and added more error checks.
* | | | Merge pull request #1145 from lioncash/fwd-declbunnei2018-08-225-4/+7
|\ \ \ \ | | | | | | | | | | vfs: Replace mode.h include with forward declarations where applicable
| * | | | vfs: Replace mode.h include with forward declarations where applicableLioncash2018-08-215-4/+7
| |/ / / | | | | | | | | | | | | | | | | Avoids the need to rebuild these source files if the mode header changes.
* | | | Merge pull request #1146 from lioncash/ambunnei2018-08-221-3/+4
|\ \ \ \ | | | | | | | | | | am: Utilize std::array within PopLaunchParameter()
| * | | | am: Utilize std::array within PopLaunchParameter()Lioncash2018-08-211-3/+4
| |/ / / | | | | | | | | | | | | | | | | | | | | Gets rid of the potential for C array-to-pointer decay, and also makes pointer arithmetic to get the end of the copy range unnecessary. We can just use std::array's begin() and end() member functions.
* | | | Merge pull request #1148 from lioncash/audio-warnbunnei2018-08-211-1/+1
|\ \ \ \ | | | | | | | | | | audio_core/filter: Add explicit cast to assignment in Process()
| * | | | audio_core/filter: Add explicit cast to assignment in Process()Lioncash2018-08-211-1/+1
| |/ / / | | | | | | | | | | | | | | | | Previously this would cause warnings about implicit conversions to s16 from a double
* | | | Merge pull request #1149 from lioncash/parenbunnei2018-08-211-1/+1
|\ \ \ \ | |/ / / |/| | | shader_bytecode: Parenthesize conditional expression within GetTextureType()
| * | | shader_bytecode: Parenthesize conditional expression within GetTextureType()Lioncash2018-08-211-1/+1
|/ / / | | | | | | | | | Resolves a -Wlogical-op-parentheses warning.
* | | Merge pull request #1143 from lioncash/incbunnei2018-08-212-1/+1
|\ \ \ | | | | | | | | sdmc_factory: Remove unnecessary core include
| * | | sdmc_factory: Remove unnecessary core includeLioncash2018-08-212-1/+1
| | |/ | |/| | | | | | | | | | This doesn't require the central core header to be included, it just needs the vfs headers.
* | | Merge pull request #1139 from lioncash/bitfieldbunnei2018-08-211-2/+1
|\ \ \ | | | | | | | | bit_field: Convert ToBool() into explicit operator bool
| * | | bit_field: Convert ToBool() into explicit operator boolLioncash2018-08-211-2/+1
| |/ / | | | | | | | | | Gets rid of a TODO that is long overdue.
* | | Merge pull request #1140 from FearlessTobi/port-4056bunnei2018-08-212-0/+14
|\ \ \ | | | | | | | | Port #4056 from Citra: "Add Clear Recent Files menu action"
| * | | Port #4056 from Citra: "Add Clear Recent Files menu action"fearlessTobi2018-08-212-0/+14
| |/ /
* | | Merge pull request #1144 from MerryMage/MAX_LAG_TIME_USMat M2018-08-211-1/+1
|\ \ \ | |/ / |/| | perf_stats: Change MAX_LAG_TIME_US to an appropriate value
| * | perf_stats: Change MAX_LAG_TIME_US to an appropriate valueMerryMage2018-08-211-1/+1
|/ / | | | | | | | | | | | | | | | | | | 25us is far too small, and would result in std::this_thread::sleep_for being called with this as a maximum value. This means that a guest application that produces frames instantly would only be limited to 40 kHz. 25ms is a more appropriate value, as it allows for a 60 Hz refresh rate while providing enough slack in the negative region.
* | Merge pull request #1123 from lioncash/screenbunnei2018-08-217-30/+25
|\ \ | | | | | | rasterizer_interface: Remove renderer-specific ScreenInfo type from AccelerateDraw() in RasterizerInterface
| * | rasterizer_interface: Remove ScreenInfo from AccelerateDraw()'s signatureLioncash2018-08-215-17/+14
| | | | | | | | | | | | | | | | | | This is an OpenGL renderer-specific data type. Given that, this type shouldn't be used within the base interface for the rasterizer. Instead, we can pass this information to the rasterizer via reference.
| * | renderer_base: Make creation of the rasterizer, the responsibility of the renderers themselvesLioncash2018-08-214-14/+12
| |/ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given we use a base-class type within the renderer for the rasterizer (RasterizerInterface), we want to allow renderers to perform more complex initialization if they need to do such a thing. This makes it important to reserve type information. Given the OpenGL renderer is quite simple settings-wise, this is just a simple shuffling of the initialization code. For something like Vulkan however this might involve doing something like: // Initialize and call rasterizer-specific function that requires // the full type of the instance created. auto raster = std::make_unique<VulkanRasterizer>(some, params); raster->CallSomeVulkanRasterizerSpecificFunction(); // Assign to base class variable rasterizer = std::move(raster)
* | Merge pull request #1129 from lioncash/headerbunnei2018-08-2111-8/+40
|\ \ | | | | | | romfs_factory, service/filesystem: Use forward declarations where applicable
| * | service/filesystem: Use forward declarations where applicableLioncash2018-08-219-5/+28
| | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to rebuild multiple source files if the filesystem code headers change. This also gets rid of a few instances of indirect inclusions being relied upon
| * | romfs_factory: Remove unnecessary includes and use forward declarations where applicableLioncash2018-08-213-3/+12
| | | | | | | | | | | | | | | | | | Avoids the need to rebuild whatever includes the romfs factory header if the loader header ever changes. We also don't need to include the main core header. We can instead include the headers we specifically need.
* | | Merge pull request #1132 from Subv/gl_FragDepthbunnei2018-08-211-1/+6
|\ \ \ | | | | | | | | Shaders: Implement depth writing in fragment shaders.
| * | | Shaders: Implement depth writing in fragment shaders.Subv2018-08-211-1/+6
| | | | | | | | | | | | | | | | We'll write <last color output reg + 2> to gl_FragDepth.
* | | | Merge pull request #1134 from lioncash/logbunnei2018-08-211-1/+1
|\ \ \ \ | | | | | | | | | | renderer_opengl: Use LOG_DEBUG for GL_DEBUG_SEVERITY_NOTIFICATION and GL_DEBUG_SEVERITY_LOW logs
| * | | | renderer_opengl: Use LOG_DEBUG for GL_DEBUG_SEVERITY_NOTIFICATION and GL_DEBUG_SEVERITY_LOW logsLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | LOG_TRACE is only enabled on debug builds which can be quite slow when trying to debug graphics issues. Instead we can log the messages to the debug log, which is available on both release and debug builds.
* | | | | Merge pull request #1121 from Subv/tex_reinterpretbunnei2018-08-214-16/+70
|\ \ \ \ \ | |/ / / / |/| | | | Rasterizer: Use PBOs to reinterpret texture formats when games re-use the same memory.
| * | | | Rasterizer: Reinterpret the raw texture bytes instead of blitting (and thus doing format conversion) to a new texture when a game requests an old texture address with a different format.Subv2018-08-201-3/+49
| | | | |
| * | | | Rasterizer: Don't attempt to copy over the old texture's data when doing a format reinterpretation if we're only going to clear the framebuffer.Subv2018-08-204-13/+21
| | |_|/ | |/| |
* | | | Merge pull request #1133 from lioncash/guardbunnei2018-08-211-0/+2
|\ \ \ \ | |_|/ / |/| | | gl_stream_buffer: Add missing header guard
| * | | gl_stream_buffer: Add missing header guardLioncash2018-08-211-0/+2
| | | | | | | | | | | | | | | | | | | | Prevents potential compilation errors from occuring due to multiple inclusions
* | | | Merge pull request #1126 from lioncash/telembunnei2018-08-211-4/+4
|\ \ \ \ | | | | | | | | | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()
| * | | | telemetry_session: Don't allocate std::string instances for program lifetime in GetTelemetryId() and RegenerateTelemetryId()Lioncash2018-08-211-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given these functions aren't intended to be used frequently, there's no need to keep the std::string instances allocated for the whole lifetime of the program. It's just a waste of memory.
* | | | | Merge pull request #1131 from bunnei/impl-tex3d-texcubebunnei2018-08-212-2/+21
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Implement TextureCube/Texture3D for TEX/TEXS.
| * | | | | shader_bytecode: Replace some UNIMPLEMENTED logs.bunnei2018-08-211-2/+6
| | | | | |
| * | | | | gl_shader_decompiler: Implement Texture3D for TEXS.bunnei2018-08-211-0/+7
| | | | | |
| * | | | | gl_shader_decompiler: Implement TextureCube for TEX.bunnei2018-08-211-0/+8
| | | | | |
* | | | | | Merge pull request #1106 from Subv/multiple_rendertargetsbunnei2018-08-212-6/+45
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Shaders: Write all the enabled color outputs when a fragment shader exits.
| * | | | | Shaders: Write all the enabled color outputs when a fragment shader exits.Subv2018-08-212-6/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were only writing to the first render target before. Note that this is only the GLSL side of the implementation, supporting multiple render targets requires more changes in the OpenGL renderer. Dual Source blending is not implemented and stuff that uses it might not work at all.
* | | | | | Merge pull request #1130 from Subv/tex_2dbunnei2018-08-211-6/+15
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Shaders: Fixed texture coordinates in TEX with Texture2D
| * | | | | Shaders: Fixed the coords in TEX with Texture2D.Subv2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The X and Y coordinates should be in gpr8 and gpr8+1, respectively. This fixes the cutscene rendering in Sonic Mania.
| * | | | | Shaders: Log and crash when using an unimplemented texture type in a texture sampling instruction.Subv2018-08-211-5/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #1122 from lioncash/accbunnei2018-08-214-57/+61
|\ \ \ \ \ | | | | | | | | | | | | acc/profile_manager: General cleanup
| * | | | | acc: Replace profile_manager include with a forward declarationLioncash2018-08-212-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | This is only used in a shared_ptr, so we can forward declare it.
| * | | | | acc: Simplify WriteBuffer call within LoadImage()Lioncash2018-08-211-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We have an overload of WriteBuffer that accepts containers that satisfy the ContiguousContainer concept, which std::array does, so we only need to pass in the array itself.
| * | | | | acc: Correct IProfile's constructor initializer list orderLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Arranges them in the order the members would be initialized
| * | | | | acc: Remove unused DEFAULT_USER_IDLioncash2018-08-211-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | This is no longer used, so it can be removed.
| * | | | | profile_manager: Use INVALID_UUID in the initializer of last_opened_userLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Makes it a little bit more self-documenting.
| * | | | | profile_manager: Remove unnecessary memcpy in GetProfileBaseAndData()Lioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the source and destination types are the same std::array type, we can simply use regular assignment to perform the same behavior.
| * | | | | profile_manager: Use type aliases for username data, profile data, and user arraysLioncash2018-08-212-19/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids the need to repeatedly specify the whole array type in multiple places.
| * | | | | profile_manager: Take ProfileInfo by const reference where applicableLioncash2018-08-212-8/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ProfileInfo is quite a large struct in terms of data, and we don't need to perform a copy in these instances, so we can just pass constant references instead.
| * | | | | profile_manager: Make array parameter to CreateNewUser a const referenceLioncash2018-08-212-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify the passed in array, so this can be a const reference.
| * | | | | profile_manager: Remove unnecessary staticLioncash2018-08-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | This can just be constexpr like the others
| * | | | | profile_manager: Simplify UUID's two param constructor, operator==, and operator boolLioncash2018-08-211-6/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use the constructor initializer list and just compare the contained u128's together instead of comparing each element individually. Ditto for comparing against an invalid UUID.
| * | | | | profile_manager: Move UUID generation function to the cpp fileLioncash2018-08-212-10/+12
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This avoids needing to dump the contents of <random> into other files that include the profile manager header.
| * | | | | profile_manager: Remove unnecessary std::move in AddToProfiles() and CreateNewUser()Lioncash2018-08-201-2/+2
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | Moving a const reference isn't possible, so this just results in a copy (and given ProfileInfo is composed of trivial types and aggregates, a move wouldn't really do anything).
* | | | | Merge pull request #1125 from bunnei/update-dynarmicbunnei2018-08-211-0/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | | externals: Update dynarmic to a42f301c.
| * | | | externals: Update dynarmic to a42f301c.bunnei2018-08-211-0/+0
| | |/ / | |/| |
* | | | Merge pull request #1095 from DarkLordZach/sysarchivesbunnei2018-08-218-20/+100
|\ \ \ \ | | | | | | | | | | filesystem: Add support for loading of system archives
| * | | | registration: Add Data_Unknown5 NCAContentTypeZach Hilman2018-08-203-2/+3
| | | | |
| * | | | filesystem: Add support for loading of system archivesZach Hilman2018-08-197-20/+99
| | | | |
* | | | | Merge pull request #1127 from yuzu-emu/revert-838-port-3616James Rowe2018-08-211-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | Revert "Port #3616 from Citra: "appveyor: set jobs to 4 for mingw""
| * | | | Revert "Port #3616 from Citra: "appveyor: set jobs to 4 for mingw""Zach Hilman2018-08-211-1/+1
|/ / / /
* | | | Merge pull request #1064 from lioncash/telemetrybunnei2018-08-213-62/+84
|\ \ \ \ | |_|/ / |/| | | common/telemetry: Migrate core-independent info gathering to common
| * | | common/telemetry: Migrate core-independent info gathering to commonLioncash2018-08-153-62/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously core itself was the library containing the code to gather common information (build info, CPU info, and OS info), however all of this isn't core-dependent and can be moved to the common code and use the common interfaces. We can then just call those functions from the core instead. This will allow replacing our CPU detection with Xbyak's which has better detection facilities than ours. It also keeps more architecture-dependent code in common instead of core.
* | | | Merge pull request #1104 from Subv/instanced_arraysbunnei2018-08-202-4/+30
|\ \ \ \ | | | | | | | | | | GLRasterizer: Implemented instanced vertex arrays.
| * | | | GLRasterizer: Implemented instanced vertex arrays.Subv2018-08-182-4/+30
| | |_|/ | |/| | | | | | | | | | Before each draw call, for every enabled vertex array configured as instanced, we take the current instance id and divide it by its configured divisor, then we multiply that by the corresponding stride and increment the start address by the resulting amount. This way we can simulate the vertex array being incremented once per instance without actually using OpenGL's instancing functions.
* | | | Merge pull request #1115 from Subv/texs_maskbunnei2018-08-201-18/+18
|\ \ \ \ | | | | | | | | | | Shaders/TEXS: Write to the correct output register when swizzling.
| * | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-201-18/+18
| | | | | | | | | | | | | | | | | | | | Previously we could end up with a TEXS that didn't write any outputs, this was wrong.
* | | | | Merge pull request #1112 from Subv/sampler_typesbunnei2018-08-203-33/+250
|\ \ \ \ \ | | | | | | | | | | | | Shaders: Use the correct shader type when sampling textures.
| * | | | | Shader: Implemented the TLD4 and TLD4S opcodes using GLSL's textureGather.Subv2018-08-191-0/+51
| | | | | | | | | | | | | | | | | | | | | | | | It is unknown how TLD4S determines the sampler type, more research is needed.
| * | | | | Shader: Use the right sampler type in the TEX, TEXS and TLDS instructions.Subv2018-08-192-29/+127
| | | | | | | | | | | | | | | | | | | | | | | | Different sampler types have their parameters in different registers.
| * | | | | Shader: Added bitfields for the texture type of the various sampling instructions.Subv2018-08-191-1/+65
| | | | | |
| * | | | | Shaders: Added decodings for TLD4 and TLD4SSubv2018-08-191-3/+7
| | | | | |
* | | | | | Merge pull request #1117 from ogniK5377/CheckFreeCommunicationPermissionbunnei2018-08-201-1/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | Added CheckFreeCommunicationPermission
| * | | | | | Added CheckFreeCommunicationPermissionDavid Marcec2018-08-201-1/+8
| | |/ / / / | |/| | | | | | | | | | | | | | | | This fixes save files not loading in splatoon 2
* | | | | | Merge pull request #1017 from ogniK5377/better-accountbunnei2018-08-2013-74/+440
|\ \ \ \ \ \ | | | | | | | | | | | | | | New account backend to allow for future extended support
| * | | | | | Better UUID randomnessDavid Marcec2018-08-111-2/+7
| | | | | | |
| * | | | | | Removed un-needed count from ListOpenUsers and ListAllUsersDavid Marcec2018-08-111-4/+2
| | | | | | |
| * | | | | | Added better explanations in the profile managerDavid Marcec2018-08-112-1/+34
| | | | | | |
| * | | | | | Code cleanup for profile managerDavid Marcec2018-08-113-40/+47
| | | | | | |
| * | | | | | Removed const from ProfileBase InvalidateDavid Marcec2018-08-111-1/+1
| | | | | | |
| * | | | | | fixed invalid uuid bool operatorDavid Marcec2018-08-111-1/+1
| | | | | | |
| * | | | | | Added GetOpenUserCountDavid Marcec2018-08-113-3/+14
| | | | | | |
| * | | | | | Removed all for loops from the profile managerDavid Marcec2018-08-111-9/+4
| | | | | | |
| * | | | | | Added missing ListAllUsers countDavid Marcec2018-08-111-1/+2
| | | | | | |
| * | | | | | If statement style changeDavid Marcec2018-08-111-11/+19
| | | | | | |
| * | | | | | Second round of account changesDavid Marcec2018-08-113-18/+21
| | | | | | |
| * | | | | | First round of account changesDavid Marcec2018-08-113-49/+55
| | | | | | |
| * | | | | | Rebase with dynarmic masterDavid Marcec2018-08-111-0/+0
| | | | | | |
| * | | | | | Refactored profile manager sharingDavid Marcec2018-08-1110-20/+28
| | | | | | |
| * | | | | | Merge remote-tracking branch 'origin/master' into better-accountDavid Marcec2018-08-1179-635/+1570
| |\ \ \ \ \ \
| * | | | | | | Added IsUserRegistrationRequestPermittedDavid Marcec2018-08-117-3/+19
| | | | | | | |
| * | | | | | | Don't add user if the uuid already existsDavid Marcec2018-08-091-0/+4
| | | | | | | |
| * | | | | | | Open first user addedDavid Marcec2018-08-081-1/+3
| | | | | | | |
| * | | | | | | Inital pass of account backend implementationDavid Marcec2018-08-083-12/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit verified working on puyo
| * | | | | | | GetProfileBase and GetProfileBaseAndData addedDavid Marcec2018-08-083-44/+106
| | | | | | | |
| * | | | | | | began initial implementation of "ProfileManager"David Marcec2018-08-085-44/+202
| | | | | | | |
| * | | | | | | Switched uuids from u128 to new UUID structDavid Marcec2018-08-082-10/+49
| | | | | | | |
* | | | | | | | Merge pull request #1120 from ogniK5377/rgba8-uintbunnei2018-08-204-45/+58
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implemented RGBA8_UINT
| * | | | | | | | Implemented RGBA8_UINTDavid Marcec2018-08-204-45/+58
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Needed by kirby
* | | | | | | | Merge pull request #1119 from lioncash/uninitbunnei2018-08-201-2/+2
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | game_list: Avoid uninitialized variables when retrieving program ID
| * | | | | | | game_list: Avoid uninitialized variables when retrieving program IDLioncash2018-08-201-2/+2
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially leaving this variable uninitialized based off the loader failing to retrieve the ID value.
* | | | | | | Merge pull request #1089 from Subv/neg_bitsbunnei2018-08-192-16/+38
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Shaders: Corrected the 'abs' and 'neg' bit usage in the float arithmetic instructions.
| * | | | | | | Shaders: Corrected the 'abs' and 'neg' bit usage in the float arithmetic instructions.Subv2018-08-182-16/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We should definitely audit our shader generator for more errors like this.
* | | | | | | | Merge pull request #1105 from Subv/convert_negbunnei2018-08-191-2/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Shader: Remove an unneeded assert, the negate bit is implemented for conversion instructions.
| * | | | | | | | Shader: Remove an unneeded assert, the negate bit is implemented for conversion instructions.Subv2018-08-181-2/+0
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #1113 from Subv/texs_maskbunnei2018-08-191-6/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.
| * | | | | | | | Shaders/TEXS: Fixed the component mask in the TEXS instruction.Subv2018-08-191-6/+11
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | Previously we could end up with a TEXS that didn't write any outputs, this was wrong.
* | | | | | | | Merge pull request #1102 from ogniK5377/mirror-clamp-edgebunnei2018-08-193-0/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Added WrapMode MirrorOnceClampToEdge
| * | | | | | | | Added check to see if ARB_texture_mirror_clamp_to_edge is supportedDavid Marcec2018-08-192-0/+4
| | | | | | | | |
| * | | | | | | | Added WrapMode MirrorOnceClampToEdgeDavid Marcec2018-08-181-0/+2
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Used by splatoon 2
* | | | | | | | Merge pull request #1101 from Subv/ssy_stackbunnei2018-08-191-3/+36
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Shaders: Implemented a stack for the SSY/SYNC instructions.
| * | | | | | | Shaders: Implemented a stack for the SSY/SYNC instructions.Subv2018-08-181-3/+36
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | The SSY instruction pushes an address into the stack, and the SYNC instruction pops it. The current stack depth is 20, we should figure out if this is enough or not.
* | | | | | | Merge pull request #1109 from Subv/ldg_decodebunnei2018-08-191-0/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Shaders: Added decodings for the LDG and STG instructions.
| * | | | | | | Shaders: Added decodings for the LDG and STG instructions.Subv2018-08-191-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #1108 from Subv/front_facingbunnei2018-08-192-0/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Shaders: Implemented the gl_FrontFacing input attribute (attr 63).
| * | | | | | | Shaders: Implemented the gl_FrontFacing input attribute (attr 63).Subv2018-08-192-0/+7
| |/ / / / / /
* | | | | | | Merge pull request #1103 from Subv/lop_predbunnei2018-08-192-11/+39
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | Shader: Implemented the predicate and mode arguments of LOP.
| * | | | | | Shader: Implemented the predicate and mode arguments of LOP.Subv2018-08-182-11/+39
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The mode can be used to set the predicate to true depending on the result of the logic operation. In some cases, this means discarding the result (writing it to register 0xFF (Zero)). This is used by Super Mario Odyssey.
* | | | | | Merge pull request #838 from FearlessTobi/port-3616James Rowe2018-08-181-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Port #3616 from Citra: "appveyor: set jobs to 4 for mingw"
| * | | | | Port #3616 from CitrafearlessTobi2018-07-261-1/+1
| | | | | |
* | | | | | Merge pull request #1100 from ogniK5377/missing-predbunnei2018-08-182-5/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | Added pred-condition GreaterThanWithNan
| * | | | | | Added predcondition GreaterThanWithNanDavid Marcec2018-08-182-5/+8
|/ / / / / /
* | | | | | Merge pull request #1096 from bunnei/supported-blitsbunnei2018-08-181-2/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: Remove asserts for supported blits.
| * | | | | | gl_rasterizer_cache: Remove asserts for supported blits.bunnei2018-08-171-2/+0
| | | | | | |
* | | | | | | Merge pull request #1097 from bunnei/gl-criticalbunnei2018-08-171-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | renderer_opengl: Treat OpenGL errors as critical.
| * | | | | | | renderer_opengl: Treat OpenGL errors as critical.bunnei2018-08-171-1/+1
| |/ / / / / /
* | | | | | | Implement SetIdleTimeDetectionExtension & GetIdleTimeDetectionExtension (#1059)greggameplayer2018-08-172-2/+22
| | | | | | | | | | | | | | | | | | | | | * Used by Mario Tennis Aces
* | | | | | | Merge pull request #1090 from lioncash/ctor-assignbunnei2018-08-171-0/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Delete System copy/move constructors and assignment operators
| * | | | | | | core: Delete System copy/move constructors and assignment operatorsLioncash2018-08-161-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents potentially making copies or doing silly things by accident with the System instance, particularly given our current core is designed (unfortunately) around one instantiable instance. This will prevent the accidental case of: auto instance = System::Instance(); being compiled without warning when it's supposed to be: auto& instance = System::Instance();
* | | | | | | | Merge pull request #1091 from lioncash/warningbunnei2018-08-171-78/+83
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | qt/main: Get rid of compilation warnings
| * | | | | | | | qt/main: Unindent code in OnMenuInstallToNAND()Lioncash2018-08-161-70/+70
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can change this into an early-return if the filename is empty. There's no need to include all of the code within the if statement.
| * | | | | | | | qt/main: Make installation dialog text within OnMenuInstallToNAND() translatableLioncash2018-08-161-14/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is user-facing text, so it should be marked as translatable by Qt.
| * | | | | | | | qt/main: Get rid of compilation warningsLioncash2018-08-161-4/+8
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of truncation warnings about conversion to int. While we're at it, we can also de-hardcode the buffer size being used.
* | | | | | | | Merge pull request #1093 from greggameplayer/GetDefaultDisplayResolutionChangeEventbunnei2018-08-172-1/+13
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Implement GetDefaultDisplayResolutionChangeEvent
| * | | | | | | correct coding stylegreggameplayer2018-08-161-1/+1
| | | | | | | |
| * | | | | | | Implement GetDefaultDisplayResolutionChangeEventgreggameplayer2018-08-162-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Require by Toki Tori and Toki Tori 2+
* | | | | | | | Merge pull request #1019 from Subv/vertex_divisorbunnei2018-08-177-5/+28
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Rasterizer: Manually implemented instanced rendering.
| * | | | | | | | Rasterizer: Implemented instanced rendering.Subv2018-08-157-5/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We keep track of the current instance and update an uniform in the shaders to let them know which instance they are. Instanced vertex arrays are not yet implemented.
* | | | | | | | | Merge pull request #1087 from MerryMage/dynarmicbunnei2018-08-172-0/+3
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | dynarmic: Update to 550d662
| * | | | | | | | | dynarmic: Update to 550d662MerryMage2018-08-162-0/+3
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 550d662 load_store_exclusive: Define s == t state to be Constraint_NONE 0b69381 A64/translate: Allow for unpredictable behaviour to be defined 6d236d4 system: Implement MRS CNTFRQ_EL0 6cbb6fb A32/testenv: Add missing headers 6729328 externals: Update xbyak to v5.67 1812bd2 Squashed 'externals/xbyak/' changes from 2794cde7..671fc805 9a95802 externals: Document subtrees 714a840 A64: Implement SQ{ADD, SUB}, and UQ{ADD, SUB}'s vector variants 8cab459 A64: Implement UQADD/UQSUB's scalar variants 18a8151 ir: Add opcodes for unsigned saturating add and subtract a5660ee x64/reg_alloc: Use type alias for array returned by GetArgumentInfo() 29489b5 ir/value: Use type alias CoprocessorInfo for std::array<u8, 8> e23ba26 status_register_access: Add support for bits 0 and 1 of mask to MSR 55190bd fuzz_with_unicorn: Split utility functions into fuzz_util 23b049d A32/translate/load_store: Correct detection of writeback 7ec9f15 A32/translate: Add TranslateSingleInstruction efeecb4 A32/ir_emitter: Bug fix: IREmitter::ExceptionRaised using incorrect opcode 08d1d19 A32/decoders: Split instruction list into include file 2d929cc tests: Refactor unicorn_emu to allow for A32 unicorn f672368 microinstruction: Improve assert messages 7ebff50 emit_x64_vector: EmitVectorNarrow16: AVX512 implementation edce230 emit_x64_vector: EmitVectorNarrow32: prefer pblendw to loading constant
* | | | | | | | | Merge pull request #1084 from bunnei/depthbunnei2018-08-172-16/+26
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | gl_rasterizer_cache: Treat Depth formats differently from DepthStencil.
| * | | | | | | | gl_rasterizer_cache: Treat Depth formats differently from DepthStencil.bunnei2018-08-162-16/+26
| | | | | | | | |
* | | | | | | | | Merge pull request #1085 from lioncash/namespacebunnei2018-08-164-12/+22
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | common: Namespace hex_util.h/.cpp
| * | | | | | | | common: Namespace hex_util.h/.cppLioncash2018-08-164-12/+22
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's in the common code, so it should be under the Common namespace like everything else.
* | | | | | | | Merge pull request #1075 from lioncash/includebunnei2018-08-164-35/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | loader/{nca, xci}: Remove unnecessary includes and unused member variables
| * | | | | | | loader/nca: Remove unnecessary includes and member variablesLioncash2018-08-152-20/+11
| | | | | | | |
| * | | | | | | loader/xci: Remove unnecessary includes and member variablesLioncash2018-08-152-15/+11
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Many of these aren't necessary and will cause this file to be required to be recompiled whenever any changes to those files are made, which lengthens compile times for no reason. This also removes an unused metadata variable from AppLoader_XCI
* | | | | | | Merge pull request #1005 from DarkLordZach/registered-fmtbunnei2018-08-1634-80/+1437
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | file_sys: Add support for registration format
| * | | | | | | registration: Various style and documentation improvementsZach Hilman2018-08-123-18/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fix logic in RealVfsFilesystem Create methods Remove magic numbers Fix regex errors
| * | | | | | | registration: Add support for force overwrite of installedZach Hilman2018-08-124-53/+106
| | | | | | | |
| * | | | | | | game_list: Split game list scans to multiple functionsZach Hilman2018-08-122-9/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary rebuilds of control data on every layer of recursion in AddFstEntriesToGameList
| * | | | | | | vfs_real: Add CreateFullPath to Create* operationsZach Hilman2018-08-122-13/+6
| | | | | | | |
| * | | | | | | control_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-2/+1
| | | | | | | |
| * | | | | | | romfs: Remove cyclic shared_ptr leak in romfs codeZach Hilman2018-08-123-8/+8
| | | | | | | |
| * | | | | | | registration: Update documentation and styleZach Hilman2018-08-125-42/+69
| | | | | | | |
| * | | | | | | nca_metadata: Remove unnecessary reference to base fileZach Hilman2018-08-122-3/+2
| | | | | | | |
| * | | | | | | bis_factory: Create NAND dirs if they don't existZach Hilman2018-08-121-2/+9
| | | | | | | |
| * | | | | | | qt: Use custom RawCopy with progress bar for installsZach Hilman2018-08-121-2/+28
| | | | | | | |
| * | | | | | | registration: Take RawCopy function as parameterZach Hilman2018-08-122-10/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of defaulting to VfsRawCopy
| * | | | | | | game_list: Populate control data from installed NANDZach Hilman2018-08-122-31/+35
| | | | | | | |
| * | | | | | | registered_cache: Fix missing reading from yuzu_metaZach Hilman2018-08-121-7/+16
| | | | | | | |
| * | | | | | | file_sys: Comply to style guidelinesZach Hilman2018-08-128-47/+60
| | | | | | | |
| * | | | | | | qt: Add 'Install to NAND' option to menuZach Hilman2018-08-125-1/+99
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prompts for title type on NCA files.
| * | | | | | | game_list: Modify game list to scan installed titlesZach Hilman2018-08-121-0/+45
| | | | | | | |
| * | | | | | | file_sys: Add RegisteredCacheZach Hilman2018-08-122-0/+543
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Manages NAND NCA get and install.
| * | | | | | | file_sys: Add support for parsing NCA metadata (CNMT)Zach Hilman2018-08-123-0/+238
| | | | | | | |
| * | | | | | | card_image: Add accessor for all NCAs in XCIZach Hilman2018-08-122-0/+5
| | | | | | | |
| * | | | | | | vfs_real: Add CreateFullPath to CreateFileZach Hilman2018-08-121-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes bugs with calling CreateFile when the immediate directory does not exist.
| * | | | | | | filesystem: Add Open and Register functions for BISFactoryZach Hilman2018-08-122-4/+23
| | | | | | | |
| * | | | | | | bis_factory: Add partial implementation of BISFactoryZach Hilman2018-08-122-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Creates and stores RegisteredCaches for user and system NAND, as creation of a RegisteredCache is expensive.
| * | | | | | | loader: Join 0* files in directory if filename is 00Zach Hilman2018-08-121-1/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | i.e. Load the concatenated 00+01 if 01 exists as well. Needed for split NAND NCAs.
| * | | | | | | loader: Recognize filename '00' as NCAZach Hilman2018-08-121-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Needed to avoid mismatch filetype warnings on split NAND NCAs
| * | | | | | | vfs: Add ConcatenatedVfsFileZach Hilman2018-08-122-0/+134
| | | | | | | |
| * | | | | | | crypto: Remove hex utilities from key_managerZach Hilman2018-08-122-36/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Move to hex_util.h in common
| * | | | | | | file_util: Add getter for NAND registration directoryZach Hilman2018-08-122-0/+8
| | | | | | | |
| * | | | | | | common: Move hex string processing to separate fileZach Hilman2018-08-123-0/+64
| | | | | | | |
* | | | | | | | Merge pull request #1078 from lioncash/messagebunnei2018-08-161-2/+20
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | lm: Handle threads and modules within the logger
| * | | | | | | lm: Use LOG_DEBUG for printing out trace logsLioncash2018-08-151-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using LOG_TRACE here isn't a good idea because LOG_TRACE is only enabled when yuzu is compiled in debug mode. Debug mode is also quite slow, and so we're potentially throwing away logging messages that can provide value when trying to boot games.
| * | | | | | | lm: Handle threads and modules within the loggerLioncash2018-08-151-1/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The thread field serves to indicate which thread a log is related to and provides the length of the thread's name, so we can print that out, ditto for modules. Now we can know what threads are potentially spawning off logging messages (for example Lydie & Suelle bounces between MainThread and LoadingThread when initializing the game).
* | | | | | | | Merge pull request #1079 from lioncash/fmtbunnei2018-08-165-14/+18
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | loader: Make ResultStatus directly compatible with fmt
| * | | | | | | | loader: Make ResultStatus directly compatible with fmtLioncash2018-08-155-14/+18
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can make the enum class type compatible with fmt by providing an overload of operator<<. While we're at it, perform proper bounds checking. If something exceeds the array, it should be a hard fail, because it's, without a doubt, a programmer error in this case.
* | | | | | | | Merge pull request #1051 from B3n30/UnscheduleEventThreadsafebunnei2018-08-163-1/+12
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Core::CoreTiming: add UnscheduleEventThreadsafe
| * | | | | | | | Core::CoreTiming: add UnscheduleEventThreadsafeB3n302018-08-133-1/+12
| | | | | | | | |
* | | | | | | | | Merge pull request #1080 from lioncash/retbunnei2018-08-161-1/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | sm/controller: Correct return value of QueryPointerBufferSize
| * | | | | | | | | sm/controller: Correct return value of QueryPointerBufferSizeLioncash2018-08-151-1/+1
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | This should be returning a u16 according to Switch Brew.
* | | | | | | | | Merge pull request #1083 from Subv/conv_negbunnei2018-08-161-13/+53
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Shaders: Implemented I2F_C and F2I_C, along with the negation bits of the conversion instructions.
| * | | | | | | | | Shader/Conversion: Implemented the negate bit in F2F and I2I instructions.Subv2018-08-151-4/+12
| | | | | | | | | |
| * | | | | | | | | Shader/I2F: Implemented the negate I2F_C instruction variant.Subv2018-08-151-7/+23
| | | | | | | | | |
| * | | | | | | | | Shader/F2I: Implemented the negate bit in the I2F instructionSubv2018-08-151-0/+4
| | | | | | | | | |
| * | | | | | | | | Shader/F2I: Implemented the F2I_C instruction variant.Subv2018-08-151-2/+10
| | | | | | | | | |
| * | | | | | | | | Shader/F2I: Implemented the negate bit in the F2I instruction.Subv2018-08-151-0/+4
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1081 from lioncash/convertbunnei2018-08-153-3/+8
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | kernel/server_session: Add IsSession() member function
| * | | | | | | | | kernel/server_session: Add IsSession() member functionLioncash2018-08-153-3/+8
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows querying the inverse of IsDomain() to make things more readable. This will likely also be usable in the event of implementing ConvertDomainToSession().
* | | | | | | | | Merge pull request #1077 from bunnei/rgba16ubunnei2018-08-151-1/+9
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Add RGBA16U to PixelFormatFromTextureFormat.
| * | | | | | | | | gl_rasterizer_cache: Add RGBA16U to PixelFormatFromTextureFormat.bunnei2018-08-151-1/+9
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | Merge pull request #1076 from bunnei/format-cleanupbunnei2018-08-152-41/+71
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | gl_rasterizer_cache: Cleanup some PixelFormat names and logging.
| * | | | | | | | gl_rasterizer_cache: Cleanup some PixelFormat names and logging.bunnei2018-08-152-41/+71
|/ / / / / / / /
* | | | | | | | Merge pull request #1069 from bunnei/vtx-szbunnei2018-08-151-5/+20
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | maxwell_to_gl: Properly handle UnsignedInt/SignedInt sizes.
| * | | | | | | | maxwell_to_gl: Properly handle UnsignedInt/SignedInt sizes.bunnei2018-08-151-5/+20
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1070 from bunnei/cbuf-szbunnei2018-08-151-3/+3
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer: Fix upload size for constant buffers.
| * | | | | | | | gl_rasterizer: Fix upload size for constant buffers.bunnei2018-08-151-3/+3
| |/ / / / / / /
* | | | | | | | Merge pull request #1071 from bunnei/fix-ldcbunnei2018-08-151-13/+22
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Several fixes for indirect constant buffer loads.
| * | | | | | | | gl_shader_decompiler: Several fixes for indirect constant buffer loads.bunnei2018-08-151-13/+22
| |/ / / / / / /
* | | | | | | | Merge pull request #1068 from bunnei/g8r8sbunnei2018-08-152-34/+49
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | gl_rasterizer_cache: Implement G8R8S format.
| * | | | | | | gl_rasterizer_cache: Implement G8R8S format.bunnei2018-08-152-34/+49
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | | Merge pull request #1067 from lioncash/initbunnei2018-08-151-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | emu_window: Ensure WindowConfig members are always initialized
| * | | | | | | emu_window: Ensure WindowConfig members are always initializedLioncash2018-08-151-3/+3
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we weren't always initializing all members of the struct. Prevents potentially wonky behavior from occurring.
* | | | | | | Merge pull request #1073 from lioncash/3dsbunnei2018-08-156-17/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | loader: Remove address mapping remnants from citra
| * | | | | | | loader: Remove address mapping remnants from citraLioncash2018-08-156-17/+0
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | These mappings are leftovers from citra and don't apply to the Switch.
* | | | | | | Merge pull request #1072 from lioncash/svcbunnei2018-08-151-2/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/svc: Log svcBreak parameters
| * | | | | | | kernel/svc: Log svcBreak parametersLioncash2018-08-151-2/+5
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given if we hit here all is lost, we should probably be logging the break reason code and associated information to distinguish between the causes.
* | | | | | | Merge pull request #1063 from lioncash/inlinebunnei2018-08-152-15/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common/xbyak_abi: Mark defined functions in header as inline
| * | | | | | | common/xbyak_abi: Mark defined functions in header as inlineLioncash2018-08-151-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potential One Definition Rule violations when these are used in the future.
| * | | | | | | common/xbyak: Use nested namespace specifiers where applicableLioncash2018-08-152-8/+4
| |/ / / / / /
* | | | | | | Merge pull request #1074 from greggameplayer/Z16_UNORMbunnei2018-08-151-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement Z16 in PixelFormatFromTextureFormat function
| * | | | | | | Implement Z16_UNORM in PixelFormatFromTextureFormat functiongreggameplayer2018-08-151-0/+2
|/ / / / / / / | | | | | | | | | | | | | | Require by Zelda Breath Of The Wild
* | | | | | | Merge pull request #1054 from zhaowenlan1779/misc-fixupbunnei2018-08-151-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common/misc: use windows.h
| * | | | | | | common/misc: use windows.hZhu PengFei2018-08-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | linux-mingw does not really like this.
* | | | | | | | Merge pull request #1056 from lioncash/mmbunnei2018-08-152-46/+52
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | mm_u: Move interface class into the cpp file
| * | | | | | | | mm_u: Forward all old variants of functions to the new onesLioncash2018-08-141-5/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures both variants go through the same interface, and while we're at it, add Finalize to provide the inverse of Initialize for consistency.
| * | | | | | | | mm_u: Move implementation class into the cpp fileLioncash2018-08-142-46/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now if changes are ever made to the behavior of the class, it doesn't involve rebuilding everything that includes the mm_u header.
* | | | | | | | | Merge pull request #1066 from lioncash/aarch64bunnei2018-08-151-0/+2
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | CMakeLists: Add architecture detection for AArch64
| * | | | | | | | | CMakeLists: Add architecture detection for AArch64Lioncash2018-08-151-0/+2
| | |_|/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We already have an equivalent in place for the 32-bit ARM architecture, so we should also have one for the newer 64-bit ARM architecture as well.
* | | | | | | | | Merge pull request #1062 from lioncash/unusedbunnei2018-08-153-141/+0
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | common: Remove unused old breakpoint source files
| * | | | | | | | common: Remove unused old breakpoint source filesLioncash2018-08-153-141/+0
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These currently aren't used and contain commented out source code that corresponds to Dolphin's JIT. Given our CPU code is organized quite differently, we shouldn't be keeping this around (at the moment it just adds to compile times marginally).
* | | | | | | | Merge pull request #1055 from lioncash/initbunnei2018-08-141-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | audout_u: Correct IAudioOut initializer list order
| * | | | | | | | audout_u: Correct IAudioOut initializer list orderLioncash2018-08-141-1/+1
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Orders elements in the precise order they'll be initialized.
* | | | | | | | Merge pull request #1058 from greggameplayer/BC7U_Fixbunnei2018-08-141-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fix BC7U
| * | | | | | | | Fix BC7Ugreggameplayer2018-08-141-1/+1
| | | | | | | | |
* | | | | | | | | Merge pull request #1050 from bunnei/rgba16-unormbunnei2018-08-144-37/+48
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UNORM.
| * | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UNORM.bunnei2018-08-144-37/+48
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | Merge pull request #1060 from lioncash/logJames Rowe2018-08-141-2/+3
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | logging/backend: Use const reference to refer to log filter
| * | | | | | | | logging/backend: Use const reference to refer to log filterLioncash2018-08-141-2/+3
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The filter is returned via const reference, so this was making a pointless copy of the entire filter every time a message was being pushed into the logger instance.
* | | | | | | | Merge pull request #1046 from ogniK5377/missing-channelsMat M2018-08-146-0/+148
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Added missing channel devices
| * | | | | | | Registered missing channel devicesDavid Marcec2018-08-131-0/+4
| | | | | | | |
| * | | | | | | Added missing channel devicesDavid Marcec2018-08-135-0/+144
| | | | | | | |
* | | | | | | | Merge pull request #1052 from ogniK5377/xenobunnei2018-08-134-7/+45
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Implement RG32UI and R32UI
| * | | | | | | | Implement RG32UI and R32UIDavid Marcec2018-08-134-7/+45
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Needed for xenoblade
* | | | | | | | Merge pull request #1033 from MerryMage/interpbunnei2018-08-137-3/+267
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | audio_core: Interpolate
| * | | | | | | | audio_renderer: samples_remaining counts frames, not samplesMerryMage2018-08-131-1/+1
| | | | | | | | |
| * | | | | | | | audio_core: InterpolateMerryMage2018-08-135-0/+121
| | | | | | | | |
| * | | | | | | | audio_core: Implement low-pass filterMerryMage2018-08-133-2/+145
| | | | | | | | |
* | | | | | | | | Merge pull request #1053 from MerryMage/rm-IsExecutingbunnei2018-08-131-3/+1
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | arm_dynarmic: Remove IsExecuting check from PrepareReschedule
| * | | | | | | | | arm_dynarmic: Remove IsExecuting check from PrepareRescheduleMerryMage2018-08-131-3/+1
| | |/ / / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | No longer required. HaltExecution is a no-op if it is not currently executing.
* | | | | | | | | Merge pull request #1049 from bunnei/vtx-size-8Mat M2018-08-131-0/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8.
| * | | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8.bunnei2018-08-131-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | Merge pull request #1032 from lioncash/sanitizebunnei2018-08-131-10/+10
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()
| * | | | | | | | | vfs: Use sanitized paths within MoveFile() and MoveDirectory()Lioncash2018-08-121-10/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously these were being unused (or partially unused). While we're at it, use better naming to make it visibly obvious which variant of the path is being used.
* | | | | | | | | | Merge pull request #1031 from lioncash/verbositybunnei2018-08-132-7/+7
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | card_image: Simplify return statement of GetSubdirectories()
| * | | | | | | | | | card_image: Use type aliases to shorten definitionsLioncash2018-08-122-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We have the aliases, so we may as well use 'em.
| * | | | | | | | | | card_image: Simplify return statement of GetSubdirectories()Lioncash2018-08-121-1/+1
| |/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to write out the construction long-form, we can just let the language itself work it out off the return type.
* | | | | | | | | | Merge pull request #1048 from lioncash/atomicbunnei2018-08-132-8/+9
|\ \ \ \ \ \ \ \ \ \ | |_|/ / / / / / / / |/| | | | | | | | | kernel/object: Tighten object against data races
| * | | | | | | | | kernel/object: Tighten object against data racesLioncash2018-08-132-8/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Despite being covered by a global mutex, we should still ensure that the class handles its reference counts properly. This avoids potential shenanigans when it comes to data races. Given this is the root object that drives quite a bit of the kernel object hierarchy, ensuring we always have the correct behavior (and no races) is a good thing.
* | | | | | | | | | Merge pull request #1047 from bunnei/rgba16-uintbunnei2018-08-134-34/+45
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UINT.
| * | | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RGBA16_UINT.bunnei2018-08-134-34/+45
|/ / / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | | Merge pull request #1045 from bunnei/rg8-unormbunnei2018-08-134-26/+61
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / |/| | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RG8_UNORM.
| * | | | | | | | | renderer_opengl: Implement RenderTargetFormat::RG8_UNORM.bunnei2018-08-134-26/+61
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | | Merge pull request #1044 from bunnei/linestripbunnei2018-08-131-0/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | maxwell_to_gl: Implement PrimitiveTopology::LineStrip.
| * | | | | | | | maxwell_to_gl: Implement PrimitiveTopology::LineStrip.bunnei2018-08-131-0/+2
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | - Used by Breath of the Wild.
* | | | | | | | Merge pull request #1043 from Subv/timingbunnei2018-08-133-2/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Use an approximated amortized amount of ticks when advancing timing.
| * | | | | | | | CPU/Timing: Use an approximated amortized amount of ticks when advancing timing.Subv2018-08-132-1/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We divide the number of ticks to add by the number of cores (4) to obtain a more or less rough estimate of the actual number of ticks added. This assumes that all 4 cores are doing similar work. Previously we were adding ~4 times the number of ticks, thus making the games think that time was going way too fast. This lets us bypass certain hangs in some games like Breath of the Wild. We should modify our CoreTiming to support multiple cores (both running in a single thread, and in multiple host threads).
| * | | | | | | | Kernel/SVC: Don't reschedule the current core when creating a new thread.Subv2018-08-131-1/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current core may have nothing to do with the core where the new thread was scheduled to run. In case it's the same core, then the following PrepareReshedule call will take care of that.
* | | | | | | | | Merge pull request #1036 from lioncash/threadbunnei2018-08-133-7/+7
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | scheduler: Make HaveReadyThreads() a const member function
| * | | | | | | | | scheduler: Make HaveReadyThreads() a const member functionLioncash2018-08-122-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't modify instance state, so the const qualifier can be added to it.
| * | | | | | | | | thread_queue_list: Make contains() and get_first() const member functionsLioncash2018-08-121-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These don't directly modify the contained data.
| * | | | | | | | | thread_queue_list: Convert typedef to a type aliasLioncash2018-08-121-1/+1
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1042 from Subv/racesbunnei2018-08-134-5/+13
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fixed a bunch of race conditions when running in multicore mode.
| * | | | | | | | | Core/HLE: Make the 'reschedule_pending' flag atomic.Subv2018-08-131-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another thread may write to this variable while the core in question is in the middle of checking for a reschedule request.
| * | | | | | | | | CPU/HLE: Lock the HLE mutex before performing a reschedule.Subv2018-08-131-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another thread might be in the middle of an SVC, thus altering the state of the schedulers.
| * | | | | | | | | Kernel/Threads: Lock the HLE mutex when executing the wakeup callback.Subv2018-08-131-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Another thread might be in the middle of a reschedule, thus altering the state of the schedulers.
| * | | | | | | | | Kernel/Thread: Always use the threadsafe option when scheduling wakeups.Subv2018-08-132-4/+4
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | WakeAfterDelay might be called from any host thread, so err on the side of caution and use the thread-safe CoreTiming::ScheduleEventThreadsafe. Note that CoreTiming is still far from thread-safe, there may be more things we have to work on for it to be up to par with what we want.
* | | | | | | | | Merge pull request #1041 from Subv/duplicated_mutexbunnei2018-08-132-2/+22
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.
| * | | | | | | | | Kernel/Mutex: Don't duplicate threads in the mutex waiter list.Subv2018-08-122-2/+22
| |/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Exit from AddMutexWaiter early if the thread is already waiting for a mutex owned by the owner thread. This accounts for the possibility of a thread that is waiting on a condition variable being awakened twice in a row. Also added more validation asserts. This should fix one of the random crashes in Breath Of The Wild.
* | | | | | | | | Merge pull request #1040 from bunnei/xmadbunnei2018-08-132-4/+120
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Implement XMAD instruction.
| * | | | | | | | | gl_shader_decompiler: Implement XMAD instruction.bunnei2018-08-132-4/+120
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1039 from lioncash/typebunnei2018-08-134-11/+17
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | vfs: Make type hierarchy objects classes instead of structs
| * | | | | | | | | vfs: Make VfsFilesystem constructor explicitLioncash2018-08-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes it consistent with the other VFS interfaces and prevents implicit construction.
| * | | | | | | | | vfs: Make type hierarchy objects classes instead of structsLioncash2018-08-124-10/+16
|/ / / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | struct should be used when the data type is very simple or otherwise has no invariants associated with it. Given these are used to form a hierarchy, class should be used instead.
* | | | | | | | | Merge pull request #1025 from ogniK5377/bad-castbunnei2018-08-124-4/+4
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fixed invalid cast in loader
| * | | | | | | | | made ResultStatus a u16David Marcec2018-08-123-3/+3
| | | | | | | | | |
| * | | | | | | | | Fixed invalid cast in loaderDavid Marcec2018-08-121-1/+1
| | |_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | GetMessageForResultStatus takes a u16, not a size_t.
* | | | | | | | | Merge pull request #1038 from MerryMage/lock-cubebbunnei2018-08-121-0/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | cubeb_sink: Protect queue with a mutex
| * | | | | | | | | cubeb_sink: Protect queue with a mutexMerryMage2018-08-121-0/+6
| | |_|_|/ / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1035 from ogniK5377/audio-dev-revision-infobunnei2018-08-122-1/+13
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | GetAudioDeviceServiceWithRevisionInfo (Used by Bloodstained: Curse of the Moon)
| * | | | | | | | GetAudioDeviceServiceWithRevisionInfoDavid Marcec2018-08-122-1/+13
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | As we're not handling any anything about the revision data for GetAudioDeviceServiceWithRevisionInfo, it's currently marked as stubbed. However for games this shouldn't affect the result. Proper revision info would be more for homebrew.
* | | | | | | | Merge pull request #1028 from ogniK5377/aoabunnei2018-08-123-6/+42
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCount
| * | | | | | | | Pushed the requested sample rate instead of our fixed sample rateDavid Marcec2018-08-122-5/+3
| | | | | | | | |
| * | | | | | | | Added GetAudioRendererSampleRate, GetAudioRendererSampleCount & GetAudioRendererMixBufferCountDavid Marcec2018-08-123-6/+44
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | GetAudioRendererSampleRate is set as a "STUB" as a game could check if the sample rate it sent and the sample rate it wants don't match. Just a thought of something which could happen so keeping it as stub for the mean time
* | | | | | | | Merge pull request #1034 from lioncash/hidbunnei2018-08-121-5/+12
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | hid: Stub DisconnectNpad()
| * | | | | | | | hid: disable clang-format around tablesLioncash2018-08-121-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents clang-format from butchering them.
| * | | | | | | | hid: Stub DisconnectNpad()Lioncash2018-08-121-1/+7
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | This is required by ARMS.
* | | | | | | | Merge pull request #1030 from bunnei/sdl2-2.0.8bunnei2018-08-121-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | externals: Update to SDL2-2.0.8.
| * | | | | | | | externals: Update to SDL2-2.0.8.bunnei2018-08-121-1/+1
| |/ / / / / / /
* | | | | | | | Merge pull request #1006 from degasus/stream_bufferbunnei2018-08-126-303/+176
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | GL renderer: Pick the streambuffer from citra and use them.
| * | | | | | | gl_rasterizer: Use a shared helper to upload from CPU memory.Markus Wick2018-08-122-28/+33
| | | | | | | |
| * | | | | | | gl_state: Don't track constant buffer mappings.Markus Wick2018-08-123-41/+3
| | | | | | | |
| * | | | | | | gl_rasterizer: Use the stream buffer for constant buffers.Markus Wick2018-08-124-29/+32
| | | | | | | |
| * | | | | | | gl_rasterizer: Use the streaming buffer itself for the constant buffer.Markus Wick2018-08-122-33/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Don't emut copies, especially not for data, which is used once. They just end in a huge GPU overhead.
| * | | | | | | gl_rasterizer: Use a helper for aligning the buffer.Markus Wick2018-08-122-15/+22
| | | | | | | |
| * | | | | | | Update the stream_buffer helper from Citra.Markus Wick2018-08-124-184/+98
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Please see https://github.com/citra-emu/citra/pull/3666 for more details.
* | | | | | | Merge pull request #1029 from bunnei/fix-out-attribbunnei2018-08-121-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_decompiler: Fix SetOutputAttributeToRegister empty check.
| * | | | | | gl_shader_decompiler: Fix SetOutputAttributeToRegister empty check.bunnei2018-08-121-2/+2
|/ / / / / /
* | | | | | Merge pull request #922 from lioncash/cmakebunnei2018-08-121-6/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | CMakeLists: Change MSVC14 variable to MSVC_VERSION
| * | | | | | CMakeLists: lowercase find_library usageLioncash2018-08-121-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The rest of the CMake script uses lowercase for commands (which is the general CMake style), making it more consistent with surrounding code.
| * | | | | | CMakeLists: Change MSVC14 variable to MSVC_VERSIONLioncash2018-08-121-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Use of the MSVC14 variable is discouraged in the CMake documentation (which makes sense, since MSVC_VERSION is the more general appliable variable).
* | | | | | | Merge pull request #1026 from ogniK5377/retro-city-rampagebunnei2018-08-121-1/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Stub UpdateUserPresence
| * | | | | | | Stub UpdateUserPresenceDavid Marcec2018-08-121-1/+8
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | Needed for Retro City Rampage to go in game
* | | | | | | Merge pull request #1027 from bunnei/fix-kilbunnei2018-08-121-0/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_decompiler: Fix GLSL compiler error with KIL instruction.
| * | | | | | gl_shader_decompiler: Fix GLSL compiler error with KIL instruction.bunnei2018-08-121-0/+8
|/ / / / / /
* | | | | | Merge pull request #1022 from bunnei/fix-splatbunnei2018-08-122-2/+103
|\ \ \ \ \ \ | | | | | | | | | | | | | | Several Friend service fixes
| * | | | | | friend: Stub DeclareCloseOnlinePlaySession.bunnei2018-08-121-1/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Splatoon 2.
| * | | | | | friend: Fix CreateFriendService to return an IFriendService interface.bunnei2018-08-121-2/+86
| | | | | | |
| * | | | | | server_session: Provide more useful information and don't crash on bad IPC request.bunnei2018-08-121-0/+8
| | | | | | |
* | | | | | | Merge pull request #1020 from lioncash/namespacebunnei2018-08-1214-22/+44
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Namespace EmuWindow
| * | | | | | | core: Namespace EmuWindowLioncash2018-08-1214-22/+44
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Gets the class out of the global namespace.
* | | | | | | Merge pull request #1021 from lioncash/warnbunnei2018-08-121-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer: Silence implicit truncation warning in SetupShaders()
| * | | | | | | gl_rasterizer: Silence implicit truncation warning in SetupShaders()Lioncash2018-08-121-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously this would warn of truncating a std::size_t to a u32. This is safe because we'll obviously never have more than UINT32_MAX amount of uniform buffers.
* | | | | | | Merge pull request #1024 from Subv/blend_glbunnei2018-08-122-0/+40
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU/Maxwell3D: Implemented an alternative set of blend factors.
| * | | | | | | GPU/Maxwell3D: Implemented an alternative set of blend factors.Subv2018-08-122-0/+40
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | These are used by nouveau and some games like SMO.
* | | | | | | Merge pull request #1023 from Subv/invalid_attribsbunnei2018-08-122-1/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | RasterizerGL: Ignore invalid/unset vertex attributes.
| * | | | | | | RasterizerGL: Ignore invalid/unset vertex attributes.Subv2018-08-122-1/+11
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | This should make the es2gears example not crash anymore.
* / / / / / / Implement R8_UINT RenderTargetFormat & PixelFormat (#1014)greggameplayer2018-08-124-55/+74
|/ / / / / / | | | | | | | | | | | | | | | | | | - Used by Go Vacation
* | | | | | Merge pull request #1010 from bunnei/unk-vert-attrib-shaderbunnei2018-08-122-10/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Improve handling of unknown input/output attributes.
| * | | | | | gl_shader_decompiler: Improve handling of unknown input/output attributes.bunnei2018-08-122-10/+11
| | | | | | |
* | | | | | | Merge pull request #1009 from bunnei/rg8-rgba8-snormbunnei2018-08-124-64/+93
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement render target formats RGBA8_SNORM and RG8_SNORM.
| * | | | | | | gl_rasterizer: Implement render target format RG8_SNORM.bunnei2018-08-124-8/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
| * | | | | | | gl_rasterizer: Implement render target format RGBA8_SNORM.bunnei2018-08-124-64/+83
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | | Merge pull request #970 from DarkLordZach/loader-errorsbunnei2018-08-1217-179/+248
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | loader: Add more descriptive errors
| * | | | | | game_list: Reorder error checksZach Hilman2018-08-101-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | clang-format fix
| * | | | | | loader: Add more descriptive errorsZach Hilman2018-08-1017-179/+249
| | | | | | | | | | | | | | | | | | | | | Full list of new errors and descriptions in core/loader/loader.h
* | | | | | | Merge pull request #1018 from Subv/ssy_syncbunnei2018-08-122-8/+38
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | GPU/Shader: Implemented SSY and SYNC as a set_target/jump pair.
| * | | | | | GPU/Shader: Don't predicate instructions that don't have a predicate field (SSY).Subv2018-08-112-2/+13
| | | | | | |
| * | | | | | GPU/Shaders: Implemented SSY and SYNC as a way to modify control flow during shader execution.Subv2018-08-111-6/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | SSY sets the target label to jump to when the SYNC instruction is executed.
* | | | | | | Merge pull request #1016 from lioncash/videobunnei2018-08-118-35/+44
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Get rid of global variable g_toggle_framelimit_enabled
| * | | | | | | video_core; Get rid of global g_toggle_framelimit_enabled variableLioncash2018-08-118-30/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, we make a struct for renderer settings and allow the renderer to update all of these settings, getting rid of the need for global-scoped variables. This also uncovered a few indirect inclusions for certain headers, which this commit also fixes.
| * | | | | | | renderer_base: Remove unused kFramebuffer enumerationLioncash2018-08-111-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is entirely unused and can be removed.
| * | | | | | | video_core: Remove unused Renderer enumerationLioncash2018-08-111-2/+0
| | |_|_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Currently we only have an OpenGL renderer, so this is unused in code (and occupies the Renderer identifier in the VideoCore namespace).
* | | | | | | Merge pull request #1003 from lioncash/varbunnei2018-08-112-4/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | video_core: Use variable template variants of type_traits interfaces where applicable
| * | | | | | | video_core: Use variable template variants of type_traits interfaces where applicableLioncash2018-08-102-4/+2
| | | | | | | |
* | | | | | | | Implement R16S & R16UI & R16I RenderTargetFormats & PixelFormats and more (R16_UNORM needed by Fate Extella) (#848)greggameplayer2018-08-114-19/+92
| |_|/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement R16S & R16UI & R16I RenderTargetFormats & PixelFormats Do a separate function in order to get Bytes Per Pixel of DepthFormat Apply the new function in gpu.h delete unneeded white space * correct merging error
* | | | | | | Merge pull request #1015 from lioncash/gamelistJames Rowe2018-08-111-13/+12
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | qt/gamelist: Minor cleanup-related changes
| * | | | | | qt/game_list: Resolve truncation warning within GameListItemPath's constructorLioncash2018-08-111-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Silences a warning about truncating from size_t to u32
| * | | | | | gt/game_list: Use std::array in GameListItemPath's data() functionLioncash2018-08-111-7/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to use a heap-allocated std::vector here, given we explicitly know the bounds.
| * | | | | | qt/game_list: Remove redundant base class constructor from initializer listLioncash2018-08-111-3/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | This is called automatically anyways.
* | | | | | Merge pull request #1007 from MerryMage/dynarmicbunnei2018-08-101-0/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | dynarmic: Update to 0118ee0
| * | | | | | dynarmic: Update to 0118ee0MerryMage2018-08-101-0/+0
| | |/ / / / | |/| | | | | | | | | | | | | | | | 0118ee0 emit_x64_vector: packusdw is SSE4.1
* | | | | | Merge pull request #1011 from bunnei/misc-vtx-fmtbunnei2018-08-101-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implements VertexAttributes Size_32_32_32 and Size_8_8.
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-101-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_32_32_32.bunnei2018-08-101-0/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | Merge pull request #1004 from lioncash/unusedbunnei2018-08-103-8/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: Remove unused viewport parameter of GetFramebufferSurfaces()
| * | | | | | gl_rasterizer_cache: Remove unused viewport parameter of GetFramebufferSurfaces()Lioncash2018-08-103-8/+6
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1008 from yuzu-emu/revert-697-disable-depth-cullbunnei2018-08-101-3/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Revert "gl_state: Temporarily disable culling and depth test."
| * | | | | | Revert "gl_state: Temporarily disable culling and depth test."bunnei2018-08-101-3/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1002 from bunnei/refactor-tex-fmtbunnei2018-08-105-181/+31
|\ \ \ \ \ \ | |/ / / / / |/| | | | | textures: Refactor out for Texture/Depth FormatFromPixelFormat.
| * | | | | textures: Refactor out for Texture/Depth FormatFromPixelFormat.bunnei2018-08-105-181/+31
|/ / / / /
* | | | | Merge pull request #995 from bunnei/gl-buff-boundsbunnei2018-08-101-10/+12
|\ \ \ \ \ | |/ / / / |/| | | | gl_rasterizer_cache: Add bounds checking for gl_buffer copies.
| * | | | gl_rasterizer_cache: Add bounds checking for gl_buffer copies.bunnei2018-08-101-10/+12
| | | | |
* | | | | Merge pull request #997 from lioncash/const-funcbunnei2018-08-104-4/+4
|\ \ \ \ \ | | | | | | | | | | | | core: Make function reference parameters const where applicable
| * | | | | buffer_queue: Make reference parameter of SetPreallocatedBuffer constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is simply copied by value, so there's no need to make it a modifiable reference. While we're at it, make the names of the parameters match its definition.
| * | | | | hle_ipc: Make WriteToOutgoingCommandBuffer()'s reference parameter constLioncash2018-08-092-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't modify anything within the reference Thread instance.
* | | | | | Merge pull request #989 from lioncash/logbunnei2018-08-102-0/+16
|\ \ \ \ \ \ | | | | | | | | | | | | | | common/logging: Add missing service log categories
| * | | | | | common/logging: Add missing service log categoriesLioncash2018-08-082-0/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | These weren't added when the services were introduced.
* | | | | | | Merge pull request #990 from lioncash/entrybunnei2018-08-102-9/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | fsp_srv: Emplace entries first when building index instead of emplacing last
| * | | | | | | fsp_srv: Use std::string_view's copy() function instead of strncpy()Lioncash2018-08-092-8/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given elements inserted into a vector are zeroed out, we can just copy MAX_LEN - 1 elements and the data will already be properly null terminated.
| * | | | | | | fsp_srv: Emplace entries first when building index instead of emplacing lastLioncash2018-08-091-2/+3
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current way were doing it would require copying a 768 character buffer (part of the Entry struct) to the new element in the vector. Given it's a plain array, std::move won't eliminate that. Instead, we can emplace an instance directly into the destination buffer and then fill it out, avoiding the need to perform any unnecessary copies. Given this is done in a loop, we can request the destination to allocate all of the necessary memory ahead of time, avoiding the need to potentially keep reallocating over and over on every few insertions into the vector.
* | | | | | | Merge pull request #1001 from lioncash/reservebunnei2018-08-101-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Reserve element memory beforehand in BuildRegisterList()
| * | | | | | | gl_shader_decompiler: Reserve element memory beforehand in BuildRegisterList()Lioncash2018-08-091-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids potentially perfoming multiple reallocations when we know the total amount of memory we need beforehand.
* | | | | | | | Merge pull request #897 from DarkLordZach/vfs-accuracy-2bunnei2018-08-1021-129/+602
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | vfs: Add VfsFilesystem and fix RealVfs* implementations
| * | | | | | | vfs: Fix documentationZach Hilman2018-08-092-2/+4
| | | | | | | |
| * | | | | | | vfs: Fix typo in VfsFilesystem docsZach Hilman2018-08-092-4/+5
| | | | | | | |
| * | | | | | | file_util: Use enum instead of bool for specifing path behaviorZach Hilman2018-08-094-24/+37
| | | | | | | |
| * | | | | | | loader: Remove unused IdentifyFile overloadZach Hilman2018-08-092-12/+0
| | | | | | | |
| * | | | | | | vfs: Use RealVfsFilesystem for fs-operations in RealVfsDirectoryZach Hilman2018-08-091-2/+10
| | | | | | | |
| * | | | | | | file_sys: Add missing include in savedata_factoryZach Hilman2018-08-091-0/+1
| | | | | | | |
| * | | | | | | core: Port core to VfsFilesystem for file accessZach Hilman2018-08-0912-22/+52
| | | | | | | |
| * | | | | | | vfs: Add unreachable assert to file permissions converterZach Hilman2018-08-091-1/+3
| | | | | | | |
| * | | | | | | vfs: Add RealVfsFilesystem implementationZach Hilman2018-08-092-81/+290
| | | | | | | |
| * | | | | | | file_util: Add platform-specific slash option to SanitizePathZach Hilman2018-08-092-5/+16
| | | | | | | |
| * | | | | | | vfs: Add VfsFilesystem interface and default implementationZach Hilman2018-08-092-3/+211
| | | | | | | |
| * | | | | | | filesystem: Remove unnecessary if conditionsZach Hilman2018-08-091-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #991 from bunnei/ignore-macbunnei2018-08-101-4/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | maxwell_3d: Ignore macros that have not been uploaded yet.
| * | | | | | | | maxwell_3d: Ignore macros that have not been uploaded yet.bunnei2018-08-091-4/+9
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (in game).
* | | | | | | | Implement SNORM for BC5/DXN2 (#998)Khangaroo2018-08-102-38/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement BC5/DXN2 (#996) - Used by Kirby Star Allies. * Implement BC5/DXN2 SNORM UNORM for Kirby Star Allies SNORM for Super Mario Odyssey
* | | | | | | | Merge pull request #999 from lioncash/mapbunnei2018-08-101-2/+4
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | gl_rasterizer_cache: Avoid iterator invalidation issues within InvalidateRegion()
| * | | | | | | gl_rasterizer_cache: Avoid iterator invalidation issues within InvalidateRegion()Lioncash2018-08-091-2/+4
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | A range-based for loop can't be used when the container being iterated is also being erased from.
* | | | | | | Merge pull request #992 from bunnei/declr-predbunnei2018-08-091-4/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Declare predicates on use.
| * | | | | | | gl_shader_decompiler: Declare predicates on use.bunnei2018-08-091-4/+5
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (when going in game).
* | | | | | | Merge pull request #994 from lioncash/constbunnei2018-08-091-7/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer_cache: Use std::vector::assign vs resize() then copy for the non-tiled case
| * | | | | | | gl_rasterizer_cache: Invert conditional in LoadGLBuffer()Lioncash2018-08-091-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's generally easier to follow code using conditionals that operate in terms of the true case followed by the false case (no chance of overlooking the exclamation mark).
| * | | | | | | gl_rasterizer_cache: Use std::vector::assign in LoadGLBuffer() for the non-tiled caseLioncash2018-08-091-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | resize() causes the vector to expand and zero out the added members to the vector, however we can avoid this zeroing by using assign(). Given we have the pointer to the data we want to copy, we can calculate the end pointer and directly copy the range of data without the need to perform the resize() beforehand.
| * | | | | | | gl_rasterizer_cache: Make pointer const in LoadGLBuffer()Lioncash2018-08-091-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is only ever read from, so we can make the data it's pointing to const.
* | | | | | | Merge pull request #993 from bunnei/smo-vtx-ptsbunnei2018-08-091-0/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement VertexAttribute::Size::Size_16_16_16_16 and PrimitiveTopology::Points.
| * | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_16_16_16_16.bunnei2018-08-091-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (in game).
| * | | | | | | maxwell_to_gl: Implement PrimitiveTopology::Points.bunnei2018-08-091-0/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey (in game).
* | | | | | | Merge pull request #984 from bunnei/rt-nonebunnei2018-08-091-0/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer: Do not render when no render target is configured.
| * | | | | | | gl_rasterizer: Do not render when no render target is configured.bunnei2018-08-091-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | | | Implement BC5/DXN2 (#996)Khangaroo2018-08-093-33/+45
| | | | | | | | | | | | | | | | | | | | | | | | - Used by Kirby Star Allies.
* | | | | | | | Merge pull request #988 from lioncash/colorbunnei2018-08-091-19/+31
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | common/color: Minor cleanup
| * | | | | | | | common/color: Remove unnecessary const qualifiers on return typesLioncash2018-08-081-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are just superfluous and not necessesary
| * | | | | | | | common/color: Get rid of undefined behaviorLioncash2018-08-081-12/+24
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of type punning via reinterpret_cast within functions. Instead, we use memcpy to transfer the contents across types.
* | | | | | | | Merge pull request #977 from bunnei/bgr565bunnei2018-08-092-0/+4
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer_cached: Implement RenderTargetFormat::B5G6R5_UNORM.
| * | | | | | | | gl_rasterizer_cached: Implement RenderTargetFormat::B5G6R5_UNORM.bunnei2018-08-082-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | | | | Merge pull request #987 from lioncash/vecbunnei2018-08-091-3/+3
|\ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / |/| | | | | | | | vector_math: Use variable template version of is_signed in Vec classes
| * | | | | | | | vector_math: Use variable template version of is_signed in Vec classesLioncash2018-08-081-3/+3
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | Same behavior, less code
* | | | | | | | Merge pull request #982 from bunnei/stub-unk-63bunnei2018-08-092-0/+9
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_shader_decompiler: Stub input attribute Unknown_63.
| * | | | | | | | gl_shader_decompiler: Stub input attribute Unknown_63.bunnei2018-08-082-0/+9
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #986 from mailwl/acc-loadimagebunnei2018-08-091-1/+22
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Service/Account: stub LoadImage function
| * | | | | | | Service/Account: stub LoadImage functionmailwl2018-08-081-1/+22
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #976 from bunnei/shader-immbunnei2018-08-092-11/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Let OpenGL interpret floats.
| * | | | | | | gl_shader_decompiler: Let OpenGL interpret floats.bunnei2018-08-082-11/+6
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | - Accuracy is lost in translation to string, e.g. with NaN. - Needed for Super Mario Odyssey.
* | | | | | | Merge pull request #981 from bunnei/cbuf-corruptbunnei2018-08-094-3/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell_3d: Use correct const buffer size and check bounds.
| * | | | | | | maxwell_3d: Use correct const buffer size and check bounds.bunnei2018-08-084-3/+12
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | - Fixes mem corruption with Super Mario Odyssey and Pokkén Tournament DX.
* | | | | | | Merge pull request #978 from bunnei/fixioctlbunnei2018-08-091-1/+1
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.
| * | | | | | nvhost_gpu: Don't over copy IoctlSubmitGpfifo.bunnei2018-08-081-1/+1
| |/ / / / /
* | | | | | Merge pull request #985 from bunnei/rt-r11g11b10bunnei2018-08-091-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | gpu: Add R11G11B10_FLOAT to RenderTargetBytesPerPixel.
| * | | | | | gpu: Add R11G11B10_FLOAT to RenderTargetBytesPerPixel.bunnei2018-08-081-0/+1
| |/ / / / / | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | Merge pull request #979 from bunnei/vtx88bunnei2018-08-091-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.
| * | | | | | maxwell_to_gl: Implement VertexAttribute::Size::Size_8_8.bunnei2018-08-081-0/+1
| |/ / / / /
* | | | | | Merge pull request #975 from bunnei/am-stubbunnei2018-08-082-1/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | am: Stub SetScreenShotImageOrientation.
| * | | | | | am: Stub SetScreenShotImageOrientation.bunnei2018-08-082-1/+9
| |/ / / / / | | | | | | | | | | | | | | | | | | - Used by Super Mario Odyssey.
* | | | | | Merge pull request #980 from bunnei/fix-logsbunnei2018-08-082-2/+2
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | renderer_opengl: Use trace log in a few places.
| * | | | | renderer_opengl: Use trace log in a few places.bunnei2018-08-082-2/+2
| |/ / / /
* | | | | Merge pull request #966 from lioncash/modernizebunnei2018-08-085-11/+11
|\ \ \ \ \ | | | | | | | | | | | | common: Convert type traits templates over to variable template versions where applicable
| * | | | | common: Convert type traits templates over to variable template versions where applicableLioncash2018-08-085-11/+11
| | | | | | | | | | | | | | | | | | | | | | | | Uses the C++17 inline variable variants
* | | | | | Merge pull request #850 from DarkLordZach/icon-metabunnei2018-08-0825-21/+491
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add Icons and Metadata Support
| * | | | | | configure_gamelist: Use explicit QVariant constructorZach Hilman2018-08-071-2/+4
| | | | | | |
| * | | | | | loader: Add icon and title support to XCIZach Hilman2018-08-077-5/+46
| | | | | | |
| * | | | | | Fix missing qjpeg DLLZach Hilman2018-08-072-0/+7
| | | | | | |
| * | | | | | Use const where applicableZach Hilman2018-08-074-7/+7
| | | | | | |
| * | | | | | Avoid parsing RomFS to directory in NCAZach Hilman2018-08-0718-19/+439
| | | | | | |
* | | | | | | Merge pull request #968 from lioncash/vecbunnei2018-08-081-180/+182
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vector_math: Minor cleanups
| * | | | | | | vector_math: Remove unimplemented function prototypesLioncash2018-08-081-23/+0
| | | | | | | |
| * | | | | | | vector_math: Make functions constexpr where applicableLioncash2018-08-081-154/+179
| | | | | | | |
| * | | | | | | vector_math: Convert typedefs to type aliasesLioncash2018-08-081-3/+3
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #969 from lioncash/lz4bunnei2018-08-081-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals/CMakeLists: Add EXCLUDE_FROM_ALL to lz4's add_subdirectory() command
| * | | | | | | externals/CMakeLists: Add EXCLUDE_FROM_ALL to lz4's add_subdirectory() commandLioncash2018-08-081-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to build the lz4 CLI tool, or anything else. We just want to build in the library statically, so we specify this to ensure that. Now, we don't potentially build unnecessary targets.
* | | | | | | | Merge pull request #958 from lioncash/nv-globalbunnei2018-08-085-11/+22
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | nvdrv: Get rid of global std::weak_ptr
| * | | | | | | nvdrv: Get rid of global std::weak_ptrLioncash2018-08-085-11/+22
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Rather than use global state, we can simply pass the instance into the NVFlinger instance directly.
* | | | | | | Merge pull request #972 from lioncash/catchbunnei2018-08-085-4/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals: Update catch to 2.3.0
| * | | | | | | externals: Update catch to 2.3.0Lioncash2018-08-085-4/+4
| | |_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | Updates the library from 2.2.3 to 2.3.0
* | | | | | | Merge pull request #965 from lioncash/unused-filesbunnei2018-08-083-126/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hle: Remove unused romfs.cpp/.h
| * | | | | | | hle: Remove unused romfs.cpp/.hLioncash2018-08-083-126/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | These files are no longer used, so we can get rid of them.
* | | | | | | Merge pull request #974 from lioncash/accbunnei2018-08-082-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | acc: Add missing function table entries for GetUserCount
| * | | | | | | acc: Add missing function table entries for GetUserCountLioncash2018-08-082-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given this is stubbed within the common module in 5ac7b84, it should be added to the other relevant tables as well.
* | | | | | | | Merge pull request #983 from mailwl/hid-fixMat M2018-08-081-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | hid: fix IsSixAxisSensorAtRest() response
| * | | | | | | hid: fix IsSixAxisSensorAtRest() responsemailwl2018-08-081-1/+1
|/ / / / / / /
* | | | | | | acc: Stub GetUserCount. (#973)bunnei2018-08-083-1/+9
| | | | | | | | | | | | | | | | | | | | | - Used by Pokken Tournament DX.
* | | | | | | Merge pull request #967 from lioncash/signbunnei2018-08-081-4/+8
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | file_util: Avoid sign-conversions in WriteArray() and ReadArray()
| * | | | | | file_util: Avoid sign-conversions in WriteArray() and ReadArray()Lioncash2018-08-071-4/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents compiler warnings.
* | | | | | | Merge pull request #971 from DarkLordZach/mbedtls-2.12.0bunnei2018-08-081-0/+0
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | externals/mbedtls: Update to mbedtls v2.12.0
| * | | | | | externals/mbedtls: Update to mbedtls v2.12.0Zach Hilman2018-08-081-0/+0
|/ / / / / /
* | | | | | Merge pull request #964 from Hexagon12/lower-logsbunnei2018-08-081-4/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Lowered down the logging for command processor methods
| * | | | | | Lowered down the logging for methodsHexagon122018-08-071-4/+4
| | | | | | |
* | | | | | | Fixed the sRGB pixel format (#963)Hexagon122018-08-081-1/+2
| |_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Changed the sRGB pixel format return * Add a message about SRGBA -> RGBA conversion
* | | | | | Merge pull request #920 from DarkLordZach/titlekeybunnei2018-08-072-7/+39
|\ \ \ \ \ \ | | | | | | | | | | | | | | content_archive: Add support for titlekey cryptography
| * | | | | | content_archive: Add support for titlekey cryptographyZach Hilman2018-08-042-7/+39
| | | | | | |
* | | | | | | Merge pull request #957 from lioncash/eventbunnei2018-08-071-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nvflinger: Correct typo in name of composition event
| * | | | | | | nvflinger: Correct typo in name of composition eventLioncash2018-08-071-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #954 from lioncash/hidbunnei2018-08-071-0/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info array
| * | | | | | | services/hid: Add ActivateNpadWithRevision() to the hid function info arrayLioncash2018-08-071-0/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Updated based off the information on Switch Brew.
* | | | | | | Merge pull request #960 from lioncash/apmbunnei2018-08-073-0/+34
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/apm: Add the apm:sys service
| * | | | | | | service/apm: Add the apm:sys serviceLioncash2018-08-073-0/+34
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton of the apm:sys service based off the information on Switch Brew.
* | | | | | | Merge pull request #950 from lioncash/hotkeybunnei2018-08-078-119/+159
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | qt/hotkey: Get rid of global hotkey map instance
| * | | | | | | qt/hotkey: Get rid of global hotkey map instanceLioncash2018-08-078-119/+159
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead, we make a proper registry class and house it within the main window, then pass it to whatever needs access to the loaded hotkeys. This way, we avoid a global variable, and don't need to initialize a std::map instance before the program can do anything.
* | | | | | | Merge pull request #948 from hcorion/fix-mbedtls-installing-filesbunnei2018-08-072-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeLists: Make mbedtls and cubeb not install headers and libraries
| * | | | | | | Make mbedtls and cubeb not install headers and librariesZion Nimchuk2018-08-072-2/+2
| | | | | | | |
* | | | | | | | Merge pull request #955 from lioncash/viewbunnei2018-08-072-3/+10
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | nvflinger: Use std::string_view in OpenDisplay()
| * | | | | | | | nvflinger: Get rid of indirect inclusionsLioncash2018-08-072-1/+7
| | | | | | | | |
| * | | | | | | | nvflinger: Use std::string_view in OpenDisplay()Lioncash2018-08-072-2/+3
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to use a std::string here, given all that's done is comparing the character sequence against another. This allows passing regular const char* without needing to heap allocate.
* | | | | | | | Merge pull request #953 from lioncash/timebunnei2018-08-071-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()
| * | | | | | | | service/time: Amend command IDs of ToPosixTime() and ToPosixTimeWithMyRule()Lioncash2018-08-071-2/+2
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Updates the ID of these based off the information on Switch Brew.
* | | | | | | | Merge pull request #959 from KAMiKAZOW/cubeb-compilationbunnei2018-08-071-2/+2
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Make building cubeb optional
| * | | | | | | | Make building cubeb optionalKAMiKAZOW2018-08-071-2/+2
| |/ / / / / / /
* | | | | | | | Merge pull request #956 from lioncash/nvbunnei2018-08-0713-16/+18
|\ \ \ \ \ \ \ \ | |_|_|_|_|/ / / |/| | | | | | | nvdrv: Get rid of indirect inclusions
| * | | | | | | nvdrv: Make Ioctl()'s definition match its prototypeLioncash2018-08-071-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The only reason this wasn't a compilation error is because we use little-endian systems.
| * | | | | | | nvdrv: Get rid of indirect inclusionsLioncash2018-08-0712-15/+17
| |/ / / / / /
* | | | | | | Merge pull request #952 from lioncash/usbbunnei2018-08-076-0/+259
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service: Add usb services
| * | | | | | | service: Add usb servicesLioncash2018-08-076-0/+259
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Adds basic skeleton for the usb services based off the information provided by Switch Brew.
* | | | | | | Merge pull request #949 from lioncash/privbunnei2018-08-073-7/+21
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | client_port: Make all data members private
| * | | | | | | client_port: Make all data members privateLioncash2018-08-073-7/+21
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These members don't need to be entirely exposed, we can instead expose an API to operate on them without directly needing to mutate them We can also guard against overflow/API misuse this way as well, given active_sessions is an unsigned value.
* | | | | | | Merge pull request #951 from lioncash/gladbunnei2018-08-072-3190/+3218
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | externals: Update glad to 0.1.26
| * | | | | | | externals: Update glad to 0.1.26Lioncash2018-08-072-3190/+3218
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updates the library from 0.1.25. Mainly fixes issues related to macOS, but we may as well update the library.
* | | | | | | Merge pull request #961 from DarkLordZach/nca-as-drd-scopebunnei2018-08-071-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | loader: Fix scope error in DeconstructedRomDirectory
| * | | | | | loader: Fix scope error in DeconstructedRomDirectoryZach Hilman2018-08-071-1/+1
|/ / / / / /
* | | | | | Merge pull request #931 from DarkLordZach/nca-as-drdbunnei2018-08-074-37/+24
|\ \ \ \ \ \ | | | | | | | | | | | | | | loader: Make AppLoader_NCA rely on directory loading code
| * | | | | | loader: Make AppLoader_NCA rely on directory loading codeZach Hilman2018-08-064-37/+24
| | |_|_|/ / | |/| | | | | | | | | | Eliminates duplicate code shared between their Load methods, after all the only difference is how the romfs is handled.
* | | | | | Merge pull request #947 from lioncash/encodingbunnei2018-08-071-13/+17
|\ \ \ \ \ \ | | | | | | | | | | | | | | game_list: Use QString::fromStdString() where applicable instead of c_str()
| * | | | | | game_list: Remove unnecessary conversion to std::string in ValidateEntry()Lioncash2018-08-061-8/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just use the file interfaces that Qt provides to prevent needing to convert to std::string.
| * | | | | | game_list: Use QString::fromStdString() where applicable instead of c_str()Lioncash2018-08-061-5/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The codec used by Qt for const char* and std::string don't necessarily have to be the same depending on locale. Therefore, we should be using the correct functions to do the conversions.
* | | | | | | GDBStub works with both Unicorn and Dynarmic now (#941)Hedges2018-08-075-9/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GDBStub works with both Unicorn and Dynarmic now * Tidy up
* | | | | | | Merge pull request #943 from lioncash/declbunnei2018-08-071-7/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | game_list: Join declarations and assignments in onTextChanged()
| * | | | | | | game_list: Join declarations and assignments in onTextChanged()Lioncash2018-08-061-7/+7
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | There's no need to keep these separate from one another.
* | | | | | | Merge pull request #946 from lioncash/compressbunnei2018-08-071-10/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | qt/main: Collapse if statement in UpdateRecentFiles()
| * | | | | | | qt/main: Avoid sign conversions in UpdateRecentFiles()Lioncash2018-08-061-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This was intermixing signed and unsigned values when they could all just be signed.
| * | | | | | | qt/main: Collapse if statement in UpdateRecentFiles()Lioncash2018-08-061-6/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the function accepts a boolean, we don't need to use an if statement here and repeat ourselves.
* | | | | | | Merge pull request #944 from lioncash/menubunnei2018-08-071-2/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | qt: Don't show error dialog when canceling the Load Folder dialog
| * | | | | | | qt: Don't show error dialog when canceling the Load Folder dialogLioncash2018-08-061-2/+8
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, when canceling out of the Load Folder dialog, a user would get an error dialog about the selected folder not containing a main file, however, by canceling out of the dialog, no selection was actually made.
* | | | | | | Merge pull request #942 from lioncash/defaultbunnei2018-08-0714-24/+26
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | qt: Minor cleanup-related changes
| * | | | | | qt/game_list_p: Remove redundant base class constructor invocationsLioncash2018-08-061-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These occur automatically without the need to call them. While we're at it, also std::move the QString instance into its member variable.
| * | | | | | qt: Add missing override specifiers where applicableLioncash2018-08-065-7/+9
| | | | | | |
| * | | | | | qt: Default destructors where applicableLioncash2018-08-069-16/+15
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Makes code consistent with our style of defaulting special member functions where applicable.
* | | | | | Merge pull request #940 from lioncash/privatebunnei2018-08-072-5/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/event: Make data members private
| * | | | | | kernel/event: Make data members privateLioncash2018-08-062-5/+9
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Instead we can simply provide accessors to the required data instead of giving external read/write access to the variables directly.
* | | | | | Merge pull request #936 from bunnei/avoid-copiesbunnei2018-08-073-6/+21
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: Avoid superfluous surface copies.
| * | | | | | maxwell_3d: Remove outdated assert.bunnei2018-08-061-2/+0
| | | | | | |
| * | | | | | gl_rasterizer_cache: Avoid superfluous surface copies.bunnei2018-08-062-4/+21
| | | | | | |
* | | | | | | Merge pull request #934 from lioncash/chronobunnei2018-08-074-16/+16
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core_timing: Make GetGlobalTimeUs() return std::chrono::microseconds
| * | | | | | | perf_stats: Correct literal used for MAX_LAG_TIME_USLioncash2018-08-061-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ms is shorthand for milliseconds, not microseconds, and given there's no comment indicating that this was intentional, it probably wasn't.
| * | | | | | | core_timing: Make GetGlobalTimeUs() return std::chrono::microsecondsLioncash2018-08-064-14/+14
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | Enforces the time unit being returned and also allows using the standard time utilities to manipulate it.
* | | | | | | Merge pull request #945 from lioncash/existJames Rowe2018-08-061-8/+6
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | qt/main: Better file-existence checking within OnMenuRecentFile() and UpdateUITheme()
| * | | | | | qt/main: Better file-existence checking within OnMenuRecentFile() and UpdateUITheme()Lioncash2018-08-061-8/+6
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In OnMenuRecentFile() we don't need to construct a QFileInfo instance just to check if a file exists, we can just use the static member function to do that (which Qt's documentation also notes as quicker than constructing an instance). In UpdateUITheme(), we just want to try and open the file and check the success of that operation. Technically speaking, between the existence check and the open call, the file can be deleted or moved, but still appear to succeed in code. i.e. 1. Existence check -> Returns true 2. File is moved/deleted 3. Open is called, the return value of which isn't checked 4. Nonsense behavior This way we combine the existence check and the open into one.
* | | | | | Merge pull request #933 from lioncash/memorybunnei2018-08-061-12/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | memory: Correct prototype of ZeroBlock
| * | | | | | memory: Make prototype parameter names match their definitionsLioncash2018-08-061-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the code consistent.
| * | | | | | memory: Correct prototype of ZeroBlockLioncash2018-08-061-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the prototype wasn't matching the definition, which has a Processor parameter before the destination address.
| * | | | | | memory: Remove unnecessary const qualifiers in prototypesLioncash2018-08-061-9/+8
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | These aren't necessary, as value-wise const only matters in the definition.
* | | | | | Merge pull request #937 from mailwl/audout-fixMat M2018-08-061-2/+0
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Service/Audio: audout_a.cpp: remove pragma once
| * | | | | Service/Audio: audout_a.cpp: remove pragma oncemailwl2018-08-061-2/+0
|/ / / / /
* | | | | Merge pull request #932 from lioncash/funcbunnei2018-08-062-9/+9
|\ \ \ \ \ | | | | | | | | | | | | core_timing: Use transparent functors where applicable
| * | | | | core_timing: Convert typedef into a type aliasLioncash2018-08-061-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | Makes the alias a little more readable from left-to-right.
| * | | | | core_timing: Use transparent functors where applicableLioncash2018-08-061-5/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of the need to hardcode the type in multiple places. This will now be deduced automatically, based off the elements in the container being provided to the algorithm.
* | | | | Merge pull request #929 from lioncash/addrbunnei2018-08-062-83/+89
|\ \ \ \ \ | | | | | | | | | | | | gdbstub: Minor changes
| * | | | | gdbstub: Use type alias for breakpoint mapsLioncash2018-08-051-37/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Rather than having to type out the full std::map type signature, we can just use a straightforward alias. While we're at it, rename GetBreakpointList to GetBreakpointMap, which makes the name more accurate. We can also get rid of unnecessary u64 static_casts, since VAddr is an alias for a u64.
| * | | | | gdbstub: Move all file-static variables into the GDBStub namespaceLioncash2018-08-051-35/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps everything under the same namespace. While we're at it, enclose them all within an inner anonymous namespace.
| * | | | | gdbstub: Replace PAddr alias with VAddrLioncash2018-08-052-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | In all cases, a virtual address is being passed in, not a physical one.
* | | | | | Merge pull request #930 from lioncash/threadbunnei2018-08-061-15/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()
| * | | | | | address_arbiter: Return by value from GetThreadsWaitingOnAddress()Lioncash2018-08-051-15/+15
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | In all cases the vector being supplied is empty, so we can just return by value in these instances.
* | | | | | Merge pull request #925 from bunnei/audrenbunnei2018-08-0619-294/+652
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Implement audren audio output
| * | | | | audio_core: Implement audren_u audio playback.bunnei2018-08-055-218/+451
| | | | | |
| * | | | | audio_core: Use s16 where possible for audio samples.bunnei2018-08-059-36/+27
| | | | | |
| * | | | | audio_core: Port codec code from Citra for ADPCM decoding.bunnei2018-08-055-11/+126
| | | | | |
| * | | | | cubeb_sink: Support variable sample_rate and num_channels.bunnei2018-08-041-15/+25
| | | | | |
| * | | | | audio_core: Sinks need unique names as well.bunnei2018-08-045-9/+14
| | | | | |
| * | | | | audio_core: Streams need unique names for CoreTiming.bunnei2018-08-045-10/+14
| | |/ / / | |/| | |
* | | | | Merge pull request #927 from bunnei/fix-texsbunnei2018-08-051-2/+5
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Fix TEXS mask and dest.
| * | | | | gl_shader_decompiler: Fix TEXS mask and dest.bunnei2018-08-051-2/+5
| | | | | |
* | | | | | Merge pull request #912 from lioncash/global-varbunnei2018-08-0519-80/+110
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | video_core: Eliminate the g_renderer global variable
| * | | | | renderer_base: Make Rasterizer() return the rasterizer by referenceLioncash2018-08-045-11/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All calling code assumes that the rasterizer will be in a valid state, which is a totally fine assumption. The only way the rasterizer wouldn't be is if initialization is done incorrectly or fails, which is checked against in System::Init().
| * | | | | video_core: Eliminate the g_renderer global variableLioncash2018-08-0419-74/+100
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We move the initialization of the renderer to the core class, while keeping the creation of it and any other specifics in video_core. This way we can ensure that the renderer is initialized and doesn't give unfettered access to the renderer. This also makes dependencies on types more explicit. For example, the GPU class doesn't need to depend on the existence of a renderer, it only needs to care about whether or not it has a rasterizer, but since it was accessing the global variable, it was also making the renderer a part of its dependency chain. By adjusting the interface, we can get rid of this dependency.
* | | | | | Merge pull request #928 from MerryMage/dynarmicMat M2018-08-051-0/+0
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | externals: Update dynarmic to 4f96c63
| * | | | | externals: Update dynarmic to 4f96c63MerryMage2018-08-051-0/+0
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 4f96c63 emit_x64_vector_floating_point: Simplify FPVector{Min,Max} e15fdfe emit_x64_vector_floating_point: Simplify Get*Vector functions 734a00b emit_x64_floating_point: Remove EmitProcessNaNs fd45191 devirtualize: Replace DEVIRT macro with function template 67ba5d0 fuzz_with_unicorn: Remove FCVT_float from ignore list 66e6dd1 a32_emit_x64: std::move A32::UserConfig in the constructor b4890b6 emit_x64_floating_point: Use EmitPostProcessNaNs in EmitFPMulX 18b2943 emit_x64_floating_point: Remove unnecessary DenormalsAreZero from EmitFPSingleToDouble and EmitFPDoubleToSingle df1f81f emit_x64_floating_point: Simplify EmitFP{Min,Max}{,Numeric}{32,64} 21fb1c3 emit_x64_floating_point: Reduce NaN processing overhead f5c9f0f A64: Implement FMULX, scalar single/double variant 8f47773 IR: Implement FPMulX IR instruction 79e6440 fuzz_with_unicorn: Randomize SP 33c80e3 fuzz_with_unicorn: Randomize PC 8d41024 testenv: Make code_mem mobile a9fae0e emit_x64_vector: Vectorize 32-bit variants of paired min/max 8926a92 emit_x64_vector: Improve code emission of VectorGetElement* for index == 0 e20bd38 reg_alloc: Do a UseScratch if a Use destination is too small a19fa0e fuzz_with_unicorn: Randomize FPCR.AHP and FPCR.FZ16 775f368 emit_x64_floating_point: AVX implementation of ForceToDefaultNaN 71018a1 emit_x64_vector_floating_point: Prefer blendvp{s,d} to vblendvp{s,d} where possible 137f4b3 backend_x64: Remove all use of xmm0 e73d67a emit_x64_vector_floating_point: AVX implementation of ForceToDefaultNaN 43cca54 emit_x64_vector_floating_point: Reduce codesize of ForceToDefaultNaN 5dc40f4 emit_x64_vector_floating_point: Reduce codesize of EmitTwoOpVectorOperation 07622ee emit_x64_vector_floating_point: Correct FMA in FTZ mode 621c85b emit_x64_floating_point: DenormalsAreZero is redundant as hardware already does DAZ 3d0ebaa emit_x64_floating_point: FlushToZero is redundant as hardware already does FTZ f626ff8 backend_x64: Fix FPVectorMulAdd and FPMulAdd NaN handling with denormals adeb9d9 a32/fuzz_arm: Disable vfp tests 19ea70d fuzz_with_unicorn: Randomize FPCR.FZ 895db36 backend_x64: Fix bugs when FPCR.FZ=1 d7e2de2 fuzz_with_unicorn: Extract RandomFpcr function c858d6c fp/info: Deduplicate functions 5b88ec2 emit_x64_floating_point: Deduplicate EmitFPMulAdd implementation
* | | | | Merge pull request #926 from ogniK5377/vertex-attrib-formatbunnei2018-08-051-2/+8
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Fix glVertexAttribFormat for integers
| * | | | | added braces for conditionsDavid Marcec2018-08-051-2/+3
| | | | | |
| * | | | | fix the attrib format for intsDavid Marcec2018-08-051-2/+7
| | |/ / / | |/| | |
* | | | | Merge pull request #924 from lioncash/arpbunnei2018-08-056-0/+97
|\ \ \ \ \ | | | | | | | | | | | | service: Add arp services
| * | | | | service: Add arp servicesLioncash2018-08-056-0/+97
| |/ / / / | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton of the arp services based off the information provided by Switch Brew.
* | | | | Merge pull request #921 from lioncash/viewbunnei2018-08-055-35/+35
|\ \ \ \ \ | | | | | | | | | | | | core/crypto: Minor changes
| * | | | | aes_util: Add static assertion to Transcode() and XTSTranscode() to ensure well-defined behaviorLioncash2018-08-041-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | These functions should only be given trivially-copyable types.
| * | | | | aes_util: Make CalculateNintendoTweak() an internally linked functionLioncash2018-08-042-12/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't directly depend on class state, so it can be hidden entirely from the interface in the cpp file.
| * | | | | aes_util: Make Transcode() a const member functionLioncash2018-08-042-8/+9
| | | | | | | | | | | | | | | | | | | | | | | | This doesn't modify member state, so it can be made const.
| * | | | | core/crypto: Remove unnecessary includesLioncash2018-08-044-5/+5
| | | | | |
| * | | | | key_manager: Use regular std::string instead of std::string_viewLioncash2018-08-042-10/+7
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The benefit of std::string_view comes from the idea of avoiding copies (essentially acting as a non-owning view), however if we're just going to copy into a local variable immediately, there's not much benefit gained here.
* | | | | Merge pull request #923 from lioncash/pragmabunnei2018-08-055-10/+0
|\ \ \ \ \ | |/ / / / |/| | | | service: Remove redundant #pragma once directives
| * | | | service: Remove redundant #pragma once directivesLioncash2018-08-045-10/+0
|/ / / / | | | | | | | | | | | | | | | | These don't do anything within .cpp files (we don't include cpp files, so...)
* | | | Merge pull request #849 from DarkLordZach/xcibunnei2018-08-0439-80/+1404
|\ \ \ \ | | | | | | | | | | XCI and Encrypted NCA Support
| * | | | Add missing parameter to files.push_back()Zach Hilman2018-08-011-5/+5
| | | | |
| * | | | Fix merge conflicts with opus and update docsZach Hilman2018-08-015-11/+13
| | | | |
| * | | | Use more descriptive error codes and messagesZach Hilman2018-08-019-34/+101
| | | | |
| * | | | Use static const instead of const staticZach Hilman2018-08-011-2/+2
| | | | |
| * | | | Use ErrorEncrypted where applicable and fix no keys crashZach Hilman2018-08-014-17/+37
| | | | |
| * | | | Add missing includes and use const where applicableZach Hilman2018-08-0111-24/+40
| | | | |
| * | | | Allow key loading from %YUZU_DIR%/keys in addition to ~/.switchZach Hilman2018-08-015-7/+23
| | | | |
| * | | | Use SHGetKnownFolderPath instead of SHGetFolderPathAZach Hilman2018-08-011-3/+4
| | | | |
| * | | | Make XCI comply to review and style guidelinesZach Hilman2018-08-0116-482/+223
| | | | |
| * | | | Extract mbedtls to cpp fileZach Hilman2018-08-015-87/+127
| | | | |
| * | | | Add missing string.h includeZach Hilman2018-08-011-0/+1
| | | | |
| * | | | Update mbedtls and fix compile errorZach Hilman2018-08-012-0/+1
| | | | |
| * | | | Remove files that are not usedZach Hilman2018-08-0136-43/+1462
| | | | |
* | | | | Merge pull request #919 from lioncash/signbunnei2018-08-041-8/+9
|\ \ \ \ \ | |_|/ / / |/| | | | gl_shader_manager: Amend sign differences in an assertion comparison in SetShaderUniformBlockBinding()
| * | | | gl_shader_manager: Invert conditional in SetShaderUniformBlockBinding()Lioncash2018-08-041-7/+9
| | | | | | | | | | | | | | | | | | | | | | | | | This lets us indent the majority of the code and places the error case first.
| * | | | gl_shader_manager: Amend sign differences in an assertion comparison in SetShaderUniformBlockBinding()Lioncash2018-08-041-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ensures both operands have the same sign in the comparison. While we're at it, we can get rid of the redundant casting of ub_size to an int. This type will always be trivial and alias a built-in type (not doing so would break backwards compatibility at a standard level).
* | | | | Merge pull request #911 from lioncash/prototypebunnei2018-08-041-3/+0
|\ \ \ \ \ | | | | | | | | | | | | video_core: Remove unimplemented Start() function prototype
| * | | | | video_core: Remove unimplemented Start() function prototypeLioncash2018-08-031-3/+0
| | | | | | | | | | | | | | | | | | | | | | | | Given this has no definition, we can just remove it entirely.
* | | | | | Merge pull request #913 from lioncash/unused-funcbunnei2018-08-041-16/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | memory: Remove unused GetSpecialHandlers() function
| * | | | | | memory: Remove unused GetSpecialHandlers() functionLioncash2018-08-031-16/+0
| | |/ / / / | |/| | | | | | | | | | | | | | | | This is just unused code, so we may as well get rid of it.
* | | | | | Merge pull request #914 from lioncash/codesetbunnei2018-08-045-20/+41
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/process: Use accessors instead of class members for referencing segment array
| * | | | | | kernel/process: Use std::array where applicableLioncash2018-08-031-1/+2
| | | | | | |
| * | | | | | kernel/process: Use accessors instead of class members for referencing segment arrayLioncash2018-08-035-20/+40
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using member variables for referencing the segments array increases the size of the class in memory for little benefit. The same behavior can be achieved through the use of accessors that just return the relevant segment.
* | | | | | Merge pull request #917 from lioncash/crashbunnei2018-08-043-13/+38
|\ \ \ \ \ \ | | | | | | | | | | | | | | kernel/thread: Fix potential crashes introduced in 26de4bb5
| * | | | | | kernel/thread: Fix potential crashes introduced in 26de4bb521b1ace7af76eff4f6956cb23ac0d58cLioncash2018-08-043-13/+38
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This amends cases where crashes can occur that were missed due to the odd way the previous code was set up (using 3DS memory regions that don't exist).
* | | | | | Merge pull request #910 from lioncash/unusedbunnei2018-08-031-2/+0
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gl_shader_decompiler: Remove unused variable in GenerateDeclarations()
| * | | | | gl_shader_decompiler: Remove unused variable in GenerateDeclarations()Lioncash2018-08-031-2/+0
| |/ / / / | | | | | | | | | | | | | | | | | | | | This variable was being incremented, but we were never actually using it.
* | | | | Merge pull request #908 from lioncash/memorybunnei2018-08-0316-559/+29
|\ \ \ \ \ | | | | | | | | | | | | core/memory: Get rid of 3DS leftovers
| * | | | | core/memory: Get rid of 3DS leftoversLioncash2018-08-0316-559/+29
| | | | | | | | | | | | | | | | | | | | | | | | Removes leftover code from citra that isn't needed.
* | | | | | Merge pull request #909 from lioncash/constbunnei2018-08-031-1/+1
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | gl_shader_manager: Make ProgramManager's GetCurrentProgramStage() a const member function
| * | | | | gl_shader_manager: Make ProgramManager's GetCurrentProgramStage() a const member functionLioncash2018-08-031-1/+1
|/ / / / / | | | | | | | | | | | | | | | This function doesn't modify class state, so it can be made const.
* | | | | Added ability to change username & language code in the settings ui. Added IProfile::Get and SET::GetLanguageCode for libnx tests (#851)David2018-08-039-8/+95
| | | | |
* | | | | Merge pull request #895 from lioncash/sinkbunnei2018-08-031-5/+8
|\ \ \ \ \ | | | | | | | | | | | | sink_details: std::move std::function instances
| * | | | | sink_details: Deduplicate long std::function repetitionLioncash2018-08-021-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can just use type aliases to avoid needing to write the same long type twice
| * | | | | sink_details: std::move std::function instancesLioncash2018-08-021-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given std::function is allowed to potentially allocate, these should be std::move'd to prevent potential reallocation (should that ever happen).
* | | | | | Merge pull request #898 from lioncash/migbunnei2018-08-036-0/+55
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Add migration services
| * | | | | | service: Add migration servicesLioncash2018-08-026-0/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for the mig:usr service based off information provided by Switch Brew.
* | | | | | | Merge pull request #900 from lioncash/initbunnei2018-08-031-5/+5
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | math_util: Always initialize members of Rectangle
| * | | | | | math_util: Always initialize members of RectangleLioncash2018-08-021-5/+5
| |/ / / / / | | | | | | | | | | | | | | | | | | Prevents potentially using the members uninitialized.
* | | | | | Merge pull request #892 from lioncash/globalbunnei2018-08-0313-64/+54
|\ \ \ \ \ \ | | | | | | | | | | | | | | video_core: Make global EmuWindow instance part of the base renderer …
| * | | | | | video_core: Make global EmuWindow instance part of the base renderer classLioncash2018-08-0213-64/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the global a member of the RendererBase class. We also change this to be a reference. Passing any form of null pointer to these functions is incorrect entirely, especially given the code itself assumes that the pointer would always be in a valid state. This also makes it easier to follow the lifecycle of instances being used, as we explicitly interact the renderer with the rasterizer, rather than it just operating on a global pointer.
* | | | | | | Merge pull request #894 from lioncash/objectbunnei2018-08-0344-156/+186
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel: Move object class to its own source files
| * | | | | | | kernel: Move object class to its own source filesLioncash2018-08-0244-156/+186
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | General moving to keep kernel object types separate from the direct kernel code. Also essentially a preliminary cleanup before eliminating global kernel state in the kernel code.
* | | | | | | Merge pull request #904 from lioncash/staticbunnei2018-08-031-8/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/thread: Minor changes
| * | | | | | | kernel/thread: Make GetFreeThreadLocalSlot()'s loop indices size_tLioncash2018-08-021-8/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids using a u32 to compare against a range of size_t, which can be a source of warnings. While we're at it, compress a std::tie into a structured binding.
| * | | | | | | kernel/thread: Make GetFreeThreadLocalSlot() reference parameter a const referenceLioncash2018-08-021-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function only reads the data being referenced, it doesn't modify it, so we can turn the reference into a const reference.
| * | | | | | | kernel/thread: Make GetFreeThreadLocalSlot() internally linkedLioncash2018-08-021-1/+1
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | This function isn't used outside of this translation unit, so we can make it internally linked.
* | | | | | | Merge pull request #906 from lioncash/overridebunnei2018-08-033-19/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | input_common: minor changes
| * | | | | | | input_common: Use std::move where applicableLioncash2018-08-032-5/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary atomic reference count increments and decrements
| * | | | | | | input_common: Add missing override specifiersLioncash2018-08-033-14/+2
| |/ / / / / /
* | | | | | | Merge pull request #907 from lioncash/slotbunnei2018-08-037-46/+49
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu: Use Qt 5 signal/slots where applicable
| * | | | | | | yuzu: Use Qt 5 signal/slots where applicableLioncash2018-08-037-46/+49
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Makes the signal/slot connections type-safe instead of string-based.
* | | | | | | Merge pull request #905 from lioncash/vmabunnei2018-08-033-23/+23
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | kernel/vm_manager: Minor changes
| * | | | | | | kernel/vm_manager: Convert loop into std::any_of()Lioncash2018-08-021-4/+4
| | | | | | | |
| * | | | | | | kernel/vm_manager: Use const where applicableLioncash2018-08-023-19/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes our immutable state explicit.
| * | | | | | | kernel/vm_manager: Use the VAddr type alias in CarveVMA()Lioncash2018-08-021-2/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | These two variables correspond to address ranges.
* | | | | | | Merge pull request #903 from lioncash/copybunnei2018-08-031-3/+6
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | vfs_vector: Minor changes
| * | | | | | | vfs_vector: Remove unused variable in FindAndRemoveVectorElement()Lioncash2018-08-021-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This wasn't being used for anything, so it can be removed.
| * | | | | | | vfs_vector: Avoid unnecessary copies where applicableLioncash2018-08-021-2/+5
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | The lambda elements should be taken by const reference here, and we can move the virtual directory passed to ReplaceFileWithSubdirectory()
* | | | | | | Merge pull request #901 from lioncash/refbunnei2018-08-031-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_manager: Take ShaderSetup instances by const reference in UseProgrammableVertexShader() and UseProgrammableFragmentShader()
| * | | | | | | gl_shader_manager: Take ShaderSetup instances by const reference in UseProgrammableVertexShader() and UseProgrammableFragmentShader()Lioncash2018-08-021-2/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids performing unnecessary copies of 65560 byte sized ShaderSetup instances, considering it's only used as part of lookup and not modified. Given the parameters were already const, it's likely taking these parameters by reference was intended but the ampersand was forgotten.
* | | | | | | Merge pull request #899 from lioncash/unusedbunnei2018-08-027-334/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hw: Remove unused files
| * | | | | | | hw: Remove unused filesLioncash2018-08-027-334/+0
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | None of these files are used in any meaningful way. They're just leftovers from citra. Also has the benefit of getting rid of an unused global variable.
* | | | | | | Merge pull request #902 from lioncash/arraybunnei2018-08-021-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_state: Make texture_units a std::array
| * | | | | | | gl_state: Make texture_units a std::arrayLioncash2018-08-021-2/+3
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | Gets rid of the use of a raw C array.
* | | | | | | Merge pull request #891 from lioncash/nsbunnei2018-08-021-0/+447
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | service/ns: Add missing ns services
| * | | | | | | service/ns: Add missing ns servicesLioncash2018-08-021-0/+447
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implements the basic skeleton of ns:am2, ns:ec, ns:rid, ns:rt, ns:su, ns:vm, and ns:web based off the information provided by Switch Brew and SwIPC.
* | | | | | | Implement RGB32F PixelFormat (#886) (used by Go Vacation)greggameplayer2018-08-023-9/+23
| | | | | | |
* | | | | | | Merge pull request #893 from lioncash/pscbunnei2018-08-026-1/+99
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | service: Add the psc services
| * | | | | | logging/log: Remove incorrect description in PCV doc commentLioncash2018-08-021-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | PCV isn't the parental control service.
| * | | | | | service: Add psc servicesLioncash2018-08-026-0/+98
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for the psc services based off the information provided by Switch Brew.
* | | | | | Merge pull request #896 from lioncash/audio-outbunnei2018-08-022-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | audio_out: Use Buffer::Tag alias in GetTagsAndReleaseBuffers()'s prototype
| * | | | | audio_out: Use Buffer::Tag alias in GetTagsAndReleaseBuffers()'s prototypeLioncash2018-08-022-2/+2
|/ / / / / | | | | | | | | | | | | | | | | | | | | This makes the Buffer::Tag usage consistent with the Stream class's prototype of GetTagsAndReleaseBuffers().
* | | | | Merge pull request #888 from lioncash/capsbunnei2018-08-026-0/+173
|\ \ \ \ \ | | | | | | | | | | | | service: Add capture services
| * | | | | service: Add capture servicesLioncash2018-08-016-0/+173
| |/ / / / | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for the capture services based off information provided by Switch Brew.
* | | | | Merge pull request #890 from lioncash/loggerbunnei2018-08-021-4/+4
|\ \ \ \ \ | | | | | | | | | | | | lm: Amend name of ILogger
| * | | | | lm: Amend name of ILoggerLioncash2018-08-011-4/+4
| |/ / / / | | | | | | | | | | | | | | | | | | | | Previously this was being registered with the name "Logger". While we're at it, also change the name of the class to match it.
* | | | | Merge pull request #889 from lioncash/fspbunnei2018-08-026-0/+89
|\ \ \ \ \ | | | | | | | | | | | | service/filesystem: Add fsp:ldr and fsp:pr services
| * | | | | service/filesystem: Add fsp:ldr and fsp:pr servicesLioncash2018-08-016-0/+89
| |/ / / / | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for the remaining fsp services based off information provided by Switch Brew.
* | | | | Merge pull request #887 from lioncash/pcvbunnei2018-08-028-0/+183
|\ \ \ \ \ | |/ / / / |/| | | | service: Add bpc and pcv services
| * | | | service: Add bpc and pcv servicesLioncash2018-08-018-0/+183
|/ / / / | | | | | | | | | | | | | | | | Adds the basic skeleton for the remaining pcv-related services based off information on Switch Brew.
* | | | Merge pull request #885 from greggameplayer/R32-Floatbunnei2018-08-013-0/+5
|\ \ \ \ | | | | | | | | | | Implement R32_FLOAT RenderTargetFormat
| * | | | Implement R32_FLOAT RenderTargetFormatUnknown2018-08-013-0/+5
|/ / / /
* | | | Merge pull request #882 from lioncash/unusedbunnei2018-08-011-6/+0
|\ \ \ \ | |/ / / |/| | | kernel/thread: Remove unimplemented function prototype
| * | | kernel/thread: Remove unimplemented function prototypeLioncash2018-08-011-6/+0
| | | | | | | | | | | | | | | | | | | | Given there's no implementation, we may as well remove the code entirely.
* | | | Merge pull request #871 from bunnei/audio-configbunnei2018-08-0112-21/+330
|\ \ \ \ | |/ / / |/| | | audio_core: Add configuration settings.
| * | | audio_core: Add configuration settings.bunnei2018-08-0112-21/+330
| | | |
* | | | Merge pull request #877 from lioncash/removebunnei2018-08-016-104/+0
|\ \ \ \ | | | | | | | | | | kernel: Remove unused object_address_table.cpp/.h
| * | | | kernel: Remove unused object_address_table.cpp/.hLioncash2018-07-316-104/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These source files were entirely unused throughout the rest of the codebase. This also has the benefit of getting rid of a global variable as well.
* | | | | Merge pull request #880 from lioncash/audiobunnei2018-08-0114-2/+289
|\ \ \ \ \ | |_|/ / / |/| | | | service/audio: Add missing services
| * | | | service/audio: Add missing servicesLioncash2018-08-0114-2/+289
| | | | | | | | | | | | | | | | | | | | | | | | | Adds the missing audctl service, as well as the :a and :d services for audin, audout, audrec, and audren.
* | | | | Merge pull request #876 from lioncash/includebunnei2018-08-0123-28/+47
|\ \ \ \ \ | | | | | | | | | | | | kernel: Remove unnecessary includes
| * | | | | kernel: Remove unnecessary includesLioncash2018-07-3123-28/+47
| | |/ / / | |/| | | | | | | | | | | | | | | | | | Removes unnecessary direct dependencies in some headers and also gets rid of indirect dependencies that were being relied on to be included.
* | | | | Merge pull request #879 from lioncash/audiobunnei2018-08-011-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | audout_u: Remove std::move in OpenAudioOutImpl()
| * | | | audout_u: Remove std::move in OpenAudioOutImpl()Lioncash2018-07-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously the code was using the values from params further below after it was std::moved. Thankfully, given AudoutParams is a trivially copyable struct, the values would have simply been copied in this instance and not invalidated to garbage values.
* | | | | Merge pull request #864 from FearlessTobi/port-3973bunnei2018-07-311-2/+30
|\ \ \ \ \ | | | | | | | | | | | | Port #3973 from Citra: "Remove polymorphism issue"
| * | | | | remove polymorphism issueB3n302018-07-291-2/+30
| | | | | |
* | | | | | Merge pull request #869 from Subv/ubsanbunnei2018-07-314-8/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | Corrected a few error cases detected by asan/ubsan
| * | | | | | MacroInterpreter: Avoid left shifting negative values.Subv2018-07-312-2/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The branch target is signed, so multiply by 4 instead of left shifting by 2
| * | | | | | nvhost_gpu: Added checks to ensure we don't read past the end of the entries when handling a GPU command list.Subv2018-07-311-3/+6
| | | | | | |
| * | | | | | nvhost_ctrl_gpu: Only read the input parameters if they are actually there.Subv2018-07-311-3/+11
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | Passing nullptr to memcpy is undefined behavior.
* | | | | | Merge pull request #875 from lioncash/fgmbunnei2018-07-316-0/+96
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Add fgm services
| * | | | | | service: Add fgm servicesLioncash2018-07-316-0/+96
| | |_|_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for the fgm services based off the information provided by Switch Brew.
* | | | | | Merge pull request #874 from lioncash/ambunnei2018-07-318-0/+156
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | service/am: Add missing am services
| * | | | | service/am: Add missing am servicesLioncash2018-07-318-0/+156
| |/ / / / | | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for missing am services idle:sys, omm, and spsm based off the information provided by Switch Brew.
* | | | | Merge pull request #870 from lioncash/initbunnei2018-07-311-9/+7
|\ \ \ \ \ | | | | | | | | | | | | arm_dynarmic: Correct initializer list order
| * | | | | arm_dynarmic: Make SetTlsAddress() prototype and definition consistentLioncash2018-07-311-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Makes the definition use the same type aliases as in its prototype.
| * | | | | arm_dynarmic: Remove unnecessary qualifying of ThreadContextLioncash2018-07-311-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the ARM_Dynarmic class inherits from ARM_Interface, we don't need to qualify here.
| * | | | | arm_dynarmic: Correct initializer list orderLioncash2018-07-311-5/+3
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Amends the initializer list to be in the same order that each variable would be initialized in. We also do this to ensure we don't use a bogus uninitialized instance of the exclusive monitor within MakeJit() We can also remove the jit member from the initializer list as this is initialized by PageTableChanged()
* | | | | Merge pull request #872 from lioncash/pciebunnei2018-07-316-0/+85
|\ \ \ \ \ | |/ / / / |/| | | | service: Add the pcie service
| * | | | service: Add the pcie serviceLioncash2018-07-316-0/+85
|/ / / / | | | | | | | | | | | | | | | | Adds the basic skeleton of the pcie service based off information on Switch Brew.
* | | | Merge pull request #855 from bunnei/cubebbunnei2018-07-3121-39/+473
|\ \ \ \ | | | | | | | | | | Audio output backend based on cubeb
| * | | | audio_core: Implement Sink and SinkStream interfaces with cubeb.bunnei2018-07-3110-6/+269
| | | | |
| * | | | audio_core: Add interfaces for Sink and SinkStream.bunnei2018-07-316-0/+163
| | | | |
| * | | | audio_core: Misc. improvements to stream/buffer/audio_out.bunnei2018-07-315-20/+32
| | | | |
| * | | | audio_core: Move to audout_u impl.bunnei2018-07-314-13/+6
| | | | | | | | | | | | | | | | | | | | - This is necessary so streams are created on the same thread.
| * | | | externals: Add cubeb for audio output.bunnei2018-07-312-0/+3
| | | | |
* | | | | Port #3758 from Citra (#852): Add missing std::string import in text_formatterTobias2018-07-311-0/+1
|/ / / /
* | | | Implemented various hwopus functions (#853)David2018-07-316-6/+139
| | | |
* | | | Merge pull request #861 from FearlessTobi/port-3972bunnei2018-07-302-81/+31
|\ \ \ \ | | | | | | | | | | Port #3972 from Citra: "common/timer: use std::chrono, avoid platform-dependent code"
| * | | | Port #3972 from Citra: "common/timer: use std::chrono, avoid platform-dependent code"zhupengfei2018-07-292-81/+31
| | |/ / | |/| |
* | | | Merge pull request #862 from FearlessTobi/port-3997bunnei2018-07-301-3/+5
|\ \ \ \ | | | | | | | | | | Port #3997 from Citra: "common/string_utils: replace boost::transform with std counterpart"
| * | | | common/string_utils: replace boost::transform with std counterpartzhupengfei2018-07-291-3/+5
| |/ / / | | | | | | | | | | | | Note: according to cppreference it is necessary to convert char to unsigned char when using std::tolower and std::toupper, otherwise the behaviour would be undefined.
* | | | Merge pull request #867 from MerryMage/dynarmicMat M2018-07-301-0/+0
|\ \ \ \ | | | | | | | | | | externals: Update dynarmic to 73d3efc
| * | | | externals: Update dynarmic to 73d3efcMerryMage2018-07-301-0/+0
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 73d3efc emit_x64_floating_point: Deduplicate code c9508c3 fuzz_with_unicorn: Randomize FPCR.DN 2970833 emit_x64_vector_floating_point: Fix FPVector{Max,Min} when FPCR.DN = 1 150764f emit_x64_floating_point: Fix FP{Max,Min} when FPCR.DN = 1 b7d209c IR: SSE4.1 implementation of FPVectorRoundInt 8cf8270 A64: Implement FRINT{N,M,P,Z,A,X,I} (vector), single/double variant 8f46c26 IR: Initial implementation of FPVectorRoundInt 97017bb A64: Implement SQADD and SQSUB, scalar variant ce58863 IR: Generalise SignedSaturated{Add,Sub} to support more bitwidths e80f8ff a64_emit_x64: Bugfix EmitA64OrQC - Incorrect argument 1e4ec7e simd_three_same: Extract non-paired SMAX, SMIN, UMAX, UMIN code to a common function 6f9dc9b A64: Implement SMAXP, SMINP, UMAXP, UMINP 1dfb29f ir: Add opcodes for vector paired maximum and minimums 017b510 A64: Implement SMAXV, SMINV, UMAXV, and UMINV aae22ee ir: Add opcodes for performing scalar integral min/max 6ef3af3 A64: Implement PMULL{2} 2a4ce19 translate: Deduplicate GetDataSize() functions 0e01500 floating_point_{conditional}_compare: Deduplicate code 259237c common: Move all cryptographic function to common/crypto c5f1080 a32_emit_x64: BMI2 implementation of A32SetCpsr a23304a a32_emit_x64: Shorten EmitA32GetCpsr 57604d2 a32_emit_x64: Assert that memory layout assumption in EmitA32GetCpsr is valid 945fa48 A64: Implement PMUL 656a404 ir: Add opcode for performing polynomial multiplication 05143df A64: Implement FCVT{N,M,A,P}{U,S} (vector), FCVTZU (vector, integer), single/double variant 34ce767 A64: Implement FCVTZS (vector, integer), single/double variant 0f9bc2d IR: Implement FPVectorTo{Signed,Unsigned}Fixed 0189e44 fp/info: Replace constant value generators with FPValue db16568 emit_x64_vector_floating_point: AVX implementation of FPVector{Max,Min} 31148bd emit_x64_vector_floating_point: Remove unnecessary double jump in HandleNaNs 4c3ca51 A64: Implement FMAX's vector single and double precision variants bf0f21c A64: Implement FMIN's vector single and double precision variants 76f0ca0 IR: Implement FPVector{Max,Min} 6c37c31 FPRecipEstimate: Move offset out of function 59546f3 microinstruction: Update ReadsFromAndWritesToFPSRCumulativeExceptionBits 3f6b03a A64: Implement FRECPS, vector/scalar single/double variants 2d2ca5e IR: Implement FPRecipStepFused, FPVectorRecipStepFused 5cb9f1d A64: Implement FRECPE, vector single/double variant c5a14ab IR: Implement FPVectorRecipEstimate 56f8a0b A64: Implement FRECPE, scalar single/double variant fde69b4 IR: Implement FPRecipEstimate 186e52c IR: Implement FPRecipEstimate cf2e1ae fp: Change FPUnpacked to a normalized representation
* | | | Merge pull request #859 from FearlessTobi/port-3837bunnei2018-07-302-3/+4
|\ \ \ \ | | | | | | | | | | Port #3837 from Citra: "citra-qt: Add build date in about dialog"
| * | | | Port #3837 from Citra: "Add build date in about dialog"fearlessTobi2018-07-292-3/+4
| |/ / /
* | | | Port #3769 from Citra: "Update Dark theme to latest version"Tobias2018-07-303-321/+471
| | | |
* | | | Merge pull request #858 from lioncash/castbunnei2018-07-301-3/+2
|\ \ \ \ | | | | | | | | | | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()
| * | | | partition_filesystem: Remove dynamic_cast in PrintDebugInfo()Lioncash2018-07-291-3/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | We shouldn't be upcasting our file instances. Given a PartitionFilesystem is currently designed to accept any arbitrary VfsFile instances, casting to a more specific type than that is just bad design, and shows an interface design issue.
* | | | Merge pull request #860 from FearlessTobi/port-3911bunnei2018-07-305-6/+3
|\ \ \ \ | | | | | | | | | | Port #3911 from Citra: "citra-qt: optimize settings application"
| * | | | Port #3911 from Citra: "Optimize settings application"fearlessTobi2018-07-295-6/+3
| |/ / /
* | | | Merge pull request #863 from FearlessTobi/port-3913bunnei2018-07-301-1/+0
|\ \ \ \ | | | | | | | | | | Port #3913 from Citra: "citra_qt: Remove obsolete application attribute"
| * | | | Port #3913 from Citra: "citra_qt: Remove obsolete application attribute"fearlessTobi2018-07-291-1/+0
| |/ / /
* | | | Merge pull request #865 from FearlessTobi/port-3732bunnei2018-07-302-4/+2
|\ \ \ \ | | | | | | | | | | Port #3732 from Citra: "common: Fix compilation on ARM"
| * | | | Port #3732 from Citra: "common: Fix compilation on ARM"Cameron Cawley2018-07-292-4/+2
| |/ / /
* | | | Merge pull request #857 from lioncash/wlanbunnei2018-07-306-1/+194
|\ \ \ \ | | | | | | | | | | service: Add wlan services
| * | | | service: Add wlan servicesLioncash2018-07-296-1/+194
| |/ / / | | | | | | | | | | | | | | | | Adds the basic skeleton for the wlan services based off the information on Switch Brew.
* | | | Merge pull request #856 from lioncash/btmbunnei2018-07-306-0/+142
|\ \ \ \ | | | | | | | | | | service: Add btm services
| * | | | service/btm: Add basic implementation of GetCoreImpl()Lioncash2018-07-291-1/+35
| | | | | | | | | | | | | | | | | | | | Based off information on SwIPC and Switch Brew.
| * | | | service: Add btm servicesLioncash2018-07-296-0/+108
| |/ / / | | | | | | | | | | | | | | | | Adds the skeleton for the btm services based off the information on Switch Brew.
* / / / Add some HID commands (#843)Hexagon122018-07-301-2/+16
|/ / / | | | | | | | | | | | | | | | * Added some HID commands * Addressed comments
* | | Merge pull request #847 from lioncash/ncmbunnei2018-07-286-0/+80
|\ \ \ | | | | | | | | service: Add ncm services
| * | | service: Add ncm servicesLioncash2018-07-276-0/+80
| | | | | | | | | | | | | | | | | | | | Adds the basic skeleton for the ncm services based off information on Switch Brew.
* | | | Merge pull request #846 from lioncash/miibunnei2018-07-286-0/+128
|\ \ \ \ | | | | | | | | | | service: Add mii services
| * | | | service: Add mii servicesLioncash2018-07-276-0/+128
| | |_|/ | |/| | | | | | | | | | | | | | Adds the skeleton for the mii services based off information provided by Switch Brew
* | | | Merge pull request #842 from bunnei/audio-corebunnei2018-07-2812-94/+459
|\ \ \ \ | | | | | | | | | | Initial implementation of Audio Core
| * | | | audout: Implement IAudioOut interface with AudioCore.bunnei2018-07-282-93/+114
| | | | |
| * | | | core: Add AudioCore to global state.bunnei2018-07-282-0/+9
| | | | |
| * | | | audio_core: Add initial code for keeping track of audout state.bunnei2018-07-288-1/+336
| | |/ / | |/| |
* | | | Merge pull request #696 from DarkLordZach/romfsbunnei2018-07-2812-20/+351
|\ \ \ \ | |/ / / |/| | | RomFS Extraction
| * | | RomFS ExtractionZach Hilman2018-07-2812-20/+351
|/ / /
* | | Merge pull request #845 from lioncash/nfcbunnei2018-07-276-0/+243
|\ \ \ | | | | | | | | service: Add nfc services
| * | | service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| | | | | | | | | | | | | | | | These simply return the respective interface.
| * | | service: Add nfc servicesLioncash2018-07-276-0/+204
| |/ / | | | | | | | | | | | | Adds the skeleton of the nfc service based off the information provided on Switch Brew.
* | | Merge pull request #839 from FearlessTobi/actually-port-3594bunnei2018-07-271-0/+16
|\ \ \ | | | | | | | | Port #3594 from Citra: "citra_qt: Add Continue/Pause & Toggle Speed Limit hotkeys"
| * | | Port #3594 from CitrafearlessTobi2018-07-261-0/+16
| | |/ | |/|
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-276-0/+111
|\ \ \ | | | | | | | | service: Add the lbl service
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-273-3/+37
| | | | | | | | | | | | | | | | | | | | Implements these functions according to the information available on Switch Brew.
| * | | service: Add the lbl serviceLioncash2018-07-274-0/+77
| | |/ | |/| | | | | | | | | | Adds the skeleton of the lbl service based off the information provided by Switch Brew.
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-274-1/+93
|\ \ \ | |/ / |/| | service: Add the btdrv service
| * | service: Add the btdrv serviceLioncash2018-07-274-1/+93
| | | | | | | | | | | | Adds the skeleton for the btdrv service based off the information provided by Switch Brew
* | | Merge pull request #837 from lioncash/privbunnei2018-07-272-8/+20
|\ \ \ | | | | | | | | kernel/timer: Make data members private where applicable
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-262-8/+20
| | | | | | | | | | | | | | | | | | | | Instead, we can just expose functions that return the queryable state instead of letting anything modify it.
* | | | Merge pull request #833 from lioncash/irsbunnei2018-07-276-0/+352
|\ \ \ \ | |_|/ / |/| | | service/hid: Add missing services
| * | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
| | | |
| * | | service/hid: Add the xcd:sys serviceLioncash2018-07-264-0/+57
| | | |
| * | | service/hid: Add irs servicesLioncash2018-07-264-0/+75
|/ / /
* | | Merge pull request #836 from FearlessTobi/port-3594bunnei2018-07-262-0/+4
|\ \ \ | | | | | | | | Port #3665 from Citra: "frontend: Log Citra version"
| * | | Port #3665 from CitrafearlessTobi2018-07-262-0/+4
| | |/ | |/|
* | | Merge pull request #835 from FearlessTobi/port-minor-prsbunnei2018-07-262-2/+2
|\ \ \ | | | | | | | | Port #3641 and #3702 from Citra (Small changes to default_ini and gitignore)
| * | | Port #3702 from CitrafearlessTobi2018-07-261-1/+1
| | | |
| * | | Port #3641 from CitrafearlessTobi2018-07-261-1/+1
| |/ /
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-264-0/+50
|\ \ \ | | | | | | | | service: Add the grc:c service
| * | | service: Add the grc:c serviceLioncash2018-07-264-0/+50
| | |/ | |/| | | | | | | | | | Adds the basic skeleton for the grc:c service based off the information provided by Switch Brew.
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-264-0/+143
|\ \ \ | | | | | | | | service: Add the nim services
| * | | service: Add the nim servicesLioncash2018-07-264-0/+143
| |/ / | | | | | | | | | | | | Adds the skeleton for the nim services based off information from Switch Brew.
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-266-0/+164
|\ \ \ | | | | | | | | service: Add ldn services
| * | | service: Add ldn servicesLioncash2018-07-266-0/+164
| |/ / | | | | | | | | | Adds ldn services based off information provided by Switch Brew.
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-266-0/+95
|\ \ \ | | | | | | | | service/sockets: Add missing socket services
| * | | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-264-0/+66
| | | |
| * | | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/ /
* | | Merge pull request #808 from lioncash/mem-dedupbunnei2018-07-261-14/+22
|\ \ \ | | | | | | | | video_core/memory_manager: Avoid repeated unnecessary page slot lookups
| * | | video_core/memory_manager: Replace a loop with std::array's fill() function in PageSlot()Lioncash2018-07-241-3/+1
| | | | | | | | | | | | | | | | | | | | We already have a function that does what this code was doing, so let's use that instead.
| * | | video_core/memory_manager: Avoid repeated unnecessary page slot lookupsLioncash2018-07-241-11/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to keep calling the same function over and over again in a loop, especially when the behavior is slightly non-trivial. We can just keep a reference to the looked up location and do all the checking and assignments based off it instead.
* | | | Merge pull request #829 from Subv/r16f_rtbunnei2018-07-262-1/+4
|\ \ \ \ | |_|_|/ |/| | | GPU: Allow using R16F as a render target format.
| * | | GPU: Allow using R16F as a render target format.Subv2018-07-262-1/+4
|/ / /
* | | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ \ | | | | | | | | service/lm: Minor changes
| * | | lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| | | | | | | | | | | | | | | | | | | | This isn't used directly outside of this translation unit, so we can hide it from external use.
| * | | lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| | | | | | | | | | | | | | | | Amends these to match the information on Switch Brew.
| * | | lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
| | | |
* | | | Merge pull request #825 from greggameplayer/R16_G16bunnei2018-07-264-19/+100
|\ \ \ \ | |_|_|/ |/| | | Implement R16_G16
| * | | Implement R16_G16Unknown2018-07-264-19/+100
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | correct trailing white spaces Delete tabs correct placement Add RG16F & RG16UI & RG16I & RG16S PixelFormats Return correct data according to changes done previously correct PixelFormat declaration correct coding style error correct coding style error part 2 correct RG16S Declaration error correct alignment
* | | | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-264-0/+101
|\ \ \ \ | | | | | | | | | | service: Add ldr services
| * | | | service: Add ldr servicesLioncash2018-07-264-0/+101
| | | | | | | | | | | | | | | | | | | | | | | | | Adds the skeleton for the ldr-related services based off the information provided on Switch Brew.
* | | | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-266-0/+143
|\ \ \ \ \ | | | | | | | | | | | | service: Add erpt and eupld services
| * | | | | service: Add eupld servicesLioncash2018-07-264-0/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the skeleton for the eupld services based off information on Switch Brew.
| * | | | | service: Add the erpt servicesLioncash2018-07-264-0/+71
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | Adds the basic skeleton of the erpt service based off information on Switch Brew.
* | | | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-269-141/+30
|\ \ \ \ \ | |_|/ / / |/| | | | service/nifm: Deduplicate interface code
| * | | | service/nifm: Deduplicate interface codeLioncash2018-07-259-141/+30
| | | | | | | | | | | | | | | | | | | | | | | | | Rather than having the same code for each nifm service variant, we can centralize it on one class and get rid of a bit of extra code.
* | | | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \ \ \ | | | | | | | | | | | | service/nvdrv: Minor changes
| * | | | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids copies from being made, since the string is only ever used for lookup, the data is never transfered anywhere. Ideally, we'd use a std::string_view here, but devices is a std::unordered_map, not a std::map, so we can't use heterogenous lookup here.
| * | | | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary reference count increments and decrements. In one case, we don't need to make a shared_ptr copy at all, just to call a member function.
* | | | | Merge pull request #822 from lioncash/pmbunnei2018-07-264-0/+90
|\ \ \ \ \ | |_|/ / / |/| | | | service: Add pm services
| * | | | service: Add pm servicesLioncash2018-07-254-0/+90
| |/ / / | | | | | | | | | | | | | | | | Adds the skeleton for the process management services based off information on Switch Brew.
* | | | Merge pull request #820 from lioncash/esMat M2018-07-264-0/+77
|\ \ \ \ | | | | | | | | | | service: Add the es service
| * | | | service: Add the es serviceLioncash2018-07-254-0/+77
| |/ / / | | | | | | | | | | | | | | | | Adds the skeleton for the ETicket service based off the information on Switch Brew
* | | | Merge pull request #821 from lioncash/waitMat M2018-07-261-0/+4
|\ \ \ \ | |_|/ / |/| | | wait_tree: Add missing switch case for WaitTreeThread::GetText()
| * | | wait_tree: Add missing switch case for WaitTreeThread::GetText()Lioncash2018-07-251-0/+4
| |/ / | | | | | | | | | We were missing the enum entry for WaitIPC
* | | Merge pull request #819 from Subv/srgbbunnei2018-07-252-9/+17
|\ \ \ | |/ / |/| | GPU: Use the right texture format for sRGBA framebuffers.
| * | GPU: Use the right texture format for sRGBA framebuffers.Subv2018-07-252-9/+17
| | |
* | | Merge pull request #801 from lioncash/timeMat M2018-07-256-64/+16
|\ \ \ | | | | | | | | time: Add the time:a service
| * | | time: Add the time:a serviceLioncash2018-07-253-10/+11
| | | | | | | | | | | | | | | | Given we already have time:s and time:u, we should also have time:a
| * | | time: Simplify interface creationLioncash2018-07-246-64/+15
| | | | | | | | | | | | | | | | We can use one instance of the interface instead of duplicating code.
* | | | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \ \ \ | | | | | | | | | | svc: Log parameters in SetMemoryAttribute()
| * | | | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
| | |_|/ | |/| | | | | | | | | | Provides slightly more context than only logging out the address value.
* | | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-2512-114/+146
|\ \ \ \ | | | | | | | | | | core_timing: Split off utility functions into core_timing_util
| * | | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-2412-105/+137
| | | | |
| * | | | CMakeLists: Sort filenamesMerryMage2018-07-241-9/+9
| | | | |
* | | | | Merge pull request #802 from lioncash/unreachbunnei2018-07-251-0/+3
|\ \ \ \ \ | | | | | | | | | | | | wait_tree: Silence warning about all code paths not returning a value
| * | | | | wait_tree: Silence warning about all code paths not returning a valueLioncash2018-07-241-0/+3
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | If code execution hits this spot, something has gone very wrong, so mark the path as unreachable. This silences a warning on MSVC.
* | | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \ \ | | | | | | | | | | | | set_sys: Implement SetColorSetId()
| * | | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| | | | | |
| * | | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| |/ / / /
* | | | | Merge pull request #813 from Subv/z24_s8_texbunnei2018-07-251-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | GPU: Allow the use of Z24S8 as a texture format.
| * | | | GPU: Allow the use of Z24S8 as a texture format.Subv2018-07-251-0/+4
|/ / / /
* | | | Merge pull request #816 from Subv/z32_s8bunnei2018-07-254-1/+16
|\ \ \ \ | | | | | | | | | | GPU: Implemented the Z32_S8_X24 depth buffer format.
| * | | | GPU: Implemented the Z32_S8_X24 depth buffer format.Subv2018-07-254-1/+16
| | | | |
* | | | | Merge pull request #815 from Subv/z32f_texbunnei2018-07-251-0/+4
|\ \ \ \ \ | | | | | | | | | | | | GPU: Allow using Z32 as a texture format.
| * | | | | GPU: Allow using Z32 as a texture format.Subv2018-07-251-0/+4
| |/ / / /
* | | | | Merge pull request #814 from Subv/rt_r8bunnei2018-07-252-0/+4
|\ \ \ \ \ | | | | | | | | | | | | GPU: Allow the usage of R8 as a render target format.
| * | | | | GPU: Allow the usage of R8 as a render target format.Subv2018-07-252-0/+4
| |/ / / /
* | | | | Merge pull request #818 from MerryMage/dynarmicbunnei2018-07-251-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update dynarmic to 98e2380
| * | | | | externals: Update dynarmic to 98e2380MerryMage2018-07-251-0/+0
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 98e2380 fuzz_with_unicorn: Disable testing of FDIV 041b7d5 block_of_code: Add ABI_PARAMS array 2a2371c A64: Implement MLA, MLS (by element), vector single/double variant 78c640a A64: Implement FMLS (vector), single/double variant b6b6993 emit_x64_vector_floating_point: Specify NanHandler::function_type explicitly 4b9d12a emit_x64_vector_floating_point: ChooseOnFsize arguments maybe_unused b1e3616 IR: Implement FPVectorNeg 4343612 A64: Implement FMLA (vector), single/double variant 93eeb25 IR: Implement FPVectorMulAdd 57e5c7e emit_x64_vector_floating_point: Standardize naming scheme bcb9e41 emit_x64_floating_point: Simplify indexers 83aa585 emit_x64_vector_floating_point: Simplify EmitVectorOperation* f4087c8 mp: rename mp.h to mp/function_info.h 1864090 emit_x64_vector: Slightly improve ArithmeticShiftRightByte e048441 emit_x64_vector: Simplify VectorShuffleImpl ff025e8 IR: Implement A64OrQC 6fac68d A64: Implement UQSHRN, UQRSHRN (vector) 5a8d9c3 emit_x64_vector: -0x80000000 isn't -0x80000000 759289e A64: Implement UQXTN (vector) 2a96281 emit_x64_vector: Fix non-SSE4.1 saturated narrowing reconstruction comparison 0682353 A64: Implement SQXTN (vector) 6c5229e emit_x64_vector: packusdw reqiures SSE4.1 158d9b1 A64: Implement SQSHRUN, SQRSHRUN (vector) f886013 simd_shift_by_immediate: Simplify ShiftRight d9b59c6 A64: Implement SQXTUN 50fe28b microinstruction: Reorganize FPSCR related instruction queries d9d036a microinstruction: Add missing FP scalar opcodes to ReadsFromFPSCR() and WritesToFPSCR() db96163 u128: Make Bit() a const-qualified member function f7052ae A64: Implement FRSQRTS (vector), single/double variant 0925ef6 A64: Implement FRSQRTE (vector), single/double variant f4cbbe3 A64: Implement FRSQRTS (scalar), single/double variant 4ef864e IR: Implement FPRSqrtStepFused 9dffeeb fp: Implement FPRSqrtStepFused aa04556 fp: Implement FPNeg cbde1c5 process_nan: Add two operand variant 1ec2663 A64: Implement FMAXP, FMINP, FMAXNMP and FMINNMP's scalar double/single-precision variant 027ddf9 emit_x64_floating_point: Fixup special NaN case in FMA FPMulAdd implementation 75a9f77 fp: Use a forward declaration in fused.h 1ee1630 u128: Implement comparison operators in terms of one another 3b77f48 tests: Print cpu info bed3cc0 u128: StickyLogicalShiftRight requires special-casing for amount == 64 15d04f4 A64: Implement FMLA and FMLS (by element)'s double/single-precision scalar variant 7cfccdf A64: Implement FMUL (by element)'s scalar double/single-precision variant 7d2d62e (fpmuladd) emit_x64_floating_point: Implement accurate fallback for FPMulAdd{32,64} a599eac fp: Implement FPMulAdd d70b90e process_nan: Add FPProcessNaNs3 38ef0e0 block_of_code: Add SysV ABI fifth and sixth parameters 8e2ff56 u128: Add StickyLogicalShiftRight 3b337df u128: Add Multiply64To128 8219075 u128: Add u128::Bit a574dcb u128: Add comparison operators 391d6d4 unpacked: Use ResidualErrorOnRightShift in FPRoundBase 5e0cf9c fp: Remove MantissaT 8c0a84c FPRSqrtEstimate: Improve documentation of RecipSqrtEstimate c41d855 FPRSqrtEstimate: Deduplicate array bounds 4cf055b A64: Implement FMAXV, FMINV, FMAXNMV, and FMINNMV bf24f0f FPRSqrtEstimate: Use forward declarations where applicable 206230e translate: Return by bool in helpers where applicable 346b725 Simplify fallback case for EmitVectorSetElement64() 2c34e1d emit_x64_floating_point: s/Esimate/Estimate/ 5213fb6 simd_scalar_two_register_misc: Implement FRSQRTE, scalar variant 7ed089f IR: Implement FPRSqrtEstimate cd2e286 simd_vector_x_indexed_element: Implement FMUL (by element), vector variant
* | | | | Merge pull request #809 from lioncash/rasterizerbunnei2018-07-252-16/+13
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Minor cleanup
| * | | | | gl_rasterizer: Replace magic number with GL_INVALID_INDEX in SetupConstBuffers()Lioncash2018-07-241-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just the named constant that OpenGL provides, so we can use that instead of using a literal -1
| * | | | | gl_rasterizer: Use std::string_view instead of std::string when checking for extensionsLioncash2018-07-241-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can avoid heap allocations here by just using a std::string_view instead of performing unnecessary copying of the string data.
| * | | | | gl_rasterizer: Use in-class member initializers where applicableLioncash2018-07-242-12/+5
| | |_|_|/ | |/| | | | | | | | | | | | | We can just assign to the members directly in these cases.
* | | | | Merge pull request #811 from Subv/code_address_assertbunnei2018-07-251-8/+0
|\ \ \ \ \ | |_|/ / / |/| | | | GPU: Remove the assert that required the CODE_ADDRESS to be 0.
| * | | | GPU: Remove the assert that required the CODE_ADDRESS to be 0.Subv2018-07-241-8/+0
| |/ / / | | | | | | | | | | | | Games usually just leave it at 0 but nouveau sets it to something else. This already works fine, the assert is useless.
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-256-48/+15
|\ \ \ \ | | | | | | | | | | friend: Deduplicate interfaces
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Given we already have friend:a and friend:u, we should add the remaining services as well.
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| | | | |
| * | | | friend: Deduplicate interfacesLioncash2018-07-246-48/+11
| |/ / /
* | | | Merge pull request #810 from Subv/r16bunnei2018-07-253-5/+32
|\ \ \ \ | | | | | | | | | | GPU: Implemented the R16 and R16F texture formats.
| * | | | GPU: Implemented the R16 and R16F texture formats.Subv2018-07-243-5/+32
| |/ / /
* | | | Merge pull request #805 from lioncash/signbunnei2018-07-241-4/+7
|\ \ \ \ | | | | | | | | | | svc: Resolve sign comparison warnings in WaitSynchronization()
| * | | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
| |/ / / | | | | | | | | | | | | | | | | The loop's induction variable was signed, but we were comparing against an unsigned variable.
* | | | Merge pull request #807 from lioncash/unusedbunnei2018-07-241-29/+0
|\ \ \ \ | |/ / / |/| | | deconstructed_rom_directory: Remove unused FindRomFS() function
| * | | deconstructed_rom_directory: Remove unused FindRomFS() functionLioncash2018-07-241-29/+0
|/ / /
* | | Merge pull request #798 from lioncash/constbunnei2018-07-242-3/+3
|\ \ \ | | | | | | | | arm_dynarmic: Make MakeJit() a const member function
| * | | arm_dynarmic: Make MakeJit() a const member functionLioncash2018-07-242-3/+3
| |/ / | | | | | | | | | | | | This functions doesn't modify instance state, so it can be a made a const member function.
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-245-5/+5
|\ \ \ | | | | | | | | core: Make converting constructors explicit where applicable
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-245-5/+5
| |/ / | | | | | | | | | | | | Avoids unwanted implicit conversions. Thankfully, given the large amount of cleanup in past PRs, only this tiny amount is left over to cover.
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \ | | | | | | | | apm/interface: Remove redundant declaration of InstallInterfaces()
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ / | | | | | | | | | This is already declared in apm/apm.h
* | | Merge pull request #799 from Subv/tex_r32fbunnei2018-07-243-6/+19
|\ \ \ | | | | | | | | GPU: Implement texture format R32F.
| * | | GPU: Implement texture format R32F.Subv2018-07-243-6/+19
| | | |
* | | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ \ | | | | | | | | | | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by reference
| * | | | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | The pointed to thread's members are simply observed in this case, so we don't need to copy it here.
* | | | | Merge pull request #796 from bunnei/gl-uintbunnei2018-07-241-0/+3
|\ \ \ \ \ | | | | | | | | | | | | maxwell_to_gl: Implement VertexAttribute::Type::UnsignedInt.
| * | | | | maxwell_to_gl: Implement VertexAttribute::Type::UnsignedInt.bunnei2018-07-241-0/+3
| | | | | |
* | | | | | Merge pull request #789 from bunnei/tex-wrap-borderbunnei2018-07-244-11/+13
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | maxwell_to_gl: Implement Texture::WrapMode::Border.
| * | | | | gl_rasterizer: Implement texture border color.bunnei2018-07-243-11/+11
| | | | | |
| * | | | | maxwell_to_gl: Implement Texture::WrapMode::Border.bunnei2018-07-241-0/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \ \ \ | | | | | | | | | | | | ipc_helpers: Make member variables of ResponseBuilder private
| * | | | | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| | | | | |
| * | | | | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| | |_|/ / | |/| | | | | | | | | | | | | These aren't used externally at all, so they can be made private.
* | | | | Merge pull request #785 from lioncash/fsbunnei2018-07-241-3/+3
|\ \ \ \ \ | |_|/ / / |/| | | | partition_filesystem: Use std::move where applicable
| * | | | partition_filesystem: Use std::move where applicableLioncash2018-07-241-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Avoids copying a std::string instance and avoids unnecessary atomic reference count incrementing and decrementing.
* | | | | Merge pull request #791 from bunnei/rg32f-rgba32f-bgra8bunnei2018-07-245-12/+70
|\ \ \ \ \ | |_|_|/ / |/| | | | gl_rasterizer_cache: Implement formats BGRA8_UNORM/RGBA32_FLOAT/RG32_FLOAT
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RG32_FLOAT.bunnei2018-07-245-7/+25
| | | | |
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RGBA32_FLOAT.bunnei2018-07-242-10/+34
| | | | |
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat BGRA8_UNORM.bunnei2018-07-244-8/+22
| | | | |
| * | | | gl_rasterizer_cache: Add missing log statements.bunnei2018-07-241-0/+2
| | | | |
* | | | | Merge pull request #792 from lioncash/retvalbunnei2018-07-241-2/+2
|\ \ \ \ \ | |_|_|_|/ |/| | | | gl_shader_decompiler: Correct return value of WriteTexsInstruction()
| * | | | gl_shader_decompiler: Correct return value of WriteTexsInstruction()Lioncash2018-07-241-2/+2
| | |_|/ | |/| | | | | | | | | | This should be returning void, not a std::string
* | | | Merge pull request #790 from bunnei/shader-print-instrbunnei2018-07-241-1/+2
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Print instruction value in shader comments.
| * | | | gl_shader_decompiler: Print instruction value in shader comments.bunnei2018-07-241-1/+2
| | |/ / | |/| |
* | | | Merge pull request #788 from bunnei/shader-check-zerobunnei2018-07-241-0/+6
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Check if SetRegister result is ZeroIndex.
| * | | | gl_shader_decompiler: Check if SetRegister result is ZeroIndex.bunnei2018-07-241-0/+6
| |/ / /
* | / / VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-245-37/+75
| |/ / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Regression and Mode Fixes * Review Fixes * string_view correction * Add operator& for FileSys::Mode * Return std::string from SanitizePath * Farming Simulator Fix * Use != With mode operator&
* | | Merge pull request #787 from bunnei/tldsbunnei2018-07-241-29/+43
|\ \ \ | | | | | | | | gl_shader_decompiler: Implement shader instruction TLDS.
| * | | gl_shader_decompiler: Implement shader instruction TLDS.bunnei2018-07-241-29/+43
| | | |
* | | | Merge pull request #786 from lioncash/exclusivebunnei2018-07-243-22/+18
|\ \ \ \ | | | | | | | | | | exclusive_monitor: Use consistent type alias for u64
| * | | | exclusive_monitor: Use consistent type alias for u64Lioncash2018-07-243-22/+18
| | |_|/ | |/| | | | | | | | | | | | | | Uses the same type aliases we use for virtual addresses, and converts one lingering usage of std::array<uint64_t, 2> to u128 for consistency.
* | | | Merge pull request #784 from lioncash/loaderbunnei2018-07-241-1/+1
|\ \ \ \ | | | | | | | | | | loader: Minor cleanup
| * | | | loader: Remove unnecessary constructor call in IdentifyFile()Lioncash2018-07-231-1/+1
| |/ / / | | | | | | | | | | | | | | | | | | | | RealVfsFile inherits from VfsFile, the instance from std::make_shared is already compatible with the function argument type, making the copy constructor call unnecessary.
* | | | Merge pull request #783 from lioncash/linkerbunnei2018-07-242-7/+4
|\ \ \ \ | | | | | | | | | | linker: Remove unused parameter from WriteRelocations()
| * | | | linker: Remove unused parameter from WriteRelocations()Lioncash2018-07-232-7/+4
| |/ / / | | | | | | | | | | | | | | | | is_jump_relocation is never used within the function, so we can just remove it.
* | | | Merge pull request #782 from lioncash/filebunnei2018-07-242-14/+33
|\ \ \ \ | |_|/ / |/| | | loader/nro: Minor changes
| * | | nro: Replace inclusion with a forward declarationLioncash2018-07-232-1/+8
| | | | | | | | | | | | | | | | | | | | It's sufficient to use a forward declaration instead of a direct inclusion here.
| * | | nro: Make bracing consistentLioncash2018-07-231-10/+24
| | | | | | | | | | | | | | | | | | | | Makes the code more uniform, and also braces cases where the body of an unbraced conditional travels more than one line.
| * | | nro: Make constructor explicitLioncash2018-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | Makes it consistent with the other Apploader constructors, and prevents implicit conversions.
| * | | nro: Remove unused forward declarationLioncash2018-07-231-2/+0
| |/ / | | | | | | | | | This isn't used anywhere in the header.
* | | Merge pull request #781 from lioncash/declbunnei2018-07-241-5/+5
|\ \ \ | | | | | | | | gl_shader_decompiler: Simplify GetCommonDeclarations()
| * | | gl_shader_decompiler: Simplify GetCommonDeclarations()Lioncash2018-07-231-5/+5
| | |/ | |/|
* | | Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ \ \ | | | | | | | | vi: Minor changes
| * | | vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| | | | | | | | | | | | | | | | | | | | | | | | It's undefined behavior to memcpy an object that isn't considered trivially copyable, so put a compile-time check in to make sure this doesn't occur.
| * | | vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
| |/ / | | | | | | | | | | | | | | | | | | Allows avoiding unnecessary copies of the vector depending on the calling code. While we're at it, remove a redundant no-parameter base constructor call
* | | Merge pull request #779 from lioncash/sharedbunnei2018-07-248-263/+0
|\ \ \ | |_|/ |/| | hle: Remove unused config_mem and shared_page source files
| * | hle: Remove config_mem.h/.cppLioncash2018-07-236-102/+0
| | | | | | | | | | | | | | | This is just an unused hold-over from citra, so we can get rid of this to trim off an exposed global, among other things.
| * | hle: Remove shared_page.h/.cppLioncash2018-07-236-161/+0
| |/ | | | | | | This is a holdover from citra that's essentially unused.
* | Merge pull request #695 from DarkLordZach/nro-assetbunnei2018-07-235-1/+215
|\ \ | | | | | | NRO Assets and NACP File Format
| * | NRO Assets and NACP file formatZach Hilman2018-07-235-1/+215
| | | | | | | | | | | | | | | | | | Cleanup Review fixes
* | | Merge pull request #778 from lioncash/logbunnei2018-07-231-0/+2
|\ \ \ | |_|/ |/| | set: Add missing log call in GetAvailableLanguageCodeCount()
| * | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
|/ / | | | | | | Forgot to include this in 22f448b6327044076959e338811ee576f3dcf093
* | Merge pull request #775 from lioncash/strbunnei2018-07-232-30/+32
|\ \ | | | | | | string_util: Minor changes
| * | string_util: Get rid of separate resize() in CPToUTF16(), UTF16ToUTF8(), CodeToUTF8() and UTF8ToUTF16()Lioncash2018-07-221-20/+22
| | | | | | | | | | | | | | | | | | | | | | | | There's no need to perform the resize separately here, since the constructor allows presizing the buffer. Also move the empty string check before the construction of the string to make the early out more straightforward.
| * | string_util: Use emplace_back() in SplitString() instead of push_back()Lioncash2018-07-221-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is equivalent to doing: push_back(std::string("")); which is likely not to cause issues, assuming a decent std::string implementation with small-string optimizations implemented in its design, however it's still a little unnecessary to copy that buffer regardless. Instead, we can use emplace_back() to directly construct the empty string within the std::vector instance, eliminating any possible overhead from the copy.
| * | string_util: Remove unnecessary std::string instance in TabsToSpaces()Lioncash2018-07-222-8/+7
| | | | | | | | | | | | | | | | | | We can just use the variant of std::string's replace() function that can replace an occurrence with N copies of the same character, eliminating the need to allocate a std::string containing a buffer of spaces.
* | | Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\ \ \ | |_|/ |/| | set: Amend return value of GetAvailableLanguageCodes()
| * | set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| | | | | | | | | | | | This just returns the size of the language code buffer.
| * | set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
| |/ | | | | | | The return code should be 32-bit in size.
* | Merge pull request #769 from bunnei/shader-mask-fixesbunnei2018-07-231-5/+9
|\ \ | | | | | | shader_bytecode: Implement other TEXS masks.
| * | shader_bytecode: Implement other TEXS masks.bunnei2018-07-221-5/+9
| | |
* | | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ \ | |_|/ |/| | Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.
| * | Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
| | |
* | | Merge pull request #773 from Subv/gl_ext_checkbunnei2018-07-222-2/+24
|\ \ \ | | | | | | | | Frontend: Check for more required OpenGL extensions during startup.
| * | | Frontend: Check for more required OpenGL extensions during startup.Subv2018-07-222-2/+24
| |/ /
* | | Merge pull request #768 from lioncash/string-viewbunnei2018-07-2210-133/+213
|\ \ \ | | | | | | | | file_util, vfs: Use std::string_view where applicable
| * | | vfs: Correct file_p variable usage within InterpretAsDirectory()Lioncash2018-07-221-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ReplaceFileWithSubdirectory() takes a VirtualFile and a VirtualDir, but it was being passed a string as one of its arguments. The only reason this never caused issues is because this template isn't instantiated anywhere yet. This corrects an issue before it occurs.
| * | | file_util, vfs: Use std::string_view where applicableLioncash2018-07-2210-131/+208
| | | | | | | | | | | | | | | | | | | | Avoids unnecessary construction of std::string instances where applicable.
* | | | Merge pull request #770 from lioncash/constructbunnei2018-07-221-4/+8
|\ \ \ \ | |_|/ / |/| | | gl_shader_decompiler: Remove redundant Subroutine construction in AddSubroutine()
| * | | gl_shader_decompiler: Remove redundant Subroutine construction in AddSubroutine()Lioncash2018-07-221-4/+8
| | |/ | |/| | | | | | | | | | | | | We don't need to toss away the Subroutine instance after the find() call and reconstruct another instance with the same data right after it. Particularly give Subroutine contains a std::set.
* | | Merge pull request #638 from MerryMage/mpMat M2018-07-229-13/+160
|\ \ \ | | | | | | | | Implement exclusive monitor
| * | | Implement exclusive monitorMerryMage2018-07-229-13/+160
| |/ /
* | | Merge pull request #772 from MerryMage/dynarmicSebastian Valle2018-07-221-0/+0
|\ \ \ | |/ / |/| | externals: Update dynarmic to fc6b73bd
| * | externals: Update dynarmic to fc6b73bdMerryMage2018-07-221-0/+0
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves issues: * 128-bit exclusive writes on Windows * Non-updating CNTPCT_EL0 fc6b73 a64_emit_x64: Ensure host has updated ticks in EmitA64GetCNTPCT 888c67 a64_emit_x64: Fix stack misalignment on Windows for 128-bit exclusive writes 352d53 emit_x64_aes: Eliminate extraneous usage of a scratch register in EmitAESInverseMixColumns() ab7fe7 A64: Implement SADDLV 09bd2b A64: Implement UADDLV 62e86d fp: Use forward declarations where applicable b3edb7 emit_x64_vector: Append 'v' prefix onto movq in AVX path
* | Merge pull request #765 from lioncash/filebunnei2018-07-221-24/+14
|\ \ | | | | | | file_util: Remove goto usages from Copy()
| * | file_util: Remove goto usages from Copy()Lioncash2018-07-221-24/+14
| | | | | | | | | | | | | | | | | | We can just leverage std::unique_ptr to automatically close these for us in error cases instead of jumping to the end of the function to call fclose on them.
* | | Merge pull request #767 from bunnei/shader-cleanupbunnei2018-07-221-78/+15
|\ \ \ | | | | | | | | gl_shader_decompiler: Remove unused state tracking and minor cleanup.
| * | | gl_shader_decompiler: Remove unused state tracking and minor cleanup.bunnei2018-07-221-78/+15
| | | |
* | | | Merge pull request #766 from bunnei/shader-selbunnei2018-07-222-0/+20
|\ \ \ \ | |_|_|/ |/| | | gl_shader_decompiler: Implement SEL instruction.
| * | | gl_shader_decompiler: Implement SEL instruction.bunnei2018-07-222-0/+20
| |/ /
* | | Merge pull request #764 from lioncash/movebunnei2018-07-225-19/+19
|\ \ \ | |/ / |/| | file_util: Minor changes to ScanDirectoryTree() and ForeachDirectoryEntry()
| * | file_util: Use a u64 to represent number of entriesLioncash2018-07-225-18/+18
| | | | | | | | | | | | | | | This avoids a truncating cast on size. I doubt we'd ever traverse a directory this large, however we also shouldn't truncate sizes away.
| * | file_util: std::move FST entries in ScanDirectoryTree()Lioncash2018-07-221-1/+1
| |/ | | | | | | Avoids unnecessary copies when building up the FST entries.
* | Merge pull request #761 from bunnei/improve-raster-cachebunnei2018-07-224-72/+157
|\ \ | |/ |/| Improvements to rasterizer cache
| * gl_rasterizer_cache: Blit surfaces on recreation instead of flush and load.bunnei2018-07-222-2/+86
| |
| * gl_rasterizer_cache: Use GPUVAddr as cache key, not parameter set.bunnei2018-07-223-57/+46
| |
| * gl_rasterizer_cache: Use zeta_width and zeta_height registers for depth buffer.bunnei2018-07-222-11/+11
| |
| * gl_rasterizer: Use zeta_enable register to enable depth buffer.bunnei2018-07-221-2/+2
| |
| * maxwell_3d: Add depth buffer enable, width, and height registers.bunnei2018-07-221-2/+14
|/
* Merge pull request #759 from lioncash/redundantbunnei2018-07-221-2/+1
|\ | | | | file_util: Remove redundant duplicate return in GetPathWithoutTop()
| * file_util: Remove explicit type from std::min() in GetPathWithoutTop()Lioncash2018-07-211-1/+1
| | | | | | | | | | Given both operands are the same type, there won't be an issue with overload selection that requires making this explicit.
| * file_util: Remove redundant duplicate return in GetPathWithoutTop()Lioncash2018-07-211-1/+0
| |
* | Merge pull request #748 from lioncash/namespacebunnei2018-07-2211-48/+24
|\ \ | | | | | | video_core: Use nested namespaces where applicable
| * | video_core: Use nested namespaces where applicableLioncash2018-07-2111-48/+24
| | | | | | | | | | | | Compresses a few namespace specifiers to be more compact.
* | | Merge pull request #758 from lioncash/syncbunnei2018-07-222-86/+0
|\ \ \ | | | | | | | | common: Remove synchronized_wrapper.h
| * | | common: Remove synchronized_wrapper.hLioncash2018-07-212-86/+0
| | | | | | | | | | | | | | | | This is entirely unused in the codebase.
* | | | Merge pull request #760 from lioncash/pathbunnei2018-07-2211-73/+85
|\ \ \ \ | | | | | | | | | | file_util: Use an enum class for GetUserPath()
| * | | | file_util: Use an enum class for GetUserPath()Lioncash2018-07-2111-73/+85
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of using an unsigned int as a parameter and expecting a user to always pass in the correct values, we can just convert the enum into an enum class and use that type as the parameter type instead, which makes the interface more type safe. We also get rid of the bookkeeping "NUM_" element in the enum by just using an unordered map. This function is generally low-frequency in terms of calls (and I'd hope so, considering otherwise would mean we're slamming the disk with IO all the time) so I'd consider this acceptable in this case.
* | | | Merge pull request #762 from Subv/ioctl2bunnei2018-07-223-6/+34
|\ \ \ \ | |/ / / |/| | | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.
| * | | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/ / / | | | | | | | | | | | | This behaves quite similarly to the SubmitGPFIFO command. Referenced from Ryujinx. Many thanks to @gdkchan for investigating this!
* | | Merge pull request #754 from lioncash/partbunnei2018-07-212-8/+20
|\ \ \ | | | | | | | | partition_filesystem, vfs_real: Minor changes
| * | | vfs_real: Remove redundant copying of std::vector instances in GetFiles() and GetSubdirectories()Lioncash2018-07-211-2/+3
| | | | | | | | | | | | | | | | | | | | We already return by value, so we don't explicitly need to make the copy.
| * | | partition_filesystem, vfs_real: Add missing standard includesLioncash2018-07-212-0/+4
| | | |
| * | | partition_filesystem, vfs_real: Use std::move in ReplaceFileWithSubdirectory() where applicableLioncash2018-07-212-2/+3
| | | | | | | | | | | | | | | | Avoids unnecessary atomic increment and decrement operations.
| * | | partition_filesystem, vfs_real: Use std::distance() instead of subtractionLioncash2018-07-212-4/+10
| | | | | | | | | | | | | | | | This is a little bit more self-documenting on what is being done here.
* | | | Merge pull request #750 from lioncash/ctxbunnei2018-07-213-9/+0
|\ \ \ \ | | | | | | | | | | arm_interface: Remove unused tls_address member of ThreadContext
| * | | | arm_interface: Remove unused tls_address member of ThreadContextLioncash2018-07-213-9/+0
| | | | | | | | | | | | | | | | | | | | | | | | | Currently, the TLS address is set within the scheduler, making this member unused.
* | | | | Merge pull request #756 from lioncash/dynarmicbunnei2018-07-211-0/+0
|\ \ \ \ \ | |_|_|/ / |/| | | | externals: Update dynarmic to 7ea1241
| * | | | externals: Update dynarmic to 7ea1241Lioncash2018-07-211-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | Resolves an issue with TPIDR setting being erroneously removed in the dead code pass.
* | | | | Merge pull request #746 from lioncash/testsbunnei2018-07-212-4/+12
|\ \ \ \ \ | | | | | | | | | | | | tests/arm_test_common: Minor changes
| * | | | | arm_test_common: Get rid of truncation warningsLioncash2018-07-201-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | Explicitly cast the value to a u8 to show that this is intentional.
| * | | | | arm_test_common: Make file static variable a member variable of the testing environmentLioncash2018-07-202-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | Gets rid of file-static behavior.
| * | | | | arm_test_common: Add missing header guardLioncash2018-07-201-0/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #747 from lioncash/unimplementedbunnei2018-07-212-3/+3
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_manager: Remove unimplemented function prototype
| * | | | | gl_shader_manager: Replace unimplemented function prototypeLioncash2018-07-212-3/+3
| |/ / / / | | | | | | | | | | | | | | | This was just a linker error waiting to happen.
* | | | | Merge pull request #755 from lioncash/ctorbunnei2018-07-211-8/+8
|\ \ \ \ \ | | | | | | | | | | | | file_sys/errors: Remove redundant object constructor calls
| * | | | | file_sys/errors: Remove redundant object constructor callsLioncash2018-07-211-8/+8
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | Given we're already constructing the error code, we don't need to call the constructor inside of it.
* | | | | Merge pull request #749 from lioncash/consistencybunnei2018-07-214-14/+17
|\ \ \ \ \ | | | | | | | | | | | | gpu: Rename Get3DEngine() to Maxwell3D()
| * | | | | gpu: Rename Get3DEngine() to Maxwell3D()Lioncash2018-07-214-14/+17
| | |_|_|/ | |/| | | | | | | | | | | | | This makes it match its const qualified equivalent.
* | | | | Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-218-0/+39
|\ \ \ \ \ | | | | | | | | | | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch
| * | | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-218-0/+39
| | | | | | | | | | | | | | | | | | | | | | | | Note that there's currently a dynarmic bug preventing this register from being written.
* | | | | | Merge pull request #753 from lioncash/constbunnei2018-07-214-21/+15
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | vfs: Minor changes
| * | | | | vfs_offset: Simplify TrimToFit()Lioncash2018-07-211-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can simply use std::clamp() here, instead of using an equivalent with std::max() and std::min().
| * | | | | vfs: Make WriteBytes() overload taking a std::vector pass the std::vector by const referenceLioncash2018-07-214-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the data is intended to be directly written, there's no need to take the std::vector by value and copy the data.
| * | | | | vfs: Use variable template variants of std::is_trivially_copyableLioncash2018-07-211-13/+6
| | | | | | | | | | | | | | | | | | | | | | | | Provides the same behavior, but with less writing
| * | | | | vfs: Amend constness on pointers in WriteBytes() and WriteArrays() member functions to be const qualifiedLioncash2018-07-211-3/+3
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | These functions don't modify the data being pointed to, so these can be pointers to const data
* | | | | Merge pull request #752 from Subv/vfs_loadbunnei2018-07-211-5/+2
|\ \ \ \ \ | |/ / / / |/| | | | Loader: Only print the module names and addresses if they actually exist.
| * | | | Loader: Only print the module names and addresses if they actually exist.Subv2018-07-211-5/+2
| |/ / /
* | | | Merge pull request #743 from lioncash/viewbunnei2018-07-214-57/+56
|\ \ \ \ | | | | | | | | | | logging: Use std::string_view where applicable
| * | | | logging/filter: Use std::string_view in ParseFilterString()Lioncash2018-07-202-41/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows avoiding constructing std::string instances, since this only reads an arbitrary sequence of characters. We can also make ParseFilterRule() internal, since it doesn't depend on any private instance state of Filter
| * | | | logging/backend: Add missing standard includesLioncash2018-07-202-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | A few inclusions were being satisfied indirectly. To prevent breakages in the future, include these directly.
| * | | | logging/backend: Use std::string_view in RemoveBackend() and GetBackend()Lioncash2018-07-202-12/+13
| | |_|/ | |/| | | | | | | | | | | | | | | | | | These can just use a view to a string since its only comparing against two names in both cases for matches. This avoids constructing std::string instances where they aren't necessary.
* | | | Merge pull request #745 from lioncash/packagebunnei2018-07-212-9/+12
|\ \ \ \ | |_|_|/ |/| | | param_package: Minor changes
| * | | param_package: Take std::string by value in string-based Set() functionLioncash2018-07-202-4/+6
| | | | | | | | | | | | | | | | | | | | Allows avoiding string copies by letting the strings be moved into the function calls.
| * | | param_package: Use std::unordered_map's insert_or_assign instead of map indexingLioncash2018-07-201-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This avoids a redundant std::string construction if a key doesn't exist in the map already. e.g. data[key] requires constructing a new default instance of the value in the map (but this is wasteful, since we're already setting something into the map over top of it).
| * | | param_package: Get rid of file-static std::string constructionLioncash2018-07-201-3/+4
| |/ / | | | | | | | | | Avoids potential dynamic allocation occuring during program launch
* | | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \ \ | | | | | | | | apm: Improve stub for GetPerformanceConfiguration.
| * | | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
| |/ /
* | | Merge pull request #741 from lioncash/enumbunnei2018-07-211-0/+19
|\ \ \ | |/ / |/| | ipc_helpers: Add PushEnum() member function to ResponseBuilder
| * | ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows pushing strongly-typed enum members without the need to always cast them at the call sites. Note that we *only* allow strongly-typed enums in this case. The reason for this is that strongly typed enums have a guaranteed defined size, so the size of the data being pushed is always deterministic. With regular enums this can be a little more error-prone, so we disallow them. This function simply uses the underlying type of the enum to determine the size of the data. For example, if an enum is defined as: enum class SomeEnum : u16 { SomeEntry }; if PushEnum(SomeEnum::SomeEntry); is called, then it will push a u16-size amount of data.
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \ | | | | | | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/ | | | | | | | | | | And make IManagerForApplication::CheckAvailability always return false. Returning a bogus id from GetAccountId causes games to crash on boot. We should investigate this with a hwtest and either stub it properly or implement it.
* | Merge pull request #739 from lioncash/gladbunnei2018-07-203-925/+993
|\ \ | | | | | | externals: Update glad to version 0.1.25
| * | externals: Update glad to version 0.1.25Lioncash2018-07-203-925/+993
| | | | | | | | | | | | | | | Keeps the OpenGL loader library up to date. Previously we were at version 0.1.16
* | | Merge pull request #738 from lioncash/signbunnei2018-07-201-16/+20
|\ \ \ | | | | | | | | gl_state: Get rid of mismatched sign conversions in Apply()
| * | | gl_state: Make references const where applicable in Apply()Lioncash2018-07-201-2/+3
| | | |
| * | | gl_state: Get rid of mismatched sign conversionsLioncash2018-07-201-14/+17
| |/ / | | | | | | | | | | | | While we're at it, amend the loop variable type to be the same width as that returned by the .size() call.
* | | Merge pull request #737 from lioncash/movebunnei2018-07-204-5/+9
|\ \ \ | | | | | | | | filesys/loader: std::move VirtualFile instances in constructors where applicable
| * | | loader/{nca, nro}: std::move VirtualFile in the constructors where applicableLioncash2018-07-202-2/+4
| | | | | | | | | | | | | | | | This avoids unnecessary atomic reference count increments and decrements
| * | | vfs_offset: std::move file and name parameters of OffsetVfsFileLioncash2018-07-202-3/+5
| |/ / | | | | | | | | | | | | Avoids potentially unnecessary atomic reference count incrementing and decrementing, as well as string copying.
* | | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ \ | | | | | | | | audout_u/audren_u: Ensure null terminators are written out in ListAudioOutsImpl(), ListAudioDeviceName(), and GetActiveAudioDeviceName()
| * | | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| | | | | | | | | | | | | | | | | | | | std::string doesn't include the null-terminator in its data() + size() range. This ensures that the null-terminator will also be written to the buffer
| * | | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| |/ / | | | | | | | | | | | | | | | Uses a type that doesn't potentially dynamically allocate, and ensures that the name of the interface is properly null-terminated when writing it to the buffer.
* | | Merge pull request #735 from lioncash/video-unusedbunnei2018-07-201-2/+0
|\ \ \ | | | | | | | | maxwell_3d: Remove unused variable within GetStageTextures()
| * | | maxwell_3d: Remove unused variable within GetStageTextures()Lioncash2018-07-201-2/+0
| |/ /
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-2010-93/+92
|\ \ \ | | | | | | | | thread: Convert ThreadStatus into an enum class
| * | | thread: Convert ThreadStatus into an enum classLioncash2018-07-2010-93/+92
| |/ / | | | | | | | | | | | | Makes the thread status strongly typed, so implicit conversions can't happen. It also makes it easier to catch mistakes at compile time.
* | | Merge pull request #733 from lioncash/dirsbunnei2018-07-201-1/+1
|\ \ \ | | | | | | | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()
| * | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()Lioncash2018-07-201-1/+1
| |/ / | | | | | | | | | | | | This should be returned here, otherwise pfs_dirs is effectively only ever added to, but never read.
* | | Merge pull request #732 from lioncash/unusedbunnei2018-07-201-17/+6
|\ \ \ | | | | | | | | nso: Minor changes
| * | | nso: Silence implicit sign conversion warningsLioncash2018-07-201-4/+6
| | | |
| * | | nso: Remove unused function ReadSegment()Lioncash2018-07-201-13/+0
| |/ /
* | | Merge pull request #731 from lioncash/shadowbunnei2018-07-201-6/+4
|\ \ \ | |_|/ |/| | gl_shader_decompiler: Eliminate variable and declaration shadowing
| * | gl_shader_decompiler: Eliminate variable and declaration shadowingLioncash2018-07-201-6/+4
| |/ | | | | | | | | Ensures that no identifiers are being hidden, which also reduces compiler warnings.
* | Merge pull request #730 from lioncash/stringbunnei2018-07-201-2/+2
|\ \ | | | | | | gl_shader_decompiler: Remove unnecessary const from return values
| * | gl_shader_decompiler: Remove unnecessary const from return valuesLioncash2018-07-201-2/+2
| |/ | | | | | | | | This adds nothing from a behavioral point of view, and can inhibit the move constructor/RVO
* | Merge pull request #729 from lioncash/simplifybunnei2018-07-201-3/+3
|\ \ | |/ |/| pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()
| * pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/ | | | With the new overload, we can simply pass the container directly.
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\ | | | | hle_ipc: Introduce generic WriteBuffer overload for multiple container types
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This introduces a slightly more generic variant of WriteBuffer(). Notably, this variant doesn't constrain the arguments to only accepting std::vector instances. It accepts whatever adheres to the ContiguousContainer concept in the C++ standard library. This essentially means, std::array, std::string, and std::vector can be used directly with this interface. The interface no longer forces you to solely use containers that dynamically allocate. To ensure our overloads play nice with one another, we only enable the container-based WriteBuffer if the argument is not a pointer, otherwise we fall back to the pointer-based one.
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \ | | | | | | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/ | | | | | | | | This WriteBuffer overload expects its size argument to be in bytes, not elements.
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \ | | | | | | HLE/ACC: Change the default user id and small improvements to the way we handle profiles
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| | | | | | | | | | | | | | | The default username for now is "yuzu". We should eventually allow the creation of users in the emulator and have the ability to modify their parameters.
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
| | | | | | | | | | | | In IApplicationFunctions::PopLaunchParameter we tell the games that they were launched as user id 1.
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \ | | | | | | | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ / | | | | | | | | | We only emulate a single user id for now.
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \ | | | | | | | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/| | | | | | | This can just use the fmt specifiers and be type-agnostic.
* | | Merge pull request #723 from lioncash/gdbbunnei2018-07-201-7/+7
|\ \ \ | | | | | | | | gdbstub: Get rid of a few signed/unsigned comparisons
| * | | gdbstub: Get rid of a few signed/unsigned comparisonsLioncash2018-07-191-7/+7
| | | | | | | | | | | | | | | | Ensures both operands in comparisons are the same signedness.
* | | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ \ | | | | | | | | | | hid: Resolve a signed/unsigned comparison warning
| * | | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Modernizes the loops themselves while also getting rid of a signed/unsigned comparison in a loop condition.
| * | | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| |/ / / | | | | | | | | | | | | Gets rid of the use of a magic constant
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \ | | | | | | | | | | svc: Correct always true assertion case in SetThreadCoreMask
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The reason this would never be true is that ideal_processor is a u8 and THREADPROCESSORID_DEFAULT is an s32. In this case, it boils down to how arithmetic conversions are performed before performing the comparison. If an unsigned value has a lesser conversion rank (aka smaller size) than the signed type being compared, then the unsigned value is promoted to the signed value (i.e. u8 -> s32 happens before the comparison). No sign-extension occurs here either. An alternative phrasing: Say we have a variable named core and it's given a value of -2. u8 core = -2; This becomes 254 due to the lack of sign. During integral promotion to the signed type, this still remains as 254, and therefore the condition will always be true, because no matter what value the u8 is given it will never be -2 in terms of 32 bits. Now, if one type was a s32 and one was a u32, this would be entirely different, since they have the same bit width (and the signed type would be converted to unsigned instead of the other way around) but would still have its representation preserved in terms of bits, allowing the comparison to be false in some cases, as opposed to being true all the time. --- We also get rid of two signed/unsigned comparison warnings while we're at it.
* | | | | Merge pull request #719 from lioncash/docsbunnei2018-07-202-5/+5
|\ \ \ \ \ | | | | | | | | | | | | loader: Amend Doxygen comments
| * | | | | loader: Amend Doxygen commentsLioncash2018-07-192-5/+5
| |/ / / / | | | | | | | | | | | | | | | These weren't adjusted when VFS was introduced
* | | | | Merge pull request #718 from lioncash/readbunnei2018-07-201-4/+6
|\ \ \ \ \ | | | | | | | | | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic value
| * | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic valueLioncash2018-07-191-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We should always assume the filesystem is volatile and check each IO operation. While we're at it reorganize checks so that early-out errors are near one another.
* | | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle/service: Make constructors explicit where applicable
| * | | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit construction and makes these lingering non-explicit constructors consistent with the rest of the other classes in services.
* | | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvflinger: Emplace Display instances directly
| * | | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use emplace_back to construct the Display instances directly, instead of constructing them separately and copying them, avoiding the need to copy std::string and std::vector instances that are part of the Display struct.
* | | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | nvdrv: Take std::string by const reference in GetDevice()
| * | | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | This is only ever used as a lookup into the device map, so we don't need to take the std::string instance by value here.
* | | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | Filesystem: Return EntryType::Directory for the root directory.
| * | | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
| | | | | | | | | | | | | | | | | | | | It is unknown if this is correct behavior, but it makes sense and fixes a regression with Stardew Valley.
* | | | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \ \ \ | | | | | | | | | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloads
| * | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the buffer_index parameter was unused, causing all writes to use the buffer index of zero, which is not necessarily what is wanted all the time. Thankfully, all current usages don't use a buffer index other than zero, so this just prevents a bug before it has a chance to spring.
* | | | | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | fsp_srv: Misc individual changes
| * | | | | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can avoid constructing a std::vector here by simply passing a pointer to the original data and the size of the copy we wish to perform to the backend's Write() function instead, avoiding copying the data where it's otherwise not needed.
| * | | | | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were using a second std::vector as a buffer to convert another std::vector's data into a byte sequence, however we can just use pointers to the original data and use them directly with WriteBuffer, which avoids copying the data at all into a separate std::vector. We simply cast the pointers to u8* (which is allowed by the standard, given std::uint8_t is an alias for unsigned char on platforms that we support).
| * | | | | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit conversions.
| * | | | | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | Gets rid of relying on indirect inclusions.
| * | | | | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| | | | | |
| * | | | | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were just copying the data whole-sale, even if the length was less than the total data size. This effectively makes the actual_data vector useless, which is likely not intended. Instead, amend this to only copy the given length amount of data. At the same time, we can avoid zeroing out the data before using it by passing iterators to the constructor instead of a size.
* | | | | Merge pull request #713 from lioncash/filesysbunnei2018-07-191-3/+3
|\ \ \ \ \ | | | | | | | | | | | | filesystem: Minor changes
| * | | | | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary atomic reference count incrementing and decrementing
| * | | | | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is simply a basic value check as opposed to potentially doing string based operations (unlikely, but still, avoiding it is free).
| * | | | | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
| |/ / / / | | | | | | | | | | | | | | | This was just an artifact missed during PR review.
* | | | | Merge pull request #711 from lioncash/swapbunnei2018-07-191-50/+50
|\ \ \ \ \ | | | | | | | | | | | | common/swap: Minor changes
| * | | | | common/swap: Remove unnecessary const on return value of swap()Lioncash2018-07-191-1/+1
| | | | | |
| * | | | | common/swap: Use static_cast where applicableLioncash2018-07-191-16/+16
| | | | | |
| * | | | | common/swap: Use using aliases where applicableLioncash2018-07-191-33/+33
| |/ / / /
* | | | | Merge pull request #710 from lioncash/unusedbunnei2018-07-191-38/+0
|\ \ \ \ \ | | | | | | | | | | | | common/common_funcs: Remove unused rotation functions
| * | | | | common/common_funcs: Remove unused rotation functionsLioncash2018-07-191-38/+0
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are unused and essentially don't provide much benefit either. If we ever need rotation functions, these can be introduced in a way that they don't sit in a common_* header and require a bunch of ifdefing to simply be available
* | | | | Merge pull request #694 from lioncash/warnbunnei2018-07-192-6/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | loader/{nro, nso}: Resolve compilation warnings
| * | | | loader/nro: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| | | | |
| * | | | loader/nso: Remove unnecessary vector resizesLioncash2018-07-191-4/+2
| | | | | | | | | | | | | | | | | | | | We can just initialize these vectors directly via their constructor.
| * | | | loader/nso: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| | | | |
* | | | | Merge pull request #709 from lioncash/thread-localbunnei2018-07-192-12/+8
|\ \ \ \ \ | | | | | | | | | | | | common/misc: Deduplicate code in GetLastErrorMsg()
| * | | | | common/misc: Deduplicate code in GetLastErrorMsg()Lioncash2018-07-192-12/+8
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Android and macOS have supported thread_local for quite a while, but most importantly is that we don't even really need it. Instead of using a thread-local buffer, we can just return a non-static buffer as a std::string, avoiding the need for that quality entirely.
* | | | | Merge pull request #708 from lioncash/xbyakbunnei2018-07-191-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update Xbyak to 5.65
| * | | | | externals: Update Xbyak to 5.65Lioncash2018-07-191-0/+0
| |/ / / / | | | | | | | | | | | | | | | | | | | | Keeps the JIT assembler library up to date and ensures we don't run into any issues that may have been resolved.
* | | | | Merge pull request #707 from lioncash/catchbunnei2018-07-191-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update catch to v2.2.3
| * | | | | externals: Update catch to v2.2.3Lioncash2018-07-191-0/+0
| |/ / / / | | | | | | | | | | | | | | | Keeps the unit-testing library up to date.
* | | | | Merge pull request #705 from lioncash/string-refbunnei2018-07-192-2/+2
|\ \ \ \ \ | | | | | | | | | | | | file_util: return string by const reference for GetExeDirectory()
| * | | | | file_util: return string by const reference for GetExeDirectory()Lioncash2018-07-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This disallows modifying the internal string buffer (which shouldn't be modified anyhow).
* | | | | | Merge pull request #704 from lioncash/stringbunnei2018-07-192-15/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | string_util: Remove AsciiToHex()
| * | | | | | string_util: Remove AsciiToHex()Lioncash2018-07-192-15/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Easy TODO
* | | | | | | Merge pull request #703 from lioncash/constbunnei2018-07-192-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member function
| * | | | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member functionLioncash2018-07-192-2/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | This function doesn't alter class state.
* | | | | | | Merge pull request #702 from lioncash/initializebunnei2018-07-192-24/+15
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initialized
| * | | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initializedLioncash2018-07-192-24/+15
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously is_hfs and pfs_header members wouldn't be initialized in the constructor, as they were stored in locals instead. This would result in things like GetName() and PrintDebugInfo() behaving incorrectly. While we're at it, initialize the members to deterministic values as well, in case loading ever fails.
* | | | | | Merge pull request #701 from lioncash/movingbunnei2018-07-192-2/+10
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | content_archive: Minor changes
| * | | | | content_archive: Make IsDirectoryExeFS() take a shared_ptr as a const referenceLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need to take this by value when it's possible to avoid unnecessary copies entirely like this.
| * | | | | content_archive: Add missing standard includesLioncash2018-07-191-0/+5
| | | | | |
| * | | | | content_archive: std::move VirtualFile in NCA's constructorLioncash2018-07-191-1/+4
| |/ / / / | | | | | | | | | | | | | | | | | | | | Gets rid of unnecessary atomic reference count incrementing and decrementing.
* | | | | Merge pull request #699 from lioncash/vfsbunnei2018-07-191-6/+6
|\ \ \ \ \ | | | | | | | | | | | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()
| * | | | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()Lioncash2018-07-191-6/+6
| |/ / / / | | | | | | | | | | | | | | | We can just use a generic lambda to avoid writing the same thing twice.
* | | | | Merge pull request #697 from bunnei/disable-depth-cullbunnei2018-07-191-1/+3
|\ \ \ \ \ | |_|_|/ / |/| | | | gl_state: Temporarily disable culling and depth test.
| * | | | gl_state: Temporarily disable culling and depth test.bunnei2018-07-191-1/+3
| | |_|/ | |/| |
* | | | Merge pull request #700 from bunnei/update-dynarmicbunnei2018-07-191-0/+0
|\ \ \ \ | |_|_|/ |/| | | externals: Update dynarmic to 5a91c94.
| * | | externals: Update dynarmic to 5a91c94.bunnei2018-07-191-0/+0
| |/ /
* | | Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\ \ \ | | | | | | | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()
| * | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | This was introduced within 4f81bc4e1bd12e4df7410c6790ba818d8dbba9c0, and considering there's no comment indicating that this is intentional, this is very likely a bug.
* | | | Merge pull request #690 from lioncash/movebunnei2018-07-199-16/+26
|\ \ \ \ | |_|_|/ |/| | | core/memory, core/hle/kernel: Use std::move where applicable
| * | | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-199-16/+26
| | | | | | | | | | | | | | | | Avoids pointless copies
* | | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \ \ | | | | | | | | | | service/prepo: Add missing header guard
| * | | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ / | |/| |
* | | | Merge pull request #686 from lioncash/fmtbunnei2018-07-192-1/+1
|\ \ \ \ | |_|_|/ |/| | | externals: update fmt to version 5.1.0
| * | | externals: update fmt to version 5.1.0Lioncash2018-07-182-1/+1
| | |/ | |/| | | | | | | Previously, we were on 4.1.0, which was a major version behind.
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \ | | | | | | | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| |/ / | | | | | | | | | | | | Without these, this would perform concatenation, which is definitely not what we want here.
* | | Merge pull request #693 from lioncash/unusedbunnei2018-07-191-7/+0
|\ \ \ | | | | | | | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()
| * | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()Lioncash2018-07-191-7/+0
| | |/ | |/|
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-196-22/+26
|\ \ \ | | | | | | | | core: Don't construct instance of Core::System, just to access its live instance
| * | | core: Make System's default constructor privateLioncash2018-07-192-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | This makes it a compilation error to construct additional instances of the System class directly, preventing accidental wasteful constructions over and over.
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-195-22/+22
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | This would result in a lot of allocations and related object construction, just to toss it all away immediately after the call. These are definitely not intentional, and it was intended that all of these should have been accessing the static function GetInstance() through the name itself, not constructed instances.
* | | Merge pull request #680 from bunnei/fix-swizzbunnei2018-07-191-1/+4
|\ \ \ | | | | | | | | decoders: Fix calc of swizzle image_width_in_gobs.
| * | | decoders: Fix calc of swizzle image_width_in_gobs.bunnei2018-07-191-1/+4
| | | |
* | | | Merge pull request #685 from lioncash/buildbunnei2018-07-190-0/+0
|\ \ \ \ | | | | | | | | | | hle/filesystem: Amend trace log in OpenSaveData() to compile in debug mode
| * | | | hle/filesystem: Amend trace log in OpenSaveData() to compile in debug modeLioncash2018-07-181-1/+1
| | |/ / | |/| | | | | | | | | | | | | | Previously this wouldn't compile, since no such function named SaveStructDebugInfo() exists.
* | | | Merge pull request #684 from lioncash/nonmemberbunnei2018-07-192-2/+1
|\ \ \ \ | |_|/ / |/| | | game_list: Make ContainsAllWords an internally linked non-member function
| * | | game_list: Make ContainsAllWords an internally linked non-member functionLioncash2018-07-182-2/+1
| |/ / | | | | | | | | | | | | This function actually depends on no internal class state, so it doesn't even need to be a part of the class interface.
* | / Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-1954-1959/+1926
| |/ |/| | | | | | | | | | | | | | | | | * Virtual Filesystem * Fix delete bug and documentate * Review fixes + other stuff * Fix puyo regression
* | Merge pull request #683 from DarkLordZach/touchbunnei2018-07-181-4/+24
|\ \ | |/ |/| Touchscreen Support
| * Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
| |
| * Single touch supportZach Hilman2018-07-181-4/+19
|/
* Merge pull request #681 from lioncash/constbunnei2018-07-182-5/+7
|\ | | | | game_list: Make containsAllWords a const member function
| * game_list: Upper-case containsAllWords to ContainsAllWords()Lioncash2018-07-182-3/+3
| | | | | | | | | | This makes it consistent with most of the other private utility functions.
| * game_list: Make containsAllWords a const member functionLioncash2018-07-182-4/+6
| | | | | | | | | | | | This doesn't actually modify the internal class state, so it can be a const member function. While we're at it, amend the function to take its arguments by const reference.
* | Merge pull request #682 from lioncash/telemetrybunnei2018-07-181-20/+7
|\ \ | | | | | | Telemetry: Minor changes
| * | telemetry: Remove unnecessary Field constructorLioncash2018-07-181-4/+1
| | | | | | | | | | | | | | | We can just take the value parameter by value which allows both moving into it, and copies at the same time, depending on the calling code.
| * | telemetry: Make operator== and operator!= const member functions of FieldLioncash2018-07-181-2/+2
| | | | | | | | | | | | | | | | | | | | | These operators don't modify internal class state, so they can be made const member functions. While we're at it, drop the unnecessary inline keywords. Member functions that are defined in the class declaration are already inline by default.
| * | telemetry: Default copy/move constructors and assignment operatorsLioncash2018-07-181-14/+4
| |/ | | | | | | | | | | This provides the equivalent behavior, but without as much boilerplate. While we're at it, explicitly default the move constructor, since we have a move-assignment operator defined.
* | Merge pull request #679 from lioncash/ctorbunnei2018-07-181-4/+1
|\ \ | | | | | | game_list: Remove unnecessary QString initialization in KeyReleaseEater
| * | game_list: Remove unnecessary QString initialization in KeyReleaseEaterLioncash2018-07-181-4/+1
| |/ | | | | | | | | | | QString initializes to an empty string by default, so this does nothing meaningful. While we're at it, use a constructor initializer list for initializing the gamelist member variable.
* | Merge pull request #678 from lioncash/astcbunnei2018-07-181-78/+60
|\ \ | | | | | | astc: Minor changes
| * | astc: Initialize vector size directly in DecompressLioncash2018-07-181-2/+1
| | | | | | | | | | | | There's no need to perform a separate resize.
| * | astc: Mark functions as internally linked where applicableLioncash2018-07-181-17/+20
| | |
| * | astc: const-correctness changes where applicableLioncash2018-07-181-14/+13
| | | | | | | | | | | | | | | A few member functions didn't actually modify class state, so these can be amended as necessary.
| * | astc: Delete Bits' copy contstructor and assignment operatorLioncash2018-07-181-8/+6
| | | | | | | | | | | | | | | This also potentially avoids warnings, considering the copy assignment operator is supposed to have a return value.
| * | astc: In-class initialize member variables where appropriateLioncash2018-07-181-39/+22
| |/
* | Merge pull request #677 from bunnei/crop-fbbunnei2018-07-1812-20/+52
|\ \ | |/ |/| Implement buffer cropping and default to handheld mode
| * settings: Turn docked mode off by default.bunnei2018-07-183-3/+3
| |
| * vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
| |
| * vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
| |
| * vi: Partially implement buffer crop parameters.bunnei2018-07-189-14/+46
|/
* Merge pull request #675 from Subv/stencilbunnei2018-07-181-2/+25
|\ | | | | GPU: Added register definitions for the stencil parameters.
| * GPU: Added register definitions for the stencil parameters.Subv2018-07-171-2/+25
| |
* | General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-1716-212/+256
| |
* | Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-176-0/+11
|\ \ | | | | | | scheduler: Clear exclusive state when switching contexts
| * | scheduler: Clear exclusive state when switching contextsMerryMage2018-07-166-0/+11
| | |
* | | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \ \ | |_|/ |/| | svc:: Fix bug in svcWaitForAddress
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* | Merge pull request #673 from bunnei/fix-buffer-queue-evtbunnei2018-07-176-32/+21
|\ \ | |/ |/| nvflinger: Fix for BufferQueue event handling.
| * nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* Merge pull request #669 from lioncash/dynarmicbunnei2018-07-161-0/+0
|\ | | | | externals: Update dynarmic to dfdec79
| * externals: Update dynarmic to dfdec79Lioncash2018-07-151-0/+0
|/
* Merge pull request #668 from jroweboy/controller-lagbunnei2018-07-151-3/+3
|\ | | | | HID: Update controllers less often
| * HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
| |
* | Merge pull request #664 from jroweboy/logging-stuffbunnei2018-07-153-4/+17
|\ \ | |/ |/| Minor logging improvements
| * Logging: Dump all logs in the queue on close in debug modeJames Rowe2018-07-153-1/+12
| |
| * Logging: Don't lock the queue for the duration of the writeJames Rowe2018-07-141-3/+5
| |
* | Merge pull request #666 from bunnei/g8r8bunnei2018-07-153-9/+40
|\ \ | | | | | | gl_rasterizer_cache: Implement texture format G8R8.
| * | gl_rasterizer_cache: Implement texture format G8R8.bunnei2018-07-153-9/+40
|/ /
* | Merge pull request #665 from bunnei/fix-z24-s8bunnei2018-07-151-1/+2
|\ \ | | | | | | gl_rasterizer_cache: Fix incorrect offset in ConvertS8Z24ToZ24S8.
| * | gl_rasterizer_cache: Fix incorrect offset in ConvertS8Z24ToZ24S8.bunnei2018-07-151-1/+2
| | |
* | | Merge pull request #659 from bunnei/depth16bunnei2018-07-153-1/+15
|\ \ \ | |/ / |/| | gl_rasterizer_cache: Implement depth format Z16_UNORM.
| * | gl_rasterizer_cache: Implement depth format Z16_UNORM.bunnei2018-07-153-1/+15
|/ /
* | Merge pull request #598 from bunnei/makedonecurrentbunnei2018-07-156-2/+39
|\ \ | | | | | | OpenGL: Use MakeCurrent/DoneCurrent for multithreaded rendering.
| * | OpenGL: Use MakeCurrent/DoneCurrent for multithreaded rendering.bunnei2018-07-146-2/+39
| | |
* | | Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\ \ \ | | | | | | | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC
| * | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
| | | |
* | | | Merge pull request #662 from Subv/delete_filebunnei2018-07-141-2/+4
|\ \ \ \ | | | | | | | | | | FileSys: Append the requested path to the filesystem base path in DeleteFile
| * | | | FileSys: Append the requested path to the filesystem base path in DeleteFile.Subv2018-07-141-2/+4
| |/ / / | | | | | | | | | | | | We were trying to delete things in the current directory instead of the actual filesystem directory. This may fix some savedata issues in some games.
* | | | Merge pull request #661 from ogniK5377/assert-nitbunnei2018-07-141-2/+2
|\ \ \ \ | |/ / / |/| | | No need to use ASSERT_MSG with an empty assert message
| * | | No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/ / /
* | | Merge pull request #660 from Subv/depth_writebunnei2018-07-141-3/+8
|\ \ \ | |/ / |/| | GPU: Always enable the depth write when clearing the depth buffer.
| * | GPU: Always enable the depth write when clearing the depth buffer.Subv2018-07-141-3/+8
|/ / | | | | | | The GPU ignores that register when clearing, but OpenGL obeys the glDepthMask parameter, so we set the depth mask to GL_TRUE when clearing the depth buffer. It will be restored to the correct value automatically on the next draw call.
* | Merge pull request #657 from bunnei/dual-vsbunnei2018-07-137-89/+149
|\ \ | | | | | | gl_shader_gen: Implement dual vertex shader mode.
| * | gl_rasterizer: Fix check for if a shader stage is enabled.bunnei2018-07-133-35/+11
| | |
| * | gl_shader_gen: Implement dual vertex shader mode.bunnei2018-07-135-55/+139
| | | | | | | | | | | | - When VertexA shader stage is enabled, we combine with VertexB program to make a single Vertex Shader stage.
* | | More improvements to GDBStub (#653)Hedges2018-07-138-50/+173
|/ / | | | | | | | | | | | | | | | | | | | | * More improvements to GDBStub - Debugging of threads should work correctly with source and assembly level stepping and modifying registers and memory, meaning threads and callstacks are fully clickable in VS. - List of modules is available to the client, with assumption that .nro and .nso are backed up by an .elf with symbols, while deconstructed ROMs keep N names. - Initial support for floating point registers. * Tidy up as requested in PR feedback * Tidy up as requested in PR feedback
* | Merge pull request #656 from ogniK5377/audren-mem-initbunnei2018-07-131-3/+3
|\ \ | | | | | | Initialized memory for RequestUpdateAudioRenderer and fixed MemoryPoolSection to be more accurate
| * | We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
| | |
| * | initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
| | |
* | | Merge pull request #655 from bunnei/pred-lt-nanbunnei2018-07-132-5/+7
|\ \ \ | | | | | | | | gl_shader_decompiler: Implement PredCondition::LessThanWithNan.
| * | | gl_shader_decompiler: Implement PredCondition::LessThanWithNan.bunnei2018-07-132-5/+7
| |/ /
* | | Merge pull request #654 from bunnei/cond-exitbunnei2018-07-132-8/+34
|\ \ \ | |/ / |/| | gl_shader_decompiler: Use FlowCondition field in EXIT instruction.
| * | gl_shader_decompiler: Use FlowCondition field in EXIT instruction.bunnei2018-07-132-8/+34
|/ /
* | Merge pull request #652 from Subv/fadd32iSebastian Valle2018-07-132-0/+32
|\ \ | | | | | | GPU: Implement the FADD32I shader instruction.
| * | GPU: Implement the FADD32I shader instruction.Subv2018-07-122-0/+32
| | |
* | | Merge pull request #651 from Subv/ffma_decodebunnei2018-07-121-1/+1
|\ \ \ | | | | | | | | GPU: Corrected the decoding of FFMA for immediate operands.
| * | | GPU: Corrected the decoding of FFMA for immediate operands.Subv2018-07-121-1/+1
| |/ /
* | | Port #3335 and #3373 from Citra: "Small SDL fixes" and "Print the actual error preventing SDL from working" (#637)Tobias2018-07-122-6/+4
| | | | | | | | | | | | | | | | | | * Port #3335 and #3373 from Citra * Fixup: Use the new logging placeholders
* | | Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\ \ \ | | | | | | | | Let games/application know that we're offline
| * | | Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
| | | | | | | | | | | | | | | | Since we have no socket implementation we should be returning 0 to indicate we're currently offline.
* | | | Merge pull request #649 from ogniK5377/audout-autobunnei2018-07-122-14/+14
|\ \ \ \ | | | | | | | | | | Audout "Auto" functions
| * | | | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
| |/ / / | | | | | | | | | | | | Audout autos are identical to their counterpart except for the buffer type which yuzu already handles for us.
* | | | Merge pull request #650 from jroweboy/logging-stuffbunnei2018-07-123-4/+8
|\ \ \ \ | |/ / / |/| | / | | |/ | |/| Minor logging fixes
| * | yuzu - Fix duplicate logsJames Rowe2018-07-122-2/+7
| | |
| * | yuzu-cmd Apply the filter string from settingsJames Rowe2018-07-121-2/+1
|/ /
* | Merge pull request #559 from Subv/mount_savedatabunnei2018-07-122-2/+12
|\ \ | | | | | | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.
| * | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-192-2/+12
| | |
* | | Merge pull request #585 from janisozaur/patch-11bunnei2018-07-121-3/+3
|\ \ \ | | | | | | | | Improve directory creation in WindowsCopyFiles.cmake
| * | | Improve directory creation in WindowsCopyFiles.cmakeMichał Janiszewski2018-06-241-3/+3
| | | |
* | | | Merge pull request #646 from bunnei/fix-hid-smobunnei2018-07-111-7/+5
|\ \ \ \ | | | | | | | | | | hid: Fix timestamps and controller type.
| * | | | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
|/ / / / | | | | | | | | | | | | - This fixes user input in SMO.
* | | | Merge pull request #644 from ogniK5377/getconfig-errbunnei2018-07-111-17/+2
|\ \ \ \ | | | | | | | | | | NvOsGetConfigU32 production impl
| * | | | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
| | | | | | | | | | | | | | | | | | | | | | | | | Settings are only used when RMOS_SET_PRODUCTION_MODE is set to 0. If production mode is set, the error code 0x30006 is returned instead
* | | | | Merge pull request #633 from FearlessTobi/port-definesbunnei2018-07-103-7/+7
|\ \ \ \ \ | | | | | | | | | | | | Port #3579 from Citra: Clean up architecture-specific defines
| * | | | | Port #3579 from CitrafearlessTobi2018-07-073-7/+7
| | | | | |
* | | | | | Merge pull request #642 from bunnei/create-save-dirbunnei2018-07-101-0/+9
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | savedata_factory: Always create a save directory for games.
| * | | | | savedata_factory: Always create a save directory for games.bunnei2018-07-081-0/+9
| | | | | |
* | | | | | Merge pull request #636 from FearlessTobi/add-gitignorebunnei2018-07-101-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port #3513 (partly) from Citra: .gitignore: Add CMakeLists.txt.user to Project/editor files
| * | | | | | Port #3513 (partly) from CitrafearlessTobi2018-07-071-0/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #635 from FearlessTobi/port-crashfixbunnei2018-07-101-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port #3474 from Citra: Do not crash on unimplemented code in debug build
| * | | | | | Port #3474 from CitrafearlessTobi2018-07-071-1/+1
| |/ / / / /
* | | | | | Merge pull request #634 from FearlessTobi/port-viewport-fixbunnei2018-07-101-6/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port #3505 from Citra: Fix QGLWidget viewport resize on macOS
| * | | | | | Port #3505 from CItrafearlessTobi2018-07-071-6/+7
| |/ / / / /
* | | | | | Merge pull request #640 from bunnei/flip-tris-viewportbunnei2018-07-091-1/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer: Flip triangles when regs.viewport_transform[0].scale_y is negative.
| * | | | | | gl_rasterizer: Flip triangles when regs.viewport_transform[0].scale_y is negative.bunnei2018-07-081-1/+4
| | |/ / / / | |/| | | | | | | | | | | | | | | | - Fixes a regression with Binding of Isaac.
* | | | | | Merge pull request #641 from bunnei/nvhost-ctrl-fixbunnei2018-07-091-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.
| * | | | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
|/ / / / /
* | | | | Merge pull request #625 from Subv/imnmxbunnei2018-07-082-3/+31
|\ \ \ \ \ | | | | | | | | | | | | GPU: Implemented the IMNMX shader instruction.
| * | | | | GPU: Implemented the IMNMX shader instruction.Subv2018-07-042-3/+31
| | | | | | | | | | | | | | | | | | | | | | | | It's similar to the FMNMX instruction but it works on integers.
* | | | | | Merge pull request #627 from Subv/bc7ubunnei2018-07-083-7/+21
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Implemented the BC7U texture format.
| * | | | | | GPU: Implemented the BC7U texture format.Subv2018-07-073-7/+21
| | |/ / / / | |/| | | | | | | | | | | | | | | | Note: Our version of glad exports GL_COMPRESSED_RGBA_BPTC_UNORM as GL_COMPRESSED_RGBA_BPTC_UNORM_ARB, maybe it's time we update it.
* | | | | | Merge pull request #639 from bunnei/revert-vfsbunnei2018-07-0845-1784/+1676
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | Revert "Virtual Filesystem (#597)"
| * | | | | Revert "Virtual Filesystem (#597)"bunnei2018-07-0845-1784/+1676
|/ / / / / | | | | | | | | | | | | | | | This reverts commit 77c684c1140f6bf3fb7d4560d06d2efb1a2ee5e2.
* | | | | Merge pull request #632 from FearlessTobi/add-discord-linkbunnei2018-07-071-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | Port #3466 from Citra: Add link to Discord
| * | | | Port #3466 from CitraTobias2018-07-071-1/+1
| | | | |
* | | | | Merge pull request #631 from lioncash/dynarmicbunnei2018-07-071-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update dynarmic to f7d11baa1
| * | | | | externals: Update dynarmic to f7d11baa1Lioncash2018-07-071-0/+0
|/ / / / /
* | | | | Merge pull request #630 from FearlessTobi/remove-citra-referencesbunnei2018-07-063-3/+3
|\ \ \ \ \ | | | | | | | | | | | | Remove some references to Citra
| * | | | | Remove some references to CitrafearlessTobi2018-07-063-3/+3
| |/ / / /
* / / / / Virtual Filesystem (#597)Zach Hilman2018-07-0645-1676/+1784
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add VfsFile and VfsDirectory classes * Finish abstract Vfs classes * Implement RealVfsFile (computer fs backend) * Finish RealVfsFile and RealVfsDirectory * Finished OffsetVfsFile * More changes * Fix import paths * Major refactor * Remove double const * Use experimental/filesystem or filesystem depending on compiler * Port partition_filesystem * More changes * More Overhaul * FSP_SRV fixes * Fixes and testing * Try to get filesystem to compile * Filesystem on linux * Remove std::filesystem and document/test * Compile fixes * Missing include * Bug fixes * Fixes * Rename v_file and v_dir * clang-format fix * Rename NGLOG_* to LOG_* * Most review changes * Fix TODO * Guess 'main' to be Directory by filename
* | | | Merge pull request #629 from Subv/depth_testbunnei2018-07-052-9/+29
|\ \ \ \ | | | | | | | | | | GPU: Allow using the old NV04 values for the depth test function.
| * | | | GPU: Allow using the old NV04 values for the depth test function.Subv2018-07-052-9/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These seem to be just a valid as the GL token values. Thanks @ReinUsesLisp This restores graphical output to Disgaea 5
* | | | | Merge pull request #626 from Subv/shader_syncbunnei2018-07-052-0/+12
|\ \ \ \ \ | |/ / / / |/| | | | GPU: Stub the shader SYNC and DEPBAR instructions.
| * | | | GPU: Stub the shader SYNC and DEPBAR instructions.Subv2018-07-042-0/+12
| |/ / / | | | | | | | | | | | | It is unknown at this moment if we actually need to do something with these instructions or if the GLSL compiler takes care of that for us.
* | | | Merge pull request #624 from Subv/f2f_roundbunnei2018-07-051-0/+3
|\ \ \ \ | | | | | | | | | | GPU: Implemented the F2F 'round' rounding mode.
| * | | | GPU: Implemented the F2F 'round' rounding mode.Subv2018-07-041-0/+3
| |/ / / | | | | | | | | | | | | It's implemented via the GLSL 'roundEven()' function.
* | | | Merge pull request #623 from Subv/vertex_typesbunnei2018-07-051-0/+8
|\ \ \ \ | | | | | | | | | | GPU: Implement the Size_16_16 and Size_10_10_10_2 vertex attribute types
| * | | | GPU: Implement the Size_16_16 and Size_10_10_10_2 vertex attribute types.Subv2018-07-041-0/+8
| |/ / / | | | | | | | | | | | | Both signed and unsigned variants.
* | | | Merge pull request #622 from Subv/unused_texbunnei2018-07-052-2/+5
|\ \ \ \ | | | | | | | | | | GPU: Ignore unused textures and corrected the TEX shader instruction decoding.
| * | | | GPU: Ignore textures that the GLSL compiler deemed unused when binding textures to the shaders.Subv2018-07-041-1/+4
| | | | |
| * | | | GPU: Corrected the decoding for the TEX shader instruction.Subv2018-07-041-1/+1
| |/ / /
* | | | Merge pull request #621 from Subv/psetp_bunnei2018-07-052-0/+43
|\ \ \ \ | | | | | | | | | | GPU: Implemented the PSETP shader instruction.
| * | | | GPU: Implemented the PSETP shader instruction.Subv2018-07-042-0/+43
| |/ / / | | | | | | | | | | | | It's similar to the isetp and fsetp instructions but it works on predicates instead.
* | | | Merge pull request #620 from Subv/depth_z32fbunnei2018-07-053-2/+15
|\ \ \ \ | | | | | | | | | | GPU: Implemented the 32 bit float depth buffer format.
| * | | | GPU: Implemented the 32 bit float depth buffer format.Subv2018-07-043-2/+15
| |/ / /
* | | | Merge pull request #619 from Subv/flip_cullbunnei2018-07-042-3/+29
|\ \ \ \ | |/ / / |/| | | GPU: Flip the triangle front face winding if the GPU is configured to not flip the triangles.
| * | | GPU: Flip the triangle front face winding if the GPU is configured to not flip the triangles.Subv2018-07-042-3/+29
|/ / / | | | | | | | | | | | | | | | OpenGL's default behavior is already correct when the GPU is configured to flip the triangles. This fixes 1-2 Switch's splash screen.
* | | Merge pull request #618 from Subv/clear_used_buffersbunnei2018-07-044-17/+48
|\ \ \ | | | | | | | | GPU: Only configure the used framebuffers during clear.
| * | | GPU: Only configure the used framebuffers during clear.Subv2018-07-044-17/+48
|/ / / | | | | | | | | | Don't try to configure the color buffer if it is not being cleared, it may not be completely valid at this point.
* | | Merge pull request #609 from Subv/clear_buffersbunnei2018-07-045-16/+105
|\ \ \ | | | | | | | | GPU: Implemented the CLEAR_BUFFERS register.
| * | | GPU: Factor out the framebuffer configuration code for both Clear and Draw commands.Subv2018-07-032-72/+39
| | | |
| * | | GPU: Support clears that don't clear the color buffer.Subv2018-07-032-6/+17
| | | |
| * | | GPU: Bind and clear the render target when the CLEAR_BUFFERS register is written to.Subv2018-07-034-0/+86
| | | |
| * | | GPU: Added registers for the CLEAR_BUFFERS and CLEAR_COLOR methods.Subv2018-07-031-2/+27
| | | |
* | | | Merge pull request #616 from bunnei/s8z24bunnei2018-07-043-11/+83
|\ \ \ \ | | | | | | | | | | gl_rasterizer_cache: Implement PixelFormat S8Z24.
| * | | | gl_rasterizer_cache: Implement PixelFormat S8Z24.bunnei2018-07-033-11/+83
| | | | |
* | | | | Merge pull request #613 from jroweboy/qt-stylebunnei2018-07-032-0/+7
|\ \ \ \ \ | |/ / / / |/| | | | Add qt windowsvistastyle dll to the build
| * | | | Add qt windowsvistastyle dll to the buildJames Rowe2018-07-032-0/+7
|/ / / /
* | | | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * voice section updating * fixed slight offset miscalculation * fixed overflow
* | | | Merge pull request #607 from jroweboy/loggingbunnei2018-07-03116-887/+1261
|\ \ \ \ | | | | | | | | | | Logging - Customizable backends
| * | | | Fix build and address review feedbackbunnei2018-07-032-4/+5
| | | | |
| * | | | Add configurable logging backendsJames Rowe2018-07-0314-22/+408
| | | | |
| * | | | Update clang formatJames Rowe2018-07-0337-154/+141
| | | | |
| * | | | Rename logging macro back to LOG_*James Rowe2018-07-03105-730/+730
| |/ / /
* | | | Merge pull request #612 from bunnei/fix-cullbunnei2018-07-031-2/+5
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Only set cull mode and front face if enabled.
| * | | | gl_rasterizer: Only set cull mode and front face if enabled.bunnei2018-07-031-2/+5
| |/ / /
* | | | Merge pull request #611 from Subv/enabled_depth_testbunnei2018-07-032-9/+13
|\ \ \ \ | | | | | | | | | | GPU: Don't try to parse the depth test function if the depth test is disabled and use only the least significant 3 bits in the depth test func
| * | | | GPU: Use only the least significant 3 bits when reading the depth test func.Subv2018-07-031-9/+9
| | | | | | | | | | | | | | | | | | | | Some games set the full GL define value here (including nouveau), but others just seem to set those last 3 bits.
| * | | | GPU: Don't try to parse the depth test function if the depth test is disabled.Subv2018-07-031-0/+4
| |/ / /
* | | | Merge pull request #610 from Subv/mufu_8bunnei2018-07-032-0/+5
|\ \ \ \ | |/ / / |/| | | GPU: Implemented MUFU suboperation 8, sqrt.
| * | | GPU: Implemented MUFU suboperation 8, sqrt.Subv2018-07-032-0/+5
| | | |
* | | | Merge pull request #608 from Subv/depthbunnei2018-07-039-32/+246
|\ \ \ \ | | | | | | | | | | GPU: Implemented the depth buffer and depth test + culling
| * | | | GPU: Set up the culling configuration on each draw.Subv2018-07-031-6/+8
| | | | |
| * | | | GPU: Set up the depth test state on every draw.Subv2018-07-022-0/+14
| | | | |
| * | | | MaxwellToGL: Added conversion functions for depth test and cull mode.Subv2018-07-021-0/+50
| | | | |
| * | | | GPU: Added registers for depth test and cull mode.Subv2018-07-021-3/+51
| | | | |
| * | | | GPU: Implemented the Z24S8 depth format and load the depth framebuffer.Subv2018-07-027-24/+124
| |/ / /
* | | | Merge pull request #606 from Subv/base_vertexSebastian Valle2018-07-022-8/+15
|\ \ \ \ | | | | | | | | | | GPU: Fixed the index offset and implement BaseVertex when doing indexed rendering.
| * | | | GPU: Implement offsetted rendering when using non-indexed drawing.Subv2018-07-021-1/+1
| | | | |
| * | | | GPU: Fixed the index offset rendering, and implemented the base vertex functionality.Subv2018-07-021-6/+8
| | | | | | | | | | | | | | | | | | | | This fixes Stardew Valley.
| * | | | GPU: Added register definitions for the vertex buffer base element.Subv2018-07-021-1/+6
| |/ / /
* | | | Merge pull request #603 from Subv/nvmap_freeSebastian Valle2018-07-023-4/+16
|\ \ \ \ | | | | | | | | | | GPU: Remove unmapped surfaces from the rasterizer cache and fix our nvmap::Free behavior.
| * | | | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
| | | | |
| * | | | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
| | | | | | | | | | | | | | | | | | | | This behavior is confirmed by reverse engineering.
* | | | | Merge pull request #605 from Subv/dma_copySebastian Valle2018-07-021-1/+5
|\ \ \ \ \ | | | | | | | | | | | | GPU: Directly copy the pixels when performing a same-layout DMA.
| * | | | | GPU: Directly copy the pixels when performing a same-layout DMA.Subv2018-07-021-1/+5
| |/ / / /
* | | | | Merge pull request #604 from Subv/invalid_texturesbunnei2018-07-023-3/+12
|\ \ \ \ \ | |_|/ / / |/| | | | GPU: Ignore invalid and disabled textures when drawing.
| * | | | GPU: Ignore disabled textures and textures with an invalid address.Subv2018-07-022-1/+10
| | | | |
| * | | | GPU: Allow GpuToCpuAddress to return boost::none for unmapped addresses.Subv2018-07-021-2/+2
| |/ / /
* | | | Merge pull request #602 from Subv/mufu_subopbunnei2018-07-012-6/+1
|\ \ \ \ | | | | | | | | | | GPU: Corrected the size of the MUFU subop field, and removed incorrect "min" operation.
| * | | | GPU: Corrected the size of the MUFU subop field, and removed incorrect "min" operation.Subv2018-06-302-6/+1
| |/ / /
* | | | Merge pull request #601 from Subv/rgba32_uibunnei2018-07-014-25/+48
|\ \ \ \ | | | | | | | | | | GPU: Implement the RGBA32_UINT rendertarget format.
| * | | | GPU: Implemented the RGBA32_UINT rendertarget format.Subv2018-06-304-9/+28
| | | | |
| * | | | GLCache: Specify the component type along the texture type in the format tuple.Subv2018-06-301-17/+21
| |/ / /
* | | | Merge pull request #600 from bunnei/pred-not-eq-nanbunnei2018-07-012-17/+24
|\ \ \ \ | |/ / / |/| | | gl_shader_decompiler: Implement predicate NotEqualWithNan.
| * | | gl_shader_decompiler: Implement predicate NotEqualWithNan.bunnei2018-06-302-17/+24
|/ / /
* | | Merge pull request #595 from bunnei/raster-cachebunnei2018-06-2915-1454/+425
|\ \ \ | | | | | | | | Rewrite the OpenGL rasterizer cache
| * | | gl_rasterizer_cache: Only dereference color_surface/depth_surface if valid.bunnei2018-06-291-2/+6
| | | |
| * | | gl_rasterizer_cache: Implement caching for texture and framebuffer surfaces.bunnei2018-06-273-16/+168
| | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Improved cache management based on Citra's implementation. gl_surface_cache: Add some docstrings.
| * | | gl_rasterizer_cache: Various fixes for ASTC handling.bunnei2018-06-272-35/+39
| | | |
| * | | gl_rasterizer_cache: Use SurfaceParams as a key for surface caching.bunnei2018-06-272-43/+72
| | | |
| * | | maxwell_3d: Add a struct for RenderTargetConfig.bunnei2018-06-271-17/+19
| | | |
| * | | settings: Add a configuration for use_accurate_framebuffers.bunnei2018-06-277-0/+21
| | | |
| * | | gl_rasterizer: Implement AccelerateDisplay to forward textures to framebuffers.bunnei2018-06-276-8/+62
| | | |
| * | | gl_rasterizer_cache: Cache size_in_bytes as a const per surface.bunnei2018-06-272-9/+13
| | | |
| * | | gl_rasterizer_cache: Refactor to make SurfaceParams members const.bunnei2018-06-272-52/+37
| | | |
| * | | gl_rasterizer_cache: Remove Citra's rasterizer cache, always load/flush surfaces.bunnei2018-06-274-1494/+210
| | | |
* | | | Merge pull request #588 from mailwl/hwopusbunnei2018-06-284-0/+53
|\ \ \ \ | | | | | | | | | | Service/Audio: add hwopus service, stub GetWorkBufferSize function
| * | | | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-254-0/+53
| | |/ / | |/| |
* | | | gl_shader_decompiler: Add a return path for unknown instructions.bunnei2018-06-271-0/+1
| |/ / |/| |
* | | Merge pull request #594 from bunnei/max-constbuffbunnei2018-06-272-1/+7
|\ \ \ | | | | | | | | gl_rasterizer: Workaround for when exceeding max UBO size.
| * | | gl_rasterizer: Workaround for when exceeding max UBO size.bunnei2018-06-272-1/+7
|/ / /
* | | Merge pull request #593 from bunnei/fix-swizzlebunnei2018-06-275-12/+20
|\ \ \ | | | | | | | | gl_state: Fix state management for texture swizzle.
| * | | gl_state: Fix state management for texture swizzle.bunnei2018-06-265-12/+20
| | | |
* | | | Merge pull request #592 from bunnei/cleanup-gl-statebunnei2018-06-272-94/+0
|\ \ \ \ | | | | | | | | | | gl_state: Remove unused state management from 3DS.
| * | | | gl_state: Remove unused state management from 3DS.bunnei2018-06-262-94/+0
| |/ / /
* | | | Merge pull request #591 from bunnei/fix-rgb565bunnei2018-06-271-1/+1
|\ \ \ \ | |/ / / |/| | | gl_rasterizer_cache: Fix inverted B5G6R5 format.
| * | | gl_rasterizer_cache: Fix inverted B5G6R5 format.bunnei2018-06-261-1/+1
|/ / /
* | | Merge pull request #590 from bunnei/rm-ssbo-checkbunnei2018-06-261-2/+0
|\ \ \ | | | | | | | | yuzu: Remove SSBOs check from Qt frontend.
| * | | yuzu: Remove SSBOs check from Qt frontend.bunnei2018-06-261-2/+0
|/ / /
* | | Merge pull request #554 from Subv/constbuffer_ubobunnei2018-06-264-18/+39
|\ \ \ | | | | | | | | Rasterizer: Use UBOs instead of SSBOs for uploading const buffers.
| * | | Rasterizer: Use UBOs instead of SSBOs for uploading const buffers.Subv2018-06-104-18/+39
| | | | | | | | | | | | | | | | This should help a bit with GPU performance once we're GPU-bound.
* | | | Merge pull request #589 from mailwl/fix-crashbunnei2018-06-261-2/+4
|\ \ \ \ | | | | | | | | | | Fix crash at exit
| * | | | Fix crash at exitmailwl2018-06-251-2/+4
| | |/ / | |/| |
* / | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ / / | | | | | | | | | | | | | | | | | | | | | * We should be returning our revision instead of what is requested. Hardware test on a 5.1.0 console * Added sysversion comment
* | | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader According to game symbols(SMO), there's references to UpdateDataHeader which seems to be what AudioRendererResponse actually is * oops * AudioRendererParameters should be AudioRendererParameter according to SMO
* | | Revert "Use Ninja for MSVC AppVeyor builds" (#584)bunnei2018-06-236-17/+9
| | |
* | | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
| | | | | | | | | | | | | | | * Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly This fixes RequestUpdateAudioRenderer deadlocks in games like Puyo Puyo Tetris and games which require a proper section size in games such as Retro City Rampage. This fixes causes various games to start rendering or trying to render
* | | Merge pull request #526 from janisozaur/appveyor-ninjabunnei2018-06-226-9/+17
|\ \ \ | | | | | | | | Use Ninja for MSVC AppVeyor builds
| * | | Use Ninja for MSVC AppVeyor buildsMichał Janiszewski2018-06-055-8/+16
| | | |
| * | | Drop /std:c++latest from MSVC command lineMichał Janiszewski2018-06-051-1/+1
| | | | | | | | | | | | | | | | CMake already sets it to version 17 in all cases
* | | | Merge pull request #579 from SciresM/masterbunnei2018-06-2212-9/+312
|\ \ \ \ | | | | | | | | | | svc: Fully implement svcSignalToAddress and svcWaitForAddress
| * | | | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-224-17/+27
| | | | |
| * | | | Add additional missing format.Michael Scire2018-06-222-21/+27
| | | | |
| * | | | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| | | | |
| * | | | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| | | | |
| * | | | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-213-1/+7
| | | | |
| * | | | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| | | | |
| * | | | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-215-11/+111
| | | | |
| * | | | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-215-6/+71
| | | | |
| * | | | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
| | | | |
* | | | | Merge pull request #581 from mailwl/empty-buf-skipbunnei2018-06-221-0/+5
|\ \ \ \ \ | | | | | | | | | | | | IPC: skip empty buffer write
| * | | | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
|/ / / / / | | | | | | | | | | | | | | | prevent yuzu crash, if games, like Axiom Verge, trying to read 0 bytes from file
* | | | | Merge pull request #577 from mailwl/audren-updatebunnei2018-06-222-49/+60
|\ \ \ \ \ | | | | | | | | | | | | Service/Audio: update audren:u service
| * | | | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
| |/ / / /
* / / / / Add support for decrypted NCA files (#567)Zach Hilman2018-06-2110-16/+453
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Start to add NCA support in loader * More nca stuff * More changes to nca.cpp * Now identifies decrypted NCA cont. * Game list fixes and more structs and stuff * More updates to Nca class * Now reads ExeFs (i think) * ACTUALLY LOADS EXEFS! * RomFS loads and games execute * Cleanup and Finalize * plumbing, cleanup and testing * fix some things that i didnt think of before * Preliminary Review Changes * Review changes for bunnei and subv
* | | | Merge pull request #576 from Subv/warnings1bunnei2018-06-2012-22/+24
|\ \ \ \ | | | | | | | | | | Build: Fixed some MSVC warnings in various parts of the code.
| * | | | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-2012-22/+24
|/ / / /
* | | | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement GetAvailableLanguageCodes2 * Revert "Implement GetAvailableLanguageCodes2" This reverts commit caadd9eea3497ae2a13382aecb8ca29e1c02c5af. * Implement GetAvailableLanguageCodes2 * Implement GetAvailableLanguageCodes2
* | | | Merge pull request #574 from Subv/shader_abs_negbunnei2018-06-191-7/+14
|\ \ \ \ | | | | | | | | | | GPU: Perform negation after absolute value in the float shader instructions.
| * | | | GPU: Perform negation after absolute value in the float shader instructions.Subv2018-06-191-7/+14
| | | | |
* | | | | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \ \ \ \ | | | | | | | | | | | | Avoid initializing single-joycon layouts with handheld controller
| * | | | | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| | | | | |
| * | | | | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| | | | | |
| * | | | | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
| | | | | |
* | | | | | Merge pull request #573 from Subv/shader_immbunnei2018-06-192-14/+18
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | GPU: Don't mark uniform buffers and registers as used for instructions which don't have them.
| * | | | | GPU: Don't mark uniform buffers and registers as used for instructions which don't have them.Subv2018-06-192-14/+18
|/ / / / / | | | | | | | | | | | | | | | | | | | | Like the MOV32I and FMUL32I instructions. This fixes a potential crash when using these instructions.
* | | | | Merge pull request #570 from bunnei/astcbunnei2018-06-196-1/+1709
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Implement texture format ASTC_2D_4X4.
| * | | | | gl_rasterizer: Implement texture format ASTC_2D_4X4.bunnei2018-06-186-1/+1709
| | | | | |
* | | | | | Merge pull request #562 from DarkLordZach/extracted-ncas-uibunnei2018-06-184-3/+50
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add UI support for extracted NCA folders
| * | | | | | Bug fixes, testing, and review changesZach Hilman2018-06-142-7/+20
| | | | | | |
| * | | | | | Add 'Load Folder' menu optionZach Hilman2018-06-143-0/+17
| | | | | | |
| * | | | | | Add support for main files in file pickerZach Hilman2018-06-141-0/+2
| | | | | | |
| * | | | | | Recognize main files in game listZach Hilman2018-06-141-2/+17
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Add a stub for UserExceptionContextAddr.
| * | | | | | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
| | | | | | |
* | | | | | | Merge pull request #571 from Armada651/loose-blendbunnei2018-06-181-1/+1
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | gl_rasterizer: Get loose on independent blending.
| * | | | | | gl_rasterizer: Get loose on independent blending.Jules Blok2018-06-181-1/+1
| | | | | | |
* | | | | | | Merge pull request #569 from bunnei/fix-cachebunnei2018-06-181-26/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer_cache: Loosen things up a bit.
| * | | | | | | gl_rasterizer_cache: Loosen things up a bit.bunnei2018-06-181-26/+8
|/ / / / / / /
* | | | | | | Merge pull request #568 from bunnei/lopbunnei2018-06-172-63/+84
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_decompiler: Implement LOP instructions.
| * | | | | | gl_shader_decompiler: Implement LOP instructions.bunnei2018-06-172-6/+42
| | | | | | |
| * | | | | | gl_shader_decompiler: Refactor LOP32I instruction a bit in support of LOP.bunnei2018-06-172-57/+42
|/ / / / / /
* | | | | | Merge pull request #565 from bunnei/shader_conversionsbunnei2018-06-162-14/+43
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Implement register size conversions for I2I and I2F.
| * | | | | | gl_shader_decompiler: Implement integer size conversions for I2I/I2F/F2I.bunnei2018-06-162-14/+43
|/ / / / / /
* | | | | | Merge pull request #564 from bunnei/lop32i_passbbunnei2018-06-161-6/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Implement LOP32I LogicOperation PassB.
| * | | | | | gl_shader_decompiler: Implement LOP32I LogicOperation PassB.bunnei2018-06-161-6/+12
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #566 from bunnei/set_pos_wbunnei2018-06-161-0/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gl_shader_gen: Set position.w to 1.
| * | | | | gl_shader_gen: Set position.w to 1.bunnei2018-06-161-0/+4
|/ / / / /
* | | | | Merge pull request #560 from Subv/crash_widgetbunnei2018-06-136-292/+0
|\ \ \ \ \ | | | | | | | | | | | | Qt: Removed the Registers widget.
| * | | | | Qt: Removed the Registers widget.Subv2018-06-136-292/+0
| | |_|_|/ | |/| | | | | | | | | | | | | It was crashing and nobody actually uses this.
* | | | | Merge pull request #556 from Subv/dma_enginebunnei2018-06-127-1/+237
|\ \ \ \ \ | | | | | | | | | | | | GPU: Partially implemented the Maxwell DMA engine.
| * | | | | GPU: Partially implemented the Maxwell DMA engine.Subv2018-06-127-1/+237
| | | | | | | | | | | | | | | | | | | | | | | | Only tiled->linear and linear->tiled copies that aren't offsetted are supported for now. Queries are not supported. Swizzled copies are not supported.
* | | | | | Merge pull request #558 from Subv/iadd32ibunnei2018-06-122-2/+31
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Implemented the iadd32i shader instruction.
| * | | | | | GPU: Implemented the iadd32i shader instruction.Subv2018-06-122-2/+31
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #557 from shinyquagsire23/libnx-hid-fixbunnei2018-06-122-2/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTO
| * | | | | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ / / / /
* | | | | | Merge pull request #552 from bunnei/sat-fmulbunnei2018-06-122-39/+32
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gl_shader_decompiler: Implement saturate for float instructions.
| * | | | | gl_shader_decompiler: Implement saturate for float instructions.bunnei2018-06-122-39/+32
|/ / / / /
* | | | | Merge pull request #555 from Subv/gpu_sysregsbunnei2018-06-111-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | GPU: Convert the gl_InstanceId and gl_VertexID variables to floats when reading from them.
| * | | | GPU: Convert the gl_InstanceId and gl_VertexID variables to floats when reading from them.Subv2018-06-101-1/+1
|/ / / / | | | | | | | | | | | | This corrects the invalid position values in some games when doing attribute-less rendering.
* | | | Merge pull request #553 from Subv/isetbunnei2018-06-102-2/+53
|\ \ \ \ | |_|_|/ |/| | | GPU: Implement the ISET family of shader instructions.
| * | | GPU: Implement the iset family of shader instructions.Subv2018-06-092-2/+46
| | | |
| * | | GPU: Added decodings for the ISET family of instructions.Subv2018-06-091-0/+7
|/ / /
* | | Merge pull request #550 from Subv/ssybunnei2018-06-092-0/+7
|\ \ \ | | | | | | | | GPU: Stub the SSY shader instruction.
| * | | GPU: Stub the SSY shader instruction.Subv2018-06-092-0/+7
| | | | | | | | | | | | | | | | This instruction tells the GPU where the flow reconverges in a non-uniform control flow scenario, we can ignore this when generating GLSL code.
* | | | Merge pull request #551 from bunnei/shrbunnei2018-06-092-0/+17
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Implement SHR instruction.
| * | | | gl_shader_decompiler: Implement SHR instruction.bunnei2018-06-092-0/+17
| |/ / /
* | | | Merge pull request #549 from bunnei/iaddbunnei2018-06-092-19/+55
|\ \ \ \ | |/ / / |/| | | gl_shader_decompiler: Implement IADD instruction.
| * | | gl_shader_decompiler: Implement IADD instruction.bunnei2018-06-092-11/+37
| | | |
| * | | gl_shader_decompiler: Add missing asserts for saturate_a instructions.bunnei2018-06-092-8/+18
|/ / /
* | | Merge pull request #505 from janisozaur/ccache-travisbunnei2018-06-095-7/+17
|\ \ \ | | | | | | | | Enable ccache usage on Travis
| * | | Cache ccache on TravisMichał Janiszewski2018-06-071-0/+4
| | | |
| * | | Add ccache support for macOS on TravisMichał Janiszewski2018-06-072-1/+5
| | | |
| * | | Add ccache support for Linux on TravisMichał Janiszewski2018-06-072-2/+8
| | | |
| * | | Install cmake from repositories for UbuntuMichał Janiszewski2018-06-071-5/+1
| | | | | | | | | | | | | | | | Ubuntu 18.04 already has cmake 3.10.2
* | | | Merge pull request #533 from mailwl/array-to-bufferbunnei2018-06-093-22/+15
|\ \ \ \ | | | | | | | | | | Common/string_util: add StringFromBuffer() function
| * | | | Common/string_util: add StringFromBuffer functionmailwl2018-06-073-22/+15
| | | | | | | | | | | | | | | | | | | | convert input buffer (std::vector<u8>) to string, stripping zero chars
* | | | | Merge pull request #548 from Subv/blendbunnei2018-06-093-47/+47
|\ \ \ \ \ | | | | | | | | | | | | GPU: Fixed ghosting when drawing with blending disabled
| * | | | | GPU: Synchronize the blend state on every draw call.Subv2018-06-092-16/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only independent blending on render target 0 is implemented for now. This fixes the elongated squids in Splatoon 2's boot screen.
| * | | | | GPU: Added registers for normal and independent blending.Subv2018-06-092-31/+27
|/ / / / /
* | | | | Merge pull request #547 from Subv/compressed_alignmentbunnei2018-06-081-2/+7
|\ \ \ \ \ | | | | | | | | | | | | GLCache: Align compressed texture sizes to their compression ratio, and then align that compressed size to the block height for tiled textures.
| * | | | | GLCache: Align compressed texture sizes to their compression ratio, and then align that compressed size to the block height for tiled textures.Subv2018-06-081-2/+7
| | |/ / / | |/| | | | | | | | | | | | | This fixes issues with retrieving non-block-aligned tiled compressed textures from the cache.
* | | | | Merge pull request #546 from Subv/flush_ubo_bufferbunnei2018-06-081-0/+3
|\ \ \ \ \ | |/ / / / |/| | | | Rasterizer: Flush the written region when writing shader uniform data before copying it to the uniform buffers.
| * | | | Rasterizer: Flush the written region when writing shader uniform data before copying it to the uniform buffers.Subv2018-06-081-0/+3
|/ / / / | | | | | | | | | | | | This fixes the flip_viewport uniform having invalid values when drawing.
* | | | Merge pull request #478 from janisozaur/patch-1bunnei2018-06-071-3/+3
|\ \ \ \ | | | | | | | | | | Use Ninja for Travis builds
| * | | | Use Ninja for Travis buildsMichał Janiszewski2018-05-281-3/+3
| | | | |
* | | | | Merge pull request #543 from Subv/uniformsbunnei2018-06-071-3/+4
|\ \ \ \ \ | |_|/ / / |/| | | | GLRenderer: Write the shader stage configuration UBO data *before* copying it to the GPU.
| * | | | GLRenderer: Write the shader stage configuration UBO data *before* copying it to the GPU.Subv2018-06-071-3/+4
| | | | | | | | | | | | | | | | | | | | This should fix the bug with the vs_config UBO being uninitialized during shader execution.
* | | | | Merge pull request #522 from mailwl/mm-ubunnei2018-06-076-0/+85
|\ \ \ \ \ | | | | | | | | | | | | Service/MM: add service and stub some functions
| * | | | | Remove unused header filesmailwl2018-06-061-2/+0
| | | | | |
| * | | | | Small fixesmailwl2018-06-052-6/+8
| | | | | |
| * | | | | Service/MM: add service and stub some functionsmailwl2018-06-056-0/+85
| | | | | |
* | | | | | Merge pull request #542 from bunnei/bfe_immbunnei2018-06-072-7/+44
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Implement BFE_IMM instruction.
| * | | | | | gl_shader_decompiler: Implement BFE_IMM instruction.bunnei2018-06-072-7/+44
| | | | | | |
* | | | | | | Merge pull request #541 from Subv/blittexturesbunnei2018-06-071-56/+9
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GLCache: Fixed copying compressed textures in the rasterizer cache.
| * | | | | | GLCache: Use the full uncompressed size when blitting from one texture to another.Subv2018-06-071-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This avoids the problem of only copying a tiny piece of the textures when they are compressed.
| * | | | | | GLCache: Simplify the logic to copy from one texture to another in BlitTextures.Subv2018-06-071-53/+3
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | We now use glCopyImageSubData, this should avoid errors with trying to attach a compressed texture as a framebuffer's color attachment and then blitting to it. Maybe in the future we can change this to glCopyTextureSubImage which only requires GL_ARB_direct_state_access.
* | | | | | Merge pull request #539 from bunnei/f2f-roundingbunnei2018-06-072-10/+35
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: F2F: Implement rounding modes.
| * | | | | | gl_shader_decompiler: F2F: Implement rounding modes.bunnei2018-06-072-10/+35
| | | | | | |
* | | | | | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Service/nfp:user : stub some functions.
| * | | | | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| | | | | | |
| * | | | | | Correct function resultsmailwl2018-06-041-4/+16
| | | | | | |
| * | | | | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by Zelda: BoTW
* | | | | | | Merge pull request #537 from bunnei/misc-shaderbunnei2018-06-072-8/+24
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Additional decodings, remove unused stuff from TEX
| * | | | | | | gl_shader_decompiler: Remove some attribute stuff that has nothing to do with TEX/TEXS.bunnei2018-06-071-8/+4
| | | | | | | |
| * | | | | | | shader_bytecode: Add instruction decodings for BFE, IMNMX, and XMAD.bunnei2018-06-071-0/+20
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #535 from Subv/gpu_swizzlebunnei2018-06-076-0/+65
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU: Support changing the texture swizzles for Maxwell textures.
| * | | | | | | GPU: Support changing the texture swizzles for Maxwell textures.Subv2018-06-073-0/+45
| | | | | | | |
| * | | | | | | GLState: Support changing the GL_TEXTURE_SWIZZLE parameter of each texture unit.Subv2018-06-073-0/+20
| |/ / / / / /
* | | | | | | Merge pull request #536 from bunnei/isetp_immbunnei2018-06-071-8/+9
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_decompiler: Implement ISETP_IMM instruction.
| * | | | | | gl_shader_decompiler: Implement ISETP_IMM instruction.bunnei2018-06-071-8/+9
|/ / / / / /
* | | | | | Merge pull request #534 from Subv/multitexturingbunnei2018-06-079-69/+172
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Implement sampling multiple textures in the generated glsl shaders.
| * | | | | | GPU: Implement sampling multiple textures in the generated glsl shaders.Subv2018-06-069-69/+172
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All tested games that use a single texture show no regression. Only Texture2D textures are supported right now, each shader gets its own "tex_fs/vs/gs" sampler array to maintain independent textures between shader stages, the textures themselves are reused if possible.
* | | | | | | Merge pull request #532 from bunnei/ld_cbunnei2018-06-074-28/+110
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_decompiler: Implement LD_C instruction.
| * | | | | | gl_shader_decompiler: Implement LD_C instruction.bunnei2018-06-072-0/+43
| | | | | | |
| * | | | | | gl_shader_gen: Add uniform handling for indirect const buffer access.bunnei2018-06-073-4/+40
| | | | | | |
| * | | | | | gl_shader_decompiler: Refactor uniform handling to allow different decodings.bunnei2018-06-062-26/+29
|/ / / / / /
* | | | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add IoctlCommands with their params in nvidia_ctrl_gpu.h * add function related to the changes done previously * fix clang-format * delete trailing whitespace * correct mistake
* | | | | | Merge pull request #529 from bunnei/am-nifm-stubsSebastian Valle2018-06-063-2/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | Stub SetConnectionConfirmationOption, GetPseudoDeviceId
| * | | | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| | | | | | |
| * | | | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
| | | | | | |
* | | | | | | Merge pull request #531 from bunnei/fix-shlSebastian Valle2018-06-061-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Fix un/signed mismatch with SHL.
| * | | | | | | gl_shader_decompiler: Fix un/signed mismatch with SHL.bunnei2018-06-061-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #530 from bunnei/wrap-mirrorSebastian Valle2018-06-061-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell_to_gl: Implement WrapMode Mirror.
| * | | | | | | maxwell_to_gl: Implement WrapMode Mirror.bunnei2018-06-061-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #527 from Subv/rgba32f_texcopybunnei2018-06-062-0/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU: Allow the usage of RGBA32_FLOAT and RGBA16_FLOAT in the texture copy engine.
| * | | | | | | GPU: Allow the usage of RGBA16_FLOAT in the texture copy engine.Subv2018-06-061-0/+2
| | | | | | | |
| * | | | | | | GPU: Allow the usage of RGBA32_FLOAT in the texture copy engine.Subv2018-06-062-0/+3
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #528 from Subv/rg11b10fbunnei2018-06-064-12/+31
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU: Implemented the R11FG11FB10F texture and rendertarget formats.
| * | | | | | | GPU: Implemented the R11FG11FB10F texture and rendertarget formats.Subv2018-06-064-11/+30
| | | | | | | |
| * | | | | | | GPU: Fixed the compression factor for RGBA16F textures.Subv2018-06-061-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | They're not compressed.
* | / / / / / GDB Stub Improvements (#508)Hedges2018-06-064-27/+194
| |/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GDB Stub should work now. * Applied clang-format. * Replaced htonll with swap64. * Tidy up.
* | | | | | Merge pull request #516 from Subv/f2i_rbunnei2018-06-062-7/+64
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | GPU: Implemented the F2I_R shader instruction.
| * | | | | GPU: Implemented the F2I_R shader instruction.Subv2018-06-052-7/+64
| | | | | |
* | | | | | Merge pull request #523 from yuzu-emu/revert-507-3616James Rowe2018-06-051-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Revert "Port citra #3616"
| * | | | | | Revert "Port citra #3616"bunnei2018-06-051-1/+1
|/ / / / / /
* | | | | | Merge pull request #521 from Subv/brabunnei2018-06-051-4/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Corrected the branch targets for the shader bra instruction.
| * | | | | | GPU: Corrected the branch targets for the shader bra instruction.Subv2018-06-051-4/+5
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #520 from bunnei/shader-shlbunnei2018-06-052-15/+48
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gl_shader_decompiler: Implement SHL instruction.
| * | | | | gl_shader_decompiler: Fix typo with ISCADD instruction.bunnei2018-06-051-1/+1
| | | | | |
| * | | | | gl_shader_decompiler: Implement SHL instruction.bunnei2018-06-052-14/+47
| | | | | |
* | | | | | Merge pull request #518 from Subv/incomplete_shadersbunnei2018-06-051-5/+16
|\ \ \ \ \ \ | |/ / / / / |/| | | | | GPU: Implemented predicated exit instructions in the shader programs.
| * | | | | GPU: Implement predicated exit instructions in the shader programs.Subv2018-06-051-4/+6
| | | | | |
| * | | | | GPU: Take into account predicated exits when performing shader control flow analysis.Subv2018-06-051-1/+10
| | | | | |
* | | | | | Merge pull request #519 from bunnei/pred-not-equalbunnei2018-06-051-3/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Implement PredCondition::NotEqual.
| * | | | | | gl_shader_decompiler: Implement PredCondition::NotEqual.bunnei2018-06-051-3/+3
|/ / / / / /
* | | | | | Merge pull request #517 from Subv/iscaddbunnei2018-06-052-0/+47
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | GPU: Implement the ISCADD shader instruction.
| * | | | | GPU: Implement the ISCADD shader instructions.Subv2018-06-052-0/+40
| | | | | |
| * | | | | GPU: Added decodings for the ISCADD instructions.Subv2018-06-051-0/+7
|/ / / / /
* | | | | Merge pull request #514 from Subv/lop32ibunnei2018-06-052-1/+58
|\ \ \ \ \ | | | | | | | | | | | | GPU: Implemented the LOP32I instruction.
| * | | | | GPU: Implemented the LOP32I instruction.Subv2018-06-042-1/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #510 from Subv/isetpbunnei2018-06-052-6/+63
|\ \ \ \ \ | | | | | | | | | | | | GPU: Implemented the ISETP_R and ISETP_C instructions
| * | | | | GPU: Use explicit types when retrieving the uniform values for fsetp/fset and isetp instead of the type of an invalid output register.Subv2018-06-041-9/+18
| | | | | |
| * | | | | GPU: Implemented the ISETP_R and ISETP_C shader instructions.Subv2018-06-042-0/+48
| | | | | |
* | | | | | Merge pull request #512 from Subv/fsetbunnei2018-06-052-4/+19
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | GPU: Corrected the FSET and I2F instructions.
| * | | | | GPU: Use the bf bit in FSET to determine whether to write 0xFFFFFFFF or 1.0f.Subv2018-06-042-2/+7
| | | | | |
| * | | | | GPU: Corrected the I2F_R implementation.Subv2018-06-041-2/+12
| | |/ / / | |/| | |
* | | | | Merge pull request #501 from Subv/shader_brabunnei2018-06-052-1/+45
|\ \ \ \ \ | | | | | | | | | | | | GPU: Partially implemented the bra shader instruction
| * | | | | GPU: Partially implemented the shader BRA instruction.Subv2018-06-042-1/+43
| | | | | |
| * | | | | GPU: Added decoding for the BRA instruction.Subv2018-06-041-0/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #515 from Subv/viewport_fixbunnei2018-06-052-14/+30
|\ \ \ \ \ | | | | | | | | | | | | GPU: Calculate the correct viewport dimensions based on the scale and translate registers.
| * | | | | GPU: Calculate the correct viewport dimensions based on the scale and translate registers.Subv2018-06-042-14/+30
| | |/ / / | |/| | | | | | | | | | | | | This is how nouveau calculates the viewport width and height. For some reason some games set 0xFFFF in the VIEWPORT_HORIZ and VIEWPORT_VERT registers, maybe those are a misnomer and actually refer to something else?
* | | | | Merge pull request #490 from BreadFish64/extension-checkbunnei2018-06-044-0/+53
|\ \ \ \ \ | | | | | | | | | | | | Add checks for OpenGL extension support
| * | | | | sdl: add check for GL extension supportBreadFish642018-06-042-0/+26
| | | | | |
| * | | | | qt: add check for GL extension supportBreadFish642018-06-042-0/+27
| | | | | |
* | | | | | Merge pull request #513 from Subv/cache_alignmentbunnei2018-06-041-1/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | GLCache: Corrected a mismatch between storing compressed sizes and verifying the uncompressed alignment in GetSurface.
| * | | | | | GLCache: Corrected a mismatch between storing compressed sizes and verifying the uncompressed alignment in GetSurface.Subv2018-06-041-1/+2
| | |/ / / / | |/| | | |
* | | | | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add some IoctlCommand with their params to nvhost_gpu * fix clang-format * delete trailing whitespace * fix some clang-format * delete one other trailing whitespace * last clang-format fix
* | | | | | Merge pull request #502 from bunnei/more-am-stuffbunnei2018-06-041-4/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | am: Implement PopOutData, and various fixes.
| * | | | | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
| | | | | | |
| * | | | | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
| | | | | | |
| * | | | | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
| |/ / / / /
* | | | | | Merge pull request #507 from valentinvanelslande/3616James Rowe2018-06-041-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Port citra #3616
| * | | | | Port citra #3616Valentin Vanelslande2018-06-041-1/+1
|/ / / / /
* | | | | Merge pull request #499 from bunnei/am-stuffbunnei2018-06-042-66/+105
|\ \ \ \ \ | |_|/ / / |/| | | | am: Implement CreateStorage, PushInData, etc.
| * | | | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
| | | | |
| * | | | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
| | | | |
| * | | | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
| | | | |
| * | | | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
| | | | |
* | | | | Merge pull request #500 from Subv/long_queriesbunnei2018-06-041-9/+24
|\ \ \ \ \ | | | | | | | | | | | | GPU: Partial implementation of long GPU queries.
| * | | | | GPU: Partial implementation of long GPU queries.Subv2018-06-041-9/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Long queries write a 128-bit result value to memory, which consists of a 64 bit query value and a 64 bit timestamp. In this implementation, only select=Zero of the Crop unit is implemented, this writes the query sequence as a 64 bit value, and a 0u64 value for the timestamp, since we emulate an infinitely fast GPU. This specific type was hwtested, but more rigorous tests should be performed in the future for the other types.
* | | | | | Merge pull request #498 from bunnei/texs-maskbunnei2018-06-042-9/+26
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | gl_shader_decompiler: Implement TEXS component mask.
| * | | | | gl_shader_decompiler: Implement TEXS component mask.bunnei2018-06-032-9/+26
|/ / / / /
* | | | | Merge pull request #494 from bunnei/shader-texbunnei2018-06-032-2/+58
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Implement TEX, fixes for TEXS.
| * | | | | gl_shader_decompiler: Implement TEX instruction.bunnei2018-06-012-1/+36
| | | | | |
| * | | | | gl_shader_decompiler: Support multi-destination for TEXS.bunnei2018-06-012-2/+23
| | | | | |
* | | | | | Merge pull request #495 from bunnei/improve-rrobunnei2018-06-032-9/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Implement RRO as a register move.
| * | | | | | gl_shader_decompiler: Implement RRO as a register move.bunnei2018-06-032-9/+18
| |/ / / / /
* | | | | | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-034-0/+74
|\ \ \ \ \ \ | | | | | | | | | | | | | | Services/nvdrv: add '/dev/nvhost-nvdec' device
| * | | | | | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-304-0/+74
| | | | | | |
* | | | | | | Merge pull request #496 from Subv/waitprocesswidekey_timeoutbunnei2018-06-031-2/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.
| * | | | | | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This situation may happen like so: Thread 1 with low priority calls WaitProcessWideKey with timeout. Thread 2 with high priority calls WaitProcessWideKey without timeout. Thread 3 calls SignalProcessWideKey - Thread 2 acquires the lock and awakens. - Thread 1 can't acquire the lock and is put to sleep with the lock owner being Thread 2. Thread 1's timeout expires, with the lock owner still being set to Thread 2.
* | | | | | | Merge pull request #497 from Subv/dxn1bunnei2018-06-033-3/+16
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GPU: Implemented the DXN1 (BC4) texture format.
| * | | | | | GPU: Implemented the DXN1 (BC4) texture format.Subv2018-06-023-3/+16
|/ / / / / /
* | | | | | Merge pull request #492 from mailwl/timebunnei2018-06-012-14/+72
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Service/time: implement posix time to calendar conversion
| * | | | | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
|/ / / / /
* | | | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \ \ \ | | | | | | | | | | | | Kernel/SVC: Corrected the behavior of svcSetThreadCoreMask for core values -2 and -3.
| * | | | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| | | | | |
| * | | | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| | | | | | | | | | | | | | | | | | | | | | | | Also added some proper error handling.
| * | | | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
| | | | | |
* | | | | | Merge pull request #491 from bunnei/rgba16fbunnei2018-06-013-7/+24
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: Implement PixelFormat RGBA16F.
| * | | | | | gl_rasterizer_cache: Assert that component type is UNorm or format is RGBA16F.bunnei2018-05-311-1/+2
| | | | | | |
| * | | | | | gl_rasterizer_cache: Implement PixelFormat RGBA16F.bunnei2018-05-313-6/+22
|/ / / / / /
* | | | | | Merge pull request #489 from Subv/vertexidbunnei2018-05-302-1/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | Shaders: Implemented reading the gl_InstanceID and gl_VertexID variables in the vertex shader.
| * | | | | | Shaders: Implemented reading the gl_InstanceID and gl_VertexID variables in the vertex shader.Subv2018-05-302-1/+11
| |/ / / / /
* | | / / / add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
| |_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add some CommandType * add some hid FunctionInfo * add some other HID FunctionInfo * delete non useful comments
* | | | | Merge pull request #483 from bunnei/sonicSebastian Valle2018-05-305-10/+35
|\ \ \ \ \ | |_|/ / / |/| | | | Several GPU fixes to boot Sonic Mania
| * | | | gl_shader_decompiler: F2F_R instruction: Implement abs.bunnei2018-05-301-1/+7
| | | | |
| * | | | gl_shader_decompiler: Partially implement F2F_R instruction.bunnei2018-05-302-4/+9
| | | | |
| * | | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
| | | | |
| * | | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
| | | | |
| * | | | gl_rasterize_cache: Invert order of tex format RGB565.bunnei2018-05-301-1/+1
| |/ / /
* | | | Merge pull request #482 from Subv/r8bunnei2018-05-303-5/+18
|\ \ \ \ | |/ / / |/| | | GPU: Implemented the R8 texture format (0x1D)
| * | | GPU: Implemented the R8 texture format (0x1D)Subv2018-05-303-5/+18
|/ / /
* | | Merge pull request #480 from mailwl/bcatbunnei2018-05-308-0/+120
|\ \ \ | | | | | | | | Service/BCAT: add module and services
| * | | Service/BCAT: add module and servicesmailwl2018-05-288-0/+120
| |/ /
* / / add all the known TextureFormat (#474)greggameplayer2018-05-291-2/+71
|/ /
* | Merge pull request #472 from bunnei/greater-equalbunnei2018-05-271-4/+3
|\ \ | | | | | | gl_shader_decompiler: Implement GetPredicateComparison GreaterEqual.
| * | gl_shader_decompiler: Implement GetPredicateComparison GreaterEqual.bunnei2018-05-261-4/+3
| | |
* | | Merge pull request #476 from Subv/a1bgr5bunnei2018-05-274-5/+21
|\ \ \ | | | | | | | | GPU: Implemented the A1B5G5R5 texture format (0x14)
| * | | GPU: Implemented the A1B5G5R5 texture format (0x14)Subv2018-05-274-5/+21
| |/ /
* | | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \ \ | | | | | | | | NvOsGetConfigU32 should return null instead of 0 for default output value
| * | | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
| |/ /
* | | Merge pull request #473 from bunnei/get-display-versionbunnei2018-05-272-1/+10
|\ \ \ | | | | | | | | am: Stub IApplicationFunctions GetDisplayVersion.
| * | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
| |/ /
* | | Merge pull request #471 from bunnei/fmnmxSebastian Valle2018-05-272-4/+10
|\ \ \ | |/ / |/| | shader_bytecode: Implement other variants of FMNMX.
| * | shader_bytecode: Implement other variants of FMNMX.bunnei2018-05-262-4/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
| | | | | | | | | | | | | | | | | | | | | | | | * add some InfoType * correct OpenApplicationProxy cmd number * add IDisplayController functions * fix clang-format * add more system languages
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \ | | | | | | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUT
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
| | | | | | | | | | | | Used in Nintendo Labo ToyCon 1&2
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetAudioRendererWorkBufferSize impl Impl of GetAudioRendererWorkBufferSize based on RE, if this can be cleaned up, please contribute! * Naming conventions * Removed unneeded placeholder * lioncache changes * fixed const * switched to Common::AlignUp
* | | Merge pull request #468 from Subv/compound_predsbunnei2018-05-261-46/+66
|\ \ \ | | | | | | | | Shader: Implemented compound predicates in the fset and fsetp instructions
| * | | Shader: Implemented compound predicates in fset.Subv2018-05-251-28/+12
| | | | | | | | | | | | | | | | | | | | | | | | You can specify a predicate in the fset instruction: Result = ((Value1 Comp Value2) OP P0) ? 1.0 : 0.0;
| * | | Shader: Implemented compound predicates in fsetp.Subv2018-05-251-19/+55
| |/ / | | | | | | | | | | | | | | | | | | You can specify three predicates in an fsetp instruction: P1 = (Value1 Comp Value2) OP P0; P2 = !(Value1 Comp Value2) OP P0;
* | | Merge pull request #469 from Subv/channel_rebindbunnei2018-05-261-1/+0
|\ \ \ | | | | | | | | GPU: Allow command lists to rebind a channel to another engine in the middle of the command list.
| * | | GPU: Allow command lists to rebind a channel to another engine in the middle of the command list.Subv2018-05-251-1/+0
| |/ /
* / / Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ / | | | | We have no clue on what this actually does yet so stubbing it since it's just input only should be fine for now
* | Merge pull request #464 from bunnei/fix-msvcbunnei2018-05-241-14/+12
|\ \ | | | | | | yuzu_cmd: Fix project for latest msvc.
| * | yuzu_cmd: Fix project for latest msvc.bunnei2018-05-241-14/+12
|/ /
* | Merge pull request #462 from ogniK5377/hid-fixbunnei2018-05-241-1/+1
|\ \ | | | | | | Fix deadlocks caused from HID having too many layouts
| * | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
|/ / | | | | | | Games such as SMO deadlock if we have more than 2 layouts
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \ | | | | | | Add & correct some error modules
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
| | |
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \ | | | | | | | | Add ioctl commands with their params and size check
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| | | | | | | | | | | | according to the changes made previously
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| | | |
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #461 from lioncash/dynarmicbunnei2018-05-231-0/+0
|\ \ \ | | | | | | | | externals: Update dynarmic
| * | | externals: Update dynarmicLioncash2018-05-231-0/+0
|/ / / | | | | | | | | | Updates dynarmic to revision 990a569b7a5f2518fe08682f5ebf8536e5388d66
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| | |
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| | |
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
| | |
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE struct + 4 seems to be hard coded at 0 and struct + 0 seems to be ignored? * IocGetWaitbase -> IocChannelGetWaitbaseCommand * Added super late fixes
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-216-1/+118
|\ \ \ | | | | | | | | Implemented nvhost-as-gpu's UnmapBuffer and nvmap's Free ioctls.
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| | | | | | | | | | | | | | | | It releases a reference to an nvmap object
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-204-0/+70
| |/ / | | | | | | | | | It removes a mapping previously created with the MapBufferEx ioctl.
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add unknown function at the number command 2 * correct audout:u commands numbers * correct audrec:u cmd number & add Unknown function * correct IAudioDevice command numbers * correct codecctl cmd numbers & rename the 8 function * correct place of unknown function & fix clang-format
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \ | | | | | | | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ / | | | | | | | | | A thread may own multiple mutexes at the same time, and only release one of them while other threads are waiting for the other mutexes.
* | | Merge pull request #458 from Subv/fmnmxbunnei2018-05-212-6/+26
|\ \ \ | | | | | | | | Shaders: Implemented the FMNMX shader instruction.
| * | | Shaders: Implemented the FMNMX shader instruction.Subv2018-05-212-6/+26
| |/ /
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \ | | | | | | | | Properly rename functions of Fatal Module & add ThrowFatal to this module
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| | | |
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| | | |
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #453 from Subv/thread_callstackSebastian Valle2018-05-212-0/+37
|\ \ \ | | | | | | | | Qt/WaitTree: Display the callstack for each thread in the wait tree widget
| * | | Qt/WaitTree: Display the callstack for each thread in the wait tree widget.Subv2018-05-192-0/+37
| |/ /
* | | Merge pull request #452 from Subv/psetpSebastian Valle2018-05-211-0/+3
|\ \ \ | | | | | | | | ShadersDecompiler: Added decoding for the PSETP instruction.
| * | | ShadersDecompiler: Added decoding for the PSETP instruction.Subv2018-05-191-0/+3
| |/ /
* | | Merge pull request #451 from Subv/gl_array_sizeSebastian Valle2018-05-212-13/+3
|\ \ \ | | | | | | | | GLRenderer: Remove unused vertex buffer and increase the size of the stream buffer to 128 MB.
| * | | GLRenderer: Remove unused hw_vao_enabled_attributes variable.Subv2018-05-192-4/+0
| | | |
| * | | GLRenderer: Remove unused vertex buffer and increase the size of the stream buffer to 128 MB.Subv2018-05-192-9/+3
| |/ / | | | | | | | | | The stream buffer is where all the vertex data is copied, some games require this to be much bigger than the 4 MB we used to have.
* | | Merge pull request #450 from Subv/shader_link_errorSebastian Valle2018-05-201-0/+27
|\ \ \ | | | | | | | | GLRenderer: Log the shader source code when program linking fails.
| * | | GLRenderer: Log the shader source code when program linking fails.Subv2018-05-191-0/+27
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \ | | | | | | | | Added IPC RequestWithContext & ControlWithContext
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
| | | | | | | | | | | | * Add and correct some Error Modules
* | | Merge pull request #442 from Hexagon12/nfp-service-namesSebastian Valle2018-05-201-24/+24
|\ \ \ | |/ / |/| | Updated nfp to have more service names
| * | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-1124-189/+613
|\ \ | | | | | | Initial support for multi-core
| * | core: Add several missing docstrings.bunnei2018-05-111-0/+8
| | |
| * | thread: Rename mask to affinity_masks.bunnei2018-05-114-5/+6
| | |
| * | core: Run all CPU cores separately, even in single-thread mode.bunnei2018-05-112-13/+23
| | |
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| | |
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| | |
| * | wait_tree: Add ideal core and affinity mask.bunnei2018-05-111-0/+2
| | |
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| | |
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-114-3/+10
| | |
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| | |
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| | |
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| | |
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| | |
| * | wait_tree: Show all threads on all schedulers.bunnei2018-05-111-6/+14
| | |
| * | core: Add a configuration setting for use_multi_core.bunnei2018-05-1110-17/+56
| | |
| * | core: Support session close with multicore.bunnei2018-05-114-16/+47
| | |
| * | core: Implement multicore support.bunnei2018-05-1113-78/+113
| | |
| * | core: Create a thread for each CPU core, keep in lock-step with a barrier.bunnei2018-05-114-18/+94
| | |
| * | core: Move common CPU core things to its own class.bunnei2018-05-115-58/+135
| | |
* | | Merge pull request #439 from ogniK5377/GetTPCMasksbunnei2018-05-112-4/+8
|\ \ \ | |/ / |/| | More accurate GetTPCMasks impl
| * | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
| | | | | | | | | | | | | | | | | | | | * Stubs for QLaunch * Wiped unrelated stuff * Addressed comment * Dropped GetPopFromGeneralChannelEvent
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-073-68/+224
| | | | | | | | | | | | | | | | | | | | | | | | | | | | * hid: Update mouse/keyboard state * hid: Working analog sticks * hid: Nits * hid: Nits * hid: Update mystery sections * hid: Tweaks
* | Merge pull request #434 from lioncash/vdtorbunnei2018-05-033-1/+13
|\ \ | | | | | | memory_hook: Default virtual destructor in the cpp file
| * | memory_hook: Default virtual destructor in the cpp fileLioncash2018-05-033-1/+13
| | | | | | | | | | | | | | | Prevents creating multiple copies of the vtable in every translation unit that uses the class. Also silences a -Wweak-vtables warning
* | | Merge pull request #433 from lioncash/loggingbunnei2018-05-032-48/+55
|\ \ \ | |/ / |/| | core_timing: Don't include the log header in core timing's header
| * | core_timing: Don't include the log header in core timing's headerLioncash2018-05-032-48/+55
|/ / | | | | | | | | Avoids propagating logging macros and facilities to files that may not need them. This also allows hiding an internal constant.
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0229-104/+105
|\ \ | | | | | | general: Make formatting of logged hex values more straightforward
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0229-104/+105
| | | | | | | | | | | | | | | | | | This makes the formatting expectations more obvious (e.g. any zero padding specified is padding that's entirely dedicated to the value being printed, not any pretty-printing that also gets tacked on).
* | | Merge pull request #430 from lioncash/vecbunnei2018-05-021-9/+9
|\ \ \ | | | | | | | | vector_math: Ensure members are always initialized
| * | | vector_math: Ensure members are always initializedLioncash2018-05-021-9/+9
| |/ / | | | | | | | | | Ensures that values are always in a well-defined state.
* | | Merge pull request #427 from bunnei/domain-inputsbunnei2018-05-024-0/+23
|\ \ \ | |/ / |/| | ipc: Add support for PopIpcInterface() method.
| * | ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ / | | | | | | - This can be used for domain objects as inputs to service functions.
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \ | | | | | | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
| | |
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetSharedFontInOrderOfPriority * Update pl_u.cpp * Ability to use ReadBuffer and WriteBuffer with different buffer indexes, fixed up GetSharedFontInOrderOfPriority * switched to NGLOG * Update pl_u.cpp * Update pl_u.cpp * language_code is actually language code and not index * u32->u64 * final cleanups
* | Merge pull request #425 from lioncash/namespacebunnei2018-04-309-14/+18
|\ \ | | | | | | core_timing: Namespace all functions and constants in core_timing's header
| * | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-309-14/+18
|/ / | | | | | | All of these variables and functions are related to timings and should be within the namespace.
* | Merge pull request #424 from lioncash/stringbunnei2018-04-308-99/+19
|\ \ | | | | | | string_util: Remove StringFromFormat() and related functions
| * | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-308-99/+19
| | | | | | | | | | | | Given we utilize fmt, we don't need to provide our own functions for formatting anymore
* | | Merge pull request #422 from bunnei/shader-movbunnei2018-04-304-0/+30
|\ \ \ | | | | | | | | Shader instructions MOV_C, MOV_R, and several minor GPU things
| * | | maxwell_3d: Reset vertex counts after drawing.bunnei2018-04-291-0/+10
| | | |
| * | | gl_shader_decompiler: Implement MOV_R.bunnei2018-04-291-1/+2
| | | |
| * | | maxwell_to_gl: Implement type SignedNorm, Size_8_8_8_8.bunnei2018-04-291-0/+12
| | | |
| * | | shader_bytecode: Add decoding for FMNMX instruction.bunnei2018-04-291-0/+2
| | | |
| * | | gl_shader_decompiler: Implement MOV_C.bunnei2018-04-291-0/+5
| | | |
* | | | Merge pull request #423 from lioncash/filebunnei2018-04-302-8/+12
|\ \ \ \ | |_|/ / |/| | | file_util: Minor changes to IOFile
| * | | file_util: Make move constructor/assignment operator and related functions noexceptLioncash2018-04-302-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Without this, it's possible to get compilation failures in the (rare) scenario where a container is used to store a bunch of live IOFile instances, as they may be using std::move_if_noexcept under the hood. Given these definitely don't throw exceptions this is also not incorrect to add either.
| * | | file_util: Add static assertions to ReadBytes() and WriteBytes()Lioncash2018-04-301-2/+6
|/ / / | | | | | | | | | | | | | | | Ensure that the actual types being passed in are trivially copyable. The internal call to ReadArray() and WriteArray() will always succeed, since they're passed a pointer to char* which is always trivially copyable.
* | | Merge pull request #421 from Subv/sh_pred3bunnei2018-04-291-0/+7
|\ \ \ | |/ / |/| | Shaders: Implemented predicate condition 3 (LessEqual) in the fset and fsetp instructions.
| * | Shaders: Implemented predicate condition 3 (LessEqual) in the fset and fsetp instructions.Subv2018-04-291-0/+7
|/ /
* | Merge pull request #416 from bunnei/shader-ints-p3bunnei2018-04-292-114/+206
|\ \ | | | | | | gl_shader_decompiler: Implement MOV32I, partially implement I2I, I2F
| * | gl_shader_decompiler: Partially implement I2I_R, and I2F_R.bunnei2018-04-292-8/+34
| | |
| * | gl_shader_decompiler: More cleanups, etc. with how we handle register types.bunnei2018-04-291-44/+120
| | |
| * | GLSLRegister: Simplify register declarations, etc.bunnei2018-04-291-63/+31
| | |
| * | shader_bytecode: Add decodings for i2i instructions.bunnei2018-04-291-3/+20
| | |
| * | gl_shader_decompiler: Implement MOV32_IMM instruction.bunnei2018-04-292-2/+7
| | |
* | | Merge pull request #417 from bunnei/lang-codesbunnei2018-04-293-8/+49
|\ \ \ | | | | | | | | set/am: Fix code for getting language codes
| * | | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
| | | |
| * | | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
| |/ /
* | | Merge pull request #418 from bunnei/copy-block-heightSebastian Valle2018-04-292-2/+7
|\ \ \ | |/ / |/| | fermi_2d: Fix surface copy block height.
| * | fermi_2d: Fix surface copy block height.bunnei2018-04-292-2/+7
|/ /
* | Merge pull request #414 from lioncash/cruftbunnei2018-04-281-8/+0
|\ \ | | | | | | file_util: Remove compiler version checks around is_trivially_copyable
| * | file_util: Remove compiler version checks around is_trivially_copyable()Lioncash2018-04-281-8/+0
| | | | | | | | | | | | | | | | | | The minimum clang/GCC versions we support already support this. We can also remove is_standard_layout(), as fread and fwrite only require the type to be trivially copyable.
* | | Merge pull request #413 from lioncash/dynarmicbunnei2018-04-281-0/+0
|\ \ \ | |/ / |/| | externals: Update dynarmic
| * | externals: Update dynarmicLioncash2018-04-281-0/+0
| | | | | | | | | | | | Just a basic update to keep it in sync
* | | Merge pull request #412 from lioncash/logbunnei2018-04-282-54/+1
|\ \ \ | |/ / |/| | log: Remove old logging macros and functions
| * | log: Remove old logging macros and functionsLioncash2018-04-272-54/+1
| | | | | | | | | | | | Now that the old macros are no longer used, we can remove all functionality related to them.
* | | Merge pull request #411 from lioncash/travisMat M2018-04-281-1/+1
|\ \ \ | |/ / |/| | travis: Use Xcode 9.3 instead of 9.2
| * | travis: Use Xcode 9.3 instead of 9.2Lioncash2018-04-271-1/+1
| | | | | | | | | | | | Keeps the toolchains up to date.
* | | Merge pull request #408 from bunnei/shader-ints-p2bunnei2018-04-271-154/+262
|\ \ \ | | | | | | | | gl_shader_decompiler: Add GLSLRegisterManager class to track register state.
| * | | gl_shader_decompiler: Add GLSLRegisterManager class to track register state.bunnei2018-04-271-154/+262
| |/ /
* | | Merge pull request #410 from lioncash/genericbunnei2018-04-274-12/+11
|\ \ \ | |/ / |/| | core/renderer_opengl: Replace usages of LOG_GENERIC with fmt-capable equivalents
| * | renderer_opengl: Replace usages of LOG_GENERIC with fmt-capable equivalentsLioncash2018-04-271-6/+7
| | |
| * | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
|/ /
* | Merge pull request #409 from lioncash/assertbunnei2018-04-2717-39/+39
|\ \ | | | | | | general: Convert assertion macros over to be fmt-compatible
| * | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-2717-39/+39
|/ /
* | Merge pull request #380 from ogniK5377/service-implbunnei2018-04-2713-13/+140
|\ \ | | | | | | Implemented some useful interfaces needed for games.
| * | Switched to NGLOG_WARNINGDavid Marcec2018-04-274-5/+5
| | |
| * | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-26110-2244/+1811
| |\ \
| * | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-263-13/+3
| | | |
| * | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-2310-25/+64
| | | |
| * | | lioncash proposed changesDavid2018-04-221-2/+2
| | | |
| * | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2211-11/+109
| | | |
* | | | Merge pull request #406 from lioncash/frontendbunnei2018-04-275-27/+26
|\ \ \ \ | | | | | | | | | | frontends: Move logging macros over to new fmt-capable ones
| * | | | frontends: Move logging macros over to new fmt-capable onesLioncash2018-04-275-27/+26
| | | | |
* | | | | Merge pull request #407 from lioncash/commonbunnei2018-04-274-67/+67
|\ \ \ \ \ | | | | | | | | | | | | common: Move logging macros over to new fmt-capable macros where applicable
| * | | | | common: Move logging macros over to new fmt-capable macros where applicableLioncash2018-04-274-67/+67
| |/ / / /
* | | | | Merge pull request #405 from lioncash/inputbunnei2018-04-271-3/+3
|\ \ \ \ \ | |/ / / / |/| | | | input_common: Move old logging macros over to fmt-capable ones
| * | | | input_common: Move old logging macros over to fmt-capable onesLioncash2018-04-271-3/+3
|/ / / /
* | | | Merge pull request #402 from lioncash/corebunnei2018-04-276-28/+28
|\ \ \ \ | | | | | | | | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalents
| * | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalentsLioncash2018-04-266-28/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | LOG_GENERIC usages will be amended in a follow-up to keep API changes separate from interface changes, as it will require removing a parameter from the relevant function in the VMManager class.
* | | | | Merge pull request #399 from bunnei/shader-intsbunnei2018-04-272-9/+120
|\ \ \ \ \ | |_|_|/ / |/| | | | Shader decompiler prep for integer instructions
| * | | | gl_shader_decompiler: Boilerplate for handling integer instructions.bunnei2018-04-262-6/+111
| | | | |
| * | | | gl_shader_decompiler: Move color output to EXIT instruction.bunnei2018-04-261-6/+12
| |/ / /
* | | | Merge pull request #403 from lioncash/commonbunnei2018-04-263-792/+0
|\ \ \ \ | |/ / / |/| | | common: Remove chunk_file.h and linear_disk_cache.h
| * | | common: Remove chunk_file.h and linear_disk_cache.hLioncash2018-04-263-792/+0
|/ / / | | | | | | | | | These are unused (and given chunk_file references Dolphin's >SVN< I doubt they were going to be used).
* | | Merge pull request #401 from lioncash/gdbstubbunnei2018-04-261-38/+37
|\ \ \ | | | | | | | | core/gdbstub: Move logging macros to new fmt-compatible ones
| * | | core/gdbstub: Move logging macros to new fmt-compatible onesLioncash2018-04-261-38/+37
|/ / /
* | | Merge pull request #400 from lioncash/hwbunnei2018-04-262-8/+10
|\ \ \ | | | | | | | | core/hw: Move logging macros over to fmt-capable ones
| * | | core/hw: Move logging macros over to fmt-capable onesLioncash2018-04-262-8/+10
|/ / /
* | | Merge pull request #396 from Subv/shader_opsbunnei2018-04-262-9/+89
|\ \ \ | | | | | | | | Shaders: Implemented the FSET instruction.
| * | | Shaders: Added bit decodings for the I2I instruction.Subv2018-04-251-0/+6
| | | |
| * | | Shaders: Implemented the FSET instruction.Subv2018-04-251-0/+53
| | | | | | | | | | | | | | | | This instruction is similar to the FSETP instruction, but it doesn't set a predicate, it sets the destination register to 1.0 if the condition holds, and 0 otherwise.
| * | | Shaders: Added decodings for the FSET instructions.Subv2018-04-252-9/+30
| | | |
* | | | Merge pull request #398 from lioncash/kernelbunnei2018-04-2611-107/+110
|\ \ \ \ | | | | | | | | | | kernel: Migrate logging macros to fmt-compatible ones
| * | | | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| | | | | | | | | | | | | | | | | | | | Functions don't need to be terminated by semicolons.
| * | | | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
| | | | |
* | | | | Merge pull request #387 from Subv/maxwell_2dbunnei2018-04-2610-52/+203
|\ \ \ \ \ | | | | | | | | | | | | GPU: Partially implemented the 2D surface copy engine
| * | | | | GPU: Partially implemented the Fermi2D surface copy operation.Subv2018-04-252-0/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The hardware allows for some rather complicated operations to be performed on the data during the copy, this is not implemented. Only same-format same-size raw copies are implemented for now.
| * | | | | Memory: Added a missing shortcut for Memory::CopyBlock for the current process.Subv2018-04-251-0/+4
| | | | | |
| * | | | | GPU: Make the Textures::CopySwizzledData function accessible from the outside of the file.Subv2018-04-252-3/+6
| | | | | |
| * | | | | GPU: Added a function to retrieve the bytes per pixel of the render target formats.Subv2018-04-252-0/+15
| | | | | |
| * | | | | GPU: Added surface copy registers to Fermi2DSubv2018-04-251-1/+57
| | | | | |
| * | | | | GPU: Added boilerplate code for the Fermi2D engineSubv2018-04-253-3/+34
| | | | | |
| * | | | | GPU: Reduce the number of registers of Maxwell3D to 0xE00.Subv2018-04-252-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | The rest are just macro shim registers.
| * | | | | GPU: Move the Maxwell3D macro uploading code to the inside of the Maxwell3D processor.Subv2018-04-254-40/+23
| | | | | | | | | | | | | | | | | | | | | | | | It doesn't belong in the PFIFO handler.
| * | | | | GPU: Corrected the upper bound of the PFIFO method ids in the command processor.Subv2018-04-251-1/+1
| | | | | |
* | | | | | Merge pull request #395 from lioncash/file-sysbunnei2018-04-268-68/+59
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | file-sys: Move logging macros over to the new fmt-capable ones
| * | | | | file-sys: convert a StringFromFormat call into fmt::format in GetFullPath()Lioncash2018-04-251-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Lessens the amount to read and gets rid of the PRIX64 macro, allowing us to use a single string for the whole path, making it easier to read.
| * | | | | file-sys: Move logging macros over to the new fmt-capable onesLioncash2018-04-258-64/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #390 from mailwl/pctl-modulebunnei2018-04-257-39/+71
|\ \ \ \ \ | | | | | | | | | | | | Service/PCTL: convert to module, add services, stub
| * | | | | Service/PCTL: convert to module, add services, stubmailwl2018-04-257-39/+71
| |/ / / / | | | | | | | | | | | | | | | PCTL::CreateServiceWithoutInitialize and IParentalControlService::Initialize, required by Kirby Star Allies
* | | | | Merge pull request #397 from lioncash/corebunnei2018-04-251-24/+26
|\ \ \ \ \ | |_|/ / / |/| | | | core/memory: Move logging macros over to the new fmt-capable ones
| * | | | core/memory: Amend address widths in assertsLioncash2018-04-251-2/+2
| | | | | | | | | | | | | | | | | | | | Addresses are 64-bit, these formatting specifiers are simply holdovers from citra. Adjust them to be the correct width.
| * | | | core/memory: Move logging macros over to new fmt-capable onesLioncash2018-04-251-22/+24
| |/ / / | | | | | | | | | | | | While we're at it, correct addresses to print all 64 bits where applicable, which were holdovers from citra.
* | | | Merge pull request #394 from lioncash/video-corebunnei2018-04-255-18/+20
|\ \ \ \ | |/ / / |/| | | video-core: Move logging macros over to new fmt-capable ones
| * | | video-core: Move logging macros over to new fmt-capable onesLioncash2018-04-255-18/+20
|/ / /
* | | Merge pull request #388 from bunnei/refactor-rasterizer-cachebunnei2018-04-2514-175/+334
|\ \ \ | | | | | | | | Refactor rasterizer cache
| * | | renderer_opengl: Use correct byte order for framebuffer pixel format ABGR8.bunnei2018-04-251-2/+1
| | | |
| * | | gl_rasterizer_cache: Use CHAR_BIT for bpp conversions instead of 8.bunnei2018-04-252-4/+4
| | | |
| * | | gl_rasterizer_cache: Use GPU PAGE_BITS/SIZE, not CPU.bunnei2018-04-251-5/+5
| | | |
| * | | gl_rasterizer_cache: Use new logger.bunnei2018-04-251-4/+4
| | | |
| * | | gl_rasterizer_cache: Add a function for finding framebuffer GPU address.bunnei2018-04-253-0/+31
| | | |
| * | | gl_rasterizer_cache: Handle compressed texture sizes.bunnei2018-04-252-24/+65
| | | |
| * | | gl_rasterizer_cache: Update to be based on GPU addresses, not CPU addresses.bunnei2018-04-2510-67/+122
| | | |
| * | | memory_manager: Add implement CpuToGpuAddress.bunnei2018-04-242-0/+27
| | | |
| * | | memory_manager: Make GpuToCpuAddress return an optional.bunnei2018-04-247-28/+37
| | | |
| * | | memory_manager: Use GPUVAdddr, not PAddr, for GPU addresses.bunnei2018-04-247-60/+57
| | | |
* | | | Merge pull request #393 from lioncash/loaderbunnei2018-04-255-26/+25
|\ \ \ \ | |/ / / |/| | | loader: Move old logging macros over to new fmt-capable ones
| * | | loader: Move old logging macros over to new fmt-capable onesLioncash2018-04-255-26/+25
|/ / /
* | | Merge pull request #386 from Subv/gpu_querybunnei2018-04-242-2/+53
|\ \ \ | | | | | | | | GPU: Added asserts to our code for handling the QUERY_GET GPU command.
| * | | GPU: Added asserts to our code for handling the QUERY_GET GPU command.Subv2018-04-242-2/+53
| | | | | | | | | | | | | | | | | | | | This is based on research from nouveau. Many things are currently unknown and will require hwtests in the future. This commit also stubs QueryMode::Write2 to do the same as Write. Nouveau code treats them interchangeably, it is currently unknown what the difference is.
* | | | Merge pull request #392 from lioncash/logbunnei2018-04-2438-297/+298
|\ \ \ \ | | | | | | | | | | service: Move logging macros over to the new fmt-compatible ones
| * | | | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| | | | |
| * | | | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| | | | |
| * | | | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| | | | |
| * | | | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| | | | |
| * | | | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| | | | |
| * | | | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| | | | |
| * | | | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| | | | |
| * | | | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| | | | |
| * | | | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| | | | |
| * | | | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| | | | |
| * | | | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| | | | |
| * | | | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| | | | |
| * | | | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| | | | |
| * | | | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| | | | |
| * | | | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| | | | |
| * | | | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| | | | |
| * | | | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| | | | |
| * | | | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| | | | |
| * | | | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| | | | |
| * | | | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
| | | | |
* | | | | Merge pull request #391 from lioncash/videobunnei2018-04-241-1/+2
|\ \ \ \ \ | |/ / / / |/| | | | renderer_opengl: Silence a -Wdangling-else warning in DrawScreenTriangles()
| * | | | renderer_opengl: Silence a -Wdangling-else warning in DrawScreenTriangles()Lioncash2018-04-241-1/+2
|/ / / /
* | | | Merge pull request #389 from mailwl/fs-renamefilebunnei2018-04-246-8/+36
|\ \ \ \ | | | | | | | | | | Service/FS: implement IFileSystem::RenameFile
| * | | | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-246-8/+36
|/ / / /
* | | | Merge pull request #379 from Subv/multi_buffersbunnei2018-04-243-43/+89
|\ \ \ \ | | | | | | | | | | GPU: Support multiple enabled vertex arrays.
| * | | | GPU: Support multiple enabled vertex arrays.Subv2018-04-233-43/+89
| |/ / / | | | | | | | | | | | | | | | | | | | | The vertex arrays will be copied to the stream buffer one after the other, and the attributes will be set using the ARB_vertex_attrib_binding extension. yuzu now thus requires OpenGL 4.3 or the ARB_vertex_attrib_binding extension.
* | | | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2316-525/+285
|\ \ \ \ | | | | | | | | | | Kernel: Reworked the new kernel synchronization primitives.
| * | | | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Verified with a hwtest and implemented based on reverse engineering. Thread A's priority will get bumped to the highest priority among all the threads that are waiting for a mutex that A holds. Once A releases the mutex and ownership is transferred to B, A's priority will return to normal and B's priority will be bumped.
| * | | | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-213-3/+3
| | | | |
| * | | | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-215-90/+55
| | | | |
| * | | | Kernel: Remove unused ConditionVariable class.Subv2018-04-216-150/+0
| | | | |
| * | | | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| | | | |
| * | | | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| | | | | | | | | | | | | | | | | | | | They work in tandem with guest code to provide synchronization primitives along with svcArbitrateLock/Unlock
| * | | | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Switch mutexes are no longer kernel objects, they are managed in userland and only use the kernel to handle the contention case. Mutex addresses store a special flag value (0x40000000) to notify the guest code that there are still some threads waiting for the mutex to be released. This flag is updated when a thread calls ArbitrateUnlock. TODO: * Fix svcWaitProcessWideKey * Fix svcSignalProcessWideKey * Remove the Mutex class.
* | | | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
|\ \ \ \ \ | | | | | | | | | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.
| * | | | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | Also added a consistency check and a comment for the case when the object id is different than its handle. The real nvservices doesn't make a distinction between ids and handles, each object gets an unique handle which doubles as its id.
| * | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | |/ / / | |/| | | | | | | | | | | | | It takes a previously-reserved (AllocateSpace) GPU memory address and maps it to the address of the nvmap object passed to Remap.
* | | | | Merge pull request #385 from Subv/unimpl_ioctlsbunnei2018-04-235-5/+5
|\ \ \ \ \ | | | | | | | | | | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.
| * | | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
| |/ / / /
* | | | | Merge pull request #383 from Subv/gpu_mmubunnei2018-04-232-34/+25
|\ \ \ \ \ | | | | | | | | | | | | GPU: Make the GPU virtual memory manager use 16 page bits and 10 pagetable bits.
| * | | | | GPU: Make the GPU virtual memory manager use 16 page bits and 10 page table bits.Subv2018-04-232-34/+25
| |/ / / / | | | | | | | | | | | | | | | Also removed some dead code and added memory map consistency asserts.
* | | | | Merge pull request #382 from Subv/a2rgb10_rtbunnei2018-04-232-0/+4
|\ \ \ \ \ | |_|_|/ / |/| | | | GPU: Implement the RGB10_A2 RenderTarget format
| * | | | GPU: Implement the RGB10_A2 RenderTarget format, it will use the same format as the A2BGR10 texture format.Subv2018-04-232-0/+4
|/ / / /
* | | | Merge pull request #378 from Subv/a2bgr10bunnei2018-04-224-6/+18
|\ \ \ \ | |/ / / |/| | | GPU: Implement the A2BGR10 texture format.
| * | | GPU: Implement the A2BGR10 texture format.Subv2018-04-224-6/+18
|/ / /
* | | Merge pull request #377 from adityaruplaha/sdl2-fullscreenbunnei2018-04-213-4/+40
|\ \ \ | | | | | | | | SDL2: Implement fullscreen. (Original PR: citra-emu/citra#3607)
| * | | SDL2: Implement fullscreen. (Original PR: citra-emu/citra#3607)adityaruplaha2018-04-213-4/+40
| | | |
* | | | Merge pull request #376 from bunnei/shader-decoderbunnei2018-04-212-210/+249
|\ \ \ \ | | | | | | | | | | Shader opcode decoding
| * | | | gl_shader_decompiler: Skip RRO instruction.bunnei2018-04-211-0/+4
| | | | |
| * | | | gl_shader_decompiler: Cleanup error logging.bunnei2018-04-211-14/+6
| | | | |
| * | | | shader_bytecode: Add several more instruction decodings.bunnei2018-04-211-5/+52
| | | | |
| * | | | shader_bytecode: Decode instructions based on bit strings.bunnei2018-04-212-205/+201
| | | | |
* | | | | Merge pull request #375 from lioncash/headerbunnei2018-04-214-11/+0
|\ \ \ \ \ | |/ / / / |/| | | | opengl: Remove unnecessary header inclusions
| * | | | opengl: Remove unnecessary header inclusionsLioncash2018-04-214-11/+0
| | | | |
* | | | | Merge pull request #369 from Subv/shader_instr2bunnei2018-04-212-4/+179
|\ \ \ \ \ | | | | | | | | | | | | ShaderGen: Implemented fsetp/kil and predicated instruction execution.
| * | | | | ShaderGen: Implemented the KIL instruction, which is equivalent to 'discard'.Subv2018-04-211-1/+7
| | | | | |
| * | | | | ShaderGen: Implemented predicated instruction execution.Subv2018-04-212-1/+40
| | | | | | | | | | | | | | | | | | | | | | | | Each predicated instruction will be wrapped in an `if (predicate) { instruction_body; }` in the GLSL, where `predicate` is one of the predicate boolean variables previously set by fsetp.
| * | | | | ShaderGen: Implemented the fsetp instruction.Subv2018-04-212-3/+112
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Predicate variables are now added to the generated shader code in the form of 'pX' where X is the predicate id. These predicate variables are initialized to false on shader startup and are set via the fsetp instructions. TODO: * Not all the comparison types are implemented. * Only the single-predicate version is implemented.
| * | | | | ShaderGen: Register id 255 is special and is hardcoded to return 0 (SR_ZERO).Subv2018-04-202-0/+5
| | | | | |
| * | | | | ShaderGen: Ignore the 'sched' instruction when generating shaders.Subv2018-04-201-0/+16
| | |_|/ / | |/| | | | | | | | | | | | | The 'sched' instruction has a very convoluted encoding, but fortunately it seems to only appear on a fixed interval (once every 4 instructions).
* | | | | Merge pull request #374 from lioncash/noexceptbunnei2018-04-211-20/+19
|\ \ \ \ \ | | | | | | | | | | | | gl_resource_manager: Add missing noexcept specifiers to move constructors and assignment operators
| * | | | | gl_resource_manager: Add missing noexcept specifiers to move constructors and assignment operatorsLioncash2018-04-211-20/+19
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Standard library containers may use std::move_if_noexcept to perform move operations. If a move cannot be performed under these circumstances, then a copy is attempted. Given we only intend for these types to be move-only this can be somewhat problematic. By defining these to be noexcept we prevent cases where copies may be attempted.
* | | | | Merge pull request #373 from lioncash/enum2bunnei2018-04-211-4/+9
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Make MatchFlags an enum class
| * | | | | gl_rasterizer_cache: Make MatchFlags an enum classLioncash2018-04-211-4/+9
| |/ / / / | | | | | | | | | | | | | | | Prevents implicit conversions and scope pollution.
* | | | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \ \ \ | | | | | | | | | | | | resource_limit: Make ResourceTypes an enum class
| * | | | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
| |/ / / / | | | | | | | | | | | | | | | Prevents enum identifiers from leaking into the surrounding scope.
* | | | | Merge pull request #371 from lioncash/globalbunnei2018-04-216-38/+66
|\ \ \ \ \ | |/ / / / |/| | | | core: Relocate g_service_manager to the System class
| * | | | core: Relocate g_service_manager to the System classLioncash2018-04-216-38/+66
|/ / / / | | | | | | | | | | | | | | | | Converts the service manager from a global into an instance-based variable.
* | | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ \ | |/ / / |/| | | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution output
| * | | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
| | | | | | | | | | | | | | | | | | | | both SetLayerVisibility() functions used in Lego games, GetDisplayResolution() fixed according switchbrew.org
* | | | Merge pull request #367 from lioncash/clampbunnei2018-04-205-24/+22
|\ \ \ \ | | | | | | | | | | math_util: Remove the Clamp() function
| * | | | math_util: Remove the Clamp() functionLioncash2018-04-205-24/+22
| | | | | | | | | | | | | | | | | | | | | | | | | C++17 adds clamp() to the standard library, so we can remove ours in favor of it.
* | | | | Merge pull request #361 from lioncash/commonbunnei2018-04-201-18/+12
|\ \ \ \ \ | | | | | | | | | | | | common_types: Minor changes
| * | | | | common_types: Convert typedefs to using aliasesLioncash2018-04-201-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | May as well while we're making changes to this file.
| * | | | | common_types: Remove unnecessary check for whether or not__func__ is definedLioncash2018-04-201-6/+0
| |/ / / / | | | | | | | | | | | | | | | VS has supported this for quite a while.
* | | | | Merge pull request #368 from lioncash/dynarmicbunnei2018-04-201-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update dynarmic to HEAD
| * | | | | externals: Update dynarmic to HEADLioncash2018-04-201-0/+0
| | | | | |
* | | | | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Use nested namespace specifiers where applicable
| * | | | | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| | |/ / / / | |/| | | | | | | | | | | | | | | | Tidies up namespace declarations
* | | | | | Merge pull request #364 from lioncash/thread-localbunnei2018-04-201-19/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | common/thread: Remove unnecessary feature checking for thread_local
| * | | | | | common/thread: Remove unnecessary feature checking for thread_localLioncash2018-04-201-19/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | Every compiler we require already supports it.
* | | | | | Merge pull request #362 from lioncash/snprintfbunnei2018-04-201-5/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | common_funcs: Remove check for VS versions that we don't even support
| * | | | | | common_funcs: Remove check for VS versions that we don't even supportLioncash2018-04-201-5/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | We don't support any VS versions that don't already have snprintf in the standard library implementation.
* | | | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-203-5/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | common_funcs: Remove ARRAY_SIZE macro
| * | | | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-203-5/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | C++17 has non-member size() which we can just call where necessary.
* | | | | | Merge pull request #366 from lioncash/vecbunnei2018-04-201-30/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]
| * | | | | | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]Lioncash2018-04-201-30/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | These are all unused and the Write() ones should arguably not even be in the interface. There are better ways to provide this if we ever need it (like iterators).
* | | | | | | Merge pull request #365 from lioncash/codeblockbunnei2018-04-202-86/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common: Remove code_block.h
| * | | | | | | common: Remove code_block.hLioncash2018-04-202-86/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | We use dynarmic, so this is unued. Anything else we need will likely use Xbyak, so this header isn't necessary any more.
* | | | | | | Merge pull request #357 from lioncash/guardbunnei2018-04-202-0/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | renderer_opengl: Add missing header guards
| * | | | | | | renderer_opengl: Add missing header guardsLioncash2018-04-202-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #358 from lioncash/explicitbunnei2018-04-202-4/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | disk_filesystem: Minor changes
| * | | | | | | disk_filesystem: Remove unused total_entries_in_directory member from Disk_DirectoryLioncash2018-04-201-1/+0
| | | | | | | |
| * | | | | | | disk_filesystem: Remove redundant initializer in Disk_Directory's constructorLioncash2018-04-201-1/+1
| | | | | | | |
| * | | | | | | disk_filesystem: Make constructors explicit where applicableLioncash2018-04-201-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #359 from lioncash/redundantbunnei2018-04-201-9/+5
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | vi: Remove redundant initializers in the constructors
| * | | | | | vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / / / / /
* | | | | | Merge pull request #356 from lioncash/shaderbunnei2018-04-201-12/+30
|\ \ \ \ \ \ | |/ / / / / |/| | | | | glsl_shader_decompiler: Minor API changes to ShaderWriter
| * | | | | glsl_shader_decompiler: Use std::string_view instead of std::string for AddLine()Lioncash2018-04-201-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't need to take ownership of the string data being given to it, considering all we do is append the characters to the internal string instance. Instead, use a string view to simply reference the string data without any potential heap allocation. Now anything that is a raw const char* won't need to be converted to a std::string before appending.
| * | | | | glsl_shader_decompiler: Add AddNewLine() function to ShaderWriterLioncash2018-04-201-6/+12
| | | | | | | | | | | | | | | | | | | | | | | | Avoids constructing a std::string just to append a newline character
| * | | | | glsl_shader_decompiler: Add char overload for ShaderWriter's AddLine()Lioncash2018-04-201-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | Avoids constructing a std::string just to append a character.
| * | | | | glsl_shader_decompiler: Append indentation without constructing a separate std::stringLioncash2018-04-201-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The interface of std::string already lets us append N copies of a character to an existing string.
* | | | | | Merge pull request #355 from Subv/shader_instrbunnei2018-04-202-11/+39
|\ \ \ \ \ \ | |/ / / / / |/| | | | | ShaderGen: Fixed TEXS overriding its own texcoords and implemented fmul32i
| * | | | | ShaderGen: Implemented the fmul32i shader instruction.Subv2018-04-192-9/+30
| | | | | |
| * | | | | ShaderGen: Fixed a case where the TEXS instruction would use the same registers for the input and the output.Subv2018-04-191-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | It will now save the coords before writing the outputs in a subscope.
* | | | | | Merge pull request #348 from jlachniet/patch-1James Rowe2018-04-191-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Technically, yuzu can boot commercial games
| * | | | | | Technically, yuzu can boot commercial gamesjlachniet2018-04-181-1/+1
| | | | | | | | | | | | | | | | | | | | | Clarifies the yuzu cannot play commercial games to any reasonable extent, rather than not at all.
* | | | | | | Implement Pull #3528 from citra: use nvidia graphics automatically on laptops with optimus (with AMD support) (#271)N00byKing2018-04-192-0/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Port 3528: use nvidia graphics automatically on laptops with optimus * Force dedicated AMD Card for switchable Graphics * Ran clang-format
* | | | | | | Merge pull request #352 from bunnei/fix-microprofileJames Rowe2018-04-191-0/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.
| * | | | | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
| |/ / / / /
* | | | | | Merge pull request #353 from Subv/compressed_formatsbunnei2018-04-193-28/+35
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Add support for the DXT23 and DXT45 compressed texture formats.
| * | | | | | GPU: Add support for the DXT23 and DXT45 compressed texture formats.Subv2018-04-193-28/+35
|/ / / / / /
* | | | | | Merge pull request #351 from Subv/tex_formatsbunnei2018-04-194-8/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Implemented the B5G6R5 format.
| * | | | | | GPU: Implemented the B5G6R5 format.Subv2018-04-194-8/+28
| | | | | | |
* | | | | | | gl_shader_gen: Support vertical/horizontal viewport flipping. (#347)bunnei2018-04-184-5/+29
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * gl_shader_gen: Support vertical/horizontal viewport flipping. * fixup! gl_shader_gen: Support vertical/horizontal viewport flipping.
* | | | | | Merge pull request #350 from Subv/tex_componentsbunnei2018-04-183-43/+90
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Fixed the incorrect component order in ABGR8 textures.
| * | | | | | GLCache: Added boilerplate code to make supporting configurable texture component types.Subv2018-04-183-9/+69
| | | | | | | | | | | | | | | | | | | | | | | | | | | | For now only the UNORM type is supported.
| * | | | | | GLCache: Unify texture and framebuffer formats when converting to OpenGL.Subv2018-04-182-26/+13
| | | | | | |
| * | | | | | GPU: Texture format 8 and framebuffer format 0xD5 are actually ABGR8.Subv2018-04-182-10/+10
|/ / / / / /
* | | | | | Merge pull request #349 from Subv/texturingbunnei2018-04-187-53/+97
|\ \ \ \ \ \ | |/ / / / / |/| | | | | GPU: Support non-tiled textures and configurable block height.
| * | | | | GPU: Pitch textures are now supported, don't assert when encountering them.Subv2018-04-181-2/+3
| | | | | |
| * | | | | GLCache: Take into account the texture's block height when caching and unswizzling.Subv2018-04-183-43/+43
| | | | | |
| * | | | | GLCache: Added a function to convert cached PixelFormats back to texture formats.Subv2018-04-181-0/+12
| | | | | | | | | | | | | | | | | | | | | | | | TODO: The way we handle cached formats must change, framebuffer and texture formats are too different to keep them in the same place.
| * | | | | GPU: Allow using a configurable block height when unswizzling textures.Subv2018-04-184-7/+23
| | | | | |
| * | | | | GPU/TIC: Added the pitch and block height fields to the TIC structure.Subv2018-04-181-1/+16
|/ / / / /
* | | | | Merge pull request #346 from bunnei/misc-gpu-improvementsbunnei2018-04-184-2/+11
|\ \ \ \ \ | | | | | | | | | | | | Misc gpu improvements
| * | | | | gl_rasterizer_cache: Add missing LOG statements.bunnei2018-04-181-0/+3
| | | | | |
| * | | | | texture: Add missing formats.bunnei2018-04-181-1/+3
| | | | | |
| * | | | | gpu: Add several framebuffer formats to RenderTargetFormat.bunnei2018-04-181-0/+3
| | | | | |
| * | | | | maxwell3d: Allow Texture2DNoMipmap as Texture2D.bunnei2018-04-181-1/+2
| | | | | |
* | | | | | Merge pull request #344 from bunnei/shader-decompiler-p2bunnei2018-04-184-73/+180
|\ \ \ \ \ \ | | | | | | | | | | | | | | Shader decompiler changes part 2
| * | | | | | shader_bytecode: Make ctor's constexpr and explicit.bunnei2018-04-181-7/+7
| | | | | | |
| * | | | | | bit_field: Remove is_pod check, add is_trivially_copyable_v.bunnei2018-04-181-6/+1
| | | | | | |
| * | | | | | gl_shader_decompiler: Fix warnings with MarkAsUsed.bunnei2018-04-171-1/+2
| | | | | | |
| * | | | | | gl_shader_decompiler: Cleanup logging, updating to NGLOG_*.bunnei2018-04-171-24/+22
| | | | | | |
| * | | | | | gl_shader_decompiler: Implement several MUFU subops and abs_d.bunnei2018-04-171-7/+21
| | | | | | |
| * | | | | | gl_shader_decompiler: Fix swizzle in GetRegister.bunnei2018-04-171-1/+1
| | | | | | |
| * | | | | | gl_shader_decompiler: Implement FMUL/FADD/FFMA immediate instructions.bunnei2018-04-172-12/+53
| | | | | | |
| * | | | | | gl_shader_decompiler: Allow vertex position to be used in fragment shader.bunnei2018-04-172-16/+18
| | | | | | |
| * | | | | | gl_shader_decompiler: Implement IPA instruction.bunnei2018-04-171-0/+11
| | | | | | |
| * | | | | | gl_shader_decompiler: Add support for TEXS instruction.bunnei2018-04-172-12/+43
| | | | | | |
| * | | | | | gl_shader_decompiler: Use fragment output color for GPR 0-3.bunnei2018-04-171-0/+5
| | | | | | |
| * | | | | | gl_shader_decompiler: Partially implement MUFU.bunnei2018-04-171-2/+11
| |/ / / / /
* | | | | | Merge pull request #345 from bunnei/blendingbunnei2018-04-186-7/+140
|\ \ \ \ \ \ | |/ / / / / |/| | | | | renderer_opengl: Implement BlendEquation and BlendFunc.
| * | | | | renderer_opengl: Implement BlendEquation and BlendFunc.bunnei2018-04-186-7/+140
|/ / / / /
* | | | | Merge pull request #341 from shinyquagsire23/pfs-hfs-implbunnei2018-04-173-0/+214
|\ \ \ \ \ | |_|/ / / |/| | | | file_sys: Add HFS/PFS helper component
| * | | | file_sys: Use NGLOGshinyquagsire232018-04-171-5/+5
| | | | |
| * | | | file_sys: tweaksshinyquagsire232018-04-162-6/+7
| | | | |
| * | | | file_sys: Add HFS/PFS helper componentshinyquagsire232018-04-163-0/+213
| |/ / /
* | | | Merge pull request #343 from Subv/tex_wrap_4bunnei2018-04-171-0/+7
|\ \ \ \ | | | | | | | | | | GPU: Implement some wrap modes
| * | | | MaxwellToGL: Implemented tex wrap mode 1 (Wrap, GL_REPEAT).Subv2018-04-171-0/+2
| | | | |
| * | | | MaxwellToGL: Added a TODO and partial implementation of maxwell wrap mode 4 (Clamp, GL_CLAMP).Subv2018-04-171-0/+5
| |/ / / | | | | | | | | | | | | This clamp mode was removed from OpenGL as of 3.1, we can emulate it by using GL_CLAMP_TO_BORDER to get the border color of the texture, and then manually sampling the edge to mix them in the fragment shader.
* | | | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Updated ACC with more service names * Updated SVC with more service names * Updated set with more service names * Updated sockets with more service names * Updated SPL with more service names * Updated time with more service names * Updated vi with more service names
* | | | Merge pull request #342 from bunnei/indexed-vertsbunnei2018-04-175-28/+98
|\ \ \ \ | |/ / / |/| | | Implement indexed mode rendering
| * | | gl_rendering: Use NGLOG* for changed code.bunnei2018-04-172-10/+11
| | | |
| * | | gl_rasterizer: Implement indexed vertex mode.bunnei2018-04-175-23/+92
|/ / /
* | | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \ \ | | | | | | | | pl_u: Use empty shared font if none is available.
| * | | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
| | | | | | | | | | | | | | | | - Makes games work in lieu of shared_font.bin.
* | | | Merge pull request #337 from Subv/used_buffersbunnei2018-04-155-12/+59
|\ \ \ \ | | | | | | | | | | GPU: Don't use explicit binding points when uploading the constbuffers to opengl
| * | | | GPU: Use the same buffer names in the generated GLSL and the buffer uploading code.Subv2018-04-154-17/+24
| | | | |
| * | | | GPU: Don't use explicit binding points when uploading the constbuffers to opengl.Subv2018-04-153-7/+47
| | | | | | | | | | | | | | | | | | | | The bindpoints will now be dynamically calculated based on the number of buffers used by the previous shader stage.
* | | | | Merge pull request #335 from bunnei/delete-filebunnei2018-04-156-9/+27
|\ \ \ \ \ | | | | | | | | | | | | fsp_srv: Implement DeleteFile.
| * | | | | fsp_srv: Implement DeleteFile.bunnei2018-04-156-9/+27
| | |/ / / | |/| | | | | | | | | | | | | - Used by Binding of Isaac.
* | | | | Merge pull request #334 from Subv/used_buffersbunnei2018-04-153-28/+39
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / / GPU: Use the buffer hints from the shader decompiler to upload only the necessary const buffers for each shader stage
| * | | GPU: Don't use GetPointer when uploading the constbuffer data to the GPU.Subv2018-04-151-3/+4
| | | |
| * | | GPU: Use the buffer hints from the shader decompiler to upload only the necessary const buffers for each shader stage.Subv2018-04-153-31/+41
|/ / /
* | | Merge pull request #333 from bunnei/const-buff-hintsbunnei2018-04-155-31/+146
|\ \ \ | | | | | | | | shaders: Expose hints about used const buffers.
| * | | shaders: Expose hints about used const buffers.bunnei2018-04-155-31/+146
|/ / /
* | | Merge pull request #328 from Subv/constbuffersbunnei2018-04-158-16/+104
|\ \ \ | | | | | | | | GPU: Upload the shader Constant Buffers as SSBOs to the GPU
| * | | GPU: Upload the entirety of each constbuffer for each shader stage as SSBOs.Subv2018-04-154-14/+48
| | | | | | | | | | | | | | | | We're going to need the shader generator to give us a mapping of the actual used const buffers to properly bind them to the shader.
| * | | GPU: Allow configuring ssbos in the opengl state manager.Subv2018-04-154-0/+30
| | | |
| * | | GPU: Added a function to determine whether a shader stage is enabled or not.Subv2018-04-153-3/+27
|/ / /
* | | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \ \ | | | | | | | | vm_manager: Increase GetTotalMemoryUsage value.
| * | | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
| |/ / | | | | | | | | | - Gets Binding of Isaac running.
* | | Merge pull request #327 from adityaruplaha/fullscreen-fixbunnei2018-04-151-2/+4
|\ \ \ | | | | | | | | Fix the stuck in fullscreen bug
| * | | Fix the stuck in fullscreen bug (Original PR: citra-emu/citra#3611)adityaruplaha2018-04-141-2/+4
| |/ /
* | | Merge pull request #331 from bunnei/fsp-flushbunnei2018-04-151-1/+9
|\ \ \ | | | | | | | | fsp_srv: Implement IFile::Flush.
| * | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
| |/ /
* | | Merge pull request #329 from bunnei/shader-gen-part-1bunnei2018-04-1526-642/+1872
|\ \ \ | |/ / |/| | OpenGL shader generation part 1
| * | shaders: Add NumTextureSamplers const, remove unused #pragma.bunnei2018-04-154-4/+5
| | |
| * | shaders: Address PR review feedback.bunnei2018-04-142-7/+9
| | |
| * | gl_shader_decompiler: Cleanup log statements.bunnei2018-04-141-15/+15
| | |
| * | shaders: Fix GCC and clang build issues.bunnei2018-04-143-5/+5
| | |
| * | gl_shader_decompiler: Implement negate, abs, etc. and lots of cleanup.bunnei2018-04-142-40/+96
| | |
| * | shader_bytecode: Add FSETP and KIL to GetInfo.bunnei2018-04-141-0/+3
| | |
| * | shader_bytecode: Add SubOp decoding.bunnei2018-04-141-0/+10
| | |
| * | gl_shader_decompiler: Add shader stage hint.bunnei2018-04-142-5/+12
| | |
| * | renderer_opengl: Fix Morton copy byteswap, etc.bunnei2018-04-142-6/+6
| | |
| * | gl_shader_manager: Implement SetShaderSamplerBindings.bunnei2018-04-141-0/+8
| | |
| * | gl_rasterizer: Generate shaders and upload uniforms.bunnei2018-04-142-32/+77
| | |
| * | gl_shader_decompiler: Basic impl. for very simple vertex shaders.bunnei2018-04-142-16/+311
| | | | | | | | | | | | - Tested with Puyo Puyo Tetris and Cave Story+
| * | gl_shader_manager: Cleanup and consolidate uniform handling.bunnei2018-04-142-26/+24
| | |
| * | maxwell_3d: Make memory_manager public.bunnei2018-04-141-2/+1
| | |
| * | maxwell_3d: Fix shader_config decodings.bunnei2018-04-141-6/+3
| | |
| * | gl_rasterizer: Use shader program manager, remove test shader.bunnei2018-04-142-196/+31
| | |
| * | renderer_opengl: Add gl_shader_manager class.bunnei2018-04-143-0/+209
| | |
| * | maxwell_to_gl: Add a few types, etc.bunnei2018-04-141-0/+10
| | |
| * | gl_shader_gen: Add hashable setup/config structs.bunnei2018-04-142-29/+50
| | |
| * | gl_shader_util: Add missing includes.bunnei2018-04-141-0/+2
| | |
| * | common: Port cityhash code from Citra.bunnei2018-04-145-147/+502
| | |
| * | renderer_opengl: Use OGLProgram instead of OGLShader.bunnei2018-04-146-6/+6
| | |
| * | gl_shader_util: Grab latest upstream.bunnei2018-04-142-149/+74
| | |
| * | gl_resource_manager: Grab latest upstream.bunnei2018-04-141-30/+86
| | |
| * | gl_shader_decompiler: Add skeleton code from Citra for shader analysis.bunnei2018-04-142-44/+142
| | |
| * | shader_bytecode: Add initial module for shader decoding.bunnei2018-04-142-0/+298
| | |
| * | bit_field: Make all methods constexpr.bunnei2018-04-141-5/+5
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \ | | | | | | Service/HID: Stubbed out GetPlayerLedPattern
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
| | |
* | | Merge pull request #325 from Hexagon12/ipc-value-fixbunnei2018-04-131-1/+1
|\ \ \ | | | | | | | | Service/vi: Fix normal_params_size in GetDisplayResolution
| * | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
| |/ /
| * | Merge pull request #1 from yuzu-emu/masterHexagon122018-04-1334-193/+853
| |\ \ | |/ / |/| | Update fork
* | | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \ \ | | | | | | | | Various service name fixes - part 1
| * | | Various fixes and clangHexagon122018-04-116-115/+108
| | | |
| * | | Decimal changeHexagon122018-04-101-4/+4
| | | |
| * | | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| | | |
| * | | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| | | |
| * | | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| | | |
| * | | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| | | |
| * | | Updated hid with more service names.Hexagon122018-04-101-0/+50
| | | |
| * | | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| | | |
| * | | Updated the unknown nameHexagon122018-04-101-1/+1
| | | |
| * | | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| | | |
| * | | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| | | |
| * | | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| | | |
| * | | Updated audren with more service names.Hexagon122018-04-101-10/+14
| | | |
| * | | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| | | |
| * | | Updated audout with more service names.Hexagon122018-04-101-13/+16
| | | |
| * | | Updated audin with more service names.Hexagon122018-04-101-9/+16
| | | |
| * | | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| | | |
| * | | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| | | |
| * | | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| | | |
| * | | Updated AM with more service names.Hexagon122018-04-101-2/+82
| |/ /
* | | Merge pull request #320 from mailwl/ssl-updatebunnei2018-04-122-1/+98
|\ \ \ | | | | | | | | Service/SSL: update service according switchbrew
| * | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
|/ / /
* | | Merge pull request #318 from mailwl/accountbunnei2018-04-1011-127/+342
|\ \ \ | |/ / |/| | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 services
| * | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1011-127/+342
|/ /
* | Merge pull request #314 from jroweboy/tegra-progress-3bbunnei2018-04-089-173/+274
|\ \ | | | | | | GPU: Bind uploaded textures when drawing (Rebased)
| * | Fix clang format issuesJames Rowe2018-04-071-1/+1
| | |
| * | GPU: Assert when finding a texture with a format type other than UNORM.Subv2018-04-072-4/+16
| | |
| * | GL: Set up the textures used for each draw call.Subv2018-04-072-2/+39
| | | | | | | | | | | | | | | Each Maxwell shader stage can have an arbitrary number of textures, but we're limited to a certain number in OpenGL. We try to only use the minimum amount of host textures by not keeping a 1:1 relation between guest texture ids and host texture ids, ie, guest texture id 8 can be host texture id 0 if it's the only texture used in the guest shader program. This mapping will have to be passed to the shader decompiler so it can rewrite the texture accesses.
| * | GL: Bind the textures to the shaders used for drawing.Subv2018-04-071-2/+11
| | |
| * | GLCache: Specialize the MortonCopy function for the DXT1 texture format.Subv2018-04-071-1/+15
| | | | | | | | | | | | It will now use the UnswizzleTexture function instead of the MortonCopyPixels128, which doesn't seem to work for textures.
| * | GLCache: Implemented GetTextureSurface.Subv2018-04-071-3/+28
| | |
| * | GLCache: Support uploading compressed textures to the GPU.Subv2018-04-071-5/+17
| | | | | | | | | | | | Compressed texture formats like DXT1, DXT2, DXT3, etc will use this to ease the load on the CPU.
| * | GL: Remove remaining references to 3DS-specific pixel formatsSubv2018-04-071-83/+22
| | |
| * | RasterizerCache: Remove 3DS-specific pixel formats.Subv2018-04-072-71/+32
| | | | | | | | | | | | We're only left with RGB8 and DXT1 for now. More will be added as they are needed.
| * | GL: Create the sampler objects when starting up the GL rasterizer.Subv2018-04-071-0/+6
| | |
| * | GL: Ported the SamplerInfo struct from citra.Subv2018-04-072-1/+59
| | |
| * | GL: Rename PicaTexture to MaxwellTexture.Subv2018-04-072-2/+2
| | |
| * | GL: Added functions to convert Maxwell tex filters and wrap modes to OpenGL.Subv2018-04-071-0/+23
| | |
| * | Textures: Added a helper function to know if a texture is blocklinear or pitch.Subv2018-04-071-0/+5
| | |
* | | Merge pull request #315 from jroweboy/spelling-fixbunnei2018-04-072-3/+3
|\ \ \ | | | | | | | | Fix spelling of Initialize
| * | | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
| |/ /
* | | Merge pull request #316 from jroweboy/dontcrashbunnei2018-04-071-2/+1
|\ \ \ | |/ / |/| | Prevent crash from uninitialized telemetry
| * | Prevent crash from uninitialized telemetryJames Rowe2018-04-071-2/+1
|/ /
* | Merge pull request #310 from N00byKing/patch-1bunnei2018-04-065-10/+10
|\ \ | | | | | | Update multiple comments from citra to yuzu
| * | rasterizer_interface.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| | |
| * | default_ini.h: Update from citra to yuzuN00byKing2018-04-041-1/+1
| | |
| * | gl_rasterizer_cache.cpp: Update from citra to yuzuN00byKing2018-04-041-1/+1
| | |
| * | gl_rasterizer_cache.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| | |
| * | renderer_opengl.h: Update from citra to yuzuN00byKing2018-04-041-2/+2
| | |
* | | core, main.h: Abort on 32Bit ROMs (#309)N00byKing2018-04-065-1/+17
| | | | | | | | | | | | | | | | | | * core, main.h: Abort on 32Bit ROMs * main.cpp: Fix Grammar
* | | Merge pull request #312 from jroweboy/update-fmtlibbunnei2018-04-063-5/+8
|\ \ \ | |/ / |/| | Update fmtlib to fix msvc warnings
| * | Update fmtlib to fix msvc warningsJames Rowe2018-04-063-5/+8
|/ / | | | | | | | | | | Additionally, when updating fmtlib, there was a change in fmtlib broke how the old logging macro was overloaded, so this works around that by just naming the fmtlib macro impl something different
* | Merge pull request #308 from bunnei/misc-fixes-2bunnei2018-04-0412-18/+108
|\ \ | | | | | | Implement and stub several SVC/VI/Audio/Friend/etc. funcs
| * | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
| | |
| * | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
| | |
| * | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
| | |
| * | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
| | |
| * | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
| | |
| * | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
| | |
| * | service: Add friend:u interface.bunnei2018-04-034-0/+41
|/ /
* | Merge pull request #306 from daniellimws/new-fmt-macrosbunnei2018-04-032-5/+11
|\ \ | | | | | | logging: Use variadic template instead of FMT_VARIADIC
| * | logging: Change FmtLogMessage to use variadic template instead of FMT_VARIADICDaniel Lim Wee Soong2018-04-032-5/+11
|/ / | | | | | | Due to premature merging of #262 I think the build may be failing right now. Should merge this ASAP to fix it.
* | Merge pull request #262 from daniellimws/fmtlib-macrosbunnei2018-04-0311-68/+112
|\ \ | | | | | | Logging: Add fmtlib-based macros
| * | Remove dependency chronoDaniel Lim Wee Soong2018-03-221-1/+0
| | | | | | | | | | | | | | | | | | Earlier chrono was included but after some code changed it was no longer needed Forgot to remove it so I'm removing it now
| * | Change "yuzu starting..." to be logged with the new macroDaniel Lim Wee Soong2018-03-221-1/+1
| | | | | | | | | | | | Just as a proof that it works
| * | Logging: Create logging macros based on fmtlibDaniel Lim Wee Soong2018-03-2210-67/+112
| | | | | | | | | | | | | | | | | | | | | | | | | | | Add a new set of logging macros based on fmtlib Similar but not exactly the same as https://github.com/citra-emu/citra/pull/3533 Citra currently uses a different version of fmt, which does not support FMT_VARIADIC so make_args is used instead. On the other hand, yuzu uses fmt 4.1.0 which doesn't have make_args yet so FMT_VARIADIC is used.
* | | Merge pull request #267 from N00byKing/patch-1bunnei2018-04-032-14/+14
|\ \ \ | | | | | | | | Update Dialog from citra to yuzu
| * | | yuzu.cpp: Update Link from citra to yuzuN00byKing2018-03-261-1/+1
| | | |
| * | | main.cpp: Replace Citra with yuzu Wiki LinksN00byKing2018-03-251-4/+4
| | | |
| * | | main.cpp: Update Dialog from citra to yuzuN00byKing2018-03-251-11/+11
| | | |
* | | | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-034-10/+10
|\ \ \ \ | | | | | | | | | | Change Telemetry Names to yuzu and remove links to citra
| * | | | telemetry.h: Reword comment from citra to yuzuN00byKing2018-03-271-1/+1
| | | | |
| * | | | telemetry_session.h: Reword Documentation Comment from citra to yuzuN00byKing2018-03-271-2/+2
| | | | |
| * | | | Remove Links to citra ServicesN00byKing2018-03-271-2/+2
| | | | |
| * | | | Change Telemetry Names to yuzuN00byKing2018-03-272-5/+5
| | | | |
* | | | | Merge pull request #304 from daniellimws/fix-openbsdbunnei2018-04-034-7/+20
|\ \ \ \ \ | | | | | | | | | | | | Fix build on OpenBSD
| * | | | | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-023-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Versions prior to this didn't compile on OpenBSD due to unconditional use of the non-standard strtod_l() function. The fmt::MemoryWriter API has been removed in the intervening versions, so replace its use with fmt::memory_buffer and fmt::format_to. The library also no longer provides the fmt::fmt ALIAS, so define it in externals/CMakeLists.txt.
| * | | | | common: fix swap functions on Bitrig and OpenBSDDaniel Lim Wee Soong2018-04-021-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | swap{16,32,64} are defined as macros on the two, but client code tries to invoke them as Common::swap{16,32,64}, which naturally doesn't work. This hack redefines the macros as inline functions in the Common namespace: the bodies of the functions are the same as the original macros, but relying on OS-specific implementation details like this is of course brittle.
* | | | | | Merge pull request #305 from N00byKing/patch-2James Rowe2018-04-031-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | deconstructed_rom_directory.cpp: Fix Typo
| * | | | | | deconstructed_rom_directory.cpp: Fix TypoN00byKing2018-04-031-1/+1
|/ / / / / /
* | | | | | Merge pull request #66 from RiverCityRansomware/qtUpdatebunnei2018-04-021-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Updates CMakeLists to use Qt 5.10.0 instead of Qt 5.7
| * | | | | Update qtRiver City Ransomware2018-01-171-1/+1
| | | | | | | | | | | | | | | | | | Updates qt from 5.7 to 5.10.0, fixing some errors relating to setting the process dpi
* | | | | | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Write empty touch screen state.
| * | | | | | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
| | | | | | |
* | | | | | | Merge pull request #296 from bunnei/misc-mem-fsp-fixesbunnei2018-04-0210-16/+49
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix stack region, implement FSP GetSize/SetSize, and some stubs
| * | | | | | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
| | | | | | | |
| * | | | | | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
| | | | | | | |
| * | | | | | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
| | | | | | | |
| * | | | | | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-312-4/+24
| | | | | | | |
| * | | | | | | memory: Fix stack region.bunnei2018-03-316-10/+12
| |/ / / / / /
* | | | | | | Merge pull request #288 from Subv/macro_interpreterbunnei2018-04-025-121/+444
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GPU: Implemented a gpu macro interpreter
| * | | | | | GPU: Use the MacroInterpreter class to execute the GPU macros instead of HLEing them.Subv2018-04-012-121/+13
| | | | | | |
| * | | | | | GPU: Implemented a gpu macro interpreter.Subv2018-04-015-0/+431
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Ryujinx macro interpreter and envydis were used as reference. Macros are programs that are uploaded by the games during boot and can later be called by writing to their method id in a GPU command buffer.
* | | | | | | Merge pull request #293 from N00byKing/drkthmbunnei2018-03-3157-5/+1428
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Add Dark Theme (And Theming in General + Icon Theming)
| * | | | | | | Port citra-emu/citra#3610 to yuzuN00byKing2018-03-302-3/+7
| | | | | | | |
| * | | | | | | Remove whitespacesN00byKing2018-03-301-1/+1
| | | | | | | |
| * | | | | | | Add Dark theme, Icon themingN00byKing2018-03-3057-5/+1424
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | configure_general.ui: Add UI Option for Themes config.cpp: Save Theme Settings
* | | | | | | | Merge pull request #292 from bunnei/botw-progressbunnei2018-03-3011-11/+163
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | NFP, SVC, and AudRen progress
| * | | | | | | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
| | | | | | | |
| * | | | | | | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
| | | | | | | |
| * | | | | | | service: Add NFP module interface.bunnei2018-03-308-0/+101
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | service: Initialize NFP service. Log: Add NFP service as a log subtype.
* | | | | | | Merge pull request #290 from MerryMage/dfix-20180329bunnei2018-03-291-0/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | dynarmic: Update to 9cc12d8
| * | | | | | | dynarmic: Update to 9cc12d8MerryMage2018-03-291-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 9cc12d8 abi: Missing includes ac35ad5 emit_x64_floating_point: Near jump instead of short jump in FPMinNumberic{32,64} 6f03fdd A64: system: Use an enum class for MRS/MSR register encodings
* | | | | | | | Merge pull request #289 from lioncash/self-assignbunnei2018-03-291-0/+3
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | result: Check against self-assignment in ResultVal's copy assignment operator
| * | | | | | | result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Avoids doing work that doesn't need to be done.
* | | | | | | Merge pull request #286 from N00byKing/citratoyuzuagainbunnei2018-03-281-5/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | main.h: Add pragma once, remove ifndef
| * | | | | | | main.h: Add pragma once, remove ifndefN00byKing2018-03-271-5/+2
| | | | | | | |
* | | | | | | | Merge pull request #285 from MerryMage/dfix-20180327bunnei2018-03-271-0/+0
|\ \ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | | dynarmic: Update to 12a1020
| * | | | | | | dynarmic: Update to 12a1020MerryMage2018-03-271-0/+0
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 12a1020 emit_X64_floating_point: Near jmp to end instead of short jmp 6278f83 emit_x64_vector: Fix typo in VectorShuffleImpl 25a0204 A64: Implement REV64 aa92e33 bit_util: Do nothing in RotateRight if the rotation amount is zero e537985 A64: Implement REV32 (vector) f62a258 ir: Add IR opcodes for emitting vector shuffles 36ac6ec emit_x64_vector_floating_point: Fix out of bounds array access in EmitVectorOperation64 20a59a9 A64: Implement REV16 (vector) b2f7bb0 CMakeLists: Add fp_util, macro_util and math_util headers fd21b58 A64: Implement EOR3 and BCAX a48c0bb travis: Use yuzu's unicorn fork 59e62e0 externals: Update catch to v2.2.1
* | | | | | | Merge pull request #284 from bunnei/docked-configbunnei2018-03-279-61/+88
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Add config for "Docked" mode and various settings cleanup
| * | | | | | settings: Remove unused CpuCore class.bunnei2018-03-271-5/+0
| | | | | | |
| * | | | | | config: Use simplified checkbox (from Citra) for CPU JIT.bunnei2018-03-278-46/+33
| | | | | | |
| * | | | | | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-277-14/+14
| | | | | | |
| * | | | | | configure_general: Cleanup naming.bunnei2018-03-271-14/+14
| | | | | | |
| * | | | | | qt: Add config option for is_docked.bunnei2018-03-272-0/+23
| | | | | | |
| * | | | | | config: Add setting for whether the system is docked or not.bunnei2018-03-275-2/+24
| | | | | | |
* | | | | | | Merge pull request #282 from N00byKing/patch-2bunnei2018-03-274-4/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Change comments from citra to yuzu
| * | | | | | log.h: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| | | | | | |
| * | | | | | file_util.h: Update Comment from citra to yuzuN00byKing2018-03-261-1/+1
| | | | | | |
| * | | | | | cpu_detect.cpp: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| | | | | | |
| * | | | | | pre-commit: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| |/ / / / /
* | | | | | Merge pull request #279 from bunnei/tegra-progress-3bunnei2018-03-2720-446/+913
|\ \ \ \ \ \ | | | | | | | | | | | | | | Tegra progress 3
| * | | | | | renderer_opengl: Use better naming for DrawScreens and DrawSingleScreen.bunnei2018-03-272-8/+8
| | | | | | |
| * | | | | | graphics_surface: Remove superfluous cast.bunnei2018-03-271-2/+1
| | | | | | |
| * | | | | | gl_rasterizer: Move code to bind framebuffer surfaces before draw to its own function.bunnei2018-03-272-22/+31
| | | | | | |
| * | | | | | gl_rasterizer: Add a SyncViewport method.bunnei2018-03-273-18/+30
| | | | | | |
| * | | | | | gl_rasterizer: Move PrimitiveTopology check to MaxwellToGL.bunnei2018-03-272-11/+12
| | | | | | |
| * | | | | | graphics_surface: Fix merge conflicts.bunnei2018-03-272-3/+4
| | | | | | |
| * | | | | | gl_rasterizer: Use ReadBlock instead of GetPointer for SetupVertexArray.bunnei2018-03-271-1/+1
| | | | | | |
| * | | | | | gl_rasterizer: Normalize vertex array data as appropriate.bunnei2018-03-272-1/+5
| | | | | | |
| * | | | | | memory: Fix cast for ReadBlock/WriteBlock/ZeroBlock/CopyBlock.bunnei2018-03-271-4/+8
| | | | | | |
| * | | | | | maxwel_to_gl: Fix string formatting in log statements.bunnei2018-03-271-2/+2
| | | | | | |
| * | | | | | rasterizer: Rename DrawTriangles to DrawArrays.bunnei2018-03-273-5/+5
| | | | | | |
| * | | | | | gl_rasterizer: Use passthrough shader for SetupVertexShader.bunnei2018-03-271-1/+2
| | | | | | |
| * | | | | | renderer_opengl: Logging, etc. cleanup.bunnei2018-03-276-33/+34
| | | | | | |
| * | | | | | renderer_opengl: Remove framebuffer RasterizerFlushVirtualRegion hack.bunnei2018-03-271-5/+0
| | | | | | |
| * | | | | | gl_rasterizer_cache: Implement UpdatePagesCachedCount.bunnei2018-03-272-8/+37
| | | | | | |
| * | | | | | memory: Add RasterizerMarkRegionCached code and cleanup.bunnei2018-03-272-200/+195
| | | | | | |
| * | | | | | gl_rasterizer: Implement SetupVertexArray.bunnei2018-03-271-20/+38
| | | | | | |
| * | | | | | gl_rasterizer_cache: Fix an ASSERT_MSG.bunnei2018-03-271-1/+1
| | | | | | |
| * | | | | | maxwell_to_gl: Add module and function for decoding VertexType.bunnei2018-03-272-0/+41
| | | | | | |
| * | | | | | maxwell_3d: Use names that match envytools for VertexType.bunnei2018-03-271-8/+8
| | | | | | |
| * | | | | | maxwell_3d: Add VertexAttribute struct and cleanup.bunnei2018-03-271-121/+160
| | | | | | |
| * | | | | | gl_rasterizer: Use 32 texture units instead of 3.bunnei2018-03-273-2/+3
| | | | | | |
| * | | | | | gl_rasterizer: Implement DrawTriangles.bunnei2018-03-271-1/+194
| | | | | | |
| * | | | | | Maxwell3D: Call AccelerateDrawBatch on DrawArrays.bunnei2018-03-271-1/+8
| | | | | | |
| * | | | | | gl_rasterizer: Implement AnalyzeVertexArray.bunnei2018-03-272-1/+56
| | | | | | |
| * | | | | | gl_rasterizer_cache: MortonCopy Switch-style.bunnei2018-03-271-72/+32
| | | | | | |
| * | | | | | gl_rasterizer_cache: Implement GetFramebufferSurfaces.bunnei2018-03-272-4/+104
| | | | | | |
| * | | | | | maxwell: Add RenderTargetFormat enum.bunnei2018-03-272-4/+5
| | | | | | |
| * | | | | | renderer_opengl: Only draw the screen if a framebuffer is specified.bunnei2018-03-271-6/+7
|/ / / / / /
* | | | | | Merge pull request #283 from Subv/tscbunnei2018-03-273-25/+147
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Added sampler information structures (TSC)
| * | | | | | GPU: Load the sampler info (TSC) when retrieving active textures.Subv2018-03-262-21/+67
| | | | | | |
| * | | | | | GPU: Added the TSC structure. It contains information about the sampler.Subv2018-03-261-0/+50
| | | | | | |
| * | | | | | GPU: Added more fields to the TIC structure.Subv2018-03-261-4/+30
| |/ / / / /
* | | | | | Merge pull request #102 from N00byKing/masterbunnei2018-03-272-15/+47
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Implement Pull #3043 from citra: appveyor: Determine dlls to include in package programmatically
| * | | | | Implement Citra pull 3043N00byKing2018-02-242-15/+47
| | | | | |
* | | | | | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \ \ \ \ \ | | | | | | | | | | | | | | Minor changes to VI, PL, HID, and AUDREN
| * | | | | | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| | | | | | |
| * | | | | | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| | | | | | |
| * | | | | | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
| | | | | | |
* | | | | | | Merge pull request #273 from Subv/texturesbunnei2018-03-2521-10/+1464
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU: Added code to unswizzle textures and ported the surface viewer from citra
| * | | | | | | GPU: Make the debug_context variable a member of the frontend instead of a global.Subv2018-03-257-19/+40
| | | | | | | |
| * | | | | | | GPU: Added a function to retrieve the active textures for a shader stage.Subv2018-03-242-50/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TODO: A shader may not use all of these textures at the same time, shader analysis should be performed to determine which textures are actually sampled.
| * | | | | | | Frontend: Updated the surface view debug widget to work with Maxwell surfaces.Subv2018-03-243-19/+38
| | | | | | | |
| * | | | | | | Frontend: Allow opening the Surface View widget in the Qt frontend.Subv2018-03-242-0/+8
| | | | | | | |
| * | | | | | | GPU: Implement the Incoming/FinishedPrimitiveBatch debug breakpoints.Subv2018-03-241-0/+7
| | | | | | | |
| * | | | | | | GPU: Implement the MaxwellCommandLoaded/Processed debug breakpoints.Subv2018-03-241-0/+10
| | | | | | | |
| * | | | | | | Frontend: Ported the GPU breakpoints and surface viewer widgets from citra.Subv2018-03-2415-4/+1155
| | | | | | | |
| * | | | | | | GPU: Added a method to unswizzle a texture without decoding it.Subv2018-03-244-5/+95
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allow unswizzling of DXT1 textures.
| * | | | | | | GPU: Preliminary work for texture decoding.Subv2018-03-245-0/+139
| |/ / / / / /
* | | | | | | Merge pull request #281 from mailwl/sockets-servicesbunnei2018-03-258-32/+96
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Service/sockets: add bsd:s, nsd:a, nsd:u services
| * | | | | | Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-258-32/+96
|/ / / / / /
* | | | | | Merge pull request #275 from MerryMage/addticks-dynarmicbunnei2018-03-241-7/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | arm_dynarmic: Fix timing
| * | | | | | arm_dynarmic: Fix timingMerryMage2018-03-241-7/+3
|/ / / / / /
* | | | | | Merge pull request #274 from Subv/viewport_regsbunnei2018-03-241-1/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Added viewport registers to Maxwell3D's reg structure.
| * | | | | | GPU: Added viewport registers to Maxwell3D's reg structure.Subv2018-03-241-1/+18
|/ / / / / /
* | | | | | Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-2417-296/+591
|\ \ \ \ \ \ | | | | | | | | | | | | | | Tegra progress 2
| * | | | | | gl_rasterizer: Fake render in green, because it's cooler.bunnei2018-03-241-1/+1
| | | | | | |
| * | | | | | gl_rasterizer: Log warning instead of sync'ing unimplemented funcs.bunnei2018-03-241-7/+1
| | | | | | |
| * | | | | | gl_rasterizer_cache: Add missing include for vm_manager.bunnei2018-03-231-0/+1
| | | | | | |
| * | | | | | renderer_opengl: Only invalidate the framebuffer region, not flush.bunnei2018-03-231-4/+3
| | | | | | |
| * | | | | | renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-232-12/+12
| | | | | | |
| * | | | | | memory: Fix typo in RasterizerFlushVirtualRegion.bunnei2018-03-231-3/+3
| | | | | | |
| * | | | | | RasterizerCacheOpenGL: FlushAll should flush full memory region.bunnei2018-03-231-1/+1
| | | | | | |
| * | | | | | memory: RasterizerFlushVirtualRegion should also check process image region.bunnei2018-03-231-0/+1
| | | | | | |
| * | | | | | rasterizer: Flush and invalidate regions should be 64-bit.bunnei2018-03-235-12/+12
| | | | | | |
| * | | | | | renderer_opengl: Add framebuffer_transform_flags member variable.bunnei2018-03-231-2/+2
| | | | | | |
| * | | | | | renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-234-6/+23
| | | | | | |
| * | | | | | renderer_opengl: Use accelerated framebuffer load with LoadFBToScreenInfo.bunnei2018-03-231-31/+25
| | | | | | |
| * | | | | | nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Workaround for texture forwarding until we have a better place.
| * | | | | | gl_rasterizer: Implement AccelerateDisplay method from Citra.bunnei2018-03-232-2/+44
| | | | | | |
| * | | | | | LoadGLBuffer: Use bytes_per_pixel, not bits.bunnei2018-03-231-1/+2
| | | | | | |
| * | | | | | memory: Port RasterizerFlushVirtualRegion from Citra.bunnei2018-03-232-1/+58
| | | | | | |
| * | | | | | gl_rasterizer_cache: LoadGLBuffer should do a morton copy.bunnei2018-03-231-16/+5
| | | | | | |
| * | | | | | video_core: Move MortonCopyPixels128 to utils header.bunnei2018-03-232-111/+113
| | | | | | |
| * | | | | | video_core: Remove usage of PAddr and replace with VAddr.bunnei2018-03-235-39/+39
| | | | | | |
| * | | | | | video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-238-69/+77
| | | | | | |
| * | | | | | gl_rasterizer: Replace a bunch of UNIMPLEMENTED with ASSERT.bunnei2018-03-232-20/+20
| | | | | | |
| * | | | | | gl_rasterizer: Add a simple passthrough shader in lieu of shader generation.bunnei2018-03-232-5/+68
| | | | | | |
| * | | | | | gpu: Expose Maxwell3D engine.bunnei2018-03-231-0/+4
| | | | | | |
| * | | | | | maxwell_3d: Add some format decodings and string helper functions.bunnei2018-03-231-3/+107
| | | | | | |
| * | | | | | renderer: Create rasterizer and cleanup.bunnei2018-03-234-4/+16
| | | | | | |
* | | | | | | Merge pull request #255 from Subv/sd_cardbunnei2018-03-2412-48/+329
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | FS: Implemented access to the SD card
| * | | | | | | FS: Move the file open mode calculation to a separate function.Subv2018-03-231-7/+14
| | | | | | | |
| * | | | | | | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-216-7/+29
| | | | | | | |
| * | | | | | | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Note that the filter parameter is not yet implemented.
| * | | | | | | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| | | | | | | |
| * | | | | | | FS: Implement DiskFileSystem's OpenDirectory interface.Subv2018-03-205-6/+19
| | | | | | | |
| * | | | | | | FS: Implement DiskFileSystem::GetEntryType for existing files/directories.Subv2018-03-201-2/+4
| | | | | | | |
| * | | | | | | FS: Updated the Directory Entry structure to match the Switch.Subv2018-03-205-30/+84
| | | | | | | |
| * | | | | | | FS: Support the file Append open mode.Subv2018-03-202-2/+23
| | | | | | | |
| * | | | | | | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| | | | | | | |
| * | | | | | | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-205-0/+79
| | | | | | | |
* | | | | | | | Merge pull request #268 from mailwl/sslbunnei2018-03-236-0/+45
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Service/SSL: add ssl service
| * | | | | | | | Service/SSL: add ssl servicemailwl2018-03-236-0/+45
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #270 from N00byKing/patch-2bunnei2018-03-231-4/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Remove Option for N/3DS from default.ini
| * | | | | | | | Remove Option for N/3DS from default.iniN00byKing2018-03-231-4/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #269 from N00byKing/icontoyuzubunnei2018-03-231-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | CITRA_ICON -> YUZU_ICON
| * | | | | | | CITRA_ICON -> YUZU_ICONN00byKing2018-03-231-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #264 from valentinvanelslande/cmd-dynarmicbunnei2018-03-232-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu_cmd: change default cpu core to dynarmic
| * | | | | | | yuzu_cmd: change default cpu core to dynarmicValentin Vanelslande2018-03-231-1/+1
| | | | | | | |
| * | | | | | | default_ini: change default cpu core to dynarmicValentin Vanelslande2018-03-231-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #263 from N00byKing/non3dsbunnei2018-03-222-20/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Remove more N3DS References
| * | | | | | | Remove more N3DS ReferencesN00byKing2018-03-222-20/+0
|/ / / / / / /
* | | | | | | Merge pull request #261 from mailwl/splbunnei2018-03-2210-0/+176
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Service/spl: add module and services
| * | | | | | Service/spl: add module and servicesmailwl2018-03-2210-0/+176
|/ / / / / /
* | | | | | Merge pull request #258 from Subv/gpu_attribsbunnei2018-03-221-3/+27
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Added vertex attrib format and triangle topology registers
| * | | | | | GPU: Added vertex attribute format registers.Subv2018-03-211-1/+14
| | | | | | |
| * | | | | | GPU: Added registers for the number of vertices to render.Subv2018-03-211-2/+13
| | | | | | |
* | | | | | | Merge pull request #260 from N00byKing/3535bunnei2018-03-214-36/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement Pull #3535 from citra: CMake: Set EMU_ARCH_BITS in CMakeLists.txt
| * | | | | | | CMake: Set EMU_ARCH_BITS in CMakeLists.txtN00byKing2018-03-214-36/+3
| | | | | | | |
* | | | | | | | Merge pull request #259 from N00byKing/usehttpsbunnei2018-03-211-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Use HTTPS for lz4
| * | | | | | | Use HTTPS for Submodule lz4N00byKing2018-03-211-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #257 from mailwl/vi-modulebunnei2018-03-218-212/+160
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Service/vi: convert services to module
| * | | | | | Service/vi: convert services to modulemailwl2018-03-218-212/+160
|/ / / / / /
* | | | | | Merge pull request #254 from bunnei/port-citra-rendererbunnei2018-03-2122-1172/+24167
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port Citra OpenGL rasterizer code
| * | | | | | renderer_gl: Port boilerplate rasterizer code over from Citra.bunnei2018-03-205-1/+495
| | | | | | |
| * | | | | | gl_shader_util: Sync latest version with Citra.bunnei2018-03-203-46/+116
| | | | | | |
| * | | | | | renderer_gl: Port over gl_shader_gen module from Citra.bunnei2018-03-203-0/+88
| | | | | | |
| * | | | | | renderer_gl: Port over gl_shader_decompiler module from Citra.bunnei2018-03-203-0/+87
| | | | | | |
| * | | | | | renderer_gl: Port over gl_rasterizer_cache module from Citra.bunnei2018-03-203-0/+1714
| | | | | | |
| * | | | | | gl_resource_manager: Sync latest version with Citra.bunnei2018-03-201-8/+77
| | | | | | |
| * | | | | | renderer_gl: Port over gl_stream_buffer module from Citra.bunnei2018-03-203-0/+218
| | | | | | |
| * | | | | | externals: Update Glad to latest version used by Citra.bunnei2018-03-204-1071/+21262
| | | | | | |
| * | | | | | gl_state: Sync latest version with Citra.bunnei2018-03-202-47/+111
| | | | | | |
* | | | | | | Merge pull request #256 from mailwl/fatalbunnei2018-03-2010-0/+146
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Service: add fatal:u, fatal:p services
| * | | | | | | Service: add fatal:u, fatal:p servicesmailwl2018-03-2010-0/+146
|/ / / / / / /
* | | | | | | Merge pull request #253 from Subv/rt_depthMat M2018-03-201-1/+48
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GPU: Added registers for color and Z buffers.
| * | | | | | GPU: Added Z buffer registers to Maxwell3D's reg structure.Subv2018-03-191-1/+17
| | | | | | |
| * | | | | | GPU: Added the render target (RT) registers to Maxwell3D's reg structure.Subv2018-03-191-1/+32
| |/ / / / /
* | | | | | Merge pull request #252 from N00byKing/3064bunnei2018-03-1915-27/+29
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Implement Pull #3064 from citra: Clean all format warnings (Yuzu-specific format warnings cleared too)
| * | | | | Clang FixesN00byKing2018-03-195-9/+11
| | | | | |
| * | | | | oopsN00byKing2018-03-191-3/+3
| | | | | |
| * | | | | More Warning cleanupsN00byKing2018-03-193-3/+3
| | | | | |
| * | | | | Clean Warnings (?)N00byKing2018-03-1915-20/+20
|/ / / / /
* | | | | Merge pull request #251 from Subv/tic_tscbunnei2018-03-191-1/+30
|\ \ \ \ \ | | | | | | | | | | | | GPU: Added TIC and TSC registers to the Maxwell3D register structure.
| * | | | | GPU: Added the TSC registers to the Maxwell3D register structure.Subv2018-03-191-1/+15
| | | | | |
| * | | | | GPU: Added the TIC registers to the Maxwell3D register structure.Subv2018-03-191-1/+16
|/ / / / /
* | | | | Merge pull request #193 from N00byKing/3184_2_robotic_boogaloobunnei2018-03-197-41/+41
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3184 from citra: core/arm: Improve timing accuracy before service calls in JIT (Rebased)
| * | | | | Implements citra-emu/citra#3184N00byKing2018-02-257-41/+41
| | | | | |
* | | | | | Merge pull request #250 from bunnei/buffer-dequeue-waitbunnei2018-03-1910-51/+128
|\ \ \ \ \ \ | | | | | | | | | | | | | | vi: TransactParcel DequeueBuffer should wait current thread
| * | | | | | vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
| | | | | | |
| * | | | | | hle_ipc: Add SleepClientThread to block current thread within HLE routines.bunnei2018-03-192-0/+47
| | | | | | |
| * | | | | | hle_ipc: Use shared_ptr instead of unique_ptr to allow copies.bunnei2018-03-192-9/+9
| | | | | | |
| * | | | | | hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-193-7/+14
| | | | | | |
| * | | | | | thread: Add THREADSTATUS_WAIT_HLE_EVENT, remove THREADSTATUS_WAIT_ARB.bunnei2018-03-194-23/+9
| | | | | | |
* | | | | | | Merge pull request #249 from Subv/macro_E1Abunnei2018-03-192-1/+29
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GPU: Implement macro 0xE1A BindTextureInfoBuffer in HLE.
| * | | | | | GPU: Implement macro 0xE1A BindTextureInfoBuffer in HLE.Subv2018-03-192-1/+29
|/ / / / / / | | | | | | | | | | | | | | | | | | This macro simply sets the current CB_ADDRESS to the texture buffer address for the input shader stage.
* | | | | | Merge pull request #248 from Subv/cb_databunnei2018-03-195-11/+105
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Handle writes to the CB_DATA method.
| * | | | | | GPU: Implement the BindStorageBuffer macro method in HLE.Subv2018-03-182-1/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This macro binds the SSBO Info Buffer as the current ConstBuffer. This buffer is usually bound to c0 during shader execution. Games seem to use this macro instead of directly writing the address for some reason.
| * | | | | | GPU: Handle writes to the CB_DATA method.Subv2018-03-182-0/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Writing to this method will cause the written value to be stored in the currently-set ConstBuffer plus CB_POS. This method is usually used to upload uniforms or other shader-visible data.
| * | | | | | GPU: Move the GPU's class constructor and destructors to a cpp file.Subv2018-03-183-10/+30
|/ / / / / / | | | | | | | | | | | | | | | | | | This should reduce recompile times when editing the Maxwell3D register structure.
* | | | | | Merge pull request #246 from Subv/gpu_macro_callsSebastian Valle2018-03-188-80/+119
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Store uploaded GPU macros and keep track of the number of method arguments.
| * | | | | | GPU: Store uploaded GPU macros and keep track of the number of method parameters.Subv2018-03-184-27/+74
| | | | | | |
| * | | | | | GPU: Macros are specific to the Maxwell3D engine, so handle them internally.Subv2018-03-188-63/+55
|/ / / / / /
* | | | | | Merge pull request #245 from Subv/set_shader2bunnei2018-03-182-23/+115
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Store shader constbuffer bindings in the GPU state.
| * | | | | | GPU: Renamed ShaderType to ShaderStage as that is less confusing.Subv2018-03-182-19/+19
| | | | | | |
| * | | | | | GPU: Store shader constbuffer bindings in the GPU state.Subv2018-03-182-5/+61
| | | | | | |
| * | | | | | GPU: Corrected some register offsets and removed superfluous macro registers.Subv2018-03-181-9/+3
| | | | | | |
| * | | | | | GPU: Make the SetShader macro call do the same as the real macro's code.Subv2018-03-182-3/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It'll now set the CB_SIZE, CB_ADDRESS and CB_BIND registers when it's called. Presumably this SetShader function is binding the constant shader uniforms to buffer 1 (c1[]).
| * | | | | | GPU: Corrected the parameter documentation for the SetShader macro call.Subv2018-03-172-11/+12
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Register 0xE24 is actually a macro that sets some shader parameters in the register structure. Macros are uploaded to the GPU at startup and have their own ISA, we'll probably write an interpreter for this in the future.
* | | | | | Merge pull request #242 from Subv/set_shaderbunnei2018-03-172-4/+38
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Handle the SetShader method call (0xE24) and store the shader config.
| * | | | | | GPU: Handle the SetShader method call (0xE24) and store the shader config.Subv2018-03-172-4/+38
| | | | | | |
* | | | | | | Merge pull request #243 from Subv/vertex_bufferbunnei2018-03-171-2/+33
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GPU: Added the vertex array registers.
| * | | | | | GPU: Added the vertex array registers.Subv2018-03-171-2/+33
|/ / / / / /
* | | | | | Merge pull request #241 from Subv/gpu_method_callbunnei2018-03-179-8/+97
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Process command mode 5 (IncreaseOnce) differently from other commands
| * | | | | | GPU: Process command mode 5 (IncreaseOnce) differently from other commands.Subv2018-03-179-8/+97
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Accumulate all arguments before calling the desired method. Note: Maybe we should do the same for the NonIncreasing mode?
* | | | | | | Merge pull request #239 from Subv/shadersbunnei2018-03-172-2/+63
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU: Added some shader-related registers.
| * | | | | | | GPU: Assert that we get a 0 CODE_ADDRESS register in the 3D engine.Subv2018-03-171-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Shader address calculation depends on this value to some extent, we do not currently know what it being 0 entails.
| * | | | | | | GPU: Added Maxwell registers for Shader Program control.Subv2018-03-171-2/+55
| |/ / / / / /
* | | | | | | Merge pull request #238 from bunnei/fix-buffer-checkbunnei2018-03-171-3/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nvflinger: Remove superfluous buffer format check.
| * | | | | | | nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
|/ / / / / / /
* | | | | | | Merge pull request #232 from bunnei/heap-fixesbunnei2018-03-1715-82/+110
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Various heap fixes for libtransistor
| * | | | | | | process: MirrorMemory should use MemoryState::Mapped.bunnei2018-03-171-1/+1
| | | | | | | |
| * | | | | | | process: Unmap previously allocated heap.bunnei2018-03-161-1/+3
| | | | | | | |
| * | | | | | | arm_interface: Support unmapping previously mapped memory.bunnei2018-03-166-2/+18
| | | | | | | |
| * | | | | | | svc: Use more correct values for GetInfo MapRegion and NewMapRegion.bunnei2018-03-163-29/+5
| | | | | | | |
| * | | | | | | kernel: Move stack region outside of application heap.bunnei2018-03-166-11/+6
| | | | | | | |
| * | | | | | | memory: Add regions for map region, "new" map region, etc.bunnei2018-03-161-19/+29
| | | | | | | |
| * | | | | | | process: Fix stack memory state.bunnei2018-03-161-2/+4
| | | | | | | |
| * | | | | | | MemoryState: Add additional memory states and improve naming.bunnei2018-03-165-18/+45
|/ / / / / / /
* | | | | | | Merge pull request #237 from mailwl/nifm-modulebunnei2018-03-168-125/+84
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Service/NIFM: convert to module
| * | | | | | IGeneralService: fix function listmailwl2018-03-161-2/+3
| | | | | | |
| * | | | | | Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
| | | | | | |
| * | | | | | Service/NIFM: convert to modulemailwl2018-03-168-122/+75
|/ / / / / /
* | | | | | Merge pull request #236 from bunnei/refactor-process-creationbunnei2018-03-1522-72/+87
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: Move process creation out of global state.
| * | | | | | core: Move process creation out of global state.bunnei2018-03-1422-72/+87
|/ / / / / /
* | | | | | Merge pull request #213 from Hexagon12/dynarmic-defaultbunnei2018-03-081-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Make Dynarmic the default CPU core
| * | | | | | pls, that was easyHexagon122018-02-141-1/+1
| |/ / / / /
* | | | | | Merge pull request #230 from Subv/gpu_drawbunnei2018-03-052-1/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Intercept writes to the VERTEX_END_GL register.
| * | | | | | GPU: Intercept writes to the VERTEX_END_GL register.Subv2018-03-052-1/+18
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the register that gets written after a game calls DrawArrays(). We should collect all GPU state and draw using our graphics API here.
* | | | | | Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-0412-43/+91
|\ \ \ \ \ \ | | | | | | | | | | | | | | FS: Make EnsureSaveData create the save data if it doesn't already exist.
| * | | | | | FS: Use the correct error code when trying to open files that don't exist.Subv2018-03-042-26/+6
| | | | | | |
| * | | | | | FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| | | | | | |
| * | | | | | FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-048-17/+70
| | | | | | |
* | | | | | | Merge pull request #228 from Subv/unschedule_eventsbunnei2018-03-043-2/+10
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | CoreTiming: Unschedule the pending events when an Interface is destroyed
| * | | | | | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/ / / / / /
* | | | | | Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called
| * | | | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This prevents a thread starvation issue in Puyo Puyo Tetris. We should hwtest this behavior and figure out where exactly this event is signaled.
* | | | | | | Merge pull request #225 from mailwl/settingsbunnei2018-03-0312-10/+348
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Service/Set: add more services
| * | | | | | Service/Set: add more servicesmailwl2018-03-0312-10/+348
|/ / / / / /
* | | | | | Merge pull request #216 from Subv/savedatabunnei2018-03-0222-44/+546
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implemented the SaveData archive and MountSaveData.
| * | | | | | SaveData: Use the current titleid when opening the savedata archive.Subv2018-03-021-2/+3
| | | | | | |
| * | | | | | Kernel: Store the program id in the Process class instead of the CodeSet class.Subv2018-03-029-26/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | There may be many CodeSets per Process, so it's wasteful and overcomplicated to store the program id in each of them.
| * | | | | | FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
| | | | | | |
| * | | | | | Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-0210-16/+329
| | | | | | |
| * | | | | | ResultCode: Mark any error code that isn't 0 as an error.Subv2018-02-271-2/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #224 from Armada651/clear-processbunnei2018-02-281-1/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | thread: Clear the process list on shutdown.
| * | | | | thread: Clear the process list on shutdown.Jules Blok2018-02-271-1/+3
|/ / / / /
* | | | | Removes the use of QKeySequence::Cancel (#186)Vishal Sharma2018-02-271-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Removes the use of QKeySequence::Cancel to remove issues while running make * Corrects characters in a line for travis failure * Corrects space in a line for travis failure
* | | | | Merge pull request #207 from mailwl/duplicatesessionbunnei2018-02-273-6/+12
|\ \ \ \ \ | |_|_|_|/ |/| | | | IPC: add domain header to response if only it exists in request
| * | | | Add warning if Domain request has no domain message headermailwl2018-02-201-0/+3
| | | | |
| * | | | Fix: change check for domain order and existance of domain message headermailwl2018-02-203-3/+4
| | | | |
| * | | | IPC: add domain header to response if only it exists in requestmailwl2018-02-203-6/+8
| | | | |
* | | | | Merge pull request #215 from N00byKing/umapsharedmmrybunnei2018-02-262-1/+17
|\ \ \ \ \ | | | | | | | | | | | | UnmapSharedMemory
| * | | | | (Hopefully) Fix MinGW BuildN00byKing2018-02-251-1/+1
| | | | | |
| * | | | | Add UnmapSharedMemoryN00byKing2018-02-252-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | C++11 requires spaces on the Identifier Add inttypes include clang
* | | | | | Merge pull request #222 from shinyquagsire23/npdm-parsingbunnei2018-02-267-9/+294
|\ \ \ \ \ \ | | | | | | | | | | | | | | NPDM Parsing
| * | | | | | file_sys: Style tweaksshinyquagsire232018-02-262-11/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Asdf
| * | | | | | loader: Check error on NPDM load, use TID for CodeSetshinyquagsire232018-02-253-6/+10
| | | | | | |
| * | | | | | loader: Use NPDM information when loading NSOsshinyquagsire232018-02-252-4/+15
| | | | | | |
| * | | | | | file_sys: Add support for parsing NPDM filesshinyquagsire232018-02-253-0/+276
|/ / / / / /
* | | | | | Merge pull request #212 from mailwl/stubsbunnei2018-02-2410-9/+112
|\ \ \ \ \ \ | | | | | | | | | | | | | | Stub some functions
| * | | | | | Stub more functionsmailwl2018-02-227-8/+90
| | | | | | |
| * | | | | | Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-225-1/+22
| |/ / / / /
* | | | | | Merge pull request #217 from shinyquagsire23/time-s-missingbunnei2018-02-231-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | time: Add missing time:s functions, used for libnx
| * | | | | | time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
| |/ / / / /
* | | | | | Merge pull request #210 from MerryMage/f/dynarmic/sysregbunnei2018-02-233-2/+33
|\ \ \ \ \ \ | |/ / / / / |/| | | | | arm_dynarmic: Implement system registers and provide more hooks
| * | | | | dynarmic: Update to 6b4c6b0MerryMage2018-02-212-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 6b4c6b0 impl: Update PC when raising exception 7a1313a A64: Implement FDIV (vector) b2d781d system: Raise exception for YIELD, WFE, WFI, SEV, SEVL b277bf5 Correct FPSR and FPCR 7673933 A64: Implement USHL 8d0e558 A64: Implement UCVTF (vector, integer), scalar variant da9a4f8 A64: Partially implement FCVTZU (scalar, fixed-point) and FCVTZS (scalar, fixed-point) 7479684 A64: Implement system register TPIDR_EL0 0fd75fd A64: Implement system registers FPCR and FPSR 31e370c A64: Implement system register CNTPCT_EL0 9a88fd3 A64: Implement system register CTR_EL0 1d16896 A64: Implement NEG (vector) 3184edf IR: Add IR instruction ZeroVector 31f8fbc emit_x64_floating_point: Add maybe_unused to preprocess parameter 567eb1a A64: Implement FMINNM (scalar) c6d8fa1 A64: Implement FMAXNM (scalar) 616056d constant_pool: Add frame parameter a3747cb A64: Implement ADDP (scalar) 5cd5d9f reg_alloc: Only exchange GPRs dd0452a A64: Implement DUP (element), scalar variant e5732ea emit_x64_floating_point: Correct FP{Max,Min}{32,64} implementations for -0/+0 40eb9c3 A64: Implement FMAX (scalar), FMIN (scalar) 7cef39b fuzz_with_unicorn: QEMU's implementation of FCVT is incorrect 826dce2 travis: Switch unicorn repository 9605f28 a64/config: Allow NaN emulation accuracy to be set e9435bc a64_emit_x64: Add conf to A64EmitContext 30b596d fuzz_with_unicorn: Explicitly test floating point instructions be292a8 A64: Implement FSQRT (scalar) 3c42d48 backend_x64: Accurately handle NaNs 4aefed0 fuzz_with_unicorn: Print AArch64 disassembly
| * | | | | arm_dynarmic: LOG_INFO on unicorn fallbackMerryMage2018-02-211-0/+4
| | | | | |
| * | | | | memory: LOG_ERROR when falling off end of page tableMerryMage2018-02-211-0/+11
| |/ / / /
* | | | | Merge pull request #211 from shinyquagsire23/time_localbunnei2018-02-223-0/+9
|\ \ \ \ \ | | | | | | | | | | | | time: Add GetStandardLocalSystemClock, used by libnx
| * | | | | time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
| |/ / / /
* | | | | Merge pull request #209 from MerryMage/f/scheduler-shutdownbunnei2018-02-221-5/+9
|\ \ \ \ \ | |/ / / / |/| | | | core: Fix scheduler-shutdown related crash
| * | | | core: Fix scheduler-shutdown related crashMerryMage2018-02-211-5/+9
|/ / / /
* | | | Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-204-2/+28
|\ \ \ \ | | | | | | | | | | Service/AOC: stub ListAddOnContent function
| * | | | Service/AOC: stub ListAddOnContent functionmailwl2018-02-204-2/+28
| | | | |
* | | | | Merge pull request #205 from bunnei/more-puyo-stubsbunnei2018-02-2010-1/+113
|\ \ \ \ \ | |/ / / / |/| | | | Stub several friend:a and acc:u0 service functions
| * | | | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
| | | | |
| * | | | service: Add Friend service interface.bunnei2018-02-196-0/+100
| | | | |
| * | | | logging: Add category for Friend service.bunnei2018-02-192-0/+2
|/ / / /
* | | | Merge pull request #202 from bunnei/scheduler-cleanupbunnei2018-02-1911-379/+239
|\ \ \ \ | | | | | | | | | | Scheduler cleanup
| * | | | scheduler: Cleanup based on PR feedback.bunnei2018-02-193-5/+4
| | | | |
| * | | | kernel: Use Scheduler class for threading.bunnei2018-02-186-174/+26
| | | | |
| * | | | kernel: Add Scheduler, which encapsulates the scheduling loading from Thread module.bunnei2018-02-183-0/+210
| | | | |
| * | | | core: Use shared_ptr for cpu_core.bunnei2018-02-182-6/+4
| | | | |
| * | | | kernel: Remove unused address_arbiter code.bunnei2018-02-185-199/+0
| | | | |
* | | | | Merge pull request #203 from Subv/ensure_save_databunnei2018-02-191-1/+2
|\ \ \ \ \ | |/ / / / |/| | | | AM: Corrected the response in EnsureSaveData.
| * | | | AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
|/ / / / | | | | | | | | | | | | | | | | The values are still unknown and the function is still considered a stub. Puyo Puyo Tetris now tries to call fsp-srv:MountSaveData.
* | | | Merge pull request #198 from N00byKing/clangbunnei2018-02-184-9/+18
|\ \ \ \ | | | | | | | | | | Use Docker for Build Target clang-format for travis.
| * | | | Update build.shN00byKing2018-02-181-1/+1
| | | | |
| * | | | Use Docker for Build Target clang-format for travis.N00byKing2018-02-164-9/+18
| | | | | | | | | | | | | | | | | | | | This uses the (apparently) more stable Ubuntu Repo instead of the LLVM one.
* | | | | Merge pull request #201 from Subv/ipc_delay_bunnei2018-02-184-50/+63
|\ \ \ \ \ | | | | | | | | | | | | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.
| * | | | | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.Subv2018-02-184-50/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ported from citra PR #3091 The delay specified here is from a Nintendo 3DS, and should be measured in a Nintendo Switch. This change is enough to prevent Puyo Puyo Tetris's main thread starvation.
* | | | | | Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Make the fence handling in Vi a little less of a hack.
| * | | | | nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | Games like Puyo Puyo Tetris and BOTW seem to depend on the buffer always having the same handle
| * | | | | Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| | | | | |
| * | | | | Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| | | | | |
| * | | | | Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | This may break libnx homebrew due to a bug in libnx but is required by official games since they always assume that the buffer will be there.
| * | | | | nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| | | | | |
| * | | | | Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| | | | | |
| * | | | | Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| | | | | |
| * | | | | Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| | | | | |
| * | | | | Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
| | | | | |
* | | | | | Merge pull request #199 from FernandoS27/update_dynarmicbunnei2018-02-171-0/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | Updated Dynarmic
| * | | | | | updated dynarmicFernandoS272018-02-171-0/+0
|/ / / / / /
* | | | | | Merge pull request #197 from mailwl/hidbunnei2018-02-174-1/+98
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Service/hid: stub some functions
| * | | | | Service/hid: stub some functionsmailwl2018-02-164-1/+98
|/ / / / /
* | | | | Merge pull request #195 from bunnei/shared-fontbunnei2018-02-1510-13/+199
|\ \ \ \ \ | |/ / / / |/| | | | pl_u: Add basic support for shared fonts.
| * | | | shared_memory: Remove some checks.bunnei2018-02-151-13/+0
| | | | |
| * | | | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-156-0/+182
| | | | |
| * | | | log: Add logging category for NS services.bunnei2018-02-152-0/+2
| | | | |
| * | | | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/ / / /
* | | | Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-1511-108/+102
|\ \ \ \ | | | | | | | | | | Refactor IPC buffer descriptor interface
| * | | | hle_ipc: Remove const from WriteBuffer size.bunnei2018-02-142-2/+2
| | | | |
| * | | | hle_ipc: Add GetReadBufferSize and check write buffer size.bunnei2018-02-142-0/+10
| | | | |
| * | | | service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| | | | |
| * | | | audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| | | | |
| * | | | vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| | | | |
| * | | | nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| | | | |
| * | | | vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| | | | |
| * | | | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-141-4/+2
| | | | |
| * | | | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-143-0/+55
| | | | |
| * | | | vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
| | | | |
* | | | | Merge pull request #192 from jroweboy/fix-fpsbunnei2018-02-141-0/+2
|\ \ \ \ \ | |_|/ / / |/| | | | Fix fps counter to correctly measure frame end when there was no frame to draw
| * | | | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
|/ / / /
* | | | Merge pull request #190 from bunnei/fix-qt-waittreebunnei2018-02-141-1/+1
|\ \ \ \ | | | | | | | | | | debugger: Fix wait_tree crash.
| * | | | debugger: Fix wait_tree crash.bunnei2018-02-141-1/+1
| |/ / /
* | | | Merge pull request #191 from lioncash/logbunnei2018-02-1412-57/+82
|\ \ \ \ | | | | | | | | | | core: Silence formatting specifier warnings
| * | | | memory: Silence formatting sepecifier warningsLioncash2018-02-141-21/+30
| | | | |
| * | | | nso: Silence formatting specifier warningsLioncash2018-02-141-2/+4
| | | | |
| * | | | deconstructed_rom_directory: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| | | | |
| * | | | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| | | | |
| * | | | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| | | | |
| * | | | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
| | | | |
| * | | | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
| | | | |
| * | | | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| | | | |
| * | | | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| | | | |
| * | | | thread: Silence formatting specifier warningsLioncash2018-02-141-2/+3
| | | | |
| * | | | vm_manager: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| | | | |
| * | | | gdbstub: Silence formatting specifier warningsLioncash2018-02-141-6/+9
| |/ / /
* | | | Merge pull request #189 from lioncash/miscbunnei2018-02-141-1/+1
|\ \ \ \ | |/ / / |/| | | maxwell_3d: Make constructor explicit
| * | | maxwell_3d: Make constructor explicitLioncash2018-02-141-1/+1
|/ / /
* | | Merge pull request #187 from Subv/maxwell3d_querybunnei2018-02-143-3/+95
|\ \ \ | | | | | | | | GPU: Partially implemented the QUERY_* registers in the Maxwell3D engine.
| * | | GPU: Partially implemented the QUERY_* registers in the Maxwell3D engine.Subv2018-02-123-3/+95
| | | | | | | | | | | | | | | | Only QueryMode::Write is supported at the moment.
* | | | audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
| | | | | | | | | | | | | | | | | | | | | | | | * audren_u: Schedule reoccuring event. * audren_u: Stub GetAudioRenderersProcessMasterVolume, and misc. changes.
* | | | Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\ \ \ \ | | | | | | | | | | VI cleanup and add a hack for booting games
| * | | | vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| | | | |
| * | | | vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| | | | |
| * | | | TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
| | | | |
* | | | | Merge pull request #184 from mailwl/lmbunnei2018-02-131-20/+49
|\ \ \ \ \ | |/ / / / |/| | | | Service/lm: add support to multiline logs
| * | | | Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
| | | | |
* | | | | Merge pull request #180 from MerryMage/f/dynarmic/direct-page-tablebunnei2018-02-134-10/+19
|\ \ \ \ \ | |/ / / / |/| | | | arm_dynarmic: Support direct page table access
| * | | | arm_dynarmic: Support direct page table accessMerryMage2018-02-124-10/+19
|/ / / /
* | | | Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\ \ \ \ | | | | | | | | | | Stub RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer
| * | | | Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
| | | | |
* | | | | Merge pull request #178 from Subv/command_buffersbunnei2018-02-1220-23/+364
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / / GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines
| * | | Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-1220-76/+125
| | | | | | | | | | | | | | | | Also moved the GPU MemoryManager class to video_core since it makes more sense for it to be there.
| * | | GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-1212-3/+285
| | | |
| * | | nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
| | | |
* | | | Merge pull request #177 from bunnei/vi-fixesbunnei2018-02-129-22/+67
|\ \ \ \ | |/ / / |/| | | Several misc. VI fixes
| * | | renderer_opengl: Support framebuffer flip vertical.bunnei2018-02-123-5/+13
| | | |
| * | | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
| | | |
| * | | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/ / /
* | | Merge pull request #175 from bunnei/libnx-fixes-2bunnei2018-02-109-99/+166
|\ \ \ | | | | | | | | More fixes for Libnx
| * | | fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
| | | |
| * | | apm: Refactor service impl. to support multiple ports.bunnei2018-02-105-58/+102
| | | |
| * | | vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
| | | |
| * | | nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
| | | |
| * | | IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
| | | | | | | | | | | | | | | | - Another fix for libnx.
| * | | IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
|/ / /
* | | Merge pull request #171 from bunnei/libnx-fixesbunnei2018-02-096-9/+38
|\ \ \ | | | | | | | | Various fixes for libnx, etc.
| * | | nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
| | | |
| * | | IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
| | | |
| * | | nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
| | | |
| * | | acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
| | | |
* | | | Merge pull request #173 from MerryMage/feature/dynarmic-fix-windowsbunnei2018-02-091-0/+0
|\ \ \ \ | | | | | | | | | | dynarmic: Fix bug due to Windows ABI mismatch
| * | | | dynarmic: Fix bug due to Windows ABI mismatchMerryMage2018-02-091-0/+0
| | | | |
* | | | | Merge pull request #170 from MerryMage/feature/dynarmic-update-201802bunnei2018-02-095-32/+46
|\| | | | | |/ / / |/| | | dynarmic: Update to 41ae12263
| * | | dynarmic: Update to 41ae12263MerryMage2018-02-095-32/+46
|/ / / | | | | | | | | | Changes: Primarily implementing more A64 instructions
* | | Merge pull request #169 from bunnei/gpu-membunnei2018-02-088-30/+225
|\ \ \ | | | | | | | | nvdrv: Implement AllocateSpace and MapBufferEx
| * | | nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
| | | |
| * | | nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-083-0/+162
| | | |
| * | | nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
| | | |
| * | | nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
|/ / /
* | | Merge pull request #168 from mailwl/new-stubsbunnei2018-02-079-6/+191
|\ \ \ | | | | | | | | Service: stub some functions in am, audio, time, vi services
| * | | Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
|/ / /
* | | Merge pull request #166 from mailwl/hid-SetNpadHandhelpActivationModebunnei2018-02-061-0/+7
|\ \ \ | | | | | | | | Service/hid: stub SetNpadHandheldActivationMode
| * | | Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
|/ / /
* | | Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-064-2/+23
|\ \ \ | | | | | | | | Stubs for HID, AM, and a mutex fix
| * | | mutex: Update hasWaiters on release.bunnei2018-02-061-0/+1
| | | |
| * | | hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| | | |
| * | | IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
| | | |
* | | | Extra nvdrv support (#162)David2018-02-0617-37/+765
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * FinishInitalize needed for 3.0.1+ games * nvdrv:s and nvdrv:t both use NVDRV * Most settings return 0 on hardware, disabled NV_MEMORY_PROFILER for now. NVN_THROUGH_OPENGL & NVRM_GPU_PREVENT_USE are a few interesting settings to look at. Carefully choosing settings can help with drawing graphics later on * Initial /dev/nvhost-gpu support * ZCullBind * Stubbed SetErrorNotifier * Fixed SetErrorNotifier log, Added SetChannelPriority * Allocate GPFIFO Ex2, Allocate Obj Ctx, Submit GPFIFO * oops * Fixed up naming/structs/enums. Used vector instead of array for "gpfifo_entry" * Added missing fixes * /dev/nvhost-ctrl-gpu * unneeded struct * Forgot u32 in enum class * Automatic descriptor swapping for ioctls, fixed nvgpu_gpu_get_tpc_masks_args being incorrect size * nvdrv#QueryEvent * Renamed logs for nvdrv * Refactor ioctl so nv_result isn't needed * /dev/nvhost-as-gpu * Fixed Log service naming, CtxObjects now u32, renamed all structs, added static_asserts to structs, used INSERT_PADDING_WORDS instead of u32s * nvdevices now uses "Ioctl" union, * IoctlGpfifoEntry now uses bit field * final changes
* | | Merge pull request #164 from ogniK5377/libnx_sm_fixbunnei2018-02-051-0/+2
|\ \ \ | | | | | | | | Don't call UNIMPLEMENTED for 'empty services', just return error code
| * | | Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
| | | |
* | | | Merge pull request #163 from ogniK5377/istorage_to_romfsbunnei2018-02-052-5/+5
|\ \ \ \ | |/ / / |/| | | Changed .istorage to .romfs
| * | | Changed .istorage to .romfsDavid Marcec2018-02-052-5/+5
|/ / /
* | | Merge pull request #161 from bunnei/service-improvementsbunnei2018-02-0524-124/+211
|\ \ \ | | | | | | | | Many service improvements
| * | | set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
| | | |
| * | | nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
| | | | | | | | | | | | | | | | - This gets BOTW booting.
| * | | logger: Add Time service logging category.bunnei2018-02-053-10/+12
| | | |
| * | | logger: Add SET service logging category.bunnei2018-02-053-16/+12
| | | |
| * | | logger: Add PCTL service logging category.bunnei2018-02-053-1/+3
| | | |
| * | | logger: Add LM service logging category.bunnei2018-02-053-2/+4
| | | |
| * | | logger: Add APM service logging category.bunnei2018-02-053-2/+5
| | | |
| * | | lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
| | | |
| * | | logger: Add NIFM service logging category.bunnei2018-02-056-11/+13
| | | |
| * | | logger: Add VI service logging category.bunnei2018-02-056-21/+22
| | | |
| * | | hid: Stub out several functions.bunnei2018-02-051-1/+39
| | | |
| * | | hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
| | | |
| * | | logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
| | | |
| * | | logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
| | | |
| * | | logger: Add AM service logging category.bunnei2018-02-045-42/+44
| | | |
| * | | logger: Add "account" service logging category.bunnei2018-02-043-8/+10
| | | |
| * | | acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
|/ / /
* | | Merge pull request #160 from bunnei/svc-improvementsbunnei2018-02-045-24/+32
|\ \ \ | | | | | | | | Several SVC fixes and improvements
| * | | GetInfo: Implement IsCurrentProcessBeingDebugged.bunnei2018-02-041-0/+3
| | | |
| * | | WaitProcessWideKeyAtomic: Handle case where condition variable was already created.bunnei2018-02-043-13/+17
| | | |
| * | | svc: SharedMemory size should be 64-bits and cleanup.bunnei2018-02-033-11/+11
| | | |
| * | | ArbitrateLock: Assert that requesting_thread is current_thread.bunnei2018-02-031-0/+1
| | | |
* | | | Merge pull request #159 from mailwl/acc0-fixbunnei2018-02-041-1/+9
|\ \ \ \ | |/ / / |/| | | acc:u0 : stub GetAccountId
| * | | acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|/ / /
* | | Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\ \ \ | | | | | | | | controller: DuplicateSession should return a ClientSession.
| * | | controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
| | | |
* | | | Merge pull request #156 from mailwl/nifmbunnei2018-02-0310-0/+378
|\ \ \ \ | |/ / / |/| | | Service/nifm: add nifm:a, nifm:s and nifm:u services
| * | | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-0310-0/+378
|/ / /
* | | Service/am: Add AppletAE service (#153)mailwl2018-02-027-379/+571
| | | | | | | | | | | | | | | | | | * Add AppletAE, step 1: move common interfaces to am.h * Add AppletAE, step 2
* | | Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\ \ \ | | | | | | | | vi::CreateStrayLayer : add padding to request
| * | | vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
| | | |
* | | | Merge pull request #155 from mailwl/vi-servicesbunnei2018-02-026-0/+128
|\ \ \ \ | | | | | | | | | | Services/vi: add vi:s and vi:u services
| * | | | Services/vi: add vi:s and vi:u servicesmailwl2018-02-026-0/+128
| |/ / /
* | | | Merge pull request #152 from shinyquagsire23/sharedmem-valid-boundsbunnei2018-02-021-1/+2
|\ \ \ \ | |/ / / |/| | | shared_memory: Only mark addresses as invalid if they are within the heap
| * | | shared_memory: Only mark addresses as invalid if they are within the heapshinyquagsire232018-01-301-1/+2
| | | |
* | | | [WIP] sfdnsres: stub (#146)mailwl2018-01-305-2/+52
|/ / / | | | | | | sfdnsres: Add several stubs
* | | Merge pull request #151 from lioncash/catchbunnei2018-01-281-0/+0
|\ \ \ | | | | | | | | externals: Update catch to v2.1.1
| * | | externals: Update catch to v2.1.1Lioncash2018-01-271-0/+0
|/ / /
* | | Merge pull request #148 from MerryMage/feature/special-memorybunnei2018-01-2711-441/+273
|\ \ \ | | | | | | | | memory: Replace all memory hooking with Special regions
| * | | memory: Replace all memory hooking with Special regionsMerryMage2018-01-2711-441/+273
| | | |
* | | | Merge pull request #149 from MerryMage/feature/remove-x86_64hbunnei2018-01-271-1/+1
|\ \ \ \ | | | | | | | | | | travis: Remove CMAKE_OSX_ARCHITECTURES argument
| * | | | travis: Remove CMAKE_OSX_ARCHITECTURES argumentMerryMage2018-01-271-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Unicorn only builds a x86_64 library, without a x86_64h slice. We can't link against x86_64-only in this manner for static libraries.
* | | | | Merge pull request #147 from chris062689/masterFlame Sage2018-01-271-0/+5
|\ \ \ \ \ | | | | | | | | | | | | Added webhook notifications to TravisCI build.
| * | | | | Added webhook notifications to TravisCI build.Flame Sage2018-01-271-0/+5
|/ / / / /
* | | | | Merge pull request #144 from KAMiKAZOW/patch-1bunnei2018-01-271-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Install Linux icon in hicolor instead of pixmaps
| * | | | | Install Linux icon in hicolor instead of pixmapsKAMiKAZOW2018-01-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | hicolor is the preferred location for applications. See https://specifications.freedesktop.org/icon-theme-spec/icon-theme-spec-latest.html#directory_layout Same as https://github.com/citra-emu/citra/pull/3007
* | | | | | Merge pull request #145 from jroweboy/oopsbunnei2018-01-261-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Fix typo for dependent options
| * | | | | Fix typo for dependent optionsJames Rowe2018-01-261-1/+1
|/ / / / /
* | | | | Merge pull request #142 from bunnei/improve-timebunnei2018-01-262-1/+22
|\ \ \ \ \ | | | | | | | | | | | | time: Implement ISteadyClock::GetCurrentTimePoint
| * | | | | time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
|/ / / / /
* | | | | Merge pull request #137 from bunnei/improve-ipcbunnei2018-01-2532-452/+311
|\ \ \ \ \ | | | | | | | | | | | | Improve IPC, unify Domains and Sessions, and add validation
| * | | | | audout_u: Various cleanups.bunnei2018-01-251-29/+17
| | | | | |
| * | | | | ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-253-11/+21
| | | | | |
| * | | | | time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
| | | | | |
| * | | | | server_session: Fix scenario where all domain handlers are closed.bunnei2018-01-251-3/+3
| | | | | |
| * | | | | hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2519-128/+129
| | | | | |
| * | | | | service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
| | | | | |
| * | | | | ipc_helpers: Make interface domain agnostic and add header validation.bunnei2018-01-252-25/+58
| | | | | |
| * | | | | hle: Integrate Domain handling into ServerSession.bunnei2018-01-257-38/+74
| | | | | |
| * | | | | hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-2510-169/+2
| | | | | |
| * | | | | handle_table: Remove ConvertSessionToDomain.bunnei2018-01-252-17/+0
|/ / / / /
* | | | | audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-254-14/+168
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * audout:u OpenAudioOut implementation and IAudioOut cmd 1,2,3,4,5 implementation * using an enum for audio_out_state as well as changing its initialize to member initializer list * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * added missing Audio loggin subclass, minor fixes, clang comment breakline * Solving backend logging conflict * minor fix * Fixed duplicated Service NVDRV in backend.cpp, my bad
* | | | | Merge pull request #140 from gdkchan/time_fixbunnei2018-01-241-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Fix time returning epoch time in milliseconds rather than in seconds
| * | | | | Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
|/ / / / /
* | | | | Merge pull request #139 from Rozelette/log_nvdrvbunnei2018-01-241-0/+1
|\ \ \ \ \ | | | | | | | | | | | | logging: add missing NVDRV subclass to macro list
| * | | | | logging: add missing NVDRV subclass to macro listRozlette2018-01-241-0/+1
|/ / / / /
* | | | | Merge pull request #136 from N00byKing/patch-1bunnei2018-01-241-2/+2
|\ \ \ \ \ | | | | | | | | | | | | Correct Spelling
| * | | | | Correct SpellingN00byKing2018-01-231-2/+2
|/ / / / /
* | | | | Merge pull request #135 from Subv/no_portsbunnei2018-01-235-65/+67
|\ \ \ \ \ | | | | | | | | | | | | IPC: Don't create unnecessary ports when returning sub interfaces.
| * | | | | Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| | | | | |
| * | | | | Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| | | | | |
| * | | | | HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| | | | | |
| * | | | | LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| | | | | |
| * | | | | IPC: Don't create an unnecessary port when using PushIpcInterface outside of a domain.Subv2018-01-221-4/+5
| | | | | |
* | | | | | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ \ \ \ \ | |/ / / / / |/| | | | | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the default display.
| * | | | | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | This function is used by libnx to obtain a new layer.
| * | | | | AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| | | | | | | | | | | | | | | | | | | | | | | | It'll be needed when we implement CreateManagedDisplayLayer.
| * | | | | Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
| | | | | | | | | | | | | | | | | | | | | | | | It is now created during Service initialization and passed to all the services that need it.
* | | | | | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Stub OpenAudioOut and fix a issue with HID IAppletResource
| * | | | | Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
| | | | | |
* | | | | | Merge pull request #132 from Subv/nvflingerbunnei2018-01-229-363/+452
|\ \ \ \ \ \ | |/ / / / / |/| | | | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.
| * | | | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-229-363/+452
|/ / / / /
* | | | | Added stubs for audio services. (#116)st4rk2018-01-2212-5/+309
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * stubs for audout:u, audin:u, audrec:u, audren:u, codecctl and decoding tables with nullptr for future implementations * fixing the changes requested (remove private, explicit)
* | | | | Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ \ \ \ \ | | | | | | | | | | | | nvmap: Make IoctlCommands an enum class
| * | | | | nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | This macro resolves to an empty macro in release builds.
| * | | | | nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | Prevents the enum values from polluting the surrounding scope
* | | | | | Merge pull request #130 from MerryMage/dynarmicbunnei2018-01-221-0/+0
|\ \ \ \ \ \ | | |_|/ / / | |/| | | | externals: Update dynarmic
| * | | | | externals: Update dynarmicMerryMage2018-01-211-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | a6d17e A64: Implement AND (vector) 963453 tests/A64: Randomize vectors adcd34 tests/A64/unicorn: Print interrupt number when InterruptHook is hit 304c91 tests/A64: Allow RunTestInstance to start from an arbitrary offset d333b5 A64: Implement ADD (vector, vector) 1cf87a A64: Implement REV, REV32, and REV16 (#126) 9fc157 IR: Simplify types. F32 -> U32, F64 -> U64, F128 -> U128 50c181 reg_alloc: GetBitWidth: Add UNREACHABLE adccbf reg_alloc: Consider bitwidth of data and registers when emitting instructions 7b7f23 A64: Implement CSEL 2f8413 IR: Implement Conditional Select ebb3e8 A64/tests: Split unicorn sanity checking from other tests 5740a0 tests/A64: Single random instruction: Test branch instructions as well 0892b4 A64/translate/branch: bug: Read-after-write error in BLR e77bc2 A64: Implement SBFM, BFM, UBFM 0c37ca A64: Implement MOVN, MOVZ, MOVK b6bb59 travis: Print current test information e77207 fuzz_thumb: Off by one error a04ca2 ir/location_descriptor: Add missing <functional> header for std::hash 1e0f5c travis: Run A64 tests
* | | | | | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-219-5/+163
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid * used clang-format-3.9 instead * lowercase pid * Moved nvmemp handlers to cpp * Removed unnecessary logging for NvOsGetConfigU32. Cleaned up log and changed to LOG_DEBUG * using std::arrays instead of c arrays * nvhost get config now uses std::array completely * added pid logging back * updated cmakelist * missing includes * added array, removed memcpy * clang-format6.0
* | | | | | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \ \ \ \ \ | | | | | | | | | | | | | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.
| * | | | | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #123 from bunnei/fsbunnei2018-01-2125-947/+535
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Initial implementation of RomFS filesystem and fsp-srv
| * | | | | file_sys: Clang format fixes.bunnei2018-01-213-4/+4
| | | | | |
| * | | | | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-215-48/+79
| | | | | |
| * | | | | deconstructed_rom_directory: Implement istorage loading for RomFS.bunnei2018-01-212-2/+71
| | | | | |
| * | | | | filesystem: Implement basic IStorage functionality.David Marcec2018-01-216-0/+258
| | | | | |
| * | | | | file_sys: Cleanup to better match Switch file system constructs.bunnei2018-01-2110-63/+136
| | | | | | | | | | | | | | | | | | | | | | | | file_sys: Add factory class for RomFS file system.
| * | | | | file_sys: Remove disk_archive, savedata_archive, and title_metadata.bunnei2018-01-217-835/+0
| | | | | |
| * | | | | archive_backend: Minor changes to match Switch IFileSystem.bunnei2018-01-215-26/+26
| | | | | |
| * | | | | file_sys: Repurpose 3DS IVFC code for Switch ROMFS.bunnei2018-01-213-51/+43
|/ / / / /
* | | | | Merge pull request #129 from Rozelette/masterbunnei2018-01-211-113/+155
|\ \ \ \ \ | | | | | | | | | | | | gdbstub: Update registers and sizes for aarch64
| * | | | | gdbstub: Update registers and sizes for aarch64Rozlette2018-01-211-113/+155
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This gets gdbstub working at least to the point where clients can communicate with it. What works: - Reading/writing GPRegs - Reading/writing memory - Interrupting the emulated program and continuing What does NOT work: - Breakpoints. Sizes have been updated to u64, but support will need to be added in the interpreter for them to work. - VRegs. Mostly because my gdb was having issues with 128-bit regs for some reason. However, the current u128 representation is a bit awkward to use and should probably be updated first.
* | | | | Merge pull request #124 from akkatracker/patch-1bunnei2018-01-211-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Fix minor spelling error in CMakeLists
| * | | | | Fix spelling error in CMakeListsMatthew Brener2018-01-211-1/+1
| |/ / / / | | | | | | | | | | Minor spelling error of its --> it's
* | | | | Merge pull request #125 from MerryMage/bundled-unicornbunnei2018-01-211-3/+6
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / / Unicorn build fixups
| * | | CMakeLists: Fix unicorn build for macOS developers with x86_64-only systemsMerryMage2018-01-211-1/+1
| | | | | | | | | | | | | | | | Some of us do not have any i386 libraries required to build x86-32 universal libraries.
| * | | CMakeLists: Do not look for system Unicorn by defaultMerryMage2018-01-211-2/+5
|/ / / | | | | | | | | | | | | Since we use a custom build of unicorn it doesn't make much sense to look for the system version, unless the user explicitly wants to override this.
* | | Merge pull request #72 from N00byKing/patch-2bunnei2018-01-211-1/+0
|\ \ \ | | | | | | | | Implement Pull #3275 from citra: core: Don't Shutdown before we've even Init-ed
| * | | Update core.cppN00byKing2018-01-171-1/+0
| | | |
* | | | Merge pull request #92 from gdkchan/nro_refactorbunnei2018-01-211-2/+2
|\ \ \ \ | | | | | | | | | | Fix NRO entry point
| * | | | Fix NRO Entry Pointgdkchan2018-01-181-2/+2
| | | | |
* | | | | Merge pull request #122 from tgsm/time-remove-pragmabunnei2018-01-212-4/+0
|\ \ \ \ \ | | | | | | | | | | | | service/time: remove accidental #pragmas
| * | | | | service/time: remove accidental #pragmastgsm2018-01-212-4/+0
| | | | | |
* | | | | | Merge pull request #121 from Rozelette/masterbunnei2018-01-211-1/+0
|\ \ \ \ \ \ | |/ / / / / |/| | | | | loader: Minor style fix in deconstructed_rom_directory
| * | | | | loader: Minor style fix in deconstructed_rom_directoryRozlette2018-01-211-1/+0
|/ / / / /
* | | | | Merge pull request #117 from jroweboy/clang-formatbunnei2018-01-2178-122/+275
|\ \ \ \ \ | | | | | | | | | | | | Clang format as a build target
| * | | | | Travis: Add missing PPA for newer libstdc++James Rowe2018-01-211-0/+1
| | | | | |
| * | | | | Travis: Update clang-format to 6.0James Rowe2018-01-212-2/+5
| | | | | |
| * | | | | Format: Run the new clang format on everythingJames Rowe2018-01-2174-117/+207
| | | | | |
| * | | | | CMake: Conditionally turn on bundled libs for MSVCJames Rowe2018-01-211-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes the annoying step when generating sln for MSVC where you have to click an extra checkbox after the first generate fails by using a conditional option. The USE_BUNDLED options will be off by default, but if the enable_lib option is enabled and the toolset is msvc, they are turned ON.
| * | | | | CMake: Update contributing guide with the new clang format infoJames Rowe2018-01-211-1/+10
| | | | | |
| * | | | | CMake: Add a custom clang format targetJames Rowe2018-01-201-0/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Checks to see if clang-format can be found, and if it is, sets up a custom target that will run against the src dir and auto formats all files. In MSVC, this is a project, and in Makefiles, its a make target
* | | | | | Merge pull request #120 from Rozelette/masterbunnei2018-01-201-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | memory: Return false for large VAddr in IsValidVirtualAddress
| * | | | | | memory: Return false for large VAddr in IsValidVirtualAddressRozlette2018-01-201-0/+3
| |/ / / / /
* | | | | | Merge pull request #119 from bunnei/desconstucted-loaderbunnei2018-01-2011-51/+200
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Separate NSO loading from DesconstuctedRomLoader
| * | | | | loader: Clean up ctors and includes.bunnei2018-01-2010-18/+22
| | | | | |
| * | | | | loader: Add DeconstructedRomDirectory for game dumps.bunnei2018-01-205-0/+156
| | | | | |
| * | | | | loader: Refactor to also pass filepath into IdentifyType.bunnei2018-01-208-19/+19
| | | | | |
| * | | | | nso: Remove code specific to directory loading.bunnei2018-01-202-17/+6
|/ / / / /
* | | | | Port citra #3352 to yuzu (#103)River City Ransomware2018-01-204-12/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Port citra #3352 to yuzu This change allows non x86_64 architectures to compile yuzu by skipping the building of dynarmic * Fixed clang-format errors * fixes more clang-format errors
* | | | | Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-203-1/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added svcCreateSharedMemory * Services which are not implemented now throw UNIMPLEMENTED() * clang-format * changed perms to u32 * removed camelcase
* | | | | Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-206-21/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixes some cast warnings, partially fixes citra #3064 * Converted casts to uint32_t to u32 * Ran clang-format
* | | | | Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\ \ \ \ \ | | | | | | | | | | | | ISelfController: Stub LockExit and UnlockExit
| * | | | | ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
| | | | | |
* | | | | | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-198-0/+161
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stubs for various acc:u0 funcs needed * Stub for GetDesiredLanguage in IApplicationFunctions * Add set service + stubs needed for games * Fix formatting * Implement IProfile, IManagerForApplication, return bool in CheckAvailability, style fixes * Remove IProfile::Get(needs more research), fix IPC response sizes
* | | | | Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-196-1/+26
|\ \ \ \ \ | | | | | | | | | | | | Fix svcGetInfo for libnx
| * | | | | nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| | | | | |
| * | | | | svc: Fix svcGetInfo MapRegionBaseAddr.bunnei2018-01-193-1/+9
| | | | | |
| * | | | | svc: Add additional fields to MemoryInfo struct.bunnei2018-01-191-0/+4
| | | | | |
* | | | | | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | time: Stub out GetTotalLocationNameCount and some cleanup.
| * | | | | | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
| | | | | | |
* | | | | | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
| | | | | | |
* | | | | | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ / / / / /
* | | | | | Merge pull request #108 from gdkchan/dispdrvbunnei2018-01-191-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Fix dispdrv typo
| * | | | | Fix dispdrv typogdkchan2018-01-191-1/+1
|/ / / / /
* | | | | Merge pull request #100 from Rozelette/masterbunnei2018-01-197-32/+113
|\ \ \ \ \ | | | | | | | | | | | | time: Refactor time:* to use a single shared module
| * | | | | time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| | | | | |
| * | | | | time: Refactor time:* to use a single shared moduleRozlette2018-01-187-26/+107
| | |_|/ / | |/| | |
* | | | | Merge pull request #104 from RiverCityRansomware/resizedConfigWindowbunnei2018-01-191-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Port citra #3336
| * | | | | Port citra #3336 - Resizes the configuration window to not be so stretched outRiver City Ransomware2018-01-181-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #107 from lioncash/qtbunnei2018-01-195-31/+31
|\ \ \ \ \ | | | | | | | | | | | | qt: Migrate to Qt 5 signal/slot connection syntax where applicable
| * | | | | qt: Migrate to Qt 5 signal/slot connection syntax where applicableLioncash2018-01-195-31/+31
|/ / / / /
* | | | | ui: Rename almost all classes in configuration_input.ui (#99)Evgeni Danailov2018-01-181-66/+66
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Rename verticalLayout_25 to verticalLayout_23. * Rename almost all classes.
* | | | | Merge pull request #101 from jroweboy/add-missing-dllsbunnei2018-01-181-3/+10
|\ \ \ \ \ | |/ / / / |/| | | | Build: Add missing dlls to msvc release
| * | | | Build: Add missing dlls to msvc releaseJames Rowe2018-01-181-3/+10
| | | | |
* | | | | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-185-7/+127
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stub PopLaunchParameter and implement Buffer C Descriptors reading * Address PR feedback * Ensure we push a u64 not a size_t * Fix formatting
* | | | | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-187-0/+159
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * run clang-format (2)
* | | | | Merge pull request #98 from lioncash/xcodebunnei2018-01-181-1/+1
|\ \ \ \ \ | | | | | | | | | | | | travis: Use Xcode 9.2
| * | | | | travis: Use Xcode 9.2Lioncash2018-01-181-1/+1
| | |/ / / | |/| | | | | | | | | | | | | | | | | | Uses the latest available Xcode version. This allows the use of more C++17 facilities without the CI failing.
* | | | | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ \ \ \ | |/ / / / |/| | | | lm: Minor logging fix to skip a byte.
| * | | | lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
| | | | |
* | | | | Merge pull request #84 from lioncash/cmakebunnei2018-01-1811-389/+361
|\ \ \ \ \ | | | | | | | | | | | | CMakeLists: Derive the source directory grouping from targets themselves
| * | | | | CMakeLists: Derive the source directory grouping from targets themselvesLioncash2018-01-1811-389/+361
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes the need to store to separate SRC and HEADER variables, and then construct the target in most cases.
* | | | | | Merge pull request #91 from lioncash/svcbunnei2018-01-181-9/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Minor clarity changes
| * | | | | | svc: Rename some entries to match their analogue on SwitchBrewLioncash2018-01-181-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the codebase a little more consistent with regards to available documentation. Also amends the duplicate case where there was a similar entry at 0x72 named ConnectToPort.
| * | | | | | svc: Add CreateJitMemory and MapJitMemory svc stringsLioncash2018-01-181-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | Makes the table match SwitchBrew for these entries
* | | | | | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ \ \ \ \ | | | | | | | | | | | | | | vi: Minor clean up/correctness changes
| * | | | | | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit conversions.
| * | | | | | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| |/ / / / /
* | | | | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | vi: Copy data directly into the std::vector within Parcel's ReadBlock function
| * | | | | | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Previously this would unnecessarily zero-initialize the vector before copying the actual data into the vector instance.
* | | | | | Merge pull request #88 from lioncash/includebunnei2018-01-181-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | hotkeys: Add missing <QTreeWidgetItem> include
| * | | | | | hotkeys: Add missing <QTreeWidgetItem> includeLioncash2018-01-181-0/+1
| |/ / / / /
* | | | | | Merge pull request #87 from lioncash/overridebunnei2018-01-181-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | game_list: Add missing override specifier for KeyReleaseEater's eventFilter function
| * | | | | | game_list: Add missing override specifier for KeyReleaseEater's eventFilter functionLioncash2018-01-181-1/+1
| |/ / / / /
* | | | | | Merge pull request #93 from jroweboy/deploy-keyFlame Sage2018-01-182-2/+2
|\ \ \ \ \ \ | | |_|/ / / | |/| | | | Build: Update deploy keys
| * | | | | Build: Update deploy keysJames Rowe2018-01-182-2/+2
|/ / / / /
* | | | | Merge pull request #86 from lioncash/doxygenbunnei2018-01-181-2/+2
|\ \ \ \ \ | | | | | | | | | | | | game_list: Amend doxygen parameter identifiers
| * | | | | game_list: Amend doxygen parameter identifiers for containsAllWords()Lioncash2018-01-181-2/+2
| |/ / / /
* | | | | Merge pull request #85 from lioncash/warnbunnei2018-01-181-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | | telemetry: Silence initialization order warnings
| * | | | telemetry: Silence initialization order warningsLioncash2018-01-181-2/+2
| |/ / /
* | | | controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
| | | |
* | | | Merge pull request #83 from lioncash/pessimizing-movebunnei2018-01-181-1/+1
|\ \ \ \ | | | | | | | | | | input_common/sdl: Silence a -Wpessimizing-move warning
| * | | | input_common/sdl: Silence a -Wpessimizing-move warningLioncash2018-01-181-1/+1
| |/ / /
* | | | Merge pull request #82 from lioncash/catchbunnei2018-01-181-0/+0
|\ \ \ \ | | | | | | | | | | externals: Update catch to 2.1.0
| * | | | externals: Update catch to 2.1.0Lioncash2018-01-181-0/+0
| |/ / /
* | | | Merge pull request #81 from lioncash/qt-bootmgrbunnei2018-01-182-7/+6
|\ \ \ \ | | | | | | | | | | bootmanager: Minor tidiness/correctness changes
| * | | | bootmanager: Minor tidiness/correctness changesLioncash2018-01-182-7/+6
| |/ / / | | | | | | | | | | | | Moved over from #3266 in citra.
* | | | Merge pull request #80 from gdkchan/nro_fixbunnei2018-01-181-20/+9
|\ \ \ \ | |/ / / |/| | | Fix NRO loading
| * | | Fix NRO loadinggdkchan2018-01-181-20/+9
| | | |
* | | | Merge pull request #73 from N00byKing/3093bunnei2018-01-182-0/+2
|\ \ \ \ | |/ / / |/| | | Implement Pull #3093 from citra: Added missing headers to CMakeLists.txt and fixed includes.
| * | | Update CMakeLists.txtN00byKing2018-01-171-0/+1
| | | |
| * | | Update title_metadata.hN00byKing2018-01-171-0/+1
| | | |
* | | | Merge pull request #76 from Rozelette/masterbunnei2018-01-175-85/+164
|\ \ \ \ | | | | | | | | | | TIME: consolidate time:* interfaces, stub functions and structs
| * | | | TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-175-85/+164
| | | | |
* | | | | Implement Pull #3306 from citra: citra_qt: Drop Qt 5 version checks in code (#41)N00byKing2018-01-171-13/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Update bootmanager.cpp * This *should* fix the clang error
* | | | | Merge pull request #77 from gdkchan/no_relocsbunnei2018-01-173-19/+2
|\ \ \ \ \ | |/ / / / |/| | | | Remove relocation on NSO/NRO
| * | | | Remove relocation on NSO/NROgdkchan2018-01-173-19/+2
|/ / / /
* | | | Merge pull request #42 from N00byKing/3295bunnei2018-01-171-5/+1
|\ \ \ \ | | | | | | | | | | Implement Pull #3295 from citra: citra_qt: CMakeLists: Drop leftover handling code for Qt 4 UI files
| * | | | Update CMakeLists.txtN00byKing2018-01-161-5/+1
| |/ / /
* | | | Merge pull request #57 from nkatz565/fix-trbunnei2018-01-171-1/+2
|\ \ \ \ | | | | | | | | | | Fix non translated string (same as Citra PR 2949)
| * | | | Fixed formattingnoah katz2018-01-171-2/+2
| | | | |
| * | | | Fix non translated string (same as Citra PR 2949)noah katz2018-01-171-1/+1
| | | | |
* | | | | Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\ \ \ \ \ | | | | | | | | | | | | hid: Adjust timing based on actual hardware
| * | | | | hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
| | |_|_|/ | |/| | |
* | | | | Merge pull request #70 from flerovii/nvdrv-closebunnei2018-01-174-0/+26
|\ \ \ \ \ | | | | | | | | | | | | nvdrv: stubbed Close(cmd 2)
| * | | | | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
| | | | | |
* | | | | | svc: Clang-format fix.bunnei2018-01-171-6/+4
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #71 from N00byKing/patch-1bunnei2018-01-171-2/+2
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3109 from citra: sdl2 default ini: fix framelimit
| * | | | | Update default_ini.hN00byKing2018-01-171-2/+2
| |/ / / /
* | | | | Merge pull request #62 from bunnei/domain-close-handlebunnei2018-01-175-4/+38
|\ \ \ \ \ | |/ / / / |/| | | | Implement IPC domain command CloseVirtualHandle
| * | | | hle_ipc: Clang format.bunnei2018-01-171-2/+3
| | | | |
| * | | | ipc: Implement domain command CloseVirtualHandle.bunnei2018-01-173-3/+34
| | | | |
| * | | | loggin: Add IPC logging category.bunnei2018-01-172-1/+3
| | | | |
* | | | | Merge pull request #67 from RiverCityRansomware/gdbstubtypobunnei2018-01-171-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | Fix gdbstub typo
| * | | | Fix gdbstub typo, fixes Citra #3318River City Ransomware2018-01-171-1/+1
|/ / / / | | | | | | | | Core::System().GetInstance().IsPoweredOn() -> Core::System::GetInstance().IsPoweredOn()
* | | | Merge pull request #60 from jroweboy/game-framebunnei2018-01-172-1/+4
|\ \ \ \ | |/ / / |/| | | UI: Fix frame rate perf stats
| * | | UI: Fix frame rate perf statsJames Rowe2018-01-172-1/+4
| | | | | | | | | | | | | | | | Adds in a missing EndGameFrame when nvdrv swaps buffers
* | | | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ \ \ | |/ / / |/| | | hid: Write to all layouts, implement circular buffers, set up controller metadata.
| * | | hid: clang-formatshinyquagsire232018-01-171-3/+3
| | | |
| * | | hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| | | |
| * | | hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
| | | |
* | | | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-176-0/+86
| | | |
* | | | Merge pull request #55 from bunnei/subv-improvementsbunnei2018-01-1723-216/+381
|\ \ \ \ | | | | | | | | | | Improvements to IPC, AppletOE, APM, VI, SVC
| * | | | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
| | | | |
| * | | | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-174-16/+18
| | | | |
| * | | | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
| | | | |
| * | | | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
| | | | |
| * | | | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/hle/service/am/applet_oe.cpp # src/core/hle/service/apm/apm.cpp
| * | | | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
| | | | |
| * | | | SVC: Correct some return values in svcGetInfo and added TitleId and PrivilegedProcessId stubs.Subv2018-01-171-6/+21
| | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/hle/kernel/svc.cpp
| * | | | SVC: Add 4.0.0+ comment to GetInfoType enum values.Subv2018-01-171-0/+1
| | | | |
| * | | | IPC: Push domain objects as move handles when not in a domain.Subv2018-01-172-2/+28
|/ / / /
* | | | Merge pull request #52 from ogniK5377/fspbunnei2018-01-176-5/+90
|\ \ \ \ | | | | | | | | | | added more svcGetInfo pairs for 3.0.0+ support, Changed HEAP_SIZE and TLS_AREA_VADDR. changed mem usage & heap usage stub added, ISelfController, IApplication function stubs. Added SetThreadCoreMask
| * | | | Update memory.hDavid2018-01-171-2/+2
| | | | |
| * | | | SetThreadCoreMask stub, time to implement fspDavid Marcec2018-01-161-1/+6
| | | | |
| * | | | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| | | | |
| * | | | Added more svcGetInfo pairsDavid Marcec2018-01-164-2/+29
| | | | |
| * | | | Increased heap size and changed tls area vaddrDavid Marcec2018-01-161-2/+2
| | |/ / | |/| |
* | | | Merge pull request #45 from FearlessTobi/patch-1bunnei2018-01-161-6/+6
|\ \ \ \ | | | | | | | | | | Implement Pull #3030 from Citra: Rename derivative class name
| * | | | Implement Pull #3030 from CitraTobias2018-01-161-6/+6
| | | | | | | | | | | | | | | citra-qt: Rename derivative class name
* | | | | Merge pull request #43 from N00byKing/3052bunnei2018-01-161-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3052 from citra: Correct spelling of searchfield in comment
| * | | | | Update game_list.cppN00byKing2018-01-161-1/+1
| | |_|_|/ | |/| | |
* | | | | Merge pull request #46 from FearlessTobi/patch-2bunnei2018-01-161-8/+8
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3034 from Citra: Change build order to check clang-format first
| * | | | | Implement Pull #3034 from CitraTobias2018-01-161-8/+8
| | |/ / / | |/| | | | | | | | Change build order to check clang-format first
* | | | | Merge pull request #53 from nkatz565/nk-fixlabelsbunnei2018-01-161-25/+52
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3240 from Citra: Add button labels for sdl joystick mappings
| * | | | | Use static functions instead of lambdasmuemart2018-01-161-49/+46
| | | | | |
| * | | | | Add translation support for button labelsmuemart2018-01-161-14/+15
| | | | | |
| * | | | | Add button labels for sdl joystick mappingsmuemart2018-01-161-17/+46
| | |_|/ / | |/| | |
* | | | | Merge pull request #44 from Rozelette/masterbunnei2018-01-161-3/+7
|\ \ \ \ \ | | | | | | | | | | | | nso: Modify .bss size calculation logic
| * | | | | nso: Modify .bss size calculation logicRozlette2018-01-161-3/+7
| | |_|/ / | |/| | |
* | | | | Merge pull request #47 from MerryMage/build-fixesbunnei2018-01-1626-63/+55
|\ \ \ \ \ | |_|/ / / |/| | | | Misc build fixes
| * | | | clang-formatMerryMage2018-01-1625-63/+54
| | | | |
| * | | | travis: Use more recent cmake on macOSMerryMage2018-01-161-0/+1
| | |/ / | |/| |
* | | | Merge pull request #48 from spycrab/cmake_pythonbunnei2018-01-161-1/+3
|\ \ \ \ | |/ / / |/| | | CMake: Override PYTHON environment variable for libunicorn
| * | | CMake: Override PYTHON environment variable for libunicornspycrab2018-01-161-1/+3
|/ / /
* | | Update README.md to include AppVeyor build status.bunnei2018-01-161-0/+1
| | |
* | | Merge pull request #31 from jroweboy/fix-deploybunnei2018-01-169-51/+67
|\ \ \ | |/ / |/| | Build/Deploy Updates to Setup Nightly Builds
| * | Build: Automagically handle unicornJames Rowe2018-01-162-46/+48
| | | | | | | | | | | | | | | | | | | | | On MSVC if unicorn isn't found, fallback to bundled unicorn On everything else, fallback to building unicorn in externals Also fixes loading unicorn in msvc
| * | Build: Update Appveyor and Travis secret keysJames Rowe2018-01-162-2/+2
| | | | | | | | | | | | | | | The keys are github auth_tokens and are assigned to yuzubot for the yuzu-nightly repository to allow Appveyor and Travis to upload releases
| * | Build: Add unicorn as a submodule and build it if neededJames Rowe2018-01-168-27/+41
| |/ | | | | | | | | | | | | Adds a cmake custom target that will build unicorn on first compile and uses this in the build scripts as well. Updates Appveyor and Travis build scripts to work with the new unicorn build, and updates the paths to all of the different artifacts.
* | Implement Pull #3333 from citra: citra_qt: Pause emulation on CoreError (#39)N00byKing2018-01-162-0/+2
| |
* | Merge pull request #24 from nkatz565/nk-inputsbunnei2018-01-167-191/+524
|\ \ | | | | | | Adding meumart's Citra SDL Joystick support. Citra PR #3116
| * | Adding meumart's Citra SDL Joystick support. Citra PR #3116muemart2018-01-167-191/+524
| | |
* | | Merge pull request #38 from goaaats/citra_mergesbunnei2018-01-165-1/+73
|\ \ \ | |_|/ |/| | Merge citra-emu PR#3001 by Styleoshin(citra-qt : Adding fullscreen mode)
| * | Merge citra-emu PR#3159 by FearlessTobi(citra-qt : Fix a bug in our fullscreen implementation)goaaats2018-01-162-15/+31
| | |
| * | Merge citra-emu PR#3001 by Styleoshin(citra-qt : Adding fullscreen mode)goaaats2018-01-165-1/+57
|/ /
* | Merge pull request #25 from chris062689/masterFlame Sage2018-01-161-1/+1
|\ \ | | | | | | Updated Discord link to match website.
| * | Updated Discord link to match website.Flame Sage2018-01-161-1/+1
|/ /
* | Merge pull request #23 from Simonx22/cmake_renamebunnei2018-01-151-6/+6
|\ \ | | | | | | CMakeList.txt: rename CITRA to YUZU
| * | rename CITRA to YUZUSimonx222018-01-151-6/+6
| |/
* / nso: Load subsdk4 if available.bunnei2018-01-151-1/+1
|/
* pctl: Clang format.bunnei2018-01-151-1/+1
|
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
|
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
|
* settings: Fix button mappings array to have correct entries.bunnei2018-01-151-2/+6
|
* Merge pull request #17 from spycrab/bindirbunnei2018-01-153-4/+7
|\ | | | | CMake: Output binaries to bin/
| * CMake: Output binaries to bin/spycrab2018-01-153-4/+7
| |
* | Merge pull request #20 from Andrix44/fixesbunnei2018-01-155-73/+11
|\ \ | | | | | | Various fixes
| * | Clanggit rebase -i fixesunknown2018-01-151-10/+2
| | |
| * | Clang formatunknown2018-01-152-4/+10
| | |
| * | Change default log level to infounknown2018-01-151-1/+1
| | |
| * | Update the internal resolution settingsunknown2018-01-153-67/+7
| | |
| * | Fix some warningsunknown2018-01-151-3/+3
| | |
* | | Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-157-115/+688
|\ \ \ | |/ / |/| | HID Sharedmem Impl Start
| * | yuzu_cmd: Fix default ini, add screenshot buttonshinyquagsire232018-01-151-1/+2
| | |
| * | hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| | |
| * | hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| | |
| * | configure_input: update w/ Switch buttonsshinyquagsire232018-01-153-90/+221
| | |
| * | settings: Screenshot buttonshinyquagsire232018-01-151-0/+2
| | |
| * | yuzu_cmd: fix default inishinyquagsire232018-01-151-9/+17
| | |
| * | settings: adjust button configs for Switch controllersshinyquagsire232018-01-151-17/+50
| | |
| * | hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
| | |
| * | fixed build for gcc c++17 / boost.icl incompatibilityHarry Prevor2018-01-151-0/+6
| | |
* | | Merge pull request #15 from bsaleil/masterbunnei2018-01-151-0/+10
|\ \ \ | | | | | | | | vi: Add IManagerDisplayService::CloseDisplay function
| * | | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/ / /
* | | Merge pull request #13 from hpr/fno-new-ttp-matchingbunnei2018-01-151-0/+6
|\ \ \ | |/ / |/| | Fix build for gcc c++17 / boost.icl incompatibility
| * | fixed build for gcc c++17 / boost.icl incompatibilityHarry Prevor2018-01-151-0/+6
| | |
* | | Merge pull request #14 from ogniK5377/masterbunnei2018-01-151-1/+1
|\ \ \ | | | | | | | | Changed ICommonStateGetter::ReceiveMessage to allow further execution in games
| * | | Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
| | | |
* | | | renderer_gl: Clear screen to black before rendering framebuffer.bunnei2018-01-152-5/+8
|/ / /
* | | renderer: Render previous frame when no new one is available.bunnei2018-01-154-17/+22
| | |
* | | Update README.md with Travis link.bunnei2018-01-151-0/+2
| | |
* | | lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
| | |
* | | time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-156-1/+121
| | |
* | | audio: Add files to CMake.bunnei2018-01-152-1/+4
| | |
* | | hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
| | |
* | | audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
| | |
* | | hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
|/ /
* | Merge pull request #10 from Andrix44/mpwarningsbunnei2018-01-151-4/+4
|\ \ | | | | | | Fix some warnings in the microprofile
| * | Fix some warnings in the microprofileAndrix442018-01-151-4/+4
| |/
* | qt: Update about dialog to show license for GPLv2 only.bunnei2018-01-141-1/+1
| | | | | | | | Fixes #6.
* | shared_memory: Minor fixes and cleanup.bunnei2018-01-141-6/+6
| |
* | svc: Implement svcMapSharedMemory.bunnei2018-01-142-1/+38
| |
* | kernel: Increase default stack size to 64K.bunnei2018-01-141-1/+1
|/
* Merge pull request #7 from JayFoxRox/remove-surface-viewerbunnei2018-01-143-13/+0
|\ | | | | Remove Surface Viewer stub
| * Remove Surface Viewer stubJannik Vogel2018-01-143-13/+0
|/
* Merge pull request #4 from spycrab/aboutdialogbunnei2018-01-148-3/+250
|\ | | | | Implement "About" dialog
| * Implement "About" dialogspycrab2018-01-148-3/+250
| |
* | Merge pull request #1 from roblabla/patch-1bunnei2018-01-141-1/+1
|\ \ | | | | | | Fix compilation on case-sensitive OSX
| * | Fix compilation on case-sensitive OSXRobin Lambertz2018-01-141-1/+1
| |/ | | | | | | | | When compiling on a case-sensitive filesystem on OSX, cmake doesn't find the FindUnicorn file, because it looks for Findunicorn.cmake. We should uses the correct case to avoid this issue.
* | Merge pull request #5 from Thog/fix/loader-file-typebunnei2018-01-141-0/+8
|\ \ | |/ |/| Add missing FileType declarations in GuessFromExtension and GetFileTypeString
| * Add missing FileType declarations in GuessFromExtension and GetFileTypeStringThog2018-01-141-0/+8
|/
* externals: Remove unused repos.bunnei2018-01-144-0/+0
|
* yuzu qt copy windows deps renamedJames Rowe2018-01-141-2/+2
|
* Minor cleanupMerryMage2018-01-1410-39/+34
|
* macOS: Update Info.plistMerryMage2018-01-141-34/+34
|
* Add new icons and fix up the linux paths for installJames Rowe2018-01-137-18/+120
|
* Update dynarmic to bc73004MerryMage2018-01-132-12/+17
| | | | | | | | | | | | | | | | | | bc73004 a64_merge_interpret_blocks: Remove debug output 4e656ed tests/A64: Randomize PSTATE.<NZCV> fd9530b A64: Optimization: Merge interpret blocks 3c9eb04 testenv: Use format constants 324f3fc tests/A64: Unicorn interface fixes 98ecbe7 tests/A64: Fuzz against unicorn b1d38e7 tests/A64: Move TestEnvironment to own header 5218ad9 A64/data_processing_pcrel: bug: ADR{,P} instructions sign extend their immediate b1a8c39 A64/data_processing_addsub: bug: {ADD,SUB}S (extended register) instructions write to ZR when d = 31 64827fb a64_emit_x64: bug: A64CallSupervisor trampled callee-save registers 1bfa04d emit_x64: bug: OP m/r64, imm32 form instructions sign-extend their immediate on x64 edadeea A64 inferface: Use two argument static_assert 9ab1304 A64: Add ExceptionRaised IR instruction 6843eed Update readme 7438d07 A64/translate: Add TranslateSingleInstruction function
* Fix build on macOS and linuxMerryMage2018-01-136-10/+11
|
* Update build scriptsMerryMage2018-01-138-43/+56
|
* yuzu: Update CONTRIBUTING.md.bunnei2018-01-131-4/+4
|
* yuzu: Update README.md.bunnei2018-01-131-22/+21
|
* arm_unicorn: Log unmapped memory access address.bunnei2018-01-131-1/+1
|
* config: Default log filter to trace.bunnei2018-01-133-3/+3
|
* yuzu: Update license text to be consistent across project.bunnei2018-01-1361-61/+61
|
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-135-53/+1
|
* Removing unused settings and yuzu rebrandingJames Rowe2018-01-1317-485/+69
|
* Get yuzu sdl to start compilingJames Rowe2018-01-135-12/+12
|
* Remove gpu debugger and get yuzu qt to compileJames Rowe2018-01-1348-3245/+47
|
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-1377-16444/+4
|
* Massive removal of unused modulesJames Rowe2018-01-13179-21306/+23
|
* config: Default CPU core to Unicorn.bunnei2018-01-133-3/+3
|
* CMakeLists: Use C++ 17.bunnei2018-01-131-2/+2
|
* boost: Update version.bunnei2018-01-132-1/+1
|
* core: Gut out cryptop, since it doesn't compile with C++17.bunnei2018-01-138-300/+7
|
* dynarmic: Update to 83afe435MerryMage2018-01-121-0/+0
|
* configuration: Add cpu_core configuration optionMerryMage2018-01-128-16/+40
|
* arm_dynarmic: Implement coreMerryMage2018-01-1210-66/+175
|
* core: Include <algorithm> where used.bunnei2018-01-123-0/+6
|
* renderer_opengl: Fix LOG_TRACE in LoadFBToScreenInfo.bunnei2018-01-121-1/+1
|
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
|
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
|
* core: Fix recent GCC build breaks.bunnei2018-01-122-2/+4
|
* svc: Implement GetSystemTick.bunnei2018-01-122-2/+21
|
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
|
* renderer_opengl: Support rendering Switch framebuffer.bunnei2018-01-113-138/+83
|
* render_base: Add a struct describing framebuffer metadata.bunnei2018-01-111-0/+26
|
* renderer_opengl: Add MortonCopyPixels function for Switch framebuffer.bunnei2018-01-111-0/+111
|
* renderer_opengl: Update DrawScreens for Switch.bunnei2018-01-112-23/+11
|
* CMakeLists: Add framebuffer_layout.cpp.bunnei2018-01-111-0/+1
|
* frontend: Update for undocked Switch screen layout.bunnei2018-01-118-279/+43
|
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1111-166/+430
|
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
| | | | This prevents missing frames if the vblank fires between the DequeueBuffer and Wait(vsync) calls
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
|
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
| | | | | | NVFlinger will call into the nvdisp_disp0 device to perform screen flips, bypassing the ioctl interface. We now have the address of the framebuffer to draw, we just need to actually put it on the screen.
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
| | | | | | Don't try to draw buffers that the guest application is using, only queued buffers are eligible for drawing. Drawing actual pixels is still not implemented.
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
|
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
|
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
|
* IPC: Allow passing arguments to the Interfaces when using PushIpcInterfaceSubv2018-01-111-3/+3
|
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-116-0/+726
| | | | The homebrew display test application now properly writes graphics data to the graphics buffer but we still don't have a way to compose the display layers.
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
|
* IPC: Corrected some definitions for the buffer C descriptor flags.Subv2018-01-113-3/+10
|
* svc: Stub ResetSignal and CreateTransferMemorySubv2018-01-112-3/+28
|
* svc: Stub SetMemoryAttributeSubv2018-01-112-0/+11
|
* Threads: Added enum values for the Switch's 4 cpu cores and implemented svcGetInfo(AllowedCpuIdBitmask)Subv2018-01-105-16/+28
|
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
|
* SVC: Fixed WaitSynchronization with multiple handles when none is immediately ready.Subv2018-01-091-7/+18
|
* SVC: Implemented CancelSynchronization.Subv2018-01-092-1/+19
|
* ErrorCodes: Updated the InvalidHandle and Timeout kernel error codes.Subv2018-01-091-2/+7
|
* SVC: Fixed WaitSynchronization with multiple handles when at least one of them is ready.Subv2018-01-092-3/+29
|
* kernel: Rename Semaphore to ConditionVariable.bunnei2018-01-0911-171/+180
|
* mutex: Remove unused call to VerifyGuestState.bunnei2018-01-091-3/+0
|
* Kernel: Actually wake up the requested number of threads in Semaphore::Release.Subv2018-01-094-21/+18
| | | | | | Also properly keep track of data in guest memory, this fixes managing the semaphore from userland. It was found that Semaphores are actually Condition Variables, with Release(1) and Release(-1) being equivalent to notify_one and notify_all. We should change the name of the class to reflect this.
* Kernel: Properly keep track of mutex lock data in the guest memory. This fixes userland locking/unlocking.Subv2018-01-094-67/+63
|
* Kernel: Allow chaining WaitSynchronization calls inside a wakeup callback.Subv2018-01-094-30/+78
|
* cmake: Use LIBUNICORN_* on Windows.bunnei2018-01-091-2/+2
|
* fix macos buildMerryMage2018-01-094-7/+7
|
* core_timing: Use 1.020GHz for core clock rate.bunnei2018-01-091-5/+3
|
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-0912-557/+638
| | | | * CoreTiming: New CoreTiming; Add Test for CoreTiming
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
|
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
|
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
|
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
|
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-072-4/+6
|
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
|
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-072-7/+9
| | | | They should have 32 bits of padding after the error code now.
* IPC: Add functions to read the input move/copy objects from an IPC request.Subv2018-01-073-2/+42
|
* IPC: Don't attempt to read the command buffer if it holds a Close request.Subv2018-01-071-0/+5
|
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-078-405/+118
| | | | Popping objects from the buffer is still not implemented.
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-072-15/+5
| | | | Service code now doesn't have to deal with this.
* IPC: Use the correct size when pushing raw data to the command buffer and fixed pushing domain objects.Subv2018-01-074-10/+29
| | | | Domain object ids are always stored immediately after the raw data.
* svc: Implement svcSignalProcessWideKey.bunnei2018-01-072-4/+23
|
* audio: Log dropping frames as trace to reduce spam.bunnei2018-01-071-1/+1
|
* semaphore: More changes for Switch.bunnei2018-01-072-11/+17
|
* wait_object: Refactor to allow waking up a single thread.bunnei2018-01-072-15/+28
|
* nso: Always load the filepath specified by the user.bunnei2018-01-071-1/+3
|
* core_timing: Increase clock speed for Switch docked.bunnei2018-01-073-3/+3
|
* svc: Implement svcWaitProcessWideKeyAtomic.bunnei2018-01-062-1/+54
|
* semaphore: Updates for Switch.bunnei2018-01-062-21/+31
|
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
|
* svc: Implement WaitSynchronization for a single handle.bunnei2018-01-061-4/+24
|
* svc: Refactor LockMutex code to use WaitSynchronization1.bunnei2018-01-061-13/+45
|
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
|
* cmake: Add script to find Unicorn.bunnei2018-01-051-0/+18
|
* svc: Add missing string_util include.bunnei2018-01-051-0/+1
|
* cmake: Don't compile Dynarmic as it's unused.bunnei2018-01-042-9/+2
|
* core: Increase tight_loop 100x for speed.bunnei2018-01-041-1/+1
|
* citra_qt: Remove VFP registers, since this isn't used anyways and caused an assert.bunnei2018-01-041-4/+0
|
* arm_unicorn: Load/release unicorn DLL.bunnei2018-01-041-0/+16
|
* cmake: Add CopyYuzuUnicornDeps script.bunnei2018-01-041-0/+9
|
* externals: Use unicorn DLL instead of static lib.bunnei2018-01-043-2/+7
|
* unicorn: Use for arm interface on Windows.bunnei2018-01-045-9/+273
|
* DownloadExternals: Use yuzu repo.bunnei2018-01-041-1/+1
|
* arm_dynarmic: More cleanup.bunnei2018-01-041-6/+0
|
* core: Remove unicorn_dynload.bunnei2018-01-041-2/+0
|
* arm_dynarmic: Gut interface until dynarmic is ready for general use.bunnei2018-01-042-142/+44
|
* externals: Point dynarmic at a real commit.bunnei2018-01-041-0/+0
|
* gitmodules: Fix to include lz4.bunnei2018-01-041-0/+3
|
* arm: Remove SkyEye/Dyncom code that is ARMv6-only.bunnei2018-01-0337-28101/+23
|
* vm_manager: Use a more reasonable MAX_ADDRESS size.bunnei2018-01-031-5/+4
|
* svc: Remove unnecessary "svc" prefix to naming scheme.bunnei2018-01-031-106/+106
|
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
|
* hle: Move SVC code to kernel namespace.bunnei2018-01-034-134/+121
|
* svc: Improve svcGetInfo.bunnei2018-01-012-35/+41
|
* vm_manager: Stub out a bunch of interfaces used by svcGetInfo.bunnei2018-01-012-1/+51
|
* svc: Fix string formatting for CreateThread.bunnei2018-01-011-1/+1
|
* cmake: Add missing object_address_table.bunnei2018-01-011-0/+2
|
* core/video_core: Fix a bunch of u64 -> u32 warnings.bunnei2018-01-018-26/+26
|
* svc: Stub out svcWaitSynchronization.bunnei2018-01-011-1/+9
| | | | - This does not matter until we implement other kernel objects, mutexes use svcLockMutex for waiting.
* svc: Implement svcExitProcess.bunnei2018-01-013-11/+77
|
* svc: Implement svcUnlockMutex.bunnei2018-01-011-1/+11
|
* svc: Implement svcLockMutex.bunnei2018-01-013-24/+134
|
* kernel: Add ObjectAddressTable class.bunnei2018-01-013-2/+101
|
* thread: Keep track of the initially created handle.bunnei2017-12-313-2/+7
| | | | This is kinda crufty, but we need it for now to update guest state variables.
* svc: Implement svcExitThread.bunnei2017-12-311-1/+9
|
* svc: Implement svcCreateThread.bunnei2017-12-311-2/+57
|
* svc: Cleanup svcGetThreadPriority.bunnei2017-12-311-3/+5
|
* svc: Stub out svcGetCurrentProcessorNumber.bunnei2017-12-311-1/+7
|
* errors: Define missing kernel error codes.bunnei2017-12-311-0/+3
|
* svc: Implement svcSetThreadPriority.bunnei2017-12-311-1/+30
|
* svc: Change SignalProcessWideKey to a stub.bunnei2017-12-311-2/+2
|
* function_wrappers: Cleanup, fix warnings, remove unused code.bunnei2017-12-311-187/+35
|
* svc: Implement svcUnmapMemory.bunnei2017-12-313-1/+15
|
* svc: Minor cleanups.bunnei2017-12-301-8/+9
|
* svc: Implement svcStartThread.bunnei2017-12-301-0/+16
|
* thread: Main thread should set thread handle to reg 1.bunnei2017-12-301-1/+4
|
* thread: Remove THUMB mode flag.bunnei2017-12-301-1/+1
|
* thread: Main thread should be ready by default, all others dormant.bunnei2017-12-301-4/+3
|
* kernel: Various 64-bit fixes in memory/process/threadbunnei2017-12-295-14/+14
|
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
|
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
|
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-2910-54/+90
|
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
|
* service: Add empty interface for pctl:a.bunnei2017-12-296-0/+90
|
* kernel: Add basic support for Domain object.bunnei2017-12-295-4/+112
|
* kernel: Add SyncObject primitive, use it for ClientSession.bunnei2017-12-294-10/+41
|
* svc: Implement MapMemory.bunnei2017-12-293-4/+17
|
* process: Add method to mirror a memory region.bunnei2017-12-292-0/+27
|
* svc: Implement SetHeapSize.bunnei2017-12-282-3/+19
|
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
|
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
|
* service: Add empty interface for aoc:u.bunnei2017-12-284-0/+44
|
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-014-9/+12
|
* hle: Use Switch formatted result codes.bunnei2017-11-018-346/+110
|
* externals: Update dynarmic and xbyak.bunnei2017-10-252-0/+0
|
* svc: Implement GetThreadId and GetProcessId.bunnei2017-10-232-2/+37
|
* logging: Rename category "Core_ARM11" to "Core_ARM".bunnei2017-10-2310-89/+89
|
* nso: Load more common submodules.bunnei2017-10-231-15/+11
|
* memory: Support 32-bit paging, move heap address space up.bunnei2017-10-232-3/+3
|
* hle: Fix QueryMemory response for MemoryInfo.bunnei2017-10-207-149/+31
|
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
|
* hle_ipc: Only copy necessary fields for outgoing command buffer.bunnei2017-10-191-1/+1
|
* hle_ipc: Parse out buffer X/A/B/B descriptors from incoming command buffer.bunnei2017-10-192-14/+19
|
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
|
* memory: Print addresses as 64-bit.bunnei2017-10-191-2/+2
|
* ipc_helpers: Fix alignment (was wrong as a result of a dynarmic bug).bunnei2017-10-181-3/+4
|
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
|
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-1510-33/+82
|
* core: Refactor MakeMagic usage and remove dead code.bunnei2017-10-1511-885/+18
|
* hle: Add service stubs for apm and appletOE.bunnei2017-10-1510-2/+136
|
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1521-859/+574
|
* nso: Add a log for loading submodules.bunnei2017-10-141-0/+1
|
* svc: Some logging cleanup.bunnei2017-10-141-7/+5
|
* svc: Update MemoryInfo flags for 64-bit.bunnei2017-10-141-5/+5
|
* svc: Initial nx impl. for QueryMemory, ConnectToPort, SendSyncRequest, etc.bunnei2017-10-141-1185/+185
|
* Remove more 3DS-specific code.bunnei2017-10-135-48/+3
|
* Remove more 3DS-specific code.bunnei2017-10-137-1414/+2
|
* Remove more 3DS-specific code.bunnei2017-10-133-55/+0
|
* Remove lots more 3DS-specific code.bunnei2017-10-1350-6976/+8
|
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10200-22393/+2
|
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-10241-2730/+20955
|\ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/CMakeLists.txt # src/core/arm/dynarmic/arm_dynarmic.cpp # src/core/arm/dyncom/arm_dyncom.cpp # src/core/hle/kernel/process.cpp # src/core/hle/kernel/thread.cpp # src/core/hle/kernel/thread.h # src/core/hle/kernel/vm_manager.cpp # src/core/loader/3dsx.cpp # src/core/loader/elf.cpp # src/core/loader/ncch.cpp # src/core/memory.cpp # src/core/memory.h # src/core/memory_setup.h
| * Merge pull request #2996 from MerryMage/split-travisJames Rowe2017-10-1014-227/+233
| |\ | | | | | | travis: Split build scripts for different platforms
| | * travis: Split build scripts for different platformsMerryMage2017-10-0714-227/+233
| | | | | | | | | | | | This commit also separates clang-format from the linux build, closing #2702.
| * | Merge pull request #3002 from Dragios/nwm-cmdhdr-fixJames Rowe2017-10-091-1/+1
| |\ \ | | | | | | | | Change command header in nwm::UDS Initialize function
| | * | Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| |/ /
| * | Merge pull request #2991 from Subv/getpointerSebastian Valle2017-10-083-63/+61
| |\ \ | | |/ | |/| Remove more usages of GetPointer.
| | * SVC: Removed GetPointer usage in the GetResourceLimit functions.Subv2017-10-041-10/+16
| | |
| | * SVC: Remove GetPointer usage in CreatePort.Subv2017-10-042-6/+4
| | |
| | * SVC: Replace GetPointer usage with ReadCString in ConnectToPort.Subv2017-10-042-20/+9
| | |
| | * SVC: Replace GetPointer usage with ReadBlock in OutputDebugString.Subv2017-10-042-4/+6
| | |
| | * SVC: Replace GetPointer usage with Read32 in ReplyAndReceive.Subv2017-10-042-7/+6
| | |
| | * SVC: Replace GetPointer usage with Read32 in WaitSynchronizationN.Subv2017-10-042-8/+8
| | |
| | * Memory: Remove all GetPointer usages from the GDB stub.Subv2017-10-041-8/+12
| | |
| * | Merge pull request #2975 from shinyquagsire23/archive-ncch-container-and-overrideSebastian Valle2017-10-067-78/+581
| |\ \ | | | | | | | | file_sys/archive_ncch: use NCCHs/.apps instead of .romfs files, NCCH section override
| | * | file_sys, loader: add support for reading TMDs to determine app pathsshinyquagsire232017-10-012-5/+27
| | | |
| | * | file_sys: add class for Title Metadata (TMD)shinyquagsire232017-10-013-0/+338
| | | |
| | * | file_sys/ncch_container: add RomFS, ExeFS override to allow for backward compatibility with existing .romfs system archive dumpsshinyquagsire232017-10-012-69/+206
| | | |
| | * | file_sys/archive_ncch: use NCCHContainer instead of loading .romfs filesshinyquagsire232017-10-011-6/+12
| | | |
| * | | Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\ \ \ | | | | | | | | | | HLE/APT: Always set up the APT parameter when starting a library applet.
| | * | | HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only use the HLE interface if an HLE applet with the desired id was started. This commit reorganizes the APT code surrounding parameter creation and delivery to make it easier to support LLE applets in the future. As future work, the HLE applet interface can be reworked to utilize the same facilities as the LLE interface.
| * | | | Merge pull request #2985 from huwpascoe/pica_regbunnei2017-10-041-217/+222
| |\ \ \ \ | | | | | | | | | | | | Extracted the attribute setup and draw commands into their own functions
| | * | | | Extracted the attribute setup and draw commands into their own functionsHuw Pascoe2017-10-041-217/+222
| |/ / / /
| * | | | Merge pull request #2977 from Subv/shmem_createbunnei2017-10-031-15/+12
| |\ \ \ \ | | | | | | | | | | | | SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it
| | * | | | Kernel/SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it.Subv2017-10-021-15/+12
| | | |/ / | | |/| | | | | | | | | | | | Also reference the right offset into the backing block for the requested address.
| * | | | Merge pull request #2982 from MerryMage/lazy-macos-optJames Rowe2017-10-032-4/+4
| |\ \ \ \ | | |_|_|/ | |/| | | macOS: Build x86_64h slice
| | * | | macOS: Build x86_64h sliceMerryMage2017-10-022-4/+4
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | This commit produces a fat-binary with two slices. The x86_64 slice is for all x64 systems, and the x86_64h slice targets x64 systems starting with Haswell. The latter allows the compiler to use newer instructions that are not available on older microarchitectures.
| * | | Merge pull request #2971 from Subv/per_process_memopsSebastian Valle2017-10-014-22/+61
| |\ \ \ | | | | | | | | | | Memory: Add overloads for ReadBlock and WriteBlock that operate on a specific process.
| | * | | Memory: Make WriteBlock take a Process parameter on which to operateSubv2017-10-012-10/+19
| | | | |
| | * | | Memory: Make ReadBlock take a Process parameter on which to operateSubv2017-10-012-12/+30
| | | | |
| | * | | Kernel/Thread: Added a helper function to get a thread's command buffer VAddr.Subv2017-10-012-0/+12
| | | | |
| * | | | Merge pull request #2974 from Subv/nim_eventSebastian Valle2017-10-013-2/+29
| |\ \ \ \ | | |_|/ / | |/| | | Services/NIM: Implement CheckForSysUpdateEvent.
| | * | | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| | | | | | | | | | | | | | | | | | | | | | | | | Implementation verified by reverse engineering. This lets the Home Menu boot without crashing on startup.
| * | | | Merge pull request #2973 from huwpascoe/down_countSebastian Valle2017-09-309-43/+33
| |\ \ \ \ | | |/ / / | |/| | | Moved down_count to CoreTiming
| | * | | Moved down_count to CoreTimingHuw Pascoe2017-09-309-43/+33
| |/ / /
| * | | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| | | | | | | | | | | | Services/UDS: Handle the rest of the connection sequence.
| * | | Merge pull request #2972 from Subv/ignore_.vsJames Rowe2017-09-301-0/+4
| |\ \ \ | | | | | | | | | | Add the .vs folder and the CMakeSettings.json file from Visual Studio to gitignore
| | * | | Add the .vs folder and the CMakeSettings.json file from Visual Studio to gitignore.Subv2017-09-301-0/+4
| | | | |
| * | | | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \ \ \ | | |/ / / | |/| | | Implement PrepareToStartNewestHomeMenu and fixed an APT regression.
| | * | | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | | | | | | | | | | | | | | | | | | | | | | | | As per 3dbrew: "During Home Menu start-up it uses APT:PrepareToStartNewestHomeMenu. If that doesn't return an error(normally NS returns 0xC8A0CFFC for that), Home Menu starts a hardware reboot with APT:StartNewestHomeMenu etc. "
| | * | | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | | |/ | | |/| | | | | | | | | | | | | We need to know what is being run so we can set the APT parameter destination AppId correctly. Delaying the preparation of the parameter until we know which AppId is running lets us support booting both the Home Menu and normal game Applications.
| * | | Merge pull request #2967 from Subv/thread_wakeup_callbacksSebastian Valle2017-09-304-17/+91
| |\ \ \ | | |_|/ | |/| | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken
| | * | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken.Subv2017-09-284-17/+91
| | | | | | | | | | | | | | | | | | | | | | | | This change makes for a clearer (less confusing) path of execution in the scheduler, now the code to execute when a thread awakes is closer to the code that puts the thread to sleep (WaitSynch1, WaitSynchN). It also allows us to implement the special wake up behavior of ReplyAndReceive without hacking up WaitObject::WakeupAllWaitingThreads. If savestates are desired in the future, we can change this implementation to one similar to the CoreTiming event system, where we first register the callback functions at startup and assign their identifiers to the Thread callback variable instead of directly assigning a lambda to the wake up callback variable.
| * | | Merge pull request #2962 from huwpascoe/static_castSebastian Valle2017-09-3032-91/+97
| |\ \ \ | | | | | | | | | | Fixed type conversion ambiguity
| | * | | Fixed type conversion ambiguityHuw Pascoe2017-09-3032-91/+97
| |/ / /
| * | | Merge pull request #2961 from Subv/load_titlesbunnei2017-09-2917-70/+157
| |\ \ \ | | |/ / | |/| | Loaders: Don't automatically set the current process every time we load an application.
| | * | Loaders: Don't automatically set the current process every time we load an application.Subv2017-09-278-37/+40
| | | | | | | | | | | | | | | | The loaders will now just create a Kernel::Process, construct it and return it to the caller, which is responsible for setting it as the current process and configuring the global page table.
| | * | Kernel/Thread: Allow specifying which process a thread belongs to when creating it.Subv2017-09-274-17/+22
| | | | | | | | | | | | | | | | Don't automatically assume that Thread::Create will only be called when the parent process is currently scheduled. This assumption will be broken when applets or system modules are loaded.
| | * | Tests: Added Memory::IsValidVirtualAddress tests.Subv2017-09-272-0/+57
| | | |
| | * | Tests: Fixed ARM VFP testsSubv2017-09-271-9/+13
| | | |
| | * | Memory: Allow IsValidVirtualAddress to be called with a specific process parameter.Subv2017-09-272-7/+25
| | | | | | | | | | | | | | | | There is still an overload of IsValidVirtualAddress that only takes the VAddr and will default to the current process.
| * | | Merge pull request #2907 from Subv/warnings3Sebastian Valle2017-09-272-5/+9
| |\ \ \ | | | | | | | | | | Disable unary operator- on Math::Vec2/Vec3/Vec4 for unsigned types.
| | * | | Disable unary operator- on Math::Vec2/Vec3/Vec4 for unsigned types.Subv2017-09-272-5/+9
| | | | | | | | | | | | | | | | | | | | | | | | | It is unlikely we will ever use this without first doing a Cast to a signed type. Fixes 9 "unary minus operator applied to unsigned type, result still unsigned" warnings on MSVC2017.3
| * | | | Merge pull request #2954 from Subv/cache_unmapped_memJames Rowe2017-09-271-1/+16
| |\ \ \ \ | | |_|/ / | |/| | | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions
| | * | | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions.Subv2017-09-261-1/+16
| | | |/ | | |/| | | | | | | | | | | | | | | | | Not all physical regions need to be mapped into the address space of every process, for example, system modules do not have a VRAM mapping. This fixes a crash when loading applets and system modules.
| * | | Merge pull request #2958 from Subv/audio_buffer_datatypeMerry2017-09-265-7/+9
| |\ \ \ | | | | | | | | | | Audio: Use std::deque instead of std::vector for the audio buffer type (StereoBuffer16)
| | * | | Audio: Use std::deque instead of std::vector for the audio buffer type (StereoBuffer16).Subv2017-09-265-7/+9
| | | |/ | | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current code inserts and deletes elements from the beginning of the audio buffer, which is very inefficient in an std::vector. Profiling was done using VisualStudio2017's Performance Analyzer in Super Mario 3D Land. Before this change: AudioInterp::Linear had 14.14% of the runtime (inclusive) and most of that time was spent in std::vector's insert implementation. After this change: AudioInterp::Linear has 0.36% of the runtime (inclusive)
| * | | Merge pull request #2947 from Subv/selfncch_factorySebastian Valle2017-09-266-18/+65
| |\ \ \ | | |/ / | |/| | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.
| | * | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-256-18/+65
| |/ / | | | | | | | | | | | | | | | | | | | | | The loaders now register each loaded ROM with the SelfNCCH factory, which keeps the data around for the duration of the emulation session. When opening the SelfNCCH archive, the factory queries the current program's programid and uses that as a key to the map that contains the NCCHData structure (RomFS, Icon, Banner, etc). 3dsx files do not have a programid and will use a default of 0 for this value, thus, only 1 3dsx file with RomFS is loadable at the same time.
| * | Merge pull request #2952 from MerryMage/page-tablesB3n302017-09-2512-27/+56
| |\ \ | | | | | | | | Switchable Page Tables
| | * | ARM_Interface: Implement PageTableChangedMerryMage2017-09-256-6/+39
| | | |
| | * | memory: Remove GetCurrentPageTablePointersMerryMage2017-09-242-10/+0
| | | |
| | * | memory: Add GetCurrentPageTable/SetCurrentPageTableMerryMage2017-09-247-13/+19
| | | | | | | | | | | | | | | | Don't expose Memory::current_page_table as a global.
| * | | Merge pull request #2951 from huwpascoe/perf-4B3n302017-09-251-10/+4
| |\ \ \ | | | | | | | | | | Optimized Morton
| | * | | Optimized MortonHuw Pascoe2017-09-241-10/+4
| | |/ /
| * | | Merge pull request #2949 from wwylele/fix-trB3n302017-09-253-21/+22
| |\ \ \ | | | | | | | | | | citra-qt: fix some untranslated strings
| | * | | citra-qt: fix some untranslated stringswwylele2017-09-243-21/+22
| | |/ /
| * | | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \ \ | | | | | | | | | | HLE/SRV: Implemented RegisterService.
| | * | | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | | |/ | | |/| | | | | | | | | Now system modules can do more than just crash immediately on startup.
| * | | Loader/NCCH: Add support for loading application updates (#2927)Max Thomas2017-09-258-439/+670
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * loader/ncch: split NCCH parsing into its own file * loader/ncch: add support for loading update NCCHs from the SD card * loader/ncch: fix formatting * file_sys/ncch_container: Return a value for OpenFile * loader/ncch: cleanup, always instantiate overlay_ncch to base_ncch * file_sys/ncch_container: better encryption checks, allow non-app NCCHs to load properly and for the existence of NCCH structures to be checked * file_sys/ncch_container: pass filepath as a const reference
| * | | Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Services/UDS: Added a function to generate the EAPoL-Start packet body. * Services/UDS: Added filter for beacons. * Services/UDS: Lock a mutex when accessing connection_status from both the emulation and network thread. * Services/UDS: Handle the Association Response frame and respond with the EAPoL-Start frame. * fixup: make use of current_node, changed received_beacons into a list, mutex and assert corrections * fixup: fix damn clang-format
| * | | Merge pull request #2944 from huwpascoe/perf-3Weiyi Wang2017-09-251-11/+7
| |\ \ \ | | |_|/ | |/| | Optimized Float<M,E> multiplication
| | * | Optimized Float<M,E> multiplicationHuw Pascoe2017-09-251-11/+7
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Before: ucomiss xmm1, xmm1 jp .L9 pxor xmm2, xmm2 mov edx, 1 ucomiss xmm0, xmm2 setp al cmovne eax, edx test al, al jne .L9 .L3: movaps xmm0, xmm2 ret .L9: ucomiss xmm0, xmm0 jp .L10 pxor xmm2, xmm2 mov edx, 1 ucomiss xmm1, xmm2 setp al cmovne eax, edx test al, al je .L3 After: movaps xmm2, xmm1 mulss xmm2, xmm0 ucomiss xmm2, xmm2 jnp .L3 ucomiss xmm1, xmm0 jnp .L11 .L3: movaps xmm0, xmm2 ret .L11: pxor xmm2, xmm2 jmp .L3
| * | Merge pull request #2921 from jroweboy/batch-fix-2James Rowe2017-09-241-12/+17
| |\ \ | | |/ | |/| GPU: Add draw for immediate and batch modes
| | * Remove pipeline.gpu_mode and fix minor issuesJames Rowe2017-09-231-12/+2
| | |
| | * GPU: Add draw for immediate and batch modesJames Rowe2017-09-111-2/+17
| | | | | | | | | | | | | | | | | | | | | | | | PR #1461 introduced a regression where some games would change configuration even while in the poorly named "drawing" mode, which broke the heuristic citra was using to determine when to draw the batch. This change adds back in a draw call for batching, and also adds in a draw call in immediate mode each time it adds a triangle.
| * | Merge pull request #2928 from huwpascoe/masterYuri Kunde Schlesner2017-09-221-7/+18
| |\ \ | | | | | | | | Fixed framebuffer warning
| | * | Fixed framebuffer warningHuw Pascoe2017-09-171-7/+18
| | | |
| * | | Merge pull request #2933 from huwpascoe/perf-1bunnei2017-09-191-1/+2
| |\ \ \ | | | | | | | | | | Improved performance of FromAttributeBuffer
| | * | | Improved performance of FromAttributeBufferHuw Pascoe2017-09-171-1/+2
| | |/ / | | | | | | | | | | | | | | | | | | | | | | | | Ternary operator is optimized by the compiler whereas std::min() is meant to return a value. I've noticed a 5%-10% emulation speed increase.
| * | | Merge pull request #2936 from B3n30/system_curl_linuxWeiyi Wang2017-09-191-1/+1
| |\ \ \ | | | | | | | | | | WebService: Set USE_SYSTEM_CURL for travis linux builds
| | * | | WebService: Set USE_SYSTEM_CURL for travis linux buildsB3n302017-09-191-1/+1
| |/ / /
| * / / WebService: Verify username and token (#2930)B3n302017-09-1918-38/+322
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | * WebService: Verify username and token; Log errors in PostJson * Fixup: added docstrings to the functions * Webservice: Added Icons to the verification, imrpved error detection in cpr, fixup nits * fixup: fmt warning
| * | Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-167-42/+77
| |\ \ | | | | | | | | Services/NS: Port ns:s to the new service framework.
| | * | Services/NS: Port ns:s to the new service framework.Subv2017-09-167-42/+77
| | | |
| * | | Merge pull request #2900 from wwylele/clip-2Yuri Kunde Schlesner2017-09-165-46/+116
| |\ \ \ | | | | | | | | | | PICA: implement custom clip plane
| | * | | SwRasterizer/Clipper: flip the sign convention to match PICA and OpenGLwwylele2017-08-251-9/+9
| | | | |
| | * | | gl_rasterizer: implement custom clip planewwylele2017-08-253-34/+83
| | | | |
| | * | | SwRasterizer: implement custom clip planewwylele2017-08-242-4/+25
| | | | |
| * | | | Merge pull request #2842 from Subv/switchable_page_tableB3n302017-09-1514-123/+191
| |\ \ \ \ | | | | | | | | | | | | Kernel/Memory: Give each process its own page table and allow switching the current page table upon reschedule
| | * | | | CPU/Dynarmic: Disable the fast page-table access in dynarmic until it supports switching page tables at runtime.Subv2017-09-151-1/+3
| | | | | |
| | * | | | Tests/VFP: Use a standalone pagetable for the TestEnvironment memory operations.Subv2017-09-151-4/+14
| | | | | | | | | | | | | | | | | | | | | | | | This fixes building the tests
| | * | | | Kernel/Memory: Make IsValidPhysicalAddress not go through the current process' virtual memory mapping.Subv2017-09-151-2/+1
| | | | | |
| | * | | | Kernel/Threads: Don't clear the CPU instruction cache when performing a context switch from an idle thread into a thread in the same process.Subv2017-09-151-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | We were unnecessarily clearing the cache when going from Process A -> Idle -> Process A, this caused extreme performance regressions.
| | * | | | Kernel/Memory: Changed GetPhysicalPointer so that it doesn't go through the current process' page table to obtain a pointer.Subv2017-09-154-30/+69
| | | | | |
| | * | | | Kernel/Memory: Switch the current page table when a new process is scheduled.Subv2017-09-101-0/+10
| | | | | |
| | * | | | Kernel/Memory: Give each Process its own page table.Subv2017-09-109-87/+93
| | | | | | | | | | | | | | | | | | | | | | | | The loader is in charge of setting the newly created process's page table as the main one during the loading process.
| * | | | | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \ \ \ \ | | | | | | | | | | | | | | APT: load different shared font depending on the region
| | * | | | | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| | | | | | |
| * | | | | | Merge pull request #2922 from jroweboy/mingw-telemetrybunnei2017-09-114-27/+49
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Build: Enable SSL in mingw by linking against WinSSL
| | * | | | | | Build: Enable SSL in mingw by linking against WinSSLJames Rowe2017-09-114-27/+49
| | | |_|_|_|/ | | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The mingw builds aren't submitting telemetry because the curl library they are linked against is configured to use openSSL and openSSL looks for the certificates in the users home folder. This keeps it from contacting web services because it can't communicate over SSL. This commit adds a download in mingw builds that will download a precompiled curl for mingw linked against winssl and sspi.
| * | | | | | Merge pull request #2923 from B3n30/system_curl_osxJames Rowe2017-09-101-1/+1
| |\ \ \ \ \ \ | | |/ / / / / | |/| | | | | travis_OSX: build with system curl
| | * | | | | trvis_OSX: build with system curlB3n302017-09-091-1/+1
| |/ / / / /
| * | | | | Merge pull request #2865 from wwylele/gs++bunnei2017-09-0815-37/+594
| |\ \ \ \ \ | | | | | | | | | | | | | | PICA: implemented geometry shader
| | * | | | | pica/command_processor: build geometry pipeline and run geometry shaderwwylele2017-08-196-28/+383
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The geometry pipeline manages data transfer between VS, GS and primitive assembler. It has known four modes: - no GS mode: sends VS output directly to the primitive assembler (what citra currently does) - GS mode 0: sends VS output to GS input registers, and sends GS output to primitive assembler - GS mode 1: sends VS output to GS uniform registers, and sends GS output to primitive assembler. It also takes an index from the index buffer at the beginning of each primitive for determine the primitive size. - GS mode 2: similar to mode 1, but doesn't take the index and uses a fixed primitive size. hwtest shows that immediate mode also supports GS (at least for mode 0), so the geometry pipeline gets refactored into its own class for supporting both drawing mode. In the immediate mode, some games don't set the pipeline registers to a valid value until the first attribute input, so a geometry pipeline reset flag is set in `pipeline.vs_default_attributes_setup.index` trigger, and the actual pipeline reconfigure is triggered in the first attribute input. In the normal drawing mode with index buffer, the vertex cache is a little bit modified to support the geometry pipeline. Instead of OutputVertex, it now holds AttributeBuffer, which is the input to the geometry pipeline. The AttributeBuffer->OutputVertex conversion is done inside the pipeline vertex handler. The actual hardware vertex cache is believed to be implemented in a similar way (because this is the only way that makes sense). Both geometry pipeline and GS unit rely on states preservation across drawing call, so they are put into the global state. In the future, the other three vertex shader units should be also placed in the global state, and a scheduler should be implemented on top of the four units. Note that the current gs_unit already allows running VS on it in the future.
| | * | | | | pica/shader/jit: implement SETEMIT and EMITwwylele2017-08-192-2/+49
| | | | | | |
| | * | | | | pica/primitive_assembly: Handle winding for GS primitivewwylele2017-08-192-3/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | hwtest shows that, although GS always emit a group of three vertices as one primitive, it still respects to the topology type, as if the three vertices are input into the primitive assembler independently and sequentially. It is also shown that the winding flag in SETEMIT only takes effect for Shader topology type, which is believed to be the actual difference between List and Shader (hence removed the TODO). However, only Shader topology type is observed in official games when GS is in use, so the other mode seems to be just unintended usage.
| | * | | | | correct constnesswwylele2017-08-192-2/+4
| | | | | | |
| | * | | | | pica/shader/interpreter: implement SETEMIT and EMITwwylele2017-08-191-0/+16
| | | | | | |
| | * | | | | pica/shader: extend UnitState for GSwwylele2017-08-192-0/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Among four shader units in pica, a special unit can be configured to run both VS and GS program. GSUnitState represents this unit, which extends UnitState (which represents the other three normal units) with extra state for primitive emitting. It uses lots of raw pointers to represent internal structure in order to keep it standard layout type for JIT to access. This unit doesn't handle triangle winding (inverting) itself; instead, it calls a WindingSetter handler. This will be explained in the following commits
| | * | | | | pica/regs: layout geometry shader configuration regswwylele2017-08-102-2/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | All the register meanings are derived from ctrulib (3dbrew is outdated for most of them)
| * | | | | | Merge pull request #2918 from jroweboy/remove-debugJames Rowe2017-09-061-0/+6
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Remove excess debug dlls for mingw build
| | * | | | | | Remove excess debug dlls for mingw buildJames Rowe2017-09-061-0/+6
| |/ / / / / /
| * | | | | | Merge pull request #2914 from wwylele/fresnel-fixbunnei2017-09-052-7/+9
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | pica/lighting: only apply Fresnel factor for the last light
| | * | | | | | pica/lighting: only apply Fresnel factor for the last lightwwylele2017-09-032-7/+9
| | | | | | | |
| * | | | | | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-057-53/+289
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Services/UDS: Handle beacon frames and the basic AP connection sequence frames.
| | * | | | | | | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | | | | | | | |
| | * | | | | | | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There is currently no stage tracking, a client is considered "Connected" when it receives the EAPoL Logoff packet from the server, this is not yet implemented.
| | * | | | | | | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | | | | | | | |
| | * | | | | | | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-275-11/+144
| | | | | | | | |
| * | | | | | | | Merge pull request #2876 from mailwl/mii-struWeiyi Wang2017-09-052-34/+29
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Mii Selector Applet: update Mii structures
| | * | | | | | | | Remove _flag in var namesmailwl2017-09-041-6/+6
| | | | | | | | | |
| | * | | | | | | | Mii Selector Applet: update Mii structuresmailwl2017-09-042-34/+29
| |/ / / / / / / /
| * | | | | | | | Merge pull request #2917 from jroweboy/icon_fixWeiyi Wang2017-09-041-1/+3
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix icon for citra qt
| | * | | | | | | | Fix icon for citra qtJames Rowe2017-09-031-1/+3
| |/ / / / / / / /
| * | | | | | | | Merge pull request #2911 from DaMan69/masterJames Rowe2017-09-034-2/+42
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Add manifest
| | * | | | | | | | Add manifestDaMan2017-09-034-2/+42
| | | |_|_|/ / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2912 from jroweboy/mingw-masterJames Rowe2017-09-021-40/+123
| |\ \ \ \ \ \ \ \ | | |/ / / / / / / | |/| | | | | | | Build: Add mingw64 compile support to appveyor
| | * | | | | | | Build: Add mingw64 compile support to appveyorJames Rowe2017-09-011-40/+123
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Releases will be built with both mingw and msvc and the binaries of both builds will be uploaded to github releases
| * | | | | | | | Merge pull request #2909 from wwylele/telemetry-gasbunnei2017-08-311-0/+6
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | video_core: report telemetry for gas mode
| | * | | | | | | | video_core: report telemetry for gas modewwylele2017-08-311-0/+6
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2858 from MerryMage/interp-on-a-frame-basisbunnei2017-08-313-88/+74
| |\ \ \ \ \ \ \ \ | | |/ / / / / / / | |/| | | | | | | interpolate: Interpolate on a frame-by-frame basis
| | * | | | | | | interpolate: Interpolate on a frame-by-frame basisMerryMage2017-08-283-88/+74
| | | | | | | | |
| * | | | | | | | Merge pull request #2891 from wwylele/sw-bumpbunnei2017-08-314-10/+40
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | | SwRasterizer/Lighting: implement bump mapping
| | * | | | | | | gl_rasterizer/lighting: more accurate CP formulawwylele2017-08-221-2/+2
| | | | | | | | |
| | * | | | | | | SwRasterizer/Lighting: implement LUT input CPwwylele2017-08-221-0/+11
| | | | | | | | |
| | * | | | | | | SwRasterizer/Lighting: implement bump mappingwwylele2017-08-223-8/+27
| | | | | | | | |
| * | | | | | | | Merge pull request #2899 from wwylele/touch-refactorbunnei2017-08-298-43/+87
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Refactor touch input into a TouchDevice
| | * | | | | | | | EmuWindow: refactor touch input into a TouchDevicewwylele2017-08-245-39/+72
| | | | | | | | | |
| | * | | | | | | | HID: use TouchDevice for touch padwwylele2017-08-243-4/+15
| | | |_|_|_|_|/ / | | |/| | | | | |
| * | | | | | | | Merge pull request #2905 from danzel/fix-2902Sebastian Valle2017-08-294-5/+5
| |\ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|/ | |/| | | | | | | Use recursive_mutex instead of mutex to fix #2902
| | * | | | | | | Use recursive_mutex instead of mutex to fix #2902danzel2017-08-294-5/+5
| | |/ / / / / /
| * | | | | | | Merge pull request #2901 from stone3311/masterWeiyi Wang2017-08-281-1/+1
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fix info about TODO list
| | * | | | | | | Fix info about TODO liststone33112017-08-261-1/+1
| | | | | | | | |
| * | | | | | | | Merge pull request #2892 from Subv/warnings2Weiyi Wang2017-08-283-6/+10
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Warnings: Fixed a few missing-return warnings in video_core.
| | * | | | | | | | Warnings: Fixed a few missing-return warnings in video_core.Subv2017-08-263-6/+10
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2897 from bunnei/telemetry-uibunnei2017-08-2720-48/+446
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | | Telemetry UI and final touches
| | * | | | | | | web_backend: Fix CPR bug where Winsock is not properly initializing.bunnei2017-08-271-15/+27
| | | | | | | | |
| | * | | | | | | web_backend: Fix asynchronous JSON post by spawning new thread.bunnei2017-08-261-9/+18
| | | | | | | | |
| | * | | | | | | web_services: Refactor to remove dependency on Core.bunnei2017-08-265-20/+35
| | | | | | | | |
| | * | | | | | | qt: Add an option to view/regenerate telemetry ID.bunnei2017-08-264-7/+40
| | | | | | | | |
| | * | | | | | | default_ini: Use correct telemetry endpoint URL.bunnei2017-08-261-1/+1
| | | | | | | | |
| | * | | | | | | # This is a combination of 2 commits.bunnei2017-08-261-3/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # This is the 1st commit message: qt: Add web configuration tab. # The commit message #2 will be skipped: # fixup! qt: Add web configuration tab.
| | * | | | | | | qt: Add web configuration tab.bunnei2017-08-266-2/+217
| | | | | | | | |
| | * | | | | | | web_backend: User config for username and token, support anonymous post.bunnei2017-08-262-40/+17
| | | | | | | | |
| | * | | | | | | telemetry: Log frontend type.bunnei2017-08-262-0/+4
| | | | | | | | |
| | * | | | | | | settings: Add enable_telemetry, citra_username, and citra_token.bunnei2017-08-264-0/+20
| | | | | | | | |
| | * | | | | | | telemetry_session: Log telemetry ID.bunnei2017-08-261-0/+36
| | | | | | | | |
| | * | | | | | | citra_qt: Show one-time callout messages to user.bunnei2017-08-264-0/+50
| |/ / / / / / /
| * | / / / / / SidebySide Layout (#2859)ThaMighty902017-08-256-7/+61
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * added a SidebySide Layout * Reworked, so both screen have the same height and cleaned up screen translates. * added the option in the UI, hope this is the right way to do it. formated framebuffer_layout.cpp * delete the x64 files * deleted ui_configure_graphics.h * added Option for the Layout in the xml * got rid of SIDE_BY_SIDE_ASPECT_RATIO because it was useless. pulled translate into variables * changed shift variables to u32 and moved them in their respective branch. remove notr="true" for the Screen layout drop down * reworked intends :). changed function description for SideFrameLayout * some description reworking
| * | | | | | Merge pull request #2839 from Subv/global_kernel_lockJames Rowe2017-08-246-4/+46
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).
| | * | | | | | Kernel/Memory: Acquire the global HLE lock when a memory read/write operation falls outside of the fast path, for it might perform an MMIO operation.Subv2017-08-221-1/+8
| | | | | | | |
| | * | | | | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).Subv2017-08-225-3/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This mutex is acquired in SVC::CallSVC, ie, as soon as the guest application enters the HLE kernel, and should be acquired by the aforementioned threads before modifying kernel structures.
| * | | | | | | Merge pull request #2893 from Subv/not_schedule_main_threadbunnei2017-08-221-5/+1
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.
| | * | | | | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.Subv2017-08-221-5/+1
| | | |/ / / / / | | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is necessary for loading multiple processes at the same time. The main thread will be automatically scheduled when necessary once the scheduler runs.
| * | | | | | | Merge pull request #2888 from Subv/warningsJames Rowe2017-08-2211-17/+22
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fixed some warnings in the core project.
| | * | | | | | | GPU/Warnings: Explicitly cast the screen refresh ticks to u64.Subv2017-08-211-1/+1
| | | | | | | | |
| | * | | | | | | Warnings: Add UNREACHABLE macros to switches that contemplate all possible values.Subv2017-08-213-2/+7
| | | | | | | | |
| | * | | | | | | HLE/Applets: Fixed some conversion warnings when creating the framebuffer shared memory objects.Subv2017-08-214-8/+8
| | | | | | | | |
| | * | | | | | | CPU/Dynarmic: Fixed a warning when incrementing the number of ticks in ExecuteInstructions.Subv2017-08-211-1/+1
| | | | | | | | |
| | * | | | | | | Dyncom: Use size_t instead of int to store the instruction offsets in the instruction cache.Subv2017-08-212-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes a few warnings.
| | * | | | | | | Dyncom: Fixed a conversion warning when decoding thumb instructions.Subv2017-08-211-1/+1
| | |/ / / / / /
| * | | | | | | Merge pull request #2894 from wwylele/motion-emu-fixbunnei2017-08-221-1/+4
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | motion_emu: fix initialization order
| | * | | | | | | motion_emu: fix initialization orderwwylele2017-08-221-1/+4
| |/ / / / / / /
| * | | | | | | Merge pull request #2884 from wwylele/clipbunnei2017-08-216-10/+28
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer: add clipping plane z<=0 defined in PICA
| | * | | | | | | swrasterizer: remove invalid TODOwwylele2017-08-211-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function is called in clipping, before the pespective divide, and is not used in later rasterization. Thus it doesn't need perspective correction.
| | * | | | | | | swrasterizer/clipper: remove tested TODOwwylele2017-08-211-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | hwtested. Current implementation is the correct behavior
| | * | | | | | | gl_shader_gen: simplify and clarify the depth transformation between vertex shader and fragment shaderwwylele2017-08-211-2/+5
| | | | | | | | |
| | * | | | | | | gl_rasterizer: add clipping plane z<=0 defined in PICAwwylele2017-08-214-0/+21
| | |/ / / / / /
| * | | | | | | Merge pull request #2889 from Schplee/updated-logo-svgbunnei2017-08-214-79/+1
| |\ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | | Updated master logo to new logo svg
| | * | | | | | Updated master logo to new logo svgSchplee2017-08-204-79/+1
| | | |_|_|_|/ | | |/| | | |
| * | | | | | Merge pull request #2872 from wwylele/sw-geo-factorYuri Kunde Schlesner2017-08-211-4/+16
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | SwRasterizer/Lighting: implement geometric factor
| | * | | | | | SwRasterizer/Lighting: implement geometric factorwwylele2017-08-111-4/+16
| | | | | | | |
| * | | | | | | Merge branch 'update-soundtouch' (PR #2885)Yuri Kunde Schlesner2017-08-211-0/+0
| |\ \ \ \ \ \ \
| | * | | | | | | externals: Update soundtouchMerryMage2017-08-211-0/+0
| | | | | | | | |
| * | | | | | | | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-2020-277/+302
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Refactor MotionEmu into a InputDevice
| | * | | | | | | | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | | | | | | | | |
| | * | | | | | | | motion_emu: no need to include thread in headerwwylele2017-08-192-2/+7
| | | | | | | | | |
| | * | | | | | | | move MotionEmu from core/frontend to input_common as a InputDevicewwylele2017-08-1117-244/+221
| | | | | | | | | |
| | * | | | | | | | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-113-5/+48
| | | | | | | | | |
| * | | | | | | | | Merge pull request #2871 from wwylele/sw-spotlightJames Rowe2017-08-201-3/+19
| |\ \ \ \ \ \ \ \ \ | | |_|_|_|/ / / / / | |/| | | | | | | | SwRasterizer/Lighting: implement spot light
| | * | | | | | | | SwRasterizer/Lighting: implement spot lightwwylele2017-08-111-3/+19
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Added missing parts in libnetwork (#2838)B3n302017-08-199-37/+310
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Network: Set and send the game information over enet Added Callbacks for RoomMember and GetMemberList to Room in preparation for web_services.
| * | | | | | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | dsp_dsp: Remove size assertion in LoadComponent
| | * | | | | | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| | | | | | | | |
| * | | | | | | | Merge pull request #2879 from danzel/patch-1bunnei2017-08-141-1/+1
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix Spelling/English mistakes
| | * | | | | | | | Fix Spelling/English mistakesDave Leaver2017-08-131-1/+1
| |/ / / / / / / /
| * | | | | | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System)
| | * | | | | | | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | | | | | | | | |
| | * | | | | | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | This gives each applet type its own set of events as per the real NS module.
| * | | | | | | | Merge pull request #2875 from wwylele/bump-skipWeiyi Wang2017-08-121-4/+5
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_gen: don't call SampleTexture when bump map is not used
| | * | | | | | | | gl_shader_gen: don't call SampleTexture when bump map is not usedwwylele2017-08-111-4/+5
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2869 from j-selby/docker-buildJames Rowe2017-08-114-50/+26
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Travis: Use Docker to build for Linux
| | * | | | | | | | Travis: Use Docker to build for LinuxJames2017-08-104-50/+26
| | | | | | | | | |
| * | | | | | | | | Merge pull request #2867 from j-selby/tag-namingJames Rowe2017-08-112-8/+23
| |\ \ \ \ \ \ \ \ \ | | |_|/ / / / / / / | |/| | | | | | | | Implement correct folder structure for CI builds
| | * | | | | | | | Implement correct folder structure for CI buildsj-selby2017-08-102-8/+23
| | | | | | | | | |
| * | | | | | | | | Merge pull request #2874 from danzel/spelling-1Weiyi Wang2017-08-112-4/+4
| |\ \ \ \ \ \ \ \ \ | | |_|_|_|/ / / / / | |/| | | | | | | | Fix some spelling mistakes
| | * | | | | | | | Fix some spelling mistakesdanzel2017-08-112-4/+4
| | |/ / / / / / /
| * | | | | | | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | | HID: zero unused PadState bits
| | * | | | | | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | | |/ / / / / | | |/| | | | |
| * | | | | | | Merge pull request #2868 from wwylele/swr-tupleWeiyi Wang2017-08-101-1/+1
| |\ \ \ \ \ \ \ | | |_|/ / / / / | |/| | | | | | SwRasterizer/Lighting: use make_tuple instead of constructor
| | * | | | | | SwRasterizer/Lighting: use make_tuple instead of constructorwwylele2017-08-101-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | implicit tuple constructor is a c++17 thing, which is not supported by some not-so-old libraries. Play safe for now
| * | | | | | Merge pull request #2857 from j-selby/deploy-fixJames Rowe2017-08-103-126/+116
| |\ \ \ \ \ \ | | |_|_|_|_|/ | |/| | | | | Travis/AppVeyor: Deploy based upon tags
| | * | | | | Travis/AppVeyor: Deploy based upon tagsj-selby2017-08-063-126/+116
| | | |_|/ / | | |/| | |
| * | | | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-092-1/+1
| |\ \ \ \ \ | | | | | | | | | | | | | | Update CryptoPP (byte ambiguity)
| | * | | | | Update cryptoppJames2017-08-082-1/+1
| | | |/ / / | | |/| | |
| * | | | | Merge pull request #2822 from wwylele/sw_lighting-2Weiyi Wang2017-08-098-9/+315
| |\ \ \ \ \ | | | | | | | | | | | | | | Implement fragment lighting in the sw renderer (take 2)
| | * | | | | SwRasterizer/Lighting: shorten file namewwylele2017-08-034-4/+4
| | | | | | |
| | * | | | | SwRasterizer/Lighting: move to its own filewwylele2017-08-024-240/+271
| | | | | | |
| | * | | | | SwRasterizer/Lighting: reduce confusionwwylele2017-08-021-1/+1
| | | | | | |
| | * | | | | SwRasterizer/Lighting: move quaternion normalization to the callerwwylele2017-08-021-3/+3
| | | | | | |
| | * | | | | SwRasterizer/Lighting: dist atten lut input need to be clampwwylele2017-07-111-1/+1
| | | | | | |
| | * | | | | SwRasterizer/Lighting: unify float suffixwwylele2017-07-111-11/+13
| | | | | | |
| | * | | | | SwRasterizer/Lighting: get rid of nested returnwwylele2017-07-111-10/+11
| | | | | | |
| | * | | | | SwRasterizer/Lighting: refactor GetLutValue into a function.wwylele2017-07-111-83/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | merging similar pattern. Also makes the code more similar to the gl one
| | * | | | | SwRasterizer: only interpolate quat and view when lighting is enabledwwylele2017-07-111-14/+14
| | | | | | |
| | * | | | | vector_math: remove dead template parameterwwylele2017-07-111-1/+1
| | | | | | |
| | * | | | | SwRasterizer/Lighting: pass lighting state as parameterwwylele2017-07-111-13/+13
| | | | | | |
| | * | | | | vector_math: remove broken SFINAE stuffwwylele2017-07-111-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | this was originally added to eliminate warnings on MSVC, but it doesn't work for custom types.
| | * | | | | SwRasterizer/Lighting: Move the clamp highlight calculation to the end of the per-light loop body.Subv2017-07-111-17/+17
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Move the lighting enable check outside the ComputeFragmentsColors function.Subv2017-07-111-7/+6
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Do not use global registers state in ComputeFragmentsColors.Subv2017-07-111-3/+3
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Do not use global state in LookupLightingLut.Subv2017-07-112-13/+22
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Fixed a bug where the distance attenuation bias was being set to the dist atten scale.Subv2017-07-111-3/+2
| | | | | | |
| | * | | | | SwRasterizer: Fixed a few conversion warnings and moved per-light values into the per-light loop.Subv2017-07-111-5/+6
| | | | | | |
| | * | | | | SwRasterizer: Run clang-formatSubv2017-07-111-45/+83
| | | | | | |
| | * | | | | SwRasterizer: Flip the vertex quaternions before clipping (if necessary).Subv2017-07-113-21/+16
| | | | | | |
| | * | | | | SwRasterizer: Corrected the light LUT lookups.Subv2017-07-111-6/+7
| | | | | | |
| | * | | | | SwRasterizer: Corrected the light LUT lookups.Subv2017-07-112-33/+48
| | | | | | |
| | * | | | | SwRasterizer: Fixed the lighting lut lookup function.Subv2017-07-111-2/+4
| | | | | | |
| | * | | | | SwRasterizer: Calculate fresnel for fragment lighting.Subv2017-07-111-1/+25
| | | | | | |
| | * | | | | SwRasterizer: Calculate specular_1 for fragment lighting.Subv2017-07-111-3/+59
| | | | | | |
| | * | | | | SwRasterizer: Calculate specular_0 for fragment lighting.Subv2017-07-111-13/+94
| | | | | | |
| | * | | | | SwRasterizer: Implement primary fragment color.Subv2017-07-111-4/+113
| | | | | | |
| * | | | | | Merge pull request #2856 from wwylele/shader-shareWeiyi Wang2017-08-092-26/+45
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | pica: upload shared shader code & swizzle to both unit
| | * | | | | | pica: upload shared shader code to both unitwwylele2017-08-072-26/+45
| | | | | | | |
| * | | | | | | Merge pull request #2864 from mailwl/dlp-updatebunnei2017-08-093-4/+44
| |\ \ \ \ \ \ \ | | |_|_|/ / / / | |/| | | | | | Service/dlp: Update function tables according 3dbrew
| | * | | | | | Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| |/ / / / / /
| * | | | | | Merge pull request #2860 from anodium/patch-1James Rowe2017-08-051-1/+1
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Quickfix typo in OpenGL 3.3 error message
| | * | | | | | Quickfix typo in OpenGL 3.3 error messageAndrea Pascal2017-08-051-1/+1
| |/ / / / / / | | | | | | | | | | | | | | User pointed out on the Discord server that "nothave" is erroneously concatenated. Added a space to prevent it.
| * | | | | | Merge pull request #2855 from bunnei/telemetry-additional-fieldsJames Rowe2017-08-049-17/+68
| |\ \ \ \ \ \ | | |_|_|/ / / | |/| | | | | Telemetry: Add several more useful fields
| | * | | | | telemetry: Add field for OsPlatform.bunnei2017-08-041-0/+9
| | | | | | |
| | * | | | | telemetry: Add field for BuildName.bunnei2017-08-041-0/+1
| | | | | | |
| | * | | | | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| | | | | | |
| | * | | | | telemetry_session: Log BuildDate and ProgramName fields.bunnei2017-08-041-0/+7
| | | | | | |
| | * | | | | common: Add build timestamp to scm_rev.bunnei2017-08-043-1/+11
| | | | | | |
| | * | | | | core: Expose AppLoader as a public interface.bunnei2017-08-041-4/+5
| | | | | | |
| | * | | | | loader: Expose program title.bunnei2017-08-043-12/+31
| |/ / / / /
| * | | | | Merge pull request #2850 from j-selby/fix_invalid_pathsYuri Kunde Schlesner2017-08-012-4/+78
| |\ \ \ \ \ | | |/ / / / | |/| | | | Handle invalid filenames when renaming files/directories
| | * | | | Handle invalid filenames when renaming files/directoriesJames2017-07-312-4/+78
| |/ / / /
| * | | | Merge pull request #2848 from wwylele/shader-loop-fixWeiyi Wang2017-07-291-1/+1
| |\ \ \ \ | | | | | | | | | | | | pica/shader_interpreter: fix off-by-one in LOOP
| | * | | | pica/shader_interpreter: fix off-by-one in LOOPwwylele2017-07-271-1/+1
| | | | | |
| * | | | | Merge pull request #2849 from j-selby/masterJames Rowe2017-07-294-4/+21
| |\ \ \ \ \ | | | | | | | | | | | | | | Produce 7zip artifacts on Travis and Appveyor
| | * | | | | Produce 7zip artifacts on Travis and Appveyorj-selby2017-07-284-4/+21
| |/ / / / /
| * | | | | Merge pull request #2679 from MerryMage/interp-testsbunnei2017-07-276-1/+13717
| |\ \ \ \ \ | | | | | | | | | | | | | | DynCom VFP tests
| | * | | | | tests: Add tests for vaddMerryMage2017-07-236-3/+13511
| | | | | | |
| | * | | | | tests: Arm testing frameworkMerryMage2017-07-233-0/+208
| | |/ / / /
| * | | | | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \ \ \ \ | | | | | | | | | | | | | | Services/APT: Corrected the behavior of the Receive/Send/Glance/CancelParameter functions
| | * | | | | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | | | | | |
| | * | | | | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | | | | | |
| | * | | | | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | | | | | |
| | * | | | | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | | | | | |
| | * | | | | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | | | | | |
| | * | | | | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
| | | |_|/ / | | |/| | |
| * | | | | Merge pull request #2837 from wwylele/shader-debugger-fixbunnei2017-07-261-23/+18
| |\ \ \ \ \ | | | | | | | | | | | | | | Misc shader debugger fixes
| | * | | | | debugger/shader: display LOOPwwylele2017-07-201-1/+3
| | | | | | |
| | * | | | | debugger/shader: print the invert flag for JMPUwwylele2017-07-201-0/+4
| | | | | | |
| | * | | | | debugger/shader: fix address register for reverted arithmetic opwwylele2017-07-201-20/+9
| | | | | | |
| | * | | | | debugger/shader: fix inverted uniform flow controlwwylele2017-07-201-2/+2
| | | | | | |
| * | | | | | Merge pull request #2847 from B3n30/network_linux_fixbunnei2017-07-262-3/+4
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Fixed build error "too many initializers for ‘const MacAddress"
| | * | | | | | Network: Moved NintendoOUI initalization to RoomMember constructorB3n302017-07-262-3/+4
| |/ / / / / /
* | | | | | | loader: Various improvements for NSO/NRO loaders.bunnei2017-10-108-58/+40
| | | | | | |
* | | | | | | loader: Add support for NRO, as well as various fixes and shared linker.bunnei2017-10-069-146/+434
| | | | | | |
* | | | | | | nso: Fixes to support homebrew NSOs without a MOD header.bunnei2017-10-042-17/+23
| | | | | | |
* | | | | | | arm_interface: Set TLS address for dynarmic core.bunnei2017-09-305-0/+32
| | | | | | |
* | | | | | | nso: Refactor and allocate .bss section.bunnei2017-09-309-132/+162
| | | | | | |
* | | | | | | process: Support loading multiple codesets.bunnei2017-09-302-20/+27
| | | | | | |
* | | | | | | loader: Add support for loading an NSO.bunnei2017-09-305-0/+342
| | | | | | |
* | | | | | | externals: Add lz4.bunnei2017-09-303-1/+6
| | | | | | |
* | | | | | | memory: Log with 64-bit values.bunnei2017-09-301-8/+8
| | | | | | |
* | | | | | | kernel: Various threading fixes to support 64-bit addressing.bunnei2017-09-302-8/+8
| | | | | | |
* | | | | | | core: Various changes to support 64-bit addressing.bunnei2017-09-305-54/+54
| | | | | | |
* | | | | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-309-80/+113
| | | | | | |
* | | | | | | elf: Check if machine is ARM.bunnei2017-09-301-2/+9
|/ / / / / /
* | | | | | Merge pull request #2844 from jroweboy/nightlyfixWeiyi Wang2017-07-241-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Use WinSSPI instead of OpenSSL
| * | | | | Use WinSSPI instead of OpenSSLJames Rowe2017-07-241-1/+1
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | Appveyor has OpenSSL installed, so cURL tries to link against it. This causes dll not found errors because we would also need to ship OpenSSL, so we link against Windows SSPI instead.
* | | | | Merge pull request #2816 from wwylele/proctex-lutlutlutSebastian Valle2017-07-235-70/+80
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: use texture buffer for proctex LUT
| * | | | | gl_rasterizer: use texture buffer for proctex LUTwwylele2017-07-015-70/+80
| | | | | |
* | | | | | Merge pull request #2834 from wwylele/depth-enable-fixSebastian Valle2017-07-231-4/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: fix using_depth_fb
| * | | | | | gl_rasterizer_cache: depth write is disabled if allow_depth_stencil_write is falsewwylele2017-06-101-4/+5
| | | | | | |
* | | | | | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-226-68/+113
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | Add address conversion functions returning optional, Add function to flush virtual region from rasterizer cache
| * | | | | | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-224-47/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is slightly more ergonomic to use, correctly handles virtual regions which are disjoint in physical addressing space, and checks only regions which can be cached by the rasterizer.
| * | | | | | Memory: Add TryVirtualToPhysicalAddress, returning a boost::optionalYuri Kunde Schlesner2017-06-222-7/+23
| | | | | | |
| * | | | | | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-224-14/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | And fix a few places in the code to take advantage of that.
* | | | | | | Merge pull request #2833 from j-selby/single-header-jsonbunnei2017-07-185-4/+14524
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Don't pull in entire JSON repo for single header file
| * | | | | | | Add description of upstream repoJames2017-07-181-0/+7
| | | | | | | |
| * | | | | | | Don't pull in entire JSON repo for single header fileJames2017-07-184-4/+14517
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2823 from bunnei/telemetry-databunnei2017-07-185-18/+96
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | telemetry: Log performance, configuration, and system data.
| * | | | | | telemetry: Log performance, configuration, and system data.bunnei2017-07-185-18/+96
|/ / / / / /
* | | | | | Merge pull request #2804 from Kloen/themingbunnei2017-07-1849-2/+1387
|\ \ \ \ \ \ | | | | | | | | | | | | | | citra-qt: UI Themes
| * | | | | | citra-qt: Add option to configure the UI themeKloen2017-06-242-0/+37
| | | | | | |
| * | | | | | citra-qt: load ui theme at startup and config change.Kloen2017-06-242-0/+22
| | | | | | |
| * | | | | | citra-qt: Add Dark theme from https://github.com/ColinDuquesnoy/QDarkStyleSheetKloen2017-06-2443-2/+1319
| | | | | | |
| * | | | | | citra-qt: add new uisetting->themeKloen2017-06-242-0/+9
| | | | | | |
* | | | | | | Merge pull request #2818 from B3n30/networkWeiyi Wang2017-07-179-21/+1206
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Enable data transfer over ENet
| * | | | | | | Network: Changed timeout for receiving packets to 100msB3n302017-07-165-43/+50
| | | | | | | |
| * | | | | | | Network: Propagate Room closing to connected membersB3n302017-07-163-3/+28
| | | | | | | |
| * | | | | | | Network: Made send async in RoomMemberB3n302017-07-164-25/+70
| | | | | | | |
| * | | | | | | Network: Send the game titleB3n302017-07-166-114/+185
| | | | | | | |
| * | | | | | | Network: Enable sending and receiving chat messagesB3n302017-07-163-0/+79
| | | | | | | |
| * | | | | | | Network: Handle the disconnect of a clientB3n302017-07-161-1/+18
| | | | | | | |
| * | | | | | | Network: Enable to send WifiPacketsB3n302017-07-163-1/+82
| | | | | | | |
| * | | | | | | Network: Init Network in SDL and QTB3n302017-07-162-1/+5
| | | | | | | |
| * | | | | | | Network: Send JoinRequest and handle the answer in RoomMemberB3n302017-07-162-2/+125
| | | | | | | |
| * | | | | | | Network: Handle join request in RoomB3n302017-07-162-1/+205
| | | | | | | |
| * | | | | | | Network: Added Packet class for serializationB3n302017-07-163-0/+423
| | | | | | | |
| * | | | | | | Network: Threads for Room and RoomMemberB3n302017-07-164-13/+119
| | | | | | | |
* | | | | | | | Merge pull request #2829 from MerryMage/check_submodules_presentbunnei2017-07-171-0/+15
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | CMakeLists: Check that all submodules are present
| * | | | | | | | CMakeLists: Check that all submodules are presentMerryMage2017-07-161-0/+15
| | | | | | | | |
* | | | | | | | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
| | | | | | | | |
* | | | | | | | | Merge pull request #2830 from linkmauve/masterJames Rowe2017-07-171-1/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Make enet use the same convention as other submodules
| * | | | | | | | .gitmodules: Make enet use the same convention as other submodules.Emmanuel Gil Peyrot2017-07-161-1/+1
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This makes it easier for packagers to preload all submodules.
* | | | | | | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-165-22/+264
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | load shared font from system archive
| * | | | | | | apt: load shared font from system archivewwylele2017-06-264-20/+260
| | | | | | | |
| * | | | | | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2824 from jroweboy/mingw_compile_testWeiyi Wang2017-07-131-0/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Update enet submodule
| * | | | | | | Update enet submoduleJames Rowe2017-07-131-0/+0
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | This includes a fix merged upstream to support mingw compilation
* | | | | | | Merge pull request #2819 from bunnei/telemetry-submitbunnei2017-07-1319-3/+301
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Telemetry: Submit logged data to the Citra service
| * | | | | | web_backend: Specify api-version on JSON post.bunnei2017-07-121-1/+3
| | | | | | |
| * | | | | | web_service: Add CMake flag to enable.bunnei2017-07-125-14/+32
| | | | | | |
| * | | | | | telemetry_session: Use TelemetryJson to submit real telemetry.bunnei2017-07-123-5/+3
| | | | | | |
| * | | | | | web_service: Implement JSON serialization of telemetry data.bunnei2017-07-122-0/+125
| | | | | | |
| * | | | | | web_backend: Add initial interface to POST data to Citra Web Services.bunnei2017-07-122-0/+63
| | | | | | |
| * | | | | | web_service: Add skeleton project.bunnei2017-07-107-1/+52
| | | | | | |
| * | | | | | settings: Add telemetry endpoint URL.bunnei2017-07-104-0/+23
| | | | | | |
| * | | | | | logging: Add WebService as a log cateogry.bunnei2017-07-102-1/+3
| | | | | | |
| * | | | | | externals: Add JSON as a submodule.bunnei2017-07-103-0/+7
| | | | | | |
| * | | | | | externals: Add CPR as a submodule.bunnei2017-07-093-0/+9
|/ / / / / /
* | | | | | Merge pull request #2815 from mailwl/bosspSebastian Valle2017-07-081-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Service/boss:P: Add some functions to FunctionTable
| * | | | | | Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2797 from yuriks/cached-vma-free-crashbunnei2017-07-081-5/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | Memory: Fix crash when unmapping a VMA covering cached surfaces
| * | | | | | Memory: Fix crash when unmapping a VMA covering cached surfacesYuri Kunde Schlesner2017-06-221-5/+20
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Unmapping pages tries to flush any cached GPU surfaces touching that region. When a cached page is invalidated, GetPointerFromVMA() is used to restore the original pagetable pointer. However, since that VMA has already been deleted, this hits an UNREACHABLE case in that function. Now when this happens, just set the page type to Unmapped and continue, which arrives at the correct end result.
* | | | | | Implement basic virtual Room support based on enet (#2803)B3n302017-07-0715-1/+364
| |_|_|_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added support for network with ENet lib, connecting is possible, but data can't be sent, yet. * fixup! Added support for network with ENet lib, * fixup! CLang * fixup! Added support for network with ENet lib, * fixup! Added support for network with ENet lib, * fixup! Clang format * More fixups! * Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Clang again * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes
* | | | | Merge pull request #2814 from Kloen/macro-removeJames Rowe2017-07-011-1/+0
|\ \ \ \ \ | |_|/ / / |/| | | | Remove unnecessary WIN32_LEAN_AND_MEAN macro definition
| * | | | Remove unnecessary WIN32_LEAN_AND_MEAN macro definitionKloen2017-06-301-1/+0
|/ / / /
* | | | Merge pull request #2793 from Subv/replyandreceiveSebastian Valle2017-06-306-23/+161
|\ \ \ \ | | | | | | | | | | Kernel/SVC: Partially implemented svcReplyAndReceive
| * | | | Kernel/SVC: Pass the current thread as a parameter to ClientSession::SendSyncRequest.Subv2017-06-293-4/+7
| | | | |
| * | | | Kernel/Sessions: Clean up the list of pending request threads of a session when the client endpoint is closed.Subv2017-06-261-0/+5
| | | | |
| * | | | Kernel/SVC: Partially implemented svcReplyAndReceive.Subv2017-06-262-11/+121
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It behaves mostly as WaitSynchronizationN with wait_all = false, except for IPC buffer translation. The target thread of an IPC response will now wake up when responding. IPC buffer translation is currently not implemented. Error passing back to svcSendSyncRequest is currently not implemented.
| * | | | Kernel/ServerSession: Keep track of which threads have issued sync requests.Subv2017-06-253-9/+29
| | | | |
* | | | | Merge pull request #2809 from wwylele/texture-copy-fixYuri Kunde Schlesner2017-06-292-19/+24
|\ \ \ \ \ | | | | | | | | | | | | gpu: fix edge cases for TextureCopy
| * | | | | gpu: add comments for TextureCopywwylele2017-06-292-8/+8
| | | | | |
| * | | | | gpu: fix edge cases for TextureCopywwylele2017-06-271-18/+23
| | | | | |
* | | | | | Merge pull request #2800 from wwylele/fog-lutlutlutYuri Kunde Schlesner2017-06-297-31/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer: use texture buffer for fog LUT
| * | | | | | gl_rasterizer: use texture buffer for fog LUTwwylele2017-06-227-29/+32
| | | | | | |
| * | | | | | gl_rasterizer: create the texture before applying the statewwylele2017-06-221-2/+2
| | |_|/ / / | |/| | | | | | | | | | | | | | | | this is a rebasing error from #2792. It doesn't affect much though, because the later more Apply() call fixes/hides it
* | | | | | Merge pull request #2811 from MerryMage/qtdebugJames Rowe2017-06-281-0/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | configure_debug: Add label warning that CPU JIT needs to be disabled …
| * | | | | | configure_debug: Add label warning that CPU JIT needs to be disabled for gdbstub to workMerryMage2017-06-281-0/+7
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2812 from tiagmoraismorgado/patch-1James Rowe2017-06-281-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | fixing a couple of typos
| * | | | | fixing a couple of typosTiago Morais Morgado2017-06-281-2/+2
|/ / / / /
* | | | | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-275-1/+436
|\ \ \ \ \ | | | | | | | | | | | | Services/UDS: Stub SendTo to generate the unencrypted data frames with the right headers
| * | | | | UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| | | | | |
| * | | | | UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-262-4/+3
| | | | | |
| * | | | | UDS: Run clang-format.Subv2017-06-263-51/+55
| | | | | |
| * | | | | UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| | | | | | | | | | | | | | | | | | | | | | | | The responsibility of encryption and encapsulation into an 802.11 MAC frame will fall into the callers of GenerateDataPayload.
| * | | | | UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | It is likely that these 4 bytes are actually a different header, part of some protocol that encapsulates the SecureData protocol.
| * | | | | UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| | | | | |
| * | | | | UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-154-1/+261
| | |/ / / | |/| | |
* | | | | externals: silence warning C4390 on MSVC for cryptopp (#2805)Klöen Lansfiel2017-06-251-0/+5
| | | | |
* | | | | Set global definition WIN32_LEAN_AND_MEAN (#2807)B3n302017-06-252-0/+5
| | | | | | | | | | | | | | | Set definition WIN32_LEAN_AND_MEAN to avoid windows.h including a lot of libs that are usually not used.
* | | | | Merge pull request #2801 from yuriks/session-svcsYuri Kunde Schlesner2017-06-245-7/+52
|\ \ \ \ \ | |_|_|/ / |/| | | | Implement CreateSessionToPort and AcceptSession; fix CreatePort
| * | | | Kernel: Implement AcceptSession SVCYuri Kunde Schlesner2017-06-234-3/+38
| | | | |
| * | | | Kernel: Fix SVC wrapper for CreatePortYuri Kunde Schlesner2017-06-231-3/+2
| | | | | | | | | | | | | | | | | | | | The return parameters were flipped.
| * | | | Kernel: Implement CreateSessionToPort SVCYuri Kunde Schlesner2017-06-231-1/+12
|/ / / /
* | | | Merge pull request #2798 from yuriks/svc-create-sessionYuri Kunde Schlesner2017-06-232-3/+26
|\ \ \ \ | | | | | | | | | | Kernel: Implement CreateSession SVC
| * | | | Kernel: Implement CreateSession SVCYuri Kunde Schlesner2017-06-222-3/+26
| | |/ / | |/| |
* | | | Merge pull request #2795 from chris062689/masterbunnei2017-06-232-6/+6
|\ \ \ \ | | | | | | | | | | Change default UI background from white to black.
| * | | | Changing default values for bg_red, bg_green, and bg_blue from 1.0 to 0.0.chris0626892017-06-212-6/+6
| | | | |
* | | | | Merge pull request #2796 from yuriks/hle-null-handlesbunnei2017-06-232-8/+36
|\ \ \ \ \ | |_|/ / / |/| | | | Kernel/IPC: Support translation of null handles
| * | | | Kernel: Fix typo in test nameYuri Kunde Schlesner2017-06-221-1/+1
| | | | |
| * | | | Kernel/IPC: Support translation of null handlesYuri Kunde Schlesner2017-06-212-7/+35
| | | | | | | | | | | | | | | | | | | | | | | | | Missed this in my first implementation. Thanks to @wwylele for pointing out that this was missing.
* | | | | Merge pull request #2792 from wwylele/lutlutlutYuri Kunde Schlesner2017-06-217-151/+175
|\ \ \ \ \ | |/ / / / |/| | | | gl_rasterizer: fix lighting LUT interpolation
| * | | | gl_state: reset 1d textureswwylele2017-06-211-0/+14
| | | | |
| * | | | gl_rasterizer: fix glGetUniformLocation typewwylele2017-06-211-8/+8
| | | | |
| * | | | gl_rasterizer: manage texture ids in one placewwylele2017-06-213-31/+55
| | | | |
| * | | | gl_rasterizer/lighting: fix LUT interpolationwwylele2017-06-217-116/+102
| | | | |
* | | | | Merge pull request #2789 from yuriks/misc-kernelWeiyi Wang2017-06-212-1/+5
|\ \ \ \ \ | |_|/ / / |/| | | | Trivial no-op additions
| * | | | Memory: Add enum definitions for the n3DS FCRAM sizeYuri Kunde Schlesner2017-06-211-1/+3
| | | | |
| * | | | Kernel: Add comment about the extended linear heap areaYuri Kunde Schlesner2017-06-191-0/+2
| |/ / /
* | | | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2124-56/+57
|\ \ \ \ | | | | | | | | | | Remove ResultVal::MoveFrom
| * | | | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1924-57/+53
| | | | | | | | | | | | | | | | | | | | | | | | | Replace it with std::move(result_val).Unwrap(), or Foo().Unwrap() in case you already have an rvalue.
| * | | | ResultVal: Add an rvalue overload of Unwrap()Yuri Kunde Schlesner2017-06-191-1/+6
| |/ / /
* | | | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \ \ \ | | | | | | | | | | UDS: Added a hook for updating the connection status when a client connects to the network.
| * | | | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| | |/ / | |/| |
* | | | Merge pull request #2787 from yuriks/hle-ipc-testsYuri Kunde Schlesner2017-06-205-7/+206
|\ \ \ \ | |_|/ / |/| | | Kernel/IPC: Add tests for HLERequestContext buffer translation
| * | | Kernel/IPC: Add tests for HLERequestContext buffer translationYuri Kunde Schlesner2017-06-192-2/+196
| | | |
| * | | Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-193-5/+10
|/ / /
* | | Merge pull request #2776 from wwylele/geo-factorYuri Kunde Schlesner2017-06-183-7/+26
|\ \ \ | | | | | | | | Fragment lighting: implement geometric factor
| * | | gl_rasterizer/lighting: use the formula from the paper for germetic factorwwylele2017-06-181-8/+8
| | | |
| * | | gl_rasterizer/lighting: implement geometric factorwwylele2017-06-153-1/+20
| | | |
* | | | Merge pull request #2785 from yuriks/compile-flagsYuri Kunde Schlesner2017-06-184-19/+20
|\ \ \ \ | |/ / / |/| | | CMake: Set MSVC flags for improved C++ standards conformance
| * | | CMake: Set MSVC flags for improved C++ standards conformanceYuri Kunde Schlesner2017-06-171-3/+6
| | | | | | | | | | | | | | | | This makes the compiler stricter and also enables small optimizations.
| * | | Stop using reserved operator names (and/or/xor) with XbyakYuri Kunde Schlesner2017-06-173-16/+14
|/ / / | | | | | | | | | Also has the Dynarmic upgrade with the same change
* | | Merge pull request #2762 from wwylele/light-cp-tangentYuri Kunde Schlesner2017-06-152-10/+38
|\ \ \ | | | | | | | | Fragment lighting: implement lut input 5 (CP) and tangent mapping
| * | | gl_rasterizer/lighting: Implement tangent mappingwwylele2017-06-111-7/+12
| | | |
| * | | gl_rasterizer/lighting: implement lut input 5 (CP)wwylele2017-06-112-3/+26
| | | |
* | | | Merge pull request #2743 from wwylele/wrap-fixYuri Kunde Schlesner2017-06-144-12/+48
|\ \ \ \ | |_|/ / |/| | | pica/rasterizer: implement/stub texture wrap mode 4-7
| * | | pica/rasterizer: implement/stub texture wrap mode 4-7wwylele2017-06-044-12/+48
| | | |
* | | | Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. This lets the application know that the host was successfully added to the session. * Services/UDS: Reset the connection status when destroying the network * Services/UDS: Reset the connection status's bitmask of changed nodes after reporting it to the game.
* | | | Merge pull request #2767 from yuriks/quaternion-flip-commentYuri Kunde Schlesner2017-06-131-8/+11
|\ \ \ \ | | | | | | | | | | OpenGL: Update comment on AreQuaternionsOpposite with new information
| * | | | OpenGL: Update comment on AreQuaternionsOpposite with new informationYuri Kunde Schlesner2017-06-101-8/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While debugging the software renderer implementation, it was noticed that this is actually exactly what the hardware does, upgrading the status of this "hack" to being a proper implementation. And there was much rejoicing.
* | | | | Merge pull request #2774 from yuriks/hle-handlesYuri Kunde Schlesner2017-06-127-69/+360
|\ \ \ \ \ | |_|_|/ / |/| | | | Add basic support for IPC translation for HLE services
| * | | | Kernel/IPC: Use boost::small_vector for HLE context objectsYuri Kunde Schlesner2017-06-121-1/+3
| | | | |
| * | | | Externals: Upgrade bundled Boost to 1.64Yuri Kunde Schlesner2017-06-111-0/+0
| | | | |
| * | | | Kernel: Allow clearing request_objects to re-use buffer spaceYuri Kunde Schlesner2017-06-113-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | Reduces the necessary allocation to max(in_handles, out_handles) rather than (in_handles + out_handles).
| * | | | Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-113-18/+130
| | | | |
| * | | | Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
| | | | |
| * | | | IPC: Add Pop/PushObjects methods to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-10/+103
| | | | | | | | | | | | | | | | | | | | | | | | | These use the context functions to create and look-up handles for the user.
| * | | | IPC: Add basic HLERequestContext support to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-1/+32
| | | | |
| * | | | Kernel: Add methods in HLERequestContext abstracting handle creationYuri Kunde Schlesner2017-06-112-0/+12
| | | | |
| * | | | ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-113-9/+29
| |/ / / | | | | | | | | | | | | | | | | | | | | Copy the IPC command buffer to/from the request context before/after the handler is invoked. This is part of a move away from using global data for handling IPC requests.
* | | | Merge pull request #2727 from wwylele/spot-lightSebastian Valle2017-06-115-28/+128
|\ \ \ \ | |/ / / |/| | | Fragment lighting: implement spot light
| * | | gl_rasterizer: implement spot lightwwylele2017-05-301-6/+24
| | | |
| * | | gl_rasterizer: sync spot light statuswwylele2017-05-304-2/+61
| | | |
| * | | pica: prepare registers for spotlightwwylele2017-05-301-20/+43
| | | |
* | | | Remove unused import in break_points.cpp (#2763)Kloen Lansfiel2017-06-091-1/+0
| | | |
* | | | Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-099-64/+355
|\ \ \ \ | | | | | | | | | | New service framework
| * | | | Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| | | | |
| * | | | Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| | | | |
| * | | | Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-085-4/+269
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The old "Interface" class had a few problems such as using free functions (Which didn't allow you to write the service handler as if it were a regular class.) which weren't very extensible. (Only received one parameter with a pointer to the Interface object.) The new ServiceFramework aims to solve these problems by working with member functions and passing a generic context struct as parameter. This struct can be extended in the future without having to update all existing service implementations.
| * | | | Kernel: Remove some unnecessary namespace qualificationsYuri Kunde Schlesner2017-06-061-4/+6
| | | | |
* | | | | Merge pull request #2761 from yuriks/session-referencesYuri Kunde Schlesner2017-06-083-9/+15
|\ \ \ \ \ | |_|_|_|/ |/| | | | Kernel: Ensure objects are kept alive during ClientSession disconnection
| * | | | Session: Remove/add some forward declarationsYuri Kunde Schlesner2017-06-083-2/+2
| | | | |
| * | | | Kernel: Ensure objects are kept alive during ClientSession disconnectionYuri Kunde Schlesner2017-06-081-7/+13
|/ / / / | | | | | | | | | | | | Fixes #2760
* | | | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ \ \ | | | | | | | | | | Services/UDS: Implement DecryptBeaconData.
| * | | | Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
| | | | | | | | | | | | | | | | | | | | This function decrypts the encrypted data tags contained in the 802.11 beacon frames.
* | | | | Merge pull request #2755 from yuriks/service-includesYuri Kunde Schlesner2017-06-0632-12/+80
|\ \ \ \ \ | | |/ / / | |/| | | Service: Remove unnecessary includes from service.h
| * | | | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0632-12/+80
| | | | | | | | | | | | | | | | | | | | | | | | | This has a huge fallout in terms of needing to fix other files because all service implementations included that file.
* | | | | Merge pull request #2754 from yuriks/sm-implYuri Kunde Schlesner2017-06-067-41/+166
|\| | | | | | | | | | | | | | Handle service registrations using sm/srv
| * | | | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-066-24/+147
| | | | | | | | | | | | | | | | | | | | Also enhances the GetServiceHandle implementation to be more accurate.
| * | | | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
| | | | | | | | | | | | | | | | | | | | | | | | | An Event was used way back then when we didn't have proper working semaphores. Our Semaphore implementation is good enough now.
| * | | | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-064-9/+10
| | | | | | | | | | | | | | | | | | | | | | | | | This will contain the implementation of the sm (Service Manager) system module.
* | | | | Merge pull request #2753 from yuriks/set-hle-handlerYuri Kunde Schlesner2017-06-0612-62/+92
|\| | | | | | | | | | | | | | Add SetHleHandler to ServerPort/ServerSession
| * | | | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-0611-62/+73
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows attaching a HLE handle to a ServerPort at any point after it is created, allowing port/session creation to be generic between HLE and regular services.
| * | | | ResultVal: Add more convenience utils for creating and cascading resultsYuri Kunde Schlesner2017-06-061-0/+19
| | | | |
* | | | | Merge pull request #2752 from yuriks/move-session-request-handlerYuri Kunde Schlesner2017-06-0614-73/+100
|\| | | | | | | | | | | | | | HLE: Move SessionRequestHandler from Service:: to Kernel::
| * | | | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-0614-73/+100
|/ / / / | | | | | | | | | | | | | | | | Most of the code that works with this is or will be in the kernel, so it's a more appropriate place for it to be.
* | | | Merge pull request #2747 from atouchet/readme-urlJames Rowe2017-06-041-1/+1
|\ \ \ \ | | | | | | | | | | Fix FAQ Link in Readme
| * | | | Fix FAQ Link in ReadmeAlex Touchet2017-06-041-1/+1
|/ / / /
* | | | Edit Citra URLs (#2728)Alex Touchet2017-06-032-3/+3
| | | |
* | | | Merge pull request #2746 from Kloen/just-whyJames Rowe2017-06-031-2/+0
|\ \ \ \ | | | | | | | | | | Remove unused imports in game_list_p.h
| * | | | Remove unused imports in game_list_p.hKloen2017-06-031-2/+0
|/ / / /
* | | | Merge pull request #2611 from TheKoopaKingdom/missing-file-dialogsbunnei2017-06-0314-41/+212
|\ \ \ \ | | | | | | | | | | Display QMessageBox Dialogs For Errors
| * | | | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-037-29/+32
| | | | | | | | | | | | | | | | | | | | | | | | | - Deleted GetStatus() because it wasn't used anywhere outside of Core::System. - Fixed design flaw where the message bar status could be set despite the game being stopped.
| * | | | Fixed wiki URLs.TheKoopaKingdom2017-06-031-6/+8
| | | | |
| * | | | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-032-4/+3
| | | | |
| * | | | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-032-53/+37
| | | | |
| * | | | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-039-35/+70
| | | | |
| * | | | Optimized messages that were repetitive and added ability for core errors to specify more details optionally.TheKoopaKingdom2017-06-035-39/+70
| | | | |
| * | | | Added message to status bar to show core errors ignored by the user.TheKoopaKingdom2017-06-032-1/+11
| | | | |
| * | | | Made some changes from review comments:TheKoopaKingdom2017-06-0310-53/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Made LoadKernelSystemMode return a pair consisting of a system mode and a result code (Could use review). - Deleted ErrorOpenGL error code in favor of just having ErrorVideoCore. - Made dialog messages more clear. - Compared archive ID in fs_user.cpp to ArchiveIdCode::NCCH as opposed to hex magic. - Cleaned up some other stuff.
| * | | | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-039-26/+121
| | | | |
| * | | | Fixed encrypted ROM error messages.TheKoopaKingdom2017-06-033-9/+19
|/ / / /
* | | | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \ \ \ | | | | | | | | | | CAM: use IPCHelper
| * | | | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| | | | |
| * | | | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| | | | |
| * | | | cam: use IPCHelperwwylele2017-05-241-278/+238
| | | | |
* | | | | Merge pull request #2739 from yuriks/kernel-reorgbunnei2017-06-0127-344/+430
|\ \ \ \ \ | | | | | | | | | | | | Split-up kernel.h
| * | | | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-3018-203/+242
| | | | | |
| * | | | | Kernel: Move WaitObject to a separate fileYuri Kunde Schlesner2017-05-3015-135/+178
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that HandleTable doesn't directly depend on WaitObject anymore, this can be separated from the main kernel.h header.
| * | | | | Kernel: Removed HandleTable::GetWaitObjectYuri Kunde Schlesner2017-05-302-11/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't necessary anymore since plain Get works correctly for WaitObjects.
| * | | | | Kernel: Extract dynamic Object pointer cast into its own functionYuri Kunde Schlesner2017-05-291-11/+24
| | |/ / / | |/| | |
* | | | | Merge pull request #2721 from wwylele/texture-cubebunnei2017-05-302-3/+77
|\ \ \ \ \ | |_|_|_|/ |/| | | | swrasterizer: implemented TextureCube
| * | | | swrasterizer: implement TextureCubewwylele2017-05-291-2/+51
| | | | |
| * | | | pica: add registers for texture cubewwylele2017-05-291-1/+26
| | | | |
* | | | | Merge pull request #2734 from yuriks/cmake-imported-libsYuri Kunde Schlesner2017-05-3014-120/+160
|\ \ \ \ \ | |_|/ / / |/| | | | CMake: Use CMake target properties for all libraries
| * | | | CMake: Re-organize root CMakeLists.txt fileYuri Kunde Schlesner2017-05-281-56/+78
| | | | | | | | | | | | | | | | | | | | Separates the file into sections and re-orders things to fit in them
| * | | | CMake: Move definitions of externals to the CMakeLists in that directoryYuri Kunde Schlesner2017-05-282-32/+47
| | | | |
| * | | | CMake: Create an INTERFACE target for CatchYuri Kunde Schlesner2017-05-282-4/+6
| | | | |
| * | | | CMake: Create INTERFACE targets for microprofile and nihstroYuri Kunde Schlesner2017-05-284-5/+9
| | | | |
| * | | | CMake: Remove unnecessary include_directories for dynarmicYuri Kunde Schlesner2017-05-281-3/+0
| | | | | | | | | | | | | | | | | | | | Dynarmic already adds the correct include paths to the library target.
| * | | | CMake: Add cryptopp include path to target propertyYuri Kunde Schlesner2017-05-282-3/+4
| | | | |
| * | | | CMake: Add SoundTouch include path to target propertyYuri Kunde Schlesner2017-05-282-2/+2
| | | | |
| * | | | CMake: Use target properties to add inih include pathsYuri Kunde Schlesner2017-05-282-3/+2
| | | | |
| * | | | CMake: Define an interface target for SDL2 definitionsYuri Kunde Schlesner2017-05-284-8/+11
| | | | |
| * | | | CMake: Remove CITRA_QT_LIBS varYuri Kunde Schlesner2017-05-282-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | This used to be required to support both Qt4 and Qt5, but we dropped Qt4 so it's not needed anymore.
| * | | | CMake: Stop using FindOpenGL, which seems to not be required anymoreYuri Kunde Schlesner2017-05-284-6/+4
| | | | |
| * | | | CMake: Use append instead of set to modify listYuri Kunde Schlesner2017-05-281-1/+1
| | | | |
| * | | | CMake: Use IMPORTED target for BoostYuri Kunde Schlesner2017-05-284-8/+11
| | | | |
| * | | | CMake: Use IMPORTED target for libpngYuri Kunde Schlesner2017-05-282-8/+5
| | | | |
| * | | | Travis: Upgrade to CMake 3.6.3Yuri Kunde Schlesner2017-05-281-1/+1
| | | | |
* | | | | Merge pull request #2729 from yuriks/quaternion-fixYuri Kunde Schlesner2017-05-281-3/+5
|\ \ \ \ \ | | | | | | | | | | | | OpenGL: Improve accuracy of quaternion interpolation
| * | | | | OpenGL: Improve accuracy of quaternion interpolationYuri Kunde Schlesner2017-05-271-3/+5
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Current order of operations (rotate then normalize) seems to produce a lot more distortion than normalizing and then rotating. This makes Citra results match pretty closesly with hardware, and indicates that hardware may also be using lerp instead of slerp to interpolate the quaternions.
* | | | | Merge pull request #2733 from yuriks/cmake-cleanupYuri Kunde Schlesner2017-05-2832-104/+111
|\ \ \ \ \ | | |/ / / | |/| | | Dependencies and build system cleanup
| * | | | CMake: Correct inter-module dependencies and library visibilityYuri Kunde Schlesner2017-05-288-23/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Modules didn't correctly define their dependencies before, which relied on the frontends implicitly including every module for linking to succeed. Also changed every target_link_libraries call to specify visibility of dependencies to avoid leaking definitions to dependents when not necessary.
| * | | | Citra: Convert include into forward declarationYuri Kunde Schlesner2017-05-282-2/+6
| | | | |
| * | | | Remove some unnecessary inclusions of video_core.hYuri Kunde Schlesner2017-05-284-4/+0
| | | | |
| * | | | Move screen size constants from video_core to coreYuri Kunde Schlesner2017-05-289-51/+63
| | | | | | | | | | | | | | | | | | | | | | | | | video_core didn't even properly use them, and they were the source of many otherwise-unnecessary dependencies from core to video_core.
| * | | | OpenGL: Remove unused RendererOpenGL fieldsYuri Kunde Schlesner2017-05-282-11/+2
| | | | |
| * | | | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-284-4/+4
| | | | |
| * | | | Common: Fix some out-of-style includesYuri Kunde Schlesner2017-05-283-5/+5
| | | | |
| * | | | Move framebuffer_layout from Common to CoreYuri Kunde Schlesner2017-05-285-4/+4
|/ / / / | | | | | | | | | | | | | | | | | | | | This removes a dependency inversion between core and common. It's also the proper place for the file since it makes screen layout decisions specific to the 3DS.
* | | | Merge pull request #2732 from yuriks/add-fmtYuri Kunde Schlesner2017-05-285-0/+5
|\ \ \ \ | |_|/ / |/| | | Add the fmt string formatting library
| * | | Add the fmt string formatting libraryYuri Kunde Schlesner2017-05-274-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | More info at http://fmtlib.net/ This commit was based on @jroweboy's work on his spdlog branch, but with modifications.
| * | | Update dynarmicYuri Kunde Schlesner2017-05-271-0/+0
|/ / / | | | | | | | | | | | | Updated to incorporate fix from MerryMage/dynarmic#106 which is required for using fmt in Citra.
* | | Merge pull request #2725 from wwylele/texture-samplerYuri Kunde Schlesner2017-05-271-40/+39
|\ \ \ | | | | | | | | gl_shader: refactor texture sampler into its own function
| * | | gl_shader: refactor texture sampler into its own functionwwylele2017-05-271-40/+39
| |/ /
* | | Merge pull request #2716 from yuriks/decentralized-resultbunnei2017-05-2633-300/+385
|\ \ \ | |/ / |/| | Decentralize ResultCode
| * | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
| | |
| * | Common: Clean up meta-template logic in BitFieldYuri Kunde Schlesner2017-05-251-3/+3
| | |
| * | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-2523-132/+178
| | |
| * | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-252-17/+23
| | |
| * | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-2510-105/+115
| | |
| * | result: Make error description a generic integerYuri Kunde Schlesner2017-05-253-6/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | It is now known that result code description vary depending on the module, and so they're best defined on a per-module basis. To support this, allow passing in an arbitrary integer instead of limiting to the ones in the ErrorDescription enum. These will be gradually migrated to their individual users, but a few will be kept as "common" codes shared by all modules.
| * | Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-252-41/+57
| | |
* | | Merge pull request #2697 from wwylele/proctexYuri Kunde Schlesner2017-05-2515-11/+1048
|\ \ \ | | | | | | | | Implemented Procedural Texture (Texture Unit 3)
| * | | gl_rasterizer: implement procedural texturewwylele2017-05-206-7/+600
| | | |
| * | | pica/swrasterizer: implement procedural texturewwylele2017-05-209-4/+448
| | | |
* | | | Merge pull request #2683 from bunnei/telemetry-frameworkbunnei2017-05-259-0/+342
|\ \ \ \ | |_|_|/ |/| | | Telemetry framework Part 1
| * | | telemetry: Log a few simple data fields throughout core.bunnei2017-05-253-1/+22
| | | |
| * | | core: Keep track of telemetry for the current emulation session.bunnei2017-05-255-0/+83
| | | |
| * | | common: Add a generic interface for logging telemetry fields.bunnei2017-05-253-0/+238
|/ / /
* | | Merge pull request #2692 from Subv/vfp_ftzSebastian Valle2017-05-222-0/+26
|\ \ \ | |_|/ |/| | Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.
| * | fixup! Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-222-4/+0
| | |
| * | Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-082-0/+30
| | | | | | | | | | | | Inputs are still not flushed to 0 if they are denormals.
* | | Merge pull request #2406 from Subv/session_disconnectYuri Kunde Schlesner2017-05-228-51/+84
|\ \ \ | | | | | | | | Kernel: Properly update port counters on session disconnection.
| * | | Kernel/Sessions: Remove the ClientSession::Create function.Subv2017-05-223-16/+3
| | | | | | | | | | | | | | | | It is not meant to be used by anything other than CreateSessionPair.
| * | | Kernel: Remove a now unused enum and variable regarding a session's status.Subv2017-05-152-8/+0
| | | |
| * | | Kernel: Use a Session object to keep track of the status of a Client/Server session pair.Subv2017-05-158-32/+86
| | | | | | | | | | | | | | | | Reduce the associated port's connection count when a ServerSession is destroyed.
* | | | Merge pull request #2694 from Subv/vfp_vsub_ftzMerry2017-05-221-2/+12
|\ \ \ \ | | | | | | | | | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.
| * | | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.Subv2017-05-141-2/+12
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were letting vadd flush the value to positive 0, but there are cases where this behavior is wrong, for example, vsub: -0 - +0 = -0 vadd: -0 + +0 = +0 Now we'll flush the value to +0 inside vsub, and then negate it.
* | | | Merge pull request #2719 from lioncash/catchYuri Kunde Schlesner2017-05-221-0/+0
|\ \ \ \ | | | | | | | | | | externals: Update catch to 1.9.4
| * | | | externals: Update catch to 1.9.4Lioncash2017-05-221-0/+0
|/ / / /
* | | | Merge pull request #2718 from citra-emu/appveyor-vs2017James Rowe2017-05-221-4/+2
|\ \ \ \ | | | | | | | | | | Upgrade AppVeyor to Visual Studio 2017
| * | | | Remove "Xamarin logspam" workaroundYuri Kunde Schlesner2017-05-221-2/+0
| | | | | | | | | | | | | | | The file does not seem to exist anymore in the VS 2017 environment.
| * | | | Upgrade AppVeyor to Visual Studio 2017Yuri Kunde Schlesner2017-05-221-3/+3
|/ / / / | | | | | | | | More C++14/17 goodness!
* | | | Merge pull request #2713 from wwylele/where-is-my-tc0_wYuri Kunde Schlesner2017-05-212-5/+8
|\ \ \ \ | | | | | | | | | | swrasterizer: add missing tc0_w attribute processing
| * | | | swrasterizer: add missing tc0_w and fragment lighting attribute processingwwylele2017-05-212-5/+8
|/ / / /
* | | | Merge pull request #2661 from Subv/uds5bunnei2017-05-195-33/+602
|\ \ \ \ | | | | | | | | | | Services/UDS: Generate 802.11 beacon frames when a network is open.
| * | | | Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| | | | |
| * | | | Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| | | | | | | | | | | | | | | | | | | | | | | | | This allows the applications to retrieve 802.11 beacon frames from nearby UDS networks. Note that the networks are still not announced anywhere.
| * | | | Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-155-7/+537
| | | | |
* | | | | Merge pull request #2710 from emmauss/ptm_ipcbunnei2017-05-193-31/+45
|\ \ \ \ \ | | | | | | | | | | | | use IPCHelper for PTM services
| * | | | | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
| | | | | |
* | | | | | Merge pull request #2709 from wwylele/pica-masked-valueYuri Kunde Schlesner2017-05-181-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | pica: use correct register value for shader bool_uniforms
| * | | | | pica: use correct register value for shader bool_uniformswwylele2017-05-171-2/+2
|/ / / / / | | | | | | | | | | | | | | | variable value is not masked. the masked and combined register value should be used instead
* | | | | Merge pull request #2703 from wwylele/pica-reg-reviseYuri Kunde Schlesner2017-05-164-17/+25
|\ \ \ \ \ | | | | | | | | | | | | pica: correct bit field length for some registers
| * | | | | pica: correct bit field length for some registerswwylele2017-05-164-17/+25
| | | | | |
* | | | | | Merge pull request #2687 from yuriks/address-mappingsYuri Kunde Schlesner2017-05-1411-80/+157
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel: Map special regions according to ExHeader
| * | | | | | Kernel: Map special regions according to ExHeaderYuri Kunde Schlesner2017-05-105-52/+105
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This replaces the hardcoded VRAM/DSP mappings with ones made based on the ExHeader ARM11 Kernel caps list. While this has no visible effect for most applications (since they use a standard set of mappings) it does improve support for system modules and n3DS exclusives.
| * | | | | | DSP: Create backing memory for entire DSP RAMYuri Kunde Schlesner2017-05-105-32/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Also move address space mapping out of video_core.
| * | | | | | Memory: Add constants for the n3DS additional RAMYuri Kunde Schlesner2017-05-102-2/+16
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | This is 4MB of extra, separate memory that was added on the New 3DS.
* | | | | | Merge pull request #2695 from JayFoxRox/gs-regsWeiyi Wang2017-05-126-70/+171
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Prepare Pica registers for Geometry Shaders
| * | | | | Pica: Write GS registersJannik Vogel2017-05-121-0/+52
| | | | | | | | | | | | | | | | | | | | | | | | This adds the handlers for the geometry shader register writes which will call the functions from the previous commit to update registers for the GS.
| * | | | | Pica: Write shader registers in functionsJannik Vogel2017-05-121-57/+103
| | | | | | | | | | | | | | | | | | | | | | | | The commit after this one adds GS register writes, so this moves the VS handlers into functions so they can be re-used and extended more easily.
| * | | | | Pica: Set program code / swizzle data limit to 4096Jannik Vogel2017-05-115-13/+16
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | One of the later commits will enable writing to GS regs. It turns out that on startup, most games will write 4096 GS program words. The current limit of 1024 would hence result in 3072 (4096 - 1024) error messages: ``` HW.GPU <Error> video_core/shader/shader.cpp:WriteProgramCode:229: Invalid GS program offset 1024 ``` New constants have been introduced to represent these limits. The swizzle data size has also been raised. This matches the given field sizes of [GPUREG_SH_OPDESCS_INDEX](https://3dbrew.org/wiki/GPU/Internal_Registers#GPUREG_SH_OPDESCS_INDEX) and [GPUREG_SH_CODETRANSFER_INDEX](https://www.3dbrew.org/wiki/GPU/Internal_Registers#GPUREG_SH_CODETRANSFER_INDEX) (12 bit = [0; 4095]).
* | | | | Merge pull request #2669 from jroweboy/async_file_watcherYuri Kunde Schlesner2017-05-113-46/+35
|\ \ \ \ \ | | | | | | | | | | | | Frontend: Prevent FileSystemWatcher from blocking UI thread
| * | | | | Frontend: Prevent FileSystemWatcher from blocking UI threadJames Rowe2017-05-103-46/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of tying the QFileSystemWatcher to the GameList and updating in the UI thread, this change moves it to the worker thread. Since it gets deleted and recreated as part of the worker thread, this prevents it from ever getting used from multiple threads (which is why it was originally done on the UI thread)
* | | | | | Merge pull request #2676 from wwylele/irrstbunnei2017-05-109-24/+208
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | ir: implement new 3ds HID via ir:rst
| * | | | | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| | | | | |
| * | | | | ir: implement new 3ds HID via ir:rstwwylele2017-05-049-24/+207
| | | | | |
* | | | | | Merge pull request #2696 from Subv/vfp_revertYuri Kunde Schlesner2017-05-093-59/+30
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Dyncom/VFP: Revert edf30d8 and fix the FPSCR getting invalid values.
| * | | | | Dyncom/VFP: Strip the VFP_NAN_FLAG sentinel value when setting vfp exceptions.Subv2017-05-092-2/+2
| | | | | |
| * | | | | Revert "Remove `exceptions` parameter from `normaliseround` VFP functions"Subv2017-05-093-57/+28
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit edf30d84cc0e8299d61c98f5bb40a6428d1576bc. Conflicts: src/core/arm/skyeye_common/vfp/vfp_helper.h src/core/arm/skyeye_common/vfp/vfpdouble.cpp src/core/arm/skyeye_common/vfp/vfpsingle.cpp
* | | | | Merge pull request #2689 from yuriks/remove-disassemblerbunnei2017-05-0823-2389/+11
|\ \ \ \ \ | |/ / / / |/| | | | Remove built-in disassembler and related code
| * | | | Dyncom: Remove disassembler codeYuri Kunde Schlesner2017-05-084-1589/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Had licensing issue around it, in addition to several bugs. Closes #1632, #1280
| * | | | Dyncom: Tweak types and log formattingYuri Kunde Schlesner2017-05-083-8/+10
| | | | |
| * | | | Remove unused symbols codeYuri Kunde Schlesner2017-05-086-124/+0
| | | | |
| * | | | Remove ability to load symbol mapsYuri Kunde Schlesner2017-05-085-55/+2
| | | | | | | | | | | | | | | | | | | | | | | | | This was now mostly unused except by thread creation, which used a symbol of the entrypoint, if available, to name the thread.
| * | | | citra-qt: Remove callstack widgetYuri Kunde Schlesner2017-05-086-168/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Appears to be currently broken, and given the complexity of doing this for ARM code without debugging information, should probably be left to an external tool or library. Use the GDB stub instead. Closes #586
| * | | | citra-qt: Remove disassembler widgetYuri Kunde Schlesner2017-05-086-448/+0
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It has performance problems, a very misleading UI, and is broken in general. It has essentially been superceded by the GDB stub, but if we wanted a built-in disassembler in the future it'd essentially need to be rewritten from scratch anyway. Closes #427, #1480
* | | | Merge pull request #2682 from nicoboss/filterYuri Kunde Schlesner2017-05-072-30/+35
|\ \ \ \ | | | | | | | | | | citra-qt: game list search function fixed minor mistakes
| * | | | Don’t focus the search field if the game is emptyNico Bosshard2017-05-061-3/+6
| | | | |
| * | | | Fixed some more typosNico Bosshard2017-05-032-4/+4
| | | | |
| * | | | citra-qt: game list search function fixed minor mistakesNico Bosshard2017-05-021-24/+26
| | | | |
* | | | | Merge pull request #2686 from wwylele/tex-coord-regYuri Kunde Schlesner2017-05-066-10/+32
|\ \ \ \ \ | | | | | | | | | | | | pica: use correct coordinates for texture 2
| * | | | | pica: shader_dirty if texture2 coord changedwwylele2017-05-055-7/+12
| | | | | |
| * | | | | pica: use correct coordinates for texture 2wwylele2017-05-034-5/+22
| |/ / / /
* | / / / Create a random console_unique_id (#2668)B3n302017-05-065-7/+123
| |/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Create a random console_id when config save_file is created Added button in system config to refresh the console unique id * Moved the connect for the button from .ui file to constructor of ConfigureSystem * Added warning and info dialog Fixup: Make use of qt5 style connects, renamed the refresh button, removed some duplicate code, changed random device and moved all to the generate function * Changed the random generator to reflect what a real 3DS stores as console unique id Fixup: Changed the warning message * Fixup: Set and Create * Fixup: Added console id label, therfore removed second message box * Fixup: fixed the endianess * Fixup: more endianness fixes * Fixup: Endianness the 3rd
* | | | Merge pull request #2606 from wwylele/irbunnei2017-05-047-51/+762
|\ \ \ \ | |/ / / |/| | | ir: implement circle pad pro
| * | | ir: implement circle pad prowwylele2017-05-036-44/+761
| | | |
| * | | qt: enable config for circle pad prowwylele2017-04-091-7/+1
| | | |
* | | | citra-qt: game list search function (#2673)Nico Bosshard2017-04-307-19/+299
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * citra-qt: game list search function * Empty search field during game list refresh * Code improvements * Code formatting * Autofocus search field * JayFoxRox's recommendations * lioncash's review
* | | | Merge pull request #2671 from wwylele/dot3-rgbabunnei2017-04-214-22/+39
|\ \ \ \ | | | | | | | | | | rasterizer: implement combiner operation 7 (Dot3_RGBA)
| * | | | gl_shader_gen: remove TODO about Lerp behaviour verification. The implementation is verified against hardwarewwylele2017-04-201-2/+0
| | | | |
| * | | | rasterizer: implement combiner operation 7 (Dot3_RGBA)wwylele2017-04-194-20/+39
| | |_|/ | |/| |
* | | | Merge pull request #2666 from yuriks/gl-cleanupsYuri Kunde Schlesner2017-04-205-214/+215
|\ \ \ \ | | | | | | | | | | PicaShaderConfig cleanups
| * | | | OpenGL: Pass Pica regs via parameterYuri Kunde Schlesner2017-04-173-7/+5
| | | | |
| * | | | OpenGL: Move PicaShaderConfig to gl_shader_gen.hYuri Kunde Schlesner2017-04-174-202/+206
| | | | | | | | | | | | | | | | | | | | Also move the implementation of CurrentConfig to the cpp file.
| * | | | OpenGL: Move Attributes enum to a more appropriate fileYuri Kunde Schlesner2017-04-173-12/+11
| |/ / /
* | | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \ \ | | | | | | | | | | ldr_ro: use IPC helper
| * | | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| | |/ / | |/| |
* | | | Merge pull request #2667 from wwylele/button_from_axisbunnei2017-04-182-4/+59
|\ \ \ \ | |_|/ / |/| | | input_common/sdl: add support for binding button to axis
| * | | input_common/sdl: add support for binding button to axiswwylele2017-04-172-4/+59
|/ / /
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \ | | | | | | | | dsp_dsp: Messages are modified by service before being sent to DSP
| * | | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
| | | |
* | | | Better looking status bar under Linux Ubuntu (#2662)Cereal-Killa2017-04-131-0/+1
| |_|/ |/| | | | | | | | | | | * Remove borders from status bar items On Ubuntu the status bar didn't look as good as on Windows due to some border being drawn around each status bar cell.
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \ | | | | | | | | Services/UDS: Initial support for hosting local-wlan networks.
| * | | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| | | |
| * | | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| | | |
| * | | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| | | |
| * | | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| | | |
| * | | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| | | |
| * | | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| | | | | | | | | | | | | | | | It will be needed when generating the beacon frames.
| * | | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
| | | | | | | | | | | | | | | | Currently it will let games create a network as hosts, but will not broadcast it anywhere and will not allow clients to connect.
* | | | Merge pull request #2658 from JayFoxRox/blend-equation-fixJames Rowe2017-04-091-2/+2
|\ \ \ \ | |_|_|/ |/| | | Pica/Regs: Correct bit width for blend-equations
| * | | Pica/Regs: Correct bit width for blend-equationsJannik Vogel2017-04-081-2/+2
|/ / /
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-066-257/+386
|\ \ \ | | | | | | | | IpcHelper enhancement and APT refactor
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| | | |
| * | | address more commentsLectem2017-03-191-20/+20
| | | |
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| | | |
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-183-38/+46
| | | |
| * | | fix #2560 and other commentsLectem2017-03-183-22/+22
| | | |
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-184-55/+114
| | | |
| * | | refactor APT service to use the new IPC helpersLectem2017-03-184-195/+258
| | | |
* | | | Merge pull request #2634 from wwylele/batterybunnei2017-04-062-1/+16
|\ \ \ \ | | | | | | | | | | shared_page: stub battery state
| * | | | shared_page: stub battery statewwylele2017-03-212-1/+16
| | | | |
* | | | | Merge pull request #2651 from jroweboy/configmovedMat M2017-04-0425-41/+41
|\ \ \ \ \ | | | | | | | | | | | | citra-qt: Move config dialog code to its own directory
| * | | | | citra-qt: Move config dialog code to its own directoryLioncash2017-04-0425-41/+41
|/ / / / /
* | | | | Merge pull request #2622 from jfmherokiller/socufixbunnei2017-04-041-39/+32
|\ \ \ \ \ | | | | | | | | | | | | error conversion fixes for soc_u
| * | | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
|/ / / / /
* | | | | Merge pull request #2648 from mtheall/masterbunnei2017-04-032-4/+4
|\ \ \ \ \ | | | | | | | | | | | | Fix OutputDebugString syscall
| * | | | | Fix OutputDebugString syscallMichael Theall2017-04-012-4/+4
|/ / / / /
* | | | | Merge pull request #2639 from wwylele/fix-ptm-fsbunnei2017-03-251-1/+1
|\ \ \ \ \ | | | | | | | | | | | | ptm: create SharedExtSave file before openning it
| * | | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
|/ / / / /
* | | | | Merge pull request #2512 from SonofUgly/custom-layoutbunnei2017-03-229-13/+104
|\ \ \ \ \ | |/ / / / |/| | | | Add custom layout settings.
| * | | | Add custom layout settings.SonofUgly2017-02-239-13/+104
| | | | |
* | | | | Removed a linebreak from the README.Christopher J. Gilbert2017-03-211-1/+0
| | | | |
* | | | | Adding a linebreak to the README file.Christopher J. Gilbert2017-03-211-0/+1
| | | | |
* | | | | Merge pull request #2630 from wwylele/qt-focus-loss-2bunnei2017-03-205-3/+18
|\ \ \ \ \ | | | | | | | | | | | | Qt: Release all pressed buttons when window focus is lost [rebased]
| * | | | | citra-qt: remove dead codewwylele2017-03-173-5/+0
| | | | | |
| * | | | | citra-qt: release all buttons when render window focus is lostwwylele2017-03-174-0/+20
| | |/ / / | |/| | | | | | | | | | | | | credit to @Hawkheart for the original idea
* | | | | Merge pull request #2631 from wwylele/fix-unwrapWeiyi Wang2017-03-181-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | apt: fix RequestBuilder parameters for Unwrap
| * | | | apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
|/ / / /
* | | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-1740-574/+1244
|\ \ \ \ | | | | | | | | | | Refactor input emulation & add SDL gamepad support
| * | | | qt/config_input: don't connect for null buttonwwylele2017-03-021-4/+7
| | | | |
| * | | | citra: update default ini with new input systemwwylele2017-03-011-28/+41
| | | | |
| * | | | Input: remove unused stuff & clean upwwylele2017-03-019-412/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 1. removed zl, zr and c-stick from HID::PadState. They are handled by IR, not HID 2. removed button handling in EmuWindow 3. removed key_map 4. cleanup #include
| * | | | Qt: rework input configuration for new input systemwwylele2017-03-012-68/+144
| | | | |
| * | | | InputCommon: add SDL joystick supportwwylele2017-03-014-0/+241
| | | | |
| * | | | InputCommon: add AnalogFromButtonwwylele2017-03-018-0/+162
| | | | |
| * | | | InputCommon: add Keyboardwwylele2017-03-0117-85/+254
| | | | |
| * | | | HID: use AnalogDevicewwylele2017-03-013-2/+30
| | | | |
| * | | | HID: use ButtonDevicewwylele2017-03-015-1/+100
| | | | |
| * | | | Input: add device and factory templatewwylele2017-03-014-0/+100
| | | | |
| * | | | Common: add ParamPackagewwylele2017-03-015-0/+188
| | | | |
* | | | | Merge pull request #2618 from wwylele/log-less-filenamebunnei2017-03-177-17/+20
|\ \ \ \ \ | | | | | | | | | | | | Reduce host file name and path logging
| * | | | | file_util: Log when using local user directorywwylele2017-03-111-0/+2
| | | | | |
| * | | | | file_sys: lower log level for setting host pathwwylele2017-03-084-4/+4
| | | | | |
| * | | | | file_util: lower logging level for harmless caseswwylele2017-03-081-9/+7
| | | | | |
| * | | | | loader/ncch: less verbose log for loading game list. only log program ID when bootingwwylele2017-03-081-3/+6
| | | | | |
| * | | | | loader: lower file name logging levelwwylele2017-03-081-1/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #2468 from Kloen/xamarin-pls-stopbunnei2017-03-161-0/+2
|\ \ \ \ \ | | | | | | | | | | | | appveyor: workaround for unnecesary Xamarin log spam
| * | | | | appveyor: workaround for unnecesary Xamarin log spamKloen2017-01-231-0/+2
| | | | | |
* | | | | | Merge pull request #2620 from FernandoS27/syscore_errorbunnei2017-03-161-5/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | Refined thread launch on syscore error messages
| * | | | | | Refined thread launch on syscore error messagesFernando Sahmkow2017-03-091-5/+15
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2625 from wwylele/hash-console-uniquebunnei2017-03-161-7/+24
|\ \ \ \ \ \ | | | | | | | | | | | | | | cfg: correctly implement GenHashConsoleUnique
| * | | | | | cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
| |/ / / / /
* | | | | | Merge pull request #2626 from yuriks/msvc2017bunnei2017-03-162-5/+7
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Fix building with MSVC 2017
| * | | | | externals: Update to boost v1.63.0Yuri Kunde Schlesner2017-03-131-0/+0
| | | | | |
| * | | | | common/cpu_detect: Add missing include and fix namespace scopeYuri Kunde Schlesner2017-03-131-5/+7
|/ / / / /
* | | | | Merge pull request #2614 from Schplee/patch-1Christopher J. Gilbert2017-03-061-2/+1
|\ \ \ \ \ | | | | | | | | | | | | Fixes typo on Citra forum link.
| * | | | | Fixes typo on Citra forum link.Schplee2017-03-061-2/+1
| | |/ / / | |/| | | | | | | | An extra ".citra-emu.org," was left when the link was changed to the current forum URL, so I fixed that.
* | | | | Merge pull request #2615 from Schplee/patch-2Christopher J. Gilbert2017-03-061-2/+2
|\ \ \ \ \ | |/ / / / |/| | | | New website link updates.
| * | | | New website link updates.Schplee2017-03-061-2/+2
|/ / / / | | | | | | | | Fixed the broken links that were a result of the updated website.
* | | | Merge pull request #2603 from wwylele/please-signalbunnei2017-02-271-0/+2
|\ \ \ \ | | | | | | | | | | Timer: restore missing signaled=true from #2421
| * | | | Timer: restore missing signaled=true from #2421wwylele2017-02-271-0/+2
|/ / / /
* | | | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \ \ \ | | | | | | | | | | IR: separate functions of each port to their own files
| * | | | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
| | | | |
* | | | | Fix log entry in timer::signal (#2600)B3n302017-02-271-1/+1
| | | | |
* | | | | Doxygen: Amend minor issues (#2593)Mat M2017-02-2718-23/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects a few issues with regards to Doxygen documentation, for example: - Incorrect parameter referencing. - Missing @param tags. - Typos in @param tags. and a few minor other issues.
* | | | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-2728-449/+321
|\ \ \ \ \ | | | | | | | | | | | | Replace built-in Profiler with indicators in status bar
| * | | | | PerfStats: Re-order and document members betterYuri Kunde Schlesner2017-02-272-5/+14
| | | | | |
| * | | | | Qt: Tweak status bar stylingYuri Kunde Schlesner2017-02-271-0/+2
| | | | | |
| * | | | | Qt: Increase status bar update interval to 2 secondsYuri Kunde Schlesner2017-02-271-1/+1
| | | | | |
| * | | | | Core: Re-write frame limiterYuri Kunde Schlesner2017-02-275-42/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now based on std::chrono, and also works in terms of emulated time instead of frames, so we can in the future frame-limit even when the display is disabled, etc. The frame limiter can also be enabled along with v-sync now, which should be useful for those with displays running at more than 60 Hz.
| * | | | | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-277-16/+25
| | | | | | | | | | | | | | | | | | | | | | | | More ergonomic to use and will be required for upcoming changes.
| * | | | | Qt: Add tooltips to status bar displaysYuri Kunde Schlesner2017-02-271-0/+7
| | | | | |
| * | | | | Qt: Don't show fractional figures in the status barYuri Kunde Schlesner2017-02-271-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | They're not very important and this makes the display changes less often, making it less distracting.
| * | | | | Remove built-in (non-Microprofile) profilerYuri Kunde Schlesner2017-02-279-382/+2
| | | | | |
| * | | | | PerfStats: Add method to get the instantaneous time ratioYuri Kunde Schlesner2017-02-273-7/+22
| | | | | |
| * | | | | Add performance statistics to status barYuri Kunde Schlesner2017-02-2711-3/+159
| | | | | |
| * | | | | SynchronizedWrapper: Add Lock convenience methodYuri Kunde Schlesner2017-02-271-18/+25
| | | | | |
| * | | | | Qt: Add (empty) status barYuri Kunde Schlesner2017-02-276-1/+35
| | | | | |
| * | | | | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-274-1/+3
| | | | | |
* | | | | | Merge pull request #2595 from jroweboy/patchbunnei2017-02-251-1/+3
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Change travis tar command to specify compression format
| * | | | | Change travis tar command to specify compression formatJames Rowe2017-02-251-1/+3
|/ / / / / | | | | | | | | | | | | | | | | | | | | macOS uses bsdtar which doesn't have the -a flag which determines compression based on file extension.
* | | | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-2517-14/+568
|\ \ \ \ \ | | | | | | | | | | | | APT: implemented Wrap and Unwrap
| * | | | | externals: remove -march=native for crypto++wwylele2017-02-211-8/+1
| | | | | |
| * | | | | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
| | | | | |
| * | | | | HW: add AES engine & implement AES-CCMwwylele2017-02-2112-0/+418
| | | | | |
* | | | | | Merge pull request #2421 from Subv/timersYuri Kunde Schlesner2017-02-253-16/+36
|\ \ \ \ \ \ | | | | | | | | | | | | | | Timers: Immediately signal the timer if it was started with an initial value of 0
| * | | | | | Timers: Return an error when calling SetTimer with negative timeouts.Subv2017-02-221-0/+5
| | | | | | |
| * | | | | | Timers: Immediately signal the timer if it was started with an initial value of 0.Subv2017-02-222-16/+31
| | | | | | |
* | | | | | | Fixes file upload pattern in the travis.yml to include macOS releases (#2592)James Rowe2017-02-251-2/+2
| | | | | | |
* | | | | | | Merge pull request #2590 from jroweboy/mac-gzipYuri Kunde Schlesner2017-02-241-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Use gzip instead of lzma on macOS releases
| * | | | | | | Revert use gzip for linuxJames Rowe2017-02-231-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | Uses tar -a flag to determine compression algorithm based off file extension (so linux will continue to use xz and macOS can use gzip)
| * | | | | | | Use gzip instead of lzma on macOS and linux releasesJames Rowe2017-02-231-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A common report from macOS users is they can't figure out how to unzip the program. This will allow them to double click to unzip the archive which is what users on macOS expect.
* | | | | | | | Use QFileSystemWatcher to reload the game list when a change is detected. (#2555)James Rowe2017-02-232-1/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added a refresh game directory option to the file menu * Make the game list watcher recursive and have it start watching from the initial load * Rework game list watcher to be thread safe * Fix code style issues
* | | | | | | | Merge pull request #2441 from jroweboy/titlebarbunnei2017-02-236-5/+32
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Gui: Change title bar to include build name
| * | | | | | | Gui: Change title bar to include build nameJames Rowe2017-02-236-5/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nightly builds now have "Citra Nightly" in the titlebar Bleeding edge builds now have "Citra Bleeding Edge" in the titlebar
* | | | | | | | [UI] Modify recursive scanning label (#2589)Anthony2017-02-231-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #2579 from wwylele/no-clang-format-checkbunnei2017-02-211-17/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hook: remove clang-format check
| * | | | | | | hook: remove clang-format checkwwylele2017-02-171-17/+0
| | | | | | | |
* | | | | | | | Merge pull request #2585 from MerryMage/sxtb16-sxtab16bunnei2017-02-201-4/+4
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | dyncom: Correct SXTAB16 and SXTB16
| * | | | | | | dyncom: Correct SXTAB16 and SXTB16MerryMage2017-02-181-4/+4
| | | | | | | |
* | | | | | | | Merge pull request #2580 from yuriks/qt-cleanup2Yuri Kunde Schlesner2017-02-194-96/+83
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | Qt cleanups 2
| * | | | | | | Qt: Move some connections from .ui file to codeYuri Kunde Schlesner2017-02-182-38/+3
| | | | | | | |
| * | | | | | | Qt: Reorganize connection of menu eventsYuri Kunde Schlesner2017-02-182-13/+23
| | | | | | | |
| * | | | | | | Qt: Re-organize setup of debugging widgetsYuri Kunde Schlesner2017-02-184-39/+51
| | | | | | | |
| * | | | | | | Qt: Fix action name to match conventionsYuri Kunde Schlesner2017-02-182-6/+6
| | | | | | | |
* | | | | | | | OpenGL: Check if uniform block exists before updating it (#2581)Jannik Vogel2017-02-181-29/+30
| | | | | | | |
* | | | | | | | dynarmic: Update the submodule.Emmanuel Gil Peyrot2017-02-181-0/+0
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes a build issue on gcc 6 due to -Werror and a warning caused by boost::optional, see: https://github.com/MerryMage/dynarmic/issues/83
* | | | | | | Merge pull request #2577 from yuriks/qt-cleanupYuri Kunde Schlesner2017-02-182-23/+19
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Qt cleanup
| * | | | | | Qt: Make IsSingleFileDropEvent staticYuri Kunde Schlesner2017-02-181-1/+1
| | | | | | |
| * | | | | | Qt: Allow any file extension in Open dialogYuri Kunde Schlesner2017-02-181-2/+3
| | | | | | |
| * | | | | | Qt: Remove orpahned function declarationYuri Kunde Schlesner2017-02-181-6/+0
| | | | | | |
| * | | | | | Qt: Remove unnecessary std::string usageYuri Kunde Schlesner2017-02-182-14/+15
|/ / / / / /
* | | | | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
| | | | | | | | | | | | | | | | | | Fixes #2556
* | | | | | Merge pull request #2573 from jfmherokiller/dragndropbunnei2017-02-172-1/+41
|\ \ \ \ \ \ | | | | | | | | | | | | | | Added drag and drop feature to the code
| * | | | | | added drag n drop featurenoah the goodra2017-02-162-1/+41
|/ / / / / /
* | | | | | Merge pull request #2571 from wwylele/missing-fileMat M2017-02-151-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: add missing errors.h in CMakeLists.txt
| * | | | | | core: add missing errors.h in CMakeLists.txtwwylele2017-02-151-0/+1
| | | | | | |
* | | | | | | video_core: remove #pragma once in cpp file (#2570)Weiyi Wang2017-02-152-4/+0
|/ / / / / /
* | | | | | Merge pull request #2566 from yuriks/file-extension-suffixWeiyi Wang2017-02-141-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Qt/GameList: Use suffix() to parse the file extension
| * | | | | | Qt/GameList: Use suffix() to parse the file extensionYuri Kunde Schlesner2017-02-141-1/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | completeSuffix returns everything after the first period, which means that a file such as `foo.bar.3ds` would not get recognized.
* | | | | | HLE/IPC: Fix uninitialized variables in helpers (#2568)Yuri Kunde Schlesner2017-02-141-3/+3
| | | | | | | | | | | | | | | | | | Fixes #2567
* | | | | | Merge pull request #2542 from jfmherokiller/httpsvclogYuri Kunde Schlesner2017-02-144-2/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | | added http service enum to the log.h file
| * | | | | applied the change suggested by @wwylelenoah the goodra2017-02-141-0/+1
| | | | | |
| * | | | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
| | | | | |
| * | | | | turned clang format back onnoah the goodra2017-02-141-1/+1
| | | | | |
| * | | | | added http service enum to the log.h filenoah the goodra2017-02-141-0/+1
|/ / / / /
* | | | | Merge pull request #2562 from yuriks/pica-refactor3Yuri Kunde Schlesner2017-02-1312-563/+661
|\ \ \ \ \ | | | | | | | | | | | | Re-organize software rasterizer code
| * | | | | SWRasterizer: Move more framebuffer functions to fileYuri Kunde Schlesner2017-02-133-100/+105
| | | | | |
| * | | | | SWRasterizer: Move texturing functions to their own fileYuri Kunde Schlesner2017-02-134-210/+259
| | | | | |
| * | | | | SWRasterizer: Convert large no-capture lambdas to standalone functionsYuri Kunde Schlesner2017-02-131-315/+310
| | | | | |
| * | | | | SWRasterizer: Move framebuffer operation functions to their own fileYuri Kunde Schlesner2017-02-134-236/+285
| | | | | |
| * | | | | VideoCore: Move software rasterizer files to sub-directoryYuri Kunde Schlesner2017-02-138-12/+12
| | | | | |
* | | | | | Core: add cryptopp library (#2412)Weiyi Wang2017-02-135-1/+176
| | | | | |
* | | | | | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-139-60/+295
|\ \ \ \ \ \ | |/ / / / / |/| | | | | file_sys: change RomFS archive to Self NCCH archive
| * | | | | loader: use self NCCH archivewwylele2017-02-136-90/+7
| | | | | |
| * | | | | file_sys: add Self NCCH archivewwylele2017-02-135-0/+318
| |/ / / /
* | | | | video_core/shader: Document sanitized MUL operationYuri Kunde Schlesner2017-02-121-0/+8
| | | | |
* | | | | Merge pull request #2550 from yuriks/pica-refactor2Yuri Kunde Schlesner2017-02-1219-140/+133
|\ \ \ \ \ | | | | | | | | | | | | Small VideoCore cleanups
| * | | | | VideoCore: Split u64 Pica reg unions into 2 separate u32 unionsYuri Kunde Schlesner2017-02-091-36/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This eliminates UB when aliasing it with the array of u32 regs, and is compatible with non-LE architectures.
| * | | | | VideoCore: Force enum sizes to u32 in LightingRegsYuri Kunde Schlesner2017-02-091-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All enums that are used with BitField must have their type forced to u32 to ensure correctness.
| * | | | | OpenGL: Remove unused duplicate of IsPassThroughTevStageYuri Kunde Schlesner2017-02-091-12/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This copy was left behind when the shader generation code was moved to a separate file.
| * | | | | VideoCore: Split regs.h inclusionsYuri Kunde Schlesner2017-02-0914-25/+47
| | | | | |
| * | | | | Pica/Regs: Use binary search to look up reg namesYuri Kunde Schlesner2017-02-093-16/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This gets rid of the static unordered_map. Also changes the return type const char*, avoiding unnecessary allocations (the result was only used by calling .c_str() on it.)
| * | | | | VideoCore: Use union to index into Regs structYuri Kunde Schlesner2017-02-092-46/+28
| |/ / / / | | | | | | | | | | | | | | | Also remove some unused members.
* | | | | citra-qt: Don't attempt to scan files with unsupported extensions (#2402)Kloen Lansfiel2017-02-123-4/+20
| | | | |
* | | | | core: Free AppLoader on shutdown to release file (#2558)Yuri Kunde Schlesner2017-02-111-9/+2
| | | | | | | | | | | | | | | Fixes #2455
* | | | | hid: remove the touch field from PadState (#2557)Weiyi Wang2017-02-112-6/+0
| | | | |
* | | | | video_core: Fix benign out-of-bounds indexing of array (#2553)Yuri Kunde Schlesner2017-02-111-2/+1
|/ / / / | | | | | | | | | | | | | | | | | | | | The resulting pointer wasn't written to unless the index was verified as valid, but that's still UB and triggered debug checks in MSVC. Reported by garrettboast on IRC
* | | | Merge pull request #2482 from yuriks/pica-refactorYuri Kunde Schlesner2017-02-0937-2427/+2635
|\ \ \ \ | | | | | | | | | | Split up monolithic Regs struct
| * | | | VideoCore: Move Regs to its own fileYuri Kunde Schlesner2017-02-0426-662/+681
| | | | |
| * | | | VideoCore: Split shader regs from Regs structYuri Kunde Schlesner2017-02-049-102/+116
| | | | |
| * | | | VideoCore: Split geometry pipeline regs from Regs structYuri Kunde Schlesner2017-02-049-264/+292
| | | | |
| * | | | VideoCore: Split lighting regs from Regs structYuri Kunde Schlesner2017-02-046-312/+341
| | | | |
| * | | | VideoCore: Split framebuffer regs from Regs structYuri Kunde Schlesner2017-02-0411-457/+503
| | | | |
| * | | | VideoCore: Split texturing regs from Regs structYuri Kunde Schlesner2017-02-0417-507/+548
| | | | |
| * | | | VideoCore: Split rasterizer regs from Regs structYuri Kunde Schlesner2017-02-0414-188/+219
| | | | |
* | | | | Merge pull request #2539 from Kloen/re-killing-warningsbunnei2017-02-061-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: nihstro, update to latest master. Again.
| * | | | | externals: nihstro, update to latest masterKloen2017-02-061-0/+0
|/ / / / /
* | | | | Merge pull request #2534 from Lectem/fix_etc1_msvc15Mat M2017-02-051-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Use std::array<u8,2> instead of u8[2] to fix MSVC build
| * | | | | Use std::array<u8,2> instead of u8[2] to fix MSVC buildLectem2017-02-051-1/+1
|/ / / / /
* | | | | Merge pull request #2027 from Lectem/ipcrefactorWeiyi Wang2017-02-056-68/+364
|\ \ \ \ \ | | | | | | | | | | | | IPC helper
| * | | | | fix wwylele's comment and use typename in templatesLectem2017-02-051-4/+4
| | | | | |
| * | | | | fix comments alignmentLectem2016-12-301-22/+22
| | | | | |
| * | | | | move Pop methods out of class bodyLectem2016-12-261-72/+88
| | | | | |
| * | | | | IPC helpers exampleLectem2016-12-263-35/+40
| | | | | |
| * | | | | IPC helpersLectem2016-12-263-48/+323
| | | | | |
* | | | | | Fix Microprofile in MinGW (#2530)Fernando Sahmkow2017-02-052-3/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #2476 from yuriks/shader-refactor3Yuri Kunde Schlesner2017-02-0420-181/+185
|\ \ \ \ \ | | | | | | | | | | | | Oh No! More shader changes!
| * | | | | VideoCore: Make PrimitiveAssembler const-correctYuri Kunde Schlesner2017-01-302-3/+4
| | | | | |
| * | | | | VideoCore: Extract swrast-specific data from OutputVertexYuri Kunde Schlesner2017-01-305-58/+64
| | | | | |
| * | | | | VideoCore/Shader: Clean up OutputVertex::FromAttributeBufferYuri Kunde Schlesner2017-01-302-10/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also fixes a long-standing but neverthless harmless memory corruption bug, whech the padding of the OutputVertex struct would get corrupted by unused attributes.
| * | | | | Common: Optimize BitSet iteratorYuri Kunde Schlesner2017-01-301-14/+19
| | | | | |
| * | | | | VideoCore: Split shader output writing from semantic loadingYuri Kunde Schlesner2017-01-303-24/+24
| | | | | |
| * | | | | VideoCore: Consistently use shader configuration to load attributesYuri Kunde Schlesner2017-01-307-47/+26
| | | | | |
| * | | | | VideoCore: Use correct register for immediate mode attribute countYuri Kunde Schlesner2017-01-302-7/+13
| | | | | |
| * | | | | VideoCore: Rename some types to more accurate namesYuri Kunde Schlesner2017-01-3010-21/+21
| | | | | |
| * | | | | VideoCore: Change misleading register namesYuri Kunde Schlesner2017-01-304-8/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A few registers had names such as "count" or "number" when they actually contained the maximum (that is, count - 1). This can easily lead to hard to notice off by one errors.
* | | | | | Merge pull request #2414 from yuriks/texture-decodeYuri Kunde Schlesner2017-02-0412-318/+482
|\ \ \ \ \ \ | | | | | | | | | | | | | | Texture decoding cleanups
| * | | | | | Pica/Texture: Move part of ETC1 decoding to new file and cleanupsYuri Kunde Schlesner2017-02-044-110/+159
| | | | | | |
| * | | | | | Pica/Texture: Simplify/cleanup texture tile addressingYuri Kunde Schlesner2017-02-045-44/+117
| | | | | | |
| * | | | | | VideoCore: Move LookupTexture out of debug_utils.hYuri Kunde Schlesner2017-02-049-308/+350
| | | | | | |
* | | | | | | changed the WIN32 macro in microprofileui (#2528)noah the goodra2017-02-041-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | I changed the macro in microprofileui.h from WIN32 to _WIN32 so that it would correctly dectect that its being compiled on a windows platform
* | | | | | Merge pull request #2496 from mailwl/cfg-memYuri Kunde Schlesner2017-02-041-5/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | Core: update Kernel Config Memory to latest version (11.2)
| * | | | | | Core: update Kernel Config Memory to latest version (11.2)mailwl2017-01-301-5/+8
| | | | | | |
* | | | | | | Merge pull request #2520 from wwylele/shader-stack-boundaryYuri Kunde Schlesner2017-02-041-2/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ShaderJIT: add 16 dummy bytes at the bottom of the stack
| * | | | | | | ShaderJIT: add 16 dummy bytes at the bottom of the stackwwylele2017-02-031-2/+5
| | | | | | | |
* | | | | | | | Merge pull request #2518 from MerryMage/coprocYuri Kunde Schlesner2017-02-047-15/+140
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | arm_dynarmic: Coprocessor support
| * | | | | | | | arm_dynarmic: Update memory interfaceMerryMage2017-02-032-10/+10
| | | | | | | | |
| * | | | | | | | arm_dynarmic: CP15 supportMerryMage2017-02-037-5/+130
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Merge pull request #2509 from jfmherokiller/settingscastpatchbunnei2017-02-031-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | removed the possibly uneeded cast on values.gdbstub_port
| * | | | | | | | removed the possibly uneeded cast on values.gdbstub_portnoah the goodra2017-01-311-1/+1
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | as far as i could tell this cast is unneeded because [GDBStub::SetServerPort](https://github.com/citra-emu/citra/blob/master/src/core/gdbstub/gdbstub.cpp#L897) takes a u16 and [values.gdbstub_port](https://github.com/citra-emu/citra/blob/master/src/core/settings.h#L116) is already a u16
* | | | | | | | Merge pull request #2507 from jfmherokiller/keyidchangebunnei2017-02-031-1/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | removal of the -1 case in the configure_input switch
| * | | | | | | | removal of the -1 case in the configure_input switchnoah the goodra2017-01-311-1/+0
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | this case is unneeded because no enumeration value can possibly correspond to it
* / / / / / / / GSP_GPU::StoreDataCache stubbed (#2428)mailwl2017-02-031-1/+28
|/ / / / / / /
* | | | | | | HLE/Applets: Stub Mint (eShop) Applet (#2463)mailwl2017-01-314-0/+108
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows Phoenix Wright - Dual Destinies to boot.
* | | | | | | Common/x64: remove legacy emitter and abi (#2504)Weiyi Wang2017-01-316-4202/+1
| | | | | | | | | | | | | | | | | | | | | These are not used any more since we moved shader JIT to xbyak.
* | | | | | | shader_jit_x64_compiler: esi and edi should be persistent (#2500)Merry2017-01-311-0/+2
| | | | | | |
* | | | | | | file_util: Fixed implicit type conversion warning (#2503)noah the goodra2017-01-311-2/+2
|/ / / / / /
* / / / / / Support looping HLE audio (#2422)Jake Merdich2017-01-302-11/+35
|/ / / / / | | | | | | | | | | | | | | | | | | | | * Support looping HLE audio * DSP: Fix dirty bit clears, handle nonmonotonically incrementing IDs * DSP: Add start offset support
* | | | | Merge pull request #2368 from wwylele/camera-2Yuri Kunde Schlesner2017-01-3014-172/+1520
|\ \ \ \ \ | | | | | | | | | | | | CAM: build the service framework with a dummy implementation
| * | | | | CAM: implement basic camera functions with a blank camerawwylele2017-01-1114-172/+1520
| | |/ / / | |/| | |
* | | | | Merge pull request #2429 from wwylele/auto-language-fixYuri Kunde Schlesner2017-01-301-36/+38
|\ \ \ \ \ | | | | | | | | | | | | CFG: move language override to the boot process
| * | | | | CFG: override language setting on bootwwylele2017-01-191-36/+38
| | | | | |
* | | | | | Merge pull request #2495 from Kloen/killing-warnings-chain-of-memoriesYuri Kunde Schlesner2017-01-302-3/+0
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | video_core: Removed unused type alias
| * | | | | video_core: gl_rasterizer_cache.cpp removed unused type aliasKloen2017-01-301-1/+0
| | | | | |
| * | | | | video_core: gl_rasterizer.cpp removed unused type aliasKloen2017-01-301-2/+0
|/ / / / /
* | | | | Merge pull request #2494 from Kloen/killing-warnings-2-final-mixYuri Kunde Schlesner2017-01-301-1/+1
|\ \ \ \ \ | | | | | | | | | | | | core: inline CPU, 132 warnings fixed on GCC
| * | | | | core: inline CPU, 132 warnings fixed on GCCKloen2017-01-301-1/+1
| | | | | |
* | | | | | Merge pull request #2492 from Kloen/killing-warnings-HD1.5ReMIXYuri Kunde Schlesner2017-01-305-0/+48
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fix OSX build warnings about unhandled enumeration values.
| * | | | | | citra: add missing control paths for ResultStatus on rom load. Fix warning about unhandled enumeration values on OSXKloen2017-01-291-0/+20
| | | | | | |
| * | | | | | core: fix err_f.cpp warning about unhandled enumeration value on OSXKloen2017-01-291-0/+2
| | | | | | |
| * | | | | | core: fix savedata_archive.cpp warnings about unhandled enumeration values on OSXKloen2017-01-291-0/+12
| | | | | | |
| * | | | | | core: fix archive_sdmc.cpp warnings about unhandled enumeration value on OSXKloen2017-01-291-0/+12
| | | | | | |
| * | | | | | core: fix archive_extsavedata.cpp warning on OSXKloen2017-01-291-0/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2493 from Kloen/killing-warnings-final-mixYuri Kunde Schlesner2017-01-301-0/+7
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | video_core: silence unused-local-typedef boost related warnings on GCC
| * | | | | video_core: silence unused-local-typedef boost related warning on GCCKloen2017-01-291-0/+7
| |/ / / /
* | | | | Merge pull request #2491 from Kloen/killing-warnings-2.5HDRemixYuri Kunde Schlesner2017-01-291-6/+6
|\ \ \ \ \ | |/ / / / |/| | | | core: emu_window.cpp, fix conversion warnings from float to s16 on MSVC
| * | | | core: emu_window.cpp, fix conversion warnings from float to s16 on MSVCKloen2017-01-291-6/+6
|/ / / /
* | | | Merge pull request #2485 from Kloen/killing-warnings-computehash64Yuri Kunde Schlesner2017-01-282-6/+7
|\ \ \ \ | | | | | | | | | | Switch ComputeHash64 len param to size_t instead of int
| * | | | common: add <cstddef> to hash.hKloen2017-01-281-0/+1
| | | | |
| * | | | common: switch ComputeHash64 len param to size_t instead of int, fix warning on MSVC on dsp_dsp.cppKloen2017-01-282-6/+6
| | | | |
* | | | | Merge pull request #2484 from Kloen/killing-warnings-nihstroYuri Kunde Schlesner2017-01-281-0/+0
|\ \ \ \ \ | |/ / / / |/| | | | Updated nihstro to latest master. Fix warning on MSVC
| * | | | externals: Updated nihstro to latest master. Fix warning on MSVCKloen2017-01-281-0/+0
|/ / / /
* | | | Merge pull request #2478 from jfmherokiller/masterJames Rowe2017-01-271-1/+1
|\ \ \ \ | | | | | | | | | | fixed the override warning
| * | | | fixed the override warningnoah the goodra2017-01-271-1/+1
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ``` In file included from citra/src/audio_core/sink_details.cpp:11: citra/src/./audio_core/sdl2_sink.h:25:10: warning: 'SetDevice' overrides a member function but is not marked 'override' [-Winconsistent-missing-override] void SetDevice(int device_id); ^ citra/src/./audio_core/sink.h:39:18: note: overridden virtual function is here virtual void SetDevice(int device_id) = 0; ^ ```
* | | | Merge pull request #2346 from yuriks/shader-refactor2Yuri Kunde Schlesner2017-01-2713-1110/+1189
|\ \ \ \ | | | | | | | | | | More shader refactoring
| * | | | VideoCore/Shader: Move entry_point to SetupBatchYuri Kunde Schlesner2017-01-267-29/+29
| | | | |
| * | | | VideoCore/Shader: Move per-batch ShaderEngine state into ShaderSetupYuri Kunde Schlesner2017-01-267-46/+43
| | | | |
| * | | | Shader: Remove OutputRegisters structYuri Kunde Schlesner2017-01-264-22/+17
| | | | |
| * | | | Shader: Initialize conditional_code in interpreterYuri Kunde Schlesner2017-01-262-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't belong in LoadInputVertex because it also happens for non-VS invocations. Since it's not used by the JIT it seems adequate to initialize it in the interpreter which is the only thing that cares about them.
| * | | | Shader: Don't read ShaderSetup from global stateYuri Kunde Schlesner2017-01-261-3/+3
| | | | |
| * | | | shader_jit_x64: Don't read program from global stateYuri Kunde Schlesner2017-01-263-22/+22
| | | | |
| * | | | VideoCore/Shader: Move ProduceDebugInfo to InterpreterEngineYuri Kunde Schlesner2017-01-265-19/+11
| | | | |
| * | | | Debugger: Always use interpreter for shader debuggingYuri Kunde Schlesner2017-01-261-3/+5
| | | | |
| * | | | VideoCore/Shader: Split interpreter and JIT into separate ShaderEnginesYuri Kunde Schlesner2017-01-268-97/+153
| | | | |
| * | | | VideoCore/Shader: Rename shader_jit_x64{ => _compiler}.{cpp,h}Yuri Kunde Schlesner2017-01-264-4/+4
| | | | |
| * | | | VideoCore/Shader: Split shader uniform state and shader engineYuri Kunde Schlesner2017-01-265-22/+57
| | | | | | | | | | | | | | | | | | | | | | | | | Currently there's only a single dummy implementation, which will be split in a following commit.
| * | | | VideoCore/Shader: Add constness to methodsYuri Kunde Schlesner2017-01-262-4/+4
| | | | |
| * | | | VideoCore/Shader: Use only entry_point as ShaderSetup paramYuri Kunde Schlesner2017-01-264-12/+14
| | | | | | | | | | | | | | | | | | | | | | | | | This removes all implicit dependency of ShaderState on global PICA state.
| * | | | VideoCore/Shader: Use self instead of g_state.vs in ShaderSetupYuri Kunde Schlesner2017-01-263-13/+9
| | | | |
| * | | | VideoCore/Shader: Extract input vertex loading code into functionYuri Kunde Schlesner2017-01-263-22/+26
| | | | |
* | | | | SDL: Select audio device (#2403)Kloen Lansfiel2017-01-2614-18/+129
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Initial Commit Added Device logic to Sinks Started on UI for selecting devices Removed redundant import * Audio Core: Complete Device Switching Complete the device switching implementation by allowing the output device to be loaded, changed and saved through the configurations menu. Worked with the Sink abstraction and tuned the "Device Selection" configuration so that the Device List is automatically populated when the Sink is changed. This hopefully addresses the concerns and recommendations mentioned in the comments of the PR. * Clean original implementation. * Refactor GetSinkDetails
* | | | Merge pull request #2434 from mailwl/nfc-amiiboYuri Kunde Schlesner2017-01-264-20/+249
|\ \ \ \ | | | | | | | | | | Service/NFC: stub some functions
| * | | | Service/NFC: stub some functionsmailwl2017-01-144-20/+249
| | | | | | | | | | | | | | | | | | | | Tested on: Mini-Mario & Friends - amiibo Challenge
* | | | | Merge pull request #2469 from Kloen/killing-warningsYuri Kunde Schlesner2017-01-254-8/+9
|\ \ \ \ \ | | | | | | | | | | | | Fixing some MSVC warnings
| * | | | | video_core: fix shader.cpp signed / unsigned warningKloen2017-01-231-2/+2
| | | | | |
| * | | | | video_core: gl_rasterizer float to int warningKloen2017-01-231-1/+2
| | | | | |
| * | | | | video_core: fix gl_rasterizer warning on MSVCKloen2017-01-231-1/+1
| | | | | |
| * | | | | core: fix mic_u warnings on MSVCKloen2017-01-231-4/+4
| | |_|_|/ | |/| | |
* / | | | github: fixed issue template forum links (#2470)Kloen Lansfiel2017-01-241-2/+2
|/ / / /
* | | | Changed FAQ link (#2462)3dsemu2017-01-231-1/+1
| | | | | | | | | | | | | | | | Changed the FAQ link so it leads to the FAQ on the Citra website, instead of the FAQ hosted on GitHub
* | | | Merge pull request #2466 from Kloen/we-dont-need-thisbunnei2017-01-2315-2385/+2
|\ \ \ \ | | | | | | | | | | Removed unused and outdated external qhexedit
| * | | | Removed unused and outdated external qhexeditKloen2017-01-2213-2353/+2
| | | | |
| * | | | citra-qt: Removed unused and unimplemented ramview files.Kloen2017-01-224-32/+0
|/ / / /
* | | | Merge pull request #2458 from wwylele/reset-accel-gyrobunnei2017-01-211-0/+2
|\ \ \ \ | | | | | | | | | | HID: reset acceleroeter and gyroscope index in Init
| * | | | HID: reset acceleroeter and gyroscope index in Initwwylele2017-01-201-0/+2
| | | | |
* | | | | Merge pull request #2459 from 3ds-emu/patch-1bunnei2017-01-211-1/+2
|\ \ \ \ \ | |/ / / / |/| | | | Updated Citra forum link
| * | | | Updated Citra forum link3ds-emu2017-01-211-1/+2
|/ / / / | | | | | | | | | | | | | | | | The Citra forum (discuss.citra-emu.org) has recently been down. The link that has been added in this file now leads to an error pages. I update updated the link so it now leads to Citra's new forum.
* | | | Merge pull request #2450 from Xtansia/masterYuri Kunde Schlesner2017-01-191-9/+25
|\ \ \ \ | | | | | | | | | | loader: Add support for 3DSX special relocation types
| * | | | loader: Add support for 3DSX special relocation types, fixes citra-emu/citra#2449Thomas Farr2017-01-181-9/+25
|/ / / / | | | | | | | | | | | | As per devkitPro/3dstools@47bea18
* | | | Merge pull request #2442 from wwylele/hid-signalYuri Kunde Schlesner2017-01-165-64/+96
|\ \ \ \ | |/ / / |/| | | HID: manages updating itself using correct ticks
| * | | CoreTiming: use named constant for ARM11 clock ratewwylele2017-01-164-5/+6
| | | |
| * | | HID: manages updating itself using correct tickswwylele2017-01-163-62/+93
|/ / /
* | | Merge pull request #2435 from mailwl/gsp-maskYuri Kunde Schlesner2017-01-141-1/+1
|\ \ \ | | | | | | | | GSP::WriteHWRegsWithMask: fix register mask
| * | | GSP::WriteHWRegsWithMask: fix register maskmailwl2017-01-141-1/+1
|/ / /
* | | Merge pull request #2423 from Kloen/floats-should-be-floatbunnei2017-01-131-1/+2
|\ \ \ | |/ / |/| | SDL2: Config, fix double to float warning
| * | SDL2: Config.cpp fix double to float warningKloen2017-01-111-1/+2
| | |
* | | Merge pull request #2424 from Kloen/qt-ui-warnings-reallybunnei2017-01-123-24/+23
|\ \ \ | | | | | | | | Qt: Fix UI related warnings and bonus ui file format
| * | | QT: Fix ui file formatKloen2017-01-111-20/+20
| | | |
| * | | QT: Fix some UI related warningsKloen2017-01-112-4/+3
| |/ /
* | | Merge pull request #2425 from Subv/cleanup_todosbunnei2017-01-124-32/+30
|\ \ \ | | | | | | | | Implement some TODOs in the code.
| * | | Threads: Check the process' resource limit for the max allowed priority when creating a thread and remove the priority clamping code.Subv2017-01-112-13/+9
| | | |
| * | | Thread: Added priority range checking to svcSetThreadPriority and removed priority clamping code from Thread::SetPriority.Subv2017-01-113-18/+18
| | | |
| * | | Y2R: Use the proper error code when GetStandardCoefficient receives an invalid value.Subv2017-01-111-1/+3
| |/ /
* | | Merge pull request #2308 from mailwl/ac-ibunnei2017-01-129-297/+424
|\ \ \ | |/ / |/| | Service/AC: add ac:i service
| * | Service/AC: add ac:i servicemailwl2016-12-309-297/+424
| | |
* | | Merge pull request #2397 from Subv/pulsebunnei2017-01-105-13/+20
|\ \ \ | | | | | | | | Kernel: Implemented Pulse event and timers.
| * | | Kernel: Implemented Pulse event and timers.Subv2017-01-055-13/+20
| | | | | | | | | | | | | | | | Closes #1904
* | | | Merge pull request #2418 from jroweboy/appveyor_masterJames Rowe2017-01-081-0/+1
|\ \ \ \ | | | | | | | | | | Prevents appveyor from attempting to deploy except on the nightly repo
| * | | | Prevents appveyor from attempting to deploy except on the nightly repoJames Rowe2017-01-081-0/+1
|/ / / /
* | | | Merge pull request #2384 from bunnei/internal-res-optionbunnei2017-01-0810-25/+170
|\ \ \ \ | | | | | | | | | | config: Add option for specifying screen resolution scale factor.
| * | | | config: Add option for specifying screen resolution scale factor.bunnei2017-01-0710-25/+170
| | | | |
* | | | | Merge pull request #1951 from wwylele/motion-sensorbunnei2017-01-0714-16/+321
|\ \ \ \ \ | |/ / / / |/| | | | Emulate motion sensor in frontend
| * | | | Frontend: make motion sensor interfaced thread-safewwylele2016-12-292-2/+8
| | | | |
| * | | | Frontend: emulate motion sensorwwylele2016-12-269-16/+239
| | | | |
| * | | | Common: add Quaternionwwylele2016-12-262-0/+45
| | | | |
| * | | | vector math: add implementation of Length and Normalizewwylele2016-12-261-0/+19
| | | | |
| * | | | MathUtil: add PI constantwwylele2016-12-261-0/+2
| | | | |
| * | | | Common::Event: add WaitUntilwwylele2016-12-261-0/+10
| | |_|/ | |/| |
* | | | Merge pull request #2410 from Subv/sleepthreadbunnei2017-01-073-0/+14
|\ \ \ \ | | | | | | | | | | Don't yield execution in SleepThread(0) if there are no available threads to run
| * | | | Kernel: Don't attempt to yield execution in SleepThread(0) if there are no available threads to run.Subv2017-01-063-0/+14
| | | | | | | | | | | | | | | | | | | | With this we avoid an useless temporary deschedule of the current thread.
* | | | | Merge pull request #2396 from Subv/sema_acquirebunnei2017-01-071-1/+2
|\ \ \ \ \ | | | | | | | | | | | | Kernel/Semaphore: Fixed a regression in semaphore waits.
| * | | | | Kernel/Semaphore: Fixed a regression in semaphore waits.Subv2017-01-051-1/+2
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | The regression was caused by a missing check in #2260. The new behavior is consistent with the real kernel.
* | | | | Kernel: Fix SharedMemory objects always returning error when addr = 0 (#2404)Hyper2017-01-061-1/+5
| | | | | | | | | | | | | | | Closes #2400
* | | | | Merge pull request #2408 from Subv/priority_boostingbunnei2017-01-061-27/+0
|\ \ \ \ \ | | | | | | | | | | | | Kernel: Removed the priority boost code for starved threads.
| * | | | | Kernel: Removed the priority boost code for starved threads.Subv2017-01-051-27/+0
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | After hwtesting and reverse engineering the kernel, it was found that the CTROS scheduler performs no priority boosting for threads like this, although some other forms of scheduling priority-starved threads might take place. For example, it was found that hardware interrupts might cause low-priority threads to run if the CPU is preempted in the middle of an SVC handler that deschedules the current (high priority) thread before scheduling it again.
* | | | | Merge pull request #2409 from Subv/unused_funcsSebastian Valle2017-01-052-32/+0
|\ \ \ \ \ | |/ / / / |/| | | | Kernel: Remove some unused functions.
| * | | | Kernel: Remove some unused functions.Subv2017-01-052-32/+0
|/ / / /
* | | | Merge pull request #2393 from Subv/synchSebastian Valle2017-01-0518-162/+227
|\ \ \ \ | | | | | | | | | | Kernel: Mutex priority inheritance and synchronization improvements.
| * | | | Kernel: Add some asserts to enforce the invariants in the scheduler.Subv2017-01-052-2/+13
| | | | |
| * | | | Kernel: Remove a thread from all of its waiting objects' waiting_threads list when it is awoken.Subv2017-01-051-18/+4
| | | | | | | | | | | | | | | | | | | | This fixes a potential bug where threads would not get removed from said list if they awoke after waiting with WaitSynchronizationN with wait_all = false
| * | | | Kernel: Remove Thread::wait_objects_index and use wait_objects to hold all the objects that a thread is waiting on.Subv2017-01-054-21/+22
| | | | |
| * | | | Kernel: Use different thread statuses when a thread calls WaitSynchronization1 and WaitSynchronizationN with wait_all = true.Subv2017-01-044-19/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit removes the overly general THREADSTATUS_WAIT_SYNCH and replaces it with two more granular statuses: THREADSTATUS_WAIT_SYNCH_ANY when a thread waits on objects via WaitSynchronization1 or WaitSynchronizationN with wait_all = false. THREADSTATUS_WAIT_SYNCH_ALL when a thread waits on objects via WaitSynchronizationN with wait_all = true.
| * | | | Kernel/Mutex: Propagate thread priority changes to other threads inheriting the priority via mutexesSubv2017-01-045-42/+60
| | | | |
| * | | | Kernel/Mutex: Update a mutex priority when a thread stops waiting on it.Subv2017-01-045-24/+42
| | | | |
| * | | | Kernel/Mutex: Implemented priority inheritance.Subv2017-01-045-31/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The implementation is based on reverse engineering of the 3DS's kernel. A mutex holder's priority will be temporarily boosted to the best priority among any threads that want to acquire any of its held mutexes. When the holder releases the mutex, it's priority will be boosted to the best priority among the threads that want to acquire any of its remaining held mutexes.
| * | | | Kernel: Object ShouldWait and Acquire calls now take a thread as a parameter.Subv2017-01-0417-68/+56
| | | | | | | | | | | | | | | | | | | | This will be useful when implementing mutex priority inheritance.
| * | | | Kernel/Synch: Do not attempt a reschedule on every syscall.Subv2017-01-042-2/+18
| | | | | | | | | | | | | | | | | | | | Not all syscalls should cause reschedules, this commit attempts to remedy that, however, it still does not cover all cases.
* | | | | Merge pull request #2407 from jroweboy/nightly-deployJames Rowe2017-01-052-2/+7
|\ \ \ \ \ | | | | | | | | | | | | Change travis to deploy on push to citra-nightly.
| * | | | | Change travis to deploy on push to citra-nightly. Add more information to the releases pageJames Rowe2017-01-052-2/+7
|/ / / / /
* | | | | Merge pull request #2405 from jroweboy/nightly-deployJames Rowe2017-01-054-42/+14
|\ \ \ \ \ | | | | | | | | | | | | Change deploy to use github releases instead
| * | | | | Change deploy to use github releases instead, but only for the citra-nightly repoJames Rowe2017-01-054-42/+14
|/ / / / /
* | | | | Fix some warnings (#2399)Jonathan Hao2017-01-0413-35/+9
| | | | |
* | | | | Update .travis.ymlbunnei2017-01-041-1/+1
| | | | |
* | | | | Merge pull request #2401 from jroweboy/travis-keyJames Rowe2017-01-041-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Try a different travis key
| * | | | | Try a different travis keyJames Rowe2017-01-041-1/+1
|/ / / / /
* | | | | Merge pull request #2382 from mailwl/nfcYuri Kunde Schlesner2017-01-037-0/+44
|\ \ \ \ \ | |_|_|/ / |/| | | | Service/NFC: stub GetTagInRangeEvent
| * | | | Service/NFC: stub GetTagInRangeEventmailwl2016-12-307-0/+44
| | |_|/ | |/| | | | | | | | | | Fix Fatal Error in Mini-Mario & Friends - amiibo Challenge
* | | | Merge pull request #2390 from jroweboy/bintrayJames Rowe2017-01-012-2/+3
|\ \ \ \ | | |/ / | |/| | Try a different encrypted bintray api key for travis.
| * | | Try a different encrypted bintray api key for travis. Change appveyor to upload to a long git hash (since travis is stuck uploading to the full hash name)James Rowe2017-01-012-2/+3
| | | |
* | | | Merge pull request #2254 from jroweboy/bintrayJames Rowe2017-01-016-51/+86
|\| | | | | | | | | | | Add deploy to bintray for builds to master
| * | | Trying to make a consistent nightly versioningJames Rowe2017-01-012-2/+4
| | | |
| * | | Add deploy to bintray for builds to masterJames Rowe2016-12-316-51/+84
|/ / /
* | | Merge pull request #2386 from bunnei/fix-bg-colorSebastian Valle2016-12-301-6/+6
|\ \ \ | |/ / |/| | config: SDL: Move background color setting to correct section.
| * | config: SDL: Move background color setting to correct section.bunnei2016-12-301-6/+6
| | |
* | | Merge pull request #2240 from wwylele/auto-regionbunnei2016-12-3011-7/+108
|\ \ \ | |/ / |/| | Config: auto-select region and language
| * | Config: auto-select region and languagewwylele2016-12-0711-7/+108
| | |
* | | Merge pull request #2367 from JayFoxRox/lighting-lut-quickfixbunnei2016-12-291-10/+9
|\ \ \ | | | | | | | | Lighting LUT Quickfix
| * | | Minor cleanup in GLSL codeJannik Vogel2016-12-251-3/+2
| | | |
| * | | Offset lighting LUT samples correctlyJannik Vogel2016-12-251-7/+7
| | | |
* | | | Merge pull request #2376 from wwylele/remove-unusedbunnei2016-12-271-58/+0
|\ \ \ \ | | | | | | | | | | Core: remove unused hle.cpp
| * | | | Core: remove unused hle.cppwwylele2016-12-271-58/+0
|/ / / /
* | | | Merge pull request #2374 from wwylele/whats-going-on-with-that-prbunnei2016-12-271-0/+1
|\ \ \ \ | |_|_|/ |/| | | Core: reset cpu_core in Shutdown to make IsPoweredOn work properly
| * | | Core: reset cpu_core in Shutdown to make IsPoweredOn work properlywwylele2016-12-241-0/+1
|/ / /
* | | Merge pull request #2369 from MerryMage/core-frontendbunnei2016-12-2314-16/+16
|\ \ \ | | | | | | | | core: Move emu_window and key_map into core
| * | | core: Move emu_window and key_map into coreMerryMage2016-12-2314-16/+16
| | | | | | | | | | | | | | | | * Removes circular dependences (common should not depend on core)
* | | | Merge pull request #2370 from wwylele/where-is-my-shared-fontYuri Kunde Schlesner2016-12-231-3/+1
|\ \ \ \ | |/ / / |/| | | file_util: fix missing sysdata path
| * | | file_util: fix missing sysdata pathwwylele2016-12-231-3/+1
| |/ /
* | | Merge pull request #2364 from mailwl/nwm-servicesbunnei2016-12-2318-10/+317
|\ \ \ | |/ / |/| | Service/NWM: add nwm services
| * | Service/NWM: add nwm servicesmailwl2016-12-2218-10/+317
|/ /
* | Merge pull request #2366 from MerryMage/MemoryReadCodebunnei2016-12-222-0/+1
|\ \ | | | | | | arm_dynarmic: Provide MemoryReadCode callback
| * | arm_dynarmic: Provide MemoryReadCode callbackMerryMage2016-12-222-0/+1
| | | | | | | | | | | | Change of interface in dynarmic 36082087ded632079b16d24137fdd0c450ce82ea
* | | Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-2245-591/+435
|\ \ \ | |/ / |/| | Core: Top-level consolidate & misc cleanup
| * | ThreadContext: Move from "core" to "arm_interface".bunnei2016-12-228-37/+26
| | |
| * | core: Replace "AppCore" nomenclature with just "CPU".bunnei2016-12-2211-105/+103
| | |
| * | Address clang-format issues.bunnei2016-12-228-49/+49
| | |
| * | core: Remove HLE module, consolidate code & various cleanups.bunnei2016-12-2219-107/+94
| | |
| * | core: Consolidate core and system state, remove system module & cleanups.bunnei2016-12-2222-336/+284
| | |
| * | file_util: Remove unused paths.bunnei2016-12-223-87/+3
| | |
| * | core: Consolidate top-level system state into a singleton.bunnei2016-12-228-103/+164
| | |
| * | loader: Remove duplicate docstrings.bunnei2016-12-223-56/+0
| | |
* | | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-224-49/+94
|\ \ \ | | | | | | | | csnd:SND: Reformat source code
| * | | csnd:SND reformat source codemailwl2016-12-124-49/+94
| | | |
* | | | Merge pull request #2361 from lioncash/disasmbunnei2016-12-221-3/+1
|\ \ \ \ | |_|/ / |/| | | disassembler: Remove mutable specifier from breakpoints member variable
| * | | disassembler: Remove mutable specifier from breakpoints member variableLioncash2016-12-211-3/+1
| | | | | | | | | | | | | | | | | | | | Breakpoints has been const correct with regards to what the DisassmblerModel needs for quite a while now.
* | | | Merge pull request #2362 from lioncash/graphicsbunnei2016-12-2217-32/+32
|\ \ \ \ | |/ / / |/| | | citra-qt: Move graphics debugging code into its own folder
| * | | citra-qt: Move graphics debugging code into its own folderLioncash2016-12-2117-32/+32
|/ / / | | | | | | | | | | | | Keeps all graphics debugging stuff from cluttering up the root debugger folder
* | | Merge pull request #2319 from yuriks/profile-scopesbunnei2016-12-212-0/+15
|\ \ \ | | | | | | | | VideoCore: Make profiling scope more representative
| * | | VideoCore: Make profiling scope more representativeYuri Kunde Schlesner2016-12-152-0/+15
| | | |
* | | | Merge pull request #2357 from lioncash/uibunnei2016-12-212-67/+100
|\ \ \ \ | | | | | | | | | | citra-qt: Move bits of constructor behavior to named functions
| * | | | citra-qt: Move bits of constructor behavior to named functionsLioncash2016-12-192-67/+100
| | | | | | | | | | | | | | | | | | | | | | | | | Makes the initialization process a tad easier to grok, since the constructor isn't just a glob of random unrelated behaviors.
* | | | | Merge pull request #2356 from Chainsawkitten/GLbooleanbunnei2016-12-211-4/+4
|\ \ \ \ \ | |/ / / / |/| | | | Use GL_TRUE when setting color_mask
| * | | | Use GL_TRUE when setting color_maskAlbin Bernhardsson2016-12-191-4/+4
|/ / / /
* | | | Merge pull request #2318 from yuriks/trace-optbunnei2016-12-193-16/+15
|\ \ \ \ | | | | | | | | | | VideoCore: Inline IsPicaTracing
| * | | | VideoCore: Inline IsPicaTracingYuri Kunde Schlesner2016-12-153-16/+15
| |/ / / | | | | | | | | | | | | Speeds up ALBW main menu slightly (~3%)
* | | | Merge pull request #2351 from CaptV0rt3x/masterbunnei2016-12-181-0/+1
|\ \ \ \ | | | | | | | | | | Fixed game_list focus issue.
| * | | | Fixed game_list focusing issue.Vamsi Krishna2016-12-181-0/+1
| | | | | | | | | | | | | | | | | | | | added line render_window->setFocus();
* | | | | Merge pull request #2347 from citra-emu/revert-2321-flush-pagesbunnei2016-12-181-10/+0
|\ \ \ \ \ | | | | | | | | | | | | Revert "Memory: Always flush whole pages from surface cache"
| * | | | | Revert "Memory: Always flush whole pages from surface cache"bunnei2016-12-181-10/+0
| |/ / / /
* | | | | Merge pull request #2353 from CaptV0rt3x/code-cleanupbunnei2016-12-183-7/+2
|\ \ \ \ \ | |/ / / / |/| | | | Code cleanup
| * | | | line fixup for travis ciCaptV0rt3x2016-12-181-1/+0
| | | | |
| * | | | screen swap - Hotkey mappingVamsi Krishna2016-12-182-5/+1
| | | | |
| * | | | Fixed GPLv2 license text in the start.Vamsi Krishna2016-12-181-1/+1
|/ / / /
* | | | Merge pull request #2345 from wwylele/no-zombie-threadbunnei2016-12-173-3/+15
|\ \ \ \ | | | | | | | | | | Thread: remove the thread from the thread list when exiting
| * | | | Thread: remove the thread from the thread list when exitingwwylele2016-12-173-3/+15
|/ / / /
* | | | Merge pull request #2335 from yuriks/shader-refactorYuri Kunde Schlesner2016-12-179-338/+336
|\ \ \ \ | | | | | | | | | | Misc. Shader refactors
| * | | | VideoCore/Shader: Extract DebugData out from UnitStateYuri Kunde Schlesner2016-12-168-103/+99
| | | | |
| * | | | Remove unnecessary castYuri Kunde Schlesner2016-12-161-3/+1
| | | | |
| * | | | VideoCore/Shader: Extract evaluate_condition lambda to function scopeYuri Kunde Schlesner2016-12-161-26/+24
| | | | |
| * | | | VideoCore/Shader: Extract call lambda up a scope and remove unused paramYuri Kunde Schlesner2016-12-161-21/+17
| | | | |
| * | | | VideoCore/Shader: Remove dynamic control flow in (Get)UniformOffsetYuri Kunde Schlesner2016-12-162-18/+11
| | | | |
| * | | | VideoCore/Shader: Move DebugData to a separate fileYuri Kunde Schlesner2016-12-164-172/+189
| | | | |
* | | | | Merge pull request #2303 from freiro/citra-qt_missing_sdl2_dllbunnei2016-12-165-30/+33
|\ \ \ \ \ | | | | | | | | | | | | Copy SDL2.dll when compiling citra-qt with msvc
| * | | | | Modularized Qt and SDL file copyingfreiro2016-12-134-14/+16
| | | | | | | | | | | | | | | | | | | | | | | | Now cmake relies on two submodules to copy the libraries in the proper folders
| * | | | | Modularization of copy_msvc_libraries cmake functfreiro2016-12-113-20/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Created a new folder in Citra's root called CMakeModules that should contain cmake functions used by the various CMakeLists.txt.
| * | | | | Removed redundant Qt check and other fixesfreiro2016-12-111-20/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This removes a redundant check and moves part of the code to a separate function.
| * | | | | [MSVC] Copy SDL2.dll to build folderfreiro2016-12-111-20/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CMake now copies SDL2.dll when compiling citra with citra-qt as a target on MSVC.
* | | | | | Merge pull request #2337 from lioncash/gdbbunnei2016-12-161-9/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | gdbstub: const correctness changes
| * | | | | | gdbstub: const correctness changesLioncash2016-12-161-9/+8
| | |/ / / / | |/| | | | | | | | | | | | | | | | Also uses size_t as the length indicator type, as is common with buffers.
* | | | | | Merge pull request #2322 from MerryMage/ctx-mnuMerry2016-12-1610-4/+87
|\ \ \ \ \ \ | | | | | | | | | | | | | | game_list: Add a context menu with "Open Save Location" option
| * | | | | | main: Open folder when open save folder location context menu is clickedMerryMage2016-12-152-0/+20
| | | | | | |
| * | | | | | game_list: Implement context menu for items in listMerryMage2016-12-153-4/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add a context menu with a "Open Save Data Location" action
| * | | | | | loader: Implement ReadProgramIdMerryMage2016-12-153-0/+28
| | | | | | |
| * | | | | | archive_source_sd_savedata: Add static method to get a specific save data pathMerryMage2016-12-152-0/+7
| | | | | | |
* | | | | | | Merge pull request #2338 from wwylele/fix-deadSebastian Valle2016-12-161-1/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Kernel: remove object's waiting thread if it is dead
| * | | | | | Kernel: remove object's waiting thread if it is deadwwylele2016-12-161-1/+2
|/ / / / / /
* | | | | | Merge pull request #2260 from Subv/schedulingbunnei2016-12-168-196/+211
|\ \ \ \ \ \ | | | | | | | | | | | | | | Threading: Reworked the way our scheduler works.
| * | | | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-144-28/+41
| | | | | | |
| * | | | | | Properly remove a thread from its wait_objects' waitlist when it is awoken by a timeout.Subv2016-12-103-2/+11
| | | | | | |
| * | | | | | WaitSynch: Removed unused variables and reduced SharedPtr copies.Subv2016-12-095-74/+57
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Define a variable with the value of the sync timeout error code. Use a boost::flat_map instead of an unordered_map to hold the equivalence of objects and wait indices in a WaitSynchN call.
| * | | | | | Use boost remove_erase_if instead of the erase-remove idiomSubv2016-12-071-2/+3
| | | | | | |
| * | | | | | Improved the algorithm for GetHighestPriorityReadyThread.Subv2016-12-071-14/+13
| | | | | | |
| * | | | | | Threading: Added some utility functions and const correctness.Subv2016-12-044-16/+36
| | | | | | |
| * | | | | | Threading: Reworked the way our scheduler works.Subv2016-12-048-190/+180
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Threads will now be awakened when the objects they're waiting on are signaled, instead of repeating the WaitSynchronization call every now and then. The scheduler is now called once after every SVC call, and once after a thread is awakened from sleep by its timeout callback. This new implementation is based off reverse-engineering of the real kernel. See https://gist.github.com/Subv/02f29bd9f1e5deb7aceea1e8f019c8f4 for a more detailed description of how the real kernel handles rescheduling.
* | | | | | | Merge pull request #2316 from endrift/macos-gccbunnei2016-12-161-0/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Common: Fix gcc build on macOS
| * | | | | | | Common: Fix gcc build on macOSJeffrey Pfau2016-12-131-0/+11
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2328 from wwylele/fix-traceYuri Kunde Schlesner2016-12-161-11/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix debug build from #2249
| * | | | | | | FS: fix debug build from #2249wwylele2016-12-151-11/+9
| | | | | | | |
* | | | | | | | Merge pull request #2332 from lioncash/gdbYuri Kunde Schlesner2016-12-165-16/+23
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gdbstub: Remove global variable from public interface
| * | | | | | | | gdbstub: Remove global variable from public interfaceLioncash2016-12-155-16/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, this is only ever queried, so adding a function to check if the server is enabled is more sensible. If directly modifying this externally is ever desirable, it should be done by adding a function to the interface, rather than exposing implementation details directly.
* | | | | | | | | Merge pull request #2320 from mailwl/cecd-updateYuri Kunde Schlesner2016-12-168-13/+81
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Service/CECD: Add cecd:ndm service
| * | | | | | | | | Service/CECD: Add cecd:ndm servicemailwl2016-12-158-13/+81
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2331 from lioncash/truncbunnei2016-12-151-1/+2
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | hid: Get rid of a double -> float truncation warning
| * | | | | | | | hid: Get rid of a double -> float truncation warningLioncash2016-12-151-1/+2
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | float literals need to have the 'f' prefix.
* | | | | | | | Merge pull request #2330 from lioncash/pragmaSebastian Valle2016-12-153-0/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: Add missing #pragma once directives where applicable
| * | | | | | | | core: Add missing #pragma once directives where applicableLioncash2016-12-153-0/+6
| |/ / / / / / /
* | | | | | | | Merge pull request #2327 from lioncash/typobunnei2016-12-151-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | act: Fix docstring typo
| * | | | | | | act: Fix docstring typoLioncash2016-12-151-1/+1
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | These aren't the AM services.
* | | | | | | Merge pull request #2325 from yuriks/fix-indexYuri Kunde Schlesner2016-12-151-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | shader_jit_x64: Use LOOPCOUNT_REG as a 64-bit reg when indexing
| * | | | | | | shader_jit_x64: Use LOOPCOUNT_REG as a 64-bit reg when indexingYuri Kunde Schlesner2016-12-151-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #2314 from mailwl/accountbunnei2016-12-158-10/+44
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Service/ACT: move ACT services to folder
| * | | | | | | Service/ACT: move ACT services to foldermailwl2016-12-148-10/+44
| | | | | | | |
* | | | | | | | Merge pull request #2321 from yuriks/flush-pagesbunnei2016-12-151-0/+10
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Memory: Always flush whole pages from surface cache
| * | | | | | | Memory: Always flush whole pages from surface cacheYuri Kunde Schlesner2016-12-151-0/+10
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This prevents individual writes touching a cached page, but which don't overlap the surface, from constantly hitting the surface cache lookup.
* | | | | | | Merge pull request #2317 from yuriks/vertex-copySebastian Valle2016-12-153-5/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | VideoCore: Eliminate an unnecessary copy in the drawcall loop
| * | | | | | | VideoCore: Eliminate an unnecessary copy in the drawcall loopYuri Kunde Schlesner2016-12-153-5/+3
|/ / / / / / /
* | | | | | | Merge pull request #2309 from yuriks/shader-jit-xbyakYuri Kunde Schlesner2016-12-1511-224/+475
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Convert shader JIT to Xbyak
| * | | | | | | shader_jit_x64: Use Reg32 for LOOP* registers, eliminating castsYuri Kunde Schlesner2016-12-151-16/+16
| | | | | | | |
| * | | | | | | VideoCore: Convert x64 shader JIT to use Xbyak for assemblyYuri Kunde Schlesner2016-12-156-224/+462
| | | | | | | |
| * | | | | | | Externals: Add XbyakYuri Kunde Schlesner2016-12-154-0/+13
| | | | | | | |
| * | | | | | | externals: Update DynarmicYuri Kunde Schlesner2016-12-151-0/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | Required to be able to use Xbyak in Citra without header conflicts.
* | | | | | | Merge pull request #2249 from Subv/sessions_v3Yuri Kunde Schlesner2016-12-1525-171/+591
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.
| * | | | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-1416-68/+108
| | | | | | |
| * | | | | | Moved the HLE command buffer translation task to ServerSession instead of the HLE handler superclass.Subv2016-12-096-47/+38
| | | | | | |
| * | | | | | Kernel/IPC: Small codestyle cleanupSubv2016-12-092-3/+1
| | | | | | |
| * | | | | | Added a framework for partially handling Session disconnections.Subv2016-12-088-9/+67
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Further implementation will happen in a future commit. Fixes a regression.
| * | | | | | Use std::move where appropriate.Subv2016-12-0812-177/+187
| | | | | | |
| * | | | | | Return an error code when connecting to a saturated port.Subv2016-12-055-7/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The error code was taken from the 3DS kernel.
| * | | | | | HLE: Use a member variable instead of a virtual function to retrieve the max number of sessions that can be connected to an HLE service at the same time.Subv2016-12-055-8/+18
| | | | | | |
| * | | | | | Split SessionRequestHandler::HandleSyncRequest into HandleSyncRequest, TranslateRequest and HandleSyncRequestImpl.Subv2016-12-056-22/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | HandleSyncRequest now takes care of calling the command buffer translate function before actually invoking the command handler for HLE services.
| * | | | | | Kernel: Remove the Redirection handle type.Subv2016-12-051-2/+0
| | | | | | |
| * | | | | | KServerPorts now have an HLE handler "template", which is inherited by all ServerSessions created from it.Subv2016-12-0512-69/+86
| | | | | | |
| * | | | | | Declare empty ServerSession and ClientSession constructors as default.Subv2016-12-032-4/+4
| | | | | | |
| * | | | | | Threads do not wait for the server endpoint to call AcceptSession before returning from a ConnectToPort or GetServiceHandle call.Subv2016-12-012-3/+5
| | | | | | |
| * | | | | | Fixed the rebase mistakes.Subv2016-12-0111-83/+76
| | | | | | |
| * | | | | | A bit of a redesign.Subv2016-12-0113-263/+266
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sessions and Ports are now detached from each other. HLE services are handled by means of a SessionRequestHandler class, Interface now inherits from this class. The File and Directory classes are no longer kernel objects, but SessionRequestHandlers instead, bound to a ServerSession when requested. File::OpenLinkFile now creates a new session pair and binds the File instance to it.
| * | | | | | IPC/HLE: Associate the ClientSessions with their parent port's HLE interface if it exists.Subv2016-12-016-26/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Pass the triggering ServerSession to the HLE command handler to differentiate which session caused the request.
| * | | | | | Kernel/HLE: Service::Interface no longer inherits from any Kernel object, and is now its own standalone class.Subv2016-12-014-24/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Interface is now used by aggregation in ClientPort, to forward service commands to their HLE implementation if needed.
| * | | | | | fixup! Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-014-5/+6
| | | | | | |
| * | | | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-0116-88/+314
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All handles obtained via srv::GetServiceHandle or svcConnectToPort are references to ClientSessions. Service modules will wait on the counterpart of those ClientSessions (Called ServerSessions) using svcReplyAndReceive or svcWaitSynchronization[1|N], and will be awoken when a SyncRequest is performed. HLE Interfaces are now ClientPorts which override the HandleSyncRequest virtual member function to perform command handling immediately.
* | | | | | | Merge pull request #2166 from endrift/clang-detectSebastian Valle2016-12-131-2/+4
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | CMakeLists: Autodetect clang and only then use libc++
| * | | | | | CMakeLists: Autodetect clang and only then use libc++Jeffrey Pfau2016-12-131-2/+4
|/ / / / / /
* | | | | | Merge pull request #2315 from JamePeng/fix-gsp_gpu-codeSebastian Valle2016-12-131-3/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | Minor amendment of GSP_GPU::ImportDisplayCaptureInfo code
| * | | | | | Minor amendment of GSP_GPU::ImportDisplayCaptureInfo codeJamePeng2016-12-131-3/+5
|/ / / / / /
* | | | | | Merge pull request #2312 from lioncash/guardYuri Kunde Schlesner2016-12-131-0/+2
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | time_stretch: Add missing #pragma once directive
| * | | | | time_stretch: Add missing #pragma once directiveLioncash2016-12-131-0/+2
| | | | | |
* | | | | | Merge pull request #2275 from jbeich/pthreadSebastian Valle2016-12-111-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Unbreak QT-only build after 75ee2f8c6702
| * | | | | | tests: add missing libcore dependency after 75ee2f8c6702Jan Beich2016-12-071-1/+1
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | $ (cmake -DENABLE_SDL2:BOOL=false /path/to/citra; gmake) [...] [ 85%] Linking CXX executable tests ../common/libcommon.a(microprofile.cpp.o): In function `MicroProfileThreadStart(pthread**, void* (*)(void*))': src/common/microprofile.cpp:(.text+0x41): undefined reference to `pthread_create' c++: error: linker command failed with exit code 1 (use -v to see invocation)
* | | | | | Merge pull request #2267 from JayFoxRox/fix-mingw-ccSebastian Valle2016-12-119-10/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | Support mingw cross-compilation
| * | | | | | gdbstub: Remove unused includeJannik Vogel2016-12-051-1/+0
| | | | | | |
| * | | | | | Unify Windows ICON resource nameJannik Vogel2016-12-052-2/+2
| | | | | | |
| * | | | | | Support mingw cross-compileJannik Vogel2016-12-059-9/+11
| | | | | | |
* | | | | | | Merge pull request #2154 from mailwl/apt-getstartupargumentSebastian Valle2016-12-112-5/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | APT::GetStartupArgument: force clear startup argument
| * | | | | | | APT::GetStartupArgument: force clear startup argumentmailwl2016-12-112-5/+11
|/ / / / / / /
* | | / / / / citra-qt: Make constructors explicit where applicableLioncash2016-12-1115-32/+35
| |_|/ / / / |/| | | | |
* | | | | | citra-qt: Add missing #pragma once directivesLioncash2016-12-115-0/+10
| | | | | |
* | | | | | game_list: Make slots private functionsLioncash2016-12-111-7/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The new Qt event syntax allows for regular member functions to be used in connect(), so explicitly indicating slots isn't necessary.
* | | | | | game_list: Make the constructor explicitLioncash2016-12-111-1/+1
| | | | | |
* | | | | | game_list: Make the AddEntry argument a const referenceLioncash2016-12-112-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | appendRow takes a QList by const reference, so it doesn't need to be modifiable.
* | | | | | game_list: Replace 0 literals with nullptrLioncash2016-12-111-1/+1
| | | | | |
* | | | | | game_list: Use QT5's new event connection syntaxLioncash2016-12-111-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | Makes for more compact code in most places.
* | | | | | game_list: Pass the parent constructor argument to the QWidget base classLioncash2016-12-111-1/+1
| |_|_|_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the control was ever passed an explicit parent, a potential memory leak would happen, as the game list wouldn't be freed. However, in our case, the game list was placed within a layout, which automatically performs reparenting, avoiding this issue.
* | | | | Merge pull request #2300 from lioncash/qtYuri Kunde Schlesner2016-12-111-18/+24
|\ \ \ \ \ | | | | | | | | | | | | graphics_cmdlist: Minor changes
| * | | | | graphics_cmdlists: Get rid of variable shadowingLioncash2016-12-111-14/+18
| | | | | |
| * | | | | graphics_cmdlists: Get rid of an unused variableLioncash2016-12-111-1/+0
| | | | | |
| * | | | | graphics_cmdlists: Make LoadTexture and TextureInfoWidget src arguments constLioncash2016-12-111-3/+4
| | | | | |
| * | | | | graphics_cmdlists: Make LoadImage internally linkedLioncash2016-12-111-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Puts the TextureInfoWidget definition in the anonymous namespace as well, as it's only used in the translation unit as well.
* | | | | | Core: Add a forgotten #include <cstring> for memcpy.Emmanuel Gil Peyrot2016-12-111-0/+1
|/ / / / /
* | | | | Add all services to the Service namespaceLioncash2016-12-1150-499/+408
| | | | | | | | | | | | | | | | | | | | | | | | | Previously there was a split where some of the services were in the Service namespace and others were not.
* | | | | configure_input: Modernize and cleanup input configuration tabMerryMage2016-12-112-115/+101
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Removed use of raw QTimer* pointer. * Update to use type-safe QObject::connect. * getKeyName can be a static local function. * Prefer to use function arguments instead of member variables. * Store Qt::Key instead of converting string back into keycode.
* | | | | Merge pull request #2296 from MerryMage/auto_is_autoYuri Kunde Schlesner2016-12-101-12/+7
|\ \ \ \ \ | | | | | | | | | | | | audio_core: SelectSink should default to auto if sink_id is invalid
| * | | | | audio_core: SelectSink should default to auto if sink_id is invalidMerryMage2016-12-101-12/+7
| | | | | |
* | | | | | Merge pull request #2291 from lioncash/svcbunnei2016-12-0910-12/+61
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Add the cfg:nor service
| * | | | | | service: Add cfg:nor serviceLioncash2016-12-094-0/+49
| | | | | | |
| * | | | | | service: Drop '_Interface' from cfg service namesLioncash2016-12-097-12/+12
| | | | | | |
* | | | | | | Merge pull request #2292 from lioncash/boolYuri Kunde Schlesner2016-12-091-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ptm: Use boolean instead of integral value
| * | | | | | | ptm: Use boolean instead of integral valueLioncash2016-12-091-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The third parameter of Write is actually a bool type, not an int.
* | | | | | | | Merge pull request #2202 from j-selby/man-docsYuri Kunde Schlesner2016-12-093-0/+101
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Add man documentation
| * | | | | | | Add man documentationJames2016-11-263-0/+101
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes both SDL and QT frontends
* | | | | | | | Merge pull request #2287 from lioncash/svcYuri Kunde Schlesner2016-12-0912-12/+170
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: Minor PTM changes
| * | | | | | | | service: Add the ptm:s serviceLioncash2016-12-083-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 3dbrew documents this as being the exact same as ptm:sysm
| * | | | | | | | service: Add common ptm:u commands to other ptm servicesLioncash2016-12-084-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 3dbrew indicates that all services have access to these commands except for ptm:sets.
| * | | | | | | | service: Drop '_Interface' in ptm service class namesLioncash2016-12-087-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Inheriting from Service::Interface makes this obvious.
| * | | | | | | | service: Add ptm::gets and ptm::sets servicesLioncash2016-12-086-0/+90
| | | | | | | | |
* | | | | | | | | Merge pull request #2280 from Subv/citrace_sizeSebastian Valle2016-12-081-2/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Fixed the gpu command list size when creating CiTraces.
| * | | | | | | | Fixed the gpu command list size when creating CiTraces.Subv2016-12-081-2/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2286 from lioncash/svcYuri Kunde Schlesner2016-12-0814-0/+271
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: Add mvd and qtm services
| * | | | | | | | service: Add mvd and qtm servicesLioncash2016-12-0814-0/+271
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the two New3DS-only modules. 3dbrew was used for command information.
* | | | | | | | | Merge pull request #2274 from degasus/masterYuri Kunde Schlesner2016-12-085-47/+8
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Drop framebuffer completeness check.
| * | | | | | | | OpenGL: Drop framebuffer completeness check.Markus Wick2016-12-075-47/+8
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This OpenGL call synchronize the worker thread of the nvidia blob. It can be verified on linux with the __GL_THREADED_OPTIMIZATIONS=1 environment variable. Those errors should not happen on tested drivers. It was used as a workaround for https://bugs.freedesktop.org/show_bug.cgi?id=94148
* | | | | | | | Merge pull request #2284 from lioncash/svcYuri Kunde Schlesner2016-12-088-30/+199
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: Add nfc services
| * | | | | | | | service: Add nfc servicesLioncash2016-12-088-30/+199
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 3dbrew was used for the command information.
* | | | | | | | | Merge pull request #2277 from lioncash/explicitYuri Kunde Schlesner2016-12-088-10/+10
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | file_sys: Make a few single-argument constructors explicit
| * | | | | | | | file_sys: Make a few single-argument constructors explicitLioncash2016-12-078-10/+10
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit conversions.
* | | | | | | | Merge pull request #2283 from lioncash/svcYuri Kunde Schlesner2016-12-0821-28/+212
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: Update function tables
| * | | | | | | | ssl_c: Update function tableLioncash2016-12-081-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew
| * | | | | | | | ptm: Update ptm_sysm function tableLioncash2016-12-083-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | pm_app: Update function tableLioncash2016-12-081-6/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | nwm_uds: Update function tableLioncash2016-12-081-5/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | nim: Update function tablesLioncash2016-12-082-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | http_c: Update function tableLioncash2016-12-081-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | gsp_lcd: Update function tableLioncash2016-12-081-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | fs_user: Update function tableLioncash2016-12-081-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | dlp_srvr: Update function tableLioncash2016-12-081-0/+7
| | | | | | | | |
| * | | | | | | | cfg: Update function tablesLioncash2016-12-083-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew
| * | | | | | | | cecd_u: Update function tableLioncash2016-12-081-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | boss_p: Update function tableLioncash2016-12-081-3/+68
| | | | | | | | |
| * | | | | | | | act: Update function tablesLioncash2016-12-082-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | apt: Update apt function tablesLioncash2016-12-082-7/+73
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | | | | | Merge pull request #2281 from lioncash/appletYuri Kunde Schlesner2016-12-088-30/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | applet: minor interface changes
| * | | | | | | applet: Move common IsRunning underlying variable to the Applet classLioncash2016-12-078-28/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of basic duplication.
| * | | | | | | applet: Make virtual destructor defaultedLioncash2016-12-071-1/+1
| | | | | | | |
| * | | | | | | applet: Make constructor protectedLioncash2016-12-071-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Considering the class is abstract, there's no need to make the constructor public.
* | | | | | | | Merge pull request #2282 from lioncash/svcMat M2016-12-086-113/+246
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Update AM service function tables
| * | | | | | | Update AM service function tablesLioncash2016-12-086-113/+246
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | | | | Merge pull request #2232 from wwylele/other-savebunnei2016-12-0711-80/+351
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | FS: implement archives for other game save data
| * | | | | | FileSys: Implement OtherSaveDatawwylele2016-11-297-0/+214
| | | | | | |
| * | | | | | FS: add missing MediaTypewwylele2016-11-291-1/+1
| | | | | | |
| * | | | | | FileSys: abstract SD save data archive sourcewwylele2016-11-296-79/+136
| | | | | | |
* | | | | | | Implement Frame rate limiter (#2223)emmauss2016-12-0610-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * implement frame limiter * fixes
* | | | | | | Merge pull request #2264 from JayFoxRox/print-shaderYuri Kunde Schlesner2016-12-062-4/+14
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Print shaders in case of error
| * | | | | | | ASSERT that shader was linked successfullyJannik Vogel2016-12-051-0/+2
| | | | | | | |
| * | | | | | | Report shader uniform block size in case of mismatchJannik Vogel2016-12-051-1/+3
| | | | | | | |
| * | | | | | | Print broken shader code to logJannik Vogel2016-12-051-3/+9
|/ / / / / / /
* | | | | | | Merge pull request #2200 from j-selby/fix-mingw-crashYuri Kunde Schlesner2016-12-051-0/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Disable Microprofile on Mingw builds
| * | | | | | Disable Microprofile on Mingw buildsJames2016-12-051-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes a crash when starting games
* | | | | | | Merge pull request #2269 from Subv/update_dynarmicYuri Kunde Schlesner2016-12-051-0/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Dynarmic: Update dynarmic to version 54d051977f7a6af9c7596ba6a4e6eb467bd1e0bc
| * | | | | | Dynarmic: Update dynarmic to versionSubv2016-12-051-0/+0
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 54d051977f7a6af9c7596ba6a4e6eb467bd1e0bc dynarmic log: 54d0519 emit_x64: Use movdqa instead of movaps in EmitPackedSubU8 52e1445 Implement USUB8:33 2016 +0000 5c1aab1 Implement CLZ 1a1646d Implement UADD8 7cad694 IR: Implement new pseudo-operation GetGEFromOp 370f654 fuzz_arm: Add tests for parallel add/subtract (modulo) 25f21b5 emit_x64: Inline nzcv computation into EmitFPCompare32 and EmitFPCompare64 52fdec5 CMakeLists: Add support for LLVM on Windows cede5e4 emit_x64: Use xorps/xorpd when argument to TransferToFP32/TransferToFP64 is an immediate zero e166965 Implement VCMP2:33 2016 +0000 f2fe376 Support 64-bit immediates ff00b8c Document register allocator and return stack buffer optimization 95f34c6 reg_alloc: Remove unnecessary breaks after returns (#54) dc9707e externals: Update xbyak to 5.32 de1f831 microinstruction: Make use_count private (#53) 3621a92 reg_alloc: Register allocator related constraints belong with the rest of the register allocator
* | | | | | Merge pull request #2266 from yuriks/fix-displaytransferYuri Kunde Schlesner2016-12-044-19/+29
|\ \ \ \ \ \ | | | | | | | | | | | | | | OpenGL: Fix DisplayTransfer accel when input width != output width
| * | | | | | GSP: Downgrade log severity of SetAxiConfigQoSModeYuri Kunde Schlesner2016-12-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't need to do anything for HLE and some games call it quite often, spamming up the logs.
| * | | | | | OpenGL: Non-zero stride only makes sense for linear buffersYuri Kunde Schlesner2016-12-043-7/+11
| | | | | | |
| * | | | | | OpenGL: Ensure framebuffer binding is restored if completion check failsYuri Kunde Schlesner2016-12-041-10/+7
| | | | | | |
| * | | | | | OpenGL: Fix DisplayTransfer accel when input width != output widthYuri Kunde Schlesner2016-12-041-1/+10
|/ / / / / / | | | | | | | | | | | | | | | | | | Fixes #2246, #2261
* | | | | | Merge pull request #2259 from JayFoxRox/fix-fallbackYuri Kunde Schlesner2016-12-041-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | shader_jit: Fix non-SSE4.1 path where FLR would not truncate
| * | | | | | shader_jit: Fix non-SSE4.1 path where FLR would not truncateJannik Vogel2016-12-041-1/+1
| | | | | | |
* | | | | | | Merge pull request #2257 from citra-emu/fix-clang-formatYuri Kunde Schlesner2016-12-044-5/+10
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Travis: Use a stable version of clang-format
| * | | | | | clang-format: Fix coding styleYuri Kunde Schlesner2016-12-031-1/+1
| | | | | | |
| * | | | | | Travis: Use a stable version of clang-formatYuri Kunde Schlesner2016-12-033-4/+9
|/ / / / / /
* | | | | | Merge pull request #2255 from JayFoxRox/lsl4Yuri Kunde Schlesner2016-12-031-6/+9
|\ \ \ \ \ \ | |/ / / / / |/| | | | | shader_jit: Load LOOPCOUNT_REG and LOOPINC 4 bit left-shifted
| * | | | | shader_jit: Load LOOPCOUNT_REG and LOOPINC 4 bit left-shiftedJannik Vogel2016-12-021-6/+9
|/ / / / /
* | | | | Merge pull request #2251 from JayFoxRox/remove-versionMat M2016-12-012-12/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | | Remove unused version.h in citra_qt
| * | | | Remove unused version.hJannik Vogel2016-12-012-12/+0
|/ / / /
* | | | Merge pull request #2228 from freiro/winver_fixYuri Kunde Schlesner2016-12-012-11/+8
|\ \ \ \ | | | | | | | | | | Move WINVER definition to cmake and a bit of cleanup
| * | | | Appending PLATFORM_LIBRARIES instead of redefining themfreiro2016-11-301-3/+3
| | | | |
| * | | | WINVER definition moved to CMake and cleanupfreiro2016-11-302-11/+8
| | | | |
* | | | | Merge pull request #2243 from MerryMage/r15Sebastian Valle2016-11-301-0/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | | dynarmic: Fix ABI violation
| * | | | dynarmic: Fix ABI violationMerryMage2016-11-301-0/+0
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | Caused by not saving/restoring the x64 r15 register on entry/exit from JITted code. Closes #2224.
* | | | Merge pull request #2241 from Subv/clang_formatwwylele2016-11-302-6/+10
|\ \ \ \ | | | | | | | | | | ClangFormat: Fixed the clang-format errors
| * | | | ClangFormat: Fixed the clang-format errorsSubv2016-11-302-6/+10
|/ / / /
* | | | Merge pull request #1820 from mailwl/service-verSebastian Valle2016-11-308-16/+88
|\ \ \ \ | |/ / / |/| | | Set client SDK version to Service APIs
| * | | Set client SDK version to Service APIsmailwl2016-11-308-16/+88
|/ / /
* | | Merge pull request #2233 from Subv/warningsbunnei2016-11-303-11/+11
|\ \ \ | | | | | | | | Build: Fixed a few warnings.
| * | | Build: Fixed a few warnings.Subv2016-11-293-11/+11
| |/ /
* / / Update dynarmic to the latest version (#2234)James Rowe2016-11-301-0/+0
|/ /
* | Merge pull request #2196 from Subv/system_modeYuri Kunde Schlesner2016-11-2810-21/+66
|\ \ | | | | | | Kernel/Loader: Grab the system mode from the NCCH ExHeader.
| * | Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-285-27/+27
| | | | | | | | | | | | | | | | | | | | | 3dsx and elf files default to system mode 2 (96MB allocated to the application). This allows Home Menu to boot without modifications. Closes #1849
| * | Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-2010-22/+67
| | | | | | | | | | | | | | | | | | | | | 3dsx and elf files default to system mode 2 (96MB allocated to the application). This allows Home Menu to boot without modifications. Closes #1849
* | | Merge pull request #2222 from linkmauve/die-frameskip-dieYuri Kunde Schlesner2016-11-287-33/+1
|\ \ \ | | | | | | | | Remove the broken frame_skip option
| * | | GPU: Remove the broken frame_skip option.Emmanuel Gil Peyrot2016-11-277-33/+1
| | | | | | | | | | | | | | | | Fixes #1960.
* | | | Merge pull request #2132 from wwylele/fix-fs-errSebastian Valle2016-11-2830-304/+1234
|\ \ \ \ | | | | | | | | | | Correct FS error codes & add path boundary checks
| * | | | tests: add a work-around for macOS linking errorwwylele2016-11-192-0/+15
| | | | |
| * | | | FileSys: rename SaveDataCheck archive to NCCH archivewwylele2016-11-195-23/+22
| | | | | | | | | | | | | | | | | | | | According to the observation from game and 3dbrew "Used for accessing general NCCH data"
| * | | | FileSys: remove unused DiskArchivewwylele2016-11-192-179/+0
| | | | | | | | | | | | | | | | | | | | All "subclasses" of DiskArchive are splitted out. This class is useless
| * | | | PTM & CFG: use the correct path and error code according to the new FileSys policywwylele2016-11-192-5/+6
| | | | |
| * | | | FileSys: w->rw permission lift only happens in SDMC archivewwylele2016-11-194-2/+14
| | | | |
| * | | | FileSys: add SDMCWriteOnlyArchivewwylele2016-11-196-0/+140
| | | | |
| * | | | FileSys: add SDMCArchivewwylele2016-11-193-1/+301
| | | | | | | | | | | | | | | | | | | | Now DiskArchive only serves for SDMC, then it should be just a "SDMCArchive"
| * | | | FileSys: add ExtSaveDataArchivewwylele2016-11-192-1/+115
| | | | | | | | | | | | | | | | | | | | ExtSaveData is more similar to SaveData, so let it be a subclass of SaveData
| * | | | FileSys: add SaveDataArchivewwylele2016-11-197-4/+368
| | | | | | | | | | | | | | | | | | | | The error checking of SaveDataArchive is completely different from DiskArchive, so it has to be a new class instead of a subclass of DiskArchive.
| * | | | FileSys: remove Open from FileBackendwwylele2016-11-194-64/+44
| | | | | | | | | | | | | | | | | | | | Same as directory, file shouldn't expose Open either.
| * | | | FileSys: remove Open from DirectoryBackendwwylele2016-11-194-25/+5
| | | | | | | | | | | | | | | | | | | | Open should not be an interface exposed by Directory because it is the Archive thats implement the methed to open the directory. The service API of 3DS also implies this - Open is not a function of directory service, but is of FS main service
| * | | | FileSys: add PathParserwwylele2016-11-195-0/+200
| | | | |
| * | | | FileSys: make Archive interfaces return error codewwylele2016-11-016-87/+91
| | | | | | | | | | | | | | | | | | | | and make the mode parameter a reference since it is a BitField union
* | | | | Merge pull request #2218 from Subv/stencil_linesYuri Kunde Schlesner2016-11-272-5/+5
|\ \ \ \ \ | |_|/ / / |/| | | | Rasterizer/Memfill: Set the correct stencil write mask when clearing the stencil buffer.
| * | | | RasterizerGL: Use GL_TRUE and 0xFF in the stencil and depth masks instead of simply true and -1Subv2016-11-272-4/+4
| | | | |
| * | | | Rasterizer/Memfill: Set the correct stencil write mask when clearing the stencil buffer.Subv2016-11-271-1/+1
|/ / / /
* | | | Merge pull request #2168 from mailwl/micSebastian Valle2016-11-274-16/+309
|\ \ \ \ | | | | | | | | | | MIC_U: Stub service funcions
| * | | | Output parameters to logmailwl2016-11-251-4/+6
| | | | |
| * | | | MIC_U: Stub service funcionsmailwl2016-11-254-16/+307
| | |_|/ | |/| |
* | | | Merge pull request #2185 from freiro/local_folderYuri Kunde Schlesner2016-11-263-1/+18
|\ \ \ \ | | | | | | | | | | Change "user" folder default location to AppData/Roaming/ on Windows systems
| * | | | Move to AppData/Roaming/Citra/freiro2016-11-261-1/+1
| | | | |
| * | | | Removed /user/ from pathfreiro2016-11-261-2/+1
| | | | |
| * | | | Switch to AppData/Roamingfreiro2016-11-242-4/+4
| | | | |
| * | | | Return by value and other fixesfreiro2016-11-192-14/+8
| | | | |
| * | | | Win32 move default user folder location to AppDatafreiro2016-11-192-0/+24
| | |_|/ | |/| |
* | | | Merge pull request #2215 from MerryMage/ticks_executedYuri Kunde Schlesner2016-11-261-2/+2
|\ \ \ \ | |_|/ / |/| | | dynarmic: Add ticks based on ticks executed, not ticks requested
| * | | dynarmic: Add ticks based on ticks executed, not ticks requestedMerryMage2016-11-261-2/+2
|/ / /
* | | Merge pull request #2210 from jroweboy/pagetablesYuri Kunde Schlesner2016-11-253-6/+18
|\ \ \ | | | | | | | | Expose page table to dynarmic for optimized reads and writes to the JIT
| * | | Expose page table to dynarmic for optimized reads and writes to the JITJames Rowe2016-11-253-6/+18
| | | |
* | | | Merge pull request #2211 from yuriks/travis-no-uploadYuri Kunde Schlesner2016-11-252-3/+0
|\ \ \ \ | | | | | | | | | | Travis: Remove build uploading
| * | | | Travis: Remove build uploadingYuri Kunde Schlesner2016-11-252-3/+0
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | @archshift has been MIA for a while, so our builds server is currently down. Furthermore, uploading is broken in both Linux and macOS: - The version of lftp in Trusty doesn't support the sftp:auto-confirm option, which means that uploading would hang, even if the server weren't down. It currently tries to connect forever and fails the build with a timeout. - lftp was removed from Homebrew, so it wasn't being installed on macOS and invoking it just failed.
* | | | Merge pull request #2208 from freiro/libsdl205Yuri Kunde Schlesner2016-11-242-3/+3
|\ \ \ \ | |/ / / |/| | | Windows, move to SDL2-2.0.5
| * | | Move to SDL2-2.0.5freiro2016-11-222-3/+3
| | | |
* | | | Cache Vertices instead of Output registers (#2165)jphalimi2016-11-241-6/+7
| | | | | | | | | | | | | | | | This patch brings +3% performance improvement on average. It removes ToVertex() as an important hotspot of the emulator.
* | | | Bravely Default/Second stuck #1822 (#2188)pippo29312016-11-244-2/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Bravely Default/Second stuck #1822 CancelLibraryApplet stub * Log parameter. * Taking care of comments * Sync with 3DBrew * White space ? * lower case
* | | | Merge pull request #2175 from PEmu1/macosYuri Kunde Schlesner2016-11-241-2/+2
|\ \ \ \ | | | | | | | | | | Change "OS X" to "macOS" in the Readme
| * | | | Change "OS X" to "macOS" in the ReadmePringo2016-11-141-2/+2
| | | | |
* | | | | Merge pull request #2186 from wwylele/config9Yuri Kunde Schlesner2016-11-241-2/+8
|\ \ \ \ \ | | | | | | | | | | | | cfg: add config block 0x00090000
| * | | | | cfg: add config block 0x00090000wwylele2016-11-171-2/+8
| | | | | |
* | | | | | Merge pull request #1654 from JamePeng/errdispYuri Kunde Schlesner2016-11-241-118/+198
|\ \ \ \ \ \ | | | | | | | | | | | | | | Rework the code of err:f service!
| * | | | | | Rework the code of err:f serviceJamePeng2016-10-061-118/+198
| | | | | | |
* | | | | | | Merge pull request #2207 from wwylele/fix-2195James Rowe2016-11-221-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix format error from #2195
| * | | | | | | Fix format error from #2195wwylele2016-11-221-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #2206 from freiro/SDL_Audio_Errorwwylele2016-11-221-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Improve verbosity of audio errors
| * | | | | | | Improve verbosity of audio errors with SDL_GetError()freiro2016-11-221-2/+2
| | |_|_|/ / / | |/| | | | |
* / | | | | | Improve MIME description and add French translationcoc4tm2016-11-201-12/+12
|/ / / / / /
* | | | | | Merge pull request #2195 from Subv/factor_checkbunnei2016-11-201-6/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU/CiTrace: Avoid calling GetTextures() when not necessary.
| * | | | | | GPU/CiTrace: Avoid calling GetTextures() when not necessary.Subv2016-11-201-6/+5
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2193 from Subv/pulse_eventsbunnei2016-11-202-0/+10
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel/Events: Log an error when trying to create Pulse events and timers
| * | | | | | Kernel/Events: Log an error when trying to create Pulse events and timers.Subv2016-11-192-0/+10
| |/ / / / / | | | | | | | | | | | | | | | | | | Related to #1904
* | | | | | Merge pull request #2192 from Subv/applet_enumsSebastian Valle2016-11-205-16/+27
|\ \ \ \ \ \ | | | | | | | | | | | | | | APT/Applets: Renamed the members of the SignalType enum.
| * | | | | | APT/Applets: Renamed the members of the SignalType enum.Subv2016-11-195-16/+27
| |/ / / / / | | | | | | | | | | | | | | | | | | Names now make sense and match 3dbrew.
* | | | | | Merge pull request #2194 from jroweboy/extremely-minor-clangformat-changeJames Rowe2016-11-191-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Minor formatting change
| * | | | | Minor formatting changeJames Rowe2016-11-191-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #2172 from jroweboy/fix-mingwbunnei2016-11-165-6/+20
|\ \ \ \ \ | | | | | | | | | | | | Fix mingw compilation support
| * | | | | Add mingw compile supportJames Rowe2016-11-145-6/+20
| |/ / / /
* | | | | Merge pull request #1753 from jroweboy/frame_layoutsbunnei2016-11-1619-127/+368
|\ \ \ \ \ | |/ / / / |/| | | | Support additional screen layouts.
| * | | | Round the rectangle size to prevent float to int casting issuesJames Rowe2016-11-123-8/+9
| | | | | | | | | | | | | | | | | | | | And other minor style changes
| * | | | Add default hotkey to swap primary screens.James Rowe2016-11-0510-13/+27
| | | | | | | | | | | | | | | | | | | | Also minor style changes
| * | | | Rework frame layouts to use a max rectangle instead of hardcoded calculationsJames Rowe2016-11-052-250/+100
| | | | |
| * | | | LargeFrameLayout + SwappedSonofUgly2016-11-051-50/+36
| | | | | | | | | | | | | | | Make small screen stay at 1x, and large screen maintain its aspect ratio.
| * | | | Support additional screen layouts.James Rowe2016-11-0516-127/+517
| | | | | | | | | | | | | | | | | | | | | | | | | Allows users to choose a single screen layout or a large screen layout. Adds a configuration option to change the prominent screen.
* | | | | Merge pull request #2171 from jroweboy/fix-mac-buildbunnei2016-11-121-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Fix Travis build issue on mac
| * | | | | Remove cmake from the install list. Its now up to date on the new travis mac imageJames Rowe2016-11-111-1/+1
|/ / / / /
* | | | | Merge pull request #2170 from Pringo/masterYuri Kunde Schlesner2016-11-112-2/+2
|\ \ \ \ \ | |/ / / / |/| | / / | | |/ / | |/| | Minor Menu Fixes
| * | | Minor Menu FixesPringo2016-11-112-2/+2
|/ / /
* | | Update CONTRIBUTING.mdbunnei2016-11-051-1/+1
| | |
* | | Update CONTRIBUTING.mdbunnei2016-11-051-4/+4
| | |
* | | Update CONTRIBUTING.mdbunnei2016-11-051-2/+4
| | |
* | | Merge pull request #2142 from mailwl/acu-updatebunnei2016-11-052-14/+194
|\ \ \ | |_|/ |/| | AC_U: Stub functions, used if EULA agreed
| * | Style fixmailwl2016-11-021-2/+2
| | |
| * | Rename AcConfig, change types u8 to u32mailwl2016-11-021-21/+25
| | |
| * | AC_U: Stub functions, used if EULA agreedmailwl2016-11-022-14/+190
|/ /
* | Merge pull request #2147 from Pringo/readme-donatebunnei2016-11-011-2/+1
|\ \ | | | | | | Update Donation Info in Readme
| * | Link to Donation Page in ReadmePringo2016-11-011-2/+1
| | | | | | | | | Link main site donation page in readme instead of providing further donation info there.
| * | Update Donation Info in ReadmePringo2016-10-291-2/+2
| | |
* | | Merge pull request #2126 from wwylele/stub-nwmbunnei2016-10-311-0/+11
|\ \ \ | | | | | | | | NWM: stub Initialize with an error
| * | | NWM: stub Initialize with an errorwwylele2016-10-121-0/+11
| | |/ | |/|
* | | Merge pull request #2149 from wwylele/fix-contributingbunnei2016-10-311-13/+8
|\ \ \ | | | | | | | | Update CONTRIBUTING.md
| * | | Update CONTRIBUTING.mdwwylele2016-10-311-13/+8
| | | |
* | | | Merge pull request #2123 from jbeich/freebsdbunnei2016-10-3111-37/+68
|\ \ \ \ | |_|_|/ |/| | | Fix build on DragonFly and FreeBSD
| * | | build: don't install freedesktop.org metadata for SDL2-only buildsJan Beich2016-10-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Citra SDL2 doesn't have a launcher, and citra.desktop tries to execute citra-qt which is N/A unless built with ENABLE_QT. Limiting installed files to one of the options also makes it easier to split them into separate non-conflicting packages downstream.
| * | | build: add default install for DragonFly, Solaris, etc.Jan Beich2016-10-283-3/+3
| | | |
| * | | build: clock_gettime() is in libc on BSDsJan Beich2016-10-281-1/+1
| | | |
| * | | build: libc may not provide iconv() on UnixJan Beich2016-10-281-3/+10
| | | | | | | | | | | | | | | | /usr/bin/ld: ../common/libcommon.a(string_util.cpp.o): undefined reference to symbol 'libiconv_open'
| * | | microprofile: unbreak on POSIX systemsJan Beich2016-10-282-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In file included from src/common/microprofile.cpp:7: In file included from src/./common/microprofile.h:23: externals/microprofile/microprofile.h:830:5: error: use of undeclared identifier 'MP_BREAK' MP_ASSERT(t == nBegin); ^ externals/microprofile/microprofile.h:238:34: note: expanded from macro 'MP_ASSERT' ^ externals/microprofile/microprofile.h:831:5: error: use of undeclared identifier 'MP_BREAK' MP_ASSERT(nTimerIndex == (nToken&0x3fff)); ^ externals/microprofile/microprofile.h:238:34: note: expanded from macro 'MP_ASSERT' ^ [...]
| * | | core: some errno values are uncommon on UnixJan Beich2016-10-281-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/hle/service/soc_u.cpp:107:6: error: 'ENODATA' was not declared in this scope {ENODATA, 43}, ^ src/core/hle/service/soc_u.cpp:117:6: error: 'ENOSR' was not declared in this scope {ENOSR, 53}, ^ src/core/hle/service/soc_u.cpp:118:6: error: 'ENOSTR' was not declared in this scope {ENOSTR, 54}, ^ src/core/hle/service/soc_u.cpp:139:6: error: 'ETIME' was not declared in this scope {ETIME, 75}, ^
| * | | common: use system bswap* functions on more BSDsJan Beich2016-10-281-2/+5
| | | |
| * | | common: use system CPUID routine on DragonFly as wellJan Beich2016-10-281-2/+2
| | | |
| * | | common: some FreeBSD headers are incomplete to avoid namespace pollutionJan Beich2016-10-281-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In file included from src/common/x64/cpu_detect.cpp:16: /usr/include/machine/cpufunc.h:66:17: error: unknown type name 'u_int' static __inline u_int ^ /usr/include/machine/cpufunc.h:67:6: error: unknown type name 'u_int' bsfl(u_int mask) ^ /usr/include/machine/cpufunc.h:69:2: error: unknown type name 'u_int' u_int result; ^ /usr/include/machine/cpufunc.h:75:17: error: unknown type name 'u_long'; did you mean 'long'? static __inline u_long ^ /usr/include/machine/cpufunc.h:76:6: error: unknown type name 'u_long'; did you mean 'long'? bsfq(u_long mask) ^ /usr/include/machine/cpufunc.h:78:2: error: use of undeclared identifier 'u_long'; did you mean 'long'? u_long result; ^ [...]
| * | | common: convert to standard stat()/fstat() interfacesAnthony J. Bentley2016-10-282-15/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Most modern Unix environments use 64-bit off_t by default: OpenBSD, FreeBSD, OS X, and Linux libc implementations such as Musl. glibc is the lone exception; it can default to 32 bits but this is configurable by setting _FILE_OFFSET_BITS. Avoiding the stat64()/fstat64() interfaces is desirable because they are nonstandard and not implemented on many systems (including OpenBSD and FreeBSD), and using 64 bits for stat()/fstat() is either the default or trivial to set up.
| * | | common: stat64 is non-standard, hide on a random UnixJan Beich2016-10-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/common/file_util.cpp:79:19: error: variable has incomplete type 'struct stat64' struct stat64 file_info; ^ src/common/file_util.cpp:79:12: note: forward declaration of 'stat64' struct stat64 file_info; ^ src/common/file_util.cpp:99:19: error: variable has incomplete type 'struct stat64' struct stat64 file_info; ^ src/common/file_util.cpp:99:12: note: forward declaration of 'stat64' struct stat64 file_info; ^ src/common/file_util.cpp:342:19: error: variable has incomplete type 'struct stat64' struct stat64 buf; ^ src/common/file_util.cpp:342:12: note: forward declaration of 'stat64' struct stat64 buf; ^ src/common/file_util.cpp:359:19: error: variable has incomplete type 'struct stat64' struct stat64 buf; ^ src/common/file_util.cpp:359:12: note: forward declaration of 'stat64' struct stat64 buf; ^ 4 errors generated.
| * | | common: only FreeBSD has thread affinity compatible with LinuxJan Beich2016-10-281-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/common/thread.cpp:90:5: error: unknown type name 'cpu_set_t'; did you mean 'cpuset_t'? cpu_set_t cpu_set; ^~~~~~~~~ cpuset_t /usr/include/sys/_cpuset.h:48:24: note: 'cpuset_t' declared here typedef struct _cpuset cpuset_t; ^ 1 error generated.
| * | | common: define routines to set thread name on more BSDsJan Beich2016-10-281-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | src/common/thread.cpp:123:5: error: use of undeclared identifier 'pthread_setname_np' pthread_setname_np(pthread_self(), szThreadName); ^ 1 error generated.
| * | | hooks: convert pre-commit to POSIX syntaxJan Beich2016-10-281-3/+3
| |/ /
* | | Merge pull request #2146 from mailwl/gdbstub-ida-regsbunnei2016-10-291-1/+1
|\ \ \ | |/ / |/| | Small fix to let IDA see target.xml
| * | Small fix to let IDA see target.xmlmailwl2016-10-281-1/+1
|/ /
* | Travis: only upload for push (#2134)wwylele2016-10-271-1/+1
| |
* | Merge pull request #2139 from mailwl/frd-fixwwylele2016-10-251-1/+1
|\ \ | | | | | | FRD: fix GetMyFriendKey
| * | FRD: fix GetMyFriendKeymailwl2016-10-251-1/+1
|/ /
* | Merge pull request #2131 from ricardotk/typoswwylele2016-10-2115-18/+18
|\ \ | | | | | | Fix typos
| * | Fix typosRicardo de Almeida Gonzaga2016-10-2015-18/+18
|/ /
* | Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-085-4/+1810
|\ \ | | | | | | Update the stub code of BOSS
| * | Update the stub code of BOSSJamePeng2016-10-025-4/+1810
| | |
* | | Merge pull request #2082 from yuriks/shader-interp-crashbunnei2016-10-073-38/+43
|\ \ \ | |_|/ |/| | Fix/mask crash in shader debugger in Mii Maker
| * | VideoCore: Shader interpreter cleanupsYuri Kunde Schlesner2016-09-301-32/+42
| | |
| * | Common: Remove dangerous Vec[234] array constructorsYuri Kunde Schlesner2016-09-301-3/+0
| | | | | | | | | | | | | | | They're not currently used, and it's easy to accidentally pass a single pointer argument to them, causing an out-of-bounds read.
| * | VideoCore: Fix out-of-bounds read in ShaderSetup::ProduceDebugInfoYuri Kunde Schlesner2016-09-301-3/+1
| |/ | | | | | | | | | | As far as I can tell, memset was replaced by a fill without correcting the parameter type, causing an out-of-bounds array read in the Vec4 constructor.
* | Merge pull request #1652 from wwylele/kernal-toolbunnei2016-10-0512-7/+646
|\ \ | | | | | | Debugger: implement wait tree widget
| * | move ResetType to kernel.hwwylele2016-09-223-7/+6
| | |
| * | name objectswwylele2016-09-221-0/+4
| | |
| * | implement wait tree widgetwwylele2016-09-229-0/+636
| | |
* | | Merge pull request #2106 from wwylele/delete-recursivebunnei2016-10-048-22/+93
|\ \ \ | | | | | | | | FS: implement DeleteDirectoryRecursively
| * | | fs: clean up log formatwwylele2016-10-021-22/+24
| | | |
| * | | fs: implement DeleteDirectoryRecursivelywwylele2016-10-028-1/+70
| | |/ | |/|
* | | Merge pull request #2103 from wwylele/gpu-reg-cleanupbunnei2016-10-045-247/+347
|\ \ \ | |/ / |/| | GPU: DisplayTransfer & MemoryFill cleanup and param check
| * | gpu: DisplayTransfer: a less amazing algorithm for flipwwylele2016-09-291-8/+11
| | | | | | | | | | | | the old implementation modifies the loop variable in the loop. Though it actually works, it is really confusing. Makes it morereadable now.
| * | gpu: keep the old signal strategy for null pointerwwylele2016-09-291-4/+8
| | | | | | | | | | | | | | | previous commits changes the behaviour of interrupt when meeting invalid params. Regresses to the same behaviour as before needs more hwtest
| * | gpu: add validity check for TextureCopy, DisplayTransfer and FillMemorywwylele2016-09-291-6/+88
| | | | | | | | | | | | | | | prevent further operation with invalid values which may cause assertion failure or divided by zero. needs more hwtest
| * | memory: fix IsValidVirtualAddress for RasterizerCachedMemorywwylele2016-09-291-0/+3
| | | | | | | | | | | | RasterizerCachedMemory doesn't has pointer but should be considered as valid
| * | gpu: move MemoryFill, TextureCopy and DisplayTransfer into functionswwylele2016-09-291-247/+249
| | | | | | | | | | | | The old code indented too much to read. Split into functions and do general cleanup.
| * | rasterizer: separate TextureCopy from DisplayTransferwwylele2016-09-293-6/+12
| |/
* | Merge pull request #2083 from yuriks/opengl-scissor-cached-rectYuri Kunde Schlesner2016-09-303-29/+25
|\ \ | | | | | | OpenGL: Take cached viewport sub-rect into account for scissor
| * | OpenGL: Take cached viewport sub-rect into account for scissorYuri Kunde Schlesner2016-09-303-29/+25
|/ / | | | | | | Fixes #1938
* | Merge pull request #2100 from wwylele/fix-load-assertbunnei2016-09-231-2/+3
|\ \ | |/ |/| Qt: shutdown system if error on loading ROM
| * qt: shutdown system if errorwwylele2016-09-221-2/+3
|/
* Merge pull request #2099 from citra-emu/fix-clang-formatwwylele2016-09-221-2/+2
|\ | | | | Fix clang-format lint
| * travis: fix clang-format lintwwylele2016-09-221-2/+2
|/
* Merge pull request #2086 from linkmauve/clang-formatYuri Kunde Schlesner2016-09-21401-18173/+19275
|\ | | | | Add clang-format as part of our {commit,travis}-time checks
| * Fix Travis clang-format checkYuri Kunde Schlesner2016-09-212-15/+31
| |
| * Remove special rules for Windows.h and library includesYuri Kunde Schlesner2016-09-216-10/+8
| |
| * Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-21164-168/+170
| |
| * Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-21289-731/+214
| | | | | | | | | | | | | | This makes clang-format useful on those. Also add a bunch of forgotten transitive includes, which otherwise prevented compilation.
| * Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-19169-812/+808
| |
| * Tweak formatting settingsYuri Kunde Schlesner2016-09-191-4/+3
| |
| * Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-18386-17707/+19187
| |
| * Travis: Import Dolphin’s clang-format hook.Emmanuel Gil Peyrot2016-09-181-1/+20
| |
| * Git hook: Remove trailing semicolons wrecking vim’s syntax highlighting.Emmanuel Gil Peyrot2016-09-181-2/+2
| |
| * Git hook: Import Dolphin’s clang-format hook.Emmanuel Gil Peyrot2016-09-181-1/+18
| |
| * Dyncom: Disable clang-format on the decoding table.Emmanuel Gil Peyrot2016-09-181-0/+3
| |
| * Sources: Add a .clang-format configuration file.Emmanuel Gil Peyrot2016-09-181-0/+89
| |
* | README: Specify master branch for Travis CI badgeYuri Kunde Schlesner2016-09-211-1/+1
| |
* | Merge pull request #2097 from citra-emu/fix-travisYuri Kunde Schlesner2016-09-211-2/+1
|\ \ | |/ |/| Travis: Fix OS X build
| * Travis: Fix OS X buildYuri Kunde Schlesner2016-09-211-2/+1
|/ | | | | | | Probably due to additional Travis caching, cmake is now already installed when the script runs. This causes the unlink to remove the symlink to the executable, which is then not re-added by the install (since it's already installed).
* Merge pull request #2080 from yuriks/shader-interp-crashYuri Kunde Schlesner2016-09-161-1/+1
|\ | | | | VideoCore: Fix dangling lambda context in shader interpreter
| * VideoCore: Fix dangling lambda context in shader interpreterYuri Kunde Schlesner2016-09-161-1/+1
|/ | | | | | The static meant that after the first execution, these lambda context would be pointing to a random location on the stack. Fixes a random crash when using the interpreter.
* Merge pull request #2042 from bunnei/dynarmicYuri Kunde Schlesner2016-09-1619-47/+317
|\ | | | | Interface ARM CPU JIT (Dynarmic)
| * arm_dynarmic: Implement GetVFPSystemReg/SetVFPSystemReg.bunnei2016-09-151-5/+12
| |
| * microprofile: Double buffer size to 16MB.bunnei2016-09-151-1/+1
| |
| * arm: ResetContext shouldn't be part of ARM_Interface.bunnei2016-09-156-30/+17
| |
| * arm_dynarmic/arm_dyncom: Remove unnecessary "virtual" keyword.bunnei2016-09-152-2/+2
| |
| * dyncom: Use VFP_FPSCR/VFP_FPEXC.bunnei2016-09-151-4/+4
| |
| * qt: Add UI configuration option to enable CPU JIT.bunnei2016-09-152-0/+25
| |
| * core: Add configuration option for CPU JIT.bunnei2016-09-155-7/+20
| |
| * dynarmic: Implement ARM CPU interface.bunnei2016-09-153-0/+233
| |
| * dynarmic: Add new submodule.bunnei2016-09-153-10/+16
| |
| * CMakeLists: Set Boost_INCLUDE_DIR.bunnei2016-09-151-4/+3
| |
| * externals/boost: Use latest upstream with variant.bunnei2016-09-151-0/+0
|/
* Merge pull request #2064 from linkmauve/remove-readdir_rYuri Kunde Schlesner2016-09-131-6/+2
|\ | | | | Switch to readdir() from readdir_r()
| * Common: readdir_r() is deprecated, switch to readdir().Emmanuel Gil Peyrot2016-09-131-6/+2
| |
* | Merge pull request #2069 from wwylele/fix-birthdayYuri Kunde Schlesner2016-09-131-2/+3
|\ \ | | | | | | Qt: fix birthday combo box updating
| * | Qt: fix birthday combo box updatingwwylele2016-09-131-2/+3
|/ /
* | Merge pull request #2059 from MerryMage/tweak-audio-latencybunnei2016-09-112-2/+2
|\ \ | |/ |/| audio_core: Tweak audio latency
| * audio_core: Tweak audio latencyMerryMage2016-09-072-2/+2
| |
* | travis cache for cmake and sdl2 (#2060)Lectem2016-09-082-4/+17
|/
* Merge pull request #2050 from MerryMage/adpcmYuri Kunde Schlesner2016-09-031-2/+2
|\ | | | | codec: Fix ADPCM distortion caused by incorrect nibble order
| * codec: Fix ADPCM distortion caused by incorrect nibble orderfincs2016-09-031-2/+2
| | | | | | | | | | | | Closes #2049. Signed-off-by: MerryMage <MerryMage@users.noreply.github.com>
* | Merge pull request #2045 from MerryMage/travisbunnei2016-09-033-3/+4
|\ \ | | | | | | travis: Update to XCode 7.3.1
| * | travis: Update to XCode 7.3.1MerryMage2016-09-023-3/+4
| |/
* | Merge pull request #2044 from wwylele/system-setting-fixbunnei2016-09-025-12/+9
|\ \ | | | | | | Qt: unify running detection of system settings configure
| * | Qt: unify running detectionwwylele2016-09-025-12/+9
|/ /
* | Merge pull request #2040 from citra-emu/revert-2037-msvc-relwithdebinfobunnei2016-09-011-11/+7
|\ \ | | | | | | Revert "MSVC: Add RelWithDebInfo and removing debugging from Release."
| * | Revert "MSVC: Add RelWithDebInfo and removing debugging from Release."bunnei2016-09-011-11/+7
|/ /
* | Merge pull request #2037 from jroweboy/msvc-relwithdebinfobunnei2016-09-011-7/+11
|\ \ | | | | | | MSVC: Add RelWithDebInfo and removing debugging from Release.
| * | MSVC: Add RelWithDebInfo and removing debugging from Release.James Rowe2016-09-011-7/+11
| | | | | | | | | | | | This should reduce build size on windows from roughly 12MB compressed to 7MB
* | | Merge pull request #2039 from jroweboy/remove-pdbbunnei2016-09-011-0/+6
|\ \ \ | | | | | | | | Create a separate archive for debug symbols on windows
| * | | Create a separate archive for debugsymbols on windowsJames Rowe2016-09-011-0/+6
|/ / / | | | | | | | | | | | | This reduces the main download size and uploads the symbols to a different directory
* | | Merge pull request #2038 from MerryMage/rm-testsbunnei2016-09-011-0/+4
|\ \ \ | |_|/ |/| | appveyor: Remove tests.exe and tests.pdb from archive
| * | appveyor: Remove tests.exe and tests.pdb from archiveMerryMage2016-09-011-0/+4
|/ /
* | Merge pull request #2032 from bunnei/qt-graphicsbunnei2016-09-0121-82/+251
|\ \ | | | | | | Qt graphics configure & V-Sync option
| * | qt: Rename all "toogle" to "toggle".bunnei2016-09-016-24/+24
| | |
| * | qt: Add an option to settings for enabling V-Sync.bunnei2016-08-301-0/+4
| | |
| * | qt: Recreate GL context on startup to support changing V-Sync.bunnei2016-08-303-25/+39
| | |
| * | system: Add a function to see if the emulator is running.bunnei2016-08-302-0/+11
| | |
| * | config: Add a setting for graphics V-Sync.bunnei2016-08-309-1/+20
| | |
| * | qt: Add a configuration tab for Graphics and move relevant fields.bunnei2016-08-308-48/+169
| | |
* | | Merge pull request #2035 from MerryMage/disable-stretchbunnei2016-09-0115-16/+83
|\ \ \ | |_|/ |/| | User-configurable option to enable/disable time-stretching of audio
| * | configure_audio: User-configuratble option to enable/disable audio stretchingMerryMage2016-08-317-0/+24
| | |
| * | audio_core: Add EnableStretching to interface so that one can toggle stretching on and offMerryMage2016-08-314-9/+52
| | |
| * | sink: Change EnqueueSamples to take a pointer to a buffer instead of a std::vectorMerryMage2016-08-315-9/+9
|/ /
* | Merge pull request #2034 from JayFoxRox/avoid-glsl-errorbunnei2016-08-311-0/+1
|\ \ | | | | | | OpenGL: Avoid error on unsupported lighting LUT
| * | OpenGL: Avoid error on unsupported lighting LUTJannik Vogel2016-08-301-0/+1
|/ /
* | Merge pull request #2023 from yuriks/autobase-bcfntbunnei2016-08-303-30/+68
|\ \ | |/ |/| Auto-detect original shared_font.bin memory base
| * Auto-detect original shared_font.bin memory baseYuri Kunde Schlesner2016-08-273-30/+68
| | | | | | | | | | This allows a file dumped from either an o3DS or a n3DS (and potentially even an original unrebased file) to be used.
* | Merge pull request #2029 from JayFoxRox/appveyor-cachebunnei2016-08-291-0/+4
|\ \ | | | | | | AppVeyor: Cache chocolatey packages
| * | AppVeyor: Cache chocolatey packagesJannik Vogel2016-08-291-0/+4
|/ /
* | Merge pull request #1948 from wwylele/cro++Yuri Kunde Schlesner2016-08-2914-99/+3041
|\ \ | | | | | | Implemented CRO
| * | LDR: Implement CROwwylele2016-08-279-99/+3013
| | |
| * | ARM: add ClearInstructionCache functionwwylele2016-08-273-0/+11
| | |
| * | Memory: add ReadCString functionwwylele2016-08-272-0/+17
| |/
* | Merge pull request #1987 from Lectem/ipcdescriptorsYuri Kunde Schlesner2016-08-275-22/+110
|\ \ | |/ |/| fix #1942 and add a few IPC functions for descriptors
| * fix #1942 and adds a few IPC functions for descriptorsLectem2016-08-025-22/+110
| |
* | Merge pull request #2022 from MerryMage/issue-tplbunnei2016-08-261-0/+25
|\ \ | | | | | | .github: Add ISSUE_TEMPLATE.md
| * | .github: Add ISSUE_TEMPLATE.mdMerryMage2016-08-261-0/+25
| | |
* | | Merge pull request #2015 from MerryMage/upstream-smlabunnei2016-08-231-2/+4
|\ \ \ | | | | | | | | dyncom: Read-after-write in SMLA
| * | | dyncom: Read-after-write in SMLAMerryMage2016-08-221-2/+4
|/ / / | | | | | | | | | | | | In the case when RD === RN, RD was updated before AddOverflow was called to check for an overflow, resulting in an incorrect state of the Q flag.
* | | citra: Default to HW renderer.bunnei2016-08-163-4/+4
| | |
* | | qt: Use 5.7 on Windows.bunnei2016-08-161-1/+1
| | |
* | | Merge pull request #2004 from MerryMage/stmYuri Kunde Schlesner2016-08-151-3/+4
|\ \ \ | | | | | | | | Dyncom: Correct implementation of STM for R15
| * | | Dyncom: Correct implementation of STM for R15MerryMage2016-08-141-3/+4
|/ / /
* | | Merge pull request #1936 from jroweboy/qt5.7-fixbunnei2016-08-082-6/+8
|\ \ \ | |_|/ |/| | CMake: Fix for QT 5.7 overwriting -std=c++1y flag
| * | CMake: Fix for QT 5.7 overwriting -std=c++1y flagJames Rowe2016-08-052-6/+8
|/ / | | | | | | | | | | | | In QT 5.7 they added a new check for CXX features which appends a minimum required standard to the CXX_FLAGS. Because we were writing the flag directly previously, cmake assumed it needed to add a c++11 flag to the build. This tells cmake to use c++14 on every build.
* | Input GUI: Add tab to remap controls (#1900)Anon2016-07-299-8/+825
| |
* | Merge pull request #1950 from JamePeng/fix-apt-0x0055004-and-0x00560000bunnei2016-07-295-22/+31
|\ \ | | | | | | Correct APT::0x00550040 and APT::0x00560000 function
| * | Correct APT::0x00550040 and APT::0x00560000 functionJamePeng2016-07-155-22/+31
| | |
* | | Merge pull request #1983 from hrydgard/font-reminderbunnei2016-07-281-0/+7
|\ \ \ | | | | | | | | Shared font file: Instead of segfaulting, log an error to remind the user to dump it
| * | | Instead of segfaulting, log an error to remind the user to dump the shared font fileHenrik Rydgard2016-07-281-0/+7
|/ / /
* | | Merge pull request #1959 from MerryMage/revsh-upstreambunnei2016-07-281-4/+13
|\ \ \ | | | | | | | | dyncom: Fix translation of thumb REVSH
| * | | dyncom: Fix translation of thumb REVSHMerryMage2016-07-281-4/+13
| | |/ | |/|
* | | Merge pull request #1966 from dwhinham/info_plist_fixbunnei2016-07-261-1/+1
|\ \ \ | | | | | | | | CMake: Fix Info.plist template for citra_qt/OSX
| * | | CMake: Fix Info.plist template for citra_qt/OSXDale Whinham2016-07-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Info.plist template incorrectly uses parentheses instead of curly braces, which means that building the .app bundle using regular 'make' results in the variable not being replaced, and hence the app bundle won't start because the executable name is incorrect. This commit fixes this issue.
* | | | Travis Build: OS X Startup Crash Fix (#1962)Andy Tran2016-07-261-0/+91
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Travis: Mac OS X Build Fix Addresses the issue of the nightly builds crashing on OS X. In short, the changes needed were to rename the references within the binaries in order to make the app “self-contained”. * Travis: Mac OS X Terminal Launches citra with a terminal (instead of going straight for the QT application, skipping the debugging terminal). * Travis: Clean Up Lines * Travis: Fix of EOL Issue * Travis: Merge Fixes from Build Branch * Travis: Forward OS X Arguments * Travis: Forward OS X Arg x2 The issue is, is that sure “open citra-qt.app —args test” works, but drag and drop doesn’t! * Travis: Something needed to be escaped
* | | | Merge pull request #1974 from LittleWhite-tb/crash_invalid_sizebunnei2016-07-251-4/+3
|\ \ \ \ | | | | | | | | | | Protection against a resize of size 0
| * | | | Protection against a resize of size 0Alexandre LittleWhite Laurent2016-07-231-4/+3
| | | | |
* | | | | Merge pull request #1973 from linkmauve/no-sse4.1Yuri Kunde Schlesner2016-07-231-5/+0
|\ \ \ \ \ | |/ / / / |/| | | | Remove the -msse4.1 on ¬MSVC
| * | | | Remove the -msse4.1 on ¬MSVC.Emmanuel Gil Peyrot2016-07-231-5/+0
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | This option makes the generated binary crash with an illegal instruction when the target CPU doesn’t support the SSE4.1 extension (see #1968), with no noticeable performance increase compared to a generic build.
* | | | Merge pull request #1963 from wwylele/rtcYuri Kunde Schlesner2016-07-233-3/+61
|\ \ \ \ | |/ / / |/| | | Implement actual system time
| * | | CoreTiming: avoid overflowwwylele2016-07-231-1/+1
| | | |
| * | | HLE: implement system timewwylele2016-07-232-2/+60
|/ / /
* | | Merge pull request #1964 from Lectem/sdl2_dll_copy_fixbunnei2016-07-211-0/+9
|\ \ \ | |_|/ |/| | Fixes SDL2.dll copy to bindir on windows
| * | Fixes SDL2.dll copy to bindir on windowsLectem2016-07-211-0/+9
|/ /
* | Merge pull request #1890 from LFsWang/fix-encode-problembunnei2016-07-151-0/+22
|\ \ | | | | | | Fix boot_filename encode on Windows
| * | Fix boot_filename encode on WindowsLFsWang2016-06-081-0/+22
| | |
* | | Merge pull request #1894 from wwylele/set-config-blockYuri Kunde Schlesner2016-07-1014-41/+703
|\ \ \ | | | | | | | | Implement config savegame editing & clean up
| * | | Qt: add system settings config tabwwylele2016-07-108-4/+450
| | | |
| * | | Service::CFG/FS: add and refactor out utilities for front-endwwylele2016-07-034-15/+146
| | | |
| * | | Service::CFG: move known block ID to an enumwwylele2016-07-031-11/+25
| | | |
| * | | Service::CFG: add SetConfigInfoBlk4wwylele2016-07-034-8/+73
| | | |
| * | | Service::CFG: add missing languagewwylele2016-07-021-1/+2
| | | |
| * | | Service::CFG: name sound output modeswwylele2016-07-022-2/+7
| | |/ | |/|
* | | Merge pull request #1940 from JamePeng/fix-archive-error-codebunnei2016-07-072-10/+15
|\ \ \ | | | | | | | | Fix the errorcode of archive handle
| * | | Fix the errorcode of archive handleJamePeng2016-07-042-10/+15
| | | |
* | | | Merge pull request #1921 from Subv/fs_funcsSebastian Valle2016-07-051-11/+42
|\ \ \ \ | | | | | | | | | | HLE/FS: Document some command parameters and implemented command 0x08560240
| * | | | HLE/FS: Document some command parameters and implemented command 0x08560240 (CreateLegacySystemSaveData)Subv2016-07-031-11/+42
| | | | |
* | | | | Merge pull request #1850 from mailwl/erreulaSebastian Valle2016-07-045-0/+118
|\ \ \ \ \ | |_|/ / / |/| | | | HLE/Applets: Implement ErrEula applet
| * | | | HLE/Applets: Implement ErrEula appletmailwl2016-07-045-0/+118
|/ / / /
* | | | Merge pull request #1935 from wwylele/fix-result-moduleSebastian Valle2016-07-031-6/+19
|\ \ \ \ | | | | | | | | | | Result: Update the ErrorModule enum
| * | | | Result: fix and update ErrorModulewwylele2016-06-301-6/+19
| | |/ / | |/| |
* | | | Merge pull request #1933 from yuriks/scissorYuri Kunde Schlesner2016-07-026-3/+112
|\ \ \ \ | |/ / / |/| | | PICA: Implement scissor test
| * | | OpenGL: Add scaled resolution support to scissorYuri Kunde Schlesner2016-06-284-3/+16
| | | |
| * | | PICA: Scissor fixes and cleanupsYuri Kunde Schlesner2016-06-285-45/+39
| | | |
| * | | PICA: Implement scissor testSubv2016-06-285-3/+105
| | | |
* | | | Merge pull request #1869 from wwylele/dont-be-lazyYuri Kunde Schlesner2016-06-291-2/+6
|\ \ \ \ | | | | | | | | | | Switch context to the same thread if necessary
| * | | | Switch context on the same thread if necessarywwylele2016-05-301-2/+6
| | | | |
* | | | | Merge pull request #1867 from mailwl/srv-updatebunnei2016-06-292-15/+125
|\ \ \ \ \ | |_|/ / / |/| | | | srv: Update according 3dbrew
| * | | | Fix parameter name in EnableNotificationmailwl2016-05-312-2/+6
| | | | |
| * | | | Fix mistakes, add output header codesmailwl2016-05-311-8/+24
| | | | |
| * | | | remove ugly functionmailwl2016-05-311-35/+3
| | | | |
| * | | | srv: Update according 3dbrewmailwl2016-05-311-15/+137
| | | | |
* | | | | Merge pull request #1930 from scurest/superfluous-movesYuri Kunde Schlesner2016-06-252-2/+2
|\ \ \ \ \ | | | | | | | | | | | | Remove superfluous std::move in return std::move(local_var)
| * | | | | Remove superfluous std::move in return std::move(local_var)scurest2016-06-252-2/+2
|/ / / / /
* | | | | Merge pull request #1926 from JayFoxRox/gplbunnei2016-06-243-4/+10
|\ \ \ \ \ | | | | | | | | | | | | Add GPL license.txt and README.md to builds
| * | | | | Add GPL license.txt and README.md to buildsJannik Vogel2016-06-213-4/+10
| | | | | |
* | | | | | Merge pull request #1923 from yuriks/fix-recursivebunnei2016-06-223-22/+15
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Fix recursive scanning of directories
| * | | | | Fix recursive scanning of directoriesYuri Kunde Schlesner2016-06-193-22/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ForeachDirectoryEntry didn't actually do anything with the `recursive` parameter, and the corresponding callback parameter was shadowing the actual recursion counters in the user functions.
* | | | | | Merge pull request #1922 from yuriks/microprofile-dpi-fixbunnei2016-06-211-7/+6
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Qt: Fix MicroProfile dpi scaling
| * | | | | Qt: Fix MicroProfile dpi scalingYuri Kunde Schlesner2016-06-191-7/+6
|/ / / / /
* | | | | Merge pull request #1877 from wwylele/wait-fix-timeoutbunnei2016-06-181-0/+49
|\ \ \ \ \ | | | | | | | | | | | | Thread: update timeout when reruning WaitSynch
| * | | | | Thread: update timeout when rerunning WaitSynchwwylele2016-06-041-0/+49
| | | | | |
* | | | | | Merge pull request #1917 from lioncash/cibunnei2016-06-174-24/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | CI: Use Qt 5 and GCC 6 on Ubuntu CI builds
| * | | | | | CMakeLists: Drop support for Qt 4Lioncash2016-06-171-11/+2
| | | | | | |
| * | | | | | travis: Use GCC 6 on Ubuntu CI buildsLioncash2016-06-173-6/+6
| | | | | | |
| * | | | | | travis: Use Qt 5 on Ubuntu CI buildsLioncash2016-06-172-7/+11
|/ / / / / /
* | | | | | Merge pull request #1898 from archshift/interpreter-split-take2bunnei2016-06-165-2727/+2729
|\ \ \ \ \ \ | | | | | | | | | | | | | | Refactor arm_dyncom_interpreter into several files (take 2)
| * | | | | | Make arm_dyncom_trans* into a fully fledged compilation unitarchshift2016-06-124-53/+73
| | | | | | |
| * | | | | | arm_dyncom_interpreter: slightly change AllocBuffer to be intuitivearchshift2016-06-121-15/+15
| | | | | | |
| * | | | | | arm_dyncom_interpreter: Add specialized GetAddressingOpLoadStoreT funcarchshift2016-06-112-39/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows us to get the addressing operation for STRT, LDRT, STRBT, and LDRBT. We do this so that translation functions don't need to see the addressing ops directly.
| * | | | | | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-112-34/+34
| | | | | | |
| * | | | | | arm_dyncom_interpreter: Rename anonymous enum to TransExtDataarchshift2016-06-114-166/+164
| | | | | | |
| * | | | | | arm_dyncom_interpreter.cpp: #include translation info from inc filesarchshift2016-06-113-2648/+2652
| | | | | | |
* | | | | | | Merge pull request #1912 from yuriks/fix-win-deploybunnei2016-06-151-5/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix AppVeyor WinSCP download
| * | | | | | | Fix AppVeyor WinSCP downloadYuri Kunde Schlesner2016-06-151-5/+3
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1875 from JayFoxRox/fogbunnei2016-06-159-48/+253
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Implement standard fog (fog mode 5)
| * | | | | | OpenGL: Implement fogJannik Vogel2016-06-075-7/+124
| | | | | | |
| * | | | | | Rasterizer: Implement fogJannik Vogel2016-06-071-21/+52
| | | | | | |
| * | | | | | Pica: Add fog stateJannik Vogel2016-06-073-14/+69
| | | | | | |
| * | | | | | OpenGL: Avoid undefined behaviour for UNIFORM_BLOCK_DATA_SIZEJannik Vogel2016-06-072-6/+8
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1842 from Subv/portsbunnei2016-06-128-3/+178
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel: Added ClientPort and ServerPort classes, along with svcCreatePort.
| * | | | | | Kernel/SVC: Implemented svcCreatePort.Subv2016-06-116-3/+41
| | | | | | |
| * | | | | | Kernel: Added ClientPort and ServerPort classes.Subv2016-06-056-2/+139
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is part of an ongoing effort to implement support for multiple processes.
* | | | | | | Merge pull request #1899 from wwylele/hid-cmathbunnei2016-06-111-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | HID: add missing header
| * | | | | | | hid: add missing headerwwylele2016-06-111-0/+2
|/ / / / / / /
* | | | | | | Merge pull request #1897 from linkmauve/sdl2-config-fixMat M2016-06-111-1/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | SDL2: Add forgotten default config changes from 7129611e65096ba2cbe8266f6cb068a9b18981d8
| * | | | | | | SDL2: Add forgotten default config changes from 7129611e65096ba2cbe8266f6cb068a9b18981d8.Emmanuel Gil Peyrot2016-06-111-1/+5
| | | | | | | |
* | | | | | | | Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-1112-75/+315
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Refactor input mapping & implement circle pad modifier
| * | | | | | | fixup! fixup! Refactor input systemwwylele2016-05-153-8/+8
| | | | | | | |
| * | | | | | | fixup! Refactor input systemwwylele2016-05-152-20/+24
| | | | | | | |
| * | | | | | | implement circle pad modifierwwylele2016-05-156-5/+37
| | | | | | | |
| * | | | | | | Refactor input subsystemwwylele2016-05-1512-75/+279
| | | | | | | |
* | | | | | | | Merge pull request #1896 from citra-emu/revert-1893-interpreter-splitarchshift2016-06-115-2731/+2727
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Revert "Split huge interpreter source file into translation info and interpreter (+ some tiny misc style fixes)"
| * | | | | | | | Revert "Split huge interpreter source file into translation info and interpreter (+ some tiny misc style fixes)"archshift2016-06-115-2731/+2727
|/ / / / / / / /
* | | | | | | | Merge pull request #1893 from archshift/interpreter-splitMat M2016-06-095-2727/+2731
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Split huge interpreter source file into translation info and interpreter (+ some tiny misc style fixes)
| * | | | | | | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-092-42/+42
| | | | | | | |
| * | | | | | | arm_dyncom_interpreter.cpp: Split by translation and interpreter logicarchshift2016-06-095-2727/+2731
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | To facilitate the split, some small changes were made to names of various structures and functions.
* | | | | | | Merge pull request #1891 from shinyquagsire23/gdb-E0-fixTony Wasserka2016-06-081-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gdbstub: E0 should be E00
| * | | | | | | gdbstub: E0 should be E00shinyquagsire232016-06-081-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1765 from JayFoxRox/debug-surface-viewerbunnei2016-06-089-583/+876
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Debugger: Pica surface viewer
| * | | | | | citra_qt: Replace 'Pica Framebuffer Debugger' with 'Pica Surface Viewer'Jannik Vogel2016-05-079-583/+876
| | | | | | |
* | | | | | | Merge pull request #1873 from archshift/remove-configbunnei2016-06-066-671/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Remove unused and bitrotted "controller config" files
| * | | | | | | Remove unused and bitrotted "controller config" filesarchshift2016-06-026-671/+0
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1884 from lioncash/dlpbunnei2016-06-0610-23/+150
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | service: Add other DLP services
| * | | | | | service: Add other DLP servicesLioncash2016-06-0510-23/+150
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Specifically, dlp::CLNT and dlp::FKCL Moves them to their own folder like with other services.
* | | | | | Merge pull request #1863 from mailwl/gpu-threadid-resetbunnei2016-06-033-16/+23
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueue
| * | | | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueuemailwl2016-06-013-16/+23
| | | | | |
* | | | | | Merge pull request #1871 from LFsWang/prevent-load-warn-msgbunnei2016-06-021-3/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | AddFstEntriesToGameList - prevent loading a directory as a file
| * | | | | AddFstEntriesToGameList - prevent loading a directoryLFsWang2016-06-011-3/+3
|/ / / / /
* | | | | Merge pull request #1812 from JayFoxRox/refactor-shaderbunnei2016-06-014-64/+81
|\ \ \ \ \ | |_|_|/ / |/| | | | Retrieve shader result from new OutputRegisters-type
| * | | | Retrieve shader result from new OutputRegisters-typeJannik Vogel2016-05-164-64/+81
| | | | |
* | | | | Merge pull request #1751 from linkmauve/no-recursive-readdirbunnei2016-05-314-30/+43
|\ \ \ \ \ | |_|_|_|/ |/| | | | Make recursive FileUtil functions take a maximum recursion
| * | | | Common: Make recursive FileUtil functions take a maximum recursionEmmanuel Gil Peyrot2016-05-214-30/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes #1115. Also improves the performances of DiskArchive’s directory implementation a lot, simply by not going through the entire tree instead of just listing the first level files. Thanks to JayRoxFox for rebasing this on current master!
* | | | | Merge pull request #1692 from Subv/rm_getpointer2bunnei2016-05-3018-139/+458
|\ \ \ \ \ | | | | | | | | | | | | Memory: Remove most usages of GetPointer
| * | | | | Memory: Handle RasterizerCachedMemory and RasterizerCachedSpecial page types in the memory block manipulation functions.Subv2016-05-282-2/+60
| | | | | |
| * | | | | Memory: Make ReadBlock and WriteBlock accept void pointers.Subv2016-05-285-21/+19
| | | | | |
| * | | | | SOC_U: Remove usage of GetPointerSubv2016-05-281-27/+73
| | | | | |
| * | | | | SSL_C: Remove use of Memory::GetPointerMerryMage2016-05-281-4/+3
| | | | | |
| * | | | | GSP_GPU: Remove use of Memory::GetPointerMerryMage2016-05-281-33/+50
| | | | | |
| * | | | | Memory: CopyBlockMerryMage2016-05-282-2/+43
| | | | | |
| * | | | | DSP_DSP: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+10
| | | | | |
| * | | | | FS/Archive: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+14
| | | | | |
| * | | | | CFG: Remove use of Memory::GetPointerMerryMage2016-05-211-6/+10
| | | | | |
| * | | | | APT: Remove use of Memory::GetPointerMerryMage2016-05-215-35/+36
| | | | | |
| * | | | | Kernel/Thread: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| | | | | |
| * | | | | Applets/swkdb: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| | | | | |
| * | | | | Memory: ZeroBlockMerryMage2016-05-212-0/+39
| | | | | |
| * | | | | FileSys/Path: Replace Memory::GetPointer with Memory::ReadBlockMerryMage2016-05-211-6/+6
| | | | | |
| * | | | | Debugger/Callstack: Replace Memory::GetPointer with Memory::IsValidVirtualAddressMerryMage2016-05-211-1/+4
| | | | | |
| * | | | | Memory: ReadBlock/WriteBlockMerryMage2016-05-213-4/+81
| | | | | |
| * | | | | Memory: IsValidVirtualAddress/IsValidPhysicalAddressMerryMage2016-05-213-0/+26
| |/ / / /
* | | | | Merge pull request #1756 from wwylele/config-cleanupbunnei2016-05-291-29/+13
|\ \ \ \ \ | | | | | | | | | | | | Config block: clean up
| * | | | | clean up config blockwwylele2016-05-031-29/+13
| | | | | |
* | | | | | Merge pull request #1857 from MerryMage/rotr-rotlbunnei2016-05-281-12/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | common_funcs: Provide rotr and rotl for MSVC
| * | | | | | common_funcs: Provide rotr and rotl for MSVCMerryMage2016-05-271-12/+18
| | | | | | |
* | | | | | | Merge pull request #1568 from JayFoxRox/fix-printfMat M2016-05-273-26/+61
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix ftoi and disable VFPv3
| * | | | | | | Fix ftoi behaviourJannik Vogel2016-05-162-22/+53
| | | | | | | |
| * | | | | | | Respect fpscr in ftoizJannik Vogel2016-05-162-4/+4
| | | | | | | |
| * | | | | | | Disable VFP3 instructionsJannik Vogel2016-05-161-0/+4
| | | | | | | |
* | | | | | | | Merge pull request #1810 from JayFoxRox/fix-float-exceptionsbunnei2016-05-273-91/+130
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fix float exceptions
| * | | | | | | | Remove `exceptions` parameter from `normaliseround` VFP functionsJannik Vogel2016-05-183-28/+57
| | | | | | | | |
| * | | | | | | | Fix exception propagation for VFP single precisionJannik Vogel2016-05-182-33/+38
| | | | | | | | |
| * | | | | | | | Fix exception propagation for VFP double precisionJannik Vogel2016-05-182-34/+39
| | | | | | | | |
* | | | | | | | | Merge pull request #1846 from JayFoxRox/missing-dirty-lightingbunnei2016-05-264-43/+140
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | OpenGL: Set shader_dirty on lighting changes
| * | | | | | | | | OpenGL: Set shader_dirty on lighting changesJannik Vogel2016-05-231-0/+23
| | | | | | | | | |
| * | | | | | | | | Pica: Name LightSrc.config registerJannik Vogel2016-05-232-17/+15
| | | | | | | | | |
| * | | | | | | | | Pica: Name lighting.config0 and .config1 registersJannik Vogel2016-05-232-18/+18
| | | | | | | | | |
| * | | | | | | | | OpenGL: Use uniforms for dist_atten_bias and dist_atten_scaleJannik Vogel2016-05-233-8/+84
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1855 from MerryMage/memory-headers-20160526Mat M2016-05-262-1/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Memory: Added necessary headers and removed unnecessary header
| * | | | | | | | | | Memory: Added necessary headers and removed unnecessary headerMerryMage2016-05-262-1/+2
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1817 from linkmauve/smdh-stuffbunnei2016-05-2514-167/+229
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Improve SMDH support in loaders and frontends
| * | | | | | | | | | Loader: Split SMDH into its own header and import helpers from QGameListEmmanuel Gil Peyrot2016-05-215-89/+149
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also rewrite Qt wrappers to use those.
| * | | | | | | | | | CitraQt: Simplify the game list loader codeEmmanuel Gil Peyrot2016-05-215-34/+18
| | | | | | | | | | |
| * | | | | | | | | | Loader: Add a GetFileType method to get the type of a loaded fileEmmanuel Gil Peyrot2016-05-214-0/+30
| | | | | | | | | | |
| * | | | | | | | | | Loader, Frontends: Refactor loader creation and game loadingEmmanuel Gil Peyrot2016-05-216-49/+37
| | |_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows frontends to keep a single loader and use it multiple times e.g. for code loading and SMDH parsing.
* | | | | | | | | | New3DS: Minor style cleanup to #1520.bunnei2016-05-244-6/+6
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1520 from JamePeng/checknew3dsbunnei2016-05-2411-14/+145
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Implement CheckNew3DS and CheckNew3DSApp
| * | | | | | | | | | Implement CheckNew3DS and CheckNew3DSAppJamePeng2016-04-2011-14/+145
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Append an item[is_new3ds] to config file[System] group Implement APT::SetNSStateField,it will update the unknown NS_state_field
* | | | | | | | | | | Merge pull request #1733 from lioncash/vert_loaderbunnei2016-05-243-11/+23
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | VertexLoader: Minor changes
| * | | | | | | | | | vertex_loader: Correct forward declaration of InputVertexLioncash2016-05-091-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's actually a struct, not a class.
| * | | | | | | | | | vertex_loader: Provide an assertion for ensuring the loader has been setupLioncash2016-05-092-0/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also adds an assert to ensure that Setup is not called more than once during a VertexLoader's lifetime.
| * | | | | | | | | | vertex_loader: Add constructors to facilitate immediate and two-step initializationLioncash2016-05-092-2/+6
| | | | | | | | | | |
| * | | | | | | | | | vertex_loader: initialize_num_total_attributes.Lioncash2016-05-091-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the public API sane.
| * | | | | | | | | | vertex_loader: Use std::array instead of raw C arraysLioncash2016-05-091-6/+7
| | | | | | | | | | |
| * | | | | | | | | | vertex_loader: Correct header orderingLioncash2016-05-091-1/+1
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1837 from wwylele/sync-trapbunnei2016-05-231-2/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | SVC::WaitSynchronizationN: Reschedule at the end
| * | | | | | | | | | SVC::WaitSynchronizationN: Reschedule at the endwwylele2016-05-211-2/+3
| | | | | | | | | | |
* | | | | | | | | | | Appveyor: Restore working directory after test_script (#1835)Maribel2016-05-211-1/+1
| |_|_|/ / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #1564 from MerryMage/this-is-only-a-testbunnei2016-05-218-2/+47
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | tests: Infrastructure for unit tests
| * | | | | | | | | | Tests: Run tests on CIMerryMage2016-05-194-2/+16
| | | | | | | | | | |
| * | | | | | | | | | tests: Infrastructure for unit testsMerryMage2016-05-196-0/+31
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1816 from JayFoxRox/refactor-tev-dumpbunnei2016-05-212-91/+114
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Refactor Tev dump
| * | | | | | | | | | Refactor Tev stage dumperJannik Vogel2016-05-212-115/+114
| | | | | | | | | | |
| * | | | | | | | | | Extend Tev stage dumperJannik Vogel2016-05-211-14/+38
|/ / / / / / / / / /
* | / / / / / / / / Config: Restore previously selected audio sink option (#1824)James Rowe2016-05-201-3/+3
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #1797 from MerryMage/audio-mixerbunnei2016-05-205-10/+317
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | DSP/HLE: Implement mixer processing
| * | | | | | | | | DSP/HLE: Audio outputMerryMage2016-05-191-0/+7
| | | | | | | | | |
| * | | | | | | | | DSP/HLE: Implement mixer processingMerryMage2016-05-195-11/+311
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1785 from MerryMage/mp-dpibunnei2016-05-191-4/+12
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Microprofile: DPI-aware drawing
| * | | | | | | | | Microprofile: DPI-aware drawingMerryMage2016-05-121-4/+12
| | | | | | | | | |
* | | | | | | | | | Config: Audio sink configuration (#1798)Maribel2016-05-196-0/+134
| |_|_|_|/ / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #1814 from JayFoxRox/fix-read-after-writeMat M2016-05-181-4/+8
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix read-after-write in SMUAD, SMLAD, SMUSD, SMLSD
| * | | | | | | | | Fix read-after-write in SMUAD, SMLAD, SMUSD, SMLSDJannik Vogel2016-05-181-4/+8
|/ / / / / / / / /
* | | | | | | | | Update ACT:U and create ACT:A (#1809)András Domonkos2016-05-185-0/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Update ACT_U * Create act_a.h * Create act_a.cpp * Add service ACT:A * Add ACT:A source and header * Fix wrong header
* | | | | | | | | Merge pull request #1800 from JayFoxRox/set-fpscrbunnei2016-05-183-0/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Set fpscr for new threads
| * | | | | | | | | Set fpscr for new threadsJannik Vogel2016-05-173-0/+6
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1786 from JayFoxRox/blend-equationbunnei2016-05-174-0/+31
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / |/| | | | | | | | | OpenGL: Support blend equation
| * | | | | | | | | OpenGL: Support blend equationJannik Vogel2016-05-124-0/+31
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1787 from JayFoxRox/refactor-jitlinkmauve2016-05-166-32/+50
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | Refactor JIT
| * | | | | | | | Use new shader-jit signature for interpreterJannik Vogel2016-05-133-8/+8
| | | | | | | | |
| * | | | | | | | Refactor access to state in shader-jitJannik Vogel2016-05-134-24/+42
| | | | | | | | |
* | | | | | | | | Merge pull request #1792 from JayFoxRox/avoid-uninitialisedbunnei2016-05-162-11/+24
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Avoid uninitialised in hw renderer + Only sync depth if necessary
| * | | | | | | | | OpenGL: Only update depth uniforms if the depth changedJannik Vogel2016-05-142-9/+22
| | | | | | | | | |
| * | | | | | | | | OpenGL: value-initialize variables which cause uninitialised access otherwiseJannik Vogel2016-05-141-2/+2
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | DSP_DSP: Remove GetHeadphoneStatus logspam (#1799)Maribel2016-05-161-2/+2
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | AudioCore: Implement time stretcher (#1737)Maribel2016-05-154-0/+219
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * AudioCore: Implement time stretcher * fixup! AudioCore: Implement time stretcher * fixup! fixup! AudioCore: Implement time stretcher * fixup! fixup! fixup! AudioCore: Implement time stretcher * fixup! fixup! fixup! fixup! AudioCore: Implement time stretcher * fixup! fixup! fixup! fixup! fixup! AudioCore: Implement time stretcher
* | | | | | | | Merge pull request #1794 from Subv/regression_fixbunnei2016-05-141-0/+3
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Memory: Fixed a regression caused by #1695 and #1689.
| * | | | | | | Memory: Fixed a regression caused by #1695 and #1689.Subv2016-05-141-0/+3
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reserve enough space in the vector that holds the linear heap memory to prevent relocations of the backing memory when growing too much. Closes #1790
* | | | | | | Merge pull request #1689 from Subv/shmembunnei2016-05-1318-128/+417
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel: Implemented shared memory.
| * | | | | | | HLE/Applets: Give each applet its own block of heap memory, and use that when creating the framebuffer shared memory block.Subv2016-05-135-5/+44
| | | | | | | |
| * | | | | | | Kernel: Account for automatically-allocated shared memories in the amount of used linear heap memory.Subv2016-05-131-0/+5
| | | | | | | |
| * | | | | | | APT: Move the shared font loading and relocation functions to their own subdirectory services/apt/bcfnt.Subv2016-05-134-66/+167
| | | | | | | |
| * | | | | | | Kernel/SharedMemory: Log an error when Map fails.Subv2016-05-131-1/+10
| | | | | | | |
| * | | | | | | Kernel: Implemented shared memory permissions.Subv2016-05-134-9/+50
| | | | | | | |
| * | | | | | | APT: Implement relocating the shared font to its true address.Subv2016-05-131-9/+74
| | | | | | | |
| * | | | | | | Kernel/Memory: Remove the Shared Memory region from the legacy memory map.Subv2016-05-131-1/+0
| | | | | | | |
| * | | | | | | Kernel/SharedMemory: Properly implemented shared memory support.Subv2016-05-1310-118/+147
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Applications can request the kernel to allocate a piece of the linear heap for them when creating a shared memory object. Shared memory areas are now properly mapped into the target processes when calling svcMapMemoryBlock. Removed the APT Shared Font hack as it is no longer needed.
| * | | | | | | Kernel/SVC: Fixed the register order for svcCreateMemoryBlock.Subv2016-05-132-2/+3
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | R0 is used as the last parameter instead of R4.
* | | | | | | Merge pull request #1788 from MerryMage/ext-soundtouchTony Wasserka2016-05-131-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | gitmodules: citra-emu/soundtouch → citra-emu/ext-soundtouch
| * | | | | | gitmodules: citra-emu/soundtouch → citra-emu/ext-soundtouchMerryMage2016-05-131-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1695 from Subv/tls_allocbunnei2016-05-135-28/+74
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel/Threads: Dynamically allocate the TLS region for threads.
| * | | | | | Kernel/Threads: Dynamically allocate the TLS region for threads in the BASE region of the linear heap.Subv2016-05-075-28/+74
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Each thread gets a 0x200-byte area from the 0x1000-sized page, when all 8 thread slots in a single page are used up, the kernel allocates a new page to hold another 8 entries. This is consistent with what the real kernel does.
* | | | | | | Merge pull request #1783 from JayFoxRox/cleanup-shadersetupbunnei2016-05-137-50/+47
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Cleanup ShaderSetup (Part 1)
| * | | | | | Move program_counter and call_stack from UnitState to interpreterJannik Vogel2016-05-123-45/+42
| | | | | | |
| * | | | | | Move default_attributes into Pica stateJannik Vogel2016-05-125-5/+5
|/ / / / / /
* | | | | | Merge pull request #1690 from JayFoxRox/tex-type-3bunnei2016-05-127-38/+106
|\ \ \ \ \ \ | | | | | | | | | | | | | | Pica: Implement texture type 3 (Projection2D)
| * | | | | | OpenGL: Implement texture type 3Jannik Vogel2016-05-114-35/+67
| | | | | | |
| * | | | | | Rasterizer: Implement texture type 3Jannik Vogel2016-05-111-2/+27
| | | | | | |
| * | | | | | Pica: Add tc0.w to OutputVertexJannik Vogel2016-05-111-1/+2
| | | | | | |
| * | | | | | Pica: Add texture type to stateJannik Vogel2016-05-111-0/+10
| | | | | | |
* | | | | | | Merge pull request #1780 from JayFoxRox/shadersetup-classbunnei2016-05-125-58/+59
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Turn ShaderSetup into a class
| * | | | | | Turn ShaderSetup into structJannik Vogel2016-05-115-58/+59
|/ / / / / /
* | | | | | Merge pull request #1621 from JayFoxRox/w-bufferbunnei2016-05-116-14/+65
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implement W-buffer and fix depth-mapping
| * | | | | | OpenGL: Implement W-Buffers and fix depth-mappingJannik Vogel2016-05-103-4/+23
| | | | | | |
| * | | | | | Pica: Implement W-Buffer in SW rasterizerJannik Vogel2016-05-104-11/+43
| | | | | | |
* | | | | | | Merge pull request #1774 from lioncash/warnbunnei2016-05-101-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gdbstub: Silence missing prototype warnings
| * | | | | | | gdbstub: Silence missing prototype warningsLioncash2016-05-101-3/+3
| |/ / / / / /
* | | | | | | Merge pull request #1773 from lioncash/debug-buildMat M2016-05-101-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_rasterizer: Fix compilation for debug builds
| * | | | | | gl_rasterizer: Fix compilation for debug buildsLioncash2016-05-101-1/+1
|/ / / / / /
* | | | | | Merge pull request #1704 from JayFoxRox/pod-configlinkmauve2016-05-103-122/+164
|\ \ \ \ \ \ | | | | | | | | | | | | | | Pica: PicaShaderConfig is TC and cleared before use
| * | | | | | Pica: Use a union for PicaShaderConfigJannik Vogel2016-05-033-125/+139
| | | | | | |
| * | | | | | Pica: Add TevStageConfigRaw to PicaShaderConfig (MSVC workaround)Jannik Vogel2016-05-032-2/+23
| | | | | | |
| * | | | | | Pica: Make PicaShaderConfig trivially_copyable and clear it before useJannik Vogel2016-05-031-21/+28
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1771 from lioncash/userbunnei2016-05-101-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | dyncom: Reset the context into user mode correctly
| * | | | | | dyncom: Reset the context into user mode correctlyLioncash2016-05-091-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The other mode was system mode.
* | | | | | | Merge pull request #1770 from lioncash/formatbunnei2016-05-091-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | source: Fix missing logging arguments
| * | | | | | source: Fix missing logging argumentsLioncash2016-05-091-2/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | Silences two warnings on OSX.
* | | | | | Merge pull request #1768 from lioncash/swapbunnei2016-05-091-46/+22
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Swap: Minor changes
| * | | | | swap: Get rid of pointer casting for swapping structsLioncash2016-05-091-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | These shouldn't haphazardly convert types
| * | | | | swap: Get rid of undefined behavior in swapf and swapdLioncash2016-05-091-14/+18
| | | | | | | | | | | | | | | | | | | | | | | | This isn't well-defined in C++.
| * | | | | swap: Remove unused methodsLioncash2016-05-091-28/+0
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also gets rid of pointer data variants as this prevents the use of the regular swapping routines as unary predicates in std lib functions. They also cast to stricter alignment types, which is undefined behavior.
* | | | | Merge pull request #1766 from Subv/log_cpubunnei2016-05-083-0/+10
|\ \ \ \ \ | | | | | | | | | | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1)
| * | | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1).Subv2016-05-073-0/+10
| | |/ / / | |/| | | | | | | | | | | | | We do not currently implement any cores other than the AppCore (Core 0).
* | | | | Merge pull request #1718 from alex-laties/fixup-type-conversionsbunnei2016-05-0714-45/+55
|\ \ \ \ \ | | | | | | | | | | | | fixup simple type conversions where possible
| * | | | | fixup simple type conversions where possibleAlexander Laties2016-05-0714-45/+55
| | | | | |
* | | | | | Merge pull request #1761 from Subv/applets_fbbunnei2016-05-075-23/+44
|\ \ \ \ \ \ | |/ / / / / |/| | | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory
| * | | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory in the swkbd and MiiSelector applets.Subv2016-05-075-23/+44
| | |/ / / | |/| | |
* | | | | Merge pull request #1736 from MerryMage/sdl2-sinkbunnei2016-05-079-3/+182
|\ \ \ \ \ | | | | | | | | | | | | AudioCore: SDL2 Sink
| * | | | | AudioCore: SDL2 SinkMerryMage2016-05-079-3/+182
| | | | | |
* | | | | | HLE: Fix recent DSP change for Visual Studio.bunnei2016-05-071-4/+2
| | | | | |
* | | | | | Merge pull request #1544 from linkmauve/move-glad-initbunnei2016-05-073-6/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | Move glad initialisation to the frontend
| * | | | | | Frontends, VideoCore: Move glad initialisation to the frontendEmmanuel Gil Peyrot2016-05-063-6/+18
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On SDL2 this allows it to use SDL_GL_GetProcAddress() instead of the default function loader, and fixes a crash when using apitrace with an EGL context. On Qt we will need to migrate from QGLWidget to QOpenGLWidget and QOpenGLContext before we can use gladLoadGLLoader() instead of gladLoadGL(), since the former doesn’t expose a function loader.
* | | | | | Merge pull request #1764 from wwylele/how-can-i-find-this-if-i-have-only-decrypted-rombunnei2016-05-061-2/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | fix loader: return proper result
| * | | | | fix:return proper errorwwylele2016-05-061-2/+3
|/ / / / /
* | | | | Merge pull request #1762 from bunnei/globalbunnei2016-05-064-8/+21
|\ \ \ \ \ | | | | | | | | | | | | hle: Get rid of direct global access to g_reschedule
| * | | | | HLE: Rename RescheduleIsPending to IsReschedulePending.bunnei2016-05-063-3/+3
| | | | | |
| * | | | | hle: Get rid of global access to g_rescheduleLioncash2016-03-214-8/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This shouldn't be directly exposed if there's already a partial API that operates on it. We can just provide the rest of that API.
* | | | | | Merge pull request #1700 from wwylele/gamelist-iconbunnei2016-05-0610-37/+260
|\ \ \ \ \ \ | | | | | | | | | | | | | | Qt: display game icon and title in the game list
| * | | | | | add missing headerwwylele2016-05-041-0/+1
| | | | | | |
| * | | | | | make the name column larger as defaultwwylele2016-05-041-1/+5
| | | | | | |
| * | | | | | add icon & title to game listwwylele2016-05-049-36/+254
| | | | | | |
* | | | | | | Merge pull request #1706 from mailwl/mii-selectorSebastian Valle2016-05-052-0/+49
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Layout Mii parameters input/output, and return success as result of applet work
| * | | | | | | Layout Mii parameters input/output, and return success as result of applet workmailwl2016-05-052-0/+49
|/ / / / / / /
* | | | | | | Merge pull request #1757 from JayFoxRox/rename-vertexloaded-bpbunnei2016-05-054-10/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Pica: Rename VertexLoaded breakpoint to VertexShaderInvocation
| * | | | | | | Pica: Rename VertexLoaded breakpoint to VertexShaderInvocationJannik Vogel2016-05-044-10/+8
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1734 from MerryMage/dsp-hle-sourcebunnei2016-05-047-5/+496
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | DSP/HLE: Implement Source processing
| * | | | | | DSP/HLE: Implement Source processingMerryMage2016-05-037-5/+496
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1754 from JayFoxRox/fix-const_color-revertbunnei2016-05-031-2/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | OpenGL: Don't copy const_color (Reverts #1745)
| * | | | | | OpenGL: Don't copy const_color (Reverts #1745)Jannik Vogel2016-05-031-2/+3
|/ / / / / /
* | | | | | Merge pull request #1750 from JayFoxRox/cleanup-shader-inputbunnei2016-05-031-34/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Pica: Replace logic in shader.cpp with loop
| * | | | | | Pica: Replace logic in shader.cpp with loopJannik Vogel2016-05-031-34/+4
| | | | | | |
* | | | | | | Merge pull request #1732 from wwylele/config00170000bunnei2016-05-032-13/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | add config block 0x00170000; remove duplicated content
| * | | | | | remove duplicated function declarationwwylele2016-05-011-13/+0
| | | | | | |
| * | | | | | add config block 0x00170000wwylele2016-04-291-0/+4
| | | | | | |
* | | | | | | Merge pull request #1741 from linkmauve/iwyu-video_corebunnei2016-05-0146-88/+234
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix video_core includes (and dependencies) using include-what-you-use
| * | | | | | | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-3045-86/+234
| | | | | | | |
| * | | | | | | LCD: Remove unneeded #undef with no matching #define.Emmanuel Gil Peyrot2016-04-301-2/+0
| | | | | | | |
* | | | | | | | Merge pull request #1745 from JayFoxRox/fix-const_colorbunnei2016-05-011-30/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | OpenGL: Copy TevStageConfig using a loop. Fixes bug: const_color not copied
| * | | | | | | | OpenGL: Copy TevStageConfig using a loop. Fixes bug: const_color not copiedJannik Vogel2016-05-011-30/+11
|/ / / / / / / /
* / / / / / / / OpenGL: border_color was never set. Fixed. (#1740)Jannik Vogel2016-04-301-0/+1
|/ / / / / / /
* | | | | | | Merge pull request #1735 from JayFoxRox/remove-tgalinkmauve2016-04-303-62/+0
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Remove TGA dumper
| * | | | | | Remove TGA dumperJannik Vogel2016-04-303-62/+0
| | | | | | |
* | | | | | | Merge pull request #1729 from MerryMage/null-sinkbunnei2016-04-3013-4/+155
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Audio Config: Implement null sink and implement sink configuration
| * | | | | | Audio: Add sink selection to configuration filesMerryMage2016-04-3010-4/+79
| | | | | | |
| * | | | | | AudioCore: List of sink typesMerryMage2016-04-303-0/+46
| | | | | | |
| * | | | | | AudioCore: Implement NullSinkMerryMage2016-04-302-0/+30
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1650 from JamePeng/update-the-ndm-codebunnei2016-04-303-27/+420
|\ \ \ \ \ \ | | | | | | | | | | | | | | Update the stub code of NDM service!
| * | | | | | Update the stub code of NDM service!JamePeng2016-04-203-27/+420
| | | | | | |
* | | | | | | Merge pull request #1647 from mailwl/acu-closeasyncbunnei2016-04-302-1/+29
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ac:u: stub CloseAsync; align memory size in svc:GetProcessInfo(type=2)
| * | | | | | | ac:u: stub CloseAsync; check memory size aling in svc:GetProcessInfo(type=2)mailwl2016-04-212-1/+29
| | | | | | | |
* | | | | | | | Merge pull request #1699 from mailwl/gpu-rightsbunnei2016-04-301-2/+38
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functions
| * | | | | | | return checks if event and memory createdmailwl2016-04-231-1/+8
| | | | | | | |
| * | | | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functionsmailwl2016-04-221-8/+37
| | | | | | | |
* | | | | | | | Merge pull request #1726 from MerryMage/read-write-regionbunnei2016-04-293-26/+31
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | AudioCore: CurrentRegion() -> ReadRegion(), WriteRegion()
| * | | | | | | | AudioCore: CurrentRegion() -> ReadRegion(), WriteRegion()MerryMage2016-04-293-26/+31
| | | | | | | | |
* | | | | | | | | Merge pull request #1723 from MerryMage/audio-interpbunnei2016-04-293-0/+128
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | AudioCore: Implement interpolation
| * | | | | | | | | AudioCore: Implement interpolationMerryMage2016-04-293-0/+128
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1730 from hrydgard/vertex-loaderbunnei2016-04-296-121/+210
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Remove late accesses to attribute_config * Refactor: Extract VertexLoader from command_processor.cpp. Preparation for a similar concept to Dolphin or PPSSPP. These can be JIT-ed and cached. * Move "&" to their proper place, add missing includes and make some properly relative. * Don't keep base_address in the loader, it doesn't belong there (with it, the loader can't be cached). * Optimize the vertex loader, nearly doubling its speed. * Debugger fix * Move and rename the MemoryAccesses class to MemoryAccessTracker.
| * | | | | | | | | Move and rename the MemoryAccesses class to MemoryAccessTracker.Henrik Rydgard2016-04-294-32/+35
| | | | | | | | | |
| * | | | | | | | | Debugger fixHenrik Rydgard2016-04-281-2/+2
| | | | | | | | | |
| * | | | | | | | | Optimize the vertex loader, nearly doubling its speed.Henrik Rydgard2016-04-282-32/+54
| | | | | | | | | |
| * | | | | | | | | Don't keep base_address in the loader, it doesn't belong there (with it, the loader can't be cached).Henrik Rydgard2016-04-283-11/+10
| | | | | | | | | |
| * | | | | | | | | Move "&" to their proper place, add missing includes and make some properly relative.Henrik Rydgard2016-04-282-8/+11
| | | | | | | | | |
| * | | | | | | | | Refactor: Extract VertexLoader from command_processor.cpp.Henrik Rydgard2016-04-285-125/+185
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Preparation for a similar concept to Dolphin or PPSSPP. These can be JIT-ed and cached.
| * | | | | | | | | Remove late accesses to attribute_configHenrik Rydgard2016-04-281-5/+7
| | | | | | | | | |
* | | | | | | | | | Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-2913-306/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This has been entirely superseded by MicroProfile. The rest of the code can go when a simpler frametime/FPS meter is added to the GUI.
* | | | | | | | | | Make Citra build with MICROPROFILE_ENABLED set to 0 (#1709)Henrik Rydgård2016-04-295-1/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Make Citra build with MICROPROFILE_ENABLED set to 0 * Buildfix with microprofile kept on * moc did not like a dialog to conditionally exist. * Cleanup * Fix end of line
* | | | | | | | | | Merge pull request #1727 from MerryMage/minor-commitbunnei2016-04-283-12/+11
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | AudioCore: Move samples_per_frame and num_sources into hle/common.h
| * | | | | | | | | | AudioCore: Move samples_per_frame and num_sources into hle/common.hMerryMage2016-04-283-12/+11
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1722 from MerryMage/soundtouchbunnei2016-04-284-1/+10
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | Externals: Add soundtouch
| * | | | | | | | | Externals: Add soundtouchMerryMage2016-04-284-1/+10
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1708 from MerryMage/dsp_dspbunnei2016-04-276-76/+180
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | DSP Service: Cleanup
| * | | | | | | | | DSP_DSP: Fix log format strings and argumentsMerryMage2016-04-271-12/+20
| | | | | | | | | |
| * | | | | | | | | AudioCore: Hack to prevent regressions: Trigger Binary pipe interrupt every audio frameMerryMage2016-04-271-0/+2
| | | | | | | | | |
| * | | | | | | | | DSP_DSP: Add return IPC headersMerryMage2016-04-272-4/+27
| | | | | | | | | |
| * | | | | | | | | DSP_DSP: Updated interrupt implementationMerryMage2016-04-274-46/+113
| | | | | | | | | |
| * | | | | | | | | DSP/Pipe: There are 8 pipesMerryMage2016-04-252-13/+19
| | | | | | | | | |
| * | | | | | | | | DSP_DSP: Remove unused variableMerryMage2016-04-241-2/+0
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1721 from bunnei/cleanup-pr-1447bunnei2016-04-271-52/+89
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | y2r_u: Cleanup some formatting.
| * | | | | | | | | y2r_u: Cleanup some formatting.bunnei2016-04-271-52/+89
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1447 from JamePeng/update-y2r-servicebunnei2016-04-272-32/+357
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Update the code of service y2r!
| * | | | | | | | | Update the code of service y2r!JamePeng2016-04-202-32/+357
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1720 from linkmauve/fix-qtlinkmauve2016-04-261-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | Qt Frontend: Add Threads::Threads import in CMakeLists.txt
| * | | | | | | | Qt Frontend: Add Threads::Threads import in CMakeLists.txt.Emmanuel Gil Peyrot2016-04-261-1/+1
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This had been forgotten in df81fa11fc8972a5775a57ccde1e0ef8d7fbfe64. Fixes #1711.
* | | | | | | | Merge pull request #1710 from hrydgard/optimize-event-breakpointsbunnei2016-04-263-9/+16
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Replace std::map with std::array for graphics event breakpoints
| * | | | | | | | Replace std::map with std::array for graphics event breakpoints, and allow the compiler to inline. Saves 1%+ in vertex heavy situations.Henrik Rydgard2016-04-243-9/+16
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1714 from smspillaz/fix-1711bunnei2016-04-256-10/+15
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Fixes for #1711 and other compilation errors.
| * | | | | | | travis: Install cmake 3.1Sam Spilsbury2016-04-251-2/+3
| | | | | | | |
| * | | | | | | shader: Shader size is long uint, not uint.Sam Spilsbury2016-04-241-1/+1
| | | | | | | |
| * | | | | | | shader: Handle non-CALL opcodes with a breakSam Spilsbury2016-04-241-0/+2
| | | | | | | |
| * | | | | | | shader: Format string must be provided inline and not as a variableSam Spilsbury2016-04-241-1/+1
| | | | | | | |
| * | | | | | | am: title_id is long long uintSam Spilsbury2016-04-241-1/+1
| | | | | | | |
| * | | | | | | assert: Allow UNREACHABLE_MSG to have just one argumentSam Spilsbury2016-04-241-1/+1
| | | | | | | |
| * | | | | | | CMakeLists: Use imported version of Threads::ThreadsSam Spilsbury2016-04-242-4/+6
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This requires bumping up to a minimum of CMake 3.1. The benefit of using the imported target is that you can switch to the -pthread compiler flag on request, which may be necessary for some systems if available.
* | | | | | | Merge pull request #1576 from smspillaz/fix-build-errors-03272016bunnei2016-04-249-9/+29
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix various build errors encountered on Clang 3.9 on OS X
| * | | | | | | assert: Add _MSG variations for UNREACHABLE and UNIMPLEMENTEDSam Spilsbury2016-04-231-0/+2
| | | | | | | |
| * | | | | | | pica: Handle default lighting caseSam Spilsbury2016-04-231-1/+6
| | | | | | | |
| * | | | | | | ncch: Use correct format specifier (for long long uint)Sam Spilsbury2016-04-231-1/+1
| | | | | | | |
| * | | | | | | fs: Fix what appears to be a typo (filename_size / file_size)Sam Spilsbury2016-04-231-1/+1
| | | | | | | |
| * | | | | | | gdbstub: Don't check if unsigned int is > 0Sam Spilsbury2016-04-231-2/+2
| | | | | | | |
| * | | | | | | debugger: Warn if we reach an unreachable formatSam Spilsbury2016-04-231-0/+6
| | | | | | | |
| * | | | | | | microprofileui: Use correct printf specifierSam Spilsbury2016-04-231-0/+5
| | | | | | | |
| * | | | | | | microprofile: Use std::absSam Spilsbury2016-04-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using the global-namespace C function will cause the wrong overload to get picked
| * | | | | | | CMakeLists: Use CMAKE_THREAD_LIBS_INITSam Spilsbury2016-04-232-3/+5
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1705 from LittleWhite-tb/compat_gcc49bunnei2016-04-231-0/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Protect use of std::is_trivially_copyable to compile with GCC 4.9
| * | | | | | Protect use of std::is_trivially_copyable to compile with GCC 4.9LittleWhite2016-04-231-0/+4
|/ / / / / /
* | | | | | Merge pull request #1697 from tfarley/hw-lighting-syncbunnei2016-04-222-9/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | HWRasterizer: Lighting Sync + Cleanup
| * | | | | | HWRasterizer: reorder declarations to match defstfarley2016-04-221-9/+9
| | | | | | |
| * | | | | | HWRasterizer: sync specular uniform for new shaderstfarley2016-04-221-0/+2
|/ / / / / /
* | | | | | Merge pull request #1436 from tfarley/hw-tex-forwardingbunnei2016-04-2230-941/+1739
|\ \ \ \ \ \ | | | | | | | | | | | | | | Hardware Renderer Texture Forwarding
| * | | | | | HWRasterizer: Texture forwardingtfarley2016-04-2120-940/+1719
| | | | | | |
| * | | | | | Config: Add scaled resolution optiontfarley2016-04-219-1/+20
| | | | | | |
| * | | | | | Update to ext-boost with interval_maptfarley2016-04-211-0/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1655 from JayFoxRox/hw-dot3bunnei2016-04-211-0/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | OpenGL: Implement color combiner Operation::Dot3_RGB
| * | | | | OpenGL: Implement color combiner Operation::Dot3_RGBJannik Vogel2016-04-101-0/+3
| | | | | |
* | | | | | Merge pull request #1691 from linkmauve/improve-sdl-optionsbunnei2016-04-201-9/+20
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | SDL2 Frontend: Use argv[0], add a --version, and reorder options
| * | | | | SDL2 Frontend: Use argv[0], add a --version, and reorder options.Emmanuel Gil Peyrot2016-04-201-9/+20
|/ / / / /
* | | | | Merge pull request #1672 from wwylele/win-driver-fixbunnei2016-04-191-3/+12
|\ \ \ \ \ | | | | | | | | | | | | Fix driver root identification on Windows
| * | | | | fix driver root identification on Windowswwylele2016-04-151-3/+12
| | | | | |
* | | | | | Merge pull request #1612 from ObsidianX/get-set-sockoptbunnei2016-04-191-3/+97
|\ \ \ \ \ \ | | | | | | | | | | | | | | SOC:U GetSockOpt/SetSockOpt
| * | | | | | Rework sockopt translation to match the error translation code already in placeRyan Loebs2016-04-021-22/+30
| | | | | | |
| * | | | | | Code styleRyan Loebs2016-03-301-2/+2
| | | | | | |
| * | | | | | Added GetSockOptNameRyan Loebs2016-03-301-15/+58
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Filter out and translate invalid sockopt names.
| * | | | | | Derp: win32: typedef int socklen_t;Ryan Loebs2016-03-291-4/+0
| | | | | | |
| * | | | | | But of course, Windows uses 'int' while Linux uses 'socklen_t'Ryan Loebs2016-03-291-0/+4
| | | | | | |
| * | | | | | Compiling on Windows nowRyan Loebs2016-03-291-3/+3
| | | | | | |
| * | | | | | Formatting...Ryan Loebs2016-03-291-1/+1
| | | | | | |
| * | | | | | Addressing PR commentsRyan Loebs2016-03-291-4/+4
| | | | | | |
| * | | | | | SOC UpdatesRyan Loebs2016-03-291-3/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | -Implement GetSockOpt / SetSockOpt -Fix bug in RecvFrom where sending from localhost does not fill in src_addr/src_addr_len on Linux
* | | | | | | Merge pull request #1625 from JayFoxRox/sw-blend-funcbunnei2016-04-181-57/+42
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | Rasterizer: Allow all blend factors for alpha blend-func
| * | | | | | Rasterizer: Allow all blend factors for alpha blend-funcJannik Vogel2016-04-171-57/+42
| | | | | | |
* | | | | | | Merge pull request #1685 from lioncash/hdrbunnei2016-04-163-14/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Clean out some unnecessary header includes
| * | | | | | | core: Clean out some unnecessary header includesLioncash2016-04-163-14/+1
|/ / / / / / /
* | | | | | | Merge pull request #1667 from wwylele/ncch-loader-fixbunnei2016-04-151-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | loader: only decompress code section
| * | | | | | | ncch:only decompress .code sectionwwylele2016-04-141-2/+2
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1673 from MerryMage/config-minimumSizebunnei2016-04-151-12/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Configure Dialog: Remove minimumSize property
| * | | | | | | Configure Dialog: Remove minimumSize propertyMerryMage2016-04-151-12/+0
| |/ / / / / /
* | | | | | | Merge pull request #1671 from lioncash/memMathew Maidment2016-04-151-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | debug_utils: use std::make_unique for initializing PicaTrace
| * | | | | | | debug_utils: use std::make_unique for initializing PicaTraceLioncash2016-04-151-1/+1
| | | | | | | |
* | | | | | | | Y2R: num_tiles should be allowed when its value is 128 (#1669)JamePeng2016-04-151-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #1666 from MerryMage/barrierbunnei2016-04-151-24/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Thread: Correct Common::Barrier implementation
| * | | | | | | Thread: Make Barrier reusableMerryMage2016-04-141-5/+5
| | | | | | | |
| * | | | | | | common/thread: Correct code styleMerryMage2016-04-141-21/+19
| |/ / / / / /
* | | | | | | Merge pull request #1665 from lioncash/filebunnei2016-04-143-48/+38
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | IOFile: Minor API changes
| * | | | | | | file_util: In-class initialize data membersLioncash2016-04-142-6/+4
| | | | | | | |
| * | | | | | | file_util: const qualify IOFile's Tell and GetSize functionsLioncash2016-04-142-8/+8
| | | | | | | |
| * | | | | | | file_util: Don't expose IOFile internals through the APILioncash2016-04-143-31/+20
| | | | | | | |
| * | | | | | | file_util: Check for is_trivially_copyableLioncash2016-04-141-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also applies the template checks to ReadArray as well.
| * | | | | | | file_util: Make IOFile data members privateLioncash2016-04-141-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #1546 from bunnei/refactor-shader-jitbunnei2016-04-147-161/+270
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Shader JIT Part 2
| * | | | | | shader_jit_x64: Rename RuntimeAssert to Compile_Assert.bunnei2016-04-142-5/+5
| | | | | | |
| * | | | | | shader_jit_x64.cpp: Rename JitCompiler to JitShader.bunnei2016-04-143-92/+92
| | | | | | |
| * | | | | | shader_jit_x64: Free memory that's no longer needed after compilation.bunnei2016-04-141-0/+6
| | | | | | |
| * | | | | | shader_jit_x64: Use a sorted vector instead of a set for keeping track of return addresses.bunnei2016-04-142-5/+8
| | | | | | |
| * | | | | | shader_jit_x64: Use CALL/RET instead of JMP for subroutines.bunnei2016-04-141-17/+7
| | | | | | |
| * | | | | | emitter: Add CALL that can be fixed up.bunnei2016-04-142-0/+13
| | | | | | |
| * | | | | | shader_jit_x64: Separate initialization and code generation for readability.bunnei2016-04-141-9/+8
| | | | | | |
| * | | | | | shader_jit_x64: Get rid of unnecessary last_program_counter variable.bunnei2016-04-142-6/+2
| | | | | | |
| * | | | | | shader_jit_x64: Execute certain asserts at runtime.bunnei2016-04-142-5/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - This is because we compile the full shader code space, and therefore its common to compile malformed instructions.
| * | | | | | shader: Remove unused 'state' argument from 'Setup' function.bunnei2016-04-143-5/+4
| | | | | | |
| * | | | | | shader_jit_x64: Specify shader main offset at runtime.bunnei2016-04-143-10/+6
| | | | | | |
| * | | | | | shader_jit_x64: Allocate each program independently and persist for emu session.bunnei2016-04-143-38/+28
| | | | | | |
| * | | | | | shader_jit_x64: Rewrite flow control to support arbitrary CALL and JMP instructions.bunnei2016-04-142-35/+119
| | | | | | |
| * | | | | | shader_jit_x64: Fix strict memory aliasing issues.bunnei2016-04-141-1/+3
| | | | | | |
| * | | | | | emitter: Support arbitrary FixupBranch targets.bunnei2016-04-142-0/+17
|/ / / / / /
* | | | | | Merge pull request #1660 from MerryMage/file_utilbunnei2016-04-121-6/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | FileUtil: Missing #include, Add const to IOFile methods
| * | | | | | FileUtil: Missing #include, Add const to IOFile methodsMerryMage2016-04-121-6/+7
|/ / / / / /
* | | | | | Merge pull request #1613 from mailwl/anpbunnei2016-04-112-2/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | Set Kernel config "Hardware Inited" to 1 (true)
| * | | | | | Set Kernel config "Unknown Value" to 0x1mailwl2016-04-112-2/+7
| |/ / / / /
* | | | | | Merge pull request #1659 from JayFoxRox/apply-configYuri Kunde Schlesner2016-04-117-17/+23
|\ \ \ \ \ \ | |/ / / / / |/| | | | | CitraQt: Apply config at startup
| * | | | | Use Settings::Apply in SDL frontendJannik Vogel2016-04-111-5/+4
| | | | | |
| * | | | | CitraQt: Apply config at startupJannik Vogel2016-04-116-12/+19
|/ / / / /
* | | | | Merge pull request #1657 from JayFoxRox/remove-dump-geometryYuri Kunde Schlesner2016-04-114-71/+0
|\ \ \ \ \ | | | | | | | | | | | | Pica: Remove geometry dumper (PICA_DUMP_GEOMETRY)
| * | | | | Pica: Remove geometry dumper (PICA_DUMP_GEOMETRY)Jannik Vogel2016-04-104-71/+0
| | |/ / / | |/| | |
* | | | | Merge pull request #1368 from LittleWhite-tb/configure-widgetbunnei2016-04-1121-262/+807
|\ \ \ \ \ | |/ / / / |/| | | | Implementation for a configure widget
| * | | | Add more stuff to configure.LittleWhite2016-03-2215-120/+211
| | | | |
| * | | | Whole config is handled by Config class.LittleWhite2016-03-218-118/+181
| | | | | | | | | | | | | | | | | | | | This also means : we have only one config file, now
| * | | | Add Configure widgetLittleWhite2016-03-2118-142/+533
| | | | |
* | | | | Merge pull request #1653 from mailwl/blx-lrMathew Maidment2016-04-091-2/+3
|\ \ \ \ \ | | | | | | | | | | | | Fix BLX LR opcode interpretation
| * | | | | Fix BLX LR opcode interpretationmailwl2016-04-091-2/+3
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1624 from JayFoxRox/buffer-allow-writebunnei2016-04-094-12/+78
|\ \ \ \ \ | |/ / / / |/| | | | Implement buffer-write allow registers
| * | | | OpenGL: Respect buffer-write allow registersJannik Vogel2016-04-081-6/+28
| | | | |
| * | | | OpenGL: Split buffer-write mask sync into seperate functionsJannik Vogel2016-04-082-8/+39
| | | | |
| * | | | Rasterizer: Respect buffer-write allow registersJannik Vogel2016-04-082-4/+16
| | | | |
| * | | | OpenGL: Keep stencil-test and framebuffer.depth_format in syncJannik Vogel2016-04-081-0/+1
| | | | |
* | | | | Merge pull request #1644 from polaris-/gdb-fixesbunnei2016-04-082-28/+107
|\ \ \ \ \ | | | | | | | | | | | | Adopted WinterMute's gdbstub changes
| * | | | | Default to settings from ini for gdbstubpolaris-2016-04-071-6/+6
| | | | | |
| * | | | | Adopted WinterMute's gdbstub changespolaris-2016-04-062-27/+106
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes the comments left on the PR (whitespace, SO_REUSEADDR, comment changes).
* | | | | | update the code of AM service! (#1623)JamePeng2016-04-086-51/+289
| | | | | |
* | | | | | cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-084-1/+29
| |/ / / / |/| | | |
* | | | | Merge pull request #1651 from mailwl/thread-init-thumbMathew Maidment2016-04-081-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Update cpsr (T)humb bit while creating thread
| * | | | | Update cpsr (T)humb bit while creating threadmailwl2016-04-081-1/+1
|/ / / / /
* | | | | Merge pull request #1639 from linkmauve/fix-double-framebuffer-checkbunnei2016-04-081-4/+6
|\ \ \ \ \ | | | | | | | | | | | | OpenGL: Fix a double framebuffer completeness checks.
| * | | | | OpenGL: Fix a double framebuffer completeness checks.Emmanuel Gil Peyrot2016-04-031-4/+6
| | | | | |
* | | | | | Merge pull request #1577 from JamePeng/update-apta-funcbunnei2016-04-075-8/+47
|\ \ \ \ \ \ | | | | | | | | | | | | | | Append the missing function name"GetAppletInfo", "SetAppCpuTimeLimit" and "GetAppCpuTimeLimit" to APT:A
| * | | | | | append SetAppCpuTimeLimit and GetAppCpuTimeLimit to APT:AJamePeng2016-04-063-13/+16
| | | | | | |
| * | | | | | implement APT::GetStartupArgumentJamePeng2016-04-045-2/+37
| | | | | | |
| * | | | | | Append the missing function name"GetAppletInfo" to APT:AJamePeng2016-04-041-1/+2
| | | | | | |
* | | | | | | Merge pull request #1645 from mailwl/thumb_pcMathew Maidment2016-04-061-6/+2
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Fix thumb ADR instruction alignment
| * | | | | | Fix thumb ADR instruction alignmentmailwl2016-04-061-6/+2
|/ / / / / /
* | | | | | Merge pull request #1435 from mailwl/frd_ubunnei2016-04-066-55/+236
|\ \ \ \ \ \ | | | | | | | | | | | | | | frd:u: Initial stub some functions
| * | | | | | frd:u: Initial stub some functionsmailwl2016-03-276-55/+236
| | | | | | |
* | | | | | | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-0624-73/+46
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Common: Remove Common::make_unique, use std::make_unique
| * | | | | | | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-0524-73/+46
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1620 from LFsWang/pathbunnei2016-04-056-33/+50
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Fix filename&path encode problem on Windows
| * | | | | | remove debug codeLFsWang2016-03-312-2/+2
| | | | | | |
| * | | | | | fix unicode url problem on windowsLFsWang2016-03-311-6/+18
| | | | | | |
| * | | | | | Fix encode problem On WindowsLFsWang2016-03-315-27/+32
| | | | | | |
* | | | | | | Merge pull request #1640 from lioncash/cpp14Yuri Kunde Schlesner2016-04-034-7/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeFiles: Compile as C++14
| * | | | | | | travis: Update dependenciesLioncash2016-04-033-6/+6
| | | | | | | |
| * | | | | | | CMakeFiles: Compile as C++14Lioncash2016-04-031-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1638 from JayFoxRox/check-fb-completelinkmauve2016-04-031-0/+3
|\| | | | | | | | | | | | | | | | | | | | OpenGL: Check for framebuffer completeness
| * | | | | | OpenGL: Check for framebuffer completenessJannik Vogel2016-04-031-0/+3
|/ / / / / /
* | | | | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-036-0/+65
|\ \ \ \ \ \ | | | | | | | | | | | | | | Dummy implementation dlp:SRVR Service.
| * | | | | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-026-0/+65
| | | | | | |
* | | | | | | Merge pull request #1619 from mailwl/cecdbunnei2016-04-025-3/+56
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandle
| * | | | | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-315-3/+56
| | | | | | | |